- grub-efi-ia32-bin
- rpm2cpio
- wget
- - device-tree-compiler
install:
# install latest device tree compiler
- #- git clone --depth=1 git://git.kernel.org/pub/scm/utils/dtc/dtc.git /tmp/dtc
- #- make -j4 -C /tmp/dtc
+ - git clone --depth=1 git://git.kernel.org/pub/scm/utils/dtc/dtc.git /tmp/dtc
+ - make -j4 -C /tmp/dtc
# Clone uboot-test-hooks
- git clone --depth=1 git://github.com/swarren/uboot-test-hooks.git /tmp/uboot-test-hooks
- ln -s travis-ci /tmp/uboot-test-hooks/bin/`hostname`
env:
global:
- - PATH=/tmp/dtc:/tmp/qemu-install/bin:/tmp/uboot-test-hooks/bin:$PATH
+ - PATH=/tmp/dtc:/tmp/qemu-install/bin:/tmp/uboot-test-hooks/bin:/usr/bin:/bin
- PYTHONPATH=/tmp/uboot-test-hooks/py/travis-ci
- BUILD_DIR=build
- HOSTCC="cc"
KBUILD_CFLAGS := -Wall -Wstrict-prototypes \
-Wno-format-security \
-fno-builtin -ffreestanding
+KBUILD_CFLAGS += -fshort-wchar
KBUILD_AFLAGS := -D__ASSEMBLY__
# Read UBOOTRELEASE from include/config/uboot.release (if it exists)
kernel configuration options. The intention is to make it easier to
build a config tool - later.
+- ARM Platform Bus Type(CCI):
+ CoreLink Cache Coherent Interconnect (CCI) is ARM BUS which
+ provides full cache coherency between two clusters of multi-core
+ CPUs and I/O coherency for devices and I/O masters
+
+ CONFIG_SYS_FSL_HAS_CCI400
+
+ Defined For SoC that has cache coherent interconnect
+ CCN-400
+
+ CONFIG_SYS_FSL_HAS_CCN504
+
+ Defined for SoC that has cache coherent interconnect CCN-504
The following options need to be configured:
development platform that supports the QorIQ LS2080A
Layerscape Architecture processor.
+config TARGET_LS1088AQDS
+ bool "Support ls1088aqds"
+ select ARCH_LS1088A
+ select ARM64
+ select ARMV8_MULTIENTRY
+ select ARCH_MISC_INIT
+ select BOARD_LATE_INIT
+ help
+ Support for NXP LS1088AQDS platform
+ The LS1088A Development System (QDS) is a high-performance
+ development platform that supports the QorIQ LS1088A
+ Layerscape Architecture processor.
+
config TARGET_LS2080AQDS
bool "Support ls2080aqds"
select ARCH_LS2080A
development platform that supports the QorIQ LS1012A
Layerscape Architecture processor.
+config TARGET_LS1088ARDB
+ bool "Support ls1088ardb"
+ select ARCH_LS1088A
+ select ARM64
+ select ARMV8_MULTIENTRY
+ select ARCH_MISC_INIT
+ select BOARD_LATE_INIT
+ help
+ Support for NXP LS1088ARDB platform.
+ The LS1088A Reference design board (RDB) is a high-performance
+ development platform that supports the QorIQ LS1088A
+ Layerscape Architecture processor.
+
config TARGET_LS1021AQDS
bool "Support ls1021aqds"
select BOARD_LATE_INIT
source "board/freescale/ls2080a/Kconfig"
source "board/freescale/ls2080aqds/Kconfig"
source "board/freescale/ls2080ardb/Kconfig"
+source "board/freescale/ls1088a/Kconfig"
source "board/freescale/ls1021aqds/Kconfig"
source "board/freescale/ls1043aqds/Kconfig"
source "board/freescale/ls1021atwr/Kconfig"
bool
select SYS_FSL_ERRATUM_A008378
select SYS_FSL_ERRATUM_A008407
+ select SYS_FSL_ERRATUM_A008997
+ select SYS_FSL_ERRATUM_A009007
+ select SYS_FSL_ERRATUM_A009008
select SYS_FSL_ERRATUM_A009663
+ select SYS_FSL_ERRATUM_A009798
select SYS_FSL_ERRATUM_A009942
select SYS_FSL_ERRATUM_A010315
+ select SYS_FSL_HAS_CCI400
select SYS_FSL_SRDS_1
select SYS_HAS_SERDES
select SYS_FSL_DDR_BE if SYS_FSL_DDR
Enable Freescale Secure Boot feature. Normally selected
by defconfig. If unsure, do not change.
+config SYS_CCI400_OFFSET
+ hex "Offset for CCI400 base"
+ depends on SYS_FSL_HAS_CCI400
+ default 0x180000
+ help
+ Offset for CCI400 base.
+ CCI400 base addr = CCSRBAR + CCI400_OFFSET
+
+config SYS_FSL_ERRATUM_A008997
+ bool
+ help
+ Workaround for USB PHY erratum A008997
+
+config SYS_FSL_ERRATUM_A009007
+ bool
+ help
+ Workaround for USB PHY erratum A009007
+
+config SYS_FSL_ERRATUM_A009008
+ bool
+ help
+ Workaround for USB PHY erratum A009008
+
+config SYS_FSL_ERRATUM_A009798
+ bool
+ help
+ Workaround for USB PHY erratum A009798
+
config SYS_FSL_ERRATUM_A010315
bool "Workaround for PCIe erratum A010315"
+config SYS_FSL_HAS_CCI400
+ bool
+
config SYS_FSL_SRDS_1
bool
return major;
}
+static void erratum_a009008(void)
+{
+#ifdef CONFIG_SYS_FSL_ERRATUM_A009008
+ u32 __iomem *scfg = (u32 __iomem *)SCFG_BASE;
+
+ clrsetbits_be32(scfg + SCFG_USB3PRM1CR / 4,
+ 0xF << 6,
+ SCFG_USB_TXVREFTUNE << 6);
+#endif /* CONFIG_SYS_FSL_ERRATUM_A009008 */
+}
+
+static void erratum_a009798(void)
+{
+#ifdef CONFIG_SYS_FSL_ERRATUM_A009798
+ u32 __iomem *scfg = (u32 __iomem *)SCFG_BASE;
+
+ clrbits_be32(scfg + SCFG_USB3PRM1CR / 4,
+ SCFG_USB_SQRXTUNE_MASK << 23);
+#endif /* CONFIG_SYS_FSL_ERRATUM_A009798 */
+}
+
+static void erratum_a008997(void)
+{
+#ifdef CONFIG_SYS_FSL_ERRATUM_A008997
+ u32 __iomem *scfg = (u32 __iomem *)SCFG_BASE;
+
+ clrsetbits_be32(scfg + SCFG_USB3PRM2CR / 4,
+ SCFG_USB_PCSTXSWINGFULL_MASK,
+ SCFG_USB_PCSTXSWINGFULL_VAL);
+#endif /* CONFIG_SYS_FSL_ERRATUM_A008997 */
+}
+
+static void erratum_a009007(void)
+{
+#ifdef CONFIG_SYS_FSL_ERRATUM_A009007
+ void __iomem *usb_phy = (void __iomem *)USB_PHY_BASE;
+
+ out_le16(usb_phy + USB_PHY_RX_OVRD_IN_HI, USB_PHY_RX_EQ_VAL_1);
+ out_le16(usb_phy + USB_PHY_RX_OVRD_IN_HI, USB_PHY_RX_EQ_VAL_2);
+ out_le16(usb_phy + USB_PHY_RX_OVRD_IN_HI, USB_PHY_RX_EQ_VAL_3);
+ out_le16(usb_phy + USB_PHY_RX_OVRD_IN_HI, USB_PHY_RX_EQ_VAL_4);
+#endif /* CONFIG_SYS_FSL_ERRATUM_A009007 */
+}
+
void s_init(void)
{
}
int arch_soc_init(void)
{
struct ccsr_scfg *scfg = (struct ccsr_scfg *)CONFIG_SYS_FSL_SCFG_ADDR;
- struct ccsr_cci400 *cci = (struct ccsr_cci400 *)CONFIG_SYS_CCI400_ADDR;
+ struct ccsr_cci400 *cci = (struct ccsr_cci400 *)(CONFIG_SYS_IMMR +
+ CONFIG_SYS_CCI400_OFFSET);
unsigned int major;
#ifdef CONFIG_LAYERSCAPE_NS_ACCESS
*/
out_be32(&scfg->eddrtqcfg, 0x63b20042);
+ /* Erratum */
+ erratum_a009008();
+ erratum_a009798();
+ erratum_a008997();
+ erratum_a009007();
+
return 0;
}
depends on !ARCH_EXYNOS7 && !ARCH_BCM283X && !TARGET_LS2080A_EMU && \
!TARGET_LS2080A_SIMU && !TARGET_LS2080AQDS && \
!TARGET_LS2080ARDB && !TARGET_LS1012AQDS && \
+ !TARGET_LS1088ARDB && !TARGET_LS1088AQDS && \
!TARGET_LS1012ARDB && !TARGET_LS1012AFRDM && \
!TARGET_LS1043ARDB && !TARGET_LS1043AQDS && \
!TARGET_LS1046ARDB && !TARGET_LS1046AQDS && \
select SYS_FSL_DDR_BE
select SYS_FSL_DDR_VER_50
select SYS_FSL_ERRATUM_A008850
+ select SYS_FSL_ERRATUM_A008997
+ select SYS_FSL_ERRATUM_A009007
+ select SYS_FSL_ERRATUM_A009008
select SYS_FSL_ERRATUM_A009660
select SYS_FSL_ERRATUM_A009663
+ select SYS_FSL_ERRATUM_A009798
select SYS_FSL_ERRATUM_A009929
select SYS_FSL_ERRATUM_A009942
select SYS_FSL_ERRATUM_A010315
select SYS_FSL_ERRATUM_A008336
select SYS_FSL_ERRATUM_A008511
select SYS_FSL_ERRATUM_A008850
+ select SYS_FSL_ERRATUM_A008997
+ select SYS_FSL_ERRATUM_A009007
+ select SYS_FSL_ERRATUM_A009008
+ select SYS_FSL_ERRATUM_A009798
select SYS_FSL_ERRATUM_A009801
select SYS_FSL_ERRATUM_A009803
select SYS_FSL_ERRATUM_A009942
select BOARD_EARLY_INIT_F
imply SCSI
+config ARCH_LS1088A
+ bool
+ select ARMV8_SET_SMPEN
+ select FSL_LSCH3
+ select SYS_FSL_DDR
+ select SYS_FSL_DDR_LE
+ select SYS_FSL_DDR_VER_50
+ select SYS_FSL_EC1
+ select SYS_FSL_EC2
+ select SYS_FSL_ERRATUM_A009803
+ select SYS_FSL_ERRATUM_A009942
+ select SYS_FSL_ERRATUM_A010165
+ select SYS_FSL_ERRATUM_A008511
+ select SYS_FSL_ERRATUM_A008850
+ select SYS_FSL_HAS_CCI400
+ select SYS_FSL_HAS_DDR4
+ select SYS_FSL_HAS_RGMII
+ select SYS_FSL_HAS_SEC
+ select SYS_FSL_SEC_COMPAT_5
+ select SYS_FSL_SEC_LE
+ select SYS_FSL_SRDS_1
+ select SYS_FSL_SRDS_2
+ select FSL_TZASC_1
+ select ARCH_EARLY_INIT_R
+ select BOARD_EARLY_INIT_F
+
config ARCH_LS2080A
bool
select ARMV8_SET_SMPEN
select SYS_FSL_DDR
select SYS_FSL_DDR_LE
select SYS_FSL_DDR_VER_50
+ select SYS_FSL_HAS_CCN504
select SYS_FSL_HAS_DP_DDR
select SYS_FSL_HAS_SEC
select SYS_FSL_HAS_DDR4
select SYS_FSL_ERRATUM_A008511
select SYS_FSL_ERRATUM_A008514
select SYS_FSL_ERRATUM_A008585
+ select SYS_FSL_ERRATUM_A008997
+ select SYS_FSL_ERRATUM_A009007
+ select SYS_FSL_ERRATUM_A009008
select SYS_FSL_ERRATUM_A009635
select SYS_FSL_ERRATUM_A009663
+ select SYS_FSL_ERRATUM_A009798
select SYS_FSL_ERRATUM_A009801
select SYS_FSL_ERRATUM_A009803
select SYS_FSL_ERRATUM_A009942
config FSL_LSCH2
bool
+ select SYS_FSL_HAS_CCI400
select SYS_FSL_HAS_SEC
select SYS_FSL_SEC_COMPAT_5
select SYS_FSL_SEC_BE
config FSL_MC_ENET
bool "Management Complex network"
- depends on ARCH_LS2080A
+ depends on ARCH_LS2080A || ARCH_LS1088A
default y
select RESV_RAM
help
default "fsl,ls1043a-pcie" if ARCH_LS1043A
default "fsl,ls1046a-pcie" if ARCH_LS1046A
default "fsl,ls2080a-pcie" if ARCH_LS2080A
+ default "fsl,ls1088a-pcie" if ARCH_LS1088A
help
This compatible is used to find pci controller node in Kernel DT
to complete fixup.
default 0x20400000 if SYS_LS_PPA_FW_IN_XIP && QSPI_BOOT && ARCH_LS2080A
default 0x40400000 if SYS_LS_PPA_FW_IN_XIP && QSPI_BOOT
default 0x580400000 if SYS_LS_PPA_FW_IN_XIP && ARCH_LS2080A
+ default 0x20400000 if SYS_LS_PPA_FW_IN_XIP && ARCH_LS1088A
default 0x60400000 if SYS_LS_PPA_FW_IN_XIP
default 0x400000 if SYS_LS_PPA_FW_IN_MMC
default 0x400000 if SYS_LS_PPA_FW_IN_NAND
config SYS_LS_PPA_ESBC_ADDR
hex "hdr address of PPA firmware loading from"
depends on FSL_LS_PPA && CHAIN_OF_TRUST
- default 0x600c0000 if SYS_LS_PPA_FW_IN_XIP && ARCH_LS1043A
- default 0x40740000 if SYS_LS_PPA_FW_IN_XIP && ARCH_LS1046A
- default 0x40480000 if SYS_LS_PPA_FW_IN_XIP && ARCH_LS1012A
- default 0x580c40000 if SYS_LS_PPA_FW_IN_XIP && FSL_LSCH3
- default 0x700000 if SYS_LS_PPA_FW_IN_MMC
- default 0x700000 if SYS_LS_PPA_FW_IN_NAND
+ default 0x60680000 if SYS_LS_PPA_FW_IN_XIP && ARCH_LS1043A
+ default 0x40680000 if SYS_LS_PPA_FW_IN_XIP && ARCH_LS1046A
+ default 0x40680000 if SYS_LS_PPA_FW_IN_XIP && ARCH_LS1012A
+ default 0x20680000 if SYS_LS_PPA_FW_IN_XIP && QSPI_BOOT && ARCH_LS2080A
+ default 0x580680000 if SYS_LS_PPA_FW_IN_XIP && ARCH_LS2080A
+ default 0x680000 if SYS_LS_PPA_FW_IN_MMC
+ default 0x680000 if SYS_LS_PPA_FW_IN_NAND
help
If the PPA header firmware locate at XIP flash, such as NOR or
QSPI flash, this address is a directly memory-mapped.
endmenu
+config SYS_FSL_ERRATUM_A008997
+ bool "Workaround for USB PHY erratum A008997"
+
+config SYS_FSL_ERRATUM_A009007
+ bool
+ help
+ Workaround for USB PHY erratum A009007
+
+config SYS_FSL_ERRATUM_A009008
+ bool "Workaround for USB PHY erratum A009008"
+
+config SYS_FSL_ERRATUM_A009798
+ bool "Workaround for USB PHY erratum A009798"
+
config SYS_FSL_ERRATUM_A010315
bool "Workaround for PCIe erratum A010315"
default 4 if ARCH_LS1043A
default 4 if ARCH_LS1046A
default 16 if ARCH_LS2080A
+ default 8 if ARCH_LS1088A
default 1
help
Set this number to the maximum number of possible CPUs in the SoC.
But some QSPI flash size up to 64MBytes, so initialize the QSPI AHB
bus for those flashes to support the full QSPI flash size.
+config SYS_CCI400_OFFSET
+ hex "Offset for CCI400 base"
+ depends on SYS_FSL_HAS_CCI400
+ default 0x3090000 if ARCH_LS1088A
+ default 0x180000 if FSL_LSCH2
+ help
+ Offset for CCI400 base
+ CCI400 base addr = CCSRBAR + CCI400_OFFSET
+
config SYS_FSL_IFC_BANK_COUNT
int "Maximum banks of Integrated flash controller"
- depends on ARCH_LS1043A || ARCH_LS1046A || ARCH_LS2080A
+ depends on ARCH_LS1043A || ARCH_LS1046A || ARCH_LS2080A || ARCH_LS1088A
default 4 if ARCH_LS1043A
default 4 if ARCH_LS1046A
- default 8 if ARCH_LS2080A
+ default 8 if ARCH_LS2080A || ARCH_LS1088A
+
+config SYS_FSL_HAS_CCI400
+ bool
+
+config SYS_FSL_HAS_CCN504
+ bool
config SYS_FSL_HAS_DP_DDR
bool
int "Platform clock divider"
default 1 if ARCH_LS1043A
default 1 if ARCH_LS1046A
+ default 1 if ARCH_LS1088A
default 2
help
This is the divider that is used to derive Platform clock from
be at the high end of physical memory. The reserve RAM may be
excluded from memory bank(s) passed to OS, or marked as reserved.
+config SYS_FSL_EC1
+ bool
+ help
+ Ethernet controller 1, this is connected to MAC3.
+ Provides DPAA2 capabilities
+
+config SYS_FSL_EC2
+ bool
+ help
+ Ethernet controller 2, this is connected to MAC4.
+ Provides DPAA2 capabilities
+
config SYS_FSL_ERRATUM_A008336
bool
config SYS_FSL_ERRATUM_A009929
bool
+
+config SYS_FSL_HAS_RGMII
+ bool
+ depends on SYS_FSL_EC1 || SYS_FSL_EC2
+
+
config SYS_MC_RSV_MEM_ALIGN
hex "Management Complex reserved memory alignment"
depends on RESV_RAM
- default 0x20000000
+ default 0x20000000 if ARCH_LS2080A
+ default 0x70000000 if ARCH_LS1088A
help
Reserved memory needs to be aligned for MC to use. Default value
is 512MB.
ifneq ($(CONFIG_ARCH_LS1046A),)
obj-$(CONFIG_SYS_HAS_SERDES) += ls1046a_serdes.o
endif
+
+ifneq ($(CONFIG_ARCH_LS1088A),)
+obj-$(CONFIG_SYS_HAS_SERDES) += ls1088a_serdes.o
+endif
#include <asm/arch/soc.h>
#include <asm/arch/cpu.h>
#include <asm/arch/speed.h>
+#include <fsl_immap.h>
#include <asm/arch/mp.h>
#include <efi_loader.h>
#include <fm_eth.h>
printf("Did not wake secondary cores\n");
}
+#ifdef CONFIG_SYS_FSL_HAS_RGMII
+ fsl_rgmii_init();
+#endif
+
#ifdef CONFIG_SYS_HAS_SERDES
fsl_serdes_init();
#endif
#endif
+/*
+ * Calculate reserved memory with given memory bank
+ * Return aligned memory size on success
+ * Return (ram_size + needed size) for failure
+ */
phys_size_t board_reserve_ram_top(phys_size_t ram_size)
{
phys_size_t ram_top = ram_size;
#if defined(CONFIG_FSL_MC_ENET) && !defined(CONFIG_SPL_BUILD)
+ ram_top = mc_get_dram_block_size();
+ if (ram_top > ram_size)
+ return ram_size + ram_top;
+
+ ram_top = ram_size - ram_top;
/* The start address of MC reserved memory needs to be aligned. */
- ram_top -= mc_get_dram_block_size();
ram_top &= ~(CONFIG_SYS_MC_RSV_MEM_ALIGN - 1);
#endif
/* Check if we have enough memory for MC */
if (rem < board_reserve_ram_top(rem)) {
/* Not enough memory in high region to reserve */
- if (ea_size > board_reserve_ram_top(rem))
- ea_size -= board_reserve_ram_top(rem);
+ if (ea_size > board_reserve_ram_top(ea_size))
+ ea_size -= board_reserve_ram_top(ea_size);
else
printf("Error: No enough space for reserved memory.\n");
}
SoC overview
1. LS1043A
- 2. LS2080A
- 3. LS1012A
- 4. LS1046A
- 5. LS2088A
- 6. LS2081A
+ 2. LS1088A
+ 3. LS2080A
+ 4. LS1012A
+ 5. LS1046A
+ 6. LS2088A
+ 7. LS2081A
LS1043A
---------
- Integrated flash controller supporting NAND and NOR flash
- QorIQ platform's trust architecture 2.1
+LS1088A
+--------
+The QorIQ LS1088A processor is built on the Layerscape
+architecture combining eight ARM A53 processor cores
+with advanced, high-performance datapath acceleration
+and networks, peripheral interfaces required for
+networking, wireless infrastructure, and general-purpose
+embedded applications.
+
+LS1088A is compliant with the Layerscape Chassis Generation 3.
+
+Features summary:
+ - 8 32-bit / 64-bit ARM v8 Cortex-A53 CPUs
+ - Cores are in 2 cluster of 4-cores each
+ - 1MB L2 - Cache per cluster
+ - Cache coherent interconnect (CCI-400)
+ - 1 64-bit DDR4 SDRAM memory controller with ECC
+ - Data path acceleration architecture 2.0 (DPAA2)
+ - 4-Lane 10GHz SerDes comprising of WRIOP
+ - 4-Lane 10GHz SerDes comprising of PCI, SATA, uQE(TDM/HLDC/UART)
+ - Ethernet interfaces: SGMIIs, RGMIIs, QSGMIIs, XFIs
+ - QSPI, SPI, IFC2.0 supporting NAND, NOR flash
+ - 3 PCIe3.0 , 1 SATA3.0, 2 USB3.0, 1 SDXC, 2 DUARTs etc
+ - 2 DUARTs
+ - 4 I2C, GPIO
+ - Thermal monitor unit(TMU)
+ - 4 Flextimers and 1 generic timer
+ - Support for hardware virtualization and partitioning enforcement
+ - QorIQ platform's trust architecture 3.0
+ - Service processor (SP) provides pre-boot initialization and secure-boot
+ capabilities
+
LS2080A
--------
The LS2080A integrated multicore processor combines eight ARM Cortex-A57
#ifdef CONFIG_SYS_DPAA_FMAN
fdt_fixup_fman_firmware(blob);
#endif
-#ifndef CONFIG_LS1012A
+#ifndef CONFIG_ARCH_LS1012A
fsl_fdt_disable_usb(blob);
#endif
#ifdef CONFIG_HAS_FEATURE_GIC64K_ALIGN
return;
}
+/*
+ *The return value of this func is the serdes protocol used.
+ *Typically this function is called number of times depending
+ *upon the number of serdes blocks in the Silicon.
+ *Zero is used to denote that no serdes was enabled,
+ *this is the case when golden RCW was used where DPAA2 bring was
+ *intentionally removed to achieve boot to prompt
+*/
+
+__weak int serdes_get_number(int serdes, int cfg)
+{
+ return cfg;
+}
+
int is_serdes_configured(enum srds_prtcl device)
{
int ret = 0;
printf("invalid SerDes%d\n", sd);
break;
}
+
+ cfg = serdes_get_number(sd, cfg);
+
/* Is serdes enabled at all? */
if (cfg == 0)
return -ENODEV;
cfg = gur_in32(&gur->rcwsr[rcwsr - 1]) & sd_prctl_mask;
cfg >>= sd_prctl_shift;
+
+ cfg = serdes_get_number(sd, cfg);
printf("Using SERDES%d Protocol: %d (0x%x)\n", sd + 1, cfg, cfg);
if (!is_serdes_prtcl_valid(sd, cfg))
switch_el x1, 1f, 100f, 100f /* skip if not in EL3 */
1:
-#ifdef CONFIG_FSL_LSCH3
+#if defined (CONFIG_SYS_FSL_HAS_CCN504)
/* Set Wuo bit for RN-I 20 */
#ifdef CONFIG_ARCH_LS2080A
ldr x0, =CCI_S2_QOS_CONTROL_BASE(20)
ldr x1, =0x00FF000C
bl ccn504_set_qos
-#endif
+#endif /* CONFIG_SYS_FSL_HAS_CCN504 */
#ifdef SMMU_BASE
/* Set the SMMU page size in the sACR register */
ldr x1, =FSL_LSCH3_SVR
ldr w0, [x1]
ret
+#endif
+#ifdef CONFIG_SYS_FSL_HAS_CCN504
hnf_pstate_poll:
/* x0 has the desired status, return 0 for success, 1 for timeout
* clobber x1, x2, x3, x4, x6, x7
mov x29, lr
mov x8, #0
- switch_el x0, 1f, 100f, 100f /* skip if not in EL3 */
-
-1:
dsb sy
mov x0, #0x1 /* HNFPSTAT_SFONLY */
bl hnf_set_pstate
bl hnf_pstate_poll
cbz x0, 1f
add x8, x8, #0x2
-100:
1:
mov x0, x8
mov lr, x29
ret
ENDPROC(__asm_flush_l3_dcache)
-#endif
+#endif /* CONFIG_SYS_FSL_HAS_CCN504 */
#ifdef CONFIG_MP
/* Keep literals not used by the secondary boot code outside it */
--- /dev/null
+/*
+ * Copyright 2017 NXP
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
+#include <asm/arch/fsl_serdes.h>
+
+struct serdes_config {
+ u8 ip_protocol;
+ u8 lanes[SRDS_MAX_LANES];
+ u8 rcw_lanes[SRDS_MAX_LANES];
+};
+
+static struct serdes_config serdes1_cfg_tbl[] = {
+ /* SerDes 1 */
+ {0x12, {SGMII3, SGMII7, SGMII1, SGMII2 }, {3, 3, 3, 3 } },
+ {0x15, {SGMII3, SGMII7, XFI1, XFI2 }, {3, 3, 1, 1 } },
+ {0x16, {SGMII3, SGMII7, SGMII1, XFI2 }, {3, 3, 3, 1 } },
+ {0x17, {SGMII3, SGMII7, SGMII1, SGMII2 }, {3, 3, 3, 2 } },
+ {0x18, {SGMII3, SGMII7, SGMII1, SGMII2 }, {3, 3, 2, 2 } },
+ {0x19, {SGMII3, QSGMII_B, XFI1, XFI2}, {3, 4, 1, 1 } },
+ {0x1A, {SGMII3, QSGMII_B, SGMII1, XFI2 }, {3, 4, 3, 1 } },
+ {0x1B, {SGMII3, QSGMII_B, SGMII1, SGMII2 }, {3, 4, 3, 2 } },
+ {0x1C, {SGMII3, QSGMII_B, SGMII1, SGMII2 }, {3, 4, 2, 2 } },
+ {0x1D, {QSGMII_A, QSGMII_B, XFI1, XFI2 }, {4, 4, 1, 1 } },
+ {0x1E, {QSGMII_A, QSGMII_B, SGMII1, XFI2 }, {4, 4, 3, 1 } },
+ {0x1F, {QSGMII_A, QSGMII_B, SGMII1, SGMII2 }, {4, 4, 3, 2 } },
+ {0x20, {QSGMII_A, QSGMII_B, SGMII1, SGMII2 }, {4, 4, 2, 2 } },
+ {0x35, {SGMII3, QSGMII_B, SGMII1, SGMII2 }, {3, 4, 3, 3 } },
+ {0x36, {QSGMII_A, QSGMII_B, SGMII1, SGMII2 }, {4, 4, 3, 3 } },
+ {0x3A, {SGMII3, PCIE1, SGMII1, SGMII2 }, {3, 5, 3, 3 } },
+ {}
+};
+static struct serdes_config serdes2_cfg_tbl[] = {
+ /* SerDes 2 */
+ {0x0C, {PCIE1, PCIE1, PCIE1, PCIE1 }, {8, 8, 8, 8 } },
+ {0x0D, {PCIE1, PCIE2, PCIE3, SATA1 }, {5, 5, 5, 9 } },
+ {0x0E, {PCIE1, PCIE1, PCIE2, SATA1 }, {7, 7, 6, 9 } },
+ {0x13, {PCIE1, PCIE1, PCIE3, PCIE3 }, {7, 7, 7, 7 } },
+ {0x14, {PCIE1, PCIE2, PCIE3, PCIE3 }, {5, 5, 7, 7 } },
+ {0x3C, {NONE, PCIE2, NONE, PCIE3 }, {0, 5, 0, 6 } },
+ {}
+};
+
+static struct serdes_config *serdes_cfg_tbl[] = {
+ serdes1_cfg_tbl,
+ serdes2_cfg_tbl,
+};
+
+int serdes_get_number(int serdes, int cfg)
+{
+ struct serdes_config *ptr;
+ int i, j, index, lnk;
+ int is_found, max_lane = SRDS_MAX_LANES;
+
+ if (serdes >= ARRAY_SIZE(serdes_cfg_tbl))
+ return 0;
+
+ ptr = serdes_cfg_tbl[serdes];
+
+ while (ptr->ip_protocol) {
+ is_found = 1;
+ for (i = 0, j = max_lane - 1; i < max_lane; i++, j--) {
+ lnk = cfg & (0xf << 4 * i);
+ lnk = lnk >> (4 * i);
+
+ index = (serdes == FSL_SRDS_1) ? j : i;
+
+ if (ptr->rcw_lanes[index] == lnk && is_found)
+ is_found = 1;
+ else
+ is_found = 0;
+ }
+
+ if (is_found)
+ return ptr->ip_protocol;
+ ptr++;
+ }
+
+ return 0;
+}
+
+enum srds_prtcl serdes_get_prtcl(int serdes, int cfg, int lane)
+{
+ struct serdes_config *ptr;
+
+ if (serdes >= ARRAY_SIZE(serdes_cfg_tbl))
+ return 0;
+
+ ptr = serdes_cfg_tbl[serdes];
+ while (ptr->ip_protocol) {
+ if (ptr->ip_protocol == cfg)
+ return ptr->lanes[lane];
+ ptr++;
+ }
+
+ return 0;
+}
+
+int is_serdes_prtcl_valid(int serdes, u32 prtcl)
+{
+ int i;
+ struct serdes_config *ptr;
+
+ if (serdes >= ARRAY_SIZE(serdes_cfg_tbl))
+ return 0;
+
+ ptr = serdes_cfg_tbl[serdes];
+ while (ptr->ip_protocol) {
+ if (ptr->ip_protocol == prtcl)
+ break;
+ ptr++;
+ }
+
+ if (!ptr->ip_protocol)
+ return 0;
+
+ for (i = 0; i < SRDS_MAX_LANES; i++) {
+ if (ptr->lanes[i] != NONE)
+ return 1;
+ }
+
+ return 0;
+}
return -EIO;
}
- /* flush cache after read */
- flush_cache((ulong)fitp, cnt * 512);
-
ret = fdt_check_header(fitp);
if (ret) {
free(fitp);
}
debug("Read PPA header to 0x%p\n", ppa_hdr_ddr);
- /* flush cache after read */
- flush_cache((ulong)ppa_hdr_ddr, cnt * 512);
-
ppa_esbc_hdr = (uintptr_t)ppa_hdr_ddr;
#endif
return -EIO;
}
- /* flush cache after read */
- flush_cache((ulong)ppa_fit_addr, cnt * 512);
-
#elif defined(CONFIG_SYS_LS_PPA_FW_IN_NAND)
struct fdt_header fit;
}
debug("Read PPA header to 0x%p\n", ppa_hdr_ddr);
- /* flush cache after read */
- flush_cache((ulong)ppa_hdr_ddr, fw_length);
-
ppa_esbc_hdr = (uintptr_t)ppa_hdr_ddr;
#endif
CONFIG_SYS_LS_PPA_FW_ADDR);
return -EIO;
}
-
- /* flush cache after read */
- flush_cache((ulong)ppa_fit_addr, fw_length);
#else
#error "No CONFIG_SYS_LS_PPA_FW_IN_xxx defined"
#endif
*/
#include <common.h>
+#include <fsl_immap.h>
#include <fsl_ifc.h>
#include <ahci.h>
#include <scsi.h>
#ifdef CONFIG_CHAIN_OF_TRUST
#include <fsl_validate.h>
#endif
+#include <fsl_immap.h>
DECLARE_GLOBAL_DATA_PTR;
return false;
}
+static inline void set_usb_txvreftune(u32 __iomem *scfg, u32 offset)
+{
+ scfg_clrsetbits32(scfg + offset / 4,
+ 0xF << 6,
+ SCFG_USB_TXVREFTUNE << 6);
+}
+
+static void erratum_a009008(void)
+{
+#ifdef CONFIG_SYS_FSL_ERRATUM_A009008
+ u32 __iomem *scfg = (u32 __iomem *)SCFG_BASE;
+
+#if defined(CONFIG_ARCH_LS1043A) || defined(CONFIG_ARCH_LS1046A)
+ set_usb_txvreftune(scfg, SCFG_USB3PRM1CR_USB1);
+ set_usb_txvreftune(scfg, SCFG_USB3PRM1CR_USB2);
+ set_usb_txvreftune(scfg, SCFG_USB3PRM1CR_USB3);
+#elif defined(CONFIG_ARCH_LS2080A)
+ set_usb_txvreftune(scfg, SCFG_USB3PRM1CR);
+#endif
+#endif /* CONFIG_SYS_FSL_ERRATUM_A009008 */
+}
+
+static inline void set_usb_sqrxtune(u32 __iomem *scfg, u32 offset)
+{
+ scfg_clrbits32(scfg + offset / 4,
+ SCFG_USB_SQRXTUNE_MASK << 23);
+}
+
+static void erratum_a009798(void)
+{
+#ifdef CONFIG_SYS_FSL_ERRATUM_A009798
+ u32 __iomem *scfg = (u32 __iomem *)SCFG_BASE;
+
+#if defined(CONFIG_ARCH_LS1043A) || defined(CONFIG_ARCH_LS1046A)
+ set_usb_sqrxtune(scfg, SCFG_USB3PRM1CR_USB1);
+ set_usb_sqrxtune(scfg, SCFG_USB3PRM1CR_USB2);
+ set_usb_sqrxtune(scfg, SCFG_USB3PRM1CR_USB3);
+#elif defined(CONFIG_ARCH_LS2080A)
+ set_usb_sqrxtune(scfg, SCFG_USB3PRM1CR);
+#endif
+#endif /* CONFIG_SYS_FSL_ERRATUM_A009798 */
+}
+
+#if defined(CONFIG_ARCH_LS1043A) || defined(CONFIG_ARCH_LS1046A)
+static inline void set_usb_pcstxswingfull(u32 __iomem *scfg, u32 offset)
+{
+ scfg_clrsetbits32(scfg + offset / 4,
+ 0x7F << 9,
+ SCFG_USB_PCSTXSWINGFULL << 9);
+}
+#endif
+
+static void erratum_a008997(void)
+{
+#ifdef CONFIG_SYS_FSL_ERRATUM_A008997
+#if defined(CONFIG_ARCH_LS1043A) || defined(CONFIG_ARCH_LS1046A)
+ u32 __iomem *scfg = (u32 __iomem *)SCFG_BASE;
+
+ set_usb_pcstxswingfull(scfg, SCFG_USB3PRM2CR_USB1);
+ set_usb_pcstxswingfull(scfg, SCFG_USB3PRM2CR_USB2);
+ set_usb_pcstxswingfull(scfg, SCFG_USB3PRM2CR_USB3);
+#endif
+#endif /* CONFIG_SYS_FSL_ERRATUM_A008997 */
+}
+
+#if defined(CONFIG_ARCH_LS1043A) || defined(CONFIG_ARCH_LS1046A)
+
+#define PROGRAM_USB_PHY_RX_OVRD_IN_HI(phy) \
+ out_be16((phy) + SCFG_USB_PHY_RX_OVRD_IN_HI, USB_PHY_RX_EQ_VAL_1); \
+ out_be16((phy) + SCFG_USB_PHY_RX_OVRD_IN_HI, USB_PHY_RX_EQ_VAL_2); \
+ out_be16((phy) + SCFG_USB_PHY_RX_OVRD_IN_HI, USB_PHY_RX_EQ_VAL_3); \
+ out_be16((phy) + SCFG_USB_PHY_RX_OVRD_IN_HI, USB_PHY_RX_EQ_VAL_4)
+
+#elif defined(CONFIG_ARCH_LS2080A)
+
+#define PROGRAM_USB_PHY_RX_OVRD_IN_HI(phy) \
+ out_le16((phy) + DCSR_USB_PHY_RX_OVRD_IN_HI, USB_PHY_RX_EQ_VAL_1); \
+ out_le16((phy) + DCSR_USB_PHY_RX_OVRD_IN_HI, USB_PHY_RX_EQ_VAL_2); \
+ out_le16((phy) + DCSR_USB_PHY_RX_OVRD_IN_HI, USB_PHY_RX_EQ_VAL_3); \
+ out_le16((phy) + DCSR_USB_PHY_RX_OVRD_IN_HI, USB_PHY_RX_EQ_VAL_4)
+
+#endif
+
+static void erratum_a009007(void)
+{
+#if defined(CONFIG_ARCH_LS1043A) || defined(CONFIG_ARCH_LS1046A)
+ void __iomem *usb_phy = (void __iomem *)SCFG_USB_PHY1;
+
+ PROGRAM_USB_PHY_RX_OVRD_IN_HI(usb_phy);
+
+ usb_phy = (void __iomem *)SCFG_USB_PHY2;
+ PROGRAM_USB_PHY_RX_OVRD_IN_HI(usb_phy);
+
+ usb_phy = (void __iomem *)SCFG_USB_PHY3;
+ PROGRAM_USB_PHY_RX_OVRD_IN_HI(usb_phy);
+#elif defined(CONFIG_ARCH_LS2080A)
+ void __iomem *dcsr = (void __iomem *)DCSR_BASE;
+
+ PROGRAM_USB_PHY_RX_OVRD_IN_HI(dcsr + DCSR_USB_PHY1);
+ PROGRAM_USB_PHY_RX_OVRD_IN_HI(dcsr + DCSR_USB_PHY2);
+#endif /* CONFIG_SYS_FSL_ERRATUM_A009007 */
+}
+
#if defined(CONFIG_FSL_LSCH3)
/*
* This erratum requires setting a value to eddrtqcr1 to
#endif
erratum_a008514();
erratum_a008336();
+ erratum_a009008();
+ erratum_a009798();
+ erratum_a008997();
+ erratum_a009007();
#ifdef CONFIG_CHAIN_OF_TRUST
/* In case of Secure Boot, the IBR configures the SMMU
* to allow only Secure transactions.
{
#ifdef CONFIG_SYS_FSL_ERRATUM_A008850
/* part 1 of 2 */
- struct ccsr_cci400 __iomem *cci = (void *)CONFIG_SYS_CCI400_ADDR;
+ struct ccsr_cci400 __iomem *cci = (void *)(CONFIG_SYS_IMMR +
+ CONFIG_SYS_CCI400_OFFSET);
struct ccsr_ddr __iomem *ddr = (void *)CONFIG_SYS_FSL_DDR_ADDR;
/* Skip if running at lower exception level */
{
#ifdef CONFIG_SYS_FSL_ERRATUM_A008850
/* part 2 of 2 */
- struct ccsr_cci400 __iomem *cci = (void *)CONFIG_SYS_CCI400_ADDR;
+ struct ccsr_cci400 __iomem *cci = (void *)(CONFIG_SYS_IMMR +
+ CONFIG_SYS_CCI400_OFFSET);
struct ccsr_ddr __iomem *ddr = (void *)CONFIG_SYS_FSL_DDR_ADDR;
u32 tmp;
void fsl_lsch2_early_init_f(void)
{
- struct ccsr_cci400 *cci = (struct ccsr_cci400 *)CONFIG_SYS_CCI400_ADDR;
+ struct ccsr_cci400 *cci = (struct ccsr_cci400 *)(CONFIG_SYS_IMMR +
+ CONFIG_SYS_CCI400_OFFSET);
struct ccsr_scfg *scfg = (struct ccsr_scfg *)CONFIG_SYS_FSL_SCFG_ADDR;
#ifdef CONFIG_LAYERSCAPE_NS_ACCESS
erratum_a009929();
erratum_a009660();
erratum_a010539();
+ erratum_a009008();
+ erratum_a009798();
+ erratum_a008997();
+ erratum_a009007();
}
#endif
rk3288-veyron-jerry.dtb \
rk3288-veyron-mickey.dtb \
rk3288-veyron-minnie.dtb \
+ rk3288-vyasa.dtb \
rk3328-evb.dtb \
rk3368-lion.dtb \
rk3368-sheep.dtb \
socfpga_cyclone5_vining_fpga.dtb
dtb-$(CONFIG_TARGET_DRA7XX_EVM) += dra72-evm.dtb dra7-evm.dtb \
- dra72-evm-revc.dtb dra71-evm.dtb
+ dra72-evm-revc.dtb dra71-evm.dtb dra76-evm.dtb
dtb-$(CONFIG_TARGET_AM57XX_EVM) += am57xx-beagle-x15.dtb \
am57xx-beagle-x15-revb1.dtb \
+ am57xx-beagle-x15-revc.dtb \
am572x-idk.dtb \
am571x-idk.dtb
dtb-$(CONFIG_TARGET_STV0991) += stv0991.dtb
dtb-$(CONFIG_FSL_LSCH3) += fsl-ls2080a-qds.dtb \
fsl-ls2080a-rdb.dtb \
fsl-ls2081a-rdb.dtb \
- fsl-ls2088a-rdb-qspi.dtb
+ fsl-ls2088a-rdb-qspi.dtb \
+ fsl-ls1088a-rdb.dtb \
+ fsl-ls1088a-qds.dtb
dtb-$(CONFIG_FSL_LSCH2) += fsl-ls1043a-qds-duart.dtb \
fsl-ls1043a-qds-lpuart.dtb \
fsl-ls1043a-rdb.dtb \
dtb-$(CONFIG_TARGET_SAMA5D2_XPLAINED) += \
at91-sama5d2_xplained.dtb
+dtb-$(CONFIG_TARGET_SAMA5D27_SOM1_EK) += \
+ at91-sama5d27_som1_ek.dtb
+
dtb-$(CONFIG_TARGET_SAMA5D3XEK) += \
sama5d31ek.dtb \
sama5d33ek.dtb \
#include <dt-bindings/gpio/gpio.h>
#include <dt-bindings/interrupt-controller/irq.h>
#include "am57xx-idk-common.dtsi"
+#include "dra72x-mmc-iodelay.dtsi"
/ {
model = "TI AM5718 IDK";
linux,default-trigger = "mmc0";
};
};
+};
+
+&omap_dwc3_2 {
+ extcon = <&extcon_usb2>;
+};
- extcon_usb2: extcon_usb2 {
- compatible = "linux,extcon-usb-gpio";
- id-gpio = <&gpio5 7 GPIO_ACTIVE_HIGH>;
+&extcon_usb2 {
+ id-gpio = <&gpio5 7 GPIO_ACTIVE_HIGH>;
+ vbus-gpio = <&gpio7 22 GPIO_ACTIVE_HIGH>;
+};
+
+&mailbox5 {
+ status = "okay";
+ mbox_ipu1_ipc3x: mbox_ipu1_ipc3x {
+ status = "okay";
+ };
+ mbox_dsp1_ipc3x: mbox_dsp1_ipc3x {
+ status = "okay";
};
};
-&mmc1 {
+&mailbox6 {
status = "okay";
- vmmc-supply = <&ldo1_reg>;
- bus-width = <4>;
- cd-gpios = <&gpio6 27 GPIO_ACTIVE_LOW>; /* gpio 219 */
+ mbox_ipu2_ipc3x: mbox_ipu2_ipc3x {
+ status = "okay";
+ };
};
-&omap_dwc3_2 {
- extcon = <&extcon_usb2>;
+&pcie1_rc {
+ status = "okay";
+ gpios = <&gpio3 23 GPIO_ACTIVE_HIGH>;
+};
+
+&pcie1_ep {
+ gpios = <&gpio3 23 GPIO_ACTIVE_HIGH>;
+};
+
+&mmc1 {
+ pinctrl-names = "default", "hs", "sdr12", "sdr25", "sdr50", "ddr50", "sdr104";
+ pinctrl-0 = <&mmc1_pins_default>;
+ pinctrl-1 = <&mmc1_pins_hs>;
+ pinctrl-2 = <&mmc1_pins_sdr12>;
+ pinctrl-3 = <&mmc1_pins_sdr25>;
+ pinctrl-4 = <&mmc1_pins_sdr50>;
+ pinctrl-5 = <&mmc1_pins_ddr50_rev20 &mmc1_iodelay_ddr50_conf>;
+ pinctrl-6 = <&mmc1_pins_sdr104 &mmc1_iodelay_sdr104_rev20_conf>;
+};
+
+&mmc2 {
+ pinctrl-names = "default", "hs", "ddr_1_8v";
+ pinctrl-0 = <&mmc2_pins_default>;
+ pinctrl-1 = <&mmc2_pins_hs>;
+ pinctrl-2 = <&mmc2_pins_ddr_rev20 &mmc2_iodelay_ddr_conf>;
};
#include <dt-bindings/gpio/gpio.h>
#include <dt-bindings/interrupt-controller/irq.h>
#include "am57xx-idk-common.dtsi"
+#include "dra74x-mmc-iodelay.dtsi"
/ {
model = "TI AM5728 IDK";
reg = <0x0 0x80000000 0x0 0x80000000>;
};
- extcon_usb2: extcon_usb2 {
- compatible = "linux,extcon-usb-gpio";
- id-gpio = <&gpio3 16 GPIO_ACTIVE_HIGH>;
- };
-
status-leds {
compatible = "gpio-leds";
cpu0-led {
};
};
+&mmc1 {
+ pinctrl-names = "default", "hs", "sdr12", "sdr25", "sdr50", "ddr50", "sdr104";
+ pinctrl-0 = <&mmc1_pins_default>;
+ pinctrl-1 = <&mmc1_pins_hs>;
+ pinctrl-2 = <&mmc1_pins_sdr12>;
+ pinctrl-3 = <&mmc1_pins_sdr25>;
+ pinctrl-4 = <&mmc1_pins_sdr50>;
+ pinctrl-5 = <&mmc1_pins_ddr50 &mmc1_iodelay_ddr_rev20_conf>;
+ pinctrl-6 = <&mmc1_pins_sdr104 &mmc1_iodelay_sdr104_rev20_conf>;
+};
+
+&mmc2 {
+ pinctrl-names = "default", "hs", "ddr_1_8v";
+ pinctrl-0 = <&mmc2_pins_default>;
+ pinctrl-1 = <&mmc2_pins_hs>;
+ pinctrl-2 = <&mmc2_pins_ddr_rev20>;
+};
+
&omap_dwc3_2 {
extcon = <&extcon_usb2>;
};
-&mmc1 {
+&extcon_usb2 {
+ id-gpio = <&gpio3 16 GPIO_ACTIVE_HIGH>;
+ vbus-gpio = <&gpio3 26 GPIO_ACTIVE_HIGH>;
+};
+
+&sn65hvs882 {
+ load-gpios = <&gpio3 19 GPIO_ACTIVE_LOW>;
+};
+
+&pcie1_rc {
status = "okay";
- vmmc-supply = <&v3_3d>;
- vmmc_aux-supply = <&ldo1_reg>;
- bus-width = <4>;
- cd-gpios = <&gpio6 27 GPIO_ACTIVE_LOW>; /* gpio 219 */
+ gpios = <&gpio3 23 GPIO_ACTIVE_HIGH>;
+};
+
+&pcie1_ep {
+ gpios = <&gpio3 23 GPIO_ACTIVE_HIGH>;
+};
+
+&mailbox5 {
+ status = "okay";
+ mbox_ipu1_ipc3x: mbox_ipu1_ipc3x {
+ status = "okay";
+ };
+ mbox_dsp1_ipc3x: mbox_dsp1_ipc3x {
+ status = "okay";
+ };
+};
+
+&mailbox6 {
+ status = "okay";
+ mbox_ipu2_ipc3x: mbox_ipu2_ipc3x {
+ status = "okay";
+ };
+ mbox_dsp2_ipc3x: mbox_dsp2_ipc3x {
+ status = "okay";
+ };
};
#include "dra74x.dtsi"
#include "am57xx-commercial-grade.dtsi"
+#include "dra74x-mmc-iodelay.dtsi"
#include <dt-bindings/gpio/gpio.h>
#include <dt-bindings/interrupt-controller/irq.h>
/ {
compatible = "ti,am572x-beagle-x15", "ti,am5728", "ti,dra742", "ti,dra74", "ti,dra7";
- chosen {
- stdout-path = &uart3;
- };
-
aliases {
rtc0 = &mcp_rtc;
rtc1 = &tps659038_rtc;
display0 = &hdmi0;
};
+ chosen {
+ stdout-path = &uart3;
+ };
+
memory@0 {
device_type = "memory";
reg = <0x0 0x80000000 0x0 0x80000000>;
};
};
-&dra7_pmx_core {
- mmc1_pins_default: mmc1_pins_default {
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x376c, PIN_INPUT | MUX_MODE14) /* mmc1sdcd.gpio219 */
- DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_clk.clk */
- DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_cmd.cmd */
- DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat0.dat0 */
- DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat1.dat1 */
- DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat2.dat2 */
- DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat3.dat3 */
- >;
- };
-
- mmc2_pins_default: mmc2_pins_default {
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x349c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a23.mmc2_clk */
- DRA7XX_CORE_IOPAD(0x34b0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_cs1.mmc2_cmd */
- DRA7XX_CORE_IOPAD(0x34a0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a24.mmc2_dat0 */
- DRA7XX_CORE_IOPAD(0x34a4, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a25.mmc2_dat1 */
- DRA7XX_CORE_IOPAD(0x34a8, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a26.mmc2_dat2 */
- DRA7XX_CORE_IOPAD(0x34ac, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a27.mmc2_dat3 */
- DRA7XX_CORE_IOPAD(0x348c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a19.mmc2_dat4 */
- DRA7XX_CORE_IOPAD(0x3490, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a20.mmc2_dat5 */
- DRA7XX_CORE_IOPAD(0x3494, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a21.mmc2_dat6 */
- DRA7XX_CORE_IOPAD(0x3498, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a22.mmc2_dat7 */
- >;
- };
-};
&i2c1 {
status = "okay";
clock-frequency = <400000>;
interrupt-controller;
ti,system-power-controller;
+ ti,palmas-override-powerhold;
tps659038_pmic {
compatible = "ti,tps659038-pmic";
};
eeprom: eeprom@50 {
- compatible = "at,24c32";
+ compatible = "atmel,24c32";
reg = <0x50>;
};
};
<&dra7_pmx_core 0x3f8>;
};
+&davinci_mdio {
+ phy0: ethernet-phy@1 {
+ reg = <1>;
+ };
+
+ phy1: ethernet-phy@2 {
+ reg = <2>;
+ };
+};
+
&mac {
status = "okay";
dual_emac;
};
&cpsw_emac0 {
- phy_id = <&davinci_mdio>, <1>;
+ phy-handle = <&phy0>;
phy-mode = "rgmii";
dual_emac_res_vlan = <1>;
};
&cpsw_emac1 {
- phy_id = <&davinci_mdio>, <2>;
+ phy-handle = <&phy1>;
phy-mode = "rgmii";
dual_emac_res_vlan = <2>;
};
};
};
-&pcie1 {
+&pcie1_rc {
+ status = "ok";
+ gpios = <&gpio2 8 GPIO_ACTIVE_LOW>;
+};
+
+&pcie1_ep {
gpios = <&gpio2 8 GPIO_ACTIVE_LOW>;
};
};
&mmc1 {
+ pinctrl-names = "default", "hs", "sdr12", "sdr25", "sdr50", "ddr50", "sdr104";
+ pinctrl-0 = <&mmc1_pins_default>;
+ pinctrl-1 = <&mmc1_pins_hs>;
+ pinctrl-2 = <&mmc1_pins_sdr12>;
+ pinctrl-3 = <&mmc1_pins_sdr25>;
+ pinctrl-4 = <&mmc1_pins_sdr50>;
+ pinctrl-5 = <&mmc1_pins_ddr50 &mmc1_iodelay_ddr_rev11_conf>;
+ pinctrl-6 = <&mmc1_pins_sdr104 &mmc1_iodelay_sdr104_rev11_conf>;
vmmc-supply = <&vdd_3v3>;
- vmmc-aux-supply = <&ldo1_reg>;
+ vqmmc-supply = <&ldo1_reg>;
+};
+
+&mmc2 {
+ pinctrl-names = "default", "hs", "ddr_1_8v";
+ pinctrl-0 = <&mmc2_pins_default>;
+ pinctrl-1 = <&mmc2_pins_hs>;
+ pinctrl-2 = <&mmc2_pins_ddr_3_3v_rev11 &mmc2_iodelay_ddr_3_3v_rev11_conf>;
+};
+
+/* errata i880 "Ethernet RGMII2 Limited to 10/100 Mbps" */
+&phy1 {
+ max-speed = <100>;
};
--- /dev/null
+/*
+ * Copyright (C) 2014-2017 Texas Instruments Incorporated - http://www.ti.com/
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+
+#include "am57xx-beagle-x15-common.dtsi"
+
+/ {
+ model = "TI AM5728 BeagleBoard-X15 rev C";
+};
+
+&tpd12s015 {
+ gpios = <&gpio7 10 GPIO_ACTIVE_HIGH>, /* gpio7_10, CT CP HPD */
+ <&gpio2 30 GPIO_ACTIVE_HIGH>, /* gpio2_30, LS OE */
+ <&gpio7 12 GPIO_ACTIVE_HIGH>; /* gpio7_12/sp1_cs2, HPD */
+};
+
+&mmc1 {
+ pinctrl-names = "default", "hs", "sdr12", "sdr25", "sdr50", "ddr50", "sdr104";
+ pinctrl-0 = <&mmc1_pins_default>;
+ pinctrl-1 = <&mmc1_pins_hs>;
+ pinctrl-2 = <&mmc1_pins_sdr12>;
+ pinctrl-3 = <&mmc1_pins_sdr25>;
+ pinctrl-4 = <&mmc1_pins_sdr50>;
+ pinctrl-5 = <&mmc1_pins_ddr50 &mmc1_iodelay_ddr_rev20_conf>;
+ pinctrl-6 = <&mmc1_pins_sdr104 &mmc1_iodelay_sdr104_rev20_conf>;
+ vmmc-supply = <&vdd_3v3>;
+ vqmmc-supply = <&ldo1_reg>;
+};
+
+&mmc2 {
+ pinctrl-names = "default", "hs", "ddr_1_8v";
+ pinctrl-0 = <&mmc2_pins_default>;
+ pinctrl-1 = <&mmc2_pins_hs>;
+ pinctrl-2 = <&mmc2_pins_ddr_rev20>;
+};
};
&mmc1 {
+ pinctrl-names = "default", "hs";
+ pinctrl-0 = <&mmc1_pins_default>;
+ pinctrl-1 = <&mmc1_pins_hs>;
+
vmmc-supply = <&ldo1_reg>;
};
+
+&mmc2 {
+ pinctrl-names = "default", "hs", "ddr_1_8v";
+ pinctrl-0 = <&mmc2_pins_default>;
+ pinctrl-1 = <&mmc2_pins_hs>;
+ pinctrl-2 = <&mmc2_pins_ddr_3_3v_rev11 &mmc2_iodelay_ddr_3_3v_rev11_conf>;
+};
+
+/* errata i880 "Ethernet RGMII2 Limited to 10/100 Mbps" */
+&phy1 {
+ max-speed = <100>;
+};
--- /dev/null
+/*
+ * Support for CompuLab CL-SOM-AM57x System-on-Module
+ *
+ * Copyright (C) 2015 CompuLab Ltd. - http://www.compulab.co.il/
+ * Author: Dmitry Lifshitz <lifshitz@compulab.co.il>
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License version 2 as published by
+ * the Free Software Foundation.
+ */
+
+/dts-v1/;
+
+#include <dt-bindings/gpio/gpio.h>
+#include <dt-bindings/interrupt-controller/irq.h>
+#include "dra74x.dtsi"
+
+/ {
+ model = "CompuLab CL-SOM-AM57x";
+ compatible = "compulab,cl-som-am57x", "ti,am5728", "ti,dra742", "ti,dra74", "ti,dra7";
+
+ memory@0 {
+ device_type = "memory";
+ reg = <0x0 0x80000000 0x0 0x20000000>; /* 512 MB - minimal configuration */
+ };
+
+ leds {
+ compatible = "gpio-leds";
+ pinctrl-names = "default";
+ pinctrl-0 = <&leds_pins_default>;
+
+ led0 {
+ label = "cl-som-am57x:green";
+ gpios = <&gpio2 5 GPIO_ACTIVE_HIGH>;
+ linux,default-trigger = "heartbeat";
+ default-state = "off";
+ };
+ };
+
+ vdd_3v3: fixedregulator-vdd_3v3 {
+ compatible = "regulator-fixed";
+ regulator-name = "vdd_3v3";
+ regulator-min-microvolt = <3300000>;
+ regulator-max-microvolt = <3300000>;
+ };
+
+ ads7846reg: fixedregulator-ads7846-reg {
+ compatible = "regulator-fixed";
+ regulator-name = "ads7846-reg";
+ regulator-min-microvolt = <3300000>;
+ regulator-max-microvolt = <3300000>;
+ };
+
+ sound0: sound0 {
+ compatible = "simple-audio-card";
+ simple-audio-card,name = "CL-SOM-AM57x-Sound-Card";
+ simple-audio-card,format = "i2s";
+ simple-audio-card,bitclock-master = <&dailink0_master>;
+ simple-audio-card,frame-master = <&dailink0_master>;
+ simple-audio-card,widgets =
+ "Headphone", "Headphone Jack",
+ "Microphone", "Microphone Jack",
+ "Line", "Line Jack";
+ simple-audio-card,routing =
+ "Headphone Jack", "RHPOUT",
+ "Headphone Jack", "LHPOUT",
+ "LLINEIN", "Line Jack",
+ "MICIN", "Mic Bias",
+ "Mic Bias", "Microphone Jack";
+
+ dailink0_master: simple-audio-card,cpu {
+ sound-dai = <&mcasp3>;
+ };
+
+ simple-audio-card,codec {
+ sound-dai = <&wm8731>;
+ system-clock-frequency = <12000000>;
+ };
+ };
+};
+
+&dra7_pmx_core {
+ leds_pins_default: leds_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x347c, PIN_OUTPUT | MUX_MODE14) /* gpmc_a15.gpio2_5 */
+ >;
+ };
+
+ i2c1_pins_default: i2c1_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3800, PIN_INPUT_PULLUP | MUX_MODE0) /* i2c1_sda.sda */
+ DRA7XX_CORE_IOPAD(0x3804, PIN_INPUT_PULLUP | MUX_MODE0) /* i2c1_scl.scl */
+ >;
+ };
+
+ i2c3_pins_default: i2c3_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x36a4, PIN_INPUT| MUX_MODE10) /* mcasp1_aclkx.i2c3_sda */
+ DRA7XX_CORE_IOPAD(0x36a8, PIN_INPUT| MUX_MODE10) /* mcasp1_fsx.i2c3_scl */
+ >;
+ };
+
+ i2c4_pins_default: i2c4_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x36ac, PIN_INPUT| MUX_MODE10) /* mcasp1_acl.i2c4_sda */
+ DRA7XX_CORE_IOPAD(0x36b0, PIN_INPUT| MUX_MODE10) /* mcasp1_fsr.i2c4_scl */
+ >;
+ };
+
+ tps659038_pins_default: tps659038_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3818, PIN_INPUT_PULLUP | MUX_MODE14) /* wakeup0.gpio1_0 */
+ >;
+ };
+
+ mmc2_pins_default: mmc2_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x349c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a23.mmc2_clk */
+ DRA7XX_CORE_IOPAD(0x34b0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_cs1.mmc2_cmd */
+ DRA7XX_CORE_IOPAD(0x34a0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a24.mmc2_dat0 */
+ DRA7XX_CORE_IOPAD(0x34a4, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a25.mmc2_dat1 */
+ DRA7XX_CORE_IOPAD(0x34a8, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a26.mmc2_dat2 */
+ DRA7XX_CORE_IOPAD(0x34ac, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a27.mmc2_dat3 */
+ DRA7XX_CORE_IOPAD(0x348c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a19.mmc2_dat4 */
+ DRA7XX_CORE_IOPAD(0x3490, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a20.mmc2_dat5 */
+ DRA7XX_CORE_IOPAD(0x3494, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a21.mmc2_dat6 */
+ DRA7XX_CORE_IOPAD(0x3498, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a22.mmc2_dat7 */
+ >;
+ };
+
+ qspi1_pins: pinmux_qspi1_pins {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3474, PIN_INPUT | MUX_MODE1) /* gpmc_a13.qspi1_rtclk */
+ DRA7XX_CORE_IOPAD(0x3480, PIN_INPUT | MUX_MODE1) /* gpmc_a16.qspi1_d0 */
+ DRA7XX_CORE_IOPAD(0x3484, PIN_INPUT | MUX_MODE1) /* gpmc_a17.qspi1_d1 */
+ DRA7XX_CORE_IOPAD(0x3488, PIN_INPUT | MUX_MODE1) /* qpmc_a18.qspi1_sclk */
+ DRA7XX_CORE_IOPAD(0x34b8, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_cs2.qspi1_cs0 */
+ DRA7XX_CORE_IOPAD(0x34bc, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_cs3.qspi1_cs1 */
+ >;
+ };
+
+ cpsw_pins_default: cpsw_pins_default {
+ pinctrl-single,pins = <
+ /* Slave at addr 0x0 */
+ DRA7XX_CORE_IOPAD(0x3650, PIN_OUTPUT | MUX_MODE0) /* rgmii0_tclk */
+ DRA7XX_CORE_IOPAD(0x3654, PIN_OUTPUT | MUX_MODE0) /* rgmii0_tctl */
+ DRA7XX_CORE_IOPAD(0x3658, PIN_OUTPUT | MUX_MODE0) /* rgmii0_td3 */
+ DRA7XX_CORE_IOPAD(0x365c, PIN_OUTPUT | MUX_MODE0) /* rgmii0_td2 */
+ DRA7XX_CORE_IOPAD(0x3660, PIN_OUTPUT | MUX_MODE0) /* rgmii0_td1 */
+ DRA7XX_CORE_IOPAD(0x3664, PIN_OUTPUT | MUX_MODE0) /* rgmii0_td0 */
+ DRA7XX_CORE_IOPAD(0x3668, PIN_INPUT_PULLDOWN | MUX_MODE0) /* rgmii0_rclk */
+ DRA7XX_CORE_IOPAD(0x366c, PIN_INPUT_PULLDOWN | MUX_MODE0) /* rgmii0_rctl */
+ DRA7XX_CORE_IOPAD(0x3670, PIN_INPUT_PULLDOWN | MUX_MODE0) /* rgmii0_rd3 */
+ DRA7XX_CORE_IOPAD(0x3674, PIN_INPUT_PULLDOWN | MUX_MODE0) /* rgmii0_rd2 */
+ DRA7XX_CORE_IOPAD(0x3678, PIN_INPUT_PULLDOWN | MUX_MODE0) /* rgmii0_rd1 */
+ DRA7XX_CORE_IOPAD(0x367c, PIN_INPUT_PULLDOWN | MUX_MODE0) /* rgmii0_rd0 */
+
+ /* Slave at addr 0x1 */
+ DRA7XX_CORE_IOPAD(0x3598, PIN_OUTPUT | MUX_MODE3) /* vin2a_d12.rgmii1_tclk */
+ DRA7XX_CORE_IOPAD(0x359c, PIN_OUTPUT | MUX_MODE3) /* vin2a_d13.rgmii1_tctl */
+ DRA7XX_CORE_IOPAD(0x35a0, PIN_OUTPUT | MUX_MODE3) /* vin2a_d14.rgmii1_td3 */
+ DRA7XX_CORE_IOPAD(0x35a4, PIN_OUTPUT | MUX_MODE3) /* vin2a_d15.rgmii1_td2 */
+ DRA7XX_CORE_IOPAD(0x35a8, PIN_OUTPUT | MUX_MODE3) /* vin2a_d16.rgmii1_td1 */
+ DRA7XX_CORE_IOPAD(0x35ac, PIN_OUTPUT | MUX_MODE3) /* vin2a_d17.rgmii1_td0 */
+ DRA7XX_CORE_IOPAD(0x35b0, PIN_INPUT_PULLDOWN | MUX_MODE3) /* vin2a_d18.rgmii1_rclk */
+ DRA7XX_CORE_IOPAD(0x35b4, PIN_INPUT_PULLDOWN | MUX_MODE3) /* vin2a_d19.rgmii1_rctl */
+ DRA7XX_CORE_IOPAD(0x35b8, PIN_INPUT_PULLDOWN | MUX_MODE3) /* vin2a_d20.rgmii1_rd3 */
+ DRA7XX_CORE_IOPAD(0x35bc, PIN_INPUT_PULLDOWN | MUX_MODE3) /* vin2a_d21.rgmii1_rd2 */
+ DRA7XX_CORE_IOPAD(0x35c0, PIN_INPUT_PULLDOWN | MUX_MODE3) /* vin2a_d22.rgmii1_rd1 */
+ DRA7XX_CORE_IOPAD(0x35c4, PIN_INPUT_PULLDOWN | MUX_MODE3) /* vin2a_d23.rgmii1_rd0 */
+ >;
+ };
+
+ cpsw_pins_sleep: cpsw_pins_sleep {
+ pinctrl-single,pins = <
+ /* Slave 1 */
+ DRA7XX_CORE_IOPAD(0x3650, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x3654, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x3658, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x365c, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x3660, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x3664, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x3668, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x366c, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x3670, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x3674, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x3678, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x367c, PIN_INPUT | MUX_MODE15)
+
+ /* Slave 2 */
+ DRA7XX_CORE_IOPAD(0x3598, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x359c, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x35a0, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x35a4, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x35a8, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x35ac, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x35b0, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x35b4, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x35b8, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x35bc, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x35c0, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x35c4, PIN_INPUT | MUX_MODE15)
+ >;
+ };
+
+ davinci_mdio_pins_default: davinci_mdio_pins_default {
+ pinctrl-single,pins = <
+ /* MDIO */
+ DRA7XX_CORE_IOPAD(0x3590, PIN_OUTPUT_PULLUP | MUX_MODE3)/* vin2a_d10.mdio_mclk */
+ DRA7XX_CORE_IOPAD(0x3594, PIN_INPUT_PULLUP | MUX_MODE3) /* vin2a_d11.mdio_d */
+ >;
+ };
+
+ davinci_mdio_pins_sleep: davinci_mdio_pins_sleep {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3590, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x3594, PIN_INPUT | MUX_MODE15)
+ >;
+ };
+
+ ads7846_pins: pinmux_ads7846_pins {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3464, PIN_INPUT_PULLDOWN | MUX_MODE14) /* gpmc_a9.gpio1_31 */
+ >;
+ };
+
+ mcasp3_pins_default: mcasp3_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3724, PIN_INPUT_PULLDOWN | MUX_MODE0) /* mcasp3_aclkx.mcasp3_aclkx */
+ DRA7XX_CORE_IOPAD(0x3728, PIN_INPUT_PULLDOWN | MUX_MODE0) /* mcasp3_fsx.mcasp3_fsx */
+ DRA7XX_CORE_IOPAD(0x372c, PIN_OUTPUT_PULLDOWN | MUX_MODE0) /* mcasp3_axr0.mcasp3_axr0 */
+ DRA7XX_CORE_IOPAD(0x3730, PIN_INPUT_PULLDOWN | MUX_MODE0) /* mcasp3_axr1.mcasp3_axr1 */
+ >;
+ };
+
+ mcasp3_pins_sleep: mcasp3_pins_sleep {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3724, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x3728, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x372c, PIN_INPUT | MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x3730, PIN_INPUT | MUX_MODE15)
+ >;
+ };
+};
+
+&i2c1 {
+ status = "okay";
+ pinctrl-names = "default";
+ pinctrl-0 = <&i2c1_pins_default>;
+ clock-frequency = <400000>;
+};
+
+&i2c3 {
+ status = "okay";
+ pinctrl-names = "default";
+ pinctrl-0 = <&i2c3_pins_default>;
+ clock-frequency = <400000>;
+};
+
+&i2c4 {
+ status = "okay";
+ pinctrl-names = "default";
+ pinctrl-0 = <&i2c4_pins_default>;
+ clock-frequency = <400000>;
+
+ tps659038: tps659038@58 {
+ compatible = "ti,tps659038";
+ reg = <0x58>;
+ interrupt-parent = <&gpio1>;
+ interrupts = <0 IRQ_TYPE_LEVEL_LOW>;
+
+ pinctrl-names = "default";
+ pinctrl-0 = <&tps659038_pins_default>;
+
+ #interrupt-cells = <2>;
+ interrupt-controller;
+
+ ti,system-power-controller;
+
+ tps659038_pmic {
+ compatible = "ti,tps659038-pmic";
+
+ regulators {
+ smps12_reg: smps12 {
+ /* VDD_MPU */
+ regulator-name = "smps12";
+ regulator-min-microvolt = < 850000>;
+ regulator-max-microvolt = <1250000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ smps3_reg: smps3 {
+ /* VDD_DDR */
+ regulator-name = "smps3";
+ regulator-min-microvolt = <1500000>;
+ regulator-max-microvolt = <1500000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ smps45_reg: smps45 {
+ /* VDD_DSPEVE */
+ regulator-name = "smps45";
+ regulator-min-microvolt = < 850000>;
+ regulator-max-microvolt = <1250000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ smps6_reg: smps6 {
+ /* VDD_GPU */
+ regulator-name = "smps6";
+ regulator-min-microvolt = < 850000>;
+ regulator-max-microvolt = <1250000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ smps7_reg: smps7 {
+ /* VDD_CORE */
+ regulator-name = "smps7";
+ regulator-min-microvolt = < 850000>;
+ regulator-max-microvolt = <1160000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ smps8_reg: smps8 {
+ /* VDD_IVA */
+ regulator-name = "smps8";
+ regulator-min-microvolt = < 850000>;
+ regulator-max-microvolt = <1250000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ smps9_reg: smps9 {
+ /* PMIC_3V3 */
+ regulator-name = "smps9";
+ regulator-min-microvolt = <3300000>;
+ regulator-max-microvolt = <3300000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+
+ ldo1_reg: ldo1 {
+ /* VDD_SD / VDDSHV8 */
+ regulator-name = "ldo1";
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <3300000>;
+ regulator-boot-on;
+ regulator-always-on;
+ };
+
+ ldo2_reg: ldo2 {
+ /* VDD_1V8 */
+ regulator-name = "ldo2";
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ ldo3_reg: ldo3 {
+ /* VDDA_1V8_PHYA - supplies VDDA_SATA, VDDA_USB1/2/3 */
+ regulator-name = "ldo3";
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ ldo4_reg: ldo4 {
+ /* VDDA_1V8_PHYB - supplies VDDA_HDMI, VDDA_PCIE/0/1 */
+ regulator-name = "ldo4";
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ ldo9_reg: ldo9 {
+ /* VDD_RTC */
+ regulator-name = "ldo9";
+ regulator-min-microvolt = <1050000>;
+ regulator-max-microvolt = <1050000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ ldoln_reg: ldoln {
+ /* VDDA_1V8_PLL */
+ regulator-name = "ldoln";
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ ldousb_reg: ldousb {
+ /* VDDA_3V_USB: VDDA_USBHS33 */
+ regulator-name = "ldousb";
+ regulator-min-microvolt = <3300000>;
+ regulator-max-microvolt = <3300000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ /* regen1 not used */
+ };
+ };
+
+ tps659038_pwr_button: tps659038_pwr_button {
+ compatible = "ti,palmas-pwrbutton";
+ interrupt-parent = <&tps659038>;
+ interrupts = <1 IRQ_TYPE_EDGE_FALLING>;
+ wakeup-source;
+ ti,palmas-long-press-seconds = <12>;
+ };
+
+ tps659038_gpio: tps659038_gpio {
+ compatible = "ti,palmas-gpio";
+ gpio-controller;
+ #gpio-cells = <2>;
+ };
+ };
+
+ rtc0: rtc@56 {
+ compatible = "emmicro,em3027";
+ reg = <0x56>;
+ };
+
+ eeprom_module: atmel@50 {
+ compatible = "atmel,24c08";
+ reg = <0x50>;
+ pagesize = <16>;
+ };
+
+ wm8731: wm8731@1a {
+ #sound-dai-cells = <0>;
+ compatible = "wlf,wm8731";
+ reg = <0x1a>;
+ status = "okay";
+ };
+};
+
+&cpu0 {
+ cpu0-supply = <&smps12_reg>;
+ voltage-tolerance = <1>;
+};
+
+&sata {
+ status = "okay";
+};
+
+&mailbox5 {
+ status = "okay";
+ mbox_ipu1_ipc3x: mbox_ipu1_ipc3x {
+ status = "okay";
+ };
+ mbox_dsp1_ipc3x: mbox_dsp1_ipc3x {
+ status = "okay";
+ };
+};
+
+&mailbox6 {
+ status = "okay";
+ mbox_ipu2_ipc3x: mbox_ipu2_ipc3x {
+ status = "okay";
+ };
+ mbox_dsp2_ipc3x: mbox_dsp2_ipc3x {
+ status = "okay";
+ };
+};
+
+&mmc2 {
+ status = "okay";
+
+ pinctrl-names = "default";
+ pinctrl-0 = <&mmc2_pins_default>;
+
+ vmmc-supply = <&vdd_3v3>;
+ bus-width = <8>;
+ ti,non-removable;
+ cap-mmc-dual-data-rate;
+};
+
+&qspi {
+ status = "okay";
+ pinctrl-names = "default";
+ pinctrl-0 = <&qspi1_pins>;
+
+ spi-max-frequency = <48000000>;
+
+ spi_flash: spi_flash@0 {
+ #address-cells = <1>;
+ #size-cells = <1>;
+ compatible = "spansion,m25p80", "jedec,spi-nor";
+ reg = <0>; /* CS0 */
+ spi-max-frequency = <48000000>;
+
+ partition@0 {
+ label = "uboot";
+ reg = <0x0 0xc0000>;
+ };
+
+ partition@c0000 {
+ label = "uboot environment";
+ reg = <0xc0000 0x40000>;
+ };
+
+ partition@100000 {
+ label = "reserved";
+ reg = <0x100000 0x0>;
+ };
+ };
+
+ /* touch controller */
+ ads7846@0 {
+ pinctrl-names = "default";
+ pinctrl-0 = <&ads7846_pins>;
+
+ compatible = "ti,ads7846";
+ vcc-supply = <&ads7846reg>;
+
+ reg = <1>; /* CS1 */
+ spi-max-frequency = <1500000>;
+
+ interrupt-parent = <&gpio1>;
+ interrupts = <31 0>;
+ pendown-gpio = <&gpio1 31 0>;
+
+
+ ti,x-min = /bits/ 16 <0x0>;
+ ti,x-max = /bits/ 16 <0x0fff>;
+ ti,y-min = /bits/ 16 <0x0>;
+ ti,y-max = /bits/ 16 <0x0fff>;
+
+ ti,x-plate-ohms = /bits/ 16 <180>;
+ ti,pressure-max = /bits/ 16 <255>;
+
+ ti,debounce-max = /bits/ 16 <30>;
+ ti,debounce-tol = /bits/ 16 <10>;
+ ti,debounce-rep = /bits/ 16 <1>;
+
+ wakeup-source;
+ };
+};
+
+&mac {
+ status = "okay";
+ pinctrl-names = "default", "sleep";
+ pinctrl-0 = <&cpsw_pins_default>;
+ pinctrl-1 = <&cpsw_pins_sleep>;
+ dual_emac;
+};
+
+&cpsw_emac0 {
+ phy_id = <&davinci_mdio>, <0>;
+ phy-mode = "rgmii-txid";
+ dual_emac_res_vlan = <0>;
+};
+
+&cpsw_emac1 {
+ phy_id = <&davinci_mdio>, <1>;
+ phy-mode = "rgmii-txid";
+ dual_emac_res_vlan = <1>;
+};
+
+&davinci_mdio {
+ pinctrl-names = "default", "sleep";
+ pinctrl-0 = <&davinci_mdio_pins_default>;
+ pinctrl-1 = <&davinci_mdio_pins_sleep>;
+};
+
+&usb2_phy1 {
+ phy-supply = <&ldousb_reg>;
+};
+
+&usb2_phy2 {
+ phy-supply = <&ldousb_reg>;
+};
+
+&usb1 {
+ dr_mode = "host";
+};
+
+&usb2 {
+ dr_mode = "host";
+};
+
+&mcasp3 {
+ #sound-dai-cells = <0>;
+ pinctrl-names = "default", "sleep";
+ pinctrl-0 = <&mcasp3_pins_default>;
+ pinctrl-1 = <&mcasp3_pins_sleep>;
+ status = "okay";
+
+ op-mode = <0>; /* MCASP_IIS_MODE */
+ tdm-slots = <2>;
+ /* 4 serializers */
+ serial-dir = < /* 0: INACTIVE, 1: TX, 2: RX */
+ 1 2 0 0
+ >;
+};
+
+&gpio3 {
+ status = "okay";
+ ti,no-reset-on-init;
+};
+
+&gpio2 {
+ status = "okay";
+ ti,no-reset-on-init;
+};
regulator-always-on;
regulator-boot-on;
};
+
+ leds-iio {
+ status = "disabled";
+ compatible = "gpio-leds";
+ led-out0 {
+ label = "out0";
+ gpios = <&tpic2810 0 GPIO_ACTIVE_HIGH>;
+ default-state = "off";
+ };
+
+ led-out1 {
+ label = "out1";
+ gpios = <&tpic2810 1 GPIO_ACTIVE_HIGH>;
+ default-state = "off";
+ };
+
+ led-out2 {
+ label = "out2";
+ gpios = <&tpic2810 2 GPIO_ACTIVE_HIGH>;
+ default-state = "off";
+ };
+
+ led-out3 {
+ label = "out3";
+ gpios = <&tpic2810 3 GPIO_ACTIVE_HIGH>;
+ default-state = "off";
+ };
+
+ led-out4 {
+ label = "out4";
+ gpios = <&tpic2810 4 GPIO_ACTIVE_HIGH>;
+ default-state = "off";
+ };
+
+ led-out5 {
+ label = "out5";
+ gpios = <&tpic2810 5 GPIO_ACTIVE_HIGH>;
+ default-state = "off";
+ };
+
+ led-out6 {
+ label = "out6";
+ gpios = <&tpic2810 6 GPIO_ACTIVE_HIGH>;
+ default-state = "off";
+ };
+
+ led-out7 {
+ label = "out7";
+ gpios = <&tpic2810 7 GPIO_ACTIVE_HIGH>;
+ default-state = "off";
+ };
+ };
+};
+
+&dra7_pmx_core {
+ dcan1_pins_default: dcan1_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x37d0, PIN_OUTPUT_PULLUP | MUX_MODE0) /* dcan1_tx */
+ DRA7XX_CORE_IOPAD(0x37d4, PIN_INPUT_PULLUP | MUX_MODE0) /* dcan1_rx */
+ >;
+ };
+
+ dcan1_pins_sleep: dcan1_pins_sleep {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x37d0, MUX_MODE15 | PULL_UP) /* dcan1_tx.off */
+ DRA7XX_CORE_IOPAD(0x37d4, MUX_MODE15 | PULL_UP) /* dcan1_rx.off */
+ >;
+ };
};
&i2c1 {
#interrupt-cells = <2>;
interrupt-controller;
ti,system-power-controller;
+ ti,palmas-override-powerhold;
tps659038_pmic {
compatible = "ti,tps659038-pmic";
gpio-controller;
#gpio-cells = <2>;
};
+
+ extcon_usb2: tps659038_usb {
+ compatible = "ti,palmas-usb-vid";
+ ti,enable-vbus-detection;
+ ti,enable-id-detection;
+ /* ID & VBUS GPIOs provided in board dts */
+ };
+ };
+
+ tpic2810: tpic2810@60 {
+ compatible = "ti,tpic2810";
+ reg = <0x60>;
+ gpio-controller;
+ #gpio-cells = <2>;
+ };
+};
+
+&mcspi3 {
+ status = "okay";
+ ti,pindir-d0-out-d1-in;
+
+ sn65hvs882: sn65hvs882@0 {
+ compatible = "pisosr-gpio";
+ gpio-controller;
+ #gpio-cells = <2>;
+
+ reg = <0>;
+ spi-max-frequency = <1000000>;
+ spi-cpol;
};
};
};
&usb2 {
- dr_mode = "otg";
+ dr_mode = "peripheral";
+};
+
+&mmc1 {
+ status = "okay";
+ vmmc-supply = <&v3_3d>;
+ vqmmc-supply = <&ldo1_reg>;
+ bus-width = <4>;
+ cd-gpios = <&gpio6 27 GPIO_ACTIVE_LOW>; /* gpio 219 */
};
&mmc2 {
max-frequency = <96000000>;
};
+&dcan1 {
+ status = "okay";
+ pinctrl-names = "default", "sleep", "active";
+ pinctrl-0 = <&dcan1_pins_sleep>;
+ pinctrl-1 = <&dcan1_pins_sleep>;
+ pinctrl-2 = <&dcan1_pins_default>;
+};
+
&qspi {
status = "okay";
spi-max-frequency = <76800000>;
m25p80@0 {
- compatible = "s25fl256s1", "spi-flash", "jedec,spi-nor";
+ compatible = "s25fl256s1", "jedec,spi-nor";
spi-max-frequency = <76800000>;
reg = <0>;
spi-tx-bus-width = <1>;
--- /dev/null
+/*
+ * Support for CompuLab SBC-AM57x single board computer
+ *
+ * Copyright (C) 2015 CompuLab Ltd. - http://www.compulab.co.il/
+ * Author: Dmitry Lifshitz <lifshitz@compulab.co.il>
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License version 2 as published by
+ * the Free Software Foundation.
+ */
+
+#include "am57xx-cl-som-am57x.dts"
+#include "compulab-sb-som.dtsi"
+
+/ {
+ model = "CompuLab CL-SOM-AM57x on SB-SOM-AM57x";
+ compatible = "compulab,sbc-am57x", "compulab,cl-som-am57x", "ti,am5728", "ti,dra742", "ti,dra74", "ti,dra7";
+
+ aliases {
+ display0 = &lcd0;
+ display1 = &hdmi;
+ };
+};
+
+&dra7_pmx_core {
+ uart3_pins_default: uart3_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3648, PIN_INPUT_SLEW | MUX_MODE0) /* uart3_rxd */
+ DRA7XX_CORE_IOPAD(0x364c, PIN_INPUT_SLEW | MUX_MODE0) /* uart3_txd */
+ >;
+ };
+
+ mmc1_pins_default: mmc1_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat3.dat3 */
+ DRA7XX_CORE_IOPAD(0x376c, PIN_INPUT | MUX_MODE14) /* mmc1_sdcd.gpio6_27 */
+ DRA7XX_CORE_IOPAD(0x377c, PIN_INPUT | MUX_MODE14) /* mmc1_sdwp.gpio6_28 */
+ >;
+ };
+
+ usb1_pins: pinmux_usb1_pins {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3680, PIN_INPUT_SLEW | MUX_MODE0) /* usb1_drvvbus */
+ >;
+ };
+
+ i2c5_pins_default: i2c5_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x36b4, PIN_INPUT| MUX_MODE10) /* mcasp1_axr0.i2c5_sda */
+ DRA7XX_CORE_IOPAD(0x36b8, PIN_INPUT| MUX_MODE10) /* mcasp1_axr1.i2c5_scl */
+ >;
+ };
+
+ lcd_pins_default: lcd_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3564, PIN_OUTPUT | MUX_MODE14) /* vin2a_vsync0.gpio4_0 */
+ >;
+ };
+
+ hdmi_pins: pinmux_hdmi_pins {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3808, PIN_INPUT | MUX_MODE1) /* i2c2_sda.hdmi1_ddc_scl */
+ DRA7XX_CORE_IOPAD(0x380c, PIN_INPUT | MUX_MODE1) /* i2c2_scl.hdmi1_ddc_sda */
+ >;
+ };
+
+ hdmi_conn_pins: pinmux_hdmi_conn_pins {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x37b8, PIN_INPUT | MUX_MODE14) /* spi1_cs2.gpio7_12 */
+ >;
+ };
+};
+
+&uart3 {
+ status = "okay";
+ interrupts-extended = <&crossbar_mpu GIC_SPI 69 IRQ_TYPE_LEVEL_HIGH>,
+ <&dra7_pmx_core 0x3f8>;
+
+ pinctrl-names = "default";
+ pinctrl-0 = <&uart3_pins_default>;
+};
+
+&mmc1 {
+ status = "okay";
+
+ pinctrl-names = "default";
+ pinctrl-0 = <&mmc1_pins_default>;
+
+ vmmc-supply = <&ldo1_reg>;
+ bus-width = <4>;
+ cd-gpios = <&gpio6 27 GPIO_ACTIVE_LOW>;
+ wp-gpios = <&gpio6 28 GPIO_ACTIVE_HIGH>;
+};
+
+&usb1 {
+ pinctrl-names = "default";
+ pinctrl-0 = <&usb1_pins>;
+};
+
+&i2c5 {
+ status = "okay";
+ pinctrl-names = "default";
+ pinctrl-0 = <&i2c5_pins_default>;
+ clock-frequency = <400000>;
+
+ eeprom_base: atmel@54 {
+ compatible = "atmel,24c08";
+ reg = <0x54>;
+ pagesize = <16>;
+ };
+
+ pca9555: pca9555@20 {
+ compatible = "nxp,pca9555";
+ reg = <0x20>;
+ gpio-controller;
+ #gpio-cells = <2>;
+ };
+};
+
+&dss {
+ status = "ok";
+
+ vdda_video-supply = <&ldoln_reg>;
+
+ port {
+ dpi_lcd_out: endpoint {
+ remote-endpoint = <&lcd_in>;
+ data-lines = <24>;
+ };
+ };
+};
+
+&lcd0 {
+ pinctrl-names = "default";
+ pinctrl-0 = <&lcd_pins_default>;
+
+ enable-gpios = <&pca9555 14 GPIO_ACTIVE_HIGH
+ &gpio4 0 GPIO_ACTIVE_HIGH>;
+
+ port {
+ lcd_in: endpoint {
+ remote-endpoint = <&dpi_lcd_out>;
+ data-lines = <24>;
+ };
+ };
+};
+
+&hdmi {
+ status = "ok";
+ vdda-supply = <&ldo4_reg>;
+
+ pinctrl-names = "default";
+ pinctrl-0 = <&hdmi_pins>;
+
+ port {
+ hdmi_out: endpoint {
+ remote-endpoint = <&hdmi_connector_in>;
+ lanes = <1 0 3 2 5 4 7 6>;
+ };
+ };
+};
+
+&hdmi_conn {
+ pinctrl-names = "default";
+ pinctrl-0 = <&hdmi_conn_pins>;
+
+ hpd-gpios = <&gpio7 12 GPIO_ACTIVE_HIGH>;
+
+ port {
+ hdmi_connector_in: endpoint {
+ remote-endpoint = <&hdmi_out>;
+ };
+ };
+};
--- /dev/null
+/*
+ * at91-sama5d27_som1_ek.dts - Device Tree file for SAMA5D27 SOM1 EK board
+ *
+ * Copyright (C) 2017 Microchip Corporation
+ * Wenyou Yang <wenyou.yang@microchip.com>
+ *
+ * This file is dual-licensed: you can use it either under the terms
+ * of the GPL or the X11 license, at your option. Note that this dual
+ * licensing only applies to this file, and not this project as a
+ * whole.
+ *
+ * a) This file is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of the
+ * License, or (at your option) any later version.
+ *
+ * This file is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * Or, alternatively,
+ *
+ * b) Permission is hereby granted, free of charge, to any person
+ * obtaining a copy of this software and associated documentation
+ * files (the "Software"), to deal in the Software without
+ * restriction, including without limitation the rights to use,
+ * copy, modify, merge, publish, distribute, sublicense, and/or
+ * sell copies of the Software, and to permit persons to whom the
+ * Software is furnished to do so, subject to the following
+ * conditions:
+ *
+ * The above copyright notice and this permission notice shall be
+ * included in all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+ * EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES
+ * OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+ * NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT
+ * HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+ * WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING
+ * FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+ * OTHER DEALINGS IN THE SOFTWARE.
+ */
+/dts-v1/;
+#include "sama5d27_som1.dtsi"
+
+/ {
+ model = "Atmel SAMA5D27 SOM1 EK";
+ compatible = "atmel,sama5d27-som1-ek", "atmel,sama5d2", "atmel,sama5";
+
+ chosen {
+ u-boot,dm-pre-reloc;
+ stdout-path = &uart1;
+ };
+
+ ahb {
+ usb1: ohci@00400000 {
+ num-ports = <3>;
+ atmel,vbus-gpio = <&pioA 42 0>;
+ pinctrl-names = "default";
+ pinctrl-0 = <&pinctrl_usb_default>;
+ status = "okay";
+ };
+
+ usb2: ehci@00500000 {
+ status = "okay";
+ };
+
+ sdmmc0: sdio-host@a0000000 {
+ bus-width = <8>;
+ pinctrl-names = "default";
+ pinctrl-0 = <&pinctrl_sdmmc0_cmd_dat_default &pinctrl_sdmmc0_ck_cd_default>;
+ status = "okay";
+ u-boot,dm-pre-reloc;
+ };
+
+ sdmmc1: sdio-host@b0000000 {
+ bus-width = <4>;
+ pinctrl-names = "default";
+ pinctrl-0 = <&pinctrl_sdmmc1_cmd_dat_default &pinctrl_sdmmc1_ck_cd_default>;
+ status = "okay"; /* conflict with qspi0 */
+ u-boot,dm-pre-reloc;
+ };
+
+ apb {
+ hlcdc: hlcdc@f0000000 {
+ atmel,vl-bpix = <4>;
+ atmel,guard-time = <1>;
+ pinctrl-names = "default";
+ pinctrl-0 = <&pinctrl_lcd_base &pinctrl_lcd_pwm &pinctrl_lcd_rgb666>;
+ status = "okay";
+ u-boot,dm-pre-reloc;
+
+ display-timings {
+ u-boot,dm-pre-reloc;
+ 480x272 {
+ clock-frequency = <9000000>;
+ hactive = <480>;
+ vactive = <272>;
+ hsync-len = <41>;
+ hfront-porch = <2>;
+ hback-porch = <2>;
+ vfront-porch = <2>;
+ vback-porch = <2>;
+ vsync-len = <11>;
+ u-boot,dm-pre-reloc;
+ };
+ };
+ };
+
+ uart1: serial@f8020000 {
+ pinctrl-names = "default";
+ pinctrl-0 = <&pinctrl_uart1_default>;
+ status = "okay";
+ u-boot,dm-pre-reloc;
+ };
+
+ pioA: gpio@fc038000 {
+ pinctrl {
+ pinctrl_lcd_base: pinctrl_lcd_base {
+ pinmux = <PIN_PC5__LCDVSYNC>,
+ <PIN_PC6__LCDHSYNC>,
+ <PIN_PC8__LCDDEN>,
+ <PIN_PC7__LCDPCK>;
+ bias-disable;
+ };
+
+ pinctrl_lcd_pwm: pinctrl_lcd_pwm {
+ pinmux = <PIN_PC3__LCDPWM>;
+ bias-disable;
+ };
+
+ pinctrl_lcd_rgb666: pinctrl_lcd_rgb666 {
+ pinmux = <PIN_PB13__LCDDAT2>,
+ <PIN_PB14__LCDDAT3>,
+ <PIN_PB15__LCDDAT4>,
+ <PIN_PB16__LCDDAT5>,
+ <PIN_PB17__LCDDAT6>,
+ <PIN_PB18__LCDDAT7>,
+ <PIN_PB21__LCDDAT10>,
+ <PIN_PB22__LCDDAT11>,
+ <PIN_PB23__LCDDAT12>,
+ <PIN_PB24__LCDDAT13>,
+ <PIN_PB25__LCDDAT14>,
+ <PIN_PB26__LCDDAT15>,
+ <PIN_PB29__LCDDAT18>,
+ <PIN_PB30__LCDDAT19>,
+ <PIN_PB31__LCDDAT20>,
+ <PIN_PC0__LCDDAT21>,
+ <PIN_PC1__LCDDAT22>,
+ <PIN_PC2__LCDDAT23>;
+ bias-disable;
+ };
+
+ pinctrl_sdmmc0_cmd_dat_default: sdmmc0_cmd_dat_default {
+ pinmux = <PIN_PA1__SDMMC0_CMD>,
+ <PIN_PA2__SDMMC0_DAT0>,
+ <PIN_PA3__SDMMC0_DAT1>,
+ <PIN_PA4__SDMMC0_DAT2>,
+ <PIN_PA5__SDMMC0_DAT3>,
+ <PIN_PA6__SDMMC0_DAT4>,
+ <PIN_PA7__SDMMC0_DAT5>,
+ <PIN_PA8__SDMMC0_DAT6>,
+ <PIN_PA9__SDMMC0_DAT7>;
+ bias-pull-up;
+ u-boot,dm-pre-reloc;
+ };
+
+ pinctrl_sdmmc0_ck_cd_default: sdmmc0_ck_cd_default {
+ pinmux = <PIN_PA0__SDMMC0_CK>,
+ <PIN_PA10__SDMMC0_RSTN>,
+ <PIN_PA13__SDMMC0_CD>;
+ bias-disable;
+ u-boot,dm-pre-reloc;
+ };
+
+ pinctrl_sdmmc1_cmd_dat_default: sdmmc1_cmd_dat_default {
+ pinmux = <PIN_PA28__SDMMC1_CMD>,
+ <PIN_PA18__SDMMC1_DAT0>,
+ <PIN_PA19__SDMMC1_DAT1>,
+ <PIN_PA20__SDMMC1_DAT2>,
+ <PIN_PA21__SDMMC1_DAT3>;
+ bias-pull-up;
+ u-boot,dm-pre-reloc;
+ };
+
+ pinctrl_sdmmc1_ck_cd_default: sdmmc1_ck_cd_default {
+ pinmux = <PIN_PA22__SDMMC1_CK>,
+ <PIN_PA30__SDMMC1_CD>;
+ bias-disable;
+ u-boot,dm-pre-reloc;
+ };
+
+ pinctrl_uart1_default: uart1_default {
+ pinmux = <PIN_PD2__URXD1>,
+ <PIN_PD3__UTXD1>;
+ bias-disable;
+ u-boot,dm-pre-reloc;
+ };
+
+ pinctrl_usb_default: usb_default {
+ pinmux = <PIN_PB10__GPIO>;
+ bias-disable;
+ };
+
+ pinctrl_usba_vbus: usba_vbus {
+ pinmux = <PIN_PA31__GPIO>;
+ bias-disable;
+ };
+ };
+ };
+ };
+ };
+};
pinctrl-names = "default";
pinctrl-0 = <&pinctrl_i2c1_default>;
status = "okay";
+
+ i2c_eeprom: i2c_eeprom@5c {
+ compatible = "atmel,24mac402";
+ reg = <0x5c>;
+ };
};
pioA: gpio@fc038000 {
i2c0: i2c@f8014000 {
status = "okay";
+
+ i2c_eeprom: i2c_eeprom@5c {
+ compatible = "atmel,24mac402";
+ reg = <0x5c>;
+ };
};
macb0: ethernet@f8020000 {
--- /dev/null
+/*
+ * Copyright (C) 2017 Texas Instruments Incorporated - http://www.ti.com/
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+
+#include <dt-bindings/gpio/gpio.h>
+#include <dt-bindings/clk/ti-dra7-atl.h>
+#include <dt-bindings/input/input.h>
+
+/ {
+ chosen {
+ stdout-path = &uart1;
+ };
+
+ extcon_usb1: extcon_usb1 {
+ compatible = "linux,extcon-usb-gpio";
+ id-gpio = <&pcf_gpio_21 1 GPIO_ACTIVE_HIGH>;
+ };
+
+ sound0: sound0 {
+ compatible = "simple-audio-card";
+ simple-audio-card,name = "DRA7xx-EVM";
+ simple-audio-card,widgets =
+ "Headphone", "Headphone Jack",
+ "Line", "Line Out",
+ "Microphone", "Mic Jack",
+ "Line", "Line In";
+ simple-audio-card,routing =
+ "Headphone Jack", "HPLOUT",
+ "Headphone Jack", "HPROUT",
+ "Line Out", "LLOUT",
+ "Line Out", "RLOUT",
+ "MIC3L", "Mic Jack",
+ "MIC3R", "Mic Jack",
+ "Mic Jack", "Mic Bias",
+ "LINE1L", "Line In",
+ "LINE1R", "Line In";
+ simple-audio-card,format = "dsp_b";
+ simple-audio-card,bitclock-master = <&sound0_master>;
+ simple-audio-card,frame-master = <&sound0_master>;
+ simple-audio-card,bitclock-inversion;
+
+ sound0_master: simple-audio-card,cpu {
+ sound-dai = <&mcasp3>;
+ system-clock-frequency = <5644800>;
+ };
+
+ simple-audio-card,codec {
+ sound-dai = <&tlv320aic3106>;
+ clocks = <&atl_clkin2_ck>;
+ };
+ };
+
+ leds {
+ compatible = "gpio-leds";
+ led0 {
+ label = "dra7:usr1";
+ gpios = <&pcf_lcd 4 GPIO_ACTIVE_LOW>;
+ default-state = "off";
+ };
+
+ led1 {
+ label = "dra7:usr2";
+ gpios = <&pcf_lcd 5 GPIO_ACTIVE_LOW>;
+ default-state = "off";
+ };
+
+ led2 {
+ label = "dra7:usr3";
+ gpios = <&pcf_lcd 6 GPIO_ACTIVE_LOW>;
+ default-state = "off";
+ };
+
+ led3 {
+ label = "dra7:usr4";
+ gpios = <&pcf_lcd 7 GPIO_ACTIVE_LOW>;
+ default-state = "off";
+ };
+ };
+
+ gpio_keys {
+ compatible = "gpio-keys";
+ #address-cells = <1>;
+ #size-cells = <0>;
+ autorepeat;
+
+ USER1 {
+ label = "btnUser1";
+ linux,code = <BTN_0>;
+ gpios = <&pcf_lcd 2 GPIO_ACTIVE_LOW>;
+ };
+
+ USER2 {
+ label = "btnUser2";
+ linux,code = <BTN_1>;
+ gpios = <&pcf_lcd 3 GPIO_ACTIVE_LOW>;
+ };
+ };
+};
+
+&i2c3 {
+ status = "okay";
+ clock-frequency = <400000>;
+};
+
+&mcspi1 {
+ status = "okay";
+};
+
+&mcspi2 {
+ status = "okay";
+};
+
+&uart1 {
+ status = "okay";
+ interrupts-extended = <&crossbar_mpu GIC_SPI 67 IRQ_TYPE_LEVEL_HIGH>,
+ <&dra7_pmx_core 0x3e0>;
+};
+
+&uart2 {
+ status = "okay";
+};
+
+&uart3 {
+ status = "okay";
+};
+
+&qspi {
+ status = "okay";
+
+ spi-max-frequency = <76800000>;
+ m25p80@0 {
+ compatible = "s25fl256s1";
+ spi-max-frequency = <76800000>;
+ reg = <0>;
+ spi-tx-bus-width = <1>;
+ spi-rx-bus-width = <4>;
+ #address-cells = <1>;
+ #size-cells = <1>;
+
+ /* MTD partition table.
+ * The ROM checks the first four physical blocks
+ * for a valid file to boot and the flash here is
+ * 64KiB block size.
+ */
+ partition@0 {
+ label = "QSPI.SPL";
+ reg = <0x00000000 0x000010000>;
+ };
+ partition@1 {
+ label = "QSPI.SPL.backup1";
+ reg = <0x00010000 0x00010000>;
+ };
+ partition@2 {
+ label = "QSPI.SPL.backup2";
+ reg = <0x00020000 0x00010000>;
+ };
+ partition@3 {
+ label = "QSPI.SPL.backup3";
+ reg = <0x00030000 0x00010000>;
+ };
+ partition@4 {
+ label = "QSPI.u-boot";
+ reg = <0x00040000 0x00100000>;
+ };
+ partition@5 {
+ label = "QSPI.u-boot-spl-os";
+ reg = <0x00140000 0x00080000>;
+ };
+ partition@6 {
+ label = "QSPI.u-boot-env";
+ reg = <0x001c0000 0x00010000>;
+ };
+ partition@7 {
+ label = "QSPI.u-boot-env.backup1";
+ reg = <0x001d0000 0x0010000>;
+ };
+ partition@8 {
+ label = "QSPI.kernel";
+ reg = <0x001e0000 0x0800000>;
+ };
+ partition@9 {
+ label = "QSPI.file-system";
+ reg = <0x009e0000 0x01620000>;
+ };
+ };
+};
+
+&omap_dwc3_1 {
+ extcon = <&extcon_usb1>;
+};
+
+&usb1 {
+ dr_mode = "otg";
+ extcon = <&extcon_usb1>;
+};
+
+&usb2 {
+ dr_mode = "host";
+};
+
+&atl {
+ assigned-clocks = <&abe_dpll_sys_clk_mux>,
+ <&atl_gfclk_mux>,
+ <&dpll_abe_ck>,
+ <&dpll_abe_m2x2_ck>,
+ <&atl_clkin2_ck>;
+ assigned-clock-parents = <&sys_clkin2>, <&dpll_abe_m2_ck>;
+ assigned-clock-rates = <0>, <0>, <180633600>, <361267200>, <5644800>;
+
+ status = "okay";
+
+ atl2 {
+ bws = <DRA7_ATL_WS_MCASP2_FSX>;
+ aws = <DRA7_ATL_WS_MCASP3_FSX>;
+ };
+};
+
+&mcasp3 {
+ #sound-dai-cells = <0>;
+
+ assigned-clocks = <&mcasp3_ahclkx_mux>;
+ assigned-clock-parents = <&atl_clkin2_ck>;
+
+ status = "okay";
+
+ op-mode = <0>; /* MCASP_IIS_MODE */
+ tdm-slots = <2>;
+ /* 4 serializer */
+ serial-dir = < /* 0: INACTIVE, 1: TX, 2: RX */
+ 1 2 0 0
+ >;
+ tx-num-evt = <32>;
+ rx-num-evt = <32>;
+};
+
+&mailbox5 {
+ status = "okay";
+ mbox_ipu1_ipc3x: mbox_ipu1_ipc3x {
+ status = "okay";
+ };
+ mbox_dsp1_ipc3x: mbox_dsp1_ipc3x {
+ status = "okay";
+ };
+};
+
+&mailbox6 {
+ status = "okay";
+ mbox_ipu2_ipc3x: mbox_ipu2_ipc3x {
+ status = "okay";
+ };
+ mbox_dsp2_ipc3x: mbox_dsp2_ipc3x {
+ status = "okay";
+ };
+};
--- /dev/null
+/*
+ * Copyright (C) 2017 Texas Instruments Incorporated - http://www.ti.com/
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include "omap5-u-boot.dtsi"
+
+&pcf_gpio_21{
+ u-boot,i2c-offset-len = <0>;
+};
+
+&pcf_hdmi{
+ u-boot,i2c-offset-len = <0>;
+};
/dts-v1/;
#include "dra74x.dtsi"
-#include <dt-bindings/gpio/gpio.h>
-#include <dt-bindings/clk/ti-dra7-atl.h>
-#include <dt-bindings/input/input.h>
+#include "dra7-evm-common.dtsi"
+#include "dra74x-mmc-iodelay.dtsi"
/ {
model = "TI DRA742";
compatible = "ti,dra7-evm", "ti,dra742", "ti,dra74", "ti,dra7";
- chosen {
- stdout-path = &uart1;
- tick-timer = &timer2;
- };
-
memory@0 {
device_type = "memory";
reg = <0x0 0x80000000 0x0 0x60000000>; /* 1536 MB */
};
+ evm_1v8_sw: fixedregulator-evm_1v8 {
+ compatible = "regulator-fixed";
+ regulator-name = "evm_1v8";
+ vin-supply = <&smps9_reg>;
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ };
+
evm_3v3_sd: fixedregulator-sd {
compatible = "regulator-fixed";
regulator-name = "evm_3v3_sd";
regulator-max-microvolt = <1800000>;
};
- extcon_usb1: extcon_usb1 {
- compatible = "linux,extcon-usb-gpio";
- id-gpio = <&pcf_gpio_21 1 GPIO_ACTIVE_HIGH>;
- };
-
extcon_usb2: extcon_usb2 {
compatible = "linux,extcon-usb-gpio";
id-gpio = <&pcf_gpio_21 2 GPIO_ACTIVE_HIGH>;
gpio = <&gpio7 11 GPIO_ACTIVE_HIGH>;
};
- sound0: sound0 {
- compatible = "simple-audio-card";
- simple-audio-card,name = "DRA7xx-EVM";
- simple-audio-card,widgets =
- "Headphone", "Headphone Jack",
- "Line", "Line Out",
- "Microphone", "Mic Jack",
- "Line", "Line In";
- simple-audio-card,routing =
- "Headphone Jack", "HPLOUT",
- "Headphone Jack", "HPROUT",
- "Line Out", "LLOUT",
- "Line Out", "RLOUT",
- "MIC3L", "Mic Jack",
- "MIC3R", "Mic Jack",
- "Mic Jack", "Mic Bias",
- "LINE1L", "Line In",
- "LINE1R", "Line In";
- simple-audio-card,format = "dsp_b";
- simple-audio-card,bitclock-master = <&sound0_master>;
- simple-audio-card,frame-master = <&sound0_master>;
- simple-audio-card,bitclock-inversion;
-
- sound0_master: simple-audio-card,cpu {
- sound-dai = <&mcasp3>;
- system-clock-frequency = <5644800>;
- };
-
- simple-audio-card,codec {
- sound-dai = <&tlv320aic3106>;
- clocks = <&atl_clkin2_ck>;
- };
- };
-
- leds {
- compatible = "gpio-leds";
- led0 {
- label = "dra7:usr1";
- gpios = <&pcf_lcd 4 GPIO_ACTIVE_LOW>;
- default-state = "off";
- };
-
- led1 {
- label = "dra7:usr2";
- gpios = <&pcf_lcd 5 GPIO_ACTIVE_LOW>;
- default-state = "off";
- };
-
- led2 {
- label = "dra7:usr3";
- gpios = <&pcf_lcd 6 GPIO_ACTIVE_LOW>;
- default-state = "off";
- };
-
- led3 {
- label = "dra7:usr4";
- gpios = <&pcf_lcd 7 GPIO_ACTIVE_LOW>;
- default-state = "off";
- };
- };
-
- gpio_keys {
- compatible = "gpio-keys";
- #address-cells = <1>;
- #size-cells = <0>;
- autorepeat;
-
- USER1 {
- label = "btnUser1";
- linux,code = <BTN_0>;
- gpios = <&pcf_lcd 2 GPIO_ACTIVE_LOW>;
- };
-
- USER2 {
- label = "btnUser2";
- linux,code = <BTN_1>;
- gpios = <&pcf_lcd 3 GPIO_ACTIVE_LOW>;
- };
- };
};
&dra7_pmx_core {
- pinctrl-names = "default";
- pinctrl-0 = <&vtt_pin>;
-
- vtt_pin: pinmux_vtt_pin {
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x37b4, PIN_OUTPUT | MUX_MODE14) /* spi1_cs1.gpio7_11 */
- >;
- };
-
- i2c1_pins: pinmux_i2c1_pins {
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x3800, PIN_INPUT | MUX_MODE0) /* i2c1_sda */
- DRA7XX_CORE_IOPAD(0x3804, PIN_INPUT | MUX_MODE0) /* i2c1_scl */
- >;
- };
-
- i2c2_pins: pinmux_i2c2_pins {
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x3808, PIN_INPUT | MUX_MODE0) /* i2c2_sda */
- DRA7XX_CORE_IOPAD(0x380c, PIN_INPUT | MUX_MODE0) /* i2c2_scl */
- >;
- };
-
- i2c3_pins: pinmux_i2c3_pins {
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x3688, PIN_INPUT | MUX_MODE9) /* gpio6_14.i2c3_sda */
- DRA7XX_CORE_IOPAD(0x368c, PIN_INPUT | MUX_MODE9) /* gpio6_15.i2c3_scl */
- >;
- };
-
- mcspi1_pins: pinmux_mcspi1_pins {
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x37a4, PIN_INPUT | MUX_MODE0) /* spi1_sclk */
- DRA7XX_CORE_IOPAD(0x37a8, PIN_INPUT | MUX_MODE0) /* spi1_d1 */
- DRA7XX_CORE_IOPAD(0x37ac, PIN_INPUT | MUX_MODE0) /* spi1_d0 */
- DRA7XX_CORE_IOPAD(0x37b0, PIN_INPUT_SLEW | MUX_MODE0) /* spi1_cs0 */
- DRA7XX_CORE_IOPAD(0x37b8, PIN_INPUT_SLEW | MUX_MODE6) /* spi1_cs2.hdmi1_hpd */
- DRA7XX_CORE_IOPAD(0x37bc, PIN_INPUT_SLEW | MUX_MODE6) /* spi1_cs3.hdmi1_cec */
- >;
- };
-
- mcspi2_pins: pinmux_mcspi2_pins {
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x37c0, PIN_INPUT | MUX_MODE0) /* spi2_sclk */
- DRA7XX_CORE_IOPAD(0x37c4, PIN_INPUT_SLEW | MUX_MODE0) /* spi2_d1 */
- DRA7XX_CORE_IOPAD(0x37c8, PIN_INPUT_SLEW | MUX_MODE0) /* spi2_d1 */
- DRA7XX_CORE_IOPAD(0x37cc, PIN_INPUT_SLEW | MUX_MODE0) /* spi2_cs0 */
- >;
- };
-
- uart1_pins: pinmux_uart1_pins {
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x37e0, PIN_INPUT_SLEW | MUX_MODE0) /* uart1_rxd */
- DRA7XX_CORE_IOPAD(0x37e4, PIN_INPUT_SLEW | MUX_MODE0) /* uart1_txd */
- DRA7XX_CORE_IOPAD(0x37e8, PIN_INPUT | MUX_MODE3) /* uart1_ctsn */
- DRA7XX_CORE_IOPAD(0x37ec, PIN_INPUT | MUX_MODE3) /* uart1_rtsn */
- >;
- };
-
- uart2_pins: pinmux_uart2_pins {
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x37f0, PIN_INPUT | MUX_MODE0) /* uart2_rxd */
- DRA7XX_CORE_IOPAD(0x37f4, PIN_INPUT | MUX_MODE0) /* uart2_txd */
- DRA7XX_CORE_IOPAD(0x37f8, PIN_INPUT | MUX_MODE0) /* uart2_ctsn */
- DRA7XX_CORE_IOPAD(0x37fc, PIN_INPUT | MUX_MODE0) /* uart2_rtsn */
- >;
- };
-
- uart3_pins: pinmux_uart3_pins {
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x3648, PIN_INPUT_SLEW | MUX_MODE0) /* uart3_rxd */
- DRA7XX_CORE_IOPAD(0x364c, PIN_INPUT_SLEW | MUX_MODE0) /* uart3_txd */
- >;
- };
-
- usb1_pins: pinmux_usb1_pins {
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x3680, PIN_INPUT_SLEW | MUX_MODE0) /* usb1_drvvbus */
- >;
- };
-
- usb2_pins: pinmux_usb2_pins {
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x3684, PIN_INPUT_SLEW | MUX_MODE0) /* usb2_drvvbus */
- >;
- };
-
- nand_flash_x16: nand_flash_x16 {
- /* On DRA7 EVM, GPMC_WPN and NAND_BOOTn comes from DIP switch
- * So NAND flash requires following switch settings:
- * SW5.1 (NAND_BOOTn) = ON (LOW)
- * SW5.9 (GPMC_WPN) = OFF (HIGH)
- */
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x3400, PIN_INPUT | MUX_MODE0) /* gpmc_ad0 */
- DRA7XX_CORE_IOPAD(0x3404, PIN_INPUT | MUX_MODE0) /* gpmc_ad1 */
- DRA7XX_CORE_IOPAD(0x3408, PIN_INPUT | MUX_MODE0) /* gpmc_ad2 */
- DRA7XX_CORE_IOPAD(0x340c, PIN_INPUT | MUX_MODE0) /* gpmc_ad3 */
- DRA7XX_CORE_IOPAD(0x3410, PIN_INPUT | MUX_MODE0) /* gpmc_ad4 */
- DRA7XX_CORE_IOPAD(0x3414, PIN_INPUT | MUX_MODE0) /* gpmc_ad5 */
- DRA7XX_CORE_IOPAD(0x3418, PIN_INPUT | MUX_MODE0) /* gpmc_ad6 */
- DRA7XX_CORE_IOPAD(0x341c, PIN_INPUT | MUX_MODE0) /* gpmc_ad7 */
- DRA7XX_CORE_IOPAD(0x3420, PIN_INPUT | MUX_MODE0) /* gpmc_ad8 */
- DRA7XX_CORE_IOPAD(0x3424, PIN_INPUT | MUX_MODE0) /* gpmc_ad9 */
- DRA7XX_CORE_IOPAD(0x3428, PIN_INPUT | MUX_MODE0) /* gpmc_ad10 */
- DRA7XX_CORE_IOPAD(0x342c, PIN_INPUT | MUX_MODE0) /* gpmc_ad11 */
- DRA7XX_CORE_IOPAD(0x3430, PIN_INPUT | MUX_MODE0) /* gpmc_ad12 */
- DRA7XX_CORE_IOPAD(0x3434, PIN_INPUT | MUX_MODE0) /* gpmc_ad13 */
- DRA7XX_CORE_IOPAD(0x3438, PIN_INPUT | MUX_MODE0) /* gpmc_ad14 */
- DRA7XX_CORE_IOPAD(0x343c, PIN_INPUT | MUX_MODE0) /* gpmc_ad15 */
- DRA7XX_CORE_IOPAD(0x34d8, PIN_INPUT_PULLUP | MUX_MODE0) /* gpmc_wait0 */
- DRA7XX_CORE_IOPAD(0x34cc, PIN_OUTPUT | MUX_MODE0) /* gpmc_wen */
- DRA7XX_CORE_IOPAD(0x34b4, PIN_OUTPUT_PULLUP | MUX_MODE0) /* gpmc_csn0 */
- DRA7XX_CORE_IOPAD(0x34c4, PIN_OUTPUT | MUX_MODE0) /* gpmc_advn_ale */
- DRA7XX_CORE_IOPAD(0x34c8, PIN_OUTPUT | MUX_MODE0) /* gpmc_oen_ren */
- DRA7XX_CORE_IOPAD(0x34d0, PIN_OUTPUT | MUX_MODE0) /* gpmc_be0n_cle */
- >;
- };
-
- cpsw_default: cpsw_default {
- pinctrl-single,pins = <
- /* Slave 1 */
- DRA7XX_CORE_IOPAD(0x3650, PIN_OUTPUT | MUX_MODE0) /* rgmii0_txc.rgmii0_txc */
- DRA7XX_CORE_IOPAD(0x3654, PIN_OUTPUT | MUX_MODE0) /* rgmii0_txctl.rgmii0_txctl */
- DRA7XX_CORE_IOPAD(0x3658, PIN_OUTPUT | MUX_MODE0) /* rgmii0_td3.rgmii0_txd3 */
- DRA7XX_CORE_IOPAD(0x365c, PIN_OUTPUT | MUX_MODE0) /* rgmii0_txd2.rgmii0_txd2 */
- DRA7XX_CORE_IOPAD(0x3660, PIN_OUTPUT | MUX_MODE0) /* rgmii0_txd1.rgmii0_txd1 */
- DRA7XX_CORE_IOPAD(0x3664, PIN_OUTPUT | MUX_MODE0) /* rgmii0_txd0.rgmii0_txd0 */
- DRA7XX_CORE_IOPAD(0x3668, PIN_INPUT | MUX_MODE0) /* rgmii0_rxc.rgmii0_rxc */
- DRA7XX_CORE_IOPAD(0x366c, PIN_INPUT | MUX_MODE0) /* rgmii0_rxctl.rgmii0_rxctl */
- DRA7XX_CORE_IOPAD(0x3670, PIN_INPUT | MUX_MODE0) /* rgmii0_rxd3.rgmii0_rxd3 */
- DRA7XX_CORE_IOPAD(0x3674, PIN_INPUT | MUX_MODE0) /* rgmii0_rxd2.rgmii0_rxd2 */
- DRA7XX_CORE_IOPAD(0x3678, PIN_INPUT | MUX_MODE0) /* rgmii0_rxd1.rgmii0_rxd1 */
- DRA7XX_CORE_IOPAD(0x367c, PIN_INPUT | MUX_MODE0) /* rgmii0_rxd0.rgmii0_rxd0 */
-
- /* Slave 2 */
- DRA7XX_CORE_IOPAD(0x3598, PIN_OUTPUT | MUX_MODE3) /* vin2a_d12.rgmii1_txc */
- DRA7XX_CORE_IOPAD(0x359c, PIN_OUTPUT | MUX_MODE3) /* vin2a_d13.rgmii1_tctl */
- DRA7XX_CORE_IOPAD(0x35a0, PIN_OUTPUT | MUX_MODE3) /* vin2a_d14.rgmii1_td3 */
- DRA7XX_CORE_IOPAD(0x35a4, PIN_OUTPUT | MUX_MODE3) /* vin2a_d15.rgmii1_td2 */
- DRA7XX_CORE_IOPAD(0x35a8, PIN_OUTPUT | MUX_MODE3) /* vin2a_d16.rgmii1_td1 */
- DRA7XX_CORE_IOPAD(0x35ac, PIN_OUTPUT | MUX_MODE3) /* vin2a_d17.rgmii1_td0 */
- DRA7XX_CORE_IOPAD(0x35b0, PIN_INPUT | MUX_MODE3) /* vin2a_d18.rgmii1_rclk */
- DRA7XX_CORE_IOPAD(0x35b4, PIN_INPUT | MUX_MODE3) /* vin2a_d19.rgmii1_rctl */
- DRA7XX_CORE_IOPAD(0x35b8, PIN_INPUT | MUX_MODE3) /* vin2a_d20.rgmii1_rd3 */
- DRA7XX_CORE_IOPAD(0x35bc, PIN_INPUT | MUX_MODE3) /* vin2a_d21.rgmii1_rd2 */
- DRA7XX_CORE_IOPAD(0x35c0, PIN_INPUT | MUX_MODE3) /* vin2a_d22.rgmii1_rd1 */
- DRA7XX_CORE_IOPAD(0x35c4, PIN_INPUT | MUX_MODE3) /* vin2a_d23.rgmii1_rd0 */
- >;
-
- };
-
- cpsw_sleep: cpsw_sleep {
- pinctrl-single,pins = <
- /* Slave 1 */
- DRA7XX_CORE_IOPAD(0x3650, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x3654, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x3658, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x365c, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x3660, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x3664, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x3668, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x366c, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x3670, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x3674, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x3678, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x367c, MUX_MODE15)
-
- /* Slave 2 */
- DRA7XX_CORE_IOPAD(0x3598, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x359c, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x35a0, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x35a4, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x35a8, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x35ac, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x35b0, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x35b4, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x35b8, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x35bc, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x35c0, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x35c4, MUX_MODE15)
- >;
- };
-
- davinci_mdio_default: davinci_mdio_default {
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x363c, PIN_OUTPUT_PULLUP | MUX_MODE0) /* mdio_d.mdio_d */
- DRA7XX_CORE_IOPAD(0x3640, PIN_INPUT_PULLUP | MUX_MODE0) /* mdio_clk.mdio_clk */
- >;
- };
-
- davinci_mdio_sleep: davinci_mdio_sleep {
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x363c, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x3640, MUX_MODE15)
- >;
- };
-
dcan1_pins_default: dcan1_pins_default {
pinctrl-single,pins = <
DRA7XX_CORE_IOPAD(0x37d0, PIN_OUTPUT_PULLUP | MUX_MODE0) /* dcan1_tx */
>;
};
- atl_pins: pinmux_atl_pins {
- pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x3698, PIN_OUTPUT | MUX_MODE5) /* xref_clk1.atl_clk1 */
- DRA7XX_CORE_IOPAD(0x369c, PIN_OUTPUT | MUX_MODE5) /* xref_clk2.atl_clk2 */
- >;
- };
-
- mcasp3_pins: pinmux_mcasp3_pins {
+ mmc1_pins_default: mmc1_pins_default {
pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x3724, PIN_OUTPUT_PULLDOWN | MUX_MODE0) /* mcasp3_aclkx */
- DRA7XX_CORE_IOPAD(0x3728, PIN_OUTPUT_PULLDOWN | MUX_MODE0) /* mcasp3_fsx */
- DRA7XX_CORE_IOPAD(0x372c, PIN_OUTPUT_PULLDOWN | MUX_MODE0) /* mcasp3_axr0 */
- DRA7XX_CORE_IOPAD(0x3730, PIN_INPUT_PULLDOWN | MUX_MODE0) /* mcasp3_axr1 */
+ DRA7XX_CORE_IOPAD(0x376c, PIN_INPUT | MUX_MODE14) /* mmc1sdcd.gpio219 */
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat3.dat3 */
>;
};
- mcasp3_sleep_pins: pinmux_mcasp3_sleep_pins {
+ mmc2_pins_default: mmc2_pins_default {
pinctrl-single,pins = <
- DRA7XX_CORE_IOPAD(0x3724, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x3728, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x372c, MUX_MODE15)
- DRA7XX_CORE_IOPAD(0x3730, MUX_MODE15)
+ DRA7XX_CORE_IOPAD(0x349c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a23.mmc2_clk */
+ DRA7XX_CORE_IOPAD(0x34b0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_cs1.mmc2_cmd */
+ DRA7XX_CORE_IOPAD(0x34a0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a24.mmc2_dat0 */
+ DRA7XX_CORE_IOPAD(0x34a4, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a25.mmc2_dat1 */
+ DRA7XX_CORE_IOPAD(0x34a8, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a26.mmc2_dat2 */
+ DRA7XX_CORE_IOPAD(0x34ac, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a27.mmc2_dat3 */
+ DRA7XX_CORE_IOPAD(0x348c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a19.mmc2_dat4 */
+ DRA7XX_CORE_IOPAD(0x3490, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a20.mmc2_dat5 */
+ DRA7XX_CORE_IOPAD(0x3494, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a21.mmc2_dat6 */
+ DRA7XX_CORE_IOPAD(0x3498, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a22.mmc2_dat7 */
>;
};
};
&i2c1 {
status = "okay";
- pinctrl-names = "default";
- pinctrl-0 = <&i2c1_pins>;
clock-frequency = <400000>;
tps659038: tps659038@58 {
compatible = "ti,tps659038";
reg = <0x58>;
+ ti,palmas-override-powerhold;
+ ti,system-power-controller;
tps659038_pmic {
compatible = "ti,tps659038-pmic";
interrupts = <11 IRQ_TYPE_EDGE_FALLING>;
interrupt-controller;
#interrupt-cells = <2>;
- u-boot,i2c-offset-len = <0>;
};
tlv320aic3106: tlv320aic3106@19 {
&i2c2 {
status = "okay";
- pinctrl-names = "default";
- pinctrl-0 = <&i2c2_pins>;
clock-frequency = <400000>;
pcf_hdmi: gpio@26 {
};
};
-&i2c3 {
- status = "okay";
- pinctrl-names = "default";
- pinctrl-0 = <&i2c3_pins>;
- clock-frequency = <400000>;
-};
-
-&mcspi1 {
- status = "okay";
- pinctrl-names = "default";
- pinctrl-0 = <&mcspi1_pins>;
-};
-
-&mcspi2 {
- status = "okay";
- pinctrl-names = "default";
- pinctrl-0 = <&mcspi2_pins>;
-};
-
-&uart1 {
- status = "okay";
- pinctrl-names = "default";
- pinctrl-0 = <&uart1_pins>;
- interrupts-extended = <&crossbar_mpu GIC_SPI 67 IRQ_TYPE_LEVEL_HIGH>,
- <&dra7_pmx_core 0x3e0>;
-};
-
-&uart2 {
- status = "okay";
- pinctrl-names = "default";
- pinctrl-0 = <&uart2_pins>;
-};
-
-&uart3 {
- status = "okay";
- pinctrl-names = "default";
- pinctrl-0 = <&uart3_pins>;
-};
-
&mmc1 {
status = "okay";
vmmc-supply = <&evm_3v3_sd>;
- vmmc_aux-supply = <&ldo1_reg>;
+ vqmmc-supply = <&ldo1_reg>;
bus-width = <4>;
/*
* SDCD signal is not being used here - using the fact that GPIO mode
* is always hardwired.
*/
cd-gpios = <&gpio6 27 GPIO_ACTIVE_LOW>;
+ pinctrl-names = "default", "hs", "sdr12", "sdr25", "sdr50", "ddr50-rev11", "sdr104-rev11", "ddr50", "sdr104";
+ pinctrl-0 = <&mmc1_pins_default>;
+ pinctrl-1 = <&mmc1_pins_hs>;
+ pinctrl-2 = <&mmc1_pins_sdr12>;
+ pinctrl-3 = <&mmc1_pins_sdr25>;
+ pinctrl-4 = <&mmc1_pins_sdr50>;
+ pinctrl-5 = <&mmc1_pins_ddr50 &mmc1_iodelay_ddr_rev11_conf>;
+ pinctrl-6 = <&mmc1_pins_sdr104 &mmc1_iodelay_sdr104_rev11_conf>;
+ pinctrl-7 = <&mmc1_pins_ddr50 &mmc1_iodelay_ddr_rev20_conf>;
+ pinctrl-8 = <&mmc1_pins_sdr104 &mmc1_iodelay_sdr104_rev20_conf>;
};
&mmc2 {
status = "okay";
- vmmc-supply = <&evm_3v3_sw>;
+ vmmc-supply = <&evm_1v8_sw>;
bus-width = <8>;
+ pinctrl-names = "default", "hs", "ddr_1_8v-rev11", "ddr_1_8v", "hs200_1_8v-rev11", "hs200_1_8v";
+ pinctrl-0 = <&mmc2_pins_default>;
+ pinctrl-1 = <&mmc2_pins_hs>;
+ pinctrl-2 = <&mmc2_pins_ddr_1_8v_rev11 &mmc2_iodelay_ddr_1_8v_rev11_conf>;
+ pinctrl-3 = <&mmc2_pins_ddr_rev20>;
+ pinctrl-4 = <&mmc2_pins_hs200 &mmc2_iodelay_hs200_rev11_conf>;
+ pinctrl-5 = <&mmc2_pins_hs200 &mmc2_iodelay_hs200_rev20_conf>;
};
&cpu0 {
cpu0-supply = <&smps123_reg>;
};
-&qspi {
- status = "okay";
-
- spi-max-frequency = <76800000>;
- m25p80@0 {
- compatible = "s25fl256s1", "spi-flash";
- spi-max-frequency = <76800000>;
- reg = <0>;
- spi-tx-bus-width = <1>;
- spi-rx-bus-width = <4>;
- #address-cells = <1>;
- #size-cells = <1>;
-
- /* MTD partition table.
- * The ROM checks the first four physical blocks
- * for a valid file to boot and the flash here is
- * 64KiB block size.
- */
- partition@0 {
- label = "QSPI.SPL";
- reg = <0x00000000 0x000010000>;
- };
- partition@1 {
- label = "QSPI.SPL.backup1";
- reg = <0x00010000 0x00010000>;
- };
- partition@2 {
- label = "QSPI.SPL.backup2";
- reg = <0x00020000 0x00010000>;
- };
- partition@3 {
- label = "QSPI.SPL.backup3";
- reg = <0x00030000 0x00010000>;
- };
- partition@4 {
- label = "QSPI.u-boot";
- reg = <0x00040000 0x00100000>;
- };
- partition@5 {
- label = "QSPI.u-boot-spl-os";
- reg = <0x00140000 0x00080000>;
- };
- partition@6 {
- label = "QSPI.u-boot-env";
- reg = <0x001c0000 0x00010000>;
- };
- partition@7 {
- label = "QSPI.u-boot-env.backup1";
- reg = <0x001d0000 0x0010000>;
- };
- partition@8 {
- label = "QSPI.kernel";
- reg = <0x001e0000 0x0800000>;
- };
- partition@9 {
- label = "QSPI.file-system";
- reg = <0x009e0000 0x01620000>;
- };
- };
-};
-
-&omap_dwc3_1 {
- extcon = <&extcon_usb1>;
-};
-
&omap_dwc3_2 {
extcon = <&extcon_usb2>;
};
-&usb1 {
- dr_mode = "peripheral";
- pinctrl-names = "default";
- pinctrl-0 = <&usb1_pins>;
-};
-
-&usb2 {
- dr_mode = "host";
- pinctrl-names = "default";
- pinctrl-0 = <&usb2_pins>;
-};
-
&elm {
status = "okay";
};
&gpmc {
- status = "okay";
- pinctrl-names = "default";
- pinctrl-0 = <&nand_flash_x16>;
+ /*
+ * For the existing IOdelay configuration via U-Boot we don't
+ * support NAND on dra7-evm. Keep it disabled. Enabling it
+ * requires a different configuration by U-Boot.
+ */
+ status = "disabled";
ranges = <0 0 0x08000000 0x01000000>; /* minimum GPMC partition = 16MB */
nand@0,0 {
compatible = "ti,omap2-nand";
interrupts = <0 IRQ_TYPE_NONE>, /* fifoevent */
<1 IRQ_TYPE_NONE>; /* termcount */
rb-gpios = <&gpmc 0 GPIO_ACTIVE_HIGH>; /* gpmc_wait0 pin */
+ ti,nand-xfer-type = "prefetch-dma";
ti,nand-ecc-opt = "bch8";
ti,elm-id = <&elm>;
nand-bus-width = <16>;
&mac {
status = "okay";
- pinctrl-names = "default", "sleep";
- pinctrl-0 = <&cpsw_default>;
- pinctrl-1 = <&cpsw_sleep>;
dual_emac;
};
dual_emac_res_vlan = <2>;
};
-&davinci_mdio {
- pinctrl-names = "default", "sleep";
- pinctrl-0 = <&davinci_mdio_default>;
- pinctrl-1 = <&davinci_mdio_sleep>;
-};
-
&dcan1 {
status = "ok";
pinctrl-names = "default", "sleep", "active";
pinctrl-2 = <&dcan1_pins_default>;
};
-&atl {
- pinctrl-names = "default";
- pinctrl-0 = <&atl_pins>;
-
- assigned-clocks = <&abe_dpll_sys_clk_mux>,
- <&atl_gfclk_mux>,
- <&dpll_abe_ck>,
- <&dpll_abe_m2x2_ck>,
- <&atl_clkin2_ck>;
- assigned-clock-parents = <&sys_clkin2>, <&dpll_abe_m2_ck>;
- assigned-clock-rates = <0>, <0>, <180633600>, <361267200>, <5644800>;
-
+&pcie1_rc {
status = "okay";
-
- atl2 {
- bws = <DRA7_ATL_WS_MCASP2_FSX>;
- aws = <DRA7_ATL_WS_MCASP3_FSX>;
- };
-};
-
-&mcasp3 {
- #sound-dai-cells = <0>;
- pinctrl-names = "default", "sleep";
- pinctrl-0 = <&mcasp3_pins>;
- pinctrl-1 = <&mcasp3_sleep_pins>;
-
- assigned-clocks = <&mcasp3_ahclkx_mux>;
- assigned-clock-parents = <&atl_clkin2_ck>;
-
- status = "okay";
-
- op-mode = <0>; /* MCASP_IIS_MODE */
- tdm-slots = <2>;
- /* 4 serializer */
- serial-dir = < /* 0: INACTIVE, 1: TX, 2: RX */
- 1 2 0 0
- >;
- tx-num-evt = <32>;
- rx-num-evt = <32>;
-};
-
-&mailbox5 {
- status = "okay";
- mbox_ipu1_ipc3x: mbox_ipu1_ipc3x {
- status = "okay";
- };
- mbox_dsp1_ipc3x: mbox_dsp1_ipc3x {
- status = "okay";
- };
-};
-
-&mailbox6 {
- status = "okay";
- mbox_ipu2_ipc3x: mbox_ipu2_ipc3x {
- status = "okay";
- };
- mbox_dsp2_ipc3x: mbox_dsp2_ipc3x {
- status = "okay";
- };
};
compatible = "ti,dra7xx";
interrupt-parent = <&crossbar_mpu>;
+ chosen { };
aliases {
i2c0 = &i2c1;
interrupt-controller;
#interrupt-cells = <3>;
reg = <0x0 0x48211000 0x0 0x1000>,
- <0x0 0x48212000 0x0 0x1000>,
+ <0x0 0x48212000 0x0 0x2000>,
<0x0 0x48214000 0x0 0x2000>,
<0x0 0x48216000 0x0 0x2000>;
interrupts = <GIC_PPI 9 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_HIGH)>;
compatible = "arm,cortex-a15";
reg = <0>;
- operating-points = <
- /* kHz uV */
- 1000000 1060000
- 1176000 1160000
- >;
+ operating-points-v2 = <&cpu0_opp_table>;
clocks = <&dpll_mpu_ck>;
clock-names = "cpu";
};
};
+ cpu0_opp_table: opp-table {
+ compatible = "operating-points-v2-ti-cpu";
+ syscon = <&scm_wkup>;
+
+ opp_nom-1000000000 {
+ opp-hz = /bits/ 64 <1000000000>;
+ opp-microvolt = <1060000 850000 1150000>;
+ opp-supported-hw = <0xFF 0x01>;
+ opp-suspend;
+ };
+
+ opp_od-1176000000 {
+ opp-hz = /bits/ 64 <1176000000>;
+ opp-microvolt = <1160000 885000 1160000>;
+ opp-supported-hw = <0xFF 0x02>;
+ };
+ };
+
/*
* The soc node represents the soc top level view. It is used for IPs
* that are not memory mapped in the MPU view or for the MPU itself.
reg = <0x1400 0x0468>;
#address-cells = <1>;
#size-cells = <0>;
+ #pinctrl-cells = <1>;
#interrupt-cells = <1>;
interrupt-controller;
pinctrl-single,register-width = <32>;
scm_conf1: scm_conf@1c04 {
compatible = "syscon";
reg = <0x1c04 0x0020>;
+ #syscon-cells = <2>;
};
scm_conf_pcie: scm_conf@1c24 {
#address-cells = <1>;
ranges = <0x51000000 0x51000000 0x3000
0x0 0x20000000 0x10000000>;
- pcie1: pcie@51000000 {
+ /**
+ * To enable PCI endpoint mode, disable the pcie1_rc
+ * node and enable pcie1_ep mode.
+ */
+ pcie1_rc: pcie@51000000 {
compatible = "ti,dra7-pcie";
reg = <0x51000000 0x2000>, <0x51002000 0x14c>, <0x1000 0x2000>;
reg-names = "rc_dbics", "ti_conf", "config";
device_type = "pci";
ranges = <0x81000000 0 0 0x03000 0 0x00010000
0x82000000 0 0x20013000 0x13000 0 0xffed000>;
+ bus-range = <0x00 0xff>;
#interrupt-cells = <1>;
num-lanes = <1>;
linux,pci-domain = <0>;
<0 0 0 2 &pcie1_intc 2>,
<0 0 0 3 &pcie1_intc 3>,
<0 0 0 4 &pcie1_intc 4>;
+ status = "disabled";
pcie1_intc: interrupt-controller {
interrupt-controller;
#address-cells = <0>;
#interrupt-cells = <1>;
};
};
+
+ pcie1_ep: pcie_ep@51000000 {
+ compatible = "ti,dra7-pcie-ep";
+ reg = <0x51000000 0x28>, <0x51002000 0x14c>, <0x51001000 0x28>, <0x1000 0x10000000>;
+ reg-names = "ep_dbics", "ti_conf", "ep_dbics2", "addr_space";
+ interrupts = <0 232 0x4>;
+ num-lanes = <1>;
+ num-ib-windows = <4>;
+ num-ob-windows = <16>;
+ ti,hwmods = "pcie1";
+ phys = <&pcie1_phy>;
+ phy-names = "pcie-phy0";
+ ti,syscon-unaligned-access = <&scm_conf1 0x14 2>;
+ status = "disabled";
+ };
};
axi@1 {
device_type = "pci";
ranges = <0x81000000 0 0 0x03000 0 0x00010000
0x82000000 0 0x30013000 0x13000 0 0xffed000>;
+ bus-range = <0x00 0xff>;
#interrupt-cells = <1>;
num-lanes = <1>;
linux,pci-domain = <1>;
reg = <0x40d00000 0x100>;
};
+ dra7_iodelay_core: padconf@4844a000 {
+ compatible = "ti,dra7-iodelay";
+ reg = <0x4844a000 0x0d1c>;
+ #address-cells = <1>;
+ #size-cells = <0>;
+ #pinctrl-cells = <2>;
+ };
+
sdma: dma-controller@4a056000 {
compatible = "ti,omap4430-sdma";
reg = <0x4a056000 0x1000>;
uart1: serial@4806a000 {
compatible = "ti,dra742-uart", "ti,omap4-uart";
reg = <0x4806a000 0x100>;
- reg-shift = <2>;
interrupts-extended = <&crossbar_mpu GIC_SPI 67 IRQ_TYPE_LEVEL_HIGH>;
ti,hwmods = "uart1";
clock-frequency = <48000000>;
uart2: serial@4806c000 {
compatible = "ti,dra742-uart", "ti,omap4-uart";
reg = <0x4806c000 0x100>;
- reg-shift = <2>;
interrupts = <GIC_SPI 68 IRQ_TYPE_LEVEL_HIGH>;
ti,hwmods = "uart2";
clock-frequency = <48000000>;
uart3: serial@48020000 {
compatible = "ti,dra742-uart", "ti,omap4-uart";
reg = <0x48020000 0x100>;
- reg-shift = <2>;
interrupts = <GIC_SPI 69 IRQ_TYPE_LEVEL_HIGH>;
ti,hwmods = "uart3";
clock-frequency = <48000000>;
uart4: serial@4806e000 {
compatible = "ti,dra742-uart", "ti,omap4-uart";
reg = <0x4806e000 0x100>;
- reg-shift = <2>;
interrupts = <GIC_SPI 65 IRQ_TYPE_LEVEL_HIGH>;
ti,hwmods = "uart4";
clock-frequency = <48000000>;
uart5: serial@48066000 {
compatible = "ti,dra742-uart", "ti,omap4-uart";
reg = <0x48066000 0x100>;
- reg-shift = <2>;
interrupts = <GIC_SPI 100 IRQ_TYPE_LEVEL_HIGH>;
ti,hwmods = "uart5";
clock-frequency = <48000000>;
uart6: serial@48068000 {
compatible = "ti,dra742-uart", "ti,omap4-uart";
reg = <0x48068000 0x100>;
- reg-shift = <2>;
interrupts = <GIC_SPI 101 IRQ_TYPE_LEVEL_HIGH>;
ti,hwmods = "uart6";
clock-frequency = <48000000>;
uart7: serial@48420000 {
compatible = "ti,dra742-uart", "ti,omap4-uart";
reg = <0x48420000 0x100>;
- reg-shift = <2>;
interrupts = <GIC_SPI 218 IRQ_TYPE_LEVEL_HIGH>;
ti,hwmods = "uart7";
clock-frequency = <48000000>;
uart8: serial@48422000 {
compatible = "ti,dra742-uart", "ti,omap4-uart";
reg = <0x48422000 0x100>;
- reg-shift = <2>;
interrupts = <GIC_SPI 219 IRQ_TYPE_LEVEL_HIGH>;
ti,hwmods = "uart8";
clock-frequency = <48000000>;
uart9: serial@48424000 {
compatible = "ti,dra742-uart", "ti,omap4-uart";
reg = <0x48424000 0x100>;
- reg-shift = <2>;
interrupts = <GIC_SPI 220 IRQ_TYPE_LEVEL_HIGH>;
ti,hwmods = "uart9";
clock-frequency = <48000000>;
uart10: serial@4ae2b000 {
compatible = "ti,dra742-uart", "ti,omap4-uart";
reg = <0x4ae2b000 0x100>;
- reg-shift = <2>;
interrupts = <GIC_SPI 221 IRQ_TYPE_LEVEL_HIGH>;
ti,hwmods = "uart10";
clock-frequency = <48000000>;
dma-names = "tx", "rx";
status = "disabled";
pbias-supply = <&pbias_mmc_reg>;
+ max-frequency = <192000000>;
};
mmc2: mmc@480b4000 {
dmas = <&sdma_xbar 47>, <&sdma_xbar 48>;
dma-names = "tx", "rx";
status = "disabled";
+ max-frequency = <192000000>;
};
mmc3: mmc@480ad000 {
dmas = <&sdma_xbar 77>, <&sdma_xbar 78>;
dma-names = "tx", "rx";
status = "disabled";
+ /* Errata i887 limits max-frequency of MMC3 to 64 MHz */
+ max-frequency = <64000000>;
};
mmc4: mmc@480d1000 {
dmas = <&sdma_xbar 57>, <&sdma_xbar 58>;
dma-names = "tx", "rx";
status = "disabled";
+ max-frequency = <192000000>;
};
mmu0_dsp1: mmu@40d01000 {
phy-names = "sata-phy";
clocks = <&sata_ref_clk>;
ti,hwmods = "sata";
+ ports-implemented = <0x1>;
};
rtc: rtc@48838000 {
cpdma_channels = <8>;
ale_entries = <1024>;
bd_ram_size = <0x2000>;
- no_bd_ram = <0>;
mac_control = <0x20>;
slaves = <2>;
active_slave = <0>;
cpts_clock_mult = <0x784CFE14>;
cpts_clock_shift = <29>;
- syscon = <&scm_conf>;
reg = <0x48484000 0x1000
0x48485200 0x2E00>;
#address-cells = <1>;
<GIC_SPI 336 IRQ_TYPE_LEVEL_HIGH>,
<GIC_SPI 337 IRQ_TYPE_LEVEL_HIGH>;
ranges;
+ syscon = <&scm_conf>;
status = "disabled";
davinci_mdio: mdio@48485000 {
&cpu_thermal {
polling-delay = <500>; /* milliseconds */
+ coefficients = <0 2000>;
+};
+
+&gpu_thermal {
+ coefficients = <0 2000>;
+};
+
+&core_thermal {
+ coefficients = <0 2000>;
+};
+
+&dspeve_thermal {
+ coefficients = <0 2000>;
+};
+
+&iva_thermal {
+ coefficients = <0 2000>;
+};
+
+&cpu_crit {
+ temperature = <120000>; /* milli Celsius */
};
/include/ "dra7xx-clocks.dtsi"
--- /dev/null
+/*
+ * Copyright (C) 2017 Texas Instruments Incorporated - http://www.ti.com/
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include "omap5-u-boot.dtsi"
+
+&pcf_gpio_21{
+ u-boot,i2c-offset-len = <0>;
+};
+
+&pcf_hdmi{
+ u-boot,i2c-offset-len = <0>;
+};
+
+&cpsw_emac0 {
+ phy-handle = <&dp83867_0>;
+};
+
+&cpsw_emac1 {
+ phy-handle = <&dp83867_1>;
+};
*/
#include "dra72-evm-common.dtsi"
+#include "dra72x-mmc-iodelay.dtsi"
#include <dt-bindings/net/ti-dp83867.h>
/ {
3000000 0x1>;
};
+ evm_1v8_sw: fixedregulator-evm_1v8 {
+ compatible = "regulator-fixed";
+ regulator-name = "evm_1v8";
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ vin-supply = <&lp8732_buck0_reg>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
poweroff: gpio-poweroff {
compatible = "gpio-poweroff";
gpios = <&gpio7 30 GPIO_ACTIVE_HIGH>;
};
};
+&pcf_lcd {
+ interrupt-parent = <&gpio7>;
+ interrupts = <31 IRQ_TYPE_EDGE_FALLING>;
+};
+
&pcf_gpio_21 {
interrupt-parent = <&gpio7>;
interrupts = <31 IRQ_TYPE_EDGE_FALLING>;
};
&mmc1 {
- vmmc_aux-supply = <&vpo_sd_1v8_3v3>;
+ pinctrl-names = "default", "hs", "sdr12", "sdr25", "sdr50", "ddr50", "sdr104";
+ pinctrl-0 = <&mmc1_pins_default>;
+ pinctrl-1 = <&mmc1_pins_hs>;
+ pinctrl-2 = <&mmc1_pins_sdr12>;
+ pinctrl-3 = <&mmc1_pins_sdr25>;
+ pinctrl-4 = <&mmc1_pins_sdr50>;
+ pinctrl-5 = <&mmc1_pins_ddr50_rev20 &mmc1_iodelay_ddr50_conf>;
+ pinctrl-6 = <&mmc1_pins_sdr104 &mmc1_iodelay_sdr104_rev20_conf>;
+ vqmmc-supply = <&vpo_sd_1v8_3v3>;
+};
+
+&mmc2 {
+ pinctrl-names = "default", "hs", "ddr_1_8v", "hs200_1_8v";
+ pinctrl-0 = <&mmc2_pins_default>;
+ pinctrl-1 = <&mmc2_pins_hs>;
+ pinctrl-2 = <&mmc2_pins_ddr_rev20 &mmc2_iodelay_ddr_conf>;
+ pinctrl-3 = <&mmc2_pins_hs200 &mmc2_iodelay_hs200_rev20_conf>;
+ vmmc-supply = <&evm_1v8_sw>;
};
&mac {
};
&cpsw_emac0 {
- phy-handle = <&dp83867_0>;
+ phy_id = <&davinci_mdio>, <2>;
phy-mode = "rgmii-id";
dual_emac_res_vlan = <1>;
};
&cpsw_emac1 {
- phy-handle = <&dp83867_1>;
+ phy_id = <&davinci_mdio>, <3>;
phy-mode = "rgmii-id";
dual_emac_res_vlan = <2>;
};
ti,rx-internal-delay = <DP83867_RGMIIDCTL_2_25_NS>;
ti,tx-internal-delay = <DP83867_RGMIIDCTL_250_PS>;
ti,fifo-depth = <DP83867_PHYCR_FIFO_DEPTH_8_B_NIB>;
- ti,impedance-control = <0x1f>;
+ ti,min-output-impedance;
+ ti,dp83867-rxctrl-strap-quirk;
};
dp83867_1: ethernet-phy@3 {
ti,rx-internal-delay = <DP83867_RGMIIDCTL_2_25_NS>;
ti,tx-internal-delay = <DP83867_RGMIIDCTL_250_PS>;
ti,fifo-depth = <DP83867_PHYCR_FIFO_DEPTH_8_B_NIB>;
- ti,impedance-control = <0x1f>;
+ ti,min-output-impedance;
+ ti,dp83867-rxctrl-strap-quirk;
};
};
chosen {
stdout-path = &uart1;
- tick-timer = &timer2;
};
evm_12v0: fixedregulator-evm12v0 {
status = "okay";
clock-frequency = <400000>;
+ pcf_lcd: gpio@20 {
+ compatible = "nxp,pcf8575";
+ reg = <0x20>;
+ gpio-controller;
+ #gpio-cells = <2>;
+ interrupt-controller;
+ #interrupt-cells = <2>;
+ };
+
pcf_gpio_21: gpio@21 {
compatible = "ti,pcf8575", "nxp,pcf8575";
- u-boot,i2c-offset-len = <0>;
reg = <0x21>;
lines-initial-states = <0x1408>;
gpio-controller;
pcf_hdmi: pcf8575@26 {
compatible = "ti,pcf8575", "nxp,pcf8575";
- u-boot,i2c-offset-len = <0>;
reg = <0x26>;
gpio-controller;
#gpio-cells = <2>;
};
&gpmc {
- status = "okay";
+ /*
+ * For the existing IOdelay configuration via U-Boot we don't
+ * support NAND on dra72-evm. Keep it disabled. Enabling it
+ * requires a different configuration by U-Boot.
+ */
+ status = "disabled";
ranges = <0 0 0x08000000 0x01000000>; /* minimum GPMC partition = 16MB */
nand@0,0 {
/* To use NAND, DIP switch SW5 must be set like so:
interrupts = <0 IRQ_TYPE_NONE>, /* fifoevent */
<1 IRQ_TYPE_NONE>; /* termcount */
rb-gpios = <&gpmc 0 GPIO_ACTIVE_HIGH>; /* gpmc_wait0 pin */
+ ti,nand-xfer-type = "prefetch-dma";
ti,nand-ecc-opt = "bch8";
ti,elm-id = <&elm>;
nand-bus-width = <16>;
};
&usb1 {
- dr_mode = "peripheral";
+ dr_mode = "otg";
+ extcon = <&extcon_usb1>;
};
&usb2 {
status = "okay";
pinctrl-names = "default";
pinctrl-0 = <&mmc2_pins_default>;
-
- vmmc-supply = <&evm_3v3_sw>;
bus-width = <8>;
ti,non-removable;
max-frequency = <192000000>;
spi-max-frequency = <76800000>;
m25p80@0 {
- compatible = "s25fl256s1", "spi-flash";
+ compatible = "s25fl256s1";
spi-max-frequency = <76800000>;
reg = <0>;
spi-tx-bus-width = <1>;
status = "okay";
};
};
+
+&pcie1_rc {
+ status = "okay";
+};
--- /dev/null
+/*
+ * Copyright (C) 2017 Texas Instruments Incorporated - http://www.ti.com/
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include "omap5-u-boot.dtsi"
+
+&pcf_gpio_21{
+ u-boot,i2c-offset-len = <0>;
+};
+
+&pcf_hdmi{
+ u-boot,i2c-offset-len = <0>;
+};
+
+&cpsw_emac0 {
+ phy-handle = <&dp83867_0>;
+};
+
+&cpsw_emac1 {
+ phy-handle = <&dp83867_1>;
+};
* published by the Free Software Foundation.
*/
#include "dra72-evm-common.dtsi"
+#include "dra72x-mmc-iodelay.dtsi"
#include <dt-bindings/net/ti-dp83867.h>
/ {
device_type = "memory";
reg = <0x0 0x80000000 0x0 0x80000000>; /* 2GB */
};
+
+ evm_1v8_sw: fixedregulator-evm_1v8 {
+ compatible = "regulator-fixed";
+ regulator-name = "evm_1v8";
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ vin-supply = <&smps4_reg>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
};
&i2c1 {
};
&cpsw_emac0 {
- phy-handle = <&dp83867_0>;
+ phy_id = <&davinci_mdio>, <2>;
phy-mode = "rgmii-id";
dual_emac_res_vlan = <1>;
};
&cpsw_emac1 {
- phy-handle = <&dp83867_1>;
+ phy_id = <&davinci_mdio>, <3>;
phy-mode = "rgmii-id";
dual_emac_res_vlan = <2>;
};
ti,tx-internal-delay = <DP83867_RGMIIDCTL_250_PS>;
ti,fifo-depth = <DP83867_PHYCR_FIFO_DEPTH_8_B_NIB>;
ti,min-output-impedance;
+ interrupt-parent = <&gpio6>;
+ interrupts = <16 IRQ_TYPE_EDGE_FALLING>;
+ ti,dp83867-rxctrl-strap-quirk;
};
dp83867_1: ethernet-phy@3 {
ti,tx-internal-delay = <DP83867_RGMIIDCTL_250_PS>;
ti,fifo-depth = <DP83867_PHYCR_FIFO_DEPTH_8_B_NIB>;
ti,min-output-impedance;
+ interrupt-parent = <&gpio6>;
+ interrupts = <16 IRQ_TYPE_EDGE_FALLING>;
+ ti,dp83867-rxctrl-strap-quirk;
};
};
+
+&mmc1 {
+ pinctrl-names = "default", "hs", "sdr12", "sdr25", "sdr50", "ddr50", "sdr104";
+ pinctrl-0 = <&mmc1_pins_default>;
+ pinctrl-1 = <&mmc1_pins_hs>;
+ pinctrl-2 = <&mmc1_pins_sdr12>;
+ pinctrl-3 = <&mmc1_pins_sdr25>;
+ pinctrl-4 = <&mmc1_pins_sdr50>;
+ pinctrl-5 = <&mmc1_pins_ddr50_rev20 &mmc1_iodelay_ddr50_conf>;
+ pinctrl-6 = <&mmc1_pins_sdr104 &mmc1_iodelay_sdr104_rev20_conf>;
+ vqmmc-supply = <&ldo1_reg>;
+};
+
+&mmc2 {
+ pinctrl-names = "default", "hs", "ddr_1_8v", "hs200_1_8v";
+ pinctrl-0 = <&mmc2_pins_default>;
+ pinctrl-1 = <&mmc2_pins_hs>;
+ pinctrl-2 = <&mmc2_pins_ddr_rev20 &mmc2_iodelay_ddr_conf>;
+ pinctrl-3 = <&mmc2_pins_hs200 &mmc2_iodelay_hs200_rev20_conf>;
+ vmmc-supply = <&evm_1v8_sw>;
+};
ti,palmas-long-press-seconds = <6>;
};
};
+
+&usb2_phy1 {
+ phy-supply = <&ldo4_reg>;
+};
+
+&usb2_phy2 {
+ phy-supply = <&ldo4_reg>;
+};
+
+&dss {
+ vdda_video-supply = <&ldo5_reg>;
+};
+
+&mmc1 {
+ vqmmc-supply = <&ldo1_reg>;
+};
* published by the Free Software Foundation.
*/
#include "dra72-evm-common.dtsi"
+#include "dra72x-mmc-iodelay.dtsi"
/ {
model = "TI DRA722";
device_type = "memory";
reg = <0x0 0x80000000 0x0 0x40000000>; /* 1024 MB */
};
+
+ evm_1v8_sw: fixedregulator-evm_1v8 {
+ compatible = "regulator-fixed";
+ regulator-name = "evm_1v8";
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ vin-supply = <&smps4_reg>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
};
&i2c1 {
phy_id = <&davinci_mdio>, <3>;
phy-mode = "rgmii";
};
+
+&mmc1 {
+ pinctrl-names = "default", "hs", "sdr12", "sdr25", "sdr50", "ddr50", "sdr104";
+ pinctrl-0 = <&mmc1_pins_default>;
+ pinctrl-1 = <&mmc1_pins_hs>;
+ pinctrl-2 = <&mmc1_pins_sdr12>;
+ pinctrl-3 = <&mmc1_pins_sdr25>;
+ pinctrl-4 = <&mmc1_pins_sdr50>;
+ pinctrl-5 = <&mmc1_pins_ddr50_rev10>;
+ pinctrl-6 = <&mmc1_pins_sdr104 &mmc1_iodelay_sdr104_rev10_conf>;
+ vqmmc-supply = <&ldo1_reg>;
+};
+
+&mmc2 {
+ pinctrl-names = "default", "hs", "ddr_1_8v", "hs200_1_8v";
+ pinctrl-0 = <&mmc2_pins_default>;
+ pinctrl-1 = <&mmc2_pins_hs>;
+ pinctrl-2 = <&mmc2_pins_ddr_rev10>;
+ pinctrl-3 = <&mmc2_pins_hs200 &mmc2_iodelay_hs200_rev10_conf>;
+ vmmc-supply = <&evm_1v8_sw>;
+};
--- /dev/null
+/*
+ * MMC IOdelay values for TI's DRA72x, DRA71x and AM571x SoCs.
+ *
+ * Copyright (C) 2017 Texas Instruments Incorporated - http://www.ti.com/
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation version 2.
+ *
+ * This program is distributed "as is" WITHOUT ANY WARRANTY of any
+ * kind, whether express or implied; without even the implied warranty
+ * of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ */
+
+/*
+ * Rules for modifying this file:
+ * a) Update of this file should typically correspond to a datamanual revision.
+ * Datamanual revision that was used should be updated in comment below.
+ * If there is no update to datamanual, do not update the values. If you
+ * need to use values different from that recommended by the datamanual
+ * for your design, then you should consider adding values to the device-
+ * -tree file for your board directly.
+ * b) We keep the mode names as close to the datamanual as possible. So
+ * if the manual calls a mode, DDR50, or DDR or DDR 1.8v or DDR 3.3v,
+ * we follow that in code too.
+ * c) If the values change between multiple revisions of silicon, we add
+ * a revision tag to both the new and old entry. Use 'rev10' for PG 1.0,
+ * 'rev20' for PG 2.0 and so on.
+ * d) The node name and node label should be the exact same string. This is
+ * to curb naming creativity and achieve consistency.
+ * e) If in future, DRA71x and DRA72x values differ, then add 'dra71_' and
+ * 'dra72_' tag to entries. Both the new and old entries should gain a tag.
+ *
+ * Datamanual Revisions:
+ *
+ * AM571x Silicon Revision 2.0: SPRS957D, Revised January 2017
+ * AM571x Silicon Revision 1.0: SPRS919M, Revised November 2017
+ * DRA71x : SPRS960B, Revised February 2017
+ */
+
+&dra7_pmx_core {
+ mmc1_pins_default: mmc1_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat3.dat3 */
+ >;
+ };
+
+ mmc1_pins_sdr12: mmc1_pins_sdr12 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat3.dat3 */
+ >;
+ };
+
+ mmc1_pins_hs: mmc1_pins_hs {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat3.dat3 */
+ >;
+ };
+
+ mmc1_pins_sdr25: mmc1_pins_sdr25 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat3.dat3 */
+ >;
+ };
+
+ mmc1_pins_sdr50: mmc1_pins_sdr50 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE15 | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE15 | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE15 | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE15 | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE15 | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE15 | MUX_MODE0) /* mmc1_dat3.dat3 */
+ >;
+ };
+
+ mmc1_pins_ddr50_rev10: mmc1_pins_ddr50_rev10 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE14 | MUX_MODE0) /* mmc1_clk.mmc1_clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE14 | MUX_MODE0) /* mmc1_cmd.mmc1_cmd */
+ DRA7XX_CORE_IOPAD(0x375C, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE14 | MUX_MODE0) /* mmc1_dat0.mmc1_dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE14 | MUX_MODE0) /* mmc1_dat1.mmc1_dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE14 | MUX_MODE0) /* mmc1_dat2.mmc1_dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE14 | MUX_MODE0) /* mmc1_dat3.mmc1_dat3 */
+ >;
+ };
+
+ mmc1_pins_ddr50_rev20: mmc1_pins_ddr50_rev20 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_dat3.dat3 */
+ >;
+ };
+
+ mmc1_pins_sdr104: mmc1_pins_sdr104 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_dat3.dat3 */
+ >;
+ };
+
+ mmc2_pins_default: mmc2_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x349c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a23.mmc2_clk */
+ DRA7XX_CORE_IOPAD(0x34b0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_cs1.mmc2_cmd */
+ DRA7XX_CORE_IOPAD(0x34a0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a24.mmc2_dat0 */
+ DRA7XX_CORE_IOPAD(0x34a4, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a25.mmc2_dat1 */
+ DRA7XX_CORE_IOPAD(0x34a8, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a26.mmc2_dat2 */
+ DRA7XX_CORE_IOPAD(0x34ac, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a27.mmc2_dat3 */
+ DRA7XX_CORE_IOPAD(0x348c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a19.mmc2_dat4 */
+ DRA7XX_CORE_IOPAD(0x3490, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a20.mmc2_dat5 */
+ DRA7XX_CORE_IOPAD(0x3494, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a21.mmc2_dat6 */
+ DRA7XX_CORE_IOPAD(0x3498, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a22.mmc2_dat7 */
+ >;
+ };
+
+ mmc2_pins_hs: mmc2_pins_hs {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x349c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a23.mmc2_clk */
+ DRA7XX_CORE_IOPAD(0x34b0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_cs1.mmc2_cmd */
+ DRA7XX_CORE_IOPAD(0x34a0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a24.mmc2_dat0 */
+ DRA7XX_CORE_IOPAD(0x34a4, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a25.mmc2_dat1 */
+ DRA7XX_CORE_IOPAD(0x34a8, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a26.mmc2_dat2 */
+ DRA7XX_CORE_IOPAD(0x34ac, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a27.mmc2_dat3 */
+ DRA7XX_CORE_IOPAD(0x348c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a19.mmc2_dat4 */
+ DRA7XX_CORE_IOPAD(0x3490, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a20.mmc2_dat5 */
+ DRA7XX_CORE_IOPAD(0x3494, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a21.mmc2_dat6 */
+ DRA7XX_CORE_IOPAD(0x3498, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a22.mmc2_dat7 */
+ >;
+ };
+
+ mmc2_pins_ddr_rev10: mmc2_pins_ddr_rev10 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x348c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a19.mmc2_dat4 */
+ DRA7XX_CORE_IOPAD(0x3490, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a20.mmc2_dat5 */
+ DRA7XX_CORE_IOPAD(0x3494, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a21.mmc2_dat6 */
+ DRA7XX_CORE_IOPAD(0x3498, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a22.mmc2_dat7 */
+ DRA7XX_CORE_IOPAD(0x349c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a23.mmc2_clk */
+ DRA7XX_CORE_IOPAD(0x34a0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a24.mmc2_dat0 */
+ DRA7XX_CORE_IOPAD(0x34a4, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a25.mmc2_dat1 */
+ DRA7XX_CORE_IOPAD(0x34a8, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a26.mmc2_dat2 */
+ DRA7XX_CORE_IOPAD(0x34ac, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a27.mmc2_dat3 */
+ DRA7XX_CORE_IOPAD(0x34b0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_cs1.mmc2_cmd */
+ >;
+ };
+
+ mmc2_pins_ddr_rev20: mmc2_pins_ddr_rev20 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x349c, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a23.mmc2_clk */
+ DRA7XX_CORE_IOPAD(0x34b0, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_cs1.mmc2_cmd */
+ DRA7XX_CORE_IOPAD(0x34a0, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a24.mmc2_dat0 */
+ DRA7XX_CORE_IOPAD(0x34a4, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a25.mmc2_dat1 */
+ DRA7XX_CORE_IOPAD(0x34a8, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a26.mmc2_dat2 */
+ DRA7XX_CORE_IOPAD(0x34ac, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a27.mmc2_dat3 */
+ DRA7XX_CORE_IOPAD(0x348c, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a19.mmc2_dat4 */
+ DRA7XX_CORE_IOPAD(0x3490, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a20.mmc2_dat5 */
+ DRA7XX_CORE_IOPAD(0x3494, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a21.mmc2_dat6 */
+ DRA7XX_CORE_IOPAD(0x3498, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a22.mmc2_dat7 */
+ >;
+ };
+
+ mmc2_pins_hs200: mmc2_pins_hs200 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x349c, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a23.mmc2_clk */
+ DRA7XX_CORE_IOPAD(0x34b0, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_cs1.mmc2_cmd */
+ DRA7XX_CORE_IOPAD(0x34a0, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a24.mmc2_dat0 */
+ DRA7XX_CORE_IOPAD(0x34a4, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a25.mmc2_dat1 */
+ DRA7XX_CORE_IOPAD(0x34a8, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a26.mmc2_dat2 */
+ DRA7XX_CORE_IOPAD(0x34ac, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a27.mmc2_dat3 */
+ DRA7XX_CORE_IOPAD(0x348c, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a19.mmc2_dat4 */
+ DRA7XX_CORE_IOPAD(0x3490, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a20.mmc2_dat5 */
+ DRA7XX_CORE_IOPAD(0x3494, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a21.mmc2_dat6 */
+ DRA7XX_CORE_IOPAD(0x3498, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a22.mmc2_dat7 */
+ >;
+ };
+};
+
+&dra7_iodelay_core {
+
+ /* Corresponds to MMC1_MANUAL1 in datamanual */
+ mmc1_iodelay_ddr50_conf: mmc1_iodelay_ddr50_conf {
+ pinctrl-pin-array = <
+ 0x618 A_DELAY_PS(588) G_DELAY_PS(0) /* CFG_MMC1_CLK_IN */
+ 0x624 A_DELAY_PS(1000) G_DELAY_PS(0) /* CFG_MMC1_CMD_IN */
+ 0x630 A_DELAY_PS(1375) G_DELAY_PS(0) /* CFG_MMC1_DAT0_IN */
+ 0x63C A_DELAY_PS(1000) G_DELAY_PS(0) /* CFG_MMC1_DAT1_IN */
+ 0x648 A_DELAY_PS(1000) G_DELAY_PS(0) /* CFG_MMC1_DAT2_IN */
+ 0x654 A_DELAY_PS(1000) G_DELAY_PS(0) /* CFG_MMC1_DAT3_IN */
+ 0x620 A_DELAY_PS(1230) G_DELAY_PS(0) /* CFG_MMC1_CLK_OUT */
+ 0x62C A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_CMD_OUT */
+ 0x638 A_DELAY_PS(56) G_DELAY_PS(0) /* CFG_MMC1_DAT0_OUT */
+ 0x644 A_DELAY_PS(76) G_DELAY_PS(0) /* CFG_MMC1_DAT1_OUT */
+ 0x650 A_DELAY_PS(91) G_DELAY_PS(0) /* CFG_MMC1_DAT2_OUT */
+ 0x65C A_DELAY_PS(99) G_DELAY_PS(0) /* CFG_MMC1_DAT3_OUT */
+ 0x628 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_CMD_OEN */
+ 0x634 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT0_OEN */
+ 0x640 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT1_OEN */
+ 0x64C A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT2_OEN */
+ 0x658 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT3_OEN */
+ >;
+ };
+
+ /* Corresponds to MMC1_MANUAL2 in datamanual */
+ mmc1_iodelay_sdr104_rev10_conf: mmc1_iodelay_sdr104_rev10_conf {
+ pinctrl-pin-array = <
+ 0x620 A_DELAY_PS(560) G_DELAY_PS(365) /* CFG_MMC1_CLK_OUT */
+ 0x62c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_CMD_OUT */
+ 0x638 A_DELAY_PS(29) G_DELAY_PS(0) /* CFG_MMC1_DAT0_OUT */
+ 0x644 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT1_OUT */
+ 0x650 A_DELAY_PS(47) G_DELAY_PS(0) /* CFG_MMC1_DAT2_OUT */
+ 0x65c A_DELAY_PS(30) G_DELAY_PS(0) /* CFG_MMC1_DAT3_OUT */
+ 0x628 A_DELAY_PS(125) G_DELAY_PS(0) /* CFG_MMC1_CMD_OEN */
+ 0x634 A_DELAY_PS(43) G_DELAY_PS(0) /* CFG_MMC1_DAT0_OEN */
+ 0x640 A_DELAY_PS(433) G_DELAY_PS(0) /* CFG_MMC1_DAT1_OEN */
+ 0x64c A_DELAY_PS(287) G_DELAY_PS(0) /* CFG_MMC1_DAT2_OEN */
+ 0x658 A_DELAY_PS(351) G_DELAY_PS(0) /* CFG_MMC1_DAT3_OEN */
+ >;
+ };
+
+ /* Corresponds to MMC1_MANUAL2 in datamanual */
+ mmc1_iodelay_sdr104_rev20_conf: mmc1_iodelay_sdr104_rev20_conf {
+ pinctrl-pin-array = <
+ 0x620 A_DELAY_PS(520) G_DELAY_PS(320) /* CFG_MMC1_CLK_OUT */
+ 0x62c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_CMD_OUT */
+ 0x638 A_DELAY_PS(40) G_DELAY_PS(0) /* CFG_MMC1_DAT0_OUT */
+ 0x644 A_DELAY_PS(83) G_DELAY_PS(0) /* CFG_MMC1_DAT1_OUT */
+ 0x650 A_DELAY_PS(98) G_DELAY_PS(0) /* CFG_MMC1_DAT2_OUT */
+ 0x65c A_DELAY_PS(106) G_DELAY_PS(0) /* CFG_MMC1_DAT3_OUT */
+ 0x628 A_DELAY_PS(51) G_DELAY_PS(0) /* CFG_MMC1_CMD_OEN */
+ 0x634 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT0_OEN */
+ 0x640 A_DELAY_PS(363) G_DELAY_PS(0) /* CFG_MMC1_DAT1_OEN */
+ 0x64c A_DELAY_PS(199) G_DELAY_PS(0) /* CFG_MMC1_DAT2_OEN */
+ 0x658 A_DELAY_PS(273) G_DELAY_PS(0) /* CFG_MMC1_DAT3_OEN */
+ >;
+ };
+
+ /* Corresponds to MMC2_MANUAL1 in datamanual */
+ mmc2_iodelay_ddr_conf: mmc2_iodelay_ddr_conf {
+ pinctrl-pin-array = <
+ 0x18c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A19_IN */
+ 0x1a4 A_DELAY_PS(119) G_DELAY_PS(0) /* CFG_GPMC_A20_IN */
+ 0x1b0 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A21_IN */
+ 0x1bc A_DELAY_PS(18) G_DELAY_PS(0) /* CFG_GPMC_A22_IN */
+ 0x1c8 A_DELAY_PS(894) G_DELAY_PS(0) /* CFG_GPMC_A23_IN */
+ 0x1d4 A_DELAY_PS(30) G_DELAY_PS(0) /* CFG_GPMC_A24_IN */
+ 0x1e0 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A25_IN */
+ 0x1ec A_DELAY_PS(23) G_DELAY_PS(0) /* CFG_GPMC_A26_IN */
+ 0x1f8 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A27_IN */
+ 0x360 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_CS1_IN */
+ 0x194 A_DELAY_PS(152) G_DELAY_PS(0) /* CFG_GPMC_A19_OUT */
+ 0x1ac A_DELAY_PS(206) G_DELAY_PS(0) /* CFG_GPMC_A20_OUT */
+ 0x1b8 A_DELAY_PS(78) G_DELAY_PS(0) /* CFG_GPMC_A21_OUT */
+ 0x1c4 A_DELAY_PS(2) G_DELAY_PS(0) /* CFG_GPMC_A22_OUT */
+ 0x1d0 A_DELAY_PS(266) G_DELAY_PS(0) /* CFG_GPMC_A23_OUT */
+ 0x1dc A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A24_OUT */
+ 0x1e8 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A25_OUT */
+ 0x1f4 A_DELAY_PS(43) G_DELAY_PS(0) /* CFG_GPMC_A26_OUT */
+ 0x200 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A27_OUT */
+ 0x368 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_CS1_OUT */
+ 0x190 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A19_OEN */
+ 0x1a8 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A20_OEN */
+ 0x1b4 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A21_OEN */
+ 0x1c0 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A22_OEN */
+ 0x1d8 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A24_OEN */
+ 0x1e4 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A25_OEN */
+ 0x1f0 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A26_OEN */
+ 0x1fc A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A27_OEN */
+ 0x364 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_CS1_OEN */
+ >;
+ };
+
+ /* Corresponds to MMC2_MANUAL3 in datamanual */
+ mmc2_iodelay_hs200_rev10_conf: mmc2_iodelay_hs200_rev10_conf {
+ pinctrl-pin-array = <
+ 0x194 A_DELAY_PS(150) G_DELAY_PS(95) /* CFG_GPMC_A19_OUT */
+ 0x1ac A_DELAY_PS(250) G_DELAY_PS(0) /* CFG_GPMC_A20_OUT */
+ 0x1b8 A_DELAY_PS(125) G_DELAY_PS(0) /* CFG_GPMC_A21_OUT */
+ 0x1c4 A_DELAY_PS(100) G_DELAY_PS(0) /* CFG_GPMC_A22_OUT */
+ 0x1d0 A_DELAY_PS(870) G_DELAY_PS(415) /* CFG_GPMC_A23_OUT */
+ 0x1dc A_DELAY_PS(30) G_DELAY_PS(0) /* CFG_GPMC_A24_OUT */
+ 0x1e8 A_DELAY_PS(200) G_DELAY_PS(0) /* CFG_GPMC_A25_OUT */
+ 0x1f4 A_DELAY_PS(200) G_DELAY_PS(0) /* CFG_GPMC_A26_OUT */
+ 0x200 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A27_OUT */
+ 0x368 A_DELAY_PS(240) G_DELAY_PS(0) /* CFG_GPMC_CS1_OUT */
+ 0x190 A_DELAY_PS(695) G_DELAY_PS(0) /* CFG_GPMC_A19_OEN */
+ 0x1a8 A_DELAY_PS(924) G_DELAY_PS(0) /* CFG_GPMC_A20_OEN */
+ 0x1b4 A_DELAY_PS(719) G_DELAY_PS(0) /* CFG_GPMC_A21_OEN */
+ 0x1c0 A_DELAY_PS(824) G_DELAY_PS(0) /* CFG_GPMC_A22_OEN */
+ 0x1d8 A_DELAY_PS(877) G_DELAY_PS(0) /* CFG_GPMC_A24_OEN */
+ 0x1e4 A_DELAY_PS(446) G_DELAY_PS(0) /* CFG_GPMC_A25_OEN */
+ 0x1f0 A_DELAY_PS(847) G_DELAY_PS(0) /* CFG_GPMC_A26_OEN */
+ 0x1fc A_DELAY_PS(586) G_DELAY_PS(0) /* CFG_GPMC_A27_OEN */
+ 0x364 A_DELAY_PS(1039) G_DELAY_PS(0) /* CFG_GPMC_CS1_OEN */
+ >;
+ };
+
+ /* Corresponds to MMC2_MANUAL3 in datamanual */
+ mmc2_iodelay_hs200_rev20_conf: mmc2_iodelay_hs200_rev20_conf {
+ pinctrl-pin-array = <
+ 0x194 A_DELAY_PS(285) G_DELAY_PS(0) /* CFG_GPMC_A19_OUT */
+ 0x1ac A_DELAY_PS(189) G_DELAY_PS(0) /* CFG_GPMC_A20_OUT */
+ 0x1b8 A_DELAY_PS(0) G_DELAY_PS(120) /* CFG_GPMC_A21_OUT */
+ 0x1c4 A_DELAY_PS(0) G_DELAY_PS(70) /* CFG_GPMC_A22_OUT */
+ 0x1d0 A_DELAY_PS(730) G_DELAY_PS(360) /* CFG_GPMC_A23_OUT */
+ 0x1dc A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A24_OUT */
+ 0x1e8 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A25_OUT */
+ 0x1f4 A_DELAY_PS(70) G_DELAY_PS(0) /* CFG_GPMC_A26_OUT */
+ 0x200 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A27_OUT */
+ 0x368 A_DELAY_PS(0) G_DELAY_PS(120) /* CFG_GPMC_CS1_OUT */
+ 0x190 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A19_OEN */
+ 0x1a8 A_DELAY_PS(231) G_DELAY_PS(0) /* CFG_GPMC_A20_OEN */
+ 0x1b4 A_DELAY_PS(39) G_DELAY_PS(0) /* CFG_GPMC_A21_OEN */
+ 0x1c0 A_DELAY_PS(91) G_DELAY_PS(0) /* CFG_GPMC_A22_OEN */
+ 0x1d8 A_DELAY_PS(176) G_DELAY_PS(0) /* CFG_GPMC_A24_OEN */
+ 0x1e4 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A25_OEN */
+ 0x1f0 A_DELAY_PS(101) G_DELAY_PS(0) /* CFG_GPMC_A26_OEN */
+ 0x1fc A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A27_OEN */
+ 0x364 A_DELAY_PS(360) G_DELAY_PS(0) /* CFG_GPMC_CS1_OEN */
+ >;
+ };
+};
/ {
compatible = "ti,dra722", "ti,dra72", "ti,dra7";
- cpus {
- #address-cells = <1>;
- #size-cells = <0>;
-
- cpu0: cpu@0 {
- device_type = "cpu";
- compatible = "arm,cortex-a15";
- reg = <0>;
-
- /* cooling options */
- cooling-min-level = <0>;
- cooling-max-level = <2>;
- #cooling-cells = <2>; /* min followed by max */
- };
- };
-
pmu {
compatible = "arm,cortex-a15-pmu";
interrupt-parent = <&wakeupgen>;
<&dss_video1_clk>;
clock-names = "fck", "video1_clk";
};
+
+&mailbox5 {
+ mbox_ipu1_ipc3x: mbox_ipu1_ipc3x {
+ ti,mbox-tx = <6 2 2>;
+ ti,mbox-rx = <4 2 2>;
+ status = "disabled";
+ };
+ mbox_dsp1_ipc3x: mbox_dsp1_ipc3x {
+ ti,mbox-tx = <5 2 2>;
+ ti,mbox-rx = <1 2 2>;
+ status = "disabled";
+ };
+};
+
+&mailbox6 {
+ mbox_ipu2_ipc3x: mbox_ipu2_ipc3x {
+ ti,mbox-tx = <6 2 2>;
+ ti,mbox-rx = <4 2 2>;
+ status = "disabled";
+ };
+};
--- /dev/null
+/*
+ * MMC IOdelay values for TI's DRA74x, DRA75x and AM572x SoCs.
+ *
+ * Copyright (C) 2017 Texas Instruments Incorporated - http://www.ti.com/
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation version 2.
+ *
+ * This program is distributed "as is" WITHOUT ANY WARRANTY of any
+ * kind, whether express or implied; without even the implied warranty
+ * of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ */
+
+/*
+ * Rules for modifying this file:
+ * a) Update of this file should typically correspond to a datamanual revision.
+ * Datamanual revision that was used should be updated in comment below.
+ * If there is no update to datamanual, do not update the values. If you
+ * need to use values different from that recommended by the datamanual
+ * for your design, then you should consider adding values to the device-
+ * -tree file for your board directly.
+ * b) We keep the mode names as close to the datamanual as possible. So
+ * if the manual calls a mode, DDR50, or DDR or DDR 1.8v or DDR 3.3v,
+ * we follow that in code too.
+ * c) If the values change between multiple revisions of silicon, we add
+ * a revision tag to both the new and old entry. Use 'rev11' for PG 1.1,
+ * 'rev20' for PG 2.0 and so on.
+ * d) The node name and node label should be the exact same string. This is
+ * to curb naming creativity and achieve consistency.
+ *
+ * Datamanual Revisions:
+ *
+ * AM572x Silicon Revision 2.0: SPRS953B, Revised November 2016
+ * AM572x Silicon Revision 1.1: SPRS915R, Revised November 2016
+ *
+ */
+
+&dra7_pmx_core {
+ mmc1_pins_default: mmc1_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat3.dat3 */
+ >;
+ };
+
+ mmc1_pins_sdr12: mmc1_pins_sdr12 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat3.dat3 */
+ >;
+ };
+
+ mmc1_pins_hs: mmc1_pins_hs {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE11 | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE11 | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE11 | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE11 | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE11 | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE11 | MUX_MODE0) /* mmc1_dat3.dat3 */
+ >;
+ };
+
+ mmc1_pins_sdr25: mmc1_pins_sdr25 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE11 | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE11 | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE11 | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE11 | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE11 | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE11 | MUX_MODE0) /* mmc1_dat3.dat3 */
+ >;
+ };
+
+ mmc1_pins_sdr50: mmc1_pins_sdr50 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE10 | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE10 | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE10 | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE10 | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE10 | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MUX_VIRTUAL_MODE10 | MUX_MODE0) /* mmc1_dat3.dat3 */
+ >;
+ };
+
+ mmc1_pins_ddr50: mmc1_pins_ddr50 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_dat3.dat3 */
+ >;
+ };
+
+ mmc1_pins_sdr104: mmc1_pins_sdr104 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0) /* mmc1_dat3.dat3 */
+ >;
+ };
+
+ mmc2_pins_default: mmc2_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x349c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a23.mmc2_clk */
+ DRA7XX_CORE_IOPAD(0x34b0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_cs1.mmc2_cmd */
+ DRA7XX_CORE_IOPAD(0x34a0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a24.mmc2_dat0 */
+ DRA7XX_CORE_IOPAD(0x34a4, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a25.mmc2_dat1 */
+ DRA7XX_CORE_IOPAD(0x34a8, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a26.mmc2_dat2 */
+ DRA7XX_CORE_IOPAD(0x34ac, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a27.mmc2_dat3 */
+ DRA7XX_CORE_IOPAD(0x348c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a19.mmc2_dat4 */
+ DRA7XX_CORE_IOPAD(0x3490, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a20.mmc2_dat5 */
+ DRA7XX_CORE_IOPAD(0x3494, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a21.mmc2_dat6 */
+ DRA7XX_CORE_IOPAD(0x3498, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a22.mmc2_dat7 */
+ >;
+ };
+
+ mmc2_pins_hs: mmc2_pins_hs {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x349c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a23.mmc2_clk */
+ DRA7XX_CORE_IOPAD(0x34b0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_cs1.mmc2_cmd */
+ DRA7XX_CORE_IOPAD(0x34a0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a24.mmc2_dat0 */
+ DRA7XX_CORE_IOPAD(0x34a4, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a25.mmc2_dat1 */
+ DRA7XX_CORE_IOPAD(0x34a8, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a26.mmc2_dat2 */
+ DRA7XX_CORE_IOPAD(0x34ac, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a27.mmc2_dat3 */
+ DRA7XX_CORE_IOPAD(0x348c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a19.mmc2_dat4 */
+ DRA7XX_CORE_IOPAD(0x3490, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a20.mmc2_dat5 */
+ DRA7XX_CORE_IOPAD(0x3494, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a21.mmc2_dat6 */
+ DRA7XX_CORE_IOPAD(0x3498, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a22.mmc2_dat7 */
+ >;
+ };
+
+ mmc2_pins_ddr_3_3v_rev11: mmc2_pins_ddr_3_3v_rev11 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x349c, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a23.mmc2_clk */
+ DRA7XX_CORE_IOPAD(0x34b0, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_cs1.mmc2_cmd */
+ DRA7XX_CORE_IOPAD(0x34a0, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a24.mmc2_dat0 */
+ DRA7XX_CORE_IOPAD(0x34a4, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a25.mmc2_dat1 */
+ DRA7XX_CORE_IOPAD(0x34a8, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a26.mmc2_dat2 */
+ DRA7XX_CORE_IOPAD(0x34ac, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a27.mmc2_dat3 */
+ DRA7XX_CORE_IOPAD(0x348c, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a19.mmc2_dat4 */
+ DRA7XX_CORE_IOPAD(0x3490, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a20.mmc2_dat5 */
+ DRA7XX_CORE_IOPAD(0x3494, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a21.mmc2_dat6 */
+ DRA7XX_CORE_IOPAD(0x3498, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a22.mmc2_dat7 */
+ >;
+ };
+
+ mmc2_pins_ddr_1_8v_rev11: mmc2_pins_ddr_1_8v_rev11 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x349c, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a23.mmc2_clk */
+ DRA7XX_CORE_IOPAD(0x34b0, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_cs1.mmc2_cmd */
+ DRA7XX_CORE_IOPAD(0x34a0, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a24.mmc2_dat0 */
+ DRA7XX_CORE_IOPAD(0x34a4, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a25.mmc2_dat1 */
+ DRA7XX_CORE_IOPAD(0x34a8, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a26.mmc2_dat2 */
+ DRA7XX_CORE_IOPAD(0x34ac, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a27.mmc2_dat3 */
+ DRA7XX_CORE_IOPAD(0x348c, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a19.mmc2_dat4 */
+ DRA7XX_CORE_IOPAD(0x3490, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a20.mmc2_dat5 */
+ DRA7XX_CORE_IOPAD(0x3494, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a21.mmc2_dat6 */
+ DRA7XX_CORE_IOPAD(0x3498, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a22.mmc2_dat7 */
+ >;
+ };
+
+ mmc2_pins_ddr_rev20: mmc2_pins_ddr_rev20 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x349c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a23.mmc2_clk */
+ DRA7XX_CORE_IOPAD(0x34b0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_cs1.mmc2_cmd */
+ DRA7XX_CORE_IOPAD(0x34a0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a24.mmc2_dat0 */
+ DRA7XX_CORE_IOPAD(0x34a4, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a25.mmc2_dat1 */
+ DRA7XX_CORE_IOPAD(0x34a8, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a26.mmc2_dat2 */
+ DRA7XX_CORE_IOPAD(0x34ac, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a27.mmc2_dat3 */
+ DRA7XX_CORE_IOPAD(0x348c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a19.mmc2_dat4 */
+ DRA7XX_CORE_IOPAD(0x3490, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a20.mmc2_dat5 */
+ DRA7XX_CORE_IOPAD(0x3494, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a21.mmc2_dat6 */
+ DRA7XX_CORE_IOPAD(0x3498, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a22.mmc2_dat7 */
+ >;
+ };
+
+ mmc2_pins_hs200: mmc2_pins_hs200 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x349c, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a23.mmc2_clk */
+ DRA7XX_CORE_IOPAD(0x34b0, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_cs1.mmc2_cmd */
+ DRA7XX_CORE_IOPAD(0x34a0, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a24.mmc2_dat0 */
+ DRA7XX_CORE_IOPAD(0x34a4, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a25.mmc2_dat1 */
+ DRA7XX_CORE_IOPAD(0x34a8, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a26.mmc2_dat2 */
+ DRA7XX_CORE_IOPAD(0x34ac, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a27.mmc2_dat3 */
+ DRA7XX_CORE_IOPAD(0x348c, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a19.mmc2_dat4 */
+ DRA7XX_CORE_IOPAD(0x3490, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a20.mmc2_dat5 */
+ DRA7XX_CORE_IOPAD(0x3494, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a21.mmc2_dat6 */
+ DRA7XX_CORE_IOPAD(0x3498, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE1) /* gpmc_a22.mmc2_dat7 */
+ >;
+ };
+
+ mmc4_pins_default: mmc4_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x37e8, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart1_ctsn.mmc4_clk */
+ DRA7XX_CORE_IOPAD(0x37ec, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart1_rtsn.mmc4_cmd */
+ DRA7XX_CORE_IOPAD(0x37f0, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart2_rxd.mmc4_dat0 */
+ DRA7XX_CORE_IOPAD(0x37f4, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart2_txd.mmc4_dat1 */
+ DRA7XX_CORE_IOPAD(0x37f8, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart2_ctsn.mmc4_dat2 */
+ DRA7XX_CORE_IOPAD(0x37fc, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart2_rtsn.mmc4_dat3 */
+ >;
+ };
+
+ mmc4_pins_hs: mmc4_pins_hs {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x37e8, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart1_ctsn.mmc4_clk */
+ DRA7XX_CORE_IOPAD(0x37ec, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart1_rtsn.mmc4_cmd */
+ DRA7XX_CORE_IOPAD(0x37f0, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart2_rxd.mmc4_dat0 */
+ DRA7XX_CORE_IOPAD(0x37f4, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart2_txd.mmc4_dat1 */
+ DRA7XX_CORE_IOPAD(0x37f8, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart2_ctsn.mmc4_dat2 */
+ DRA7XX_CORE_IOPAD(0x37fc, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart2_rtsn.mmc4_dat3 */
+ >;
+ };
+
+ mmc3_pins_default: mmc3_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x377c, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_clk.mmc3_clk */
+ DRA7XX_CORE_IOPAD(0x3780, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_cmd.mmc3_cmd */
+ DRA7XX_CORE_IOPAD(0x3784, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_dat0.mmc3_dat0 */
+ DRA7XX_CORE_IOPAD(0x3788, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_dat1.mmc3_dat1 */
+ DRA7XX_CORE_IOPAD(0x378c, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_dat2.mmc3_dat2 */
+ DRA7XX_CORE_IOPAD(0x3790, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_dat3.mmc3_dat3 */
+ >;
+ };
+
+ mmc3_pins_hs: mmc3_pins_hs {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x377c, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_clk.mmc3_clk */
+ DRA7XX_CORE_IOPAD(0x3780, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_cmd.mmc3_cmd */
+ DRA7XX_CORE_IOPAD(0x3784, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_dat0.mmc3_dat0 */
+ DRA7XX_CORE_IOPAD(0x3788, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_dat1.mmc3_dat1 */
+ DRA7XX_CORE_IOPAD(0x378c, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_dat2.mmc3_dat2 */
+ DRA7XX_CORE_IOPAD(0x3790, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_dat3.mmc3_dat3 */
+ >;
+ };
+
+ mmc3_pins_sdr12: mmc3_pins_sdr12 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x377c, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_clk.mmc3_clk */
+ DRA7XX_CORE_IOPAD(0x3780, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_cmd.mmc3_cmd */
+ DRA7XX_CORE_IOPAD(0x3784, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_dat0.mmc3_dat0 */
+ DRA7XX_CORE_IOPAD(0x3788, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_dat1.mmc3_dat1 */
+ DRA7XX_CORE_IOPAD(0x378c, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_dat2.mmc3_dat2 */
+ DRA7XX_CORE_IOPAD(0x3790, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_dat3.mmc3_dat3 */
+ >;
+ };
+
+ mmc3_pins_sdr25: mmc3_pins_sdr25 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x377c, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_clk.mmc3_clk */
+ DRA7XX_CORE_IOPAD(0x3780, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_cmd.mmc3_cmd */
+ DRA7XX_CORE_IOPAD(0x3784, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_dat0.mmc3_dat0 */
+ DRA7XX_CORE_IOPAD(0x3788, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_dat1.mmc3_dat1 */
+ DRA7XX_CORE_IOPAD(0x378c, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_dat2.mmc3_dat2 */
+ DRA7XX_CORE_IOPAD(0x3790, (PIN_INPUT_PULLUP | MUX_MODE0)) /* mmc3_dat3.mmc3_dat3 */
+ >;
+ };
+
+ mmc3_pins_sdr50: mmc3_pins_sdr50 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x377c, (PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0)) /* mmc3_clk.mmc3_clk */
+ DRA7XX_CORE_IOPAD(0x3780, (PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0)) /* mmc3_cmd.mmc3_cmd */
+ DRA7XX_CORE_IOPAD(0x3784, (PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0)) /* mmc3_dat0.mmc3_dat0 */
+ DRA7XX_CORE_IOPAD(0x3788, (PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0)) /* mmc3_dat1.mmc3_dat1 */
+ DRA7XX_CORE_IOPAD(0x378c, (PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0)) /* mmc3_dat2.mmc3_dat2 */
+ DRA7XX_CORE_IOPAD(0x3790, (PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE0)) /* mmc3_dat3.mmc3_dat3 */
+ >;
+ };
+
+ mmc4_pins_sdr12: mmc4_pins_sdr12 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x37e8, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart1_ctsn.mmc4_clk */
+ DRA7XX_CORE_IOPAD(0x37ec, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart1_rtsn.mmc4_cmd */
+ DRA7XX_CORE_IOPAD(0x37f0, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart2_rxd.mmc4_dat0 */
+ DRA7XX_CORE_IOPAD(0x37f4, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart2_txd.mmc4_dat1 */
+ DRA7XX_CORE_IOPAD(0x37f8, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart2_ctsn.mmc4_dat2 */
+ DRA7XX_CORE_IOPAD(0x37fc, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart2_rtsn.mmc4_dat3 */
+ >;
+ };
+
+ mmc4_pins_sdr25: mmc4_pins_sdr25 {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x37e8, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart1_ctsn.mmc4_clk */
+ DRA7XX_CORE_IOPAD(0x37ec, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart1_rtsn.mmc4_cmd */
+ DRA7XX_CORE_IOPAD(0x37f0, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart2_rxd.mmc4_dat0 */
+ DRA7XX_CORE_IOPAD(0x37f4, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart2_txd.mmc4_dat1 */
+ DRA7XX_CORE_IOPAD(0x37f8, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart2_ctsn.mmc4_dat2 */
+ DRA7XX_CORE_IOPAD(0x37fc, PIN_INPUT_PULLUP | MODE_SELECT | MUX_MODE3) /* uart2_rtsn.mmc4_dat3 */
+ >;
+ };
+};
+
+&dra7_iodelay_core {
+
+ /* Corresponds to MMC1_DDR_MANUAL1 in datamanual */
+ mmc1_iodelay_ddr_rev11_conf: mmc1_iodelay_ddr_rev11_conf {
+ pinctrl-pin-array = <
+ 0x618 A_DELAY_PS(572) G_DELAY_PS(540) /* CFG_MMC1_CLK_IN */
+ 0x620 A_DELAY_PS(1525) G_DELAY_PS(0) /* CFG_MMC1_CLK_OUT */
+ 0x624 A_DELAY_PS(0) G_DELAY_PS(600) /* CFG_MMC1_CMD_IN */
+ 0x628 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_CMD_OEN */
+ 0x62c A_DELAY_PS(55) G_DELAY_PS(0) /* CFG_MMC1_CMD_OUT */
+ 0x630 A_DELAY_PS(403) G_DELAY_PS(120) /* CFG_MMC1_DAT0_IN */
+ 0x634 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT0_OEN */
+ 0x638 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT0_OUT */
+ 0x63c A_DELAY_PS(23) G_DELAY_PS(60) /* CFG_MMC1_DAT1_IN */
+ 0x640 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT1_OEN */
+ 0x644 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT1_OUT */
+ 0x648 A_DELAY_PS(25) G_DELAY_PS(60) /* CFG_MMC1_DAT2_IN */
+ 0x64c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT2_OEN */
+ 0x650 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT2_OUT */
+ 0x654 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT3_IN */
+ 0x658 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT3_OEN */
+ 0x65c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT3_OUT */
+ >;
+ };
+
+ /* Corresponds to MMC1_DDR_MANUAL1 in datamanual */
+ mmc1_iodelay_ddr_rev20_conf: mmc1_iodelay_ddr50_rev20_conf {
+ pinctrl-pin-array = <
+ 0x618 A_DELAY_PS(1076) G_DELAY_PS(330) /* CFG_MMC1_CLK_IN */
+ 0x620 A_DELAY_PS(1271) G_DELAY_PS(0) /* CFG_MMC1_CLK_OUT */
+ 0x624 A_DELAY_PS(722) G_DELAY_PS(0) /* CFG_MMC1_CMD_IN */
+ 0x628 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_CMD_OEN */
+ 0x62C A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_CMD_OUT */
+ 0x630 A_DELAY_PS(751) G_DELAY_PS(0) /* CFG_MMC1_DAT0_IN */
+ 0x634 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT0_OEN */
+ 0x638 A_DELAY_PS(20) G_DELAY_PS(0) /* CFG_MMC1_DAT0_OUT */
+ 0x63C A_DELAY_PS(256) G_DELAY_PS(0) /* CFG_MMC1_DAT1_IN */
+ 0x640 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT1_OEN */
+ 0x644 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT1_OUT */
+ 0x648 A_DELAY_PS(263) G_DELAY_PS(0) /* CFG_MMC1_DAT2_IN */
+ 0x64C A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT2_OEN */
+ 0x650 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT2_OUT */
+ 0x654 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT3_IN */
+ 0x658 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT3_OEN */
+ 0x65C A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT3_OUT */
+ >;
+ };
+
+ /* Corresponds to MMC1_SDR104_MANUAL1 in datamanual */
+ mmc1_iodelay_sdr104_rev11_conf: mmc1_iodelay_sdr104_rev11_conf {
+ pinctrl-pin-array = <
+ 0x620 A_DELAY_PS(1063) G_DELAY_PS(17) /* CFG_MMC1_CLK_OUT */
+ 0x628 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_CMD_OEN */
+ 0x62c A_DELAY_PS(23) G_DELAY_PS(0) /* CFG_MMC1_CMD_OUT */
+ 0x634 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT0_OEN */
+ 0x638 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT0_OUT */
+ 0x640 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT1_OEN */
+ 0x644 A_DELAY_PS(2) G_DELAY_PS(0) /* CFG_MMC1_DAT1_OUT */
+ 0x64c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT2_OEN */
+ 0x650 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT2_OUT */
+ 0x658 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT3_OEN */
+ 0x65c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT3_OUT */
+ >;
+ };
+
+ /* Corresponds to MMC1_SDR104_MANUAL1 in datamanual */
+ mmc1_iodelay_sdr104_rev20_conf: mmc1_iodelay_sdr104_rev20_conf {
+ pinctrl-pin-array = <
+ 0x620 A_DELAY_PS(600) G_DELAY_PS(400) /* CFG_MMC1_CLK_OUT */
+ 0x628 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_CMD_OEN */
+ 0x62c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_CMD_OUT */
+ 0x634 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT0_OEN */
+ 0x638 A_DELAY_PS(30) G_DELAY_PS(0) /* CFG_MMC1_DAT0_OUT */
+ 0x640 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT1_OEN */
+ 0x644 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT1_OUT */
+ 0x64c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT2_OEN */
+ 0x650 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT2_OUT */
+ 0x658 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT3_OEN */
+ 0x65c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC1_DAT3_OUT */
+ >;
+ };
+
+ /* Corresponds to MMC2_HS200_MANUAL1 in datamanual */
+ mmc2_iodelay_hs200_rev11_conf: mmc2_iodelay_hs200_rev11_conf {
+ pinctrl-pin-array = <
+ 0x190 A_DELAY_PS(621) G_DELAY_PS(600) /* CFG_GPMC_A19_OEN */
+ 0x194 A_DELAY_PS(300) G_DELAY_PS(0) /* CFG_GPMC_A19_OUT */
+ 0x1a8 A_DELAY_PS(739) G_DELAY_PS(600) /* CFG_GPMC_A20_OEN */
+ 0x1ac A_DELAY_PS(240) G_DELAY_PS(0) /* CFG_GPMC_A20_OUT */
+ 0x1b4 A_DELAY_PS(812) G_DELAY_PS(600) /* CFG_GPMC_A21_OEN */
+ 0x1b8 A_DELAY_PS(240) G_DELAY_PS(0) /* CFG_GPMC_A21_OUT */
+ 0x1c0 A_DELAY_PS(954) G_DELAY_PS(600) /* CFG_GPMC_A22_OEN */
+ 0x1c4 A_DELAY_PS(60) G_DELAY_PS(0) /* CFG_GPMC_A22_OUT */
+ 0x1d0 A_DELAY_PS(1340) G_DELAY_PS(420) /* CFG_GPMC_A23_OUT */
+ 0x1d8 A_DELAY_PS(935) G_DELAY_PS(600) /* CFG_GPMC_A24_OEN */
+ 0x1dc A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A24_OUT */
+ 0x1e4 A_DELAY_PS(525) G_DELAY_PS(600) /* CFG_GPMC_A25_OEN */
+ 0x1e8 A_DELAY_PS(120) G_DELAY_PS(0) /* CFG_GPMC_A25_OUT */
+ 0x1f0 A_DELAY_PS(767) G_DELAY_PS(600) /* CFG_GPMC_A26_OEN */
+ 0x1f4 A_DELAY_PS(225) G_DELAY_PS(0) /* CFG_GPMC_A26_OUT */
+ 0x1fc A_DELAY_PS(565) G_DELAY_PS(600) /* CFG_GPMC_A27_OEN */
+ 0x200 A_DELAY_PS(60) G_DELAY_PS(0) /* CFG_GPMC_A27_OUT */
+ 0x364 A_DELAY_PS(969) G_DELAY_PS(600) /* CFG_GPMC_CS1_OEN */
+ 0x368 A_DELAY_PS(180) G_DELAY_PS(0) /* CFG_GPMC_CS1_OUT */
+ >;
+ };
+
+ /* Corresponds to MMC2_HS200_MANUAL1 in datamanual */
+ mmc2_iodelay_hs200_rev20_conf: mmc2_iodelay_hs200_rev20_conf {
+ pinctrl-pin-array = <
+ 0x190 A_DELAY_PS(274) G_DELAY_PS(0) /* CFG_GPMC_A19_OEN */
+ 0x194 A_DELAY_PS(162) G_DELAY_PS(0) /* CFG_GPMC_A19_OUT */
+ 0x1a8 A_DELAY_PS(401) G_DELAY_PS(0) /* CFG_GPMC_A20_OEN */
+ 0x1ac A_DELAY_PS(73) G_DELAY_PS(0) /* CFG_GPMC_A20_OUT */
+ 0x1b4 A_DELAY_PS(465) G_DELAY_PS(0) /* CFG_GPMC_A21_OEN */
+ 0x1b8 A_DELAY_PS(115) G_DELAY_PS(0) /* CFG_GPMC_A21_OUT */
+ 0x1c0 A_DELAY_PS(633) G_DELAY_PS(0) /* CFG_GPMC_A22_OEN */
+ 0x1c4 A_DELAY_PS(47) G_DELAY_PS(0) /* CFG_GPMC_A22_OUT */
+ 0x1d0 A_DELAY_PS(935) G_DELAY_PS(280) /* CFG_GPMC_A23_OUT */
+ 0x1d8 A_DELAY_PS(621) G_DELAY_PS(0) /* CFG_GPMC_A24_OEN */
+ 0x1dc A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A24_OUT */
+ 0x1e4 A_DELAY_PS(183) G_DELAY_PS(0) /* CFG_GPMC_A25_OEN */
+ 0x1e8 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A25_OUT */
+ 0x1f0 A_DELAY_PS(467) G_DELAY_PS(0) /* CFG_GPMC_A26_OEN */
+ 0x1f4 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A26_OUT */
+ 0x1fc A_DELAY_PS(262) G_DELAY_PS(0) /* CFG_GPMC_A27_OEN */
+ 0x200 A_DELAY_PS(46) G_DELAY_PS(0) /* CFG_GPMC_A27_OUT */
+ 0x364 A_DELAY_PS(684) G_DELAY_PS(0) /* CFG_GPMC_CS1_OEN */
+ 0x368 A_DELAY_PS(76) G_DELAY_PS(0) /* CFG_GPMC_CS1_OUT */
+ >;
+ };
+
+ /* Correspnds to MMC2_DDR_3V3_MANUAL1 in datamanual */
+ mmc2_iodelay_ddr_3_3v_rev11_conf: mmc2_iodelay_ddr_3_3v_rev11_conf {
+ pinctrl-pin-array = <
+ 0x18c A_DELAY_PS(0) G_DELAY_PS(120) /* CFG_GPMC_A19_IN */
+ 0x190 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A19_OEN */
+ 0x194 A_DELAY_PS(174) G_DELAY_PS(0) /* CFG_GPMC_A19_OUT */
+ 0x1a4 A_DELAY_PS(265) G_DELAY_PS(360) /* CFG_GPMC_A20_IN */
+ 0x1a8 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A20_OEN */
+ 0x1ac A_DELAY_PS(168) G_DELAY_PS(0) /* CFG_GPMC_A20_OUT */
+ 0x1b0 A_DELAY_PS(0) G_DELAY_PS(120) /* CFG_GPMC_A21_IN */
+ 0x1b4 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A21_OEN */
+ 0x1b8 A_DELAY_PS(136) G_DELAY_PS(0) /* CFG_GPMC_A21_OUT */
+ 0x1bc A_DELAY_PS(0) G_DELAY_PS(120) /* CFG_GPMC_A22_IN */
+ 0x1c0 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A22_OEN */
+ 0x1c4 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A22_OUT */
+ 0x1c8 A_DELAY_PS(287) G_DELAY_PS(420) /* CFG_GPMC_A23_IN */
+ 0x1d0 A_DELAY_PS(879) G_DELAY_PS(0) /* CFG_GPMC_A23_OUT */
+ 0x1d4 A_DELAY_PS(144) G_DELAY_PS(240) /* CFG_GPMC_A24_IN */
+ 0x1d8 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A24_OEN */
+ 0x1dc A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A24_OUT */
+ 0x1e0 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A25_IN */
+ 0x1e4 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A25_OEN */
+ 0x1e8 A_DELAY_PS(34) G_DELAY_PS(0) /* CFG_GPMC_A25_OUT */
+ 0x1ec A_DELAY_PS(0) G_DELAY_PS(120) /* CFG_GPMC_A26_IN */
+ 0x1f0 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A26_OEN */
+ 0x1f4 A_DELAY_PS(120) G_DELAY_PS(0) /* CFG_GPMC_A26_OUT */
+ 0x1f8 A_DELAY_PS(120) G_DELAY_PS(180) /* CFG_GPMC_A27_IN */
+ 0x1fc A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A27_OEN */
+ 0x200 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A27_OUT */
+ 0x360 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_CS1_IN */
+ 0x364 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_CS1_OEN */
+ 0x368 A_DELAY_PS(11) G_DELAY_PS(0) /* CFG_GPMC_CS1_OUT */
+ >;
+ };
+
+ /* Corresponds to MMC2_DDR_1V8_MANUAL1 in datamanual */
+ mmc2_iodelay_ddr_1_8v_rev11_conf: mmc2_iodelay_ddr_1_8v_rev11_conf {
+ pinctrl-pin-array = <
+ 0x18c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A19_IN */
+ 0x190 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A19_OEN */
+ 0x194 A_DELAY_PS(174) G_DELAY_PS(0) /* CFG_GPMC_A19_OUT */
+ 0x1a4 A_DELAY_PS(274) G_DELAY_PS(240) /* CFG_GPMC_A20_IN */
+ 0x1a8 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A20_OEN */
+ 0x1ac A_DELAY_PS(168) G_DELAY_PS(0) /* CFG_GPMC_A20_OUT */
+ 0x1b0 A_DELAY_PS(0) G_DELAY_PS(60) /* CFG_GPMC_A21_IN */
+ 0x1b4 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A21_OEN */
+ 0x1b8 A_DELAY_PS(136) G_DELAY_PS(0) /* CFG_GPMC_A21_OUT */
+ 0x1bc A_DELAY_PS(0) G_DELAY_PS(60) /* CFG_GPMC_A22_IN */
+ 0x1c0 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A22_OEN */
+ 0x1c4 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A22_OUT */
+ 0x1c8 A_DELAY_PS(514) G_DELAY_PS(360) /* CFG_GPMC_A23_IN */
+ 0x1d0 A_DELAY_PS(879) G_DELAY_PS(0) /* CFG_GPMC_A23_OUT */
+ 0x1d4 A_DELAY_PS(187) G_DELAY_PS(120) /* CFG_GPMC_A24_IN */
+ 0x1d8 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A24_OEN */
+ 0x1dc A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A24_OUT */
+ 0x1e0 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A25_IN */
+ 0x1e4 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A25_OEN */
+ 0x1e8 A_DELAY_PS(34) G_DELAY_PS(0) /* CFG_GPMC_A25_OUT */
+ 0x1ec A_DELAY_PS(0) G_DELAY_PS(60) /* CFG_GPMC_A26_IN */
+ 0x1f0 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A26_OEN */
+ 0x1f4 A_DELAY_PS(120) G_DELAY_PS(0) /* CFG_GPMC_A26_OUT */
+ 0x1f8 A_DELAY_PS(121) G_DELAY_PS(60) /* CFG_GPMC_A27_IN */
+ 0x1fc A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A27_OEN */
+ 0x200 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_A27_OUT */
+ 0x360 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_CS1_IN */
+ 0x364 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_GPMC_CS1_OEN */
+ 0x368 A_DELAY_PS(11) G_DELAY_PS(0) /* CFG_GPMC_CS1_OUT */
+ >;
+ };
+
+ /* Corresponds to MMC3_MANUAL1 in datamanual */
+ mmc3_iodelay_manual1_rev20_conf: mmc3_iodelay_manual1_conf {
+ pinctrl-pin-array = <
+ 0x678 A_DELAY_PS(0) G_DELAY_PS(386) /* CFG_MMC3_CLK_IN */
+ 0x680 A_DELAY_PS(605) G_DELAY_PS(0) /* CFG_MMC3_CLK_OUT */
+ 0x684 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_CMD_IN */
+ 0x688 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_CMD_OEN */
+ 0x68c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_CMD_OUT */
+ 0x690 A_DELAY_PS(171) G_DELAY_PS(0) /* CFG_MMC3_DAT0_IN */
+ 0x694 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT0_OEN */
+ 0x698 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT0_OUT */
+ 0x69c A_DELAY_PS(221) G_DELAY_PS(0) /* CFG_MMC3_DAT1_IN */
+ 0x6a0 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT1_OEN */
+ 0x6a4 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT1_OUT */
+ 0x6a8 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT2_IN */
+ 0x6ac A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT2_OEN */
+ 0x6b0 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT2_OUT */
+ 0x6b4 A_DELAY_PS(474) G_DELAY_PS(0) /* CFG_MMC3_DAT3_IN */
+ 0x6b8 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT3_OEN */
+ 0x6bc A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT3_OUT */
+ >;
+ };
+
+ /* Corresponds to MMC3_MANUAL1 in datamanual */
+ mmc3_iodelay_manual1_rev11_conf: mmc3_iodelay_manual1_conf {
+ pinctrl-pin-array = <
+ 0x678 A_DELAY_PS(406) G_DELAY_PS(0) /* CFG_MMC3_CLK_IN */
+ 0x680 A_DELAY_PS(659) G_DELAY_PS(0) /* CFG_MMC3_CLK_OUT */
+ 0x684 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_CMD_IN */
+ 0x688 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_CMD_OEN */
+ 0x68c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_CMD_OUT */
+ 0x690 A_DELAY_PS(130) G_DELAY_PS(0) /* CFG_MMC3_DAT0_IN */
+ 0x694 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT0_OEN */
+ 0x698 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT0_OUT */
+ 0x69c A_DELAY_PS(169) G_DELAY_PS(0) /* CFG_MMC3_DAT1_IN */
+ 0x6a0 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT1_OEN */
+ 0x6a4 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT1_OUT */
+ 0x6a8 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT2_IN */
+ 0x6ac A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT2_OEN */
+ 0x6b0 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT2_OUT */
+ 0x6b4 A_DELAY_PS(457) G_DELAY_PS(0) /* CFG_MMC3_DAT3_IN */
+ 0x6b8 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT3_OEN */
+ 0x6bc A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_MMC3_DAT3_OUT */
+ >;
+ };
+
+ /* Corresponds to MMC4_DS_MANUAL1 in datamanual */
+ mmc4_iodelay_ds_rev11_conf: mmc4_iodelay_ds_rev11_conf {
+ pinctrl-pin-array = <
+ 0x840 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART1_CTSN_IN */
+ 0x848 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART1_CTSN_OUT */
+ 0x84c A_DELAY_PS(96) G_DELAY_PS(0) /* CFG_UART1_RTSN_IN */
+ 0x850 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART1_RTSN_OEN */
+ 0x854 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART1_RTSN_OUT */
+ 0x870 A_DELAY_PS(582) G_DELAY_PS(0) /* CFG_UART2_CTSN_IN */
+ 0x874 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_CTSN_OEN */
+ 0x878 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_CTSN_OUT */
+ 0x87c A_DELAY_PS(391) G_DELAY_PS(0) /* CFG_UART2_RTSN_IN */
+ 0x880 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_RTSN_OEN */
+ 0x884 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_RTSN_OUT */
+ 0x888 A_DELAY_PS(561) G_DELAY_PS(0) /* CFG_UART2_RXD_IN */
+ 0x88c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_RXD_OEN */
+ 0x890 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_RXD_OUT */
+ 0x894 A_DELAY_PS(588) G_DELAY_PS(0) /* CFG_UART2_TXD_IN */
+ 0x898 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_TXD_OEN */
+ 0x89c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_TXD_OUT */
+ >;
+ };
+
+ /* Corresponds to MMC4_DS_MANUAL1 in datamanual */
+ mmc4_iodelay_ds_rev20_conf: mmc4_iodelay_ds_rev20_conf {
+ pinctrl-pin-array = <
+ 0x840 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART1_CTSN_IN */
+ 0x848 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART1_CTSN_OUT */
+ 0x84c A_DELAY_PS(307) G_DELAY_PS(0) /* CFG_UART1_RTSN_IN */
+ 0x850 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART1_RTSN_OEN */
+ 0x854 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART1_RTSN_OUT */
+ 0x870 A_DELAY_PS(785) G_DELAY_PS(0) /* CFG_UART2_CTSN_IN */
+ 0x874 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_CTSN_OEN */
+ 0x878 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_CTSN_OUT */
+ 0x87c A_DELAY_PS(613) G_DELAY_PS(0) /* CFG_UART2_RTSN_IN */
+ 0x880 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_RTSN_OEN */
+ 0x884 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_RTSN_OUT */
+ 0x888 A_DELAY_PS(683) G_DELAY_PS(0) /* CFG_UART2_RXD_IN */
+ 0x88c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_RXD_OEN */
+ 0x890 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_RXD_OUT */
+ 0x894 A_DELAY_PS(835) G_DELAY_PS(0) /* CFG_UART2_TXD_IN */
+ 0x898 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_TXD_OEN */
+ 0x89c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_TXD_OUT */
+ >;
+ };
+
+ /* Corresponds to MMC4_MANUAL1 in datamanual */
+ mmc4_iodelay_sdr12_hs_sdr25_rev11_conf: mmc4_iodelay_sdr12_hs_sdr25_rev11_conf {
+ pinctrl-pin-array = <
+ 0x840 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART1_CTSN_IN */
+ 0x848 A_DELAY_PS(2651) G_DELAY_PS(0) /* CFG_UART1_CTSN_OUT */
+ 0x84c A_DELAY_PS(1572) G_DELAY_PS(0) /* CFG_UART1_RTSN_IN */
+ 0x850 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART1_RTSN_OEN */
+ 0x854 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART1_RTSN_OUT */
+ 0x870 A_DELAY_PS(1913) G_DELAY_PS(0) /* CFG_UART2_CTSN_IN */
+ 0x874 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_CTSN_OEN */
+ 0x878 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_CTSN_OUT */
+ 0x87c A_DELAY_PS(1721) G_DELAY_PS(0) /* CFG_UART2_RTSN_IN */
+ 0x880 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_RTSN_OEN */
+ 0x884 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_RTSN_OUT */
+ 0x888 A_DELAY_PS(1891) G_DELAY_PS(0) /* CFG_UART2_RXD_IN */
+ 0x88c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_RXD_OEN */
+ 0x890 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_RXD_OUT */
+ 0x894 A_DELAY_PS(1919) G_DELAY_PS(0) /* CFG_UART2_TXD_IN */
+ 0x898 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_TXD_OEN */
+ 0x89c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_TXD_OUT */
+ >;
+ };
+
+ /* Corresponds to MMC4_MANUAL1 in datamanual */
+ mmc4_iodelay_sdr12_hs_sdr25_rev20_conf: mmc4_iodelay_sdr12_hs_sdr25_rev20_conf {
+ pinctrl-pin-array = <
+ 0x840 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART1_CTSN_IN */
+ 0x848 A_DELAY_PS(1147) G_DELAY_PS(0) /* CFG_UART1_CTSN_OUT */
+ 0x84c A_DELAY_PS(1834) G_DELAY_PS(0) /* CFG_UART1_RTSN_IN */
+ 0x850 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART1_RTSN_OEN */
+ 0x854 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART1_RTSN_OUT */
+ 0x870 A_DELAY_PS(2165) G_DELAY_PS(0) /* CFG_UART2_CTSN_IN */
+ 0x874 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_CTSN_OEN */
+ 0x878 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_CTSN_OUT */
+ 0x87c A_DELAY_PS(1929) G_DELAY_PS(64) /* CFG_UART2_RTSN_IN */
+ 0x880 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_RTSN_OEN */
+ 0x884 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_RTSN_OUT */
+ 0x888 A_DELAY_PS(1935) G_DELAY_PS(128) /* CFG_UART2_RXD_IN */
+ 0x88c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_RXD_OEN */
+ 0x890 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_RXD_OUT */
+ 0x894 A_DELAY_PS(2172) G_DELAY_PS(44) /* CFG_UART2_TXD_IN */
+ 0x898 A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_TXD_OEN */
+ 0x89c A_DELAY_PS(0) G_DELAY_PS(0) /* CFG_UART2_TXD_OUT */
+ >;
+ };
+};
compatible = "ti,dra742", "ti,dra74", "ti,dra7";
cpus {
- #address-cells = <1>;
- #size-cells = <0>;
-
- cpu0: cpu@0 {
- device_type = "cpu";
- compatible = "arm,cortex-a15";
- reg = <0>;
-
- operating-points = <
- /* kHz uV */
- 1000000 1060000
- 1176000 1160000
- >;
-
- clocks = <&dpll_mpu_ck>;
- clock-names = "cpu";
-
- clock-latency = <300000>; /* From omap-cpufreq driver */
-
- /* cooling options */
- cooling-min-level = <0>;
- cooling-max-level = <2>;
- #cooling-cells = <2>; /* min followed by max */
- };
cpu@1 {
device_type = "cpu";
compatible = "arm,cortex-a15";
reg = <1>;
+ operating-points-v2 = <&cpu0_opp_table>;
};
};
};
ocp {
+ dsp2_system: dsp_system@41500000 {
+ compatible = "syscon";
+ reg = <0x41500000 0x100>;
+ };
+
omap_dwc3_4: omap_dwc3_4@48940000 {
compatible = "ti,dwc3";
ti,hwmods = "usb_otg_ss4";
usb4: usb@48950000 {
compatible = "snps,dwc3";
reg = <0x48950000 0x17000>;
- interrupts = <GIC_SPI 345 IRQ_TYPE_LEVEL_HIGH>;
- tx-fifo-resize;
+ interrupts = <GIC_SPI 345 IRQ_TYPE_LEVEL_HIGH>,
+ <GIC_SPI 345 IRQ_TYPE_LEVEL_HIGH>,
+ <GIC_SPI 346 IRQ_TYPE_LEVEL_HIGH>;
+ interrupt-names = "peripheral",
+ "host",
+ "otg";
maximum-speed = "high-speed";
dr_mode = "otg";
};
};
+
+ mmu0_dsp2: mmu@41501000 {
+ compatible = "ti,dra7-dsp-iommu";
+ reg = <0x41501000 0x100>;
+ interrupts = <GIC_SPI 146 IRQ_TYPE_LEVEL_HIGH>;
+ ti,hwmods = "mmu0_dsp2";
+ #iommu-cells = <0>;
+ ti,syscon-mmuconfig = <&dsp2_system 0x0>;
+ status = "disabled";
+ };
+
+ mmu1_dsp2: mmu@41502000 {
+ compatible = "ti,dra7-dsp-iommu";
+ reg = <0x41502000 0x100>;
+ interrupts = <GIC_SPI 147 IRQ_TYPE_LEVEL_HIGH>;
+ ti,hwmods = "mmu1_dsp2";
+ #iommu-cells = <0>;
+ ti,syscon-mmuconfig = <&dsp2_system 0x1>;
+ status = "disabled";
+ };
};
};
+&cpu0_opp_table {
+ opp-shared;
+};
+
&dss {
reg = <0x58000000 0x80>,
<0x58004054 0x4>,
<0x58004300 0x20>,
- <0x58005054 0x4>,
- <0x58005300 0x20>;
+ <0x58009054 0x4>,
+ <0x58009300 0x20>;
reg-names = "dss", "pll1_clkctrl", "pll1",
"pll2_clkctrl", "pll2";
<&dss_video2_clk>;
clock-names = "fck", "video1_clk", "video2_clk";
};
+
+&mailbox5 {
+ mbox_ipu1_ipc3x: mbox_ipu1_ipc3x {
+ ti,mbox-tx = <6 2 2>;
+ ti,mbox-rx = <4 2 2>;
+ status = "disabled";
+ };
+ mbox_dsp1_ipc3x: mbox_dsp1_ipc3x {
+ ti,mbox-tx = <5 2 2>;
+ ti,mbox-rx = <1 2 2>;
+ status = "disabled";
+ };
+};
+
+&mailbox6 {
+ mbox_ipu2_ipc3x: mbox_ipu2_ipc3x {
+ ti,mbox-tx = <6 2 2>;
+ ti,mbox-rx = <4 2 2>;
+ status = "disabled";
+ };
+ mbox_dsp2_ipc3x: mbox_dsp2_ipc3x {
+ ti,mbox-tx = <5 2 2>;
+ ti,mbox-rx = <1 2 2>;
+ status = "disabled";
+ };
+};
--- /dev/null
+/*
+ * Copyright (C) 2017 Texas Instruments Incorporated - http://www.ti.com/
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include "omap5-u-boot.dtsi"
+
+&cpsw_emac0 {
+ phy-handle = <&dp83867_0>;
+};
+
+&cpsw_emac1 {
+ phy-handle = <&dp83867_1>;
+};
--- /dev/null
+/*
+ * Copyright (C) 2017 Texas Instruments Incorporated - http://www.ti.com/
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+/dts-v1/;
+
+#include "dra76x.dtsi"
+#include "dra7-evm-common.dtsi"
+#include <dt-bindings/net/ti-dp83867.h>
+
+/ {
+ model = "TI DRA762 EVM";
+ compatible = "ti,dra76-evm", "ti,dra762", "ti,dra7";
+
+ memory@0 {
+ device_type = "memory";
+ reg = <0x0 0x80000000 0x0 0x80000000>;
+ };
+
+ vsys_12v0: fixedregulator-vsys12v0 {
+ /* main supply */
+ compatible = "regulator-fixed";
+ regulator-name = "vsys_12v0";
+ regulator-min-microvolt = <12000000>;
+ regulator-max-microvolt = <12000000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ vsys_5v0: fixedregulator-vsys5v0 {
+ /* Output of Cntlr B of TPS43351-Q1 on dra76-evm */
+ compatible = "regulator-fixed";
+ regulator-name = "vsys_5v0";
+ regulator-min-microvolt = <5000000>;
+ regulator-max-microvolt = <5000000>;
+ vin-supply = <&vsys_12v0>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ vsys_3v3: fixedregulator-vsys3v3 {
+ /* Output of Cntlr A of TPS43351-Q1 on dra76-evm */
+ compatible = "regulator-fixed";
+ regulator-name = "vsys_3v3";
+ regulator-min-microvolt = <3300000>;
+ regulator-max-microvolt = <3300000>;
+ vin-supply = <&vsys_12v0>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ vio_3v3: fixedregulator-vio_3v3 {
+ compatible = "regulator-fixed";
+ regulator-name = "vio_3v3";
+ regulator-min-microvolt = <3300000>;
+ regulator-max-microvolt = <3300000>;
+ vin-supply = <&vsys_3v3>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ vio_3v3_sd: fixedregulator-sd {
+ compatible = "regulator-fixed";
+ regulator-name = "vio_3v3_sd";
+ regulator-min-microvolt = <3300000>;
+ regulator-max-microvolt = <3300000>;
+ vin-supply = <&vio_3v3>;
+ enable-active-high;
+ gpio = <&gpio4 21 GPIO_ACTIVE_HIGH>;
+ };
+
+ vio_1v8: fixedregulator-vio_1v8 {
+ compatible = "regulator-fixed";
+ regulator-name = "vio_1v8";
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ vin-supply = <&smps5_reg>;
+ };
+
+ vtt_fixed: fixedregulator-vtt {
+ compatible = "regulator-fixed";
+ regulator-name = "vtt_fixed";
+ regulator-min-microvolt = <1350000>;
+ regulator-max-microvolt = <1350000>;
+ vin-supply = <&vsys_3v3>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ aic_dvdd: fixedregulator-aic_dvdd {
+ /* TPS77018DBVT */
+ compatible = "regulator-fixed";
+ regulator-name = "aic_dvdd";
+ vin-supply = <&vio_3v3>;
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ };
+};
+
+&dra7_pmx_core {
+ mmc1_pins_default: mmc1_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x376c, PIN_INPUT | MUX_MODE14) /* mmc1sdcd.gpio219 */
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat3.dat3 */
+ >;
+ };
+
+ mmc1_pins_sdr12: pinmux_mmc1_sdr12_pins {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x3754, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_clk.clk */
+ DRA7XX_CORE_IOPAD(0x3758, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_cmd.cmd */
+ DRA7XX_CORE_IOPAD(0x375c, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat0.dat0 */
+ DRA7XX_CORE_IOPAD(0x3760, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat1.dat1 */
+ DRA7XX_CORE_IOPAD(0x3764, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat2.dat2 */
+ DRA7XX_CORE_IOPAD(0x3768, PIN_INPUT_PULLUP | MUX_MODE0) /* mmc1_dat3.dat3 */
+ >;
+ };
+
+ mmc2_pins_default: mmc2_pins_default {
+ pinctrl-single,pins = <
+ DRA7XX_CORE_IOPAD(0x349c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a23.mmc2_clk */
+ DRA7XX_CORE_IOPAD(0x34b0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_cs1.mmc2_cmd */
+ DRA7XX_CORE_IOPAD(0x34a0, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a24.mmc2_dat0 */
+ DRA7XX_CORE_IOPAD(0x34a4, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a25.mmc2_dat1 */
+ DRA7XX_CORE_IOPAD(0x34a8, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a26.mmc2_dat2 */
+ DRA7XX_CORE_IOPAD(0x34ac, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a27.mmc2_dat3 */
+ DRA7XX_CORE_IOPAD(0x348c, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a19.mmc2_dat4 */
+ DRA7XX_CORE_IOPAD(0x3490, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a20.mmc2_dat5 */
+ DRA7XX_CORE_IOPAD(0x3494, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a21.mmc2_dat6 */
+ DRA7XX_CORE_IOPAD(0x3498, PIN_INPUT_PULLUP | MUX_MODE1) /* gpmc_a22.mmc2_dat7 */
+ >;
+ };
+};
+
+&i2c1 {
+ status = "okay";
+ clock-frequency = <400000>;
+
+ tps65917: tps65917@58 {
+ compatible = "ti,tps65917";
+ reg = <0x58>;
+ ti,system-power-controller;
+ interrupt-controller;
+ #interrupt-cells = <2>;
+
+ tps65917_pmic {
+ compatible = "ti,tps65917-pmic";
+
+ smps12-in-supply = <&vsys_3v3>;
+ smps3-in-supply = <&vsys_3v3>;
+ smps4-in-supply = <&vsys_3v3>;
+ smps5-in-supply = <&vsys_3v3>;
+ ldo1-in-supply = <&vsys_3v3>;
+ ldo2-in-supply = <&vsys_3v3>;
+ ldo3-in-supply = <&vsys_5v0>;
+ ldo4-in-supply = <&vsys_5v0>;
+ ldo5-in-supply = <&vsys_3v3>;
+
+ tps65917_regulators: regulators {
+ smps12_reg: smps12 {
+ /* VDD_DSPEVE */
+ regulator-name = "smps12";
+ regulator-min-microvolt = <850000>;
+ regulator-max-microvolt = <1250000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ smps3_reg: smps3 {
+ /* VDD_CORE */
+ regulator-name = "smps3";
+ regulator-min-microvolt = <850000>;
+ regulator-max-microvolt = <1250000>;
+ regulator-boot-on;
+ regulator-always-on;
+ };
+
+ smps4_reg: smps4 {
+ /* VDD_IVA */
+ regulator-name = "smps4";
+ regulator-min-microvolt = <850000>;
+ regulator-max-microvolt = <1250000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ smps5_reg: smps5 {
+ /* VDDS1V8 */
+ regulator-name = "smps5";
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ regulator-boot-on;
+ regulator-always-on;
+ };
+
+ ldo1_reg: ldo1 {
+ /* LDO1_OUT --> VDA_PHY1_1V8 */
+ regulator-name = "ldo1";
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ regulator-always-on;
+ regulator-boot-on;
+ regulator-allow-bypass;
+ };
+
+ ldo2_reg: ldo2 {
+ /* LDO2_OUT --> VDA_PHY2_1V8 */
+ regulator-name = "ldo2";
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ regulator-allow-bypass;
+ regulator-always-on;
+ };
+
+ ldo3_reg: ldo3 {
+ /* VDA_USB_3V3 */
+ regulator-name = "ldo3";
+ regulator-min-microvolt = <3300000>;
+ regulator-max-microvolt = <3300000>;
+ regulator-boot-on;
+ regulator-always-on;
+ };
+
+ ldo5_reg: ldo5 {
+ /* VDDA_1V8_PLL */
+ regulator-name = "ldo5";
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ ldo4_reg: ldo4 {
+ /* VDD_SDIO_DV */
+ regulator-name = "ldo4";
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <3300000>;
+ regulator-boot-on;
+ regulator-always-on;
+ };
+ };
+ };
+
+ tps65917_power_button {
+ compatible = "ti,palmas-pwrbutton";
+ interrupt-parent = <&tps65917>;
+ interrupts = <1 IRQ_TYPE_NONE>;
+ wakeup-source;
+ ti,palmas-long-press-seconds = <6>;
+ };
+ };
+
+ lp87565: lp87565@60 {
+ compatible = "ti,lp87565-q1";
+ reg = <0x60>;
+
+ buck10-in-supply =<&vsys_3v3>;
+ buck23-in-supply =<&vsys_3v3>;
+
+ regulators: regulators {
+ buck10_reg: buck10 {
+ /*VDD_MPU*/
+ regulator-name = "buck10";
+ regulator-min-microvolt = <850000>;
+ regulator-max-microvolt = <1250000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+
+ buck23_reg: buck23 {
+ /* VDD_GPU*/
+ regulator-name = "buck23";
+ regulator-min-microvolt = <850000>;
+ regulator-max-microvolt = <1250000>;
+ regulator-boot-on;
+ regulator-always-on;
+ };
+ };
+ };
+
+ pcf_lcd: pcf8757@20 {
+ compatible = "ti,pcf8575", "nxp,pcf8575";
+ reg = <0x20>;
+ gpio-controller;
+ #gpio-cells = <2>;
+ interrupt-controller;
+ #interrupt-cells = <2>;
+ interrupt-parent = <&gpio1>;
+ interrupts = <3 IRQ_TYPE_EDGE_FALLING>;
+ };
+
+ pcf_gpio_21: pcf8757@21 {
+ compatible = "ti,pcf8575", "nxp,pcf8575";
+ reg = <0x21>;
+ gpio-controller;
+ #gpio-cells = <2>;
+ interrupt-parent = <&gpio1>;
+ interrupts = <3 IRQ_TYPE_EDGE_FALLING>;
+ interrupt-controller;
+ #interrupt-cells = <2>;
+ };
+
+ pcf_hdmi: pcf8575@26 {
+ compatible = "ti,pcf8575", "nxp,pcf8575";
+ reg = <0x26>;
+ gpio-controller;
+ #gpio-cells = <2>;
+ p1 {
+ /* vin6_sel_s0: high: VIN6, low: audio */
+ gpio-hog;
+ gpios = <1 GPIO_ACTIVE_HIGH>;
+ output-low;
+ line-name = "vin6_sel_s0";
+ };
+ };
+
+ tlv320aic3106: tlv320aic3106@19 {
+ #sound-dai-cells = <0>;
+ compatible = "ti,tlv320aic3106";
+ reg = <0x19>;
+ adc-settle-ms = <40>;
+ ai3x-micbias-vg = <1>; /* 2.0V */
+ status = "okay";
+
+ /* Regulators */
+ AVDD-supply = <&vio_3v3>;
+ IOVDD-supply = <&vio_3v3>;
+ DRVDD-supply = <&vio_3v3>;
+ DVDD-supply = <&aic_dvdd>;
+ };
+};
+
+&cpu0 {
+ vdd-supply = <&buck10_reg>;
+};
+
+&mmc1 {
+ status = "okay";
+ vmmc-supply = <&vio_3v3_sd>;
+ vmmc_aux-supply = <&ldo4_reg>;
+ bus-width = <4>;
+ /*
+ * SDCD signal is not being used here - using the fact that GPIO mode
+ * is always hardwired.
+ */
+ cd-gpios = <&gpio6 27 GPIO_ACTIVE_LOW>;
+ pinctrl-names = "default";
+ pinctrl-0 = <&mmc1_pins_default>;
+};
+
+&mmc2 {
+ status = "okay";
+ vmmc-supply = <&vio_1v8>;
+ bus-width = <8>;
+ pinctrl-names = "default";
+ pinctrl-0 = <&mmc2_pins_default>;
+};
+
+/* No RTC on this device */
+&rtc {
+ status = "disabled";
+};
+
+&mac {
+ status = "okay";
+
+ dual_emac;
+};
+
+&cpsw_emac0 {
+ phy_id = <&davinci_mdio>, <2>;
+ phy-mode = "rgmii-id";
+ dual_emac_res_vlan = <1>;
+};
+
+&cpsw_emac1 {
+ phy_id = <&davinci_mdio>, <3>;
+ phy-mode = "rgmii-id";
+ dual_emac_res_vlan = <2>;
+};
+
+&davinci_mdio {
+ dp83867_0: ethernet-phy@2 {
+ reg = <2>;
+ ti,rx-internal-delay = <DP83867_RGMIIDCTL_2_25_NS>;
+ ti,tx-internal-delay = <DP83867_RGMIIDCTL_250_PS>;
+ ti,fifo-depth = <DP83867_PHYCR_FIFO_DEPTH_8_B_NIB>;
+ ti,min-output-impedance;
+ ti,dp83867-rxctrl-strap-quirk;
+ };
+
+ dp83867_1: ethernet-phy@3 {
+ reg = <3>;
+ ti,rx-internal-delay = <DP83867_RGMIIDCTL_2_25_NS>;
+ ti,tx-internal-delay = <DP83867_RGMIIDCTL_250_PS>;
+ ti,fifo-depth = <DP83867_PHYCR_FIFO_DEPTH_8_B_NIB>;
+ ti,min-output-impedance;
+ ti,dp83867-rxctrl-strap-quirk;
+ };
+};
+
+&usb2_phy1 {
+ phy-supply = <&ldo3_reg>;
+};
+
+&usb2_phy2 {
+ phy-supply = <&ldo3_reg>;
+};
+
+&qspi {
+ spi-max-frequency = <96000000>;
+ m25p80@0 {
+ spi-max-frequency = <96000000>;
+ };
+};
--- /dev/null
+/*
+ * Copyright (C) 2017 Texas Instruments Incorporated - http://www.ti.com/
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+
+#include "dra74x.dtsi"
+
+/ {
+ compatible = "ti,dra762", "ti,dra7";
+
+};
+
+/* MCAN interrupts are hard-wired to irqs 67, 68 */
+&crossbar_mpu {
+ ti,irqs-skip = <10 67 68 133 139 140>;
+};
compatible = "ti,omap4-dpll-clock";
clocks = <&sys_clkin1>, <&dpll_dsp_byp_mux>;
reg = <0x0234>, <0x0238>, <0x0240>, <0x023c>;
+ assigned-clocks = <&dpll_dsp_ck>;
+ assigned-clock-rates = <600000000>;
};
dpll_dsp_m2_ck: dpll_dsp_m2_ck@244 {
reg = <0x0244>;
ti,index-starts-at-one;
ti,invert-autoidle-bit;
+ assigned-clocks = <&dpll_dsp_m2_ck>;
+ assigned-clock-rates = <600000000>;
};
iva_dpll_hs_clk_div: iva_dpll_hs_clk_div {
compatible = "ti,omap4-dpll-clock";
clocks = <&sys_clkin1>, <&dpll_iva_byp_mux>;
reg = <0x01a0>, <0x01a4>, <0x01ac>, <0x01a8>;
+ assigned-clocks = <&dpll_iva_ck>;
+ assigned-clock-rates = <1165000000>;
};
dpll_iva_m2_ck: dpll_iva_m2_ck@1b0 {
reg = <0x01b0>;
ti,index-starts-at-one;
ti,invert-autoidle-bit;
+ assigned-clocks = <&dpll_iva_m2_ck>;
+ assigned-clock-rates = <388333334>;
};
iva_dclk: iva_dclk {
compatible = "ti,omap4-dpll-clock";
clocks = <&sys_clkin1>, <&dpll_gpu_byp_mux>;
reg = <0x02d8>, <0x02dc>, <0x02e4>, <0x02e0>;
+ assigned-clocks = <&dpll_gpu_ck>;
+ assigned-clock-rates = <1277000000>;
};
dpll_gpu_m2_ck: dpll_gpu_m2_ck@2e8 {
reg = <0x02e8>;
ti,index-starts-at-one;
ti,invert-autoidle-bit;
+ assigned-clocks = <&dpll_gpu_m2_ck>;
+ assigned-clock-rates = <425666667>;
};
dpll_core_m2_ck: dpll_core_m2_ck@130 {
reg = <0x0248>;
ti,index-starts-at-one;
ti,invert-autoidle-bit;
+ assigned-clocks = <&dpll_dsp_m3x2_ck>;
+ assigned-clock-rates = <400000000>;
};
dpll_gmac_x2_ck: dpll_gmac_x2_ck {
clocks = <&dpll_abe_m2x2_ck>, <&dpll_core_h22x2_ck>;
ti,bit-shift = <24>;
reg = <0x0520>;
+ assigned-clocks = <&ipu1_gfclk_mux>;
+ assigned-clock-parents = <&dpll_core_h22x2_ck>;
};
mcasp1_ahclkr_mux: mcasp1_ahclkr_mux@550 {
clocks = <&dpll_core_h14x2_ck>, <&dpll_per_h14x2_ck>, <&dpll_gpu_m2_ck>;
ti,bit-shift = <24>;
reg = <0x1220>;
+ assigned-clocks = <&gpu_core_gclk_mux>;
+ assigned-clock-parents = <&dpll_gpu_m2_ck>;
};
gpu_hyd_gclk_mux: gpu_hyd_gclk_mux@1220 {
clocks = <&dpll_core_h14x2_ck>, <&dpll_per_h14x2_ck>, <&dpll_gpu_m2_ck>;
ti,bit-shift = <26>;
reg = <0x1220>;
+ assigned-clocks = <&gpu_hyd_gclk_mux>;
+ assigned-clock-parents = <&dpll_gpu_m2_ck>;
};
l3instr_ts_gclk_div: l3instr_ts_gclk_div@e50 {
};
i2c-gpio-0 {
+ #address-cells = <1>;
+ #size-cells = <0>;
status = "okay";
pcf8563@50 {
--- /dev/null
+/*
+ * NXP ls1088a QDS board device tree source
+ *
+ * Copyright 2017 NXP
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+/dts-v1/;
+
+#include "fsl-ls1088a.dtsi"
+
+/ {
+ model = "NXP Layerscape 1088a QDS Board";
+ compatible = "fsl,ls1088a-qds", "fsl,ls1088a";
+ aliases {
+ spi0 = &qspi;
+ spi1 = &dspi;
+ };
+};
+
+&dspi {
+ bus-num = <0>;
+ status = "okay";
+
+ dflash0: n25q128a {
+ #address-cells = <1>;
+ #size-cells = <1>;
+ compatible = "spi-flash";
+ reg = <0>;
+ spi-max-frequency = <1000000>; /* input clock */
+ };
+
+ dflash1: sst25wf040b {
+ #address-cells = <1>;
+ #size-cells = <1>;
+ compatible = "spi-flash";
+ spi-max-frequency = <3500000>;
+ reg = <1>;
+ };
+
+ dflash2: en25s64 {
+ #address-cells = <1>;
+ #size-cells = <1>;
+ compatible = "spi-flash";
+ spi-max-frequency = <3500000>;
+ reg = <2>;
+ };
+};
+
+&qspi {
+ bus-num = <0>;
+ status = "okay";
+
+ qflash0: s25fs512s@0 {
+ #address-cells = <1>;
+ #size-cells = <1>;
+ compatible = "spi-flash";
+ spi-max-frequency = <50000000>;
+ reg = <0>;
+ };
+
+ qflash1: s25fs512s@1 {
+ #address-cells = <1>;
+ #size-cells = <1>;
+ compatible = "spi-flash";
+ spi-max-frequency = <50000000>;
+ reg = <1>;
+ };
+};
--- /dev/null
+/*
+ * NXP ls1088a RDB board device tree source
+ *
+ * Copyright 2017 NXP
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+/dts-v1/;
+
+#include "fsl-ls1088a.dtsi"
+
+/ {
+ model = "NXP Layerscape 1088a RDB Board";
+ compatible = "fsl,ls1088a-rdb", "fsl,ls1088a";
+ aliases {
+ spi0 = &qspi;
+ };
+};
+
+&qspi {
+ bus-num = <0>;
+ status = "okay";
+
+ qflash0: s25fs512s@0 {
+ #address-cells = <1>;
+ #size-cells = <1>;
+ compatible = "spi-flash";
+ spi-max-frequency = <50000000>;
+ reg = <0>;
+ };
+
+ qflash1: s25fs512s@1 {
+ #address-cells = <1>;
+ #size-cells = <1>;
+ compatible = "spi-flash";
+ spi-max-frequency = <50000000>;
+ reg = <1>;
+ };
+};
--- /dev/null
+/*
+ * NXP ls1088a SOC common device tree source
+ *
+ * Copyright 2017 NXP
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+/ {
+ compatible = "fsl,ls1088a";
+ interrupt-parent = <&gic>;
+ #address-cells = <2>;
+ #size-cells = <2>;
+
+ memory@80000000 {
+ device_type = "memory";
+ reg = <0x00000000 0x80000000 0 0x80000000>;
+ /* DRAM space - 1, size : 2 GB DRAM */
+ };
+
+ gic: interrupt-controller@6000000 {
+ compatible = "arm,gic-v3";
+ reg = <0x0 0x06000000 0 0x10000>, /* GIC Dist */
+ <0x0 0x06100000 0 0x100000>; /* GICR (RD_base + SGI_base) */
+ #interrupt-cells = <3>;
+ interrupt-controller;
+ interrupts = <1 9 0x4>;
+ };
+
+ timer {
+ compatible = "arm,armv8-timer";
+ interrupts = <1 13 0x8>, /* Physical Secure PPI, active-low */
+ <1 14 0x8>, /* Physical Non-Secure PPI, active-low */
+ <1 11 0x8>, /* Virtual PPI, active-low */
+ <1 10 0x8>; /* Hypervisor PPI, active-low */
+ };
+
+ serial0: serial@21c0500 {
+ device_type = "serial";
+ compatible = "fsl,ns16550", "ns16550a";
+ reg = <0x0 0x21c0500 0x0 0x100>;
+ clock-frequency = <0>; /* Updated by bootloader */
+ interrupts = <0 32 0x1>; /* edge triggered */
+ };
+
+ serial1: serial@21c0600 {
+ device_type = "serial";
+ compatible = "fsl,ns16550", "ns16550a";
+ reg = <0x0 0x21c0600 0x0 0x100>;
+ clock-frequency = <0>; /* Updated by bootloader */
+ interrupts = <0 32 0x1>; /* edge triggered */
+ };
+
+ fsl_mc: fsl-mc@80c000000 {
+ compatible = "fsl,qoriq-mc";
+ reg = <0x00000008 0x0c000000 0 0x40>, /* MC portal base */
+ <0x00000000 0x08340000 0 0x40000>; /* MC control reg */
+ };
+
+ dspi: dspi@2100000 {
+ compatible = "fsl,vf610-dspi";
+ #address-cells = <1>;
+ #size-cells = <0>;
+ reg = <0x0 0x2100000 0x0 0x10000>;
+ interrupts = <0 26 0x4>; /* Level high type */
+ num-cs = <6>;
+ };
+
+ qspi: quadspi@1550000 {
+ compatible = "fsl,vf610-qspi";
+ #address-cells = <1>;
+ #size-cells = <0>;
+ reg = <0x0 0x20c0000 0x0 0x10000>,
+ <0x0 0x20000000 0x0 0x10000000>;
+ reg-names = "QuadSPI", "QuadSPI-memory";
+ num-cs = <4>;
+ };
+
+ pcie@3400000 {
+ compatible = "fsl,ls-pcie", "snps,dw-pcie";
+ reg = <0x00 0x03400000 0x0 0x80000 /* dbi registers */
+ 0x00 0x03480000 0x0 0x80000 /* lut registers */
+ 0x00 0x034c0000 0x0 0x40000 /* pf controls registers */
+ 0x20 0x00000000 0x0 0x20000>; /* configuration space */
+ reg-names = "dbi", "lut", "ctrl", "config";
+ #address-cells = <3>;
+ #size-cells = <2>;
+ device_type = "pci";
+ num-lanes = <4>;
+ bus-range = <0x0 0xff>;
+ ranges = <0x81000000 0x0 0x00000000 0x20 0x00020000 0x0 0x00010000 /* downstream I/O */
+ 0x82000000 0x0 0x40000000 0x20 0x40000000 0x0 0x40000000>; /* non-prefetchable memory */
+ };
+
+ pcie@3500000 {
+ compatible = "fsl,ls-pcie", "snps,dw-pcie";
+ reg = <0x00 0x03500000 0x0 0x80000 /* dbi registers */
+ 0x00 0x03580000 0x0 0x80000 /* lut registers */
+ 0x00 0x035c0000 0x0 0x40000 /* pf controls registers */
+ 0x28 0x00000000 0x0 0x20000>; /* configuration space */
+ reg-names = "dbi", "lut", "ctrl", "config";
+ #address-cells = <3>;
+ #size-cells = <2>;
+ device_type = "pci";
+ num-lanes = <4>;
+ bus-range = <0x0 0xff>;
+ ranges = <0x81000000 0x0 0x00000000 0x28 0x00020000 0x0 0x00010000 /* downstream I/O */
+ 0x82000000 0x0 0x40000000 0x28 0x40000000 0x0 0x40000000>; /* non-prefetchable memory */
+ };
+
+ pcie@3600000 {
+ compatible = "fsl,ls-pcie", "snps,dw-pcie";
+ reg = <0x00 0x03600000 0x0 0x80000 /* dbi registers */
+ 0x00 0x03680000 0x0 0x80000 /* lut registers */
+ 0x00 0x036c0000 0x0 0x40000 /* pf controls registers */
+ 0x30 0x00000000 0x0 0x20000>; /* configuration space */
+ reg-names = "dbi", "lut", "ctrl", "config";
+ #address-cells = <3>;
+ #size-cells = <2>;
+ device_type = "pci";
+ num-lanes = <8>;
+ bus-range = <0x0 0xff>;
+ ranges = <0x81000000 0x0 0x00000000 0x30 0x00020000 0x0 0x00010000 /* downstream I/O */
+ 0x82000000 0x0 0x40000000 0x30 0x40000000 0x0 0x40000000>; /* non-prefetchable memory */
+ };
+};
--- /dev/null
+/*
+ * Copyright (C) 2017
+ * Logic PD - http://www.logicpd.com
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+/ {
+ chosen {
+ stdout-path = &uart1;
+ };
+};
+
+&i2c1 {
+ clock-frequency = <400000>;
+};
+
+&i2c2 {
+ clock-frequency = <400000>;
+};
+
+&mmc1 {
+ cd-inverted;
+};
+
+&mmc2 {
+ status = "disabled";
+};
+
+&mmc3 {
+ status = "disabled";
+};
+
+&uart1 {
+ reg-shift = <2>;
+};
+
+&uart2 {
+ reg-shift = <2>;
+};
+
+&uart3 {
+ reg-shift = <2>;
+};
+
model = "LogicPD Zoom DM3730 Torpedo + Wireless Development Kit";
compatible = "logicpd,dm3730-torpedo-devkit", "ti,omap3630", "ti,omap3";
- chosen {
- stdout-path = &uart1;
- };
-
gpio_keys {
compatible = "gpio-keys";
pinctrl-names = "default";
interrupts-extended = <&intc 83 &omap3_pmx_core 0x11a>;
pinctrl-names = "default";
pinctrl-0 = <&mmc1_pins &mmc1_cd>;
+ cd-gpios = <&gpio4 31 IRQ_TYPE_LEVEL_LOW>; /* gpio127 */
vmmc-supply = <&vmmc1>;
bus-width = <4>;
cap-power-off-card;
};
-&mmc2 {
- status = "disabled";
-};
-
&omap3_pmx_core {
gpio_key_pins: pinmux_gpio_key_pins {
pinctrl-single,pins = <
OMAP3_CORE1_IOPAD(0x2110, PIN_INPUT | MUX_MODE0) /* cam_xclka.cam_xclka */
OMAP3_CORE1_IOPAD(0x2112, PIN_INPUT | MUX_MODE0) /* cam_pclk.cam_pclk */
- OMAP3_CORE1_IOPAD(0x2114, PIN_INPUT | MUX_MODE0) /* cam_d0.cam_d0 */
- OMAP3_CORE1_IOPAD(0x2116, PIN_INPUT | MUX_MODE0) /* cam_d1.cam_d1 */
- OMAP3_CORE1_IOPAD(0x2118, PIN_INPUT | MUX_MODE0) /* cam_d2.cam_d2 */
+ OMAP3_CORE1_IOPAD(0x2116, PIN_INPUT | MUX_MODE0) /* cam_d0.cam_d0 */
+ OMAP3_CORE1_IOPAD(0x2118, PIN_INPUT | MUX_MODE0) /* cam_d1.cam_d1 */
+ OMAP3_CORE1_IOPAD(0x211a, PIN_INPUT | MUX_MODE0) /* cam_d2.cam_d2 */
OMAP3_CORE1_IOPAD(0x211c, PIN_INPUT | MUX_MODE0) /* cam_d3.cam_d3 */
OMAP3_CORE1_IOPAD(0x211e, PIN_INPUT | MUX_MODE0) /* cam_d4.cam_d4 */
OMAP3_CORE1_IOPAD(0x2120, PIN_INPUT | MUX_MODE0) /* cam_d5.cam_d5 */
--- /dev/null
+/*
+ * Device Tree Source for OMAP3 SoC CPU thermal
+ *
+ * Copyright (C) 2017 Texas Instruments Incorporated - http://www.ti.com/
+ *
+ * This file is licensed under the terms of the GNU General Public License
+ * version 2. This program is licensed "as is" without any warranty of any
+ * kind, whether express or implied.
+ */
+
+#include <dt-bindings/thermal/thermal.h>
+
+cpu_thermal: cpu_thermal {
+ polling-delay-passive = <250>; /* milliseconds */
+ polling-delay = <1000>; /* milliseconds */
+ coefficients = <0 20000>;
+
+ /* sensor ID */
+ thermal-sensors = <&bandgap 0>;
+};
--- /dev/null
+/*
+ * Copyright (C) 2017
+ * Logic PD - http://www.logicpd.com
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+&uart1 {
+ reg-shift = <2>;
+};
+
+&uart2 {
+ reg-shift = <2>;
+};
+
+&uart3 {
+ reg-shift = <2>;
+};
+
#include <dt-bindings/pinctrl/omap.h>
/ {
- compatible = "ti,omap3430", "ti,omap3";
- interrupt-parent = <&intc>;
- #address-cells = <1>;
- #size-cells = <1>;
- chosen { };
-
- aliases {
- i2c0 = &i2c1;
- i2c1 = &i2c2;
- i2c2 = &i2c3;
- serial0 = &uart1;
- serial1 = &uart2;
- serial2 = &uart3;
- };
-
- cpus {
- #address-cells = <1>;
- #size-cells = <0>;
-
- cpu@0 {
- compatible = "arm,cortex-a8";
- device_type = "cpu";
- reg = <0x0>;
-
- clocks = <&dpll1_ck>;
- clock-names = "cpu";
-
- clock-latency = <300000>; /* From omap-cpufreq driver */
- };
- };
-
- pmu@54000000 {
- compatible = "arm,cortex-a8-pmu";
- reg = <0x54000000 0x800000>;
- interrupts = <3>;
- ti,hwmods = "debugss";
- };
-
- /*
- * The soc node represents the soc top level view. It is used for IPs
- * that are not memory mapped in the MPU view or for the MPU itself.
- */
- soc {
- compatible = "ti,omap-infra";
- mpu {
- compatible = "ti,omap3-mpu";
- ti,hwmods = "mpu";
- };
-
- iva: iva {
- compatible = "ti,iva2.2";
- ti,hwmods = "iva";
-
- dsp {
- compatible = "ti,omap3-c64";
- };
- };
- };
-
- /*
- * XXX: Use a flat representation of the OMAP3 interconnect.
- * The real OMAP interconnect network is quite complex.
- * Since it will not bring real advantage to represent that in DT for
- * the moment, just use a fake OCP bus entry to represent the whole bus
- * hierarchy.
- */
- ocp@68000000 {
- compatible = "ti,omap3-l3-smx", "simple-bus";
- reg = <0x68000000 0x10000>;
- interrupts = <9 10>;
- #address-cells = <1>;
- #size-cells = <1>;
- ranges;
- ti,hwmods = "l3_main";
-
- l4_core: l4@48000000 {
- compatible = "ti,omap3-l4-core", "simple-bus";
- #address-cells = <1>;
- #size-cells = <1>;
- ranges = <0 0x48000000 0x1000000>;
-
- scm: scm@2000 {
- compatible = "ti,omap3-scm", "simple-bus";
- reg = <0x2000 0x2000>;
- #address-cells = <1>;
- #size-cells = <1>;
- ranges = <0 0x2000 0x2000>;
-
- omap3_pmx_core: pinmux@30 {
- compatible = "ti,omap3-padconf",
- "pinctrl-single";
- reg = <0x30 0x238>;
- #address-cells = <1>;
- #size-cells = <0>;
- #interrupt-cells = <1>;
- interrupt-controller;
- pinctrl-single,register-width = <16>;
- pinctrl-single,function-mask = <0xff1f>;
- };
-
- scm_conf: scm_conf@270 {
- compatible = "syscon", "simple-bus";
- reg = <0x270 0x330>;
- #address-cells = <1>;
- #size-cells = <1>;
- ranges = <0 0x270 0x330>;
-
- pbias_regulator: pbias_regulator@2b0 {
- compatible = "ti,pbias-omap3", "ti,pbias-omap";
- reg = <0x2b0 0x4>;
- syscon = <&scm_conf>;
- pbias_mmc_reg: pbias_mmc_omap2430 {
- regulator-name = "pbias_mmc_omap2430";
- regulator-min-microvolt = <1800000>;
- regulator-max-microvolt = <3000000>;
- };
- };
-
- scm_clocks: clocks {
- #address-cells = <1>;
- #size-cells = <0>;
- };
- };
-
- scm_clockdomains: clockdomains {
- };
-
- omap3_pmx_wkup: pinmux@a00 {
- compatible = "ti,omap3-padconf",
- "pinctrl-single";
- reg = <0xa00 0x5c>;
- #address-cells = <1>;
- #size-cells = <0>;
- #interrupt-cells = <1>;
- interrupt-controller;
- pinctrl-single,register-width = <16>;
- pinctrl-single,function-mask = <0xff1f>;
- };
- };
- };
-
- aes: aes@480c5000 {
- compatible = "ti,omap3-aes";
- ti,hwmods = "aes";
- reg = <0x480c5000 0x50>;
- interrupts = <0>;
- dmas = <&sdma 65 &sdma 66>;
- dma-names = "tx", "rx";
- };
-
- prm: prm@48306000 {
- compatible = "ti,omap3-prm";
- reg = <0x48306000 0x4000>;
- interrupts = <11>;
-
- prm_clocks: clocks {
- #address-cells = <1>;
- #size-cells = <0>;
- };
-
- prm_clockdomains: clockdomains {
- };
- };
-
- cm: cm@48004000 {
- compatible = "ti,omap3-cm";
- reg = <0x48004000 0x4000>;
-
- cm_clocks: clocks {
- #address-cells = <1>;
- #size-cells = <0>;
- };
-
- cm_clockdomains: clockdomains {
- };
- };
-
- counter32k: counter@48320000 {
- compatible = "ti,omap-counter32k";
- reg = <0x48320000 0x20>;
- ti,hwmods = "counter_32k";
- };
-
- intc: interrupt-controller@48200000 {
- compatible = "ti,omap3-intc";
- interrupt-controller;
- #interrupt-cells = <1>;
- reg = <0x48200000 0x1000>;
- };
-
- sdma: dma-controller@48056000 {
- compatible = "ti,omap3630-sdma", "ti,omap3430-sdma";
- reg = <0x48056000 0x1000>;
- interrupts = <12>,
- <13>,
- <14>,
- <15>;
- #dma-cells = <1>;
- dma-channels = <32>;
- dma-requests = <96>;
- };
-
- gpio1: gpio@48310000 {
- compatible = "ti,omap3-gpio";
- reg = <0x48310000 0x200>;
- interrupts = <29>;
- ti,hwmods = "gpio1";
- ti,gpio-always-on;
- gpio-controller;
- #gpio-cells = <2>;
- interrupt-controller;
- #interrupt-cells = <2>;
- };
-
- gpio2: gpio@49050000 {
- compatible = "ti,omap3-gpio";
- reg = <0x49050000 0x200>;
- interrupts = <30>;
- ti,hwmods = "gpio2";
- gpio-controller;
- #gpio-cells = <2>;
- interrupt-controller;
- #interrupt-cells = <2>;
- };
-
- gpio3: gpio@49052000 {
- compatible = "ti,omap3-gpio";
- reg = <0x49052000 0x200>;
- interrupts = <31>;
- ti,hwmods = "gpio3";
- gpio-controller;
- #gpio-cells = <2>;
- interrupt-controller;
- #interrupt-cells = <2>;
- };
-
- gpio4: gpio@49054000 {
- compatible = "ti,omap3-gpio";
- reg = <0x49054000 0x200>;
- interrupts = <32>;
- ti,hwmods = "gpio4";
- gpio-controller;
- #gpio-cells = <2>;
- interrupt-controller;
- #interrupt-cells = <2>;
- };
-
- gpio5: gpio@49056000 {
- compatible = "ti,omap3-gpio";
- reg = <0x49056000 0x200>;
- interrupts = <33>;
- ti,hwmods = "gpio5";
- gpio-controller;
- #gpio-cells = <2>;
- interrupt-controller;
- #interrupt-cells = <2>;
- };
-
- gpio6: gpio@49058000 {
- compatible = "ti,omap3-gpio";
- reg = <0x49058000 0x200>;
- interrupts = <34>;
- ti,hwmods = "gpio6";
- gpio-controller;
- #gpio-cells = <2>;
- interrupt-controller;
- #interrupt-cells = <2>;
- };
-
- uart1: serial@4806a000 {
- compatible = "ti,omap3-uart";
- reg = <0x4806a000 0x2000>;
- reg-shift = <2>;
- interrupts-extended = <&intc 72>;
- dmas = <&sdma 49 &sdma 50>;
- dma-names = "tx", "rx";
- ti,hwmods = "uart1";
- clock-frequency = <48000000>;
- };
-
- uart2: serial@4806c000 {
- compatible = "ti,omap3-uart";
- reg = <0x4806c000 0x400>;
- interrupts-extended = <&intc 73>;
- dmas = <&sdma 51 &sdma 52>;
- dma-names = "tx", "rx";
- ti,hwmods = "uart2";
- clock-frequency = <48000000>;
- };
-
- uart3: serial@49020000 {
- compatible = "ti,omap3-uart";
- reg = <0x49020000 0x400>;
- interrupts-extended = <&intc 74>;
- dmas = <&sdma 53 &sdma 54>;
- dma-names = "tx", "rx";
- ti,hwmods = "uart3";
- clock-frequency = <48000000>;
- };
-
- i2c1: i2c@48070000 {
- compatible = "ti,omap3-i2c";
- reg = <0x48070000 0x80>;
- interrupts = <56>;
- dmas = <&sdma 27 &sdma 28>;
- dma-names = "tx", "rx";
- #address-cells = <1>;
- #size-cells = <0>;
- ti,hwmods = "i2c1";
- };
-
- i2c2: i2c@48072000 {
- compatible = "ti,omap3-i2c";
- reg = <0x48072000 0x80>;
- interrupts = <57>;
- dmas = <&sdma 29 &sdma 30>;
- dma-names = "tx", "rx";
- #address-cells = <1>;
- #size-cells = <0>;
- ti,hwmods = "i2c2";
- };
-
- i2c3: i2c@48060000 {
- compatible = "ti,omap3-i2c";
- reg = <0x48060000 0x80>;
- interrupts = <61>;
- dmas = <&sdma 25 &sdma 26>;
- dma-names = "tx", "rx";
- #address-cells = <1>;
- #size-cells = <0>;
- ti,hwmods = "i2c3";
- };
-
- mailbox: mailbox@48094000 {
- compatible = "ti,omap3-mailbox";
- ti,hwmods = "mailbox";
- reg = <0x48094000 0x200>;
- interrupts = <26>;
- #mbox-cells = <1>;
- ti,mbox-num-users = <2>;
- ti,mbox-num-fifos = <2>;
- mbox_dsp: dsp {
- ti,mbox-tx = <0 0 0>;
- ti,mbox-rx = <1 0 0>;
- };
- };
-
- mcspi1: spi@48098000 {
- compatible = "ti,omap2-mcspi";
- reg = <0x48098000 0x100>;
- interrupts = <65>;
- #address-cells = <1>;
- #size-cells = <0>;
- ti,hwmods = "mcspi1";
- ti,spi-num-cs = <4>;
- dmas = <&sdma 35>,
- <&sdma 36>,
- <&sdma 37>,
- <&sdma 38>,
- <&sdma 39>,
- <&sdma 40>,
- <&sdma 41>,
- <&sdma 42>;
- dma-names = "tx0", "rx0", "tx1", "rx1",
- "tx2", "rx2", "tx3", "rx3";
- };
-
- mcspi2: spi@4809a000 {
- compatible = "ti,omap2-mcspi";
- reg = <0x4809a000 0x100>;
- interrupts = <66>;
- #address-cells = <1>;
- #size-cells = <0>;
- ti,hwmods = "mcspi2";
- ti,spi-num-cs = <2>;
- dmas = <&sdma 43>,
- <&sdma 44>,
- <&sdma 45>,
- <&sdma 46>;
- dma-names = "tx0", "rx0", "tx1", "rx1";
- };
-
- mcspi3: spi@480b8000 {
- compatible = "ti,omap2-mcspi";
- reg = <0x480b8000 0x100>;
- interrupts = <91>;
- #address-cells = <1>;
- #size-cells = <0>;
- ti,hwmods = "mcspi3";
- ti,spi-num-cs = <2>;
- dmas = <&sdma 15>,
- <&sdma 16>,
- <&sdma 23>,
- <&sdma 24>;
- dma-names = "tx0", "rx0", "tx1", "rx1";
- };
-
- mcspi4: spi@480ba000 {
- compatible = "ti,omap2-mcspi";
- reg = <0x480ba000 0x100>;
- interrupts = <48>;
- #address-cells = <1>;
- #size-cells = <0>;
- ti,hwmods = "mcspi4";
- ti,spi-num-cs = <1>;
- dmas = <&sdma 70>, <&sdma 71>;
- dma-names = "tx0", "rx0";
- };
-
- hdqw1w: 1w@480b2000 {
- compatible = "ti,omap3-1w";
- reg = <0x480b2000 0x1000>;
- interrupts = <58>;
- ti,hwmods = "hdq1w";
- };
-
- mmc1: mmc@4809c000 {
- compatible = "ti,omap3-hsmmc";
- reg = <0x4809c000 0x200>;
- interrupts = <83>;
- ti,hwmods = "mmc1";
- ti,dual-volt;
- dmas = <&sdma 61>, <&sdma 62>;
- dma-names = "tx", "rx";
- pbias-supply = <&pbias_mmc_reg>;
- };
-
- mmc2: mmc@480b4000 {
- compatible = "ti,omap3-hsmmc";
- reg = <0x480b4000 0x200>;
- interrupts = <86>;
- ti,hwmods = "mmc2";
- dmas = <&sdma 47>, <&sdma 48>;
- dma-names = "tx", "rx";
- };
-
- mmc3: mmc@480ad000 {
- compatible = "ti,omap3-hsmmc";
- reg = <0x480ad000 0x200>;
- interrupts = <94>;
- ti,hwmods = "mmc3";
- dmas = <&sdma 77>, <&sdma 78>;
- dma-names = "tx", "rx";
- };
-
- mmu_isp: mmu@480bd400 {
- #iommu-cells = <0>;
- compatible = "ti,omap2-iommu";
- reg = <0x480bd400 0x80>;
- interrupts = <24>;
- ti,hwmods = "mmu_isp";
- ti,#tlb-entries = <8>;
- };
-
- mmu_iva: mmu@5d000000 {
- #iommu-cells = <0>;
- compatible = "ti,omap2-iommu";
- reg = <0x5d000000 0x80>;
- interrupts = <28>;
- ti,hwmods = "mmu_iva";
- status = "disabled";
- };
-
- wdt2: wdt@48314000 {
- compatible = "ti,omap3-wdt";
- reg = <0x48314000 0x80>;
- ti,hwmods = "wd_timer2";
- };
-
- mcbsp1: mcbsp@48074000 {
- compatible = "ti,omap3-mcbsp";
- reg = <0x48074000 0xff>;
- reg-names = "mpu";
- interrupts = <16>, /* OCP compliant interrupt */
- <59>, /* TX interrupt */
- <60>; /* RX interrupt */
- interrupt-names = "common", "tx", "rx";
- ti,buffer-size = <128>;
- ti,hwmods = "mcbsp1";
- dmas = <&sdma 31>,
- <&sdma 32>;
- dma-names = "tx", "rx";
- clocks = <&mcbsp1_fck>;
- clock-names = "fck";
- status = "disabled";
- };
-
- mcbsp2: mcbsp@49022000 {
- compatible = "ti,omap3-mcbsp";
- reg = <0x49022000 0xff>,
- <0x49028000 0xff>;
- reg-names = "mpu", "sidetone";
- interrupts = <17>, /* OCP compliant interrupt */
- <62>, /* TX interrupt */
- <63>, /* RX interrupt */
- <4>; /* Sidetone */
- interrupt-names = "common", "tx", "rx", "sidetone";
- ti,buffer-size = <1280>;
- ti,hwmods = "mcbsp2", "mcbsp2_sidetone";
- dmas = <&sdma 33>,
- <&sdma 34>;
- dma-names = "tx", "rx";
- clocks = <&mcbsp2_fck>, <&mcbsp2_ick>;
- clock-names = "fck", "ick";
- status = "disabled";
- };
-
- mcbsp3: mcbsp@49024000 {
- compatible = "ti,omap3-mcbsp";
- reg = <0x49024000 0xff>,
- <0x4902a000 0xff>;
- reg-names = "mpu", "sidetone";
- interrupts = <22>, /* OCP compliant interrupt */
- <89>, /* TX interrupt */
- <90>, /* RX interrupt */
- <5>; /* Sidetone */
- interrupt-names = "common", "tx", "rx", "sidetone";
- ti,buffer-size = <128>;
- ti,hwmods = "mcbsp3", "mcbsp3_sidetone";
- dmas = <&sdma 17>,
- <&sdma 18>;
- dma-names = "tx", "rx";
- clocks = <&mcbsp3_fck>, <&mcbsp3_ick>;
- clock-names = "fck", "ick";
- status = "disabled";
- };
-
- mcbsp4: mcbsp@49026000 {
- compatible = "ti,omap3-mcbsp";
- reg = <0x49026000 0xff>;
- reg-names = "mpu";
- interrupts = <23>, /* OCP compliant interrupt */
- <54>, /* TX interrupt */
- <55>; /* RX interrupt */
- interrupt-names = "common", "tx", "rx";
- ti,buffer-size = <128>;
- ti,hwmods = "mcbsp4";
- dmas = <&sdma 19>,
- <&sdma 20>;
- dma-names = "tx", "rx";
- clocks = <&mcbsp4_fck>;
- clock-names = "fck";
- status = "disabled";
- };
-
- mcbsp5: mcbsp@48096000 {
- compatible = "ti,omap3-mcbsp";
- reg = <0x48096000 0xff>;
- reg-names = "mpu";
- interrupts = <27>, /* OCP compliant interrupt */
- <81>, /* TX interrupt */
- <82>; /* RX interrupt */
- interrupt-names = "common", "tx", "rx";
- ti,buffer-size = <128>;
- ti,hwmods = "mcbsp5";
- dmas = <&sdma 21>,
- <&sdma 22>;
- dma-names = "tx", "rx";
- clocks = <&mcbsp5_fck>;
- clock-names = "fck";
- status = "disabled";
- };
-
- sham: sham@480c3000 {
- compatible = "ti,omap3-sham";
- ti,hwmods = "sham";
- reg = <0x480c3000 0x64>;
- interrupts = <49>;
- dmas = <&sdma 69>;
- dma-names = "rx";
- };
-
- smartreflex_core: smartreflex@480cb000 {
- compatible = "ti,omap3-smartreflex-core";
- ti,hwmods = "smartreflex_core";
- reg = <0x480cb000 0x400>;
- interrupts = <19>;
- };
-
- smartreflex_mpu_iva: smartreflex@480c9000 {
- compatible = "ti,omap3-smartreflex-iva";
- ti,hwmods = "smartreflex_mpu_iva";
- reg = <0x480c9000 0x400>;
- interrupts = <18>;
- };
-
- timer1: timer@48318000 {
- compatible = "ti,omap3430-timer";
- reg = <0x48318000 0x400>;
- interrupts = <37>;
- ti,hwmods = "timer1";
- ti,timer-alwon;
- };
-
- timer2: timer@49032000 {
- compatible = "ti,omap3430-timer";
- reg = <0x49032000 0x400>;
- interrupts = <38>;
- ti,hwmods = "timer2";
- };
-
- timer3: timer@49034000 {
- compatible = "ti,omap3430-timer";
- reg = <0x49034000 0x400>;
- interrupts = <39>;
- ti,hwmods = "timer3";
- };
-
- timer4: timer@49036000 {
- compatible = "ti,omap3430-timer";
- reg = <0x49036000 0x400>;
- interrupts = <40>;
- ti,hwmods = "timer4";
- };
-
- timer5: timer@49038000 {
- compatible = "ti,omap3430-timer";
- reg = <0x49038000 0x400>;
- interrupts = <41>;
- ti,hwmods = "timer5";
- ti,timer-dsp;
- };
-
- timer6: timer@4903a000 {
- compatible = "ti,omap3430-timer";
- reg = <0x4903a000 0x400>;
- interrupts = <42>;
- ti,hwmods = "timer6";
- ti,timer-dsp;
- };
-
- timer7: timer@4903c000 {
- compatible = "ti,omap3430-timer";
- reg = <0x4903c000 0x400>;
- interrupts = <43>;
- ti,hwmods = "timer7";
- ti,timer-dsp;
- };
-
- timer8: timer@4903e000 {
- compatible = "ti,omap3430-timer";
- reg = <0x4903e000 0x400>;
- interrupts = <44>;
- ti,hwmods = "timer8";
- ti,timer-pwm;
- ti,timer-dsp;
- };
-
- timer9: timer@49040000 {
- compatible = "ti,omap3430-timer";
- reg = <0x49040000 0x400>;
- interrupts = <45>;
- ti,hwmods = "timer9";
- ti,timer-pwm;
- };
-
- timer10: timer@48086000 {
- compatible = "ti,omap3430-timer";
- reg = <0x48086000 0x400>;
- interrupts = <46>;
- ti,hwmods = "timer10";
- ti,timer-pwm;
- };
-
- timer11: timer@48088000 {
- compatible = "ti,omap3430-timer";
- reg = <0x48088000 0x400>;
- interrupts = <47>;
- ti,hwmods = "timer11";
- ti,timer-pwm;
- };
-
- timer12: timer@48304000 {
- compatible = "ti,omap3430-timer";
- reg = <0x48304000 0x400>;
- interrupts = <95>;
- ti,hwmods = "timer12";
- ti,timer-alwon;
- ti,timer-secure;
- };
-
- usbhstll: usbhstll@48062000 {
- compatible = "ti,usbhs-tll";
- reg = <0x48062000 0x1000>;
- interrupts = <78>;
- ti,hwmods = "usb_tll_hs";
- };
-
- usbhshost: usbhshost@48064000 {
- compatible = "ti,usbhs-host";
- reg = <0x48064000 0x400>;
- ti,hwmods = "usb_host_hs";
- #address-cells = <1>;
- #size-cells = <1>;
- ranges;
-
- usbhsohci: ohci@48064400 {
- compatible = "ti,ohci-omap3";
- reg = <0x48064400 0x400>;
- interrupt-parent = <&intc>;
- interrupts = <76>;
- };
-
- usbhsehci: ehci@48064800 {
- compatible = "ti,ehci-omap";
- reg = <0x48064800 0x400>;
- interrupt-parent = <&intc>;
- interrupts = <77>;
- };
- };
-
- gpmc: gpmc@6e000000 {
- compatible = "ti,omap3430-gpmc";
- ti,hwmods = "gpmc";
- reg = <0x6e000000 0x02d0>;
- interrupts = <20>;
- dmas = <&sdma 4>;
- dma-names = "rxtx";
- gpmc,num-cs = <8>;
- gpmc,num-waitpins = <4>;
- #address-cells = <2>;
- #size-cells = <1>;
- interrupt-controller;
- #interrupt-cells = <2>;
- gpio-controller;
- #gpio-cells = <2>;
- };
-
- usb_otg_hs: usb_otg_hs@480ab000 {
- compatible = "ti,omap3-musb";
- reg = <0x480ab000 0x1000>;
- interrupts = <92>, <93>;
- interrupt-names = "mc", "dma";
- ti,hwmods = "usb_otg_hs";
- multipoint = <1>;
- num-eps = <16>;
- ram-bits = <12>;
- };
-
- dss: dss@48050000 {
- compatible = "ti,omap3-dss";
- reg = <0x48050000 0x200>;
- status = "disabled";
- ti,hwmods = "dss_core";
- clocks = <&dss1_alwon_fck>;
- clock-names = "fck";
- #address-cells = <1>;
- #size-cells = <1>;
- ranges;
-
- dispc@48050400 {
- compatible = "ti,omap3-dispc";
- reg = <0x48050400 0x400>;
- interrupts = <25>;
- ti,hwmods = "dss_dispc";
- clocks = <&dss1_alwon_fck>;
- clock-names = "fck";
- };
-
- dsi: encoder@4804fc00 {
- compatible = "ti,omap3-dsi";
- reg = <0x4804fc00 0x200>,
- <0x4804fe00 0x40>,
- <0x4804ff00 0x20>;
- reg-names = "proto", "phy", "pll";
- interrupts = <25>;
- status = "disabled";
- ti,hwmods = "dss_dsi1";
- clocks = <&dss1_alwon_fck>, <&dss2_alwon_fck>;
- clock-names = "fck", "sys_clk";
- };
-
- rfbi: encoder@48050800 {
- compatible = "ti,omap3-rfbi";
- reg = <0x48050800 0x100>;
- status = "disabled";
- ti,hwmods = "dss_rfbi";
- clocks = <&dss1_alwon_fck>, <&dss_ick>;
- clock-names = "fck", "ick";
- };
-
- venc: encoder@48050c00 {
- compatible = "ti,omap3-venc";
- reg = <0x48050c00 0x100>;
- status = "disabled";
- ti,hwmods = "dss_venc";
- clocks = <&dss_tv_fck>;
- clock-names = "fck";
- };
- };
-
- ssi: ssi-controller@48058000 {
- compatible = "ti,omap3-ssi";
- ti,hwmods = "ssi";
-
- status = "disabled";
-
- reg = <0x48058000 0x1000>,
- <0x48059000 0x1000>;
- reg-names = "sys",
- "gdd";
-
- interrupts = <71>;
- interrupt-names = "gdd_mpu";
-
- #address-cells = <1>;
- #size-cells = <1>;
- ranges;
-
- ssi_port1: ssi-port@4805a000 {
- compatible = "ti,omap3-ssi-port";
-
- reg = <0x4805a000 0x800>,
- <0x4805a800 0x800>;
- reg-names = "tx",
- "rx";
-
- interrupt-parent = <&intc>;
- interrupts = <67>,
- <68>;
- };
-
- ssi_port2: ssi-port@4805b000 {
- compatible = "ti,omap3-ssi-port";
-
- reg = <0x4805b000 0x800>,
- <0x4805b800 0x800>;
- reg-names = "tx",
- "rx";
-
- interrupt-parent = <&intc>;
- interrupts = <69>,
- <70>;
- };
- };
- };
+ compatible = "ti,omap3430", "ti,omap3";
+ interrupt-parent = <&intc>;
+ #address-cells = <1>;
+ #size-cells = <1>;
+ chosen { };
+
+ aliases {
+ i2c0 = &i2c1;
+ i2c1 = &i2c2;
+ i2c2 = &i2c3;
+ serial0 = &uart1;
+ serial1 = &uart2;
+ serial2 = &uart3;
+ };
+
+ cpus {
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+ cpu@0 {
+ compatible = "arm,cortex-a8";
+ device_type = "cpu";
+ reg = <0x0>;
+
+ clocks = <&dpll1_ck>;
+ clock-names = "cpu";
+
+ clock-latency = <300000>; /* From omap-cpufreq driver */
+ };
+ };
+
+ pmu@54000000 {
+ compatible = "arm,cortex-a8-pmu";
+ reg = <0x54000000 0x800000>;
+ interrupts = <3>;
+ ti,hwmods = "debugss";
+ };
+
+ /*
+ * The soc node represents the soc top level view. It is used for IPs
+ * that are not memory mapped in the MPU view or for the MPU itself.
+ */
+ soc {
+ compatible = "ti,omap-infra";
+ mpu {
+ compatible = "ti,omap3-mpu";
+ ti,hwmods = "mpu";
+ };
+
+ iva: iva {
+ compatible = "ti,iva2.2";
+ ti,hwmods = "iva";
+
+ dsp {
+ compatible = "ti,omap3-c64";
+ };
+ };
+ };
+
+ /*
+ * XXX: Use a flat representation of the OMAP3 interconnect.
+ * The real OMAP interconnect network is quite complex.
+ * Since it will not bring real advantage to represent that in DT for
+ * the moment, just use a fake OCP bus entry to represent the whole bus
+ * hierarchy.
+ */
+ ocp@68000000 {
+ compatible = "ti,omap3-l3-smx", "simple-bus";
+ reg = <0x68000000 0x10000>;
+ interrupts = <9 10>;
+ #address-cells = <1>;
+ #size-cells = <1>;
+ ranges;
+ ti,hwmods = "l3_main";
+
+ l4_core: l4@48000000 {
+ compatible = "ti,omap3-l4-core", "simple-bus";
+ #address-cells = <1>;
+ #size-cells = <1>;
+ ranges = <0 0x48000000 0x1000000>;
+
+ scm: scm@2000 {
+ compatible = "ti,omap3-scm", "simple-bus";
+ reg = <0x2000 0x2000>;
+ #address-cells = <1>;
+ #size-cells = <1>;
+ ranges = <0 0x2000 0x2000>;
+
+ omap3_pmx_core: pinmux@30 {
+ compatible = "ti,omap3-padconf",
+ "pinctrl-single";
+ reg = <0x30 0x238>;
+ #address-cells = <1>;
+ #size-cells = <0>;
+ #pinctrl-cells = <1>;
+ #interrupt-cells = <1>;
+ interrupt-controller;
+ pinctrl-single,register-width = <16>;
+ pinctrl-single,function-mask = <0xff1f>;
+ };
+
+ scm_conf: scm_conf@270 {
+ compatible = "syscon", "simple-bus";
+ reg = <0x270 0x330>;
+ #address-cells = <1>;
+ #size-cells = <1>;
+ ranges = <0 0x270 0x330>;
+
+ pbias_regulator: pbias_regulator@2b0 {
+ compatible = "ti,pbias-omap3", "ti,pbias-omap";
+ reg = <0x2b0 0x4>;
+ syscon = <&scm_conf>;
+ pbias_mmc_reg: pbias_mmc_omap2430 {
+ regulator-name = "pbias_mmc_omap2430";
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <3000000>;
+ };
+ };
+
+ scm_clocks: clocks {
+ #address-cells = <1>;
+ #size-cells = <0>;
+ };
+ };
+
+ scm_clockdomains: clockdomains {
+ };
+
+ omap3_pmx_wkup: pinmux@a00 {
+ compatible = "ti,omap3-padconf",
+ "pinctrl-single";
+ reg = <0xa00 0x5c>;
+ #address-cells = <1>;
+ #size-cells = <0>;
+ #pinctrl-cells = <1>;
+ #interrupt-cells = <1>;
+ interrupt-controller;
+ pinctrl-single,register-width = <16>;
+ pinctrl-single,function-mask = <0xff1f>;
+ };
+ };
+ };
+
+ aes: aes@480c5000 {
+ compatible = "ti,omap3-aes";
+ ti,hwmods = "aes";
+ reg = <0x480c5000 0x50>;
+ interrupts = <0>;
+ dmas = <&sdma 65 &sdma 66>;
+ dma-names = "tx", "rx";
+ };
+
+ prm: prm@48306000 {
+ compatible = "ti,omap3-prm";
+ reg = <0x48306000 0x4000>;
+ interrupts = <11>;
+
+ prm_clocks: clocks {
+ #address-cells = <1>;
+ #size-cells = <0>;
+ };
+
+ prm_clockdomains: clockdomains {
+ };
+ };
+
+ cm: cm@48004000 {
+ compatible = "ti,omap3-cm";
+ reg = <0x48004000 0x4000>;
+
+ cm_clocks: clocks {
+ #address-cells = <1>;
+ #size-cells = <0>;
+ };
+
+ cm_clockdomains: clockdomains {
+ };
+ };
+
+ counter32k: counter@48320000 {
+ compatible = "ti,omap-counter32k";
+ reg = <0x48320000 0x20>;
+ ti,hwmods = "counter_32k";
+ };
+
+ intc: interrupt-controller@48200000 {
+ compatible = "ti,omap3-intc";
+ interrupt-controller;
+ #interrupt-cells = <1>;
+ reg = <0x48200000 0x1000>;
+ };
+
+ sdma: dma-controller@48056000 {
+ compatible = "ti,omap3630-sdma", "ti,omap3430-sdma";
+ reg = <0x48056000 0x1000>;
+ interrupts = <12>,
+ <13>,
+ <14>,
+ <15>;
+ #dma-cells = <1>;
+ dma-channels = <32>;
+ dma-requests = <96>;
+ };
+
+ gpio1: gpio@48310000 {
+ compatible = "ti,omap3-gpio";
+ reg = <0x48310000 0x200>;
+ interrupts = <29>;
+ ti,hwmods = "gpio1";
+ ti,gpio-always-on;
+ gpio-controller;
+ #gpio-cells = <2>;
+ interrupt-controller;
+ #interrupt-cells = <2>;
+ };
+
+ gpio2: gpio@49050000 {
+ compatible = "ti,omap3-gpio";
+ reg = <0x49050000 0x200>;
+ interrupts = <30>;
+ ti,hwmods = "gpio2";
+ gpio-controller;
+ #gpio-cells = <2>;
+ interrupt-controller;
+ #interrupt-cells = <2>;
+ };
+
+ gpio3: gpio@49052000 {
+ compatible = "ti,omap3-gpio";
+ reg = <0x49052000 0x200>;
+ interrupts = <31>;
+ ti,hwmods = "gpio3";
+ gpio-controller;
+ #gpio-cells = <2>;
+ interrupt-controller;
+ #interrupt-cells = <2>;
+ };
+
+ gpio4: gpio@49054000 {
+ compatible = "ti,omap3-gpio";
+ reg = <0x49054000 0x200>;
+ interrupts = <32>;
+ ti,hwmods = "gpio4";
+ gpio-controller;
+ #gpio-cells = <2>;
+ interrupt-controller;
+ #interrupt-cells = <2>;
+ };
+
+ gpio5: gpio@49056000 {
+ compatible = "ti,omap3-gpio";
+ reg = <0x49056000 0x200>;
+ interrupts = <33>;
+ ti,hwmods = "gpio5";
+ gpio-controller;
+ #gpio-cells = <2>;
+ interrupt-controller;
+ #interrupt-cells = <2>;
+ };
+
+ gpio6: gpio@49058000 {
+ compatible = "ti,omap3-gpio";
+ reg = <0x49058000 0x200>;
+ interrupts = <34>;
+ ti,hwmods = "gpio6";
+ gpio-controller;
+ #gpio-cells = <2>;
+ interrupt-controller;
+ #interrupt-cells = <2>;
+ };
+
+ uart1: serial@4806a000 {
+ compatible = "ti,omap3-uart";
+ reg = <0x4806a000 0x2000>;
+ reg-shift = <2>;
+ interrupts-extended = <&intc 72>;
+ dmas = <&sdma 49 &sdma 50>;
+ dma-names = "tx", "rx";
+ ti,hwmods = "uart1";
+ clock-frequency = <48000000>;
+ };
+
+ uart2: serial@4806c000 {
+ compatible = "ti,omap3-uart";
+ reg = <0x4806c000 0x400>;
+ reg-shift = <2>;
+ interrupts-extended = <&intc 73>;
+ dmas = <&sdma 51 &sdma 52>;
+ dma-names = "tx", "rx";
+ ti,hwmods = "uart2";
+ clock-frequency = <48000000>;
+ };
+
+ uart3: serial@49020000 {
+ compatible = "ti,omap3-uart";
+ reg = <0x49020000 0x400>;
+ reg-shift = <2>;
+ interrupts-extended = <&intc 74>;
+ dmas = <&sdma 53 &sdma 54>;
+ dma-names = "tx", "rx";
+ ti,hwmods = "uart3";
+ clock-frequency = <48000000>;
+ };
+
+ i2c1: i2c@48070000 {
+ compatible = "ti,omap3-i2c";
+ reg = <0x48070000 0x80>;
+ interrupts = <56>;
+ dmas = <&sdma 27 &sdma 28>;
+ dma-names = "tx", "rx";
+ #address-cells = <1>;
+ #size-cells = <0>;
+ ti,hwmods = "i2c1";
+ };
+
+ i2c2: i2c@48072000 {
+ compatible = "ti,omap3-i2c";
+ reg = <0x48072000 0x80>;
+ interrupts = <57>;
+ dmas = <&sdma 29 &sdma 30>;
+ dma-names = "tx", "rx";
+ #address-cells = <1>;
+ #size-cells = <0>;
+ ti,hwmods = "i2c2";
+ };
+
+ i2c3: i2c@48060000 {
+ compatible = "ti,omap3-i2c";
+ reg = <0x48060000 0x80>;
+ interrupts = <61>;
+ dmas = <&sdma 25 &sdma 26>;
+ dma-names = "tx", "rx";
+ #address-cells = <1>;
+ #size-cells = <0>;
+ ti,hwmods = "i2c3";
+ };
+
+ mailbox: mailbox@48094000 {
+ compatible = "ti,omap3-mailbox";
+ ti,hwmods = "mailbox";
+ reg = <0x48094000 0x200>;
+ interrupts = <26>;
+ #mbox-cells = <1>;
+ ti,mbox-num-users = <2>;
+ ti,mbox-num-fifos = <2>;
+ mbox_dsp: dsp {
+ ti,mbox-tx = <0 0 0>;
+ ti,mbox-rx = <1 0 0>;
+ };
+ };
+
+ mcspi1: spi@48098000 {
+ compatible = "ti,omap2-mcspi";
+ reg = <0x48098000 0x100>;
+ interrupts = <65>;
+ #address-cells = <1>;
+ #size-cells = <0>;
+ ti,hwmods = "mcspi1";
+ ti,spi-num-cs = <4>;
+ dmas = <&sdma 35>,
+ <&sdma 36>,
+ <&sdma 37>,
+ <&sdma 38>,
+ <&sdma 39>,
+ <&sdma 40>,
+ <&sdma 41>,
+ <&sdma 42>;
+ dma-names = "tx0", "rx0", "tx1", "rx1",
+ "tx2", "rx2", "tx3", "rx3";
+ };
+
+ mcspi2: spi@4809a000 {
+ compatible = "ti,omap2-mcspi";
+ reg = <0x4809a000 0x100>;
+ interrupts = <66>;
+ #address-cells = <1>;
+ #size-cells = <0>;
+ ti,hwmods = "mcspi2";
+ ti,spi-num-cs = <2>;
+ dmas = <&sdma 43>,
+ <&sdma 44>,
+ <&sdma 45>,
+ <&sdma 46>;
+ dma-names = "tx0", "rx0", "tx1", "rx1";
+ };
+
+ mcspi3: spi@480b8000 {
+ compatible = "ti,omap2-mcspi";
+ reg = <0x480b8000 0x100>;
+ interrupts = <91>;
+ #address-cells = <1>;
+ #size-cells = <0>;
+ ti,hwmods = "mcspi3";
+ ti,spi-num-cs = <2>;
+ dmas = <&sdma 15>,
+ <&sdma 16>,
+ <&sdma 23>,
+ <&sdma 24>;
+ dma-names = "tx0", "rx0", "tx1", "rx1";
+ };
+
+ mcspi4: spi@480ba000 {
+ compatible = "ti,omap2-mcspi";
+ reg = <0x480ba000 0x100>;
+ interrupts = <48>;
+ #address-cells = <1>;
+ #size-cells = <0>;
+ ti,hwmods = "mcspi4";
+ ti,spi-num-cs = <1>;
+ dmas = <&sdma 70>, <&sdma 71>;
+ dma-names = "tx0", "rx0";
+ };
+
+ hdqw1w: 1w@480b2000 {
+ compatible = "ti,omap3-1w";
+ reg = <0x480b2000 0x1000>;
+ interrupts = <58>;
+ ti,hwmods = "hdq1w";
+ };
+
+ mmc1: mmc@4809c000 {
+ compatible = "ti,omap3-hsmmc";
+ reg = <0x4809c000 0x200>;
+ interrupts = <83>;
+ ti,hwmods = "mmc1";
+ ti,dual-volt;
+ dmas = <&sdma 61>, <&sdma 62>;
+ dma-names = "tx", "rx";
+ pbias-supply = <&pbias_mmc_reg>;
+ };
+
+ mmc2: mmc@480b4000 {
+ compatible = "ti,omap3-hsmmc";
+ reg = <0x480b4000 0x200>;
+ interrupts = <86>;
+ ti,hwmods = "mmc2";
+ dmas = <&sdma 47>, <&sdma 48>;
+ dma-names = "tx", "rx";
+ };
+
+ mmc3: mmc@480ad000 {
+ compatible = "ti,omap3-hsmmc";
+ reg = <0x480ad000 0x200>;
+ interrupts = <94>;
+ ti,hwmods = "mmc3";
+ dmas = <&sdma 77>, <&sdma 78>;
+ dma-names = "tx", "rx";
+ };
+
+ mmu_isp: mmu@480bd400 {
+ #iommu-cells = <0>;
+ compatible = "ti,omap2-iommu";
+ reg = <0x480bd400 0x80>;
+ interrupts = <24>;
+ ti,hwmods = "mmu_isp";
+ ti,#tlb-entries = <8>;
+ };
+
+ mmu_iva: mmu@5d000000 {
+ #iommu-cells = <0>;
+ compatible = "ti,omap2-iommu";
+ reg = <0x5d000000 0x80>;
+ interrupts = <28>;
+ ti,hwmods = "mmu_iva";
+ status = "disabled";
+ };
+
+ wdt2: wdt@48314000 {
+ compatible = "ti,omap3-wdt";
+ reg = <0x48314000 0x80>;
+ ti,hwmods = "wd_timer2";
+ };
+
+ mcbsp1: mcbsp@48074000 {
+ compatible = "ti,omap3-mcbsp";
+ reg = <0x48074000 0xff>;
+ reg-names = "mpu";
+ interrupts = <16>, /* OCP compliant interrupt */
+ <59>, /* TX interrupt */
+ <60>; /* RX interrupt */
+ interrupt-names = "common", "tx", "rx";
+ ti,buffer-size = <128>;
+ ti,hwmods = "mcbsp1";
+ dmas = <&sdma 31>,
+ <&sdma 32>;
+ dma-names = "tx", "rx";
+ clocks = <&mcbsp1_fck>;
+ clock-names = "fck";
+ status = "disabled";
+ };
+
+ mcbsp2: mcbsp@49022000 {
+ compatible = "ti,omap3-mcbsp";
+ reg = <0x49022000 0xff>,
+ <0x49028000 0xff>;
+ reg-names = "mpu", "sidetone";
+ interrupts = <17>, /* OCP compliant interrupt */
+ <62>, /* TX interrupt */
+ <63>, /* RX interrupt */
+ <4>; /* Sidetone */
+ interrupt-names = "common", "tx", "rx", "sidetone";
+ ti,buffer-size = <1280>;
+ ti,hwmods = "mcbsp2", "mcbsp2_sidetone";
+ dmas = <&sdma 33>,
+ <&sdma 34>;
+ dma-names = "tx", "rx";
+ clocks = <&mcbsp2_fck>, <&mcbsp2_ick>;
+ clock-names = "fck", "ick";
+ status = "disabled";
+ };
+
+ mcbsp3: mcbsp@49024000 {
+ compatible = "ti,omap3-mcbsp";
+ reg = <0x49024000 0xff>,
+ <0x4902a000 0xff>;
+ reg-names = "mpu", "sidetone";
+ interrupts = <22>, /* OCP compliant interrupt */
+ <89>, /* TX interrupt */
+ <90>, /* RX interrupt */
+ <5>; /* Sidetone */
+ interrupt-names = "common", "tx", "rx", "sidetone";
+ ti,buffer-size = <128>;
+ ti,hwmods = "mcbsp3", "mcbsp3_sidetone";
+ dmas = <&sdma 17>,
+ <&sdma 18>;
+ dma-names = "tx", "rx";
+ clocks = <&mcbsp3_fck>, <&mcbsp3_ick>;
+ clock-names = "fck", "ick";
+ status = "disabled";
+ };
+
+ mcbsp4: mcbsp@49026000 {
+ compatible = "ti,omap3-mcbsp";
+ reg = <0x49026000 0xff>;
+ reg-names = "mpu";
+ interrupts = <23>, /* OCP compliant interrupt */
+ <54>, /* TX interrupt */
+ <55>; /* RX interrupt */
+ interrupt-names = "common", "tx", "rx";
+ ti,buffer-size = <128>;
+ ti,hwmods = "mcbsp4";
+ dmas = <&sdma 19>,
+ <&sdma 20>;
+ dma-names = "tx", "rx";
+ clocks = <&mcbsp4_fck>;
+ clock-names = "fck";
+ status = "disabled";
+ };
+
+ mcbsp5: mcbsp@48096000 {
+ compatible = "ti,omap3-mcbsp";
+ reg = <0x48096000 0xff>;
+ reg-names = "mpu";
+ interrupts = <27>, /* OCP compliant interrupt */
+ <81>, /* TX interrupt */
+ <82>; /* RX interrupt */
+ interrupt-names = "common", "tx", "rx";
+ ti,buffer-size = <128>;
+ ti,hwmods = "mcbsp5";
+ dmas = <&sdma 21>,
+ <&sdma 22>;
+ dma-names = "tx", "rx";
+ clocks = <&mcbsp5_fck>;
+ clock-names = "fck";
+ status = "disabled";
+ };
+
+ sham: sham@480c3000 {
+ compatible = "ti,omap3-sham";
+ ti,hwmods = "sham";
+ reg = <0x480c3000 0x64>;
+ interrupts = <49>;
+ dmas = <&sdma 69>;
+ dma-names = "rx";
+ };
+
+ smartreflex_core: smartreflex@480cb000 {
+ compatible = "ti,omap3-smartreflex-core";
+ ti,hwmods = "smartreflex_core";
+ reg = <0x480cb000 0x400>;
+ interrupts = <19>;
+ };
+
+ smartreflex_mpu_iva: smartreflex@480c9000 {
+ compatible = "ti,omap3-smartreflex-iva";
+ ti,hwmods = "smartreflex_mpu_iva";
+ reg = <0x480c9000 0x400>;
+ interrupts = <18>;
+ };
+
+ timer1: timer@48318000 {
+ compatible = "ti,omap3430-timer";
+ reg = <0x48318000 0x400>;
+ interrupts = <37>;
+ ti,hwmods = "timer1";
+ ti,timer-alwon;
+ };
+
+ timer2: timer@49032000 {
+ compatible = "ti,omap3430-timer";
+ reg = <0x49032000 0x400>;
+ interrupts = <38>;
+ ti,hwmods = "timer2";
+ };
+
+ timer3: timer@49034000 {
+ compatible = "ti,omap3430-timer";
+ reg = <0x49034000 0x400>;
+ interrupts = <39>;
+ ti,hwmods = "timer3";
+ };
+
+ timer4: timer@49036000 {
+ compatible = "ti,omap3430-timer";
+ reg = <0x49036000 0x400>;
+ interrupts = <40>;
+ ti,hwmods = "timer4";
+ };
+
+ timer5: timer@49038000 {
+ compatible = "ti,omap3430-timer";
+ reg = <0x49038000 0x400>;
+ interrupts = <41>;
+ ti,hwmods = "timer5";
+ ti,timer-dsp;
+ };
+
+ timer6: timer@4903a000 {
+ compatible = "ti,omap3430-timer";
+ reg = <0x4903a000 0x400>;
+ interrupts = <42>;
+ ti,hwmods = "timer6";
+ ti,timer-dsp;
+ };
+
+ timer7: timer@4903c000 {
+ compatible = "ti,omap3430-timer";
+ reg = <0x4903c000 0x400>;
+ interrupts = <43>;
+ ti,hwmods = "timer7";
+ ti,timer-dsp;
+ };
+
+ timer8: timer@4903e000 {
+ compatible = "ti,omap3430-timer";
+ reg = <0x4903e000 0x400>;
+ interrupts = <44>;
+ ti,hwmods = "timer8";
+ ti,timer-pwm;
+ ti,timer-dsp;
+ };
+
+ timer9: timer@49040000 {
+ compatible = "ti,omap3430-timer";
+ reg = <0x49040000 0x400>;
+ interrupts = <45>;
+ ti,hwmods = "timer9";
+ ti,timer-pwm;
+ };
+
+ timer10: timer@48086000 {
+ compatible = "ti,omap3430-timer";
+ reg = <0x48086000 0x400>;
+ interrupts = <46>;
+ ti,hwmods = "timer10";
+ ti,timer-pwm;
+ };
+
+ timer11: timer@48088000 {
+ compatible = "ti,omap3430-timer";
+ reg = <0x48088000 0x400>;
+ interrupts = <47>;
+ ti,hwmods = "timer11";
+ ti,timer-pwm;
+ };
+
+ timer12: timer@48304000 {
+ compatible = "ti,omap3430-timer";
+ reg = <0x48304000 0x400>;
+ interrupts = <95>;
+ ti,hwmods = "timer12";
+ ti,timer-alwon;
+ ti,timer-secure;
+ };
+
+ usbhstll: usbhstll@48062000 {
+ compatible = "ti,usbhs-tll";
+ reg = <0x48062000 0x1000>;
+ interrupts = <78>;
+ ti,hwmods = "usb_tll_hs";
+ };
+
+ usbhshost: usbhshost@48064000 {
+ compatible = "ti,usbhs-host";
+ reg = <0x48064000 0x400>;
+ ti,hwmods = "usb_host_hs";
+ #address-cells = <1>;
+ #size-cells = <1>;
+ ranges;
+
+ usbhsohci: ohci@48064400 {
+ compatible = "ti,ohci-omap3";
+ reg = <0x48064400 0x400>;
+ interrupt-parent = <&intc>;
+ interrupts = <76>;
+ };
+
+ usbhsehci: ehci@48064800 {
+ compatible = "ti,ehci-omap";
+ reg = <0x48064800 0x400>;
+ interrupt-parent = <&intc>;
+ interrupts = <77>;
+ };
+ };
+
+ gpmc: gpmc@6e000000 {
+ compatible = "ti,omap3430-gpmc";
+ ti,hwmods = "gpmc";
+ reg = <0x6e000000 0x02d0>;
+ interrupts = <20>;
+ dmas = <&sdma 4>;
+ dma-names = "rxtx";
+ gpmc,num-cs = <8>;
+ gpmc,num-waitpins = <4>;
+ #address-cells = <2>;
+ #size-cells = <1>;
+ interrupt-controller;
+ #interrupt-cells = <2>;
+ gpio-controller;
+ #gpio-cells = <2>;
+ };
+
+ usb_otg_hs: usb_otg_hs@480ab000 {
+ compatible = "ti,omap3-musb";
+ reg = <0x480ab000 0x1000>;
+ interrupts = <92>, <93>;
+ interrupt-names = "mc", "dma";
+ ti,hwmods = "usb_otg_hs";
+ multipoint = <1>;
+ num-eps = <16>;
+ ram-bits = <12>;
+ };
+
+ dss: dss@48050000 {
+ compatible = "ti,omap3-dss";
+ reg = <0x48050000 0x200>;
+ status = "disabled";
+ ti,hwmods = "dss_core";
+ clocks = <&dss1_alwon_fck>;
+ clock-names = "fck";
+ #address-cells = <1>;
+ #size-cells = <1>;
+ ranges;
+
+ dispc@48050400 {
+ compatible = "ti,omap3-dispc";
+ reg = <0x48050400 0x400>;
+ interrupts = <25>;
+ ti,hwmods = "dss_dispc";
+ clocks = <&dss1_alwon_fck>;
+ clock-names = "fck";
+ };
+
+ dsi: encoder@4804fc00 {
+ compatible = "ti,omap3-dsi";
+ reg = <0x4804fc00 0x200>,
+ <0x4804fe00 0x40>,
+ <0x4804ff00 0x20>;
+ reg-names = "proto", "phy", "pll";
+ interrupts = <25>;
+ status = "disabled";
+ ti,hwmods = "dss_dsi1";
+ clocks = <&dss1_alwon_fck>, <&dss2_alwon_fck>;
+ clock-names = "fck", "sys_clk";
+ };
+
+ rfbi: encoder@48050800 {
+ compatible = "ti,omap3-rfbi";
+ reg = <0x48050800 0x100>;
+ status = "disabled";
+ ti,hwmods = "dss_rfbi";
+ clocks = <&dss1_alwon_fck>, <&dss_ick>;
+ clock-names = "fck", "ick";
+ };
+
+ venc: encoder@48050c00 {
+ compatible = "ti,omap3-venc";
+ reg = <0x48050c00 0x100>;
+ status = "disabled";
+ ti,hwmods = "dss_venc";
+ clocks = <&dss_tv_fck>;
+ clock-names = "fck";
+ };
+ };
+
+ ssi: ssi-controller@48058000 {
+ compatible = "ti,omap3-ssi";
+ ti,hwmods = "ssi";
+
+ status = "disabled";
+
+ reg = <0x48058000 0x1000>,
+ <0x48059000 0x1000>;
+ reg-names = "sys",
+ "gdd";
+
+ interrupts = <71>;
+ interrupt-names = "gdd_mpu";
+
+ #address-cells = <1>;
+ #size-cells = <1>;
+ ranges;
+
+ ssi_port1: ssi-port@4805a000 {
+ compatible = "ti,omap3-ssi-port";
+
+ reg = <0x4805a000 0x800>,
+ <0x4805a800 0x800>;
+ reg-names = "tx",
+ "rx";
+
+ interrupt-parent = <&intc>;
+ interrupts = <67>,
+ <68>;
+ };
+
+ ssi_port2: ssi-port@4805b000 {
+ compatible = "ti,omap3-ssi-port";
+
+ reg = <0x4805b000 0x800>,
+ <0x4805b800 0x800>;
+ reg-names = "tx",
+ "rx";
+
+ interrupt-parent = <&intc>;
+ interrupts = <69>,
+ <70>;
+ };
+ };
+ };
};
/include/ "omap3xxx-clocks.dtsi"
* published by the Free Software Foundation.
*/
&cm_clocks {
- security_l4_ick2: security_l4_ick2 {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&l4_ick>;
- clock-mult = <1>;
- clock-div = <1>;
- };
+ security_l4_ick2: security_l4_ick2 {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&l4_ick>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
- aes1_ick: aes1_ick@a14 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&security_l4_ick2>;
- ti,bit-shift = <3>;
- reg = <0x0a14>;
- };
+ aes1_ick: aes1_ick@a14 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&security_l4_ick2>;
+ ti,bit-shift = <3>;
+ reg = <0x0a14>;
+ };
- rng_ick: rng_ick@a14 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&security_l4_ick2>;
- reg = <0x0a14>;
- ti,bit-shift = <2>;
- };
+ rng_ick: rng_ick@a14 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&security_l4_ick2>;
+ reg = <0x0a14>;
+ ti,bit-shift = <2>;
+ };
- sha11_ick: sha11_ick@a14 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&security_l4_ick2>;
- reg = <0x0a14>;
- ti,bit-shift = <1>;
- };
+ sha11_ick: sha11_ick@a14 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&security_l4_ick2>;
+ reg = <0x0a14>;
+ ti,bit-shift = <1>;
+ };
- des1_ick: des1_ick@a14 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&security_l4_ick2>;
- reg = <0x0a14>;
- ti,bit-shift = <0>;
- };
+ des1_ick: des1_ick@a14 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&security_l4_ick2>;
+ reg = <0x0a14>;
+ ti,bit-shift = <0>;
+ };
- cam_mclk: cam_mclk@f00 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&dpll4_m5x2_ck>;
- ti,bit-shift = <0>;
- reg = <0x0f00>;
- ti,set-rate-parent;
- };
+ cam_mclk: cam_mclk@f00 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&dpll4_m5x2_ck>;
+ ti,bit-shift = <0>;
+ reg = <0x0f00>;
+ ti,set-rate-parent;
+ };
- cam_ick: cam_ick@f10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-no-wait-interface-clock";
- clocks = <&l4_ick>;
- reg = <0x0f10>;
- ti,bit-shift = <0>;
- };
+ cam_ick: cam_ick@f10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-no-wait-interface-clock";
+ clocks = <&l4_ick>;
+ reg = <0x0f10>;
+ ti,bit-shift = <0>;
+ };
- csi2_96m_fck: csi2_96m_fck@f00 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&core_96m_fck>;
- reg = <0x0f00>;
- ti,bit-shift = <1>;
- };
+ csi2_96m_fck: csi2_96m_fck@f00 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&core_96m_fck>;
+ reg = <0x0f00>;
+ ti,bit-shift = <1>;
+ };
- security_l3_ick: security_l3_ick {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&l3_ick>;
- clock-mult = <1>;
- clock-div = <1>;
- };
+ security_l3_ick: security_l3_ick {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&l3_ick>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
- pka_ick: pka_ick@a14 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&security_l3_ick>;
- reg = <0x0a14>;
- ti,bit-shift = <4>;
- };
+ pka_ick: pka_ick@a14 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&security_l3_ick>;
+ reg = <0x0a14>;
+ ti,bit-shift = <4>;
+ };
- icr_ick: icr_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <29>;
- };
+ icr_ick: icr_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <29>;
+ };
- des2_ick: des2_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <26>;
- };
+ des2_ick: des2_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <26>;
+ };
- mspro_ick: mspro_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <23>;
- };
+ mspro_ick: mspro_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <23>;
+ };
- mailboxes_ick: mailboxes_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <7>;
- };
+ mailboxes_ick: mailboxes_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <7>;
+ };
- ssi_l4_ick: ssi_l4_ick {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&l4_ick>;
- clock-mult = <1>;
- clock-div = <1>;
- };
+ ssi_l4_ick: ssi_l4_ick {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&l4_ick>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
- sr1_fck: sr1_fck@c00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&sys_ck>;
- reg = <0x0c00>;
- ti,bit-shift = <6>;
- };
+ sr1_fck: sr1_fck@c00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&sys_ck>;
+ reg = <0x0c00>;
+ ti,bit-shift = <6>;
+ };
- sr2_fck: sr2_fck@c00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&sys_ck>;
- reg = <0x0c00>;
- ti,bit-shift = <7>;
- };
+ sr2_fck: sr2_fck@c00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&sys_ck>;
+ reg = <0x0c00>;
+ ti,bit-shift = <7>;
+ };
- sr_l4_ick: sr_l4_ick {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&l4_ick>;
- clock-mult = <1>;
- clock-div = <1>;
- };
+ sr_l4_ick: sr_l4_ick {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&l4_ick>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
- dpll2_fck: dpll2_fck@40 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&core_ck>;
- ti,bit-shift = <19>;
- ti,max-div = <7>;
- reg = <0x0040>;
- ti,index-starts-at-one;
- };
+ dpll2_fck: dpll2_fck@40 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&core_ck>;
+ ti,bit-shift = <19>;
+ ti,max-div = <7>;
+ reg = <0x0040>;
+ ti,index-starts-at-one;
+ };
- dpll2_ck: dpll2_ck@4 {
- #clock-cells = <0>;
- compatible = "ti,omap3-dpll-clock";
- clocks = <&sys_ck>, <&dpll2_fck>;
- reg = <0x0004>, <0x0024>, <0x0040>, <0x0034>;
- ti,low-power-stop;
- ti,lock;
- ti,low-power-bypass;
- };
+ dpll2_ck: dpll2_ck@4 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-dpll-clock";
+ clocks = <&sys_ck>, <&dpll2_fck>;
+ reg = <0x0004>, <0x0024>, <0x0040>, <0x0034>;
+ ti,low-power-stop;
+ ti,lock;
+ ti,low-power-bypass;
+ };
- dpll2_m2_ck: dpll2_m2_ck@44 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&dpll2_ck>;
- ti,max-div = <31>;
- reg = <0x0044>;
- ti,index-starts-at-one;
- };
+ dpll2_m2_ck: dpll2_m2_ck@44 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&dpll2_ck>;
+ ti,max-div = <31>;
+ reg = <0x0044>;
+ ti,index-starts-at-one;
+ };
- iva2_ck: iva2_ck@0 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&dpll2_m2_ck>;
- reg = <0x0000>;
- ti,bit-shift = <0>;
- };
+ iva2_ck: iva2_ck@0 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&dpll2_m2_ck>;
+ reg = <0x0000>;
+ ti,bit-shift = <0>;
+ };
- modem_fck: modem_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&sys_ck>;
- reg = <0x0a00>;
- ti,bit-shift = <31>;
- };
+ modem_fck: modem_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&sys_ck>;
+ reg = <0x0a00>;
+ ti,bit-shift = <31>;
+ };
- sad2d_ick: sad2d_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&l3_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <3>;
- };
+ sad2d_ick: sad2d_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&l3_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <3>;
+ };
- mad2d_ick: mad2d_ick@a18 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&l3_ick>;
- reg = <0x0a18>;
- ti,bit-shift = <3>;
- };
+ mad2d_ick: mad2d_ick@a18 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&l3_ick>;
+ reg = <0x0a18>;
+ ti,bit-shift = <3>;
+ };
- mspro_fck: mspro_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&core_96m_fck>;
- reg = <0x0a00>;
- ti,bit-shift = <23>;
- };
+ mspro_fck: mspro_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&core_96m_fck>;
+ reg = <0x0a00>;
+ ti,bit-shift = <23>;
+ };
};
&cm_clockdomains {
- cam_clkdm: cam_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&cam_ick>, <&csi2_96m_fck>;
- };
+ cam_clkdm: cam_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&cam_ick>, <&csi2_96m_fck>;
+ };
- iva2_clkdm: iva2_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&iva2_ck>;
- };
+ iva2_clkdm: iva2_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&iva2_ck>;
+ };
- dpll2_clkdm: dpll2_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&dpll2_ck>;
- };
+ dpll2_clkdm: dpll2_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&dpll2_ck>;
+ };
- wkup_clkdm: wkup_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&gpio1_dbck>, <&wdt2_fck>, <&wdt2_ick>, <&wdt1_ick>,
- <&gpio1_ick>, <&omap_32ksync_ick>, <&gpt12_ick>,
- <&gpt1_ick>, <&sr1_fck>, <&sr2_fck>;
- };
+ wkup_clkdm: wkup_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&gpio1_dbck>, <&wdt2_fck>, <&wdt2_ick>, <&wdt1_ick>,
+ <&gpio1_ick>, <&omap_32ksync_ick>, <&gpt12_ick>,
+ <&gpt1_ick>, <&sr1_fck>, <&sr2_fck>;
+ };
- d2d_clkdm: d2d_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&modem_fck>, <&sad2d_ick>, <&mad2d_ick>;
- };
+ d2d_clkdm: d2d_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&modem_fck>, <&sad2d_ick>, <&mad2d_ick>;
+ };
- core_l4_clkdm: core_l4_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&mmchs2_fck>, <&mmchs1_fck>, <&i2c3_fck>, <&i2c2_fck>,
- <&i2c1_fck>, <&mcspi4_fck>, <&mcspi3_fck>,
- <&mcspi2_fck>, <&mcspi1_fck>, <&uart2_fck>,
- <&uart1_fck>, <&hdq_fck>, <&mmchs2_ick>, <&mmchs1_ick>,
- <&hdq_ick>, <&mcspi4_ick>, <&mcspi3_ick>,
- <&mcspi2_ick>, <&mcspi1_ick>, <&i2c3_ick>, <&i2c2_ick>,
- <&i2c1_ick>, <&uart2_ick>, <&uart1_ick>, <&gpt11_ick>,
- <&gpt10_ick>, <&mcbsp5_ick>, <&mcbsp1_ick>,
- <&omapctrl_ick>, <&aes2_ick>, <&sha12_ick>, <&icr_ick>,
- <&des2_ick>, <&mspro_ick>, <&mailboxes_ick>,
- <&mspro_fck>;
- };
+ core_l4_clkdm: core_l4_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&mmchs2_fck>, <&mmchs1_fck>, <&i2c3_fck>, <&i2c2_fck>,
+ <&i2c1_fck>, <&mcspi4_fck>, <&mcspi3_fck>,
+ <&mcspi2_fck>, <&mcspi1_fck>, <&uart2_fck>,
+ <&uart1_fck>, <&hdq_fck>, <&mmchs2_ick>, <&mmchs1_ick>,
+ <&hdq_ick>, <&mcspi4_ick>, <&mcspi3_ick>,
+ <&mcspi2_ick>, <&mcspi1_ick>, <&i2c3_ick>, <&i2c2_ick>,
+ <&i2c1_ick>, <&uart2_ick>, <&uart1_ick>, <&gpt11_ick>,
+ <&gpt10_ick>, <&mcbsp5_ick>, <&mcbsp1_ick>,
+ <&omapctrl_ick>, <&aes2_ick>, <&sha12_ick>, <&icr_ick>,
+ <&des2_ick>, <&mspro_ick>, <&mailboxes_ick>,
+ <&mspro_fck>;
+ };
};
* published by the Free Software Foundation.
*/
&prm_clocks {
- corex2_d3_fck: corex2_d3_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&corex2_fck>;
- clock-mult = <1>;
- clock-div = <3>;
- };
-
- corex2_d5_fck: corex2_d5_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&corex2_fck>;
- clock-mult = <1>;
- clock-div = <5>;
- };
+ corex2_d3_fck: corex2_d3_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&corex2_fck>;
+ clock-mult = <1>;
+ clock-div = <3>;
+ };
+
+ corex2_d5_fck: corex2_d5_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&corex2_fck>;
+ clock-mult = <1>;
+ clock-div = <5>;
+ };
};
&cm_clocks {
- dpll5_ck: dpll5_ck@d04 {
- #clock-cells = <0>;
- compatible = "ti,omap3-dpll-clock";
- clocks = <&sys_ck>, <&sys_ck>;
- reg = <0x0d04>, <0x0d24>, <0x0d4c>, <0x0d34>;
- ti,low-power-stop;
- ti,lock;
- };
-
- dpll5_m2_ck: dpll5_m2_ck@d50 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&dpll5_ck>;
- ti,max-div = <31>;
- reg = <0x0d50>;
- ti,index-starts-at-one;
- };
-
- sgx_gate_fck: sgx_gate_fck@b00 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&core_ck>;
- ti,bit-shift = <1>;
- reg = <0x0b00>;
- };
-
- core_d3_ck: core_d3_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&core_ck>;
- clock-mult = <1>;
- clock-div = <3>;
- };
-
- core_d4_ck: core_d4_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&core_ck>;
- clock-mult = <1>;
- clock-div = <4>;
- };
-
- core_d6_ck: core_d6_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&core_ck>;
- clock-mult = <1>;
- clock-div = <6>;
- };
-
- omap_192m_alwon_fck: omap_192m_alwon_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll4_m2x2_ck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- core_d2_ck: core_d2_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&core_ck>;
- clock-mult = <1>;
- clock-div = <2>;
- };
-
- sgx_mux_fck: sgx_mux_fck@b40 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&core_d3_ck>, <&core_d4_ck>, <&core_d6_ck>, <&cm_96m_fck>, <&omap_192m_alwon_fck>, <&core_d2_ck>, <&corex2_d3_fck>, <&corex2_d5_fck>;
- reg = <0x0b40>;
- };
-
- sgx_fck: sgx_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&sgx_gate_fck>, <&sgx_mux_fck>;
- };
-
- sgx_ick: sgx_ick@b10 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&l3_ick>;
- reg = <0x0b10>;
- ti,bit-shift = <0>;
- };
-
- cpefuse_fck: cpefuse_fck@a08 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&sys_ck>;
- reg = <0x0a08>;
- ti,bit-shift = <0>;
- };
-
- ts_fck: ts_fck@a08 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&omap_32k_fck>;
- reg = <0x0a08>;
- ti,bit-shift = <1>;
- };
-
- usbtll_fck: usbtll_fck@a08 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&dpll5_m2_ck>;
- reg = <0x0a08>;
- ti,bit-shift = <2>;
- };
-
- usbtll_ick: usbtll_ick@a18 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a18>;
- ti,bit-shift = <2>;
- };
-
- mmchs3_ick: mmchs3_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <30>;
- };
-
- mmchs3_fck: mmchs3_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&core_96m_fck>;
- reg = <0x0a00>;
- ti,bit-shift = <30>;
- };
-
- dss1_alwon_fck: dss1_alwon_fck_3430es2@e00 {
- #clock-cells = <0>;
- compatible = "ti,dss-gate-clock";
- clocks = <&dpll4_m4x2_ck>;
- ti,bit-shift = <0>;
- reg = <0x0e00>;
- ti,set-rate-parent;
- };
-
- dss_ick: dss_ick_3430es2@e10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-dss-interface-clock";
- clocks = <&l4_ick>;
- reg = <0x0e10>;
- ti,bit-shift = <0>;
- };
-
- usbhost_120m_fck: usbhost_120m_fck@1400 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&dpll5_m2_ck>;
- reg = <0x1400>;
- ti,bit-shift = <1>;
- };
-
- usbhost_48m_fck: usbhost_48m_fck@1400 {
- #clock-cells = <0>;
- compatible = "ti,dss-gate-clock";
- clocks = <&omap_48m_fck>;
- reg = <0x1400>;
- ti,bit-shift = <0>;
- };
-
- usbhost_ick: usbhost_ick@1410 {
- #clock-cells = <0>;
- compatible = "ti,omap3-dss-interface-clock";
- clocks = <&l4_ick>;
- reg = <0x1410>;
- ti,bit-shift = <0>;
- };
+ dpll5_ck: dpll5_ck@d04 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-dpll-clock";
+ clocks = <&sys_ck>, <&sys_ck>;
+ reg = <0x0d04>, <0x0d24>, <0x0d4c>, <0x0d34>;
+ ti,low-power-stop;
+ ti,lock;
+ };
+
+ dpll5_m2_ck: dpll5_m2_ck@d50 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&dpll5_ck>;
+ ti,max-div = <31>;
+ reg = <0x0d50>;
+ ti,index-starts-at-one;
+ };
+
+ sgx_gate_fck: sgx_gate_fck@b00 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&core_ck>;
+ ti,bit-shift = <1>;
+ reg = <0x0b00>;
+ };
+
+ core_d3_ck: core_d3_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&core_ck>;
+ clock-mult = <1>;
+ clock-div = <3>;
+ };
+
+ core_d4_ck: core_d4_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&core_ck>;
+ clock-mult = <1>;
+ clock-div = <4>;
+ };
+
+ core_d6_ck: core_d6_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&core_ck>;
+ clock-mult = <1>;
+ clock-div = <6>;
+ };
+
+ omap_192m_alwon_fck: omap_192m_alwon_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll4_m2x2_ck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ core_d2_ck: core_d2_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&core_ck>;
+ clock-mult = <1>;
+ clock-div = <2>;
+ };
+
+ sgx_mux_fck: sgx_mux_fck@b40 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&core_d3_ck>, <&core_d4_ck>, <&core_d6_ck>, <&cm_96m_fck>, <&omap_192m_alwon_fck>, <&core_d2_ck>, <&corex2_d3_fck>, <&corex2_d5_fck>;
+ reg = <0x0b40>;
+ };
+
+ sgx_fck: sgx_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&sgx_gate_fck>, <&sgx_mux_fck>;
+ };
+
+ sgx_ick: sgx_ick@b10 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&l3_ick>;
+ reg = <0x0b10>;
+ ti,bit-shift = <0>;
+ };
+
+ cpefuse_fck: cpefuse_fck@a08 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&sys_ck>;
+ reg = <0x0a08>;
+ ti,bit-shift = <0>;
+ };
+
+ ts_fck: ts_fck@a08 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&omap_32k_fck>;
+ reg = <0x0a08>;
+ ti,bit-shift = <1>;
+ };
+
+ usbtll_fck: usbtll_fck@a08 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&dpll5_m2_ck>;
+ reg = <0x0a08>;
+ ti,bit-shift = <2>;
+ };
+
+ usbtll_ick: usbtll_ick@a18 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a18>;
+ ti,bit-shift = <2>;
+ };
+
+ mmchs3_ick: mmchs3_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <30>;
+ };
+
+ mmchs3_fck: mmchs3_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&core_96m_fck>;
+ reg = <0x0a00>;
+ ti,bit-shift = <30>;
+ };
+
+ dss1_alwon_fck: dss1_alwon_fck_3430es2@e00 {
+ #clock-cells = <0>;
+ compatible = "ti,dss-gate-clock";
+ clocks = <&dpll4_m4x2_ck>;
+ ti,bit-shift = <0>;
+ reg = <0x0e00>;
+ ti,set-rate-parent;
+ };
+
+ dss_ick: dss_ick_3430es2@e10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-dss-interface-clock";
+ clocks = <&l4_ick>;
+ reg = <0x0e10>;
+ ti,bit-shift = <0>;
+ };
+
+ usbhost_120m_fck: usbhost_120m_fck@1400 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&dpll5_m2_ck>;
+ reg = <0x1400>;
+ ti,bit-shift = <1>;
+ };
+
+ usbhost_48m_fck: usbhost_48m_fck@1400 {
+ #clock-cells = <0>;
+ compatible = "ti,dss-gate-clock";
+ clocks = <&omap_48m_fck>;
+ reg = <0x1400>;
+ ti,bit-shift = <0>;
+ };
+
+ usbhost_ick: usbhost_ick@1410 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-dss-interface-clock";
+ clocks = <&l4_ick>;
+ reg = <0x1410>;
+ ti,bit-shift = <0>;
+ };
};
&cm_clockdomains {
- dpll5_clkdm: dpll5_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&dpll5_ck>;
- };
-
- sgx_clkdm: sgx_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&sgx_ick>;
- };
-
- dss_clkdm: dss_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&dss_tv_fck>, <&dss_96m_fck>, <&dss2_alwon_fck>,
- <&dss1_alwon_fck>, <&dss_ick>;
- };
-
- core_l4_clkdm: core_l4_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&mmchs2_fck>, <&mmchs1_fck>, <&i2c3_fck>, <&i2c2_fck>,
- <&i2c1_fck>, <&mcspi4_fck>, <&mcspi3_fck>,
- <&mcspi2_fck>, <&mcspi1_fck>, <&uart2_fck>,
- <&uart1_fck>, <&hdq_fck>, <&mmchs2_ick>, <&mmchs1_ick>,
- <&hdq_ick>, <&mcspi4_ick>, <&mcspi3_ick>,
- <&mcspi2_ick>, <&mcspi1_ick>, <&i2c3_ick>, <&i2c2_ick>,
- <&i2c1_ick>, <&uart2_ick>, <&uart1_ick>, <&gpt11_ick>,
- <&gpt10_ick>, <&mcbsp5_ick>, <&mcbsp1_ick>,
- <&omapctrl_ick>, <&aes2_ick>, <&sha12_ick>,
- <&cpefuse_fck>, <&ts_fck>, <&usbtll_fck>,
- <&usbtll_ick>, <&mmchs3_ick>, <&mmchs3_fck>;
- };
-
- usbhost_clkdm: usbhost_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&usbhost_120m_fck>, <&usbhost_48m_fck>,
- <&usbhost_ick>;
- };
+ dpll5_clkdm: dpll5_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&dpll5_ck>;
+ };
+
+ sgx_clkdm: sgx_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&sgx_ick>;
+ };
+
+ dss_clkdm: dss_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&dss_tv_fck>, <&dss_96m_fck>, <&dss2_alwon_fck>,
+ <&dss1_alwon_fck>, <&dss_ick>;
+ };
+
+ core_l4_clkdm: core_l4_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&mmchs2_fck>, <&mmchs1_fck>, <&i2c3_fck>, <&i2c2_fck>,
+ <&i2c1_fck>, <&mcspi4_fck>, <&mcspi3_fck>,
+ <&mcspi2_fck>, <&mcspi1_fck>, <&uart2_fck>,
+ <&uart1_fck>, <&hdq_fck>, <&mmchs2_ick>, <&mmchs1_ick>,
+ <&hdq_ick>, <&mcspi4_ick>, <&mcspi3_ick>,
+ <&mcspi2_ick>, <&mcspi1_ick>, <&i2c3_ick>, <&i2c2_ick>,
+ <&i2c1_ick>, <&uart2_ick>, <&uart1_ick>, <&gpt11_ick>,
+ <&gpt10_ick>, <&mcbsp5_ick>, <&mcbsp1_ick>,
+ <&omapctrl_ick>, <&aes2_ick>, <&sha12_ick>,
+ <&cpefuse_fck>, <&ts_fck>, <&usbtll_fck>,
+ <&usbtll_ick>, <&mmchs3_ick>, <&mmchs3_fck>;
+ };
+
+ usbhost_clkdm: usbhost_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&usbhost_120m_fck>, <&usbhost_48m_fck>,
+ <&usbhost_ick>;
+ };
};
* published by the Free Software Foundation.
*/
&cm_clocks {
- dpll4_ck: dpll4_ck@d00 {
- #clock-cells = <0>;
- compatible = "ti,omap3-dpll-per-j-type-clock";
- clocks = <&sys_ck>, <&sys_ck>;
- reg = <0x0d00>, <0x0d20>, <0x0d44>, <0x0d30>;
- };
+ dpll4_ck: dpll4_ck@d00 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-dpll-per-j-type-clock";
+ clocks = <&sys_ck>, <&sys_ck>;
+ reg = <0x0d00>, <0x0d20>, <0x0d44>, <0x0d30>;
+ };
- dpll4_m5x2_ck: dpll4_m5x2_ck@d00 {
- #clock-cells = <0>;
- compatible = "ti,hsdiv-gate-clock";
- clocks = <&dpll4_m5x2_mul_ck>;
- ti,bit-shift = <0x1e>;
- reg = <0x0d00>;
- ti,set-rate-parent;
- ti,set-bit-to-disable;
- };
+ dpll4_m5x2_ck: dpll4_m5x2_ck@d00 {
+ #clock-cells = <0>;
+ compatible = "ti,hsdiv-gate-clock";
+ clocks = <&dpll4_m5x2_mul_ck>;
+ ti,bit-shift = <0x1e>;
+ reg = <0x0d00>;
+ ti,set-rate-parent;
+ ti,set-bit-to-disable;
+ };
- dpll4_m2x2_ck: dpll4_m2x2_ck@d00 {
- #clock-cells = <0>;
- compatible = "ti,hsdiv-gate-clock";
- clocks = <&dpll4_m2x2_mul_ck>;
- ti,bit-shift = <0x1b>;
- reg = <0x0d00>;
- ti,set-bit-to-disable;
- };
+ dpll4_m2x2_ck: dpll4_m2x2_ck@d00 {
+ #clock-cells = <0>;
+ compatible = "ti,hsdiv-gate-clock";
+ clocks = <&dpll4_m2x2_mul_ck>;
+ ti,bit-shift = <0x1b>;
+ reg = <0x0d00>;
+ ti,set-bit-to-disable;
+ };
- dpll3_m3x2_ck: dpll3_m3x2_ck@d00 {
- #clock-cells = <0>;
- compatible = "ti,hsdiv-gate-clock";
- clocks = <&dpll3_m3x2_mul_ck>;
- ti,bit-shift = <0xc>;
- reg = <0x0d00>;
- ti,set-bit-to-disable;
- };
+ dpll3_m3x2_ck: dpll3_m3x2_ck@d00 {
+ #clock-cells = <0>;
+ compatible = "ti,hsdiv-gate-clock";
+ clocks = <&dpll3_m3x2_mul_ck>;
+ ti,bit-shift = <0xc>;
+ reg = <0x0d00>;
+ ti,set-bit-to-disable;
+ };
- dpll4_m3x2_ck: dpll4_m3x2_ck@d00 {
- #clock-cells = <0>;
- compatible = "ti,hsdiv-gate-clock";
- clocks = <&dpll4_m3x2_mul_ck>;
- ti,bit-shift = <0x1c>;
- reg = <0x0d00>;
- ti,set-bit-to-disable;
- };
+ dpll4_m3x2_ck: dpll4_m3x2_ck@d00 {
+ #clock-cells = <0>;
+ compatible = "ti,hsdiv-gate-clock";
+ clocks = <&dpll4_m3x2_mul_ck>;
+ ti,bit-shift = <0x1c>;
+ reg = <0x0d00>;
+ ti,set-bit-to-disable;
+ };
- dpll4_m6x2_ck: dpll4_m6x2_ck@d00 {
- #clock-cells = <0>;
- compatible = "ti,hsdiv-gate-clock";
- clocks = <&dpll4_m6x2_mul_ck>;
- ti,bit-shift = <0x1f>;
- reg = <0x0d00>;
- ti,set-bit-to-disable;
- };
+ dpll4_m6x2_ck: dpll4_m6x2_ck@d00 {
+ #clock-cells = <0>;
+ compatible = "ti,hsdiv-gate-clock";
+ clocks = <&dpll4_m6x2_mul_ck>;
+ ti,bit-shift = <0x1f>;
+ reg = <0x0d00>;
+ ti,set-bit-to-disable;
+ };
- uart4_fck: uart4_fck@1000 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&per_48m_fck>;
- reg = <0x1000>;
- ti,bit-shift = <18>;
- };
+ uart4_fck: uart4_fck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&per_48m_fck>;
+ reg = <0x1000>;
+ ti,bit-shift = <18>;
+ };
};
&dpll4_m2x2_mul_ck {
- clock-mult = <1>;
+ clock-mult = <1>;
};
&dpll4_m3x2_mul_ck {
- clock-mult = <1>;
+ clock-mult = <1>;
};
&dpll4_m4x2_mul_ck {
- ti,clock-mult = <1>;
+ ti,clock-mult = <1>;
};
&dpll4_m5x2_mul_ck {
- ti,clock-mult = <1>;
+ ti,clock-mult = <1>;
};
&dpll4_m6x2_mul_ck {
- clock-mult = <1>;
+ clock-mult = <1>;
};
&cm_clockdomains {
- dpll4_clkdm: dpll4_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&dpll4_ck>;
- };
+ dpll4_clkdm: dpll4_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&dpll4_ck>;
+ };
- per_clkdm: per_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&uart3_fck>, <&gpio6_dbck>, <&gpio5_dbck>,
- <&gpio4_dbck>, <&gpio3_dbck>, <&gpio2_dbck>,
- <&wdt3_fck>, <&gpio6_ick>, <&gpio5_ick>, <&gpio4_ick>,
- <&gpio3_ick>, <&gpio2_ick>, <&wdt3_ick>, <&uart3_ick>,
- <&uart4_ick>, <&gpt9_ick>, <&gpt8_ick>, <&gpt7_ick>,
- <&gpt6_ick>, <&gpt5_ick>, <&gpt4_ick>, <&gpt3_ick>,
- <&gpt2_ick>, <&mcbsp2_ick>, <&mcbsp3_ick>,
- <&mcbsp4_ick>, <&uart4_fck>;
- };
+ per_clkdm: per_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&uart3_fck>, <&gpio6_dbck>, <&gpio5_dbck>,
+ <&gpio4_dbck>, <&gpio3_dbck>, <&gpio2_dbck>,
+ <&wdt3_fck>, <&gpio6_ick>, <&gpio5_ick>, <&gpio4_ick>,
+ <&gpio3_ick>, <&gpio2_ick>, <&wdt3_ick>, <&uart3_ick>,
+ <&uart4_ick>, <&gpt9_ick>, <&gpt8_ick>, <&gpt7_ick>,
+ <&gpt6_ick>, <&gpt5_ick>, <&gpt4_ick>, <&gpt3_ick>,
+ <&gpt2_ick>, <&mcbsp2_ick>, <&mcbsp3_ick>,
+ <&mcbsp4_ick>, <&uart4_fck>;
+ };
};
* published by the Free Software Foundation.
*/
&cm_clocks {
- ssi_ssr_gate_fck_3430es2: ssi_ssr_gate_fck_3430es2@a00 {
- #clock-cells = <0>;
- compatible = "ti,composite-no-wait-gate-clock";
- clocks = <&corex2_fck>;
- ti,bit-shift = <0>;
- reg = <0x0a00>;
- };
-
- ssi_ssr_div_fck_3430es2: ssi_ssr_div_fck_3430es2@a40 {
- #clock-cells = <0>;
- compatible = "ti,composite-divider-clock";
- clocks = <&corex2_fck>;
- ti,bit-shift = <8>;
- reg = <0x0a40>;
- ti,dividers = <0>, <1>, <2>, <3>, <4>, <0>, <6>, <0>, <8>;
- };
-
- ssi_ssr_fck: ssi_ssr_fck_3430es2 {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&ssi_ssr_gate_fck_3430es2>, <&ssi_ssr_div_fck_3430es2>;
- };
-
- ssi_sst_fck: ssi_sst_fck_3430es2 {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&ssi_ssr_fck>;
- clock-mult = <1>;
- clock-div = <2>;
- };
-
- hsotgusb_ick_3430es2: hsotgusb_ick_3430es2@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-hsotgusb-interface-clock";
- clocks = <&core_l3_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <4>;
- };
-
- ssi_l4_ick: ssi_l4_ick {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&l4_ick>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- ssi_ick: ssi_ick_3430es2@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-ssi-interface-clock";
- clocks = <&ssi_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <0>;
- };
-
- usim_gate_fck: usim_gate_fck@c00 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&omap_96m_fck>;
- ti,bit-shift = <9>;
- reg = <0x0c00>;
- };
-
- sys_d2_ck: sys_d2_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&sys_ck>;
- clock-mult = <1>;
- clock-div = <2>;
- };
-
- omap_96m_d2_fck: omap_96m_d2_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&omap_96m_fck>;
- clock-mult = <1>;
- clock-div = <2>;
- };
-
- omap_96m_d4_fck: omap_96m_d4_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&omap_96m_fck>;
- clock-mult = <1>;
- clock-div = <4>;
- };
-
- omap_96m_d8_fck: omap_96m_d8_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&omap_96m_fck>;
- clock-mult = <1>;
- clock-div = <8>;
- };
-
- omap_96m_d10_fck: omap_96m_d10_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&omap_96m_fck>;
- clock-mult = <1>;
- clock-div = <10>;
- };
-
- dpll5_m2_d4_ck: dpll5_m2_d4_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll5_m2_ck>;
- clock-mult = <1>;
- clock-div = <4>;
- };
-
- dpll5_m2_d8_ck: dpll5_m2_d8_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll5_m2_ck>;
- clock-mult = <1>;
- clock-div = <8>;
- };
-
- dpll5_m2_d16_ck: dpll5_m2_d16_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll5_m2_ck>;
- clock-mult = <1>;
- clock-div = <16>;
- };
-
- dpll5_m2_d20_ck: dpll5_m2_d20_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll5_m2_ck>;
- clock-mult = <1>;
- clock-div = <20>;
- };
-
- usim_mux_fck: usim_mux_fck@c40 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&sys_ck>, <&sys_d2_ck>, <&omap_96m_d2_fck>, <&omap_96m_d4_fck>, <&omap_96m_d8_fck>, <&omap_96m_d10_fck>, <&dpll5_m2_d4_ck>, <&dpll5_m2_d8_ck>, <&dpll5_m2_d16_ck>, <&dpll5_m2_d20_ck>;
- ti,bit-shift = <3>;
- reg = <0x0c40>;
- ti,index-starts-at-one;
- };
-
- usim_fck: usim_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&usim_gate_fck>, <&usim_mux_fck>;
- };
-
- usim_ick: usim_ick@c10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&wkup_l4_ick>;
- reg = <0x0c10>;
- ti,bit-shift = <9>;
- };
+ ssi_ssr_gate_fck_3430es2: ssi_ssr_gate_fck_3430es2@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-no-wait-gate-clock";
+ clocks = <&corex2_fck>;
+ ti,bit-shift = <0>;
+ reg = <0x0a00>;
+ };
+
+ ssi_ssr_div_fck_3430es2: ssi_ssr_div_fck_3430es2@a40 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-divider-clock";
+ clocks = <&corex2_fck>;
+ ti,bit-shift = <8>;
+ reg = <0x0a40>;
+ ti,dividers = <0>, <1>, <2>, <3>, <4>, <0>, <6>, <0>, <8>;
+ };
+
+ ssi_ssr_fck: ssi_ssr_fck_3430es2 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&ssi_ssr_gate_fck_3430es2>, <&ssi_ssr_div_fck_3430es2>;
+ };
+
+ ssi_sst_fck: ssi_sst_fck_3430es2 {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&ssi_ssr_fck>;
+ clock-mult = <1>;
+ clock-div = <2>;
+ };
+
+ hsotgusb_ick_3430es2: hsotgusb_ick_3430es2@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-hsotgusb-interface-clock";
+ clocks = <&core_l3_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <4>;
+ };
+
+ ssi_l4_ick: ssi_l4_ick {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&l4_ick>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ ssi_ick: ssi_ick_3430es2@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-ssi-interface-clock";
+ clocks = <&ssi_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <0>;
+ };
+
+ usim_gate_fck: usim_gate_fck@c00 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&omap_96m_fck>;
+ ti,bit-shift = <9>;
+ reg = <0x0c00>;
+ };
+
+ sys_d2_ck: sys_d2_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&sys_ck>;
+ clock-mult = <1>;
+ clock-div = <2>;
+ };
+
+ omap_96m_d2_fck: omap_96m_d2_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&omap_96m_fck>;
+ clock-mult = <1>;
+ clock-div = <2>;
+ };
+
+ omap_96m_d4_fck: omap_96m_d4_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&omap_96m_fck>;
+ clock-mult = <1>;
+ clock-div = <4>;
+ };
+
+ omap_96m_d8_fck: omap_96m_d8_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&omap_96m_fck>;
+ clock-mult = <1>;
+ clock-div = <8>;
+ };
+
+ omap_96m_d10_fck: omap_96m_d10_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&omap_96m_fck>;
+ clock-mult = <1>;
+ clock-div = <10>;
+ };
+
+ dpll5_m2_d4_ck: dpll5_m2_d4_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll5_m2_ck>;
+ clock-mult = <1>;
+ clock-div = <4>;
+ };
+
+ dpll5_m2_d8_ck: dpll5_m2_d8_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll5_m2_ck>;
+ clock-mult = <1>;
+ clock-div = <8>;
+ };
+
+ dpll5_m2_d16_ck: dpll5_m2_d16_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll5_m2_ck>;
+ clock-mult = <1>;
+ clock-div = <16>;
+ };
+
+ dpll5_m2_d20_ck: dpll5_m2_d20_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll5_m2_ck>;
+ clock-mult = <1>;
+ clock-div = <20>;
+ };
+
+ usim_mux_fck: usim_mux_fck@c40 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&sys_ck>, <&sys_d2_ck>, <&omap_96m_d2_fck>, <&omap_96m_d4_fck>, <&omap_96m_d8_fck>, <&omap_96m_d10_fck>, <&dpll5_m2_d4_ck>, <&dpll5_m2_d8_ck>, <&dpll5_m2_d16_ck>, <&dpll5_m2_d20_ck>;
+ ti,bit-shift = <3>;
+ reg = <0x0c40>;
+ ti,index-starts-at-one;
+ };
+
+ usim_fck: usim_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&usim_gate_fck>, <&usim_mux_fck>;
+ };
+
+ usim_ick: usim_ick@c10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&wkup_l4_ick>;
+ reg = <0x0c10>;
+ ti,bit-shift = <9>;
+ };
};
&cm_clockdomains {
- core_l3_clkdm: core_l3_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&sdrc_ick>, <&hsotgusb_ick_3430es2>;
- };
-
- wkup_clkdm: wkup_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&gpio1_dbck>, <&wdt2_fck>, <&wdt2_ick>, <&wdt1_ick>,
- <&gpio1_ick>, <&omap_32ksync_ick>, <&gpt12_ick>,
- <&gpt1_ick>, <&usim_ick>;
- };
-
- core_l4_clkdm: core_l4_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&cpefuse_fck>, <&ts_fck>, <&usbtll_fck>,
- <&usbtll_ick>, <&mmchs3_ick>, <&mmchs3_fck>,
- <&mmchs2_fck>, <&mmchs1_fck>, <&i2c3_fck>, <&i2c2_fck>,
- <&i2c1_fck>, <&mcspi4_fck>, <&mcspi3_fck>,
- <&mcspi2_fck>, <&mcspi1_fck>, <&uart2_fck>,
- <&uart1_fck>, <&hdq_fck>, <&mmchs2_ick>, <&mmchs1_ick>,
- <&hdq_ick>, <&mcspi4_ick>, <&mcspi3_ick>,
- <&mcspi2_ick>, <&mcspi1_ick>, <&i2c3_ick>, <&i2c2_ick>,
- <&i2c1_ick>, <&uart2_ick>, <&uart1_ick>, <&gpt11_ick>,
- <&gpt10_ick>, <&mcbsp5_ick>, <&mcbsp1_ick>,
- <&omapctrl_ick>, <&aes2_ick>, <&sha12_ick>,
- <&ssi_ick>;
- };
+ core_l3_clkdm: core_l3_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&sdrc_ick>, <&hsotgusb_ick_3430es2>;
+ };
+
+ wkup_clkdm: wkup_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&gpio1_dbck>, <&wdt2_fck>, <&wdt2_ick>, <&wdt1_ick>,
+ <&gpio1_ick>, <&omap_32ksync_ick>, <&gpt12_ick>,
+ <&gpt1_ick>, <&usim_ick>;
+ };
+
+ core_l4_clkdm: core_l4_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&cpefuse_fck>, <&ts_fck>, <&usbtll_fck>,
+ <&usbtll_ick>, <&mmchs3_ick>, <&mmchs3_fck>,
+ <&mmchs2_fck>, <&mmchs1_fck>, <&i2c3_fck>, <&i2c2_fck>,
+ <&i2c1_fck>, <&mcspi4_fck>, <&mcspi3_fck>,
+ <&mcspi2_fck>, <&mcspi1_fck>, <&uart2_fck>,
+ <&uart1_fck>, <&hdq_fck>, <&mmchs2_ick>, <&mmchs1_ick>,
+ <&hdq_ick>, <&mcspi4_ick>, <&mcspi3_ick>,
+ <&mcspi2_ick>, <&mcspi1_ick>, <&i2c3_ick>, <&i2c2_ick>,
+ <&i2c1_ick>, <&uart2_ick>, <&uart1_ick>, <&gpt11_ick>,
+ <&gpt10_ick>, <&mcbsp5_ick>, <&mcbsp1_ick>,
+ <&omapctrl_ick>, <&aes2_ick>, <&sha12_ick>,
+ <&ssi_ick>;
+ };
};
--- /dev/null
+/*
+ * Copyright (C) 2017
+ * Logic PD - http://www.logicpd.com
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+&uart4 {
+ reg-shift = <2>;
+};
#include "omap3.dtsi"
/ {
- aliases {
- serial3 = &uart4;
- };
+ aliases {
+ serial3 = &uart4;
+ };
- cpus {
- /* OMAP3630/OMAP37xx 'standard device' variants OPP50 to OPP130 */
- cpu@0 {
- operating-points = <
- /* kHz uV */
- 300000 1012500
- 600000 1200000
- 800000 1325000
- >;
- clock-latency = <300000>; /* From legacy driver */
- };
- };
+ cpus {
+ /* OMAP3630/OMAP37xx 'standard device' variants OPP50 to OPP130 */
+ cpu: cpu@0 {
+ operating-points = <
+ /* kHz uV */
+ 300000 1012500
+ 600000 1200000
+ 800000 1325000
+ >;
+ clock-latency = <300000>; /* From legacy driver */
+ };
+ };
- ocp@68000000 {
- uart4: serial@49042000 {
- compatible = "ti,omap3-uart";
- reg = <0x49042000 0x400>;
- interrupts = <80>;
- dmas = <&sdma 81 &sdma 82>;
- dma-names = "tx", "rx";
- ti,hwmods = "uart4";
- clock-frequency = <48000000>;
- };
+ ocp@68000000 {
+ uart4: serial@49042000 {
+ compatible = "ti,omap3-uart";
+ reg = <0x49042000 0x400>;
+ reg-shift = <2>;
+ interrupts = <80>;
+ dmas = <&sdma 81 &sdma 82>;
+ dma-names = "tx", "rx";
+ ti,hwmods = "uart4";
+ clock-frequency = <48000000>;
+ };
- abb_mpu_iva: regulator-abb-mpu {
- compatible = "ti,abb-v1";
- regulator-name = "abb_mpu_iva";
- #address-cells = <0>;
- #size-cells = <0>;
- reg = <0x483072f0 0x8>, <0x48306818 0x4>;
- reg-names = "base-address", "int-address";
- ti,tranxdone-status-mask = <0x4000000>;
- clocks = <&sys_ck>;
- ti,settling-time = <30>;
- ti,clock-cycles = <8>;
- ti,abb_info = <
- /*uV ABB efuse rbb_m fbb_m vset_m*/
- 1012500 0 0 0 0 0
- 1200000 0 0 0 0 0
- 1325000 0 0 0 0 0
- 1375000 1 0 0 0 0
- >;
- };
+ abb_mpu_iva: regulator-abb-mpu {
+ compatible = "ti,abb-v1";
+ regulator-name = "abb_mpu_iva";
+ #address-cells = <0>;
+ #size-cells = <0>;
+ reg = <0x483072f0 0x8>, <0x48306818 0x4>;
+ reg-names = "base-address", "int-address";
+ ti,tranxdone-status-mask = <0x4000000>;
+ clocks = <&sys_ck>;
+ ti,settling-time = <30>;
+ ti,clock-cycles = <8>;
+ ti,abb_info = <
+ /*uV ABB efuse rbb_m fbb_m vset_m*/
+ 1012500 0 0 0 0 0
+ 1200000 0 0 0 0 0
+ 1325000 0 0 0 0 0
+ 1375000 1 0 0 0 0
+ >;
+ };
- omap3_pmx_core2: pinmux@480025a0 {
- compatible = "ti,omap3-padconf", "pinctrl-single";
- reg = <0x480025a0 0x5c>;
- #address-cells = <1>;
- #size-cells = <0>;
- #interrupt-cells = <1>;
- interrupt-controller;
- pinctrl-single,register-width = <16>;
- pinctrl-single,function-mask = <0xff1f>;
- };
+ omap3_pmx_core2: pinmux@480025a0 {
+ compatible = "ti,omap3-padconf", "pinctrl-single";
+ reg = <0x480025a0 0x5c>;
+ #address-cells = <1>;
+ #size-cells = <0>;
+ #pinctrl-cells = <1>;
+ #interrupt-cells = <1>;
+ interrupt-controller;
+ pinctrl-single,register-width = <16>;
+ pinctrl-single,function-mask = <0xff1f>;
+ };
- isp: isp@480bc000 {
- compatible = "ti,omap3-isp";
- reg = <0x480bc000 0x12fc
- 0x480bd800 0x0600>;
- interrupts = <24>;
- iommus = <&mmu_isp>;
- syscon = <&scm_conf 0x2f0>;
- ti,phy-type = <OMAP3ISP_PHY_TYPE_CSIPHY>;
- #clock-cells = <1>;
- ports {
- #address-cells = <1>;
- #size-cells = <0>;
- };
- };
+ isp: isp@480bc000 {
+ compatible = "ti,omap3-isp";
+ reg = <0x480bc000 0x12fc
+ 0x480bd800 0x0600>;
+ interrupts = <24>;
+ iommus = <&mmu_isp>;
+ syscon = <&scm_conf 0x2f0>;
+ ti,phy-type = <OMAP3ISP_PHY_TYPE_CSIPHY>;
+ #clock-cells = <1>;
+ ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
+ };
+ };
- bandgap@48002524 {
- reg = <0x48002524 0x4>;
- compatible = "ti,omap36xx-bandgap";
- #thermal-sensor-cells = <0>;
- };
- };
+ bandgap: bandgap@48002524 {
+ reg = <0x48002524 0x4>;
+ compatible = "ti,omap36xx-bandgap";
+ #thermal-sensor-cells = <0>;
+ };
+ };
+
+ thermal_zones: thermal-zones {
+ #include "omap3-cpu-thermal.dtsi"
+ };
};
/* OMAP3630 needs dss_96m_fck for VENC */
&venc {
- clocks = <&dss_tv_fck>, <&dss_96m_fck>;
- clock-names = "fck", "tv_dac_clk";
+ clocks = <&dss_tv_fck>, <&dss_96m_fck>;
+ clock-names = "fck", "tv_dac_clk";
};
&ssi {
- status = "ok";
+ status = "ok";
- clocks = <&ssi_ssr_fck>,
- <&ssi_sst_fck>,
- <&ssi_ick>;
- clock-names = "ssi_ssr_fck",
- "ssi_sst_fck",
- "ssi_ick";
+ clocks = <&ssi_ssr_fck>,
+ <&ssi_sst_fck>,
+ <&ssi_ick>;
+ clock-names = "ssi_ssr_fck",
+ "ssi_sst_fck",
+ "ssi_ick";
};
/include/ "omap34xx-omap36xx-clocks.dtsi"
* published by the Free Software Foundation.
*/
&prm_clocks {
- virt_16_8m_ck: virt_16_8m_ck {
- #clock-cells = <0>;
- compatible = "fixed-clock";
- clock-frequency = <16800000>;
- };
-
- osc_sys_ck: osc_sys_ck@d40 {
- #clock-cells = <0>;
- compatible = "ti,mux-clock";
- clocks = <&virt_12m_ck>, <&virt_13m_ck>, <&virt_19200000_ck>, <&virt_26000000_ck>, <&virt_38_4m_ck>, <&virt_16_8m_ck>;
- reg = <0x0d40>;
- };
-
- sys_ck: sys_ck@1270 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&osc_sys_ck>;
- ti,bit-shift = <6>;
- ti,max-div = <3>;
- reg = <0x1270>;
- ti,index-starts-at-one;
- };
-
- sys_clkout1: sys_clkout1@d70 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&osc_sys_ck>;
- reg = <0x0d70>;
- ti,bit-shift = <7>;
- };
-
- dpll3_x2_ck: dpll3_x2_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll3_ck>;
- clock-mult = <2>;
- clock-div = <1>;
- };
-
- dpll3_m2x2_ck: dpll3_m2x2_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll3_m2_ck>;
- clock-mult = <2>;
- clock-div = <1>;
- };
-
- dpll4_x2_ck: dpll4_x2_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll4_ck>;
- clock-mult = <2>;
- clock-div = <1>;
- };
-
- corex2_fck: corex2_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll3_m2x2_ck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- wkup_l4_ick: wkup_l4_ick {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&sys_ck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
+ virt_16_8m_ck: virt_16_8m_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-clock";
+ clock-frequency = <16800000>;
+ };
+
+ osc_sys_ck: osc_sys_ck@d40 {
+ #clock-cells = <0>;
+ compatible = "ti,mux-clock";
+ clocks = <&virt_12m_ck>, <&virt_13m_ck>, <&virt_19200000_ck>, <&virt_26000000_ck>, <&virt_38_4m_ck>, <&virt_16_8m_ck>;
+ reg = <0x0d40>;
+ };
+
+ sys_ck: sys_ck@1270 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&osc_sys_ck>;
+ ti,bit-shift = <6>;
+ ti,max-div = <3>;
+ reg = <0x1270>;
+ ti,index-starts-at-one;
+ };
+
+ sys_clkout1: sys_clkout1@d70 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&osc_sys_ck>;
+ reg = <0x0d70>;
+ ti,bit-shift = <7>;
+ };
+
+ dpll3_x2_ck: dpll3_x2_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll3_ck>;
+ clock-mult = <2>;
+ clock-div = <1>;
+ };
+
+ dpll3_m2x2_ck: dpll3_m2x2_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll3_m2_ck>;
+ clock-mult = <2>;
+ clock-div = <1>;
+ };
+
+ dpll4_x2_ck: dpll4_x2_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll4_ck>;
+ clock-mult = <2>;
+ clock-div = <1>;
+ };
+
+ corex2_fck: corex2_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll3_m2x2_ck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ wkup_l4_ick: wkup_l4_ick {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&sys_ck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
};
&scm_clocks {
- mcbsp5_mux_fck: mcbsp5_mux_fck@68 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&core_96m_fck>, <&mcbsp_clks>;
- ti,bit-shift = <4>;
- reg = <0x68>;
- };
-
- mcbsp5_fck: mcbsp5_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&mcbsp5_gate_fck>, <&mcbsp5_mux_fck>;
- };
-
- mcbsp1_mux_fck: mcbsp1_mux_fck@4 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&core_96m_fck>, <&mcbsp_clks>;
- ti,bit-shift = <2>;
- reg = <0x04>;
- };
-
- mcbsp1_fck: mcbsp1_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&mcbsp1_gate_fck>, <&mcbsp1_mux_fck>;
- };
-
- mcbsp2_mux_fck: mcbsp2_mux_fck@4 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&per_96m_fck>, <&mcbsp_clks>;
- ti,bit-shift = <6>;
- reg = <0x04>;
- };
-
- mcbsp2_fck: mcbsp2_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&mcbsp2_gate_fck>, <&mcbsp2_mux_fck>;
- };
-
- mcbsp3_mux_fck: mcbsp3_mux_fck@68 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&per_96m_fck>, <&mcbsp_clks>;
- reg = <0x68>;
- };
-
- mcbsp3_fck: mcbsp3_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&mcbsp3_gate_fck>, <&mcbsp3_mux_fck>;
- };
-
- mcbsp4_mux_fck: mcbsp4_mux_fck@68 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&per_96m_fck>, <&mcbsp_clks>;
- ti,bit-shift = <2>;
- reg = <0x68>;
- };
-
- mcbsp4_fck: mcbsp4_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&mcbsp4_gate_fck>, <&mcbsp4_mux_fck>;
- };
+ mcbsp5_mux_fck: mcbsp5_mux_fck@68 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&core_96m_fck>, <&mcbsp_clks>;
+ ti,bit-shift = <4>;
+ reg = <0x68>;
+ };
+
+ mcbsp5_fck: mcbsp5_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&mcbsp5_gate_fck>, <&mcbsp5_mux_fck>;
+ };
+
+ mcbsp1_mux_fck: mcbsp1_mux_fck@4 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&core_96m_fck>, <&mcbsp_clks>;
+ ti,bit-shift = <2>;
+ reg = <0x04>;
+ };
+
+ mcbsp1_fck: mcbsp1_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&mcbsp1_gate_fck>, <&mcbsp1_mux_fck>;
+ };
+
+ mcbsp2_mux_fck: mcbsp2_mux_fck@4 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&per_96m_fck>, <&mcbsp_clks>;
+ ti,bit-shift = <6>;
+ reg = <0x04>;
+ };
+
+ mcbsp2_fck: mcbsp2_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&mcbsp2_gate_fck>, <&mcbsp2_mux_fck>;
+ };
+
+ mcbsp3_mux_fck: mcbsp3_mux_fck@68 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&per_96m_fck>, <&mcbsp_clks>;
+ reg = <0x68>;
+ };
+
+ mcbsp3_fck: mcbsp3_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&mcbsp3_gate_fck>, <&mcbsp3_mux_fck>;
+ };
+
+ mcbsp4_mux_fck: mcbsp4_mux_fck@68 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&per_96m_fck>, <&mcbsp_clks>;
+ ti,bit-shift = <2>;
+ reg = <0x68>;
+ };
+
+ mcbsp4_fck: mcbsp4_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&mcbsp4_gate_fck>, <&mcbsp4_mux_fck>;
+ };
};
&cm_clocks {
- dummy_apb_pclk: dummy_apb_pclk {
- #clock-cells = <0>;
- compatible = "fixed-clock";
- clock-frequency = <0x0>;
- };
-
- omap_32k_fck: omap_32k_fck {
- #clock-cells = <0>;
- compatible = "fixed-clock";
- clock-frequency = <32768>;
- };
-
- virt_12m_ck: virt_12m_ck {
- #clock-cells = <0>;
- compatible = "fixed-clock";
- clock-frequency = <12000000>;
- };
-
- virt_13m_ck: virt_13m_ck {
- #clock-cells = <0>;
- compatible = "fixed-clock";
- clock-frequency = <13000000>;
- };
-
- virt_19200000_ck: virt_19200000_ck {
- #clock-cells = <0>;
- compatible = "fixed-clock";
- clock-frequency = <19200000>;
- };
-
- virt_26000000_ck: virt_26000000_ck {
- #clock-cells = <0>;
- compatible = "fixed-clock";
- clock-frequency = <26000000>;
- };
-
- virt_38_4m_ck: virt_38_4m_ck {
- #clock-cells = <0>;
- compatible = "fixed-clock";
- clock-frequency = <38400000>;
- };
-
- dpll4_ck: dpll4_ck@d00 {
- #clock-cells = <0>;
- compatible = "ti,omap3-dpll-per-clock";
- clocks = <&sys_ck>, <&sys_ck>;
- reg = <0x0d00>, <0x0d20>, <0x0d44>, <0x0d30>;
- };
-
- dpll4_m2_ck: dpll4_m2_ck@d48 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&dpll4_ck>;
- ti,max-div = <63>;
- reg = <0x0d48>;
- ti,index-starts-at-one;
- };
-
- dpll4_m2x2_mul_ck: dpll4_m2x2_mul_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll4_m2_ck>;
- clock-mult = <2>;
- clock-div = <1>;
- };
-
- dpll4_m2x2_ck: dpll4_m2x2_ck@d00 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&dpll4_m2x2_mul_ck>;
- ti,bit-shift = <0x1b>;
- reg = <0x0d00>;
- ti,set-bit-to-disable;
- };
-
- omap_96m_alwon_fck: omap_96m_alwon_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll4_m2x2_ck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- dpll3_ck: dpll3_ck@d00 {
- #clock-cells = <0>;
- compatible = "ti,omap3-dpll-core-clock";
- clocks = <&sys_ck>, <&sys_ck>;
- reg = <0x0d00>, <0x0d20>, <0x0d40>, <0x0d30>;
- };
-
- dpll3_m3_ck: dpll3_m3_ck@1140 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&dpll3_ck>;
- ti,bit-shift = <16>;
- ti,max-div = <31>;
- reg = <0x1140>;
- ti,index-starts-at-one;
- };
-
- dpll3_m3x2_mul_ck: dpll3_m3x2_mul_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll3_m3_ck>;
- clock-mult = <2>;
- clock-div = <1>;
- };
-
- dpll3_m3x2_ck: dpll3_m3x2_ck@d00 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&dpll3_m3x2_mul_ck>;
- ti,bit-shift = <0xc>;
- reg = <0x0d00>;
- ti,set-bit-to-disable;
- };
-
- emu_core_alwon_ck: emu_core_alwon_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll3_m3x2_ck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- sys_altclk: sys_altclk {
- #clock-cells = <0>;
- compatible = "fixed-clock";
- clock-frequency = <0x0>;
- };
-
- mcbsp_clks: mcbsp_clks {
- #clock-cells = <0>;
- compatible = "fixed-clock";
- clock-frequency = <0x0>;
- };
-
- dpll3_m2_ck: dpll3_m2_ck@d40 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&dpll3_ck>;
- ti,bit-shift = <27>;
- ti,max-div = <31>;
- reg = <0x0d40>;
- ti,index-starts-at-one;
- };
-
- core_ck: core_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll3_m2_ck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- dpll1_fck: dpll1_fck@940 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&core_ck>;
- ti,bit-shift = <19>;
- ti,max-div = <7>;
- reg = <0x0940>;
- ti,index-starts-at-one;
- };
-
- dpll1_ck: dpll1_ck@904 {
- #clock-cells = <0>;
- compatible = "ti,omap3-dpll-clock";
- clocks = <&sys_ck>, <&dpll1_fck>;
- reg = <0x0904>, <0x0924>, <0x0940>, <0x0934>;
- };
-
- dpll1_x2_ck: dpll1_x2_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll1_ck>;
- clock-mult = <2>;
- clock-div = <1>;
- };
-
- dpll1_x2m2_ck: dpll1_x2m2_ck@944 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&dpll1_x2_ck>;
- ti,max-div = <31>;
- reg = <0x0944>;
- ti,index-starts-at-one;
- };
-
- cm_96m_fck: cm_96m_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&omap_96m_alwon_fck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- omap_96m_fck: omap_96m_fck@d40 {
- #clock-cells = <0>;
- compatible = "ti,mux-clock";
- clocks = <&cm_96m_fck>, <&sys_ck>;
- ti,bit-shift = <6>;
- reg = <0x0d40>;
- };
-
- dpll4_m3_ck: dpll4_m3_ck@e40 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&dpll4_ck>;
- ti,bit-shift = <8>;
- ti,max-div = <32>;
- reg = <0x0e40>;
- ti,index-starts-at-one;
- };
-
- dpll4_m3x2_mul_ck: dpll4_m3x2_mul_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll4_m3_ck>;
- clock-mult = <2>;
- clock-div = <1>;
- };
-
- dpll4_m3x2_ck: dpll4_m3x2_ck@d00 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&dpll4_m3x2_mul_ck>;
- ti,bit-shift = <0x1c>;
- reg = <0x0d00>;
- ti,set-bit-to-disable;
- };
-
- omap_54m_fck: omap_54m_fck@d40 {
- #clock-cells = <0>;
- compatible = "ti,mux-clock";
- clocks = <&dpll4_m3x2_ck>, <&sys_altclk>;
- ti,bit-shift = <5>;
- reg = <0x0d40>;
- };
-
- cm_96m_d2_fck: cm_96m_d2_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&cm_96m_fck>;
- clock-mult = <1>;
- clock-div = <2>;
- };
-
- omap_48m_fck: omap_48m_fck@d40 {
- #clock-cells = <0>;
- compatible = "ti,mux-clock";
- clocks = <&cm_96m_d2_fck>, <&sys_altclk>;
- ti,bit-shift = <3>;
- reg = <0x0d40>;
- };
-
- omap_12m_fck: omap_12m_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&omap_48m_fck>;
- clock-mult = <1>;
- clock-div = <4>;
- };
-
- dpll4_m4_ck: dpll4_m4_ck@e40 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&dpll4_ck>;
- ti,max-div = <32>;
- reg = <0x0e40>;
- ti,index-starts-at-one;
- };
-
- dpll4_m4x2_mul_ck: dpll4_m4x2_mul_ck {
- #clock-cells = <0>;
- compatible = "ti,fixed-factor-clock";
- clocks = <&dpll4_m4_ck>;
- ti,clock-mult = <2>;
- ti,clock-div = <1>;
- ti,set-rate-parent;
- };
-
- dpll4_m4x2_ck: dpll4_m4x2_ck@d00 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&dpll4_m4x2_mul_ck>;
- ti,bit-shift = <0x1d>;
- reg = <0x0d00>;
- ti,set-bit-to-disable;
- ti,set-rate-parent;
- };
-
- dpll4_m5_ck: dpll4_m5_ck@f40 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&dpll4_ck>;
- ti,max-div = <63>;
- reg = <0x0f40>;
- ti,index-starts-at-one;
- };
-
- dpll4_m5x2_mul_ck: dpll4_m5x2_mul_ck {
- #clock-cells = <0>;
- compatible = "ti,fixed-factor-clock";
- clocks = <&dpll4_m5_ck>;
- ti,clock-mult = <2>;
- ti,clock-div = <1>;
- ti,set-rate-parent;
- };
-
- dpll4_m5x2_ck: dpll4_m5x2_ck@d00 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&dpll4_m5x2_mul_ck>;
- ti,bit-shift = <0x1e>;
- reg = <0x0d00>;
- ti,set-bit-to-disable;
- ti,set-rate-parent;
- };
-
- dpll4_m6_ck: dpll4_m6_ck@1140 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&dpll4_ck>;
- ti,bit-shift = <24>;
- ti,max-div = <63>;
- reg = <0x1140>;
- ti,index-starts-at-one;
- };
-
- dpll4_m6x2_mul_ck: dpll4_m6x2_mul_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll4_m6_ck>;
- clock-mult = <2>;
- clock-div = <1>;
- };
-
- dpll4_m6x2_ck: dpll4_m6x2_ck@d00 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&dpll4_m6x2_mul_ck>;
- ti,bit-shift = <0x1f>;
- reg = <0x0d00>;
- ti,set-bit-to-disable;
- };
-
- emu_per_alwon_ck: emu_per_alwon_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll4_m6x2_ck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- clkout2_src_gate_ck: clkout2_src_gate_ck@d70 {
- #clock-cells = <0>;
- compatible = "ti,composite-no-wait-gate-clock";
- clocks = <&core_ck>;
- ti,bit-shift = <7>;
- reg = <0x0d70>;
- };
-
- clkout2_src_mux_ck: clkout2_src_mux_ck@d70 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&core_ck>, <&sys_ck>, <&cm_96m_fck>, <&omap_54m_fck>;
- reg = <0x0d70>;
- };
-
- clkout2_src_ck: clkout2_src_ck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&clkout2_src_gate_ck>, <&clkout2_src_mux_ck>;
- };
-
- sys_clkout2: sys_clkout2@d70 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&clkout2_src_ck>;
- ti,bit-shift = <3>;
- ti,max-div = <64>;
- reg = <0x0d70>;
- ti,index-power-of-two;
- };
-
- mpu_ck: mpu_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&dpll1_x2m2_ck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- arm_fck: arm_fck@924 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&mpu_ck>;
- reg = <0x0924>;
- ti,max-div = <2>;
- };
-
- emu_mpu_alwon_ck: emu_mpu_alwon_ck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&mpu_ck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- l3_ick: l3_ick@a40 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&core_ck>;
- ti,max-div = <3>;
- reg = <0x0a40>;
- ti,index-starts-at-one;
- };
-
- l4_ick: l4_ick@a40 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&l3_ick>;
- ti,bit-shift = <2>;
- ti,max-div = <3>;
- reg = <0x0a40>;
- ti,index-starts-at-one;
- };
-
- rm_ick: rm_ick@c40 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&l4_ick>;
- ti,bit-shift = <1>;
- ti,max-div = <3>;
- reg = <0x0c40>;
- ti,index-starts-at-one;
- };
-
- gpt10_gate_fck: gpt10_gate_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&sys_ck>;
- ti,bit-shift = <11>;
- reg = <0x0a00>;
- };
-
- gpt10_mux_fck: gpt10_mux_fck@a40 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&omap_32k_fck>, <&sys_ck>;
- ti,bit-shift = <6>;
- reg = <0x0a40>;
- };
-
- gpt10_fck: gpt10_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&gpt10_gate_fck>, <&gpt10_mux_fck>;
- };
-
- gpt11_gate_fck: gpt11_gate_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&sys_ck>;
- ti,bit-shift = <12>;
- reg = <0x0a00>;
- };
-
- gpt11_mux_fck: gpt11_mux_fck@a40 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&omap_32k_fck>, <&sys_ck>;
- ti,bit-shift = <7>;
- reg = <0x0a40>;
- };
-
- gpt11_fck: gpt11_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&gpt11_gate_fck>, <&gpt11_mux_fck>;
- };
-
- core_96m_fck: core_96m_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&omap_96m_fck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- mmchs2_fck: mmchs2_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&core_96m_fck>;
- reg = <0x0a00>;
- ti,bit-shift = <25>;
- };
-
- mmchs1_fck: mmchs1_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&core_96m_fck>;
- reg = <0x0a00>;
- ti,bit-shift = <24>;
- };
-
- i2c3_fck: i2c3_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&core_96m_fck>;
- reg = <0x0a00>;
- ti,bit-shift = <17>;
- };
-
- i2c2_fck: i2c2_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&core_96m_fck>;
- reg = <0x0a00>;
- ti,bit-shift = <16>;
- };
-
- i2c1_fck: i2c1_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&core_96m_fck>;
- reg = <0x0a00>;
- ti,bit-shift = <15>;
- };
-
- mcbsp5_gate_fck: mcbsp5_gate_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&mcbsp_clks>;
- ti,bit-shift = <10>;
- reg = <0x0a00>;
- };
-
- mcbsp1_gate_fck: mcbsp1_gate_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&mcbsp_clks>;
- ti,bit-shift = <9>;
- reg = <0x0a00>;
- };
-
- core_48m_fck: core_48m_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&omap_48m_fck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- mcspi4_fck: mcspi4_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&core_48m_fck>;
- reg = <0x0a00>;
- ti,bit-shift = <21>;
- };
-
- mcspi3_fck: mcspi3_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&core_48m_fck>;
- reg = <0x0a00>;
- ti,bit-shift = <20>;
- };
-
- mcspi2_fck: mcspi2_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&core_48m_fck>;
- reg = <0x0a00>;
- ti,bit-shift = <19>;
- };
-
- mcspi1_fck: mcspi1_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&core_48m_fck>;
- reg = <0x0a00>;
- ti,bit-shift = <18>;
- };
-
- uart2_fck: uart2_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&core_48m_fck>;
- reg = <0x0a00>;
- ti,bit-shift = <14>;
- };
-
- uart1_fck: uart1_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&core_48m_fck>;
- reg = <0x0a00>;
- ti,bit-shift = <13>;
- };
-
- core_12m_fck: core_12m_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&omap_12m_fck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- hdq_fck: hdq_fck@a00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&core_12m_fck>;
- reg = <0x0a00>;
- ti,bit-shift = <22>;
- };
-
- core_l3_ick: core_l3_ick {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&l3_ick>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- sdrc_ick: sdrc_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&core_l3_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <1>;
- };
-
- gpmc_fck: gpmc_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&core_l3_ick>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- core_l4_ick: core_l4_ick {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&l4_ick>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- mmchs2_ick: mmchs2_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <25>;
- };
-
- mmchs1_ick: mmchs1_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <24>;
- };
-
- hdq_ick: hdq_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <22>;
- };
-
- mcspi4_ick: mcspi4_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <21>;
- };
-
- mcspi3_ick: mcspi3_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <20>;
- };
-
- mcspi2_ick: mcspi2_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <19>;
- };
-
- mcspi1_ick: mcspi1_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <18>;
- };
-
- i2c3_ick: i2c3_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <17>;
- };
-
- i2c2_ick: i2c2_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <16>;
- };
-
- i2c1_ick: i2c1_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <15>;
- };
-
- uart2_ick: uart2_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <14>;
- };
-
- uart1_ick: uart1_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <13>;
- };
-
- gpt11_ick: gpt11_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <12>;
- };
-
- gpt10_ick: gpt10_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <11>;
- };
-
- mcbsp5_ick: mcbsp5_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <10>;
- };
-
- mcbsp1_ick: mcbsp1_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <9>;
- };
-
- omapctrl_ick: omapctrl_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <6>;
- };
-
- dss_tv_fck: dss_tv_fck@e00 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&omap_54m_fck>;
- reg = <0x0e00>;
- ti,bit-shift = <2>;
- };
-
- dss_96m_fck: dss_96m_fck@e00 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&omap_96m_fck>;
- reg = <0x0e00>;
- ti,bit-shift = <2>;
- };
-
- dss2_alwon_fck: dss2_alwon_fck@e00 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&sys_ck>;
- reg = <0x0e00>;
- ti,bit-shift = <1>;
- };
-
- dummy_ck: dummy_ck {
- #clock-cells = <0>;
- compatible = "fixed-clock";
- clock-frequency = <0>;
- };
-
- gpt1_gate_fck: gpt1_gate_fck@c00 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&sys_ck>;
- ti,bit-shift = <0>;
- reg = <0x0c00>;
- };
-
- gpt1_mux_fck: gpt1_mux_fck@c40 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&omap_32k_fck>, <&sys_ck>;
- reg = <0x0c40>;
- };
-
- gpt1_fck: gpt1_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&gpt1_gate_fck>, <&gpt1_mux_fck>;
- };
-
- aes2_ick: aes2_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- ti,bit-shift = <28>;
- reg = <0x0a10>;
- };
-
- wkup_32k_fck: wkup_32k_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&omap_32k_fck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- gpio1_dbck: gpio1_dbck@c00 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&wkup_32k_fck>;
- reg = <0x0c00>;
- ti,bit-shift = <3>;
- };
-
- sha12_ick: sha12_ick@a10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&core_l4_ick>;
- reg = <0x0a10>;
- ti,bit-shift = <27>;
- };
-
- wdt2_fck: wdt2_fck@c00 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&wkup_32k_fck>;
- reg = <0x0c00>;
- ti,bit-shift = <5>;
- };
-
- wdt2_ick: wdt2_ick@c10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&wkup_l4_ick>;
- reg = <0x0c10>;
- ti,bit-shift = <5>;
- };
-
- wdt1_ick: wdt1_ick@c10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&wkup_l4_ick>;
- reg = <0x0c10>;
- ti,bit-shift = <4>;
- };
-
- gpio1_ick: gpio1_ick@c10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&wkup_l4_ick>;
- reg = <0x0c10>;
- ti,bit-shift = <3>;
- };
-
- omap_32ksync_ick: omap_32ksync_ick@c10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&wkup_l4_ick>;
- reg = <0x0c10>;
- ti,bit-shift = <2>;
- };
-
- gpt12_ick: gpt12_ick@c10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&wkup_l4_ick>;
- reg = <0x0c10>;
- ti,bit-shift = <1>;
- };
-
- gpt1_ick: gpt1_ick@c10 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&wkup_l4_ick>;
- reg = <0x0c10>;
- ti,bit-shift = <0>;
- };
-
- per_96m_fck: per_96m_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&omap_96m_alwon_fck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- per_48m_fck: per_48m_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&omap_48m_fck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- uart3_fck: uart3_fck@1000 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&per_48m_fck>;
- reg = <0x1000>;
- ti,bit-shift = <11>;
- };
-
- gpt2_gate_fck: gpt2_gate_fck@1000 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&sys_ck>;
- ti,bit-shift = <3>;
- reg = <0x1000>;
- };
-
- gpt2_mux_fck: gpt2_mux_fck@1040 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&omap_32k_fck>, <&sys_ck>;
- reg = <0x1040>;
- };
-
- gpt2_fck: gpt2_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&gpt2_gate_fck>, <&gpt2_mux_fck>;
- };
-
- gpt3_gate_fck: gpt3_gate_fck@1000 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&sys_ck>;
- ti,bit-shift = <4>;
- reg = <0x1000>;
- };
-
- gpt3_mux_fck: gpt3_mux_fck@1040 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&omap_32k_fck>, <&sys_ck>;
- ti,bit-shift = <1>;
- reg = <0x1040>;
- };
-
- gpt3_fck: gpt3_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&gpt3_gate_fck>, <&gpt3_mux_fck>;
- };
-
- gpt4_gate_fck: gpt4_gate_fck@1000 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&sys_ck>;
- ti,bit-shift = <5>;
- reg = <0x1000>;
- };
-
- gpt4_mux_fck: gpt4_mux_fck@1040 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&omap_32k_fck>, <&sys_ck>;
- ti,bit-shift = <2>;
- reg = <0x1040>;
- };
-
- gpt4_fck: gpt4_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&gpt4_gate_fck>, <&gpt4_mux_fck>;
- };
-
- gpt5_gate_fck: gpt5_gate_fck@1000 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&sys_ck>;
- ti,bit-shift = <6>;
- reg = <0x1000>;
- };
-
- gpt5_mux_fck: gpt5_mux_fck@1040 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&omap_32k_fck>, <&sys_ck>;
- ti,bit-shift = <3>;
- reg = <0x1040>;
- };
-
- gpt5_fck: gpt5_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&gpt5_gate_fck>, <&gpt5_mux_fck>;
- };
-
- gpt6_gate_fck: gpt6_gate_fck@1000 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&sys_ck>;
- ti,bit-shift = <7>;
- reg = <0x1000>;
- };
-
- gpt6_mux_fck: gpt6_mux_fck@1040 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&omap_32k_fck>, <&sys_ck>;
- ti,bit-shift = <4>;
- reg = <0x1040>;
- };
-
- gpt6_fck: gpt6_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&gpt6_gate_fck>, <&gpt6_mux_fck>;
- };
-
- gpt7_gate_fck: gpt7_gate_fck@1000 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&sys_ck>;
- ti,bit-shift = <8>;
- reg = <0x1000>;
- };
-
- gpt7_mux_fck: gpt7_mux_fck@1040 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&omap_32k_fck>, <&sys_ck>;
- ti,bit-shift = <5>;
- reg = <0x1040>;
- };
-
- gpt7_fck: gpt7_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&gpt7_gate_fck>, <&gpt7_mux_fck>;
- };
-
- gpt8_gate_fck: gpt8_gate_fck@1000 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&sys_ck>;
- ti,bit-shift = <9>;
- reg = <0x1000>;
- };
-
- gpt8_mux_fck: gpt8_mux_fck@1040 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&omap_32k_fck>, <&sys_ck>;
- ti,bit-shift = <6>;
- reg = <0x1040>;
- };
-
- gpt8_fck: gpt8_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&gpt8_gate_fck>, <&gpt8_mux_fck>;
- };
-
- gpt9_gate_fck: gpt9_gate_fck@1000 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&sys_ck>;
- ti,bit-shift = <10>;
- reg = <0x1000>;
- };
-
- gpt9_mux_fck: gpt9_mux_fck@1040 {
- #clock-cells = <0>;
- compatible = "ti,composite-mux-clock";
- clocks = <&omap_32k_fck>, <&sys_ck>;
- ti,bit-shift = <7>;
- reg = <0x1040>;
- };
-
- gpt9_fck: gpt9_fck {
- #clock-cells = <0>;
- compatible = "ti,composite-clock";
- clocks = <&gpt9_gate_fck>, <&gpt9_mux_fck>;
- };
-
- per_32k_alwon_fck: per_32k_alwon_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&omap_32k_fck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- gpio6_dbck: gpio6_dbck@1000 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&per_32k_alwon_fck>;
- reg = <0x1000>;
- ti,bit-shift = <17>;
- };
-
- gpio5_dbck: gpio5_dbck@1000 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&per_32k_alwon_fck>;
- reg = <0x1000>;
- ti,bit-shift = <16>;
- };
-
- gpio4_dbck: gpio4_dbck@1000 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&per_32k_alwon_fck>;
- reg = <0x1000>;
- ti,bit-shift = <15>;
- };
-
- gpio3_dbck: gpio3_dbck@1000 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&per_32k_alwon_fck>;
- reg = <0x1000>;
- ti,bit-shift = <14>;
- };
-
- gpio2_dbck: gpio2_dbck@1000 {
- #clock-cells = <0>;
- compatible = "ti,gate-clock";
- clocks = <&per_32k_alwon_fck>;
- reg = <0x1000>;
- ti,bit-shift = <13>;
- };
-
- wdt3_fck: wdt3_fck@1000 {
- #clock-cells = <0>;
- compatible = "ti,wait-gate-clock";
- clocks = <&per_32k_alwon_fck>;
- reg = <0x1000>;
- ti,bit-shift = <12>;
- };
-
- per_l4_ick: per_l4_ick {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&l4_ick>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- gpio6_ick: gpio6_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <17>;
- };
-
- gpio5_ick: gpio5_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <16>;
- };
-
- gpio4_ick: gpio4_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <15>;
- };
-
- gpio3_ick: gpio3_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <14>;
- };
-
- gpio2_ick: gpio2_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <13>;
- };
-
- wdt3_ick: wdt3_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <12>;
- };
-
- uart3_ick: uart3_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <11>;
- };
-
- uart4_ick: uart4_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <18>;
- };
-
- gpt9_ick: gpt9_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <10>;
- };
-
- gpt8_ick: gpt8_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <9>;
- };
-
- gpt7_ick: gpt7_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <8>;
- };
-
- gpt6_ick: gpt6_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <7>;
- };
-
- gpt5_ick: gpt5_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <6>;
- };
-
- gpt4_ick: gpt4_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <5>;
- };
-
- gpt3_ick: gpt3_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <4>;
- };
-
- gpt2_ick: gpt2_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <3>;
- };
-
- mcbsp2_ick: mcbsp2_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <0>;
- };
-
- mcbsp3_ick: mcbsp3_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <1>;
- };
-
- mcbsp4_ick: mcbsp4_ick@1010 {
- #clock-cells = <0>;
- compatible = "ti,omap3-interface-clock";
- clocks = <&per_l4_ick>;
- reg = <0x1010>;
- ti,bit-shift = <2>;
- };
-
- mcbsp2_gate_fck: mcbsp2_gate_fck@1000 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&mcbsp_clks>;
- ti,bit-shift = <0>;
- reg = <0x1000>;
- };
-
- mcbsp3_gate_fck: mcbsp3_gate_fck@1000 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&mcbsp_clks>;
- ti,bit-shift = <1>;
- reg = <0x1000>;
- };
-
- mcbsp4_gate_fck: mcbsp4_gate_fck@1000 {
- #clock-cells = <0>;
- compatible = "ti,composite-gate-clock";
- clocks = <&mcbsp_clks>;
- ti,bit-shift = <2>;
- reg = <0x1000>;
- };
-
- emu_src_mux_ck: emu_src_mux_ck@1140 {
- #clock-cells = <0>;
- compatible = "ti,mux-clock";
- clocks = <&sys_ck>, <&emu_core_alwon_ck>, <&emu_per_alwon_ck>, <&emu_mpu_alwon_ck>;
- reg = <0x1140>;
- };
-
- emu_src_ck: emu_src_ck {
- #clock-cells = <0>;
- compatible = "ti,clkdm-gate-clock";
- clocks = <&emu_src_mux_ck>;
- };
-
- pclk_fck: pclk_fck@1140 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&emu_src_ck>;
- ti,bit-shift = <8>;
- ti,max-div = <7>;
- reg = <0x1140>;
- ti,index-starts-at-one;
- };
-
- pclkx2_fck: pclkx2_fck@1140 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&emu_src_ck>;
- ti,bit-shift = <6>;
- ti,max-div = <3>;
- reg = <0x1140>;
- ti,index-starts-at-one;
- };
-
- atclk_fck: atclk_fck@1140 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&emu_src_ck>;
- ti,bit-shift = <4>;
- ti,max-div = <3>;
- reg = <0x1140>;
- ti,index-starts-at-one;
- };
-
- traceclk_src_fck: traceclk_src_fck@1140 {
- #clock-cells = <0>;
- compatible = "ti,mux-clock";
- clocks = <&sys_ck>, <&emu_core_alwon_ck>, <&emu_per_alwon_ck>, <&emu_mpu_alwon_ck>;
- ti,bit-shift = <2>;
- reg = <0x1140>;
- };
-
- traceclk_fck: traceclk_fck@1140 {
- #clock-cells = <0>;
- compatible = "ti,divider-clock";
- clocks = <&traceclk_src_fck>;
- ti,bit-shift = <11>;
- ti,max-div = <7>;
- reg = <0x1140>;
- ti,index-starts-at-one;
- };
-
- secure_32k_fck: secure_32k_fck {
- #clock-cells = <0>;
- compatible = "fixed-clock";
- clock-frequency = <32768>;
- };
-
- gpt12_fck: gpt12_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&secure_32k_fck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
-
- wdt1_fck: wdt1_fck {
- #clock-cells = <0>;
- compatible = "fixed-factor-clock";
- clocks = <&secure_32k_fck>;
- clock-mult = <1>;
- clock-div = <1>;
- };
+ dummy_apb_pclk: dummy_apb_pclk {
+ #clock-cells = <0>;
+ compatible = "fixed-clock";
+ clock-frequency = <0x0>;
+ };
+
+ omap_32k_fck: omap_32k_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-clock";
+ clock-frequency = <32768>;
+ };
+
+ virt_12m_ck: virt_12m_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-clock";
+ clock-frequency = <12000000>;
+ };
+
+ virt_13m_ck: virt_13m_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-clock";
+ clock-frequency = <13000000>;
+ };
+
+ virt_19200000_ck: virt_19200000_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-clock";
+ clock-frequency = <19200000>;
+ };
+
+ virt_26000000_ck: virt_26000000_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-clock";
+ clock-frequency = <26000000>;
+ };
+
+ virt_38_4m_ck: virt_38_4m_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-clock";
+ clock-frequency = <38400000>;
+ };
+
+ dpll4_ck: dpll4_ck@d00 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-dpll-per-clock";
+ clocks = <&sys_ck>, <&sys_ck>;
+ reg = <0x0d00>, <0x0d20>, <0x0d44>, <0x0d30>;
+ };
+
+ dpll4_m2_ck: dpll4_m2_ck@d48 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&dpll4_ck>;
+ ti,max-div = <63>;
+ reg = <0x0d48>;
+ ti,index-starts-at-one;
+ };
+
+ dpll4_m2x2_mul_ck: dpll4_m2x2_mul_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll4_m2_ck>;
+ clock-mult = <2>;
+ clock-div = <1>;
+ };
+
+ dpll4_m2x2_ck: dpll4_m2x2_ck@d00 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&dpll4_m2x2_mul_ck>;
+ ti,bit-shift = <0x1b>;
+ reg = <0x0d00>;
+ ti,set-bit-to-disable;
+ };
+
+ omap_96m_alwon_fck: omap_96m_alwon_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll4_m2x2_ck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ dpll3_ck: dpll3_ck@d00 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-dpll-core-clock";
+ clocks = <&sys_ck>, <&sys_ck>;
+ reg = <0x0d00>, <0x0d20>, <0x0d40>, <0x0d30>;
+ };
+
+ dpll3_m3_ck: dpll3_m3_ck@1140 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&dpll3_ck>;
+ ti,bit-shift = <16>;
+ ti,max-div = <31>;
+ reg = <0x1140>;
+ ti,index-starts-at-one;
+ };
+
+ dpll3_m3x2_mul_ck: dpll3_m3x2_mul_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll3_m3_ck>;
+ clock-mult = <2>;
+ clock-div = <1>;
+ };
+
+ dpll3_m3x2_ck: dpll3_m3x2_ck@d00 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&dpll3_m3x2_mul_ck>;
+ ti,bit-shift = <0xc>;
+ reg = <0x0d00>;
+ ti,set-bit-to-disable;
+ };
+
+ emu_core_alwon_ck: emu_core_alwon_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll3_m3x2_ck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ sys_altclk: sys_altclk {
+ #clock-cells = <0>;
+ compatible = "fixed-clock";
+ clock-frequency = <0x0>;
+ };
+
+ mcbsp_clks: mcbsp_clks {
+ #clock-cells = <0>;
+ compatible = "fixed-clock";
+ clock-frequency = <0x0>;
+ };
+
+ dpll3_m2_ck: dpll3_m2_ck@d40 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&dpll3_ck>;
+ ti,bit-shift = <27>;
+ ti,max-div = <31>;
+ reg = <0x0d40>;
+ ti,index-starts-at-one;
+ };
+
+ core_ck: core_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll3_m2_ck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ dpll1_fck: dpll1_fck@940 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&core_ck>;
+ ti,bit-shift = <19>;
+ ti,max-div = <7>;
+ reg = <0x0940>;
+ ti,index-starts-at-one;
+ };
+
+ dpll1_ck: dpll1_ck@904 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-dpll-clock";
+ clocks = <&sys_ck>, <&dpll1_fck>;
+ reg = <0x0904>, <0x0924>, <0x0940>, <0x0934>;
+ };
+
+ dpll1_x2_ck: dpll1_x2_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll1_ck>;
+ clock-mult = <2>;
+ clock-div = <1>;
+ };
+
+ dpll1_x2m2_ck: dpll1_x2m2_ck@944 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&dpll1_x2_ck>;
+ ti,max-div = <31>;
+ reg = <0x0944>;
+ ti,index-starts-at-one;
+ };
+
+ cm_96m_fck: cm_96m_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&omap_96m_alwon_fck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ omap_96m_fck: omap_96m_fck@d40 {
+ #clock-cells = <0>;
+ compatible = "ti,mux-clock";
+ clocks = <&cm_96m_fck>, <&sys_ck>;
+ ti,bit-shift = <6>;
+ reg = <0x0d40>;
+ };
+
+ dpll4_m3_ck: dpll4_m3_ck@e40 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&dpll4_ck>;
+ ti,bit-shift = <8>;
+ ti,max-div = <32>;
+ reg = <0x0e40>;
+ ti,index-starts-at-one;
+ };
+
+ dpll4_m3x2_mul_ck: dpll4_m3x2_mul_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll4_m3_ck>;
+ clock-mult = <2>;
+ clock-div = <1>;
+ };
+
+ dpll4_m3x2_ck: dpll4_m3x2_ck@d00 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&dpll4_m3x2_mul_ck>;
+ ti,bit-shift = <0x1c>;
+ reg = <0x0d00>;
+ ti,set-bit-to-disable;
+ };
+
+ omap_54m_fck: omap_54m_fck@d40 {
+ #clock-cells = <0>;
+ compatible = "ti,mux-clock";
+ clocks = <&dpll4_m3x2_ck>, <&sys_altclk>;
+ ti,bit-shift = <5>;
+ reg = <0x0d40>;
+ };
+
+ cm_96m_d2_fck: cm_96m_d2_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&cm_96m_fck>;
+ clock-mult = <1>;
+ clock-div = <2>;
+ };
+
+ omap_48m_fck: omap_48m_fck@d40 {
+ #clock-cells = <0>;
+ compatible = "ti,mux-clock";
+ clocks = <&cm_96m_d2_fck>, <&sys_altclk>;
+ ti,bit-shift = <3>;
+ reg = <0x0d40>;
+ };
+
+ omap_12m_fck: omap_12m_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&omap_48m_fck>;
+ clock-mult = <1>;
+ clock-div = <4>;
+ };
+
+ dpll4_m4_ck: dpll4_m4_ck@e40 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&dpll4_ck>;
+ ti,max-div = <32>;
+ reg = <0x0e40>;
+ ti,index-starts-at-one;
+ };
+
+ dpll4_m4x2_mul_ck: dpll4_m4x2_mul_ck {
+ #clock-cells = <0>;
+ compatible = "ti,fixed-factor-clock";
+ clocks = <&dpll4_m4_ck>;
+ ti,clock-mult = <2>;
+ ti,clock-div = <1>;
+ ti,set-rate-parent;
+ };
+
+ dpll4_m4x2_ck: dpll4_m4x2_ck@d00 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&dpll4_m4x2_mul_ck>;
+ ti,bit-shift = <0x1d>;
+ reg = <0x0d00>;
+ ti,set-bit-to-disable;
+ ti,set-rate-parent;
+ };
+
+ dpll4_m5_ck: dpll4_m5_ck@f40 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&dpll4_ck>;
+ ti,max-div = <63>;
+ reg = <0x0f40>;
+ ti,index-starts-at-one;
+ };
+
+ dpll4_m5x2_mul_ck: dpll4_m5x2_mul_ck {
+ #clock-cells = <0>;
+ compatible = "ti,fixed-factor-clock";
+ clocks = <&dpll4_m5_ck>;
+ ti,clock-mult = <2>;
+ ti,clock-div = <1>;
+ ti,set-rate-parent;
+ };
+
+ dpll4_m5x2_ck: dpll4_m5x2_ck@d00 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&dpll4_m5x2_mul_ck>;
+ ti,bit-shift = <0x1e>;
+ reg = <0x0d00>;
+ ti,set-bit-to-disable;
+ ti,set-rate-parent;
+ };
+
+ dpll4_m6_ck: dpll4_m6_ck@1140 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&dpll4_ck>;
+ ti,bit-shift = <24>;
+ ti,max-div = <63>;
+ reg = <0x1140>;
+ ti,index-starts-at-one;
+ };
+
+ dpll4_m6x2_mul_ck: dpll4_m6x2_mul_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll4_m6_ck>;
+ clock-mult = <2>;
+ clock-div = <1>;
+ };
+
+ dpll4_m6x2_ck: dpll4_m6x2_ck@d00 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&dpll4_m6x2_mul_ck>;
+ ti,bit-shift = <0x1f>;
+ reg = <0x0d00>;
+ ti,set-bit-to-disable;
+ };
+
+ emu_per_alwon_ck: emu_per_alwon_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll4_m6x2_ck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ clkout2_src_gate_ck: clkout2_src_gate_ck@d70 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-no-wait-gate-clock";
+ clocks = <&core_ck>;
+ ti,bit-shift = <7>;
+ reg = <0x0d70>;
+ };
+
+ clkout2_src_mux_ck: clkout2_src_mux_ck@d70 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&core_ck>, <&sys_ck>, <&cm_96m_fck>, <&omap_54m_fck>;
+ reg = <0x0d70>;
+ };
+
+ clkout2_src_ck: clkout2_src_ck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&clkout2_src_gate_ck>, <&clkout2_src_mux_ck>;
+ };
+
+ sys_clkout2: sys_clkout2@d70 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&clkout2_src_ck>;
+ ti,bit-shift = <3>;
+ ti,max-div = <64>;
+ reg = <0x0d70>;
+ ti,index-power-of-two;
+ };
+
+ mpu_ck: mpu_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&dpll1_x2m2_ck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ arm_fck: arm_fck@924 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&mpu_ck>;
+ reg = <0x0924>;
+ ti,max-div = <2>;
+ };
+
+ emu_mpu_alwon_ck: emu_mpu_alwon_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&mpu_ck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ l3_ick: l3_ick@a40 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&core_ck>;
+ ti,max-div = <3>;
+ reg = <0x0a40>;
+ ti,index-starts-at-one;
+ };
+
+ l4_ick: l4_ick@a40 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&l3_ick>;
+ ti,bit-shift = <2>;
+ ti,max-div = <3>;
+ reg = <0x0a40>;
+ ti,index-starts-at-one;
+ };
+
+ rm_ick: rm_ick@c40 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&l4_ick>;
+ ti,bit-shift = <1>;
+ ti,max-div = <3>;
+ reg = <0x0c40>;
+ ti,index-starts-at-one;
+ };
+
+ gpt10_gate_fck: gpt10_gate_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&sys_ck>;
+ ti,bit-shift = <11>;
+ reg = <0x0a00>;
+ };
+
+ gpt10_mux_fck: gpt10_mux_fck@a40 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&omap_32k_fck>, <&sys_ck>;
+ ti,bit-shift = <6>;
+ reg = <0x0a40>;
+ };
+
+ gpt10_fck: gpt10_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&gpt10_gate_fck>, <&gpt10_mux_fck>;
+ };
+
+ gpt11_gate_fck: gpt11_gate_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&sys_ck>;
+ ti,bit-shift = <12>;
+ reg = <0x0a00>;
+ };
+
+ gpt11_mux_fck: gpt11_mux_fck@a40 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&omap_32k_fck>, <&sys_ck>;
+ ti,bit-shift = <7>;
+ reg = <0x0a40>;
+ };
+
+ gpt11_fck: gpt11_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&gpt11_gate_fck>, <&gpt11_mux_fck>;
+ };
+
+ core_96m_fck: core_96m_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&omap_96m_fck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ mmchs2_fck: mmchs2_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&core_96m_fck>;
+ reg = <0x0a00>;
+ ti,bit-shift = <25>;
+ };
+
+ mmchs1_fck: mmchs1_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&core_96m_fck>;
+ reg = <0x0a00>;
+ ti,bit-shift = <24>;
+ };
+
+ i2c3_fck: i2c3_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&core_96m_fck>;
+ reg = <0x0a00>;
+ ti,bit-shift = <17>;
+ };
+
+ i2c2_fck: i2c2_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&core_96m_fck>;
+ reg = <0x0a00>;
+ ti,bit-shift = <16>;
+ };
+
+ i2c1_fck: i2c1_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&core_96m_fck>;
+ reg = <0x0a00>;
+ ti,bit-shift = <15>;
+ };
+
+ mcbsp5_gate_fck: mcbsp5_gate_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&mcbsp_clks>;
+ ti,bit-shift = <10>;
+ reg = <0x0a00>;
+ };
+
+ mcbsp1_gate_fck: mcbsp1_gate_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&mcbsp_clks>;
+ ti,bit-shift = <9>;
+ reg = <0x0a00>;
+ };
+
+ core_48m_fck: core_48m_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&omap_48m_fck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ mcspi4_fck: mcspi4_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&core_48m_fck>;
+ reg = <0x0a00>;
+ ti,bit-shift = <21>;
+ };
+
+ mcspi3_fck: mcspi3_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&core_48m_fck>;
+ reg = <0x0a00>;
+ ti,bit-shift = <20>;
+ };
+
+ mcspi2_fck: mcspi2_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&core_48m_fck>;
+ reg = <0x0a00>;
+ ti,bit-shift = <19>;
+ };
+
+ mcspi1_fck: mcspi1_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&core_48m_fck>;
+ reg = <0x0a00>;
+ ti,bit-shift = <18>;
+ };
+
+ uart2_fck: uart2_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&core_48m_fck>;
+ reg = <0x0a00>;
+ ti,bit-shift = <14>;
+ };
+
+ uart1_fck: uart1_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&core_48m_fck>;
+ reg = <0x0a00>;
+ ti,bit-shift = <13>;
+ };
+
+ core_12m_fck: core_12m_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&omap_12m_fck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ hdq_fck: hdq_fck@a00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&core_12m_fck>;
+ reg = <0x0a00>;
+ ti,bit-shift = <22>;
+ };
+
+ core_l3_ick: core_l3_ick {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&l3_ick>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ sdrc_ick: sdrc_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&core_l3_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <1>;
+ };
+
+ gpmc_fck: gpmc_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&core_l3_ick>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ core_l4_ick: core_l4_ick {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&l4_ick>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ mmchs2_ick: mmchs2_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <25>;
+ };
+
+ mmchs1_ick: mmchs1_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <24>;
+ };
+
+ hdq_ick: hdq_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <22>;
+ };
+
+ mcspi4_ick: mcspi4_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <21>;
+ };
+
+ mcspi3_ick: mcspi3_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <20>;
+ };
+
+ mcspi2_ick: mcspi2_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <19>;
+ };
+
+ mcspi1_ick: mcspi1_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <18>;
+ };
+
+ i2c3_ick: i2c3_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <17>;
+ };
+
+ i2c2_ick: i2c2_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <16>;
+ };
+
+ i2c1_ick: i2c1_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <15>;
+ };
+
+ uart2_ick: uart2_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <14>;
+ };
+
+ uart1_ick: uart1_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <13>;
+ };
+
+ gpt11_ick: gpt11_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <12>;
+ };
+
+ gpt10_ick: gpt10_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <11>;
+ };
+
+ mcbsp5_ick: mcbsp5_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <10>;
+ };
+
+ mcbsp1_ick: mcbsp1_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <9>;
+ };
+
+ omapctrl_ick: omapctrl_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <6>;
+ };
+
+ dss_tv_fck: dss_tv_fck@e00 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&omap_54m_fck>;
+ reg = <0x0e00>;
+ ti,bit-shift = <2>;
+ };
+
+ dss_96m_fck: dss_96m_fck@e00 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&omap_96m_fck>;
+ reg = <0x0e00>;
+ ti,bit-shift = <2>;
+ };
+
+ dss2_alwon_fck: dss2_alwon_fck@e00 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&sys_ck>;
+ reg = <0x0e00>;
+ ti,bit-shift = <1>;
+ };
+
+ dummy_ck: dummy_ck {
+ #clock-cells = <0>;
+ compatible = "fixed-clock";
+ clock-frequency = <0>;
+ };
+
+ gpt1_gate_fck: gpt1_gate_fck@c00 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&sys_ck>;
+ ti,bit-shift = <0>;
+ reg = <0x0c00>;
+ };
+
+ gpt1_mux_fck: gpt1_mux_fck@c40 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&omap_32k_fck>, <&sys_ck>;
+ reg = <0x0c40>;
+ };
+
+ gpt1_fck: gpt1_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&gpt1_gate_fck>, <&gpt1_mux_fck>;
+ };
+
+ aes2_ick: aes2_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ ti,bit-shift = <28>;
+ reg = <0x0a10>;
+ };
+
+ wkup_32k_fck: wkup_32k_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&omap_32k_fck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ gpio1_dbck: gpio1_dbck@c00 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&wkup_32k_fck>;
+ reg = <0x0c00>;
+ ti,bit-shift = <3>;
+ };
+
+ sha12_ick: sha12_ick@a10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&core_l4_ick>;
+ reg = <0x0a10>;
+ ti,bit-shift = <27>;
+ };
+
+ wdt2_fck: wdt2_fck@c00 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&wkup_32k_fck>;
+ reg = <0x0c00>;
+ ti,bit-shift = <5>;
+ };
+
+ wdt2_ick: wdt2_ick@c10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&wkup_l4_ick>;
+ reg = <0x0c10>;
+ ti,bit-shift = <5>;
+ };
+
+ wdt1_ick: wdt1_ick@c10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&wkup_l4_ick>;
+ reg = <0x0c10>;
+ ti,bit-shift = <4>;
+ };
+
+ gpio1_ick: gpio1_ick@c10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&wkup_l4_ick>;
+ reg = <0x0c10>;
+ ti,bit-shift = <3>;
+ };
+
+ omap_32ksync_ick: omap_32ksync_ick@c10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&wkup_l4_ick>;
+ reg = <0x0c10>;
+ ti,bit-shift = <2>;
+ };
+
+ gpt12_ick: gpt12_ick@c10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&wkup_l4_ick>;
+ reg = <0x0c10>;
+ ti,bit-shift = <1>;
+ };
+
+ gpt1_ick: gpt1_ick@c10 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&wkup_l4_ick>;
+ reg = <0x0c10>;
+ ti,bit-shift = <0>;
+ };
+
+ per_96m_fck: per_96m_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&omap_96m_alwon_fck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ per_48m_fck: per_48m_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&omap_48m_fck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ uart3_fck: uart3_fck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&per_48m_fck>;
+ reg = <0x1000>;
+ ti,bit-shift = <11>;
+ };
+
+ gpt2_gate_fck: gpt2_gate_fck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&sys_ck>;
+ ti,bit-shift = <3>;
+ reg = <0x1000>;
+ };
+
+ gpt2_mux_fck: gpt2_mux_fck@1040 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&omap_32k_fck>, <&sys_ck>;
+ reg = <0x1040>;
+ };
+
+ gpt2_fck: gpt2_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&gpt2_gate_fck>, <&gpt2_mux_fck>;
+ };
+
+ gpt3_gate_fck: gpt3_gate_fck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&sys_ck>;
+ ti,bit-shift = <4>;
+ reg = <0x1000>;
+ };
+
+ gpt3_mux_fck: gpt3_mux_fck@1040 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&omap_32k_fck>, <&sys_ck>;
+ ti,bit-shift = <1>;
+ reg = <0x1040>;
+ };
+
+ gpt3_fck: gpt3_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&gpt3_gate_fck>, <&gpt3_mux_fck>;
+ };
+
+ gpt4_gate_fck: gpt4_gate_fck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&sys_ck>;
+ ti,bit-shift = <5>;
+ reg = <0x1000>;
+ };
+
+ gpt4_mux_fck: gpt4_mux_fck@1040 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&omap_32k_fck>, <&sys_ck>;
+ ti,bit-shift = <2>;
+ reg = <0x1040>;
+ };
+
+ gpt4_fck: gpt4_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&gpt4_gate_fck>, <&gpt4_mux_fck>;
+ };
+
+ gpt5_gate_fck: gpt5_gate_fck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&sys_ck>;
+ ti,bit-shift = <6>;
+ reg = <0x1000>;
+ };
+
+ gpt5_mux_fck: gpt5_mux_fck@1040 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&omap_32k_fck>, <&sys_ck>;
+ ti,bit-shift = <3>;
+ reg = <0x1040>;
+ };
+
+ gpt5_fck: gpt5_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&gpt5_gate_fck>, <&gpt5_mux_fck>;
+ };
+
+ gpt6_gate_fck: gpt6_gate_fck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&sys_ck>;
+ ti,bit-shift = <7>;
+ reg = <0x1000>;
+ };
+
+ gpt6_mux_fck: gpt6_mux_fck@1040 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&omap_32k_fck>, <&sys_ck>;
+ ti,bit-shift = <4>;
+ reg = <0x1040>;
+ };
+
+ gpt6_fck: gpt6_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&gpt6_gate_fck>, <&gpt6_mux_fck>;
+ };
+
+ gpt7_gate_fck: gpt7_gate_fck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&sys_ck>;
+ ti,bit-shift = <8>;
+ reg = <0x1000>;
+ };
+
+ gpt7_mux_fck: gpt7_mux_fck@1040 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&omap_32k_fck>, <&sys_ck>;
+ ti,bit-shift = <5>;
+ reg = <0x1040>;
+ };
+
+ gpt7_fck: gpt7_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&gpt7_gate_fck>, <&gpt7_mux_fck>;
+ };
+
+ gpt8_gate_fck: gpt8_gate_fck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&sys_ck>;
+ ti,bit-shift = <9>;
+ reg = <0x1000>;
+ };
+
+ gpt8_mux_fck: gpt8_mux_fck@1040 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&omap_32k_fck>, <&sys_ck>;
+ ti,bit-shift = <6>;
+ reg = <0x1040>;
+ };
+
+ gpt8_fck: gpt8_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&gpt8_gate_fck>, <&gpt8_mux_fck>;
+ };
+
+ gpt9_gate_fck: gpt9_gate_fck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&sys_ck>;
+ ti,bit-shift = <10>;
+ reg = <0x1000>;
+ };
+
+ gpt9_mux_fck: gpt9_mux_fck@1040 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-mux-clock";
+ clocks = <&omap_32k_fck>, <&sys_ck>;
+ ti,bit-shift = <7>;
+ reg = <0x1040>;
+ };
+
+ gpt9_fck: gpt9_fck {
+ #clock-cells = <0>;
+ compatible = "ti,composite-clock";
+ clocks = <&gpt9_gate_fck>, <&gpt9_mux_fck>;
+ };
+
+ per_32k_alwon_fck: per_32k_alwon_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&omap_32k_fck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ gpio6_dbck: gpio6_dbck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&per_32k_alwon_fck>;
+ reg = <0x1000>;
+ ti,bit-shift = <17>;
+ };
+
+ gpio5_dbck: gpio5_dbck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&per_32k_alwon_fck>;
+ reg = <0x1000>;
+ ti,bit-shift = <16>;
+ };
+
+ gpio4_dbck: gpio4_dbck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&per_32k_alwon_fck>;
+ reg = <0x1000>;
+ ti,bit-shift = <15>;
+ };
+
+ gpio3_dbck: gpio3_dbck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&per_32k_alwon_fck>;
+ reg = <0x1000>;
+ ti,bit-shift = <14>;
+ };
+
+ gpio2_dbck: gpio2_dbck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,gate-clock";
+ clocks = <&per_32k_alwon_fck>;
+ reg = <0x1000>;
+ ti,bit-shift = <13>;
+ };
+
+ wdt3_fck: wdt3_fck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,wait-gate-clock";
+ clocks = <&per_32k_alwon_fck>;
+ reg = <0x1000>;
+ ti,bit-shift = <12>;
+ };
+
+ per_l4_ick: per_l4_ick {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&l4_ick>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ gpio6_ick: gpio6_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <17>;
+ };
+
+ gpio5_ick: gpio5_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <16>;
+ };
+
+ gpio4_ick: gpio4_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <15>;
+ };
+
+ gpio3_ick: gpio3_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <14>;
+ };
+
+ gpio2_ick: gpio2_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <13>;
+ };
+
+ wdt3_ick: wdt3_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <12>;
+ };
+
+ uart3_ick: uart3_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <11>;
+ };
+
+ uart4_ick: uart4_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <18>;
+ };
+
+ gpt9_ick: gpt9_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <10>;
+ };
+
+ gpt8_ick: gpt8_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <9>;
+ };
+
+ gpt7_ick: gpt7_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <8>;
+ };
+
+ gpt6_ick: gpt6_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <7>;
+ };
+
+ gpt5_ick: gpt5_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <6>;
+ };
+
+ gpt4_ick: gpt4_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <5>;
+ };
+
+ gpt3_ick: gpt3_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <4>;
+ };
+
+ gpt2_ick: gpt2_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <3>;
+ };
+
+ mcbsp2_ick: mcbsp2_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <0>;
+ };
+
+ mcbsp3_ick: mcbsp3_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <1>;
+ };
+
+ mcbsp4_ick: mcbsp4_ick@1010 {
+ #clock-cells = <0>;
+ compatible = "ti,omap3-interface-clock";
+ clocks = <&per_l4_ick>;
+ reg = <0x1010>;
+ ti,bit-shift = <2>;
+ };
+
+ mcbsp2_gate_fck: mcbsp2_gate_fck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&mcbsp_clks>;
+ ti,bit-shift = <0>;
+ reg = <0x1000>;
+ };
+
+ mcbsp3_gate_fck: mcbsp3_gate_fck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&mcbsp_clks>;
+ ti,bit-shift = <1>;
+ reg = <0x1000>;
+ };
+
+ mcbsp4_gate_fck: mcbsp4_gate_fck@1000 {
+ #clock-cells = <0>;
+ compatible = "ti,composite-gate-clock";
+ clocks = <&mcbsp_clks>;
+ ti,bit-shift = <2>;
+ reg = <0x1000>;
+ };
+
+ emu_src_mux_ck: emu_src_mux_ck@1140 {
+ #clock-cells = <0>;
+ compatible = "ti,mux-clock";
+ clocks = <&sys_ck>, <&emu_core_alwon_ck>, <&emu_per_alwon_ck>, <&emu_mpu_alwon_ck>;
+ reg = <0x1140>;
+ };
+
+ emu_src_ck: emu_src_ck {
+ #clock-cells = <0>;
+ compatible = "ti,clkdm-gate-clock";
+ clocks = <&emu_src_mux_ck>;
+ };
+
+ pclk_fck: pclk_fck@1140 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&emu_src_ck>;
+ ti,bit-shift = <8>;
+ ti,max-div = <7>;
+ reg = <0x1140>;
+ ti,index-starts-at-one;
+ };
+
+ pclkx2_fck: pclkx2_fck@1140 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&emu_src_ck>;
+ ti,bit-shift = <6>;
+ ti,max-div = <3>;
+ reg = <0x1140>;
+ ti,index-starts-at-one;
+ };
+
+ atclk_fck: atclk_fck@1140 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&emu_src_ck>;
+ ti,bit-shift = <4>;
+ ti,max-div = <3>;
+ reg = <0x1140>;
+ ti,index-starts-at-one;
+ };
+
+ traceclk_src_fck: traceclk_src_fck@1140 {
+ #clock-cells = <0>;
+ compatible = "ti,mux-clock";
+ clocks = <&sys_ck>, <&emu_core_alwon_ck>, <&emu_per_alwon_ck>, <&emu_mpu_alwon_ck>;
+ ti,bit-shift = <2>;
+ reg = <0x1140>;
+ };
+
+ traceclk_fck: traceclk_fck@1140 {
+ #clock-cells = <0>;
+ compatible = "ti,divider-clock";
+ clocks = <&traceclk_src_fck>;
+ ti,bit-shift = <11>;
+ ti,max-div = <7>;
+ reg = <0x1140>;
+ ti,index-starts-at-one;
+ };
+
+ secure_32k_fck: secure_32k_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-clock";
+ clock-frequency = <32768>;
+ };
+
+ gpt12_fck: gpt12_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&secure_32k_fck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
+
+ wdt1_fck: wdt1_fck {
+ #clock-cells = <0>;
+ compatible = "fixed-factor-clock";
+ clocks = <&secure_32k_fck>;
+ clock-mult = <1>;
+ clock-div = <1>;
+ };
};
&cm_clockdomains {
- core_l3_clkdm: core_l3_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&sdrc_ick>;
- };
-
- dpll3_clkdm: dpll3_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&dpll3_ck>;
- };
-
- dpll1_clkdm: dpll1_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&dpll1_ck>;
- };
-
- per_clkdm: per_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&uart3_fck>, <&gpio6_dbck>, <&gpio5_dbck>,
- <&gpio4_dbck>, <&gpio3_dbck>, <&gpio2_dbck>,
- <&wdt3_fck>, <&gpio6_ick>, <&gpio5_ick>, <&gpio4_ick>,
- <&gpio3_ick>, <&gpio2_ick>, <&wdt3_ick>, <&uart3_ick>,
- <&uart4_ick>, <&gpt9_ick>, <&gpt8_ick>, <&gpt7_ick>,
- <&gpt6_ick>, <&gpt5_ick>, <&gpt4_ick>, <&gpt3_ick>,
- <&gpt2_ick>, <&mcbsp2_ick>, <&mcbsp3_ick>,
- <&mcbsp4_ick>;
- };
-
- emu_clkdm: emu_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&emu_src_ck>;
- };
-
- dpll4_clkdm: dpll4_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&dpll4_ck>;
- };
-
- wkup_clkdm: wkup_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&gpio1_dbck>, <&wdt2_fck>, <&wdt2_ick>, <&wdt1_ick>,
- <&gpio1_ick>, <&omap_32ksync_ick>, <&gpt12_ick>,
- <&gpt1_ick>;
- };
-
- dss_clkdm: dss_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&dss_tv_fck>, <&dss_96m_fck>, <&dss2_alwon_fck>;
- };
-
- core_l4_clkdm: core_l4_clkdm {
- compatible = "ti,clockdomain";
- clocks = <&mmchs2_fck>, <&mmchs1_fck>, <&i2c3_fck>, <&i2c2_fck>,
- <&i2c1_fck>, <&mcspi4_fck>, <&mcspi3_fck>,
- <&mcspi2_fck>, <&mcspi1_fck>, <&uart2_fck>,
- <&uart1_fck>, <&hdq_fck>, <&mmchs2_ick>, <&mmchs1_ick>,
- <&hdq_ick>, <&mcspi4_ick>, <&mcspi3_ick>,
- <&mcspi2_ick>, <&mcspi1_ick>, <&i2c3_ick>, <&i2c2_ick>,
- <&i2c1_ick>, <&uart2_ick>, <&uart1_ick>, <&gpt11_ick>,
- <&gpt10_ick>, <&mcbsp5_ick>, <&mcbsp1_ick>,
- <&omapctrl_ick>, <&aes2_ick>, <&sha12_ick>;
- };
+ core_l3_clkdm: core_l3_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&sdrc_ick>;
+ };
+
+ dpll3_clkdm: dpll3_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&dpll3_ck>;
+ };
+
+ dpll1_clkdm: dpll1_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&dpll1_ck>;
+ };
+
+ per_clkdm: per_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&uart3_fck>, <&gpio6_dbck>, <&gpio5_dbck>,
+ <&gpio4_dbck>, <&gpio3_dbck>, <&gpio2_dbck>,
+ <&wdt3_fck>, <&gpio6_ick>, <&gpio5_ick>, <&gpio4_ick>,
+ <&gpio3_ick>, <&gpio2_ick>, <&wdt3_ick>, <&uart3_ick>,
+ <&uart4_ick>, <&gpt9_ick>, <&gpt8_ick>, <&gpt7_ick>,
+ <&gpt6_ick>, <&gpt5_ick>, <&gpt4_ick>, <&gpt3_ick>,
+ <&gpt2_ick>, <&mcbsp2_ick>, <&mcbsp3_ick>,
+ <&mcbsp4_ick>;
+ };
+
+ emu_clkdm: emu_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&emu_src_ck>;
+ };
+
+ dpll4_clkdm: dpll4_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&dpll4_ck>;
+ };
+
+ wkup_clkdm: wkup_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&gpio1_dbck>, <&wdt2_fck>, <&wdt2_ick>, <&wdt1_ick>,
+ <&gpio1_ick>, <&omap_32ksync_ick>, <&gpt12_ick>,
+ <&gpt1_ick>;
+ };
+
+ dss_clkdm: dss_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&dss_tv_fck>, <&dss_96m_fck>, <&dss2_alwon_fck>;
+ };
+
+ core_l4_clkdm: core_l4_clkdm {
+ compatible = "ti,clockdomain";
+ clocks = <&mmchs2_fck>, <&mmchs1_fck>, <&i2c3_fck>, <&i2c2_fck>,
+ <&i2c1_fck>, <&mcspi4_fck>, <&mcspi3_fck>,
+ <&mcspi2_fck>, <&mcspi1_fck>, <&uart2_fck>,
+ <&uart1_fck>, <&hdq_fck>, <&mmchs2_ick>, <&mmchs1_ick>,
+ <&hdq_ick>, <&mcspi4_ick>, <&mcspi3_ick>,
+ <&mcspi2_ick>, <&mcspi1_ick>, <&i2c3_ick>, <&i2c2_ick>,
+ <&i2c1_ick>, <&uart2_ick>, <&uart1_ick>, <&gpt11_ick>,
+ <&gpt10_ick>, <&mcbsp5_ick>, <&mcbsp1_ick>,
+ <&omapctrl_ick>, <&aes2_ick>, <&sha12_ick>;
+ };
};
*/
/{
+ chosen {
+ tick-timer = &timer2;
+ };
+
ocp {
u-boot,dm-spl;
&uart1 {
u-boot,dm-spl;
+ reg-shift = <2>;
};
&uart3 {
u-boot,dm-spl;
+ reg-shift = <2>;
};
&mmc1 {
u-boot,dm-spl;
m25p80@0 {
+ compatible = "spi-flash";
u-boot,dm-spl;
};
};
--- /dev/null
+/*
+ * Copyright (C) 2017 Jagan Teki <jagan@amarulasolutions.com>
+ *
+ * This file is dual-licensed: you can use it either under the terms
+ * of the GPL or the X11 license, at your option. Note that this dual
+ * licensing only applies to this file, and not this project as a
+ * whole.
+ *
+ * a) This file is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of the
+ * License, or (at your option) any later version.
+ *
+ * This file is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * Or, alternatively,
+ *
+ * b) Permission is hereby granted, free of charge, to any person
+ * obtaining a copy of this software and associated documentation
+ * files (the "Software"), to deal in the Software without
+ * restriction, including without limitation the rights to use,
+ * copy, modify, merge, publish, distribute, sublicense, and/or
+ * sell copies of the Software, and to permit persons to whom the
+ * Software is furnished to do so, subject to the following
+ * conditions:
+ *
+ * The above copyright notice and this permission notice shall be
+ * included in all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+ * EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES
+ * OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+ * NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT
+ * HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+ * WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING
+ * FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+ * OTHER DEALINGS IN THE SOFTWARE.
+ */
+
+/dts-v1/;
+#include "rk3288.dtsi"
+
+/ {
+ model = "Amarula Vyasa-RK3288";
+ compatible = "amarula,vyasa-rk3288", "rockchip,rk3288";
+
+ chosen {
+ stdout-path = &uart2;
+ };
+
+ memory {
+ device_type = "memory";
+ reg = <0 0x80000000>;
+ };
+
+ vcc_sd: sdmmc-regulator {
+ compatible = "regulator-fixed";
+ gpio = <&gpio7 RK_PB3 GPIO_ACTIVE_LOW>;
+ pinctrl-names = "default";
+ pinctrl-0 = <&sdmmc_pwr>;
+ regulator-name = "vcc_sd";
+ regulator-min-microvolt = <3300000>;
+ regulator-max-microvolt = <3300000>;
+ startup-delay-us = <100000>;
+ vin-supply = <&vcc_io>;
+ };
+
+ vcc_sys: vsys-regulator {
+ compatible = "regulator-fixed";
+ regulator-name = "vcc_sys";
+ regulator-min-microvolt = <5000000>;
+ regulator-max-microvolt = <5000000>;
+ regulator-always-on;
+ regulator-boot-on;
+ };
+};
+
+&dmc {
+ rockchip,pctl-timing = <0x29a 0xc8 0x1f8 0x42 0x4e 0x4 0xea 0xa
+ 0x5 0x0 0xa 0x7 0x19 0x24 0xa 0x7
+ 0x5 0xa 0x5 0x200 0x5 0x10 0x40 0x0
+ 0x1 0x7 0x7 0x4 0xc 0x43 0x100 0x0
+ 0x5 0x0>;
+ rockchip,phy-timing = <0x48f9aab4 0xea0910 0x1002c200
+ 0xa60 0x40 0x10 0x0>;
+ /* Add a dummy value to cause of-platdata think this is bytes */
+ rockchip,sdram-params = <0x30B25564 0x627 3 666000000 3 9 1>;
+};
+
+&cpu0 {
+ cpu0-supply = <&vdd_cpu>;
+};
+
+&i2c0 {
+ clock-frequency = <400000>;
+ status = "okay";
+
+ rk808: pmic@1b {
+ compatible = "rockchip,rk808";
+ reg = <0x1b>;
+ interrupt-parent = <&gpio0>;
+ interrupts = <RK_PA4 IRQ_TYPE_LEVEL_LOW>;
+ pinctrl-names = "default";
+ pinctrl-0 = <&pmic_int &global_pwroff>;
+ wakeup-source;
+ rockchip,system-power-controller;
+ #clock-cells = <1>;
+ clock-output-names = "xin32k", "rk808-clkout2";
+
+ vcc1-supply = <&vcc_sys>;
+ vcc2-supply = <&vcc_sys>;
+ vcc3-supply = <&vcc_sys>;
+ vcc4-supply = <&vcc_sys>;
+ vcc6-supply = <&vcc_sys>;
+ vcc7-supply = <&vcc_sys>;
+ vcc8-supply = <&vcc_io>;
+ vcc9-supply = <&vcc_sys>;
+ vcc10-supply = <&vcc_sys>;
+ vcc11-supply = <&vcc_sys>;
+ vcc12-supply = <&vcc_io>;
+
+ regulators {
+ vdd_cpu: vdd_log: DCDC_REG1 {
+ regulator-always-on;
+ regulator-boot-on;
+ regulator-min-microvolt = <750000>;
+ regulator-max-microvolt = <1350000>;
+ regulator-name = "vdd_log";
+ regulator-state-mem {
+ regulator-off-in-suspend;
+ };
+ };
+
+ vdd_gpu: DCDC_REG2 {
+ regulator-always-on;
+ regulator-boot-on;
+ regulator-min-microvolt = <850000>;
+ regulator-max-microvolt = <1250000>;
+ regulator-name = "vdd_gpu";
+ regulator-state-mem {
+ regulator-on-in-suspend;
+ regulator-suspend-microvolt = <1000000>;
+ };
+ };
+
+ vcc_ddr: DCDC_REG3 {
+ regulator-always-on;
+ regulator-boot-on;
+ regulator-name = "vcc_ddr";
+ regulator-state-mem {
+ regulator-on-in-suspend;
+ };
+ };
+
+ vcc_io: DCDC_REG4 {
+ regulator-always-on;
+ regulator-boot-on;
+ regulator-min-microvolt = <3300000>;
+ regulator-max-microvolt = <3300000>;
+ regulator-name = "vcc_io";
+ regulator-state-mem {
+ regulator-on-in-suspend;
+ regulator-suspend-microvolt = <3300000>;
+ };
+ };
+
+ vcca_tp: LDO_REG1 {
+ regulator-always-on;
+ regulator-boot-on;
+ regulator-min-microvolt = <3300000>;
+ regulator-max-microvolt = <3300000>;
+ regulator-name = "vcc_tp";
+ regulator-state-mem {
+ regulator-on-in-suspend;
+ regulator-suspend-microvolt = <3300000>;
+ };
+ };
+
+ vcc_codec: LDO_REG2 {
+ regulator-always-on;
+ regulator-boot-on;
+ regulator-min-microvolt = <3300000>;
+ regulator-max-microvolt = <3300000>;
+ regulator-name = "vcc_codec";
+ regulator-state-mem {
+ regulator-off-in-suspend;
+ };
+ };
+
+ vdd_10: LDO_REG3 {
+ regulator-always-on;
+ regulator-boot-on;
+ regulator-min-microvolt = <1000000>;
+ regulator-max-microvolt = <1000000>;
+ regulator-name = "vdd_10";
+ regulator-state-mem {
+ regulator-on-in-suspend;
+ regulator-suspend-microvolt = <1000000>;
+ };
+ };
+
+ vcc_gps: LDO_REG4 {
+ regulator-always-on;
+ regulator-boot-on;
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ regulator-name = "vcc_gps";
+ regulator-state-mem {
+ regulator-on-in-suspend;
+ regulator-suspend-microvolt = <1800000>;
+ };
+ };
+
+ vccio_sd: LDO_REG5 {
+ regulator-always-on;
+ regulator-boot-on;
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <3300000>;
+ regulator-name = "vccio_sd";
+ regulator-state-mem {
+ regulator-on-in-suspend;
+ regulator-suspend-microvolt = <3300000>;
+ };
+ };
+
+ vcc10_lcd: LDO_REG6 {
+ regulator-always-on;
+ regulator-boot-on;
+ regulator-min-microvolt = <1000000>;
+ regulator-max-microvolt = <1000000>;
+ regulator-name = "vcc10_lcd";
+ regulator-state-mem {
+ regulator-on-in-suspend;
+ regulator-suspend-microvolt = <1800000>;
+ };
+ };
+
+ vcc_18: LDO_REG7 {
+ regulator-always-on;
+ regulator-boot-on;
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ regulator-name = "vcc_18";
+ regulator-state-mem {
+ regulator-on-in-suspend;
+ regulator-suspend-microvolt = <1800000>;
+ };
+ };
+
+ vcc18_lcd: LDO_REG8 {
+ regulator-always-on;
+ regulator-boot-on;
+ regulator-min-microvolt = <1800000>;
+ regulator-max-microvolt = <1800000>;
+ regulator-name = "vcc18_lcd";
+ regulator-state-mem {
+ regulator-on-in-suspend;
+ regulator-suspend-microvolt = <1800000>;
+ };
+ };
+
+ vcc33_sd: SWITCH_REG1 {
+ regulator-always-on;
+ regulator-boot-on;
+ regulator-min-microvolt = <3300000>;
+ regulator-max-microvolt = <3300000>;
+ regulator-name = "vcc33_sd";
+ regulator-state-mem {
+ regulator-on-in-suspend;
+ };
+ };
+
+ vcc_lan: SWITCH_REG2 {
+ regulator-always-on;
+ regulator-boot-on;
+ regulator-min-microvolt = <3300000>;
+ regulator-max-microvolt = <3300000>;
+ regulator-name = "vcc_lan";
+ regulator-state-mem {
+ regulator-on-in-suspend;
+ };
+ };
+ };
+ };
+};
+
+&sdmmc {
+ u-boot,dm-pre-reloc;
+ status = "okay";
+
+ bus-width = <4>;
+ cap-mmc-highspeed;
+ cap-sd-highspeed;
+ card-detect-delay = <200>;
+ disable-wp;
+ pinctrl-names = "default";
+ pinctrl-0 = <&sdmmc_clk>, <&sdmmc_cmd>, <&sdmmc_cd>, <&sdmmc_bus4>;
+ vmmc-supply = <&vcc_sd>;
+ vqmmc-supply = <&vccio_sd>;
+};
+
+&uart2 {
+ u-boot,dm-pre-reloc;
+ status = "okay";
+};
+
+&wdt {
+ status = "okay";
+};
+
+&pinctrl {
+ u-boot,dm-pre-reloc;
+ pmic {
+ pmic_int: pmic-int {
+ rockchip,pins = <RK_GPIO0 4 RK_FUNC_GPIO &pcfg_pull_up>;
+ };
+ };
+
+ sdmmc {
+ sdmmc_pwr: sdmmc-pwr {
+ rockchip,pins = <7 11 RK_FUNC_GPIO &pcfg_pull_none>;
+ };
+ };
+};
chosen {
stdout-path = "serial0:115200n8";
u-boot,spl-boot-order = &emmc, &sdmmc;
+ tick-timer = "/timer@ff810000";
};
};
};
&emmc {
- u-boot,dm-pre-reloc;
+ u-boot,dm-spl;
};
&sdmmc {
- u-boot,dm-pre-reloc;
+ u-boot,dm-spl;
};
&spi1 {
- u-boot,dm-pre-reloc;
+ u-boot,dm-spl;
spiflash: w25q32dw@0 {
- u-boot,dm-pre-reloc;
+ u-boot,dm-spl;
};
};
&timer0 {
u-boot,dm-pre-reloc;
clock-frequency = <24000000>;
+ status = "okay";
};
};
};
+ usbhub_enable: usbhub_enable {
+ compatible = "regulator-fixed";
+ regulator-name = "usbhub_enable";
+ enable-active-low;
+ gpio = <&gpio4 3 GPIO_ACTIVE_HIGH>;
+ regulator-always-on;
+ regulator-boot-on;
+ regulator-min-microvolt = <3300000>;
+ regulator-max-microvolt = <3300000>;
+ };
+
vccadc_ref: vccadc-ref {
compatible = "regulator-fixed";
regulator-name = "vcc1v8_sys";
};
&dwc3_typec1 {
- rockchip,vbus-gpio = <&gpio4 3 GPIO_ACTIVE_LOW>;
status = "okay";
};
chosen {
stdout-path = "serial2:1500000n8";
};
+
+ vcc5v0_otg: vcc5v0-otg-drv {
+ compatible = "regulator-fixed";
+ enable-active-high;
+ regulator-name = "vcc5v0_otg";
+ gpio = <&gpio0 RK_PB0 GPIO_ACTIVE_HIGH>;
+ regulator-min-microvolt = <5000000>;
+ regulator-max-microvolt = <5000000>;
+ };
};
&gmac {
&uart2 {
status = "okay";
};
+
+&usb20_otg {
+ vbus-supply = <&vcc5v0_otg>;
+ status = "okay";
+};
+
+&usb_host_ehci {
+ status = "okay";
+};
+
+&usb_host_ohci {
+ status = "okay";
+};
status = "disabled";
};
+ usb_host_ehci: usb@30140000 {
+ compatible = "generic-ehci";
+ reg = <0x30140000 0x20000>;
+ interrupts = <GIC_SPI 15 IRQ_TYPE_LEVEL_HIGH>;
+ status = "disabled";
+ };
+
+ usb_host_ohci: usb@30160000 {
+ compatible = "generic-ohci";
+ reg = <0x30160000 0x20000>;
+ interrupts = <GIC_SPI 16 IRQ_TYPE_LEVEL_HIGH>;
+ status = "disabled";
+ };
+
+ usb20_otg: usb@30180000 {
+ compatible = "rockchip,rv1108-usb", "rockchip,rk3288-usb",
+ "snps,dwc2";
+ reg = <0x30180000 0x40000>;
+ interrupts = <GIC_SPI 18 IRQ_TYPE_LEVEL_HIGH>;
+ hnp-srp-disable;
+ dr_mode = "otg";
+ status = "disabled";
+ };
+
sfc: sfc@301c0000 {
compatible = "rockchip,sfc";
reg = <0x301c0000 0x200>;
compatible = "atmel,at91sam9x5-clk-utmi";
#clock-cells = <0>;
clocks = <&main>;
+ regmap-sfr = <&sfr>;
u-boot,dm-pre-reloc;
};
qspi0_clk: qspi0_clk@52 {
#clock-cells = <0>;
reg = <52>;
+ u-boot,dm-pre-reloc;
};
qspi1_clk: qspi1_clk@53 {
#clock-cells = <0>;
reg = <53>;
+ u-boot,dm-pre-reloc;
};
};
status = "disabled";
};
+ qspi1: spi@f0024000 {
+ compatible = "atmel,sama5d2-qspi";
+ reg = <0xf0024000 0x100>, <0xd8000000 0x08000000>;
+ reg-names = "qspi_base", "qspi_mmap";
+ #address-cells = <1>;
+ #size-cells = <0>;
+ clocks = <&qspi1_clk>;
+ status = "disabled";
+ };
+
spi0: spi@f8000000 {
compatible = "atmel,at91rm9200-spi";
reg = <0xf8000000 0x100>;
status = "disabled";
};
+ sfr: sfr@f8030000 {
+ compatible = "atmel,sama5d2-sfr", "syscon";
+ reg = <0xf8030000 0x98>;
+ };
+
sckc@f8048050 {
compatible = "atmel,at91sam9x5-sckc";
reg = <0xf8048050 0x4>;
status = "disabled";
};
+ uart3: serial@fc008000 {
+ compatible = "atmel,at91sam9260-usart";
+ reg = <0xfc008000 0x100>;
+ clocks = <&uart3_clk>;
+ clock-names = "usart";
+ status = "disabled";
+ };
+
i2c1: i2c@fc028000 {
compatible = "atmel,sama5d2-i2c";
reg = <0xfc028000 0x100>;
--- /dev/null
+/*
+ * sama5d27_som1.dtsi - Device Tree file for SAMA5D27 SOM1
+ *
+ * Copyright (C) 2017 Microchip Corporation
+ * Wenyou Yang <wenyou.yang@microchip.com>
+ *
+ * This file is dual-licensed: you can use it either under the terms
+ * of the GPL or the X11 license, at your option. Note that this dual
+ * licensing only applies to this file, and not this project as a
+ * whole.
+ *
+ * a) This file is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of the
+ * License, or (at your option) any later version.
+ *
+ * This file is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * Or, alternatively,
+ *
+ * b) Permission is hereby granted, free of charge, to any person
+ * obtaining a copy of this software and associated documentation
+ * files (the "Software"), to deal in the Software without
+ * restriction, including without limitation the rights to use,
+ * copy, modify, merge, publish, distribute, sublicense, and/or
+ * sell copies of the Software, and to permit persons to whom the
+ * Software is furnished to do so, subject to the following
+ * conditions:
+ *
+ * The above copyright notice and this permission notice shall be
+ * included in all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+ * EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES
+ * OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+ * NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT
+ * HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+ * WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING
+ * FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+ * OTHER DEALINGS IN THE SOFTWARE.
+ */
+
+#include "sama5d2.dtsi"
+#include "sama5d2-pinfunc.h"
+/ {
+ model = "Atmel SAMA5D27 SOM1 EK";
+ compatible = "atmel,sama5d27-som1-ek", "atmel,sama5d2", "atmel,sama5";
+
+ memory {
+ reg = <0x20000000 0x8000000>;
+ };
+
+ aliases {
+ spi0 = &qspi1;
+ u-boot,dm-pre-reloc;
+ };
+
+ ahb {
+ apb {
+ qspi1: spi@f0024000 {
+ pinctrl-names = "default";
+ pinctrl-0 = <&pinctrl_qspi1_sck_cs_default &pinctrl_qspi1_dat_default>;
+ status = "okay";
+ u-boot,dm-pre-reloc;
+
+ spi_flash@0 {
+ compatible = "spi-flash";
+ reg = <0>;
+ spi-max-frequency = <50000000>;
+ spi-rx-bus-width = <4>;
+ spi-tx-bus-width = <4>;
+ u-boot,dm-pre-reloc;
+ };
+ };
+
+ macb0: ethernet@f8008000 {
+ pinctrl-names = "default";
+ pinctrl-0 = <&pinctrl_macb0_rmii &pinctrl_macb0_phy_irq>;
+ phy-mode = "rmii";
+ status = "okay";
+
+ ethernet-phy@1 {
+ reg = <0x1>;
+ };
+ };
+
+ i2c0: i2c@f8028000 {
+ pinctrl-names = "default";
+ pinctrl-0 = <&pinctrl_i2c0_default>;
+ status = "okay";
+
+ i2c_eeprom: i2c_eeprom@50 {
+ compatible = "microchip,24aa02e48";
+ reg = <0x50>;
+ };
+ };
+
+ i2c1: i2c@fc028000 {
+ pinctrl-names = "default";
+ pinctrl-0 = <&pinctrl_i2c1_default>;
+ status = "okay";
+ };
+
+ pioA: gpio@fc038000 {
+ pinctrl {
+ pinctrl_i2c0_default: i2c0_default {
+ pinmux = <PIN_PD21__TWD0>,
+ <PIN_PD22__TWCK0>;
+ bias-disable;
+ };
+
+ pinctrl_i2c1_default: i2c1_default {
+ pinmux = <PIN_PD4__TWD1>,
+ <PIN_PD5__TWCK1>;
+ bias-disable;
+ };
+
+ pinctrl_macb0_phy_irq: macb0_phy_irq {
+ pinmux = <PIN_PD31__GPIO>;
+ bias-disable;
+ };
+
+ pinctrl_macb0_rmii: macb0_rmii {
+ pinmux = <PIN_PD9__GTXCK>,
+ <PIN_PD10__GTXEN>,
+ <PIN_PD11__GRXDV>,
+ <PIN_PD12__GRXER>,
+ <PIN_PD13__GRX0>,
+ <PIN_PD14__GRX1>,
+ <PIN_PD15__GTX0>,
+ <PIN_PD16__GTX1>,
+ <PIN_PD17__GMDC>,
+ <PIN_PD18__GMDIO>;
+ bias-disable;
+ };
+
+ pinctrl_qspi1_sck_cs_default: qspi1_sck_cs_default {
+ pinmux = <PIN_PB5__QSPI1_SCK>,
+ <PIN_PB6__QSPI1_CS>;
+ bias-disable;
+ u-boot,dm-pre-reloc;
+ };
+
+ pinctrl_qspi1_dat_default: qspi1_dat_default {
+ pinmux = <PIN_PB7__QSPI1_IO0>,
+ <PIN_PB8__QSPI1_IO1>,
+ <PIN_PB9__QSPI1_IO2>,
+ <PIN_PB10__QSPI1_IO3>;
+ bias-pull-up;
+ u-boot,dm-pre-reloc;
+ };
+ };
+ };
+ };
+ };
+};
interrupt-parent = <&pmc>;
interrupts = <AT91_PMC_LOCKU>;
clocks = <&main>;
+ regmap-sfr = <&sfr>;
+ u-boot,dm-pre-reloc;
};
mck: masterck {
#define CONFIG_SYS_FSL_ERRATUM_A008751
#define CONFIG_SYS_FSL_MAX_NUM_OF_SEC 1
+
+#elif defined(CONFIG_ARCH_LS1088A)
+#define CONFIG_SYS_FSL_NUM_CC_PLLS 3
+#define CONFIG_SYS_FSL_CLUSTER_CLOCKS { 1, 1 }
+#define CONFIG_GICV3
+#define CONFIG_FSL_TZPC_BP147
+#define CONFIG_FSL_TZASC_400
+#define CONFIG_SYS_PAGE_SIZE 0x10000
+
+#define SRDS_MAX_LANES 4
+
+/* TZ Protection Controller Definitions */
+#define TZPC_BASE 0x02200000
+#define TZPCR0SIZE_BASE (TZPC_BASE)
+#define TZPCDECPROT_0_STAT_BASE (TZPC_BASE + 0x800)
+#define TZPCDECPROT_0_SET_BASE (TZPC_BASE + 0x804)
+#define TZPCDECPROT_0_CLR_BASE (TZPC_BASE + 0x808)
+#define TZPCDECPROT_1_STAT_BASE (TZPC_BASE + 0x80C)
+#define TZPCDECPROT_1_SET_BASE (TZPC_BASE + 0x810)
+#define TZPCDECPROT_1_CLR_BASE (TZPC_BASE + 0x814)
+#define TZPCDECPROT_2_STAT_BASE (TZPC_BASE + 0x818)
+#define TZPCDECPROT_2_SET_BASE (TZPC_BASE + 0x81C)
+#define TZPCDECPROT_2_CLR_BASE (TZPC_BASE + 0x820)
+
+/* Generic Interrupt Controller Definitions */
+#define GICD_BASE 0x06000000
+#define GICR_BASE 0x06100000
+
+/* SMMU Defintions */
+#define SMMU_BASE 0x05000000 /* GR0 Base */
+
+/* DDR */
+#define CONFIG_SYS_DDR_BLOCK1_SIZE ((phys_size_t)2 << 30)
+#define CONFIG_MAX_MEM_MAPPED CONFIG_SYS_DDR_BLOCK1_SIZE
+
+#define CONFIG_SYS_FSL_CCSR_GUR_LE
+#define CONFIG_SYS_FSL_CCSR_SCFG_LE
+#define CONFIG_SYS_FSL_ESDHC_LE
+#define CONFIG_SYS_FSL_IFC_LE
+#define CONFIG_SYS_FSL_PEX_LUT_LE
+
+#define CONFIG_SYS_MEMAC_LITTLE_ENDIAN
+
+/* SFP */
+#define CONFIG_SYS_FSL_SFP_VER_3_4
+#define CONFIG_SYS_FSL_SFP_LE
+#define CONFIG_SYS_FSL_SRK_LE
+
+/* Security Monitor */
+#define CONFIG_SYS_FSL_SEC_MON_LE
+
+/* Secure Boot */
+#define CONFIG_ESBC_HDR_LS
+
+/* DCFG - GUR */
+#define CONFIG_SYS_FSL_CCSR_GUR_LE
+#define CONFIG_SYS_FSL_MAX_NUM_OF_SEC 1
+#define CONFIG_SYS_FSL_OCRAM_BASE 0x18000000 /* initial RAM */
+#define SYS_FSL_OCRAM_SPACE_SIZE 0x00200000 /* 2M space */
+#define CONFIG_SYS_FSL_OCRAM_SIZE 0x00020000 /* Real size 128K */
+
#elif defined(CONFIG_FSL_LSCH2)
#define CONFIG_SYS_FSL_OCRAM_BASE 0x10000000 /* initial RAM */
#define SYS_FSL_OCRAM_SPACE_SIZE 0x00200000 /* 2M space */
#define GICC_BASE 0x01420000
#define CONFIG_SYS_FSL_MAX_NUM_OF_SEC 1
-
#else
#error SoC not defined
#endif
CPU_TYPE_ENTRY(LS1026A, LS1026A, 2),
CPU_TYPE_ENTRY(LS2040A, LS2040A, 4),
CPU_TYPE_ENTRY(LS1012A, LS1012A, 1),
+ CPU_TYPE_ENTRY(LS1088A, LS1088A, 8),
+ CPU_TYPE_ENTRY(LS1084A, LS1084A, 8),
+ CPU_TYPE_ENTRY(LS1048A, LS1048A, 4),
+ CPU_TYPE_ENTRY(LS1044A, LS1044A, 4),
};
#ifndef CONFIG_SYS_DCACHE_OFF
},
{ CONFIG_SYS_FSL_QSPI_BASE1, CONFIG_SYS_FSL_QSPI_BASE1,
CONFIG_SYS_FSL_QSPI_SIZE1,
- PTE_BLOCK_MEMTYPE(MT_NORMAL) | PTE_BLOCK_NON_SHARE
+ PTE_BLOCK_MEMTYPE(MT_DEVICE_NGNRNE) |
+ PTE_BLOCK_NON_SHARE | PTE_BLOCK_PXN | PTE_BLOCK_UXN
},
{ CONFIG_SYS_FSL_QSPI_BASE2, CONFIG_SYS_FSL_QSPI_BASE2,
CONFIG_SYS_FSL_QSPI_SIZE2,
},
{ CONFIG_SYS_FSL_IFC_BASE2, CONFIG_SYS_FSL_IFC_BASE2,
CONFIG_SYS_FSL_IFC_SIZE2,
- PTE_BLOCK_MEMTYPE(MT_DEVICE_NGNRNE) | PTE_BLOCK_NON_SHARE
+ PTE_BLOCK_MEMTYPE(MT_DEVICE_NGNRNE) |
+ PTE_BLOCK_NON_SHARE | PTE_BLOCK_PXN | PTE_BLOCK_UXN
},
{ CONFIG_SYS_FSL_DCSR_BASE, CONFIG_SYS_FSL_DCSR_BASE,
CONFIG_SYS_FSL_DCSR_SIZE,
#include <config.h>
-#ifdef CONFIG_ARCH_LS2080A
+#ifdef CONFIG_FSL_LSCH3
enum srds_prtcl {
/*
* Nobody will check whether the device 'NONE' has been configured,
int serdes_get_first_lane(u32 sd, enum srds_prtcl device);
enum srds_prtcl serdes_get_prtcl(int serdes, int cfg, int lane);
int is_serdes_prtcl_valid(int serdes, u32 prtcl);
+int serdes_get_number(int serdes, int cfg);
+void fsl_rgmii_init(void);
#ifdef CONFIG_FSL_LSCH2
const char *serdes_clock_to_string(u32 clock);
#define CONFIG_SYS_DCSR_COP_CCP_ADDR (CONFIG_SYS_DCSRBAR + 0x02008040)
#define CONFIG_SYS_FSL_DDR_ADDR (CONFIG_SYS_IMMR + 0x00080000)
-#define CONFIG_SYS_CCI400_ADDR (CONFIG_SYS_IMMR + 0x00180000)
#define CONFIG_SYS_GIC400_ADDR (CONFIG_SYS_IMMR + 0x00400000)
#define CONFIG_SYS_IFC_ADDR (CONFIG_SYS_IMMR + 0x00530000)
#define SYS_FSL_QSPI_ADDR (CONFIG_SYS_IMMR + 0x00550000)
#define SCFG_USBPWRFAULT_USB2_SHIFT 2
#define SCFG_USBPWRFAULT_USB1_SHIFT 0
+#define SCFG_BASE 0x01570000
+#define SCFG_USB3PRM1CR_USB1 0x070
+#define SCFG_USB3PRM2CR_USB1 0x074
+#define SCFG_USB3PRM1CR_USB2 0x07C
+#define SCFG_USB3PRM2CR_USB2 0x080
+#define SCFG_USB3PRM1CR_USB3 0x088
+#define SCFG_USB3PRM2CR_USB3 0x08c
+#define SCFG_USB_TXVREFTUNE 0x9
+#define SCFG_USB_SQRXTUNE_MASK 0x7
+#define SCFG_USB_PCSTXSWINGFULL 0x47
+#define SCFG_USB_PHY1 0x084F0000
+#define SCFG_USB_PHY2 0x08500000
+#define SCFG_USB_PHY3 0x08510000
+#define SCFG_USB_PHY_RX_OVRD_IN_HI 0x200c
+#define USB_PHY_RX_EQ_VAL_1 0x0000
+#define USB_PHY_RX_EQ_VAL_2 0x0080
+#define USB_PHY_RX_EQ_VAL_3 0x0380
+#define USB_PHY_RX_EQ_VAL_4 0x0b80
+
#define SCFG_SNPCNFGCR_SECRDSNP 0x80000000
#define SCFG_SNPCNFGCR_SECWRSNP 0x40000000
#define SCFG_SNPCNFGCR_SATARDSNP 0x00800000
u8 res_19a0[0x2000-0x19a0]; /* from 0x19a0 to 0x1fff */
};
-#define CCI400_CTRLORD_TERM_BARRIER 0x00000008
-#define CCI400_CTRLORD_EN_BARRIER 0
-#define CCI400_SHAORD_NON_SHAREABLE 0x00000002
-#define CCI400_DVM_MESSAGE_REQ_EN 0x00000002
-#define CCI400_SNOOP_REQ_EN 0x00000001
-
-/* CCI-400 registers */
-struct ccsr_cci400 {
- u32 ctrl_ord; /* Control Override */
- u32 spec_ctrl; /* Speculation Control */
- u32 secure_access; /* Secure Access */
- u32 status; /* Status */
- u32 impr_err; /* Imprecise Error */
- u8 res_14[0x100 - 0x14];
- u32 pmcr; /* Performance Monitor Control */
- u8 res_104[0xfd0 - 0x104];
- u32 pid[8]; /* Peripheral ID */
- u32 cid[4]; /* Component ID */
- struct {
- u32 snoop_ctrl; /* Snoop Control */
- u32 sha_ord; /* Shareable Override */
- u8 res_1008[0x1100 - 0x1008];
- u32 rc_qos_ord; /* read channel QoS Value Override */
- u32 wc_qos_ord; /* read channel QoS Value Override */
- u8 res_1108[0x110c - 0x1108];
- u32 qos_ctrl; /* QoS Control */
- u32 max_ot; /* Max OT */
- u8 res_1114[0x1130 - 0x1114];
- u32 target_lat; /* Target Latency */
- u32 latency_regu; /* Latency Regulation */
- u32 qos_range; /* QoS Range */
- u8 res_113c[0x2000 - 0x113c];
- } slave[5]; /* Slave Interface */
- u8 res_6000[0x9004 - 0x6000];
- u32 cycle_counter; /* Cycle counter */
- u32 count_ctrl; /* Count Control */
- u32 overflow_status; /* Overflow Flag Status */
- u8 res_9010[0xa000 - 0x9010];
- struct {
- u32 event_select; /* Event Select */
- u32 event_count; /* Event Count */
- u32 counter_ctrl; /* Counter Control */
- u32 overflow_status; /* Overflow Flag Status */
- u8 res_a010[0xb000 - 0xa010];
- } pcounter[4]; /* Performance Counter */
- u8 res_e004[0x10000 - 0xe004];
-};
-
/* MMU 500 */
#define SMMU_SCR0 (SMMU_BASE + 0x0)
#define SMMU_SCR1 (SMMU_BASE + 0x4)
#define CONFIG_SYS_PCIE2_ADDR (CONFIG_SYS_IMMR + 0x2500000)
#define CONFIG_SYS_PCIE3_ADDR (CONFIG_SYS_IMMR + 0x2600000)
#define CONFIG_SYS_PCIE4_ADDR (CONFIG_SYS_IMMR + 0x2700000)
+#ifdef CONFIG_ARCH_LS1088A
+#define CONFIG_SYS_PCIE1_PHYS_ADDR 0x2000000000ULL
+#define CONFIG_SYS_PCIE2_PHYS_ADDR 0x2800000000ULL
+#define CONFIG_SYS_PCIE3_PHYS_ADDR 0x3000000000ULL
+#else
#define CONFIG_SYS_PCIE1_PHYS_ADDR 0x1000000000ULL
#define CONFIG_SYS_PCIE2_PHYS_ADDR 0x1200000000ULL
#define CONFIG_SYS_PCIE3_PHYS_ADDR 0x1400000000ULL
#define CONFIG_SYS_PCIE4_PHYS_ADDR 0x1600000000ULL
+#endif
/* Device Configuration */
#define DCFG_BASE 0x01e00000
#define SCFG_BASE 0x01fc0000
#define SCFG_USB3PRM1CR 0x000
#define SCFG_USB3PRM1CR_INIT 0x27672b2a
+#define SCFG_USB_TXVREFTUNE 0x9
+#define SCFG_USB_SQRXTUNE_MASK 0x7
#define SCFG_QSPICLKCTLR 0x10
+#define DCSR_BASE 0x700000000ULL
+#define DCSR_USB_PHY1 0x4600000
+#define DCSR_USB_PHY2 0x4610000
+#define DCSR_USB_PHY_RX_OVRD_IN_HI 0x200C
+#define USB_PHY_RX_EQ_VAL_1 0x0000
+#define USB_PHY_RX_EQ_VAL_2 0x0080
+#define USB_PHY_RX_EQ_VAL_3 0x0380
+#define USB_PHY_RX_EQ_VAL_4 0x0b80
+
#define TP_ITYP_AV 0x00000001 /* Initiator available */
#define TP_ITYP_TYPE(x) (((x) & 0x6) >> 1) /* Initiator Type */
#define TP_ITYP_TYPE_ARM 0x0
#define FSL_CHASSIS3_SRDS2_PRTCL_SHIFT FSL_CHASSIS3_RCWSR28_SRDS2_PRTCL_SHIFT
#define FSL_CHASSIS3_SRDS1_REGSR 29
#define FSL_CHASSIS3_SRDS2_REGSR 29
+#elif defined(CONFIG_ARCH_LS1088A)
+#define FSL_CHASSIS3_EC1_REGSR 26
+#define FSL_CHASSIS3_EC2_REGSR 26
+#define FSL_CHASSIS3_RCWSR25_EC1_PRTCL_MASK 0x00000007
+#define FSL_CHASSIS3_RCWSR25_EC1_PRTCL_SHIFT 0
+#define FSL_CHASSIS3_RCWSR25_EC2_PRTCL_MASK 0x00000038
+#define FSL_CHASSIS3_RCWSR25_EC2_PRTCL_SHIFT 3
+#define FSL_CHASSIS3_RCWSR29_SRDS1_PRTCL_MASK 0xFFFF0000
+#define FSL_CHASSIS3_RCWSR29_SRDS1_PRTCL_SHIFT 16
+#define FSL_CHASSIS3_RCWSR30_SRDS2_PRTCL_MASK 0x0000FFFF
+#define FSL_CHASSIS3_RCWSR30_SRDS2_PRTCL_SHIFT 0
+#define FSL_CHASSIS3_SRDS1_PRTCL_MASK FSL_CHASSIS3_RCWSR29_SRDS1_PRTCL_MASK
+#define FSL_CHASSIS3_SRDS1_PRTCL_SHIFT FSL_CHASSIS3_RCWSR29_SRDS1_PRTCL_SHIFT
+#define FSL_CHASSIS3_SRDS2_PRTCL_MASK FSL_CHASSIS3_RCWSR30_SRDS2_PRTCL_MASK
+#define FSL_CHASSIS3_SRDS2_PRTCL_SHIFT FSL_CHASSIS3_RCWSR30_SRDS2_PRTCL_SHIFT
+#define FSL_CHASSIS3_SRDS1_REGSR 29
+#define FSL_CHASSIS3_SRDS2_REGSR 30
#endif
#define RCW_SB_EN_REG_INDEX 9
#define RCW_SB_EN_MASK 0x00000400
#ifdef CONFIG_SYS_FSL_CCSR_SCFG_LE
#define scfg_in32(a) in_le32(a)
#define scfg_out32(a, v) out_le32(a, v)
+#define scfg_clrbits32(addr, clear) clrbits_le32(addr, clear)
+#define scfg_clrsetbits32(addr, clear, set) clrsetbits_le32(addr, clear, set)
#elif defined(CONFIG_SYS_FSL_CCSR_SCFG_BE)
#define scfg_in32(a) in_be32(a)
#define scfg_out32(a, v) out_be32(a, v)
+#define scfg_clrbits32(addr, clear) clrbits_be32(addr, clear)
+#define scfg_clrsetbits32(addr, clear, set) clrsetbits_be32(addr, clear, set)
#endif
#ifdef CONFIG_SYS_FSL_PEX_LUT_LE
#define SVR_LS1023A 0x879208
#define SVR_LS1046A 0x870700
#define SVR_LS1026A 0x870708
+#define SVR_LS1048A 0x870320
+#define SVR_LS1084A 0x870302
+#define SVR_LS1088A 0x870300
+#define SVR_LS1044A 0x870322
#define SVR_LS2045A 0x870120
#define SVR_LS2080A 0x870110
#define SVR_LS2085A 0x870100
#define FSL_USB2_STREAM_ID 2
#define FSL_SDMMC_STREAM_ID 3
#define FSL_SATA1_STREAM_ID 4
+
+#if defined(CONFIG_ARCH_LS2080A)
#define FSL_SATA2_STREAM_ID 5
+#endif
+
+#if defined(CONFIG_ARCH_LS2080A)
#define FSL_DMA_STREAM_ID 6
+#elif defined(CONFIG_ARCH_LS1088A)
+#define FSL_DMA_STREAM_ID 5
+#endif
/* PCI - programmed in PEXn_LUT */
#define FSL_PEX_STREAM_ID_START 7
+
+#if defined(CONFIG_ARCH_LS2080A)
#define FSL_PEX_STREAM_ID_END 22
+#elif defined(CONFIG_ARCH_LS1088A)
+#define FSL_PEX_STREAM_ID_END 18
+#endif
+
/* DPAA2 - set in MC DPC and alloced by MC */
#define FSL_DPAA2_STREAM_ID_START 23
#define SYS_FSL_GIC_ADDR (CONFIG_SYS_IMMR + 0x00400000)
#define CONFIG_SYS_FSL_DDR_ADDR (CONFIG_SYS_IMMR + 0x00080000)
-#define CONFIG_SYS_CCI400_ADDR (CONFIG_SYS_IMMR + 0x00180000)
#define CONFIG_SYS_FSL_CSU_ADDR (CONFIG_SYS_IMMR + 0x00510000)
#define CONFIG_SYS_IFC_ADDR (CONFIG_SYS_IMMR + 0x00530000)
#define CONFIG_SYS_FSL_ESDHC_ADDR (CONFIG_SYS_IMMR + 0x00560000)
#ifndef __ASM_ARCH_LS102XA_IMMAP_H_
#define __ASM_ARCH_LS102XA_IMMAP_H_
+#include <fsl_immap.h>
#define SVR_MAJ(svr) (((svr) >> 4) & 0xf)
#define SVR_MIN(svr) (((svr) >> 0) & 0xf)
#define SCFG_PMCINTECR_ETSECERRG1 0x00040000
#define SCFG_CLUSTERPMCR_WFIL2EN 0x80000000
+#define SCFG_BASE 0x01570000
+#define SCFG_USB3PRM1CR 0x070
+#define SCFG_USB_TXVREFTUNE 0x9
+#define SCFG_USB_SQRXTUNE_MASK 0x7
+#define SCFG_USB3PRM2CR 0x074
+#define SCFG_USB_PCSTXSWINGFULL_MASK 0x0000FE00
+#define SCFG_USB_PCSTXSWINGFULL_VAL 0x00008E00
+
+#define USB_PHY_BASE 0x08510000
+#define USB_PHY_RX_OVRD_IN_HI 0x200c
+#define USB_PHY_RX_EQ_VAL_1 0x0000
+#define USB_PHY_RX_EQ_VAL_2 0x8000
+#define USB_PHY_RX_EQ_VAL_3 0x8004
+#define USB_PHY_RX_EQ_VAL_4 0x800C
+
/* Supplemental Configuration Unit */
struct ccsr_scfg {
u32 dpslpcr;
u8 res_a00[0x1000-0xa00]; /* from 0xa00 to 0xfff */
};
-#define CCI400_CTRLORD_TERM_BARRIER 0x00000008
-#define CCI400_CTRLORD_EN_BARRIER 0
-#define CCI400_SHAORD_NON_SHAREABLE 0x00000002
-#define CCI400_DVM_MESSAGE_REQ_EN 0x00000002
-#define CCI400_SNOOP_REQ_EN 0x00000001
-
-/* CCI-400 registers */
-struct ccsr_cci400 {
- u32 ctrl_ord; /* Control Override */
- u32 spec_ctrl; /* Speculation Control */
- u32 secure_access; /* Secure Access */
- u32 status; /* Status */
- u32 impr_err; /* Imprecise Error */
- u8 res_14[0x100 - 0x14];
- u32 pmcr; /* Performance Monitor Control */
- u8 res_104[0xfd0 - 0x104];
- u32 pid[8]; /* Peripheral ID */
- u32 cid[4]; /* Component ID */
- struct {
- u32 snoop_ctrl; /* Snoop Control */
- u32 sha_ord; /* Shareable Override */
- u8 res_1008[0x1100 - 0x1008];
- u32 rc_qos_ord; /* read channel QoS Value Override */
- u32 wc_qos_ord; /* read channel QoS Value Override */
- u8 res_1108[0x110c - 0x1108];
- u32 qos_ctrl; /* QoS Control */
- u32 max_ot; /* Max OT */
- u8 res_1114[0x1130 - 0x1114];
- u32 target_lat; /* Target Latency */
- u32 latency_regu; /* Latency Regulation */
- u32 qos_range; /* QoS Range */
- u8 res_113c[0x2000 - 0x113c];
- } slave[5]; /* Slave Interface */
- u8 res_6000[0x9004 - 0x6000];
- u32 cycle_counter; /* Cycle counter */
- u32 count_ctrl; /* Count Control */
- u32 overflow_status; /* Overflow Flag Status */
- u8 res_9010[0xa000 - 0x9010];
- struct {
- u32 event_select; /* Event Select */
- u32 event_count; /* Event Count */
- u32 counter_ctrl; /* Counter Control */
- u32 overflow_status; /* Overflow Flag Status */
- u8 res_a010[0xb000 - 0xa010];
- } pcounter[4]; /* Performance Counter */
- u8 res_e004[0x10000 - 0xe004];
-};
+
/* AHCI (sata) register map */
struct ccsr_ahci {
*/
#include <asm/mach-imx/sys_proto.h>
+
+#define USBPHY_PWD 0x00000000
+
+#define USBPHY_PWD_RXPWDRX (1 << 20) /* receiver block power down */
+
+#define is_usbotg_phy_active(void) (!(readl(USB_PHY0_BASE_ADDR + USBPHY_PWD) & \
+ USBPHY_PWD_RXPWDRX))
};
enum enet_freq {
- ENET_25MHz,
- ENET_50MHz,
- ENET_125MHz,
+ ENET_25MHZ,
+ ENET_50MHZ,
+ ENET_125MHZ,
};
u32 get_root_clk(enum clk_root_index clock_id);
/* Offset is 0.73V for LP873x */
#define LP873X_BUCK_BASE_VOLT_UV 730000
+/* Offset is 0.73V for LP87565 */
+#define LP87565_BUCK_BASE_VOLT_UV 730000
+
/* TPS659038 */
#define TPS659038_I2C_SLAVE_ADDR 0x58
#define TPS659038_REG_ADDR_SMPS12 0x23
#define TPS65917_REG_ADDR_SMPS1 0x23
#define TPS65917_REG_ADDR_SMPS2 0x27
#define TPS65917_REG_ADDR_SMPS3 0x2F
+#define TPS65917_REG_ADDR_SMPS4 0x33
/* LP873X */
#define LP873X_I2C_SLAVE_ADDR 0x60
#define LP873X_REG_ADDR_BUCK1 0x7
#define LP873X_REG_ADDR_LDO1 0xA
+/* LP87565 */
+#define LP87565_I2C_SLAVE_ADDR 0x61
+#define LP87565_REG_ADDR_BUCK01 0xA
+#define LP87565_REG_ADDR_BUCK23 0xE
+
/* TPS */
#define TPS62361_I2C_SLAVE_ADDR 0x60
#define TPS62361_REG_ADDR_SET0 0x0
#include <asm/types.h>
-#define FSC (1 << 19)
-#define SSC (0 << 19)
-
-#define IEN (1 << 18)
-#define IDIS (0 << 18)
-
-#define PTU (1 << 17)
-#define PTD (0 << 17)
-#define PEN (1 << 16)
-#define PDIS (0 << 16)
-
-#define WKEN (1 << 24)
-#define WKDIS (0 << 24)
-
#define PULL_ENA (0 << 16)
#define PULL_DIS (1 << 16)
#define PULL_UP (1 << 17)
#define OMAP5430_CONTROL_ID_CODE_ES2_0 0x1B94202F
#define OMAP5432_CONTROL_ID_CODE_ES1_0 0x0B99802F
#define OMAP5432_CONTROL_ID_CODE_ES2_0 0x1B99802F
+#define DRA762_CONTROL_ID_CODE_ES1_0 0x0BB5002F
#define DRA752_CONTROL_ID_CODE_ES1_0 0x0B99002F
#define DRA752_CONTROL_ID_CODE_ES1_1 0x1B99002F
#define DRA752_CONTROL_ID_CODE_ES2_0 0x2B99002F
#define DRA722_CONTROL_ID_CODE_ES1_0 0x0B9BC02F
#define DRA722_CONTROL_ID_CODE_ES2_0 0x1B9BC02F
+#define DRA722_CONTROL_ID_CODE_ES2_1 0x2B9BC02F
/* UART */
#define UART1_BASE (OMAP54XX_L4_PER_BASE + 0x6a000)
unsigned int os_reg[8];
unsigned int reserved9[(0x604 - 0x5e4) / 4 - 1];
unsigned int ddrc_stat;
+ unsigned int reserved10[(0x680 - 0x604) / 4 - 1];
+ unsigned int sig_detect_con[2];
+ unsigned int reserved11[(0x690 - 0x684) / 4 - 1];
+ unsigned int sig_detect_status[2];
+ unsigned int reserved12[(0x6a0 - 0x694) / 4 - 1];
+ unsigned int sig_detect_clr[2];
+ unsigned int reserved13[(0x6b0 - 0x6a4) / 4 - 1];
+ unsigned int emmc_det;
+ unsigned int reserved14[(0x700 - 0x6b0) / 4 - 1];
+ unsigned int host0_con[3];
+ unsigned int reserved15;
+ unsigned int host1_con[3];
+ unsigned int reserved16;
+ unsigned int host2_con[3];
+ unsigned int reserved17[(0x760 - 0x728) / 4 - 1];
+ unsigned int usbphy0_con[27];
+ unsigned int reserved18[(0x800 - 0x7c8) / 4 - 1];
+ unsigned int usbphy1_con[27];
+ unsigned int reserved19[(0x880 - 0x868) / 4 - 1];
+ unsigned int otg_con0;
+ unsigned int uoc_status0;
+ unsigned int reserved20[(0x900 - 0x884) / 4 - 1];
+ unsigned int mac_con[2];
+ unsigned int reserved21[(0xb00 - 0x904) / 4 - 1];
+ unsigned int macphy_con[4];
+ unsigned int macphy_status;
};
check_member(rk322x_grf, ddrc_stat, 0x604);
CON_IOMUX_PWM0SEL_SHIFT = 0,
CON_IOMUX_PWM0SEL_MASK = 1 << CON_IOMUX_PWM0SEL_SHIFT,
};
+
+/* GRF_MACPHY_CON0 */
+enum {
+ MACPHY_CFG_ENABLE_SHIFT = 0,
+ MACPHY_CFG_ENABLE_MASK = 1 << MACPHY_CFG_ENABLE_SHIFT,
+};
#endif
#ifndef _ASM_ARMV8_MMU_H_
#define _ASM_ARMV8_MMU_H_
-/***************************************************************/
-/*
- * The following definitions are related each other, shoud be
- * calculated specifically.
- */
-
-#define VA_BITS CONFIG_SYS_VA_BITS
-#define PTE_BLOCK_BITS CONFIG_SYS_PTL2_BITS
-
/*
* block/section address mask and size definitions.
*/
#undef PAGE_SIZE
#define PAGE_SHIFT 12
#define PAGE_SIZE (1 << PAGE_SHIFT)
-#define PAGE_MASK (~(PAGE_SIZE-1))
+#define PAGE_MASK (~(PAGE_SIZE - 1))
/***************************************************************/
#ifndef __ASM_ARM_DMA_MAPPING_H
#define __ASM_ARM_DMA_MAPPING_H
-#define dma_mapping_error(x, y) 0
+#include <linux/dma-direction.h>
-enum dma_data_direction {
- DMA_BIDIRECTIONAL = 0,
- DMA_TO_DEVICE = 1,
- DMA_FROM_DEVICE = 2,
-};
+#define dma_mapping_error(x, y) 0
static inline void *dma_alloc_coherent(size_t len, unsigned long *handle)
{
/*
* Copyright 2015 Freescale Semiconductor, Inc.
+ * Copyright 2017 NXP
*
* SPDX-License-Identifier: GPL-2.0+
*/
* DDR memory map
*/
#ifdef CONFIG_FSL_LSCH3
-#define CONFIG_BS_HDR_ADDR_DEVICE 0x580d00000
-#define CONFIG_BS_ADDR_DEVICE 0x580e00000
-#define CONFIG_BS_HDR_ADDR_RAM 0xa0d00000
-#define CONFIG_BS_ADDR_RAM 0xa0e00000
-#define CONFIG_BS_HDR_SIZE 0x00002000
+#ifdef CONFIG_QSPI_BOOT
+#define CONFIG_BS_ADDR_DEVICE 0x20600000
+#define CONFIG_BS_HDR_ADDR_DEVICE 0x20640000
+#else /* NOR BOOT */
+#define CONFIG_BS_ADDR_DEVICE 0x580600000
+#define CONFIG_BS_HDR_ADDR_DEVICE 0x580640000
+#endif /*ifdef CONFIG_QSPI_BOOT */
#define CONFIG_BS_SIZE 0x00001000
+#define CONFIG_BS_HDR_SIZE 0x00004000
+#define CONFIG_BS_ADDR_RAM 0xa0600000
+#define CONFIG_BS_HDR_ADDR_RAM 0xa0640000
#else
#ifdef CONFIG_SD_BOOT
/* For SD boot address and size are assigned in terms of sector
* offset and no. of sectors respectively.
*/
-#if defined(CONFIG_ARCH_LS1043A) || defined(CONFIG_ARCH_LS1046A)
-#define CONFIG_BS_HDR_ADDR_DEVICE 0x00000920
-#else
-#define CONFIG_BS_HDR_ADDR_DEVICE 0x00000900
-#endif
-#define CONFIG_BS_ADDR_DEVICE 0x00000940
-#define CONFIG_BS_HDR_SIZE 0x00000010
+#define CONFIG_BS_ADDR_DEVICE 0x00003000
+#define CONFIG_BS_HDR_ADDR_DEVICE 0x00003200
#define CONFIG_BS_SIZE 0x00000008
+#define CONFIG_BS_HDR_SIZE 0x00000010
#elif defined(CONFIG_NAND_BOOT)
-#define CONFIG_BS_HDR_ADDR_DEVICE 0x00800000
-#define CONFIG_BS_ADDR_DEVICE 0x00802000
-#define CONFIG_BS_HDR_SIZE 0x00002000
-#define CONFIG_BS_SIZE 0x00001000
-#elif defined(CONFIG_QSPI_BOOT)
-#ifdef CONFIG_ARCH_LS1046A
-#define CONFIG_BS_HDR_ADDR_DEVICE 0x40780000
-#define CONFIG_BS_ADDR_DEVICE 0x40800000
-#elif defined(CONFIG_ARCH_LS1012A)
-#define CONFIG_BS_HDR_ADDR_DEVICE 0x400c0000
-#define CONFIG_BS_ADDR_DEVICE 0x40060000
-#else
-#error "Platform not supported"
-#endif
+#define CONFIG_BS_ADDR_DEVICE 0x00600000
+#define CONFIG_BS_HDR_ADDR_DEVICE 0x00640000
+#define CONFIG_BS_SIZE 0x00001000
#define CONFIG_BS_HDR_SIZE 0x00002000
+#elif defined(CONFIG_QSPI_BOOT)
+#define CONFIG_BS_ADDR_DEVICE 0x40600000
+#define CONFIG_BS_HDR_ADDR_DEVICE 0x40640000
#define CONFIG_BS_SIZE 0x00001000
-#else /* Default NOR Boot */
-#define CONFIG_BS_HDR_ADDR_DEVICE 0x600a0000
-#define CONFIG_BS_ADDR_DEVICE 0x60060000
#define CONFIG_BS_HDR_SIZE 0x00002000
+#else /* Default NOR Boot */
+#define CONFIG_BS_ADDR_DEVICE 0x60600000
+#define CONFIG_BS_HDR_ADDR_DEVICE 0x60640000
#define CONFIG_BS_SIZE 0x00001000
+#define CONFIG_BS_HDR_SIZE 0x00002000
#endif
-#define CONFIG_BS_HDR_ADDR_RAM 0x81000000
-#define CONFIG_BS_ADDR_RAM 0x81020000
+#define CONFIG_BS_ADDR_RAM 0x81000000
+#define CONFIG_BS_HDR_ADDR_RAM 0x81020000
#endif
#ifdef CONFIG_BOOTSCRIPT_COPY_RAM
-#define CONFIG_BOOTSCRIPT_HDR_ADDR CONFIG_BS_HDR_ADDR_RAM
#define CONFIG_BOOTSCRIPT_ADDR CONFIG_BS_ADDR_RAM
+#define CONFIG_BOOTSCRIPT_HDR_ADDR CONFIG_BS_HDR_ADDR_RAM
#else
#define CONFIG_BOOTSCRIPT_HDR_ADDR CONFIG_BS_HDR_ADDR_DEVICE
/* BOOTSCRIPT_ADDR is not required */
extern struct prcm_regs const dra7xx_prcm;
extern struct dplls const **dplls_data;
extern struct dplls dra7xx_dplls;
+extern struct dplls dra72x_dplls;
extern struct vcores_data const **omap_vcores;
extern const u32 sys_clk_array[8];
extern struct omap_sys_ctrl_regs const **ctrl;
extern struct pmic_data tps659038;
extern struct pmic_data lp8733;
+extern struct pmic_data lp87565;
void hw_data_init(void);
#define DRA7XX 0x07000000
#define DRA72X 0x07200000
+#define DRA76X 0x07600000
static inline u8 is_dra7xx(void)
{
extern u32 *const omap_si_rev;
return (*omap_si_rev & 0xFFF00000) == DRA72X;
}
+
+static inline u8 is_dra76x(void)
+{
+ extern u32 *const omap_si_rev;
+ return (*omap_si_rev & 0xFFF00000) == DRA76X;
+}
#endif
/*
#define OMAP5432_ES2_0 0x54320200
/* DRA7XX */
+#define DRA762_ES1_0 0x07620100
#define DRA752_ES1_0 0x07520100
#define DRA752_ES1_1 0x07520110
#define DRA752_ES2_0 0x07520200
#define DRA722_ES1_0 0x07220100
#define DRA722_ES2_0 0x07220200
+#define DRA722_ES2_1 0x07220210
/*
* silicon device type
int wp_gpio);
void vmmc_pbias_config(uint voltage);
+void board_mmc_poweron_ldo(uint voltage);
#endif /* OMAP_MMC_H_ */
if ARCH_AT91
+config AT91FAMILY
+ def_bool y
+
+config AT91SAM9260
+ bool
+ select CPU_ARM926EJS
+
+config AT91SAM9G20
+ bool
+ select CPU_ARM926EJS
+
+config AT91SAM9XE
+ bool
+ select CPU_ARM926EJS
+
+config AT91SAM9261
+ bool
+ select CPU_ARM926EJS
+
+config AT91SAM9263
+ bool
+ select CPU_ARM926EJS
+
+config AT91SAM9G45
+ bool
+ select CPU_ARM926EJS
+
+config AT91SAM9M10G45
+ bool
+ select CPU_ARM926EJS
+
+config AT91SAM9N12
+ bool
+ select CPU_ARM926EJS
+
+config AT91SAM9RL
+ bool
+ select CPU_ARM926EJS
+
+config AT91SAM9X5
+ bool
+ select CPU_ARM926EJS
+
+config SAMA5D2
+ bool
+ select CPU_V7
+
+config SAMA5D3
+ bool
+ select CPU_V7
+
+config SAMA5D4
+ bool
+ select CPU_V7
+
choice
prompt "Atmel AT91 board select"
optional
config TARGET_AT91SAM9260EK
bool "Atmel at91sam9260 reference board"
- select CPU_ARM926EJS
+ select AT91SAM9260
select BOARD_EARLY_INIT_F
config TARGET_ETHERNUT5
bool "Ethernut5 board"
- select CPU_ARM926EJS
+ select AT91SAM9XE
config TARGET_SNAPPER9260
bool "Support snapper9260"
- select CPU_ARM926EJS
+ select AT91SAM9260
select DM
select DM_SERIAL
select DM_GPIO
config TARGET_GURNARD
bool "Support gurnard"
+ select AT91SAM9G45
select BOARD_LATE_INIT
- select CPU_ARM926EJS
select DM
select DM_SERIAL
select DM_GPIO
config TARGET_AT91SAM9261EK
bool "Atmel at91sam9261 reference board"
- select CPU_ARM926EJS
+ select AT91SAM9261
select BOARD_EARLY_INIT_F
config TARGET_PM9261
bool "Ronetix pm9261 board"
- select CPU_ARM926EJS
+ select AT91SAM9261
config TARGET_AT91SAM9263EK
bool "Atmel at91sam9263 reference board"
- select CPU_ARM926EJS
+ select AT91SAM9263
select BOARD_EARLY_INIT_F
config TARGET_USB_A9263
bool "Caloa USB A9260 board"
- select CPU_ARM926EJS
+ select AT91SAM9263
config TARGET_PM9263
bool "Ronetix pm9263 board"
- select CPU_ARM926EJS
+ select AT91SAM9263
config TARGET_AT91SAM9M10G45EK
bool "Atmel AT91SAM9M10G45-EK board"
- select CPU_ARM926EJS
+ select AT91SAM9M10G45
select SUPPORT_SPL
select BOARD_EARLY_INIT_F
config TARGET_PM9G45
bool "Ronetix pm9g45 board"
- select CPU_ARM926EJS
+ select AT91SAM9G45
config TARGET_PICOSAM9G45
bool "Mini-box picosam9g45 board"
- select CPU_ARM926EJS
+ select AT91SAM9M10G45
select SUPPORT_SPL
config TARGET_AT91SAM9N12EK
bool "Atmel AT91SAM9N12-EK board"
- select CPU_ARM926EJS
+ select AT91SAM9N12
select SUPPORT_SPL
select BOARD_EARLY_INIT_F
config TARGET_AT91SAM9RLEK
bool "Atmel at91sam9rl reference board"
- select CPU_ARM926EJS
+ select AT91SAM9RL
select BOARD_EARLY_INIT_F
config TARGET_AT91SAM9X5EK
bool "Atmel AT91SAM9X5-EK board"
- select CPU_ARM926EJS
+ select AT91SAM9X5
select SUPPORT_SPL
select BOARD_EARLY_INIT_F
config TARGET_SAMA5D2_PTC
bool "SAMA5D2 PTC board"
- select CPU_V7
+ select SAMA5D2
select SUPPORT_SPL
select BOARD_EARLY_INIT_F
config TARGET_SAMA5D2_XPLAINED
bool "SAMA5D2 Xplained board"
+ select SAMA5D2
+ select SUPPORT_SPL
+ select BOARD_EARLY_INIT_F
+
+config TARGET_SAMA5D27_SOM1_EK
+ bool "SAMA5D27 SOM1 EK board"
select CPU_V7
select SUPPORT_SPL
select BOARD_EARLY_INIT_F
+ select BOARD_LATE_INIT
+ help
+ The SAMA5D27 SOM1 embeds SAMA5D2 SiP(System in Package),
+ a 64Mbit QSPI flash, KSZ8081 Phy and a Mac-address EEPROM
+ 24AA02E48. The SAMA5D2 SiP integrates the ARM Cortex-A5
+ processor-based SAMA5D2 MPU with up to 1 Gbit DDR2-SDRAM
+ in a single package.
config TARGET_SAMA5D3_XPLAINED
bool "SAMA5D3 Xplained board"
- select CPU_V7
+ select SAMA5D3
select SUPPORT_SPL
select BOARD_EARLY_INIT_F
config TARGET_SAMA5D3XEK
bool "SAMA5D3X-EK board"
+ select SAMA5D3
select BOARD_LATE_INIT
- select CPU_V7
select SUPPORT_SPL
select BOARD_EARLY_INIT_F
config TARGET_SAMA5D4_XPLAINED
bool "SAMA5D4 Xplained board"
- select CPU_V7
+ select SAMA5D4
select SUPPORT_SPL
select BOARD_EARLY_INIT_F
config TARGET_SAMA5D4EK
bool "SAMA5D4 Evaluation Kit"
- select CPU_V7
+ select SAMA5D4
select SUPPORT_SPL
select BOARD_EARLY_INIT_F
config TARGET_MA5D4EVK
bool "Aries MA5D4EVK Evaluation Kit"
- select CPU_V7
+ select SAMA5D4
select SUPPORT_SPL
config TARGET_MEESC
bool "Support meesc"
- select CPU_ARM926EJS
+ select AT91SAM9263
config TARGET_CORVUS
bool "Support corvus"
- select CPU_ARM926EJS
+ select AT91SAM9M10G45
select SUPPORT_SPL
select DM
select DM_SERIAL
config TARGET_TAURUS
bool "Support taurus"
- select CPU_ARM926EJS
+ select AT91SAM9G20
select SUPPORT_SPL
select DM
select DM_SERIAL
config TARGET_SMARTWEB
bool "Support smartweb"
- select CPU_ARM926EJS
+ select AT91SAM9260
select SUPPORT_SPL
select DM
select DM_SERIAL
config TARGET_VINCO
bool "Support VINCO"
- select CPU_V7
+ select SAMA5D4
select SUPPORT_SPL
endchoice
source "board/atmel/at91sam9x5ek/Kconfig"
source "board/atmel/sama5d2_ptc/Kconfig"
source "board/atmel/sama5d2_xplained/Kconfig"
+source "board/atmel/sama5d27_som1_ek/Kconfig"
source "board/atmel/sama5d3_xplained/Kconfig"
source "board/atmel/sama5d3xek/Kconfig"
source "board/atmel/sama5d4_xplained/Kconfig"
;
}
+/*
+ * For the Master Clock Controller Register(MCKR), while switching
+ * to a lower clock source, we must switch the clock source first
+ * instead of last. Otherwise, we could end up with too high frequency
+ * on the internal bus and peripherals.
+ */
+void at91_mck_init_down(u32 mckr)
+{
+ struct at91_pmc *pmc = (struct at91_pmc *)ATMEL_BASE_PMC;
+ u32 tmp;
+
+ tmp = readl(&pmc->mckr);
+ tmp &= (~AT91_PMC_MCKR_CSS_MASK);
+ tmp |= (mckr & AT91_PMC_MCKR_CSS_MASK);
+ writel(tmp, &pmc->mckr);
+
+ while (!(readl(&pmc->sr) & AT91_PMC_MCKRDY))
+ ;
+
+#ifdef CPU_HAS_H32MXDIV
+ tmp = readl(&pmc->mckr);
+ tmp &= (~AT91_PMC_MCKR_H32MXDIV);
+ tmp |= (mckr & AT91_PMC_MCKR_H32MXDIV);
+ writel(tmp, &pmc->mckr);
+#endif
+
+ tmp = readl(&pmc->mckr);
+ tmp &= (~AT91_PMC_MCKR_PLLADIV_MASK);
+ tmp |= (mckr & AT91_PMC_MCKR_PLLADIV_MASK);
+ writel(tmp, &pmc->mckr);
+
+ tmp = readl(&pmc->mckr);
+ tmp &= (~AT91_PMC_MCKR_MDIV_MASK);
+ tmp |= (mckr & AT91_PMC_MCKR_MDIV_MASK);
+ writel(tmp, &pmc->mckr);
+
+ tmp = readl(&pmc->mckr);
+ tmp &= (~AT91_PMC_MCKR_PRES_MASK);
+ tmp |= (mckr & AT91_PMC_MCKR_PRES_MASK);
+ writel(tmp, &pmc->mckr);
+}
+
int at91_enable_periph_generated_clk(u32 id, u32 clk_source, u32 div)
{
struct at91_pmc *pmc = (struct at91_pmc *)ATMEL_BASE_PMC;
#include <asm/arch/clk.h>
#include <asm/arch/sama5d2.h>
-char *get_cpu_name()
+int cpu_is_sama5d2(void)
{
+ unsigned int chip_id = get_chip_id();
+
+ return ((chip_id == ARCH_ID_SAMA5D2) ||
+ (chip_id == ARCH_ID_SAMA5D2_SIP)) ? 1 : 0;
+}
+
+char *get_cpu_name(void)
+{
+ unsigned int chip_id = get_chip_id();
unsigned int extension_id = get_extension_chip_id();
- if (cpu_is_sama5d2()) {
+ if (chip_id == ARCH_ID_SAMA5D2) {
switch (extension_id) {
case ARCH_EXID_SAMA5D21CU:
return "SAMA5D21";
}
}
+ if ((chip_id == ARCH_ID_SAMA5D2) || (chip_id == ARCH_ID_SAMA5D2_SIP)) {
+ switch (extension_id) {
+ case ARCH_EXID_SAMA5D225C_D1M:
+ return "SAMA5D225 128M bits DDR2 SDRAM";
+ case ARCH_EXID_SAMA5D27C_D5M:
+ return "SAMA5D27 512M bits DDR2 SDRAM";
+ case ARCH_EXID_SAMA5D27C_D1G:
+ return "SAMA5D27 1G bits DDR2 SDRAM";
+ case ARCH_EXID_SAMA5D28C_D1G:
+ return "SAMA5D28 1G bits DDR2 SDRAM";
+ }
+ }
+
return "Unknown CPU type";
}
*/
#include <common.h>
+#include <asm/hardware.h>
#include <asm/io.h>
#include <asm/arch/sama5_sfr.h>
void at91_plla_init(u32 pllar);
void at91_pllb_init(u32 pllar);
void at91_mck_init(u32 mckr);
+void at91_mck_init_down(u32 mckr);
void at91_pmc_init(void);
void mem_init(void);
void at91_phy_reset(void);
void redirect_int_from_saic_to_aic(void);
void configure_2nd_sram_as_l2_cache(void);
+int at91_set_ethaddr(int offset);
+int at91_video_show_board_info(void);
+
#endif /* AT91_COMMON_H */
#define AT91_PMC_MCFR_MAINRDY 0x00010000
#define AT91_PMC_MCFR_MAINF_MASK 0x0000FFFF
+#define AT91_PMC_MCFR_RCMEAS 0x00100000
+#define AT91_PMC_MCFR_CCSS_XTAL_OSC 0x01000000
#define AT91_PMC_MCKR_CSS_SLOW 0x00000000
#define AT91_PMC_MCKR_CSS_MAIN 0x00000001
#ifndef __AT91RM9200_H__
#define __AT91RM9200_H__
-#define CONFIG_AT91FAMILY /* it's a member of AT91 family */
#define CONFIG_ARCH_CPU_INIT /* we need arch_cpu_init() for hw timers */
#define CONFIG_AT91_GPIO /* and require always gpio features */
#ifndef AT91SAM9260_H
#define AT91SAM9260_H
-/*
- * defines to be used in other places
- */
-#define CONFIG_AT91FAMILY /* it's a member of AT91 */
-
/*
* Peripheral identifiers/interrupts.
*/
#ifndef AT91SAM9261_H
#define AT91SAM9261_H
-/*
- * defines to be used in other places
- */
-#define CONFIG_AT91FAMILY /* it's a member of AT91 */
-
/*
* Peripheral identifiers/interrupts.
*/
#ifndef AT91SAM9263_H
#define AT91SAM9263_H
-/*
- * defines to be used in other places
- */
-#define CONFIG_AT91FAMILY /* it's a member of AT91 */
-
/*
* Peripheral identifiers/interrupts.
*/
#ifndef AT91SAM9G45_H
#define AT91SAM9G45_H
-/*
- * defines to be used in other places
- */
-#define CONFIG_AT91FAMILY /* it's a member of AT91 */
-
/*
* Peripheral identifiers/interrupts.
*/
#ifndef AT91SAM9RL_H
#define AT91SAM9RL_H
-/*
- * defines to be used in other places
- */
-#define CONFIG_AT91FAMILY /* it's a member of AT91 */
-
/*
* Peripheral identifiers/interrupts.
*/
#ifndef __AT91SAM9X5_H__
#define __AT91SAM9X5_H__
-#define CONFIG_AT91FAMILY /* it's a member of AT91 family */
-
/*
* Peripheral identifiers/interrupts.
*/
#define ATMEL_MPDDRC_CR_DLL_RESET_ENABLED (0x1 << 7)
#define ATMEL_MPDDRC_CR_DIC_DS (0x1 << 8)
#define ATMEL_MPDDRC_CR_DIS_DLL (0x1 << 9)
+#define ATMEL_MPDDRC_CR_ZQ_INIT (0x0 << 10)
+#define ATMEL_MPDDRC_CR_ZQ_LONG (0x1 << 10)
+#define ATMEL_MPDDRC_CR_ZQ_SHORT (0x2 << 10)
+#define ATMEL_MPDDRC_CR_ZQ_RESET (0x3 << 10)
#define ATMEL_MPDDRC_CR_OCD_DEFAULT (0x7 << 12)
#define ATMEL_MPDDRC_CR_DQMS_SHARED (0x1 << 16)
#define ATMEL_MPDDRC_CR_ENRDM_ON (0x1 << 17)
u32 l2cc_hramc; /* 0x58 */
};
+/* Register Mapping*/
+#define AT91_SFR_UTMICKTRIM 0x30 /* UTMI Clock Trimming Register */
+
/* Bit field in DDRCFG */
#define ATMEL_SFR_DDRCFG_FDQIEN 0x00010000
#define ATMEL_SFR_DDRCFG_FDQSIEN 0x00020000
#define AT91_SFR_EBICFG_SCH1_OFF (0x0 << 12)
#define AT91_SFR_EBICFG_SCH1_ON (0x1 << 12)
+#define AT91_UTMICKTRIM_FREQ GENMASK(1, 0)
+
/* Bit field in AICREDIR */
#define ATMEL_SFR_AICREDIR_NSAIC 0x00000001
#ifndef __SAMA5D2_H
#define __SAMA5D2_H
-/*
- * definitions to be used in other places
- */
-#define CONFIG_AT91FAMILY /* It's a member of AT91 */
-
/*
* Peripheral identifiers/interrupts.
*/
#define ARCH_EXID_SAMA5D28CU 0x00000010
#define ARCH_EXID_SAMA5D28CN 0x00000020
-#define cpu_is_sama5d2() (get_chip_id() == ARCH_ID_SAMA5D2)
+#define ARCH_ID_SAMA5D2_SIP 0x8a5c08c2
+#define ARCH_EXID_SAMA5D225C_D1M 0x00000053
+#define ARCH_EXID_SAMA5D27C_D5M 0x00000032
+#define ARCH_EXID_SAMA5D27C_D1G 0x00000033
+#define ARCH_EXID_SAMA5D28C_D1G 0x00000013
/* PIT Timer(PIT_PIIR) */
#define CONFIG_SYS_TIMER_COUNTER 0xf804803c
#ifndef __ASSEMBLY__
unsigned int get_chip_id(void);
unsigned int get_extension_chip_id(void);
+int cpu_is_sama5d2(void);
unsigned int has_lcdc(void);
char *get_cpu_name(void);
#endif
#ifndef SAMA5D3_H
#define SAMA5D3_H
-/*
- * defines to be used in other places
- */
-#define CONFIG_AT91FAMILY /* it's a member of AT91 */
-
/*
* Peripheral identifiers/interrupts.
*/
#ifndef __SAMA5D4_H
#define __SAMA5D4_H
-/*
- * defines to be used in other places
- */
-#define CONFIG_AT91FAMILY /* It's a member of AT91 */
-
/*
* Peripheral identifiers/interrupts.
*/
*/
#include <common.h>
+#include <asm/hardware.h>
#include <asm/io.h>
#include <asm/arch/sama5_matrix.h>
*/
#include <common.h>
+#include <asm/hardware.h>
#include <asm/io.h>
#include <linux/sizes.h>
#include <asm/arch/at91_rstc.h>
u32 off = (bootrom_stash.r4 >> ATMEL_SAMA5_BOOT_DEV_ID_OFF) &
ATMEL_SAMA5_BOOT_DEV_ID_MASK;
-#if defined(CONFIG_SYS_USE_MMC)
+#if defined(CONFIG_SYS_USE_MMC) || defined(CONFIG_SD_BOOT)
if (dev == ATMEL_SAMA5_BOOT_FROM_MCI) {
#if defined(CONFIG_SPL_OF_CONTROL)
return BOOT_DEVICE_MMC1;
}
#endif
-#if defined(CONFIG_SYS_USE_SERIALFLASH) || defined(CONFIG_SYS_USE_SPIFLASH)
+#if defined(CONFIG_SYS_USE_SERIALFLASH) || \
+ defined(CONFIG_SYS_USE_SPIFLASH) || \
+ defined(CONFIG_SPI_BOOT)
if (dev == ATMEL_SAMA5_BOOT_FROM_SPI)
return BOOT_DEVICE_SPI;
#endif
+ if (dev == ATMEL_SAMA5_BOOT_FROM_QSPI)
+ return BOOT_DEVICE_SPI;
if (dev == ATMEL_SAMA5_BOOT_FROM_SMC)
return BOOT_DEVICE_NAND;
#else
u32 spl_boot_device(void)
{
-#ifdef CONFIG_SYS_USE_MMC
+#if defined(CONFIG_SYS_USE_MMC) || defined(CONFIG_SD_BOOT)
return BOOT_DEVICE_MMC1;
-#elif CONFIG_SYS_USE_NANDFLASH
+#elif defined(CONFIG_SYS_USE_NANDFLASH) || defined(CONFIG_NAND_BOOT)
return BOOT_DEVICE_NAND;
-#elif CONFIG_SYS_USE_SERIALFLASH || CONFIG_SYS_USE_SPIFLASH
+#elif defined(CONFIG_SYS_USE_SERIALFLASH) || \
+ defined(CONFIG_SYS_USE_SPIFLASH) || \
+ defined(CONFIG_SPI_BOOT)
return BOOT_DEVICE_SPI;
#endif
return BOOT_DEVICE_NONE;
u32 spl_boot_mode(const u32 boot_device)
{
switch (boot_device) {
-#ifdef CONFIG_SYS_USE_MMC
+#if defined(CONFIG_SYS_USE_MMC) || defined(CONFIG_SD_BOOT)
case BOOT_DEVICE_MMC1:
case BOOT_DEVICE_MMC2:
return MMCSD_MODE_FS;
while (!(readl(&pmc->sr) & AT91_PMC_IXR_MOSCS))
;
+#if defined(CONFIG_SAMA5D2)
+ /* Enable a measurement of the external oscillator */
+ tmp = readl(&pmc->mcfr);
+ tmp |= AT91_PMC_MCFR_CCSS_XTAL_OSC;
+ tmp |= AT91_PMC_MCFR_RCMEAS;
+ writel(tmp, &pmc->mcfr);
+
+ while (!(readl(&pmc->mcfr) & AT91_PMC_MCFR_MAINRDY))
+ ;
+
+ if (!(readl(&pmc->mcfr) & AT91_PMC_MCFR_MAINF_MASK))
+ hang();
+#endif
+
tmp = readl(&pmc->mor);
tmp &= ~AT91_PMC_MOR_OSCBYPASS;
tmp &= ~AT91_PMC_MOR_KEY(0xff);
while (!(readl(&pmc->sr) & AT91_PMC_IXR_MOSCSELS))
;
+#if !defined(CONFIG_SAMA5D2)
/* Wait until MAINRDY field is set to make sure main clock is stable */
while (!(readl(&pmc->mcfr) & AT91_PMC_MAINRDY))
;
+#endif
-#ifndef CONFIG_SAMA5D4
+#if !defined(CONFIG_SAMA5D4) && !defined(CONFIG_SAMA5D2)
tmp = readl(&pmc->mor);
tmp &= ~AT91_PMC_MOR_MOSCRCEN;
tmp &= ~AT91_PMC_MOR_KEY(0xff);
obj-$(CONFIG_SOC_DM365) += dm365.o
obj-$(CONFIG_SOC_DM644X) += dm644x.o
obj-$(CONFIG_SOC_DM646X) += dm646x.o
-obj-$(CONFIG_SOC_DA830) += da830_pinmux.o
obj-$(CONFIG_SOC_DA850) += da850_pinmux.o
obj-$(CONFIG_DRIVER_TI_EMAC) += lxt972.o dp83848.o et1011c.o ksz8873.o
+++ /dev/null
-/*
- * Pinmux configurations for the DA830 SoCs
- *
- * Copyright (C) 2013 Texas Instruments Incorporated - http://www.ti.com/
- *
- * SPDX-License-Identifier: GPL-2.0+
- */
-
-#include <common.h>
-#include <asm/arch/davinci_misc.h>
-#include <asm/arch/hardware.h>
-#include <asm/arch/pinmux_defs.h>
-
-/* SPI0 pin muxer settings */
-const struct pinmux_config spi0_pins_base[] = {
- { pinmux(7), 1, 3 }, /* SPI0_SOMI */
- { pinmux(7), 1, 4 }, /* SPI0_SIMO */
- { pinmux(7), 1, 6 } /* SPI0_CLK */
-};
-
-const struct pinmux_config spi0_pins_scs0[] = {
- { pinmux(7), 1, 7 } /* SPI0_SCS[0] */
-};
-
-const struct pinmux_config spi0_pins_ena[] = {
- { pinmux(7), 1, 5 } /* SPI0_ENA */
-};
-
-/* NAND pin muxer settings */
-const struct pinmux_config emifa_pins_cs0[] = {
- { pinmux(18), 1, 2 } /* EMA_CS[0] */
-};
-
-const struct pinmux_config emifa_pins_cs2[] = {
- { pinmux(18), 1, 3 } /* EMA_CS[2] */
-};
-
-const struct pinmux_config emifa_pins_cs3[] = {
- { pinmux(18), 1, 4 } /* EMA_CS[3] */
-};
-
-#ifdef CONFIG_USE_NAND
-const struct pinmux_config emifa_pins[] = {
- { pinmux(13), 1, 6 }, /* EMA_D[0] */
- { pinmux(13), 1, 7 }, /* EMA_D[1] */
- { pinmux(14), 1, 0 }, /* EMA_D[2] */
- { pinmux(14), 1, 1 }, /* EMA_D[3] */
- { pinmux(14), 1, 2 }, /* EMA_D[4] */
- { pinmux(14), 1, 3 }, /* EMA_D[5] */
- { pinmux(14), 1, 4 }, /* EMA_D[6] */
- { pinmux(14), 1, 5 }, /* EMA_D[7] */
- { pinmux(14), 1, 6 }, /* EMA_D[8] */
- { pinmux(14), 1, 7 }, /* EMA_D[9] */
- { pinmux(15), 1, 0 }, /* EMA_D[10] */
- { pinmux(15), 1, 1 }, /* EMA_D[11] */
- { pinmux(15), 1, 2 }, /* EMA_D[12] */
- { pinmux(15), 1, 3 }, /* EMA_D[13] */
- { pinmux(15), 1, 4 }, /* EMA_D[14] */
- { pinmux(15), 1, 5 }, /* EMA_D[15] */
- { pinmux(15), 1, 6 }, /* EMA_A[0] */
- { pinmux(15), 1, 7 }, /* EMA_A[1] */
- { pinmux(16), 1, 0 }, /* EMA_A[2] */
- { pinmux(16), 1, 1 }, /* EMA_A[3] */
- { pinmux(16), 1, 2 }, /* EMA_A[4] */
- { pinmux(16), 1, 3 }, /* EMA_A[5] */
- { pinmux(16), 1, 4 }, /* EMA_A[6] */
- { pinmux(16), 1, 5 }, /* EMA_A[7] */
- { pinmux(16), 1, 6 }, /* EMA_A[8] */
- { pinmux(16), 1, 7 }, /* EMA_A[9] */
- { pinmux(17), 1, 0 }, /* EMA_A[10] */
- { pinmux(17), 1, 1 }, /* EMA_A[11] */
- { pinmux(17), 1, 2 }, /* EMA_A[12] */
- { pinmux(17), 1, 3 }, /* EMA_BA[1] */
- { pinmux(17), 1, 4 }, /* EMA_BA[0] */
- { pinmux(17), 1, 5 }, /* EMA_CLK */
- { pinmux(17), 1, 6 }, /* EMA_SDCKE */
- { pinmux(17), 1, 7 }, /* EMA_CAS */
- { pinmux(18), 1, 0 }, /* EMA_CAS */
- { pinmux(18), 1, 1 }, /* EMA_WE */
- { pinmux(18), 1, 5 }, /* EMA_OE */
- { pinmux(18), 1, 6 }, /* EMA_WE_DQM[1] */
- { pinmux(18), 1, 7 }, /* EMA_WE_DQM[0] */
- { pinmux(10), 1, 0 } /* Tristate */
-};
-#endif
-
-/* EMAC PHY interface pins */
-const struct pinmux_config emac_pins_rmii[] = {
- { pinmux(10), 2, 1 }, /* RMII_TXD[0] */
- { pinmux(10), 2, 2 }, /* RMII_TXD[1] */
- { pinmux(10), 2, 3 }, /* RMII_TXEN */
- { pinmux(10), 2, 4 }, /* RMII_CRS_DV */
- { pinmux(10), 2, 5 }, /* RMII_RXD[0] */
- { pinmux(10), 2, 6 }, /* RMII_RXD[1] */
- { pinmux(10), 2, 7 } /* RMII_RXER */
-};
-
-const struct pinmux_config emac_pins_mdio[] = {
- { pinmux(11), 2, 0 }, /* MDIO_CLK */
- { pinmux(11), 2, 1 } /* MDIO_D */
-};
-
-const struct pinmux_config emac_pins_rmii_clk_source[] = {
- { pinmux(9), 0, 5 } /* ref.clk from external source */
-};
-
-/* UART2 pin muxer settings */
-const struct pinmux_config uart2_pins_txrx[] = {
- { pinmux(8), 2, 7 }, /* UART2_RXD */
- { pinmux(9), 2, 0 } /* UART2_TXD */
-};
-
-/* I2C0 pin muxer settings */
-const struct pinmux_config i2c0_pins[] = {
- { pinmux(8), 2, 3 }, /* I2C0_SDA */
- { pinmux(8), 2, 4 } /* I2C0_SCL */
-};
-
-/* USB0_DRVVBUS pin muxer settings */
-const struct pinmux_config usb_pins[] = {
- { pinmux(9), 1, 1 } /* USB0_DRVVBUS */
-};
-
-#ifdef CONFIG_MMC_DAVINCI
-/* MMC0 pin muxer settings */
-const struct pinmux_config mmc0_pins_8bit[] = {
- { pinmux(15), 2, 7 }, /* MMCSD0_CLK */
- { pinmux(16), 2, 0 }, /* MMCSD0_CMD */
- { pinmux(13), 2, 6 }, /* MMCSD0_DAT_0 */
- { pinmux(13), 2, 7 }, /* MMCSD0_DAT_1 */
- { pinmux(14), 2, 0 }, /* MMCSD0_DAT_2 */
- { pinmux(14), 2, 1 }, /* MMCSD0_DAT_3 */
- { pinmux(14), 2, 2 }, /* MMCSD0_DAT_4 */
- { pinmux(14), 2, 3 }, /* MMCSD0_DAT_5 */
- { pinmux(14), 2, 4 }, /* MMCSD0_DAT_6 */
- { pinmux(14), 2, 5 } /* MMCSD0_DAT_7 */
- /* DA830 supports 8-bit mode */
-};
-#endif
clock_enable(CCGR_ENET2, 0);
switch (type) {
- case ENET_125MHz:
+ case ENET_125MHZ:
enet1_ref = ENET1_REF_CLK_ROOT_FROM_PLL_ENET_MAIN_125M_CLK;
enet2_ref = ENET2_REF_CLK_ROOT_FROM_PLL_ENET_MAIN_125M_CLK;
break;
- case ENET_50MHz:
+ case ENET_50MHZ:
enet1_ref = ENET1_REF_CLK_ROOT_FROM_PLL_ENET_MAIN_50M_CLK;
enet2_ref = ENET2_REF_CLK_ROOT_FROM_PLL_ENET_MAIN_50M_CLK;
break;
- case ENET_25MHz:
+ case ENET_25MHZ:
enet1_ref = ENET1_REF_CLK_ROOT_FROM_PLL_ENET_MAIN_25M_CLK;
enet2_ref = ENET2_REF_CLK_ROOT_FROM_PLL_ENET_MAIN_25M_CLK;
break;
#include <asm/spl.h>
#include <spl.h>
#include <asm/mach-imx/hab.h>
+#include <g_dnl.h>
DECLARE_GLOBAL_DATA_PTR;
if (((bmode >> 24) & 0x03) == 0x01) /* Serial Downloader */
return BOOT_DEVICE_BOARD;
+ /*
+ * The above method does not detect that the boot ROM used
+ * serial downloader in case the boot ROM decided to use the
+ * serial downloader as a fall back (primary boot source failed).
+ *
+ * Infer that the boot ROM used the USB serial downloader by
+ * checking whether the USB PHY is currently active... This
+ * assumes that SPL did not (yet) initialize the USB PHY...
+ */
+ if (is_usbotg_phy_active())
+ return BOOT_DEVICE_BOARD;
+
/* BOOT_CFG1[7:4] - see IMX6DQRM Table 8-8 */
switch ((reg & IMX6_BMODE_MASK) >> IMX6_BMODE_SHIFT) {
/* EIM: See 8.5.1, Table 8-9 */
}
return BOOT_DEVICE_NONE;
}
+
+#ifdef CONFIG_SPL_USB_GADGET_SUPPORT
+int g_dnl_bind_fixup(struct usb_device_descriptor *dev, const char *name)
+{
+ put_unaligned(CONFIG_G_DNL_PRODUCT_NUM + 0xfff, &dev->idProduct);
+
+ return 0;
+}
+#endif
#endif
#if defined(CONFIG_SPL_MMC_SUPPORT)
select DM
select DM_SERIAL
select DM_GPIO
+ select OMAP3_GPIO_3
select OMAP3_GPIO_4
select OMAP3_GPIO_6
endchoice
+choice
+ prompt "Memory Controller"
+ default SDRC
+
+config SDRC
+ bool "SDRC controller"
+ help
+ The default memory controller on most OMAP3 boards is SDRC.
+
+config EMIF4
+ bool "EMIF4 controller"
+ help
+ Enable this on boards like AM3517 which use EMIF4 controller
+endchoice
+
config SPL_OMAP3_ID_NAND
bool "Support OMAP3-specific ID and MFR function"
help
select TI_I2C_BOARD_DETECT
select PHYS_64BIT
imply SCSI
+ imply DM_PMIC
+ imply PMIC_LP87565
+ imply DM_REGULATOR
+ imply DM_REGULATOR_LP87565
config TARGET_AM57XX_EVM
bool "AM57XX"
{10, 0, 4, 1, 3, 4, 4, 2, -1, -1, -1, -1}, /* 38.4 MHz */
};
+static const struct dpll_params per_dpll_params_768mhz_dra76x[NUM_SYS_CLKS] = {
+ {32, 0, 4, 1, 3, 4, 8, 2, -1, -1, -1, -1}, /* 12 MHz */
+ {96, 4, 4, 1, 3, 4, 8, 2, -1, -1, -1, -1}, /* 20 MHz */
+ {160, 6, 4, 1, 3, 4, 8, 2, -1, -1, -1, -1}, /* 16.8 MHz */
+ {20, 0, 4, 1, 3, 4, 8, 2, -1, -1, -1, -1}, /* 19.2 MHz */
+ {192, 12, 4, 1, 3, 4, 8, 2, -1, -1, -1, -1}, /* 26 MHz */
+ {-1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1}, /* 27 MHz */
+ {10, 0, 4, 1, 3, 4, 8, 2, -1, -1, -1, -1}, /* 38.4 MHz */
+};
+
static const struct dpll_params iva_dpll_params_2330mhz[NUM_SYS_CLKS] = {
{1165, 11, -1, -1, 5, 6, -1, -1, -1, -1, -1, -1}, /* 12 MHz */
{-1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1}, /* 13 MHz */
.ddr = NULL
};
+struct dplls dra76x_dplls = {
+ .mpu = mpu_dpll_params_1ghz,
+ .core = core_dpll_params_2128mhz_dra7xx,
+ .per = per_dpll_params_768mhz_dra76x,
+ .abe = abe_dpll_params_sysclk2_361267khz,
+ .iva = iva_dpll_params_2330mhz_dra7xx,
+ .usb = usb_dpll_params_1920mhz,
+ .ddr = ddr_dpll_params_2664mhz,
+ .gmac = gmac_dpll_params_2000mhz,
+};
+
struct dplls dra7xx_dplls = {
.mpu = mpu_dpll_params_1ghz,
.core = core_dpll_params_2128mhz_dra7xx,
.gpio_en = 0,
};
+/* The LP87565*/
+struct pmic_data lp87565 = {
+ .base_offset = LP873X_BUCK_BASE_VOLT_UV,
+ .step = 5000, /* 5 mV represented in uV */
+ /*
+ * Offset codes 0 - 0x13 Invalid.
+ * Offset codes 0x14 0x17 give 10mV steps
+ * Offset codes 0x17 through 0x9D give 5mV steps
+ * So let us start with our operating range from .73V
+ */
+ .start_code = 0x17,
+ .i2c_slave_addr = 0x60,
+ .pmic_bus_init = gpi2c_init,
+ .pmic_write = palmas_i2c_write_u8,
+};
+
/* The LP8732 and LP8733 are software-compatible, use common struct */
struct pmic_data lp8733 = {
.base_offset = LP873X_BUCK_BASE_VOLT_UV,
*ctrl = &omap5_ctrl;
break;
+ case DRA762_ES1_0:
+ *prcm = &dra7xx_prcm;
+ *dplls_data = &dra76x_dplls;
+ *ctrl = &dra7xx_ctrl;
+ break;
+
case DRA752_ES1_0:
case DRA752_ES1_1:
case DRA752_ES2_0:
case DRA722_ES1_0:
case DRA722_ES2_0:
+ case DRA722_ES2_1:
*prcm = &dra7xx_prcm;
*dplls_data = &dra72x_dplls;
*ctrl = &dra7xx_ctrl;
case DRA752_ES1_0:
case DRA752_ES1_1:
case DRA752_ES2_0:
+ case DRA762_ES1_0:
*regs = &ioregs_dra7xx_es1;
break;
case DRA722_ES1_0:
*regs = &ioregs_dra72x_es1;
break;
case DRA722_ES2_0:
+ case DRA722_ES2_1:
*regs = &ioregs_dra72x_es2;
break;
case OMAP5432_CONTROL_ID_CODE_ES2_0:
*omap_si_rev = OMAP5432_ES2_0;
break;
+ case DRA762_CONTROL_ID_CODE_ES1_0:
+ *omap_si_rev = DRA762_ES1_0;
+ break;
case DRA752_CONTROL_ID_CODE_ES1_0:
*omap_si_rev = DRA752_ES1_0;
break;
case DRA722_CONTROL_ID_CODE_ES2_0:
*omap_si_rev = DRA722_ES2_0;
break;
+ case DRA722_CONTROL_ID_CODE_ES2_1:
+ *omap_si_rev = DRA722_ES2_1;
+ break;
default:
*omap_si_rev = OMAP5430_SILICON_ID_INVALID;
}
}
#if defined(CONFIG_PALMAS_POWER)
+__weak void board_mmc_poweron_ldo(uint voltage)
+{
+ palmas_mmc1_poweron_ldo(LDO1_VOLTAGE, LDO1_CTRL, voltage);
+}
+
void vmmc_pbias_config(uint voltage)
{
u32 value = 0;
- struct vcores_data const *vcores = *omap_vcores;
value = readl((*ctrl)->control_pbias);
value &= ~SDCARD_PWRDNZ;
value &= ~SDCARD_BIAS_PWRDNZ;
writel(value, (*ctrl)->control_pbias);
- if (vcores->core.pmic->i2c_slave_addr == 0x60) {
- if (voltage == LDO_VOLT_3V0)
- voltage = 0x19;
- else if (voltage == LDO_VOLT_1V8)
- voltage = 0xa;
- lp873x_mmc1_poweron_ldo(voltage);
- } else {
- palmas_mmc1_poweron_ldo(voltage);
- }
+ board_mmc_poweron_ldo(voltage);
value = readl((*ctrl)->control_pbias);
value |= SDCARD_BIAS_PWRDNZ;
*regs = dra_ddr3_ext_phy_ctrl_const_base_666MHz;
*size = ARRAY_SIZE(dra_ddr3_ext_phy_ctrl_const_base_666MHz);
break;
+ case DRA762_ES1_0:
case DRA722_ES2_0:
+ case DRA722_ES2_1:
*regs = dra_ddr3_ext_phy_ctrl_const_base_666MHz_es2;
*size = ARRAY_SIZE(dra_ddr3_ext_phy_ctrl_const_base_666MHz_es2);
break;
*iterations = sizeof(omap5_bug_00339_regs)/
sizeof(omap5_bug_00339_regs[0]);
break;
+ case DRA762_ES1_0:
case DRA752_ES1_0:
case DRA752_ES1_1:
case DRA752_ES2_0:
case DRA722_ES1_0:
case DRA722_ES2_0:
+ case DRA722_ES2_1:
bug_00339_regs_ptr = dra_bug_00339_regs;
*iterations = sizeof(dra_bug_00339_regs)/
sizeof(dra_bug_00339_regs[0]);
if ((hdr->magic != OPTEE_MAGIC) ||
(hdr->version != OPTEE_VERSION) ||
- (hdr->init_load_addr_hi != 0) ||
- (hdr->init_load_addr_lo < (sec_mem_start + sizeof(struct optee_header))) ||
- (tee_file_size > size) ||
- ((hdr->init_load_addr_lo + tee_file_size - 1) >
- (sec_mem_start + size - 1))) {
- printf("Error in TEE header. Check load address and sizes\n");
+ (tee_file_size > size)) {
+ printf("Error in TEE header. Check firewall and TEE sizes\n");
unmap_sysmem(hdr);
return CMD_RET_FAILURE;
}
#include <clk.h>
#include <dm.h>
#include <ram.h>
+#include <syscon.h>
#include <asm/io.h>
#include <asm/arch/clock.h>
#include <asm/arch/periph.h>
CON_IOMUX_UART2SEL_MASK,
CON_IOMUX_UART2SEL_21 << CON_IOMUX_UART2SEL_SHIFT);
+ /*
+ * The integrated macphy is enabled by default, disable it
+ * for saving power consuming.
+ */
+ rk_clrsetreg(&grf->macphy_con[0],
+ MACPHY_CFG_ENABLE_MASK,
+ 0 << MACPHY_CFG_ENABLE_SHIFT);
+
return 0;
}
return 0;
}
#endif
+
+#if defined(CONFIG_USB_FUNCTION_FASTBOOT)
+int fb_set_reboot_flag(void)
+{
+ struct rk322x_grf *grf;
+
+ printf("Setting reboot to fastboot flag ...\n");
+ grf = syscon_get_first_range(ROCKCHIP_SYSCON_GRF);
+ /* Set boot mode to fastboot */
+ writel(BOOT_FASTBOOT, &grf->os_reg[0]);
+
+ return 0;
+}
+#endif
2GB DDR3. Expansion connectors provide access to I2C, SPI, UART,
GPIOs and display interface.
+config TARGET_VYASA_RK3288
+ bool "Vyasa-RK3288"
+ select BOARD_LATE_INIT
+ help
+ Vyasa is a RK3288-based development board with 2 USB ports,
+ HDMI, VGA, micro-SD card, audio, WiFi and Gigabit Ethernet, It
+ also includes on-board eMMC and 2GB of SDRAM. Expansion connectors
+ provide access to display pins, I2C, SPI, UART and GPIOs.
+
config TARGET_ROCK2
bool "Radxa Rock 2"
select BOARD_LATE_INIT
config SPL_SERIAL_SUPPORT
default y
+source "board/amarula/vyasa-rk3288/Kconfig"
+
source "board/chipspark/popmetal_rk3288/Kconfig"
source "board/firefly/firefly-rk3288/Kconfig"
*/
#include <common.h>
-#include <debug_uart.h>
-#include <dm.h>
-#include <ram.h>
-#include <spl.h>
-#include <asm/gpio.h>
-#include <asm/io.h>
#include <asm/arch/clock.h>
+#include <asm/arch/grf_rk3399.h>
#include <asm/arch/hardware.h>
#include <asm/arch/periph.h>
-#include <asm/arch/sdram.h>
-#include <asm/arch/timer.h>
+#include <asm/io.h>
+#include <debug_uart.h>
+#include <dm.h>
#include <dm/pinctrl.h>
-#include <power/regulator.h>
+#include <ram.h>
+#include <spl.h>
+#include <syscon.h>
DECLARE_GLOBAL_DATA_PTR;
void board_debug_uart_init(void)
{
-#include <asm/arch/grf_rk3399.h>
#define GRF_BASE 0xff770000
struct rk3399_grf_regs * const grf = (void *)GRF_BASE;
#endif
}
-#define GRF_EMMCCORE_CON11 0xff77f02c
-#define SGRF_DDR_RGN_CON16 0xff330040
-#define SGRF_SLV_SECURE_CON4 0xff33e3d0
void board_init_f(ulong dummy)
{
struct udevice *pinctrl;
struct udevice *dev;
+ struct rk3399_pmusgrf_regs *sgrf;
+ struct rk3399_grf_regs *grf;
int ret;
#define EARLY_UART
printascii("U-Boot SPL board init");
#endif
- /* Emmc clock generator: disable the clock multipilier */
- rk_clrreg(GRF_EMMCCORE_CON11, 0x0ff);
-
ret = spl_early_init();
if (ret) {
debug("spl_early_init() failed: %d\n", ret);
* driver, which tries to DMA from/to the stack (likely)
* located in this range.
*/
- rk_clrsetreg(SGRF_DDR_RGN_CON16, 0x1FF, 0);
- rk_clrreg(SGRF_SLV_SECURE_CON4, 0x2000);
+ sgrf = syscon_get_first_range(ROCKCHIP_SYSCON_PMUSGRF);
+ rk_clrsetreg(&sgrf->ddr_rgn_con[16], 0x1ff, 0);
+ rk_clrreg(&sgrf->slv_secure_con4, 0x2000);
+
+ /* eMMC clock generator: disable the clock multipilier */
+ grf = syscon_get_first_range(ROCKCHIP_SYSCON_GRF);
+ rk_clrreg(&grf->emmccore_con[11], 0x0ff);
secure_timer_init();
int ret;
ret = regmap_init_mem_platdata(dev, dtplat->reg,
- ARRAY_SIZE(dtplat->reg) / 4,
+ ARRAY_SIZE(dtplat->reg) / 2,
&plat->map);
if (ret)
return ret;
config->name = ofnode_get_name(node);
- for (subnode = ofnode_first_subnode(node);
- ofnode_valid(subnode);
- subnode = ofnode_next_subnode(subnode)) {
+ ofnode_for_each_subnode(subnode, node) {
struct tegra_xusb_padctl_group *group;
int err;
return err;
}
- for (subnode = ofnode_first_subnode(node);
- ofnode_valid(subnode);
- subnode = ofnode_next_subnode(subnode)) {
+ ofnode_for_each_subnode(subnode, node) {
struct tegra_xusb_padctl_config *config = &padctl->config;
debug("%s: subnode=%s\n", __func__, ofnode_get_name(subnode));
choice
prompt "UniPhier SoC select"
- default ARCH_UNIPHIER_PRO4
+ default ARCH_UNIPHIER_V8_MULTI
config ARCH_UNIPHIER_LD4_SLD8
bool "UniPhier LD4/sLD8 SoCs"
select ARCH_UNIPHIER_32BIT
-config ARCH_UNIPHIER_PRO4
- bool "UniPhier Pro4 SoC"
- select ARCH_UNIPHIER_32BIT
-
-config ARCH_UNIPHIER_PRO5_PXS2_LD6B
- bool "UniPhier Pro5/PXs2/LD6b SoCs"
+config ARCH_UNIPHIER_V7_MULTI
+ bool "UniPhier Pro4/Pro5/PXs2/LD6b SoCs"
select ARCH_UNIPHIER_32BIT
config ARCH_UNIPHIER_V8_MULTI
depends on ARCH_UNIPHIER_LD4_SLD8
default y
+config ARCH_UNIPHIER_PRO4
+ bool "Enable UniPhier Pro4 SoC support"
+ depends on ARCH_UNIPHIER_V7_MULTI
+ default y
+
config ARCH_UNIPHIER_PRO5
bool "Enable UniPhier Pro5 SoC support"
- depends on ARCH_UNIPHIER_PRO5_PXS2_LD6B
+ depends on ARCH_UNIPHIER_V7_MULTI
default y
config ARCH_UNIPHIER_PXS2
bool "Enable UniPhier Pxs2 SoC support"
- depends on ARCH_UNIPHIER_PRO5_PXS2_LD6B
+ depends on ARCH_UNIPHIER_V7_MULTI
default y
config ARCH_UNIPHIER_LD6B
bool "Enable UniPhier LD6b SoC support"
- depends on ARCH_UNIPHIER_PRO5_PXS2_LD6B
+ depends on ARCH_UNIPHIER_V7_MULTI
default y
config ARCH_UNIPHIER_LD11
int ch;
tmp = readl(SC_CLKCTRL4);
- tmp |= SC_CLKCTRL4_MIO | SC_CLKCTRL4_STDMAC;
+ tmp |= BIT(10) | BIT(8); /* MIO, STDMAC */
writel(tmp, SC_CLKCTRL4);
for (ch = 0; ch < 3; ch++) {
* SPDX-License-Identifier: GPL-2.0+
*/
+#include <linux/bitops.h>
#include <linux/io.h>
#include "../init.h"
+#include "../sc64-regs.h"
#define SDCTRL_EMMC_HW_RESET 0x59810280
void uniphier_ld20_clk_init(void)
{
+ u32 tmp;
+
+ tmp = readl(SC_RSTCTRL6);
+ tmp |= BIT(8); /* Mali */
+ writel(tmp, SC_RSTCTRL6);
+
+ tmp = readl(SC_CLKCTRL6);
+ tmp |= BIT(8); /* Mali */
+ writel(tmp, SC_CLKCTRL6);
+
/* TODO: use "mmc-pwrseq-emmc" */
writel(1, SDCTRL_EMMC_HW_RESET);
}
* SPDX-License-Identifier: GPL-2.0+
*/
+#include <linux/bitops.h>
#include <linux/io.h>
#include "../init.h"
+#include "../sc64-regs.h"
#define SDCTRL_EMMC_HW_RESET 0x59810280
void uniphier_pxs3_clk_init(void)
{
+ u32 tmp;
+
+ tmp = readl(SC_RSTCTRL6);
+ tmp |= BIT(8); /* Mali */
+ writel(tmp, SC_RSTCTRL6);
+
+ tmp = readl(SC_CLKCTRL6);
+ tmp |= BIT(8); /* Mali */
+ writel(tmp, SC_CLKCTRL6);
+
/* TODO: use "mmc-pwrseq-emmc" */
writel(1, SDCTRL_EMMC_HW_RESET);
}
#define SC_RSTCTRL (SC_BASE_ADDR | 0x2000)
#define SC_RSTCTRL3 (SC_BASE_ADDR | 0x2008)
#define SC_RSTCTRL4 (SC_BASE_ADDR | 0x200c)
-#define SC_RSTCTRL4_ETHER (1 << 6)
-#define SC_RSTCTRL4_NAND (1 << 0)
#define SC_RSTCTRL5 (SC_BASE_ADDR | 0x2010)
#define SC_RSTCTRL6 (SC_BASE_ADDR | 0x2014)
#define SC_RSTCTRL7 (SC_BASE_ADDR | 0x2018)
-#define SC_RSTCTRL7_UMCSB (1 << 16)
-#define SC_RSTCTRL7_UMCA2 (1 << 10)
-#define SC_RSTCTRL7_UMCA1 (1 << 9)
-#define SC_RSTCTRL7_UMCA0 (1 << 8)
-#define SC_RSTCTRL7_UMC32 (1 << 2)
-#define SC_RSTCTRL7_UMC31 (1 << 1)
-#define SC_RSTCTRL7_UMC30 (1 << 0)
#define SC_CLKCTRL (SC_BASE_ADDR | 0x2100)
#define SC_CLKCTRL3 (SC_BASE_ADDR | 0x2108)
#define SC_CLKCTRL4 (SC_BASE_ADDR | 0x210c)
-#define SC_CLKCTRL4_MIO (1 << 10)
-#define SC_CLKCTRL4_STDMAC (1 << 8)
-#define SC_CLKCTRL4_PERI (1 << 7)
-#define SC_CLKCTRL4_ETHER (1 << 6)
-#define SC_CLKCTRL4_NAND (1 << 0)
#define SC_CLKCTRL5 (SC_BASE_ADDR | 0x2110)
#define SC_CLKCTRL6 (SC_BASE_ADDR | 0x2114)
#define SC_CLKCTRL7 (SC_BASE_ADDR | 0x2118)
-#define SC_CLKCTRL7_UMCSB (1 << 16)
-#define SC_CLKCTRL7_UMC32 (1 << 2)
-#define SC_CLKCTRL7_UMC31 (1 << 1)
-#define SC_CLKCTRL7_UMC30 (1 << 0)
#define SC_CA72_GEARST (SC_BASE_ADDR | 0x8000)
#define SC_CA72_GEARSET (SC_BASE_ADDR | 0x8004)
/* set IVIC, vector size: 4 bytes, base: 0x0 */
mtsr $r0, $ivb
/*
- * MMU_CTL NTC0 Cacheable/Write-Back
+ * MMU_CTL NTC0 Non-cacheable
*/
+ li $r0, ~0x6
+ mfsr $r1, $mr0
+ and $r1, $r1, $r0
+ mtsr $r1, $mr0
+
li $r0, ~0x3
mfsr $r1, $mr8
and $r1, $r1, $r0
mtsr $r1, $mr8
#if (!defined(CONFIG_SYS_ICACHE_OFF) || !defined(CONFIG_SYS_DCACHE_OFF))
+/*
+ * MMU_CTL NTC0 Cacheable/Write-Back
+ */
li $r0, 0x4
mfsr $r1, $mr0
or $r1, $r1, $r0
mtsr $r1, $mr0
#endif
+#ifndef CONFIG_SYS_DCACHE_OFF
+#ifdef CONFIG_ARCH_MAP_SYSMEM
+/*
+ * MMU_CTL NTC1 Non-cacheable
+ */
+ li $r0, ~0x18
+ mfsr $r1, $mr0
+ and $r1, $r1, $r0
+ mtsr $r1, $mr0
+/*
+ * MMU_CTL NTM1 mapping for partition 0
+ */
+ li $r0, ~0x6000
+ mfsr $r1, $mr0
+ and $r1, $r1, $r0
+ mtsr $r1, $mr0
+#endif
+#endif
+
#if !defined(CONFIG_SYS_ICACHE_OFF)
li $r0, 0x1
mfsr $r1, $mr8
aliases {
uart0 = &serial0;
ethernet0 = &mac0;
+ spi0 = &spi;
} ;
chosen {
reg = <0x00000000 0x40000000>;
};
+ spiclk: virt_100mhz {
+ #clock-cells = <0>;
+ compatible = "fixed-clock";
+ clock-frequency = <100000000>;
+ };
+
cpus {
#address-cells = <1>;
#size-cells = <0>;
device-width = <1>;
};
+ spi: spi@f0b00000 {
+ compatible = "andestech,atcspi200";
+ reg = <0xf0b00000 0x1000>;
+ #address-cells = <1>;
+ #size-cells = <0>;
+ num-cs = <1>;
+ clocks = <&spiclk>;
+ interrupts = <3 4>;
+ flash@0 {
+ compatible = "spi-flash";
+ spi-max-frequency = <50000000>;
+ reg = <0>;
+ spi-cpol;
+ spi-cpha;
+ };
+ };
};
#ifndef NDS32_BOOTM_H
#define NDS32_BOOTM_H
+#include <asm/setup.h>
+
extern void udc_disconnect(void);
#if defined(CONFIG_SETUP_MEMORY_TAGS) || \
#ifndef __ASM_NDS_DMA_MAPPING_H
#define __ASM_NDS_DMA_MAPPING_H
-enum dma_data_direction {
- DMA_BIDIRECTIONAL = 0,
- DMA_TO_DEVICE = 1,
- DMA_FROM_DEVICE = 2,
-};
+#include <linux/dma-direction.h>
static void *dma_alloc_coherent(size_t len, unsigned long *handle)
{
#define MAP_WRBACK (0)
#define MAP_WRTHROUGH (0)
+#ifdef CONFIG_ARCH_MAP_SYSMEM
+static inline void *map_sysmem(phys_addr_t paddr, unsigned long len)
+{
+ if(paddr <PHYS_SDRAM_0_SIZE + PHYS_SDRAM_1_SIZE)
+ paddr = paddr | 0x40000000;
+ return (void *)(uintptr_t)paddr;
+}
+
+static inline void *unmap_sysmem(const void *vaddr)
+{
+ phys_addr_t paddr = (phys_addr_t)vaddr;
+ paddr = paddr & ~0x40000000;
+ return (void *)(uintptr_t)paddr;
+}
+
+static inline phys_addr_t map_to_sysmem(const void *ptr)
+{
+ return (phys_addr_t)(uintptr_t)ptr;
+}
+#endif
+
static inline void *
map_physmem(phys_addr_t paddr, unsigned long len, unsigned long flags)
{
#include <u-boot/zlib.h>
#include <asm/byteorder.h>
#include <asm/bootm.h>
-#include <asm/setup.h>
DECLARE_GLOBAL_DATA_PTR;
default "sandbox_spl" if SANDBOX_SPL
default "sandbox" if !SANDBOX_SPL
+choice
+ prompt "Run sandbox on 32/64-bit host"
+ default SANDBOX_64BIT
+ help
+ Sandbox can be built on 32-bit and 64-bit hosts.
+ The default is to build on a 64-bit host and run
+ on a 64-bit host. If you want to run sandbox on
+ a 32-bit host, change it here.
+
+config SANDBOX_32BIT
+ bool "32-bit host"
+
+config SANDBOX_64BIT
+ bool "64-bit host"
+
+endchoice
+
+config SANDBOX_BITS_PER_LONG
+ int
+ default 32 if SANDBOX_32BIT
+ default 64 if SANDBOX_64BIT
+
endmenu
compatible = "denx,u-boot-fdt-test";
};
- clk_fixed: clk-fixed {
- compatible = "fixed-clock";
- #clock-cells = <0>;
- clock-frequency = <1234>;
+ clocks {
+ clk_fixed: clk-fixed {
+ compatible = "fixed-clock";
+ #clock-cells = <0>;
+ clock-frequency = <1234>;
+ };
};
clk_sandbox: clk-sbox {
# platform-specific options below
source "arch/x86/cpu/baytrail/Kconfig"
+source "arch/x86/cpu/braswell/Kconfig"
source "arch/x86/cpu/broadwell/Kconfig"
source "arch/x86/cpu/coreboot/Kconfig"
source "arch/x86/cpu/ivybridge/Kconfig"
address of 0xfff90000 indicates that the image will be put at offset
0x90000 from the beginning of a 1MB flash device.
+config HAVE_VBT
+ bool "Add a Video BIOS Table (VBT) image"
+ depends on HAVE_FSP
+ help
+ Select this option if you have a Video BIOS Table (VBT) image that
+ you would like to add to your ROM. This is normally required if you
+ are using an Intel FSP firmware that is complaint with spec 1.1 or
+ later to initialize the integrated graphics device (IGD).
+
+ Video BIOS Table, or VBT, provides platform and board specific
+ configuration information to the driver that is not discoverable
+ or available through other means. By other means the most used
+ method here is to read EDID table from the attached monitor, over
+ Display Data Channel (DDC) using two pin I2C serial interface. VBT
+ configuration is related to display hardware and is available via
+ the ACPI OpRegion or, on older systems, in the PCI ROM (Option ROM).
+
+config VBT_FILE
+ string "Video BIOS Table (VBT) image filename"
+ depends on HAVE_VBT
+ default "vbt.bin"
+ help
+ The filename of the file to use as Video BIOS Table (VBT) image
+ in the board directory.
+
+config VBT_ADDR
+ hex "Video BIOS Table (VBT) image location"
+ depends on HAVE_VBT
+ default 0xfff90000
+ help
+ The location of Video BIOS Table (VBT) image in the SPI flash. For
+ example, base address of 0xfff90000 indicates that the image will
+ be put at offset 0x90000 from the beginning of a 1MB flash device.
+
+config VIDEO_FSP
+ bool "Enable FSP framebuffer driver support"
+ depends on HAVE_VBT && DM_VIDEO
+ help
+ Turn on this option to enable a framebuffer driver when U-Boot is
+ using Video BIOS Table (VBT) image for FSP firmware to initialize
+ the integrated graphics device.
+
config ROM_TABLE_ADDR
hex
default 0xf0000
obj-y += intel_common/
obj-$(CONFIG_INTEL_BAYTRAIL) += baytrail/
+obj-$(CONFIG_INTEL_BRASWELL) += braswell/
obj-$(CONFIG_INTEL_BROADWELL) += broadwell/
obj-$(CONFIG_SYS_COREBOOT) += coreboot/
obj-$(CONFIG_EFI_APP) += efi/
--- /dev/null
+#
+# Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+config INTEL_BRASWELL
+ bool
+ select HAVE_FSP
+ select ARCH_MISC_INIT
+ select CPU_INTEL_TURBO_NOT_PACKAGE_SCOPED
+ imply HAVE_INTEL_ME
+ imply HAVE_VBT
+ imply ENABLE_MRC_CACHE
+ imply ENV_IS_IN_SPI_FLASH
+ imply AHCI_PCI
+ imply ICH_SPI
+ imply MMC
+ imply MMC_PCI
+ imply MMC_SDHCI
+ imply MMC_SDHCI_SDMA
+ imply SCSI
+ imply SPI_FLASH
+ imply SYS_NS16550
+ imply USB
+ imply USB_XHCI_HCD
+ imply VIDEO_FSP
+
+if INTEL_BRASWELL
+
+config FSP_ADDR
+ hex
+ default 0xfff20000
+
+config FSP_LOCKDOWN_SPI
+ bool
+ default y
+
+endif
--- /dev/null
+#
+# Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += braswell.o cpu.o early_uart.o fsp_configs.o
--- /dev/null
+/*
+ * Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
+#include <asm/mrccache.h>
+#include <asm/post.h>
+
+int arch_cpu_init(void)
+{
+ post_code(POST_CPU_INIT);
+
+ return x86_cpu_init_f();
+}
+
+int arch_misc_init(void)
+{
+#ifdef CONFIG_ENABLE_MRC_CACHE
+ /*
+ * We intend not to check any return value here, as even MRC cache
+ * is not saved successfully, it is not a severe error that will
+ * prevent system from continuing to boot.
+ */
+ mrccache_save();
+#endif
+
+ return 0;
+}
+
+void reset_cpu(ulong addr)
+{
+ /* cold reset */
+ x86_full_reset();
+}
--- /dev/null
+/*
+ * Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ *
+ * Derived from arch/x86/cpu/baytrail/cpu.c
+ */
+
+#include <common.h>
+#include <cpu.h>
+#include <dm.h>
+#include <asm/cpu.h>
+#include <asm/cpu_x86.h>
+#include <asm/io.h>
+#include <asm/lapic.h>
+#include <asm/msr.h>
+#include <asm/turbo.h>
+
+static const unsigned int braswell_bus_freq_table[] = {
+ 83333333,
+ 100000000,
+ 133333333,
+ 116666666,
+ 80000000,
+ 93333333,
+ 90000000,
+ 88900000,
+ 87500000
+};
+
+static unsigned int braswell_bus_freq(void)
+{
+ msr_t clk_info = msr_read(MSR_BSEL_CR_OVERCLOCK_CONTROL);
+
+ if ((clk_info.lo & 0xf) < (ARRAY_SIZE(braswell_bus_freq_table)))
+ return braswell_bus_freq_table[clk_info.lo & 0xf];
+
+ return 0;
+}
+
+static unsigned long braswell_tsc_freq(void)
+{
+ msr_t platform_info;
+ ulong bclk = braswell_bus_freq();
+
+ if (!bclk)
+ return 0;
+
+ platform_info = msr_read(MSR_PLATFORM_INFO);
+
+ return bclk * ((platform_info.lo >> 8) & 0xff);
+}
+
+static int braswell_get_info(struct udevice *dev, struct cpu_info *info)
+{
+ info->cpu_freq = braswell_tsc_freq();
+ info->features = (1 << CPU_FEAT_L1_CACHE) | (1 << CPU_FEAT_MMU);
+
+ return 0;
+}
+
+static int braswell_get_count(struct udevice *dev)
+{
+ int ecx = 0;
+
+ /*
+ * Use the algorithm described in Intel 64 and IA-32 Architectures
+ * Software Developer's Manual Volume 3 (3A, 3B & 3C): System
+ * Programming Guide, Jan-2015. Section 8.9.2: Hierarchical Mapping
+ * of CPUID Extended Topology Leaf.
+ */
+ while (1) {
+ struct cpuid_result leaf_b;
+
+ leaf_b = cpuid_ext(0xb, ecx);
+
+ /*
+ * Braswell doesn't have hyperthreading so just determine the
+ * number of cores by from level type (ecx[15:8] == * 2)
+ */
+ if ((leaf_b.ecx & 0xff00) == 0x0200)
+ return leaf_b.ebx & 0xffff;
+
+ ecx++;
+ }
+
+ return 0;
+}
+
+static void braswell_set_max_freq(void)
+{
+ msr_t perf_ctl;
+ msr_t msr;
+
+ /* Enable speed step */
+ msr = msr_read(MSR_IA32_MISC_ENABLES);
+ msr.lo |= (1 << 16);
+ msr_write(MSR_IA32_MISC_ENABLES, msr);
+
+ /* Enable Burst Mode */
+ msr = msr_read(MSR_IA32_MISC_ENABLES);
+ msr.hi = 0;
+ msr_write(MSR_IA32_MISC_ENABLES, msr);
+
+ /*
+ * Set guaranteed ratio [21:16] from IACORE_TURBO_RATIOS to
+ * bits [15:8] of the PERF_CTL
+ */
+ msr = msr_read(MSR_IACORE_TURBO_RATIOS);
+ perf_ctl.lo = (msr.lo & 0x3f0000) >> 8;
+
+ /*
+ * Set guaranteed vid [22:16] from IACORE_TURBO_VIDS to
+ * bits [7:0] of the PERF_CTL
+ */
+ msr = msr_read(MSR_IACORE_TURBO_VIDS);
+ perf_ctl.lo |= (msr.lo & 0x7f0000) >> 16;
+
+ perf_ctl.hi = 0;
+ msr_write(MSR_IA32_PERF_CTL, perf_ctl);
+}
+
+static int braswell_probe(struct udevice *dev)
+{
+ debug("Init Braswell core\n");
+
+ /*
+ * On Braswell the turbo disable bit is actually scoped at the
+ * building-block level, not package. For non-BSP cores that are
+ * within a building block, enable turbo. The cores within the BSP's
+ * building block will just see it already enabled and move on.
+ */
+ if (lapicid())
+ turbo_enable();
+
+ /* Dynamic L2 shrink enable and threshold, clear SINGLE_PCTL bit 11 */
+ msr_clrsetbits_64(MSR_PMG_CST_CONFIG_CONTROL, 0x3f080f, 0xe0008),
+ msr_clrsetbits_64(MSR_POWER_MISC,
+ ENABLE_ULFM_AUTOCM_MASK | ENABLE_INDP_AUTOCM_MASK, 0);
+
+ /* Disable C1E */
+ msr_clrsetbits_64(MSR_POWER_CTL, 2, 0);
+ msr_setbits_64(MSR_POWER_MISC, 0x44);
+
+ /* Set this core to max frequency ratio */
+ braswell_set_max_freq();
+
+ return 0;
+}
+
+static const struct udevice_id braswell_ids[] = {
+ { .compatible = "intel,braswell-cpu" },
+ { }
+};
+
+static const struct cpu_ops braswell_ops = {
+ .get_desc = cpu_x86_get_desc,
+ .get_info = braswell_get_info,
+ .get_count = braswell_get_count,
+ .get_vendor = cpu_x86_get_vendor,
+};
+
+U_BOOT_DRIVER(cpu_x86_braswell_drv) = {
+ .name = "cpu_x86_braswell",
+ .id = UCLASS_CPU,
+ .of_match = braswell_ids,
+ .bind = cpu_x86_bind,
+ .probe = braswell_probe,
+ .ops = &braswell_ops,
+};
--- /dev/null
+/*
+ * Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
+#include <asm/io.h>
+
+#define PCI_DEV_CONFIG(segbus, dev, fn) ( \
+ (((segbus) & 0xfff) << 20) | \
+ (((dev) & 0x1f) << 15) | \
+ (((fn) & 0x07) << 12))
+
+/* Platform Controller Unit */
+#define LPC_DEV 0x1f
+#define LPC_FUNC 0
+
+/* Enable UART */
+#define UART_CONT 0x80
+
+/* UART PAD definitions */
+#define UART_RXD_COMMUITY 1
+#define UART_TXD_COMMUITY 1
+#define UART_RXD_FAMILY 4
+#define UART_TXD_FAMILY 4
+#define UART_RXD_PAD 2
+#define UART_TXD_PAD 7
+#define UART_RXD_FUNC 3
+#define UART_TXD_FUNC 3
+
+/* IO Memory */
+#define IO_BASE_ADDRESS 0xfed80000
+
+static inline uint32_t gpio_pconf0(int community, int family, int pad)
+{
+ return IO_BASE_ADDRESS + community * 0x8000 + 0x4400 +
+ family * 0x400 + pad * 8;
+}
+
+static void gpio_select_func(int community, int family, int pad, int func)
+{
+ uint32_t pconf0_addr = gpio_pconf0(community, family, pad);
+
+ clrsetbits_le32(pconf0_addr, 0xf << 16, func << 16);
+}
+
+static void x86_pci_write_config32(int dev, unsigned int where, u32 value)
+{
+ unsigned long addr;
+
+ addr = CONFIG_PCIE_ECAM_BASE | dev | (where & ~3);
+ writel(value, addr);
+}
+
+/* This can be called after memory-mapped PCI is working */
+int setup_internal_uart(int enable)
+{
+ /* Enable or disable the legacy UART hardware */
+ x86_pci_write_config32(PCI_DEV_CONFIG(0, LPC_DEV, LPC_FUNC), UART_CONT,
+ enable);
+
+ /* All done for the disable part, so just return */
+ if (!enable)
+ return 0;
+
+ /*
+ * Set up the pads to the UART function. This allows the signals to
+ * leave the chip
+ */
+ gpio_select_func(UART_RXD_COMMUITY, UART_RXD_FAMILY,
+ UART_RXD_PAD, UART_RXD_FUNC);
+ gpio_select_func(UART_TXD_COMMUITY, UART_TXD_FAMILY,
+ UART_TXD_PAD, UART_TXD_FUNC);
+
+ return 0;
+}
+
+void board_debug_uart_init(void)
+{
+ setup_internal_uart(1);
+}
--- /dev/null
+/*
+ * Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
+#include <fdtdec.h>
+#include <asm/fsp/fsp_support.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+/**
+ * Override the FSP's Azalia configuration data
+ *
+ * @azalia: pointer to be updated to point to a ROM address where Azalia
+ * configuration data is stored
+ */
+__weak void update_fsp_azalia_configs(struct azalia_config **azalia)
+{
+ *azalia = NULL;
+}
+
+/**
+ * Override the FSP's GPIO configuration data
+ *
+ * @family: pointer to be updated to point to a ROM address where GPIO
+ * family configuration data is stored
+ * @pad: pointer to be updated to point to a ROM address where GPIO
+ * pad configuration data is stored
+ */
+__weak void update_fsp_gpio_configs(struct gpio_family **family,
+ struct gpio_pad **pad)
+{
+ *family = NULL;
+ *pad = NULL;
+}
+
+/**
+ * Override the FSP's configuration data.
+ * If the device tree does not specify an integer setting, use the default
+ * provided in Intel's Braswell release FSP/BraswellFsp.bsf file.
+ */
+void update_fsp_configs(struct fsp_config_data *config,
+ struct fspinit_rtbuf *rt_buf)
+{
+ struct upd_region *fsp_upd = &config->fsp_upd;
+ struct memory_upd *memory_upd = &fsp_upd->memory_upd;
+ struct silicon_upd *silicon_upd = &fsp_upd->silicon_upd;
+ const void *blob = gd->fdt_blob;
+ int node;
+
+ /* Initialize runtime buffer for fsp_init() */
+ rt_buf->common.stack_top = config->common.stack_top - 32;
+ rt_buf->common.boot_mode = config->common.boot_mode;
+ rt_buf->common.upd_data = &config->fsp_upd;
+
+ node = fdt_node_offset_by_compatible(blob, 0, "intel,braswell-fsp");
+ if (node < 0) {
+ debug("%s: Cannot find FSP node\n", __func__);
+ return;
+ }
+
+ node = fdt_node_offset_by_compatible(blob, node,
+ "intel,braswell-fsp-memory");
+ if (node < 0) {
+ debug("%s: Cannot find FSP memory node\n", __func__);
+ return;
+ }
+
+ /* Override memory UPD contents */
+ memory_upd->mrc_init_tseg_size = fdtdec_get_int(blob, node,
+ "fsp,mrc-init-tseg-size", MRC_INIT_TSEG_SIZE_4MB);
+ memory_upd->mrc_init_mmio_size = fdtdec_get_int(blob, node,
+ "fsp,mrc-init-mmio-size", MRC_INIT_MMIO_SIZE_2048MB);
+ memory_upd->mrc_init_spd_addr1 = fdtdec_get_int(blob, node,
+ "fsp,mrc-init-spd-addr1", 0xa0);
+ memory_upd->mrc_init_spd_addr2 = fdtdec_get_int(blob, node,
+ "fsp,mrc-init-spd-addr2", 0xa2);
+ memory_upd->igd_dvmt50_pre_alloc = fdtdec_get_int(blob, node,
+ "fsp,igd-dvmt50-pre-alloc", IGD_DVMT50_PRE_ALLOC_32MB);
+ memory_upd->aperture_size = fdtdec_get_int(blob, node,
+ "fsp,aperture-size", APERTURE_SIZE_256MB);
+ memory_upd->gtt_size = fdtdec_get_int(blob, node,
+ "fsp,gtt-size", GTT_SIZE_1MB);
+ memory_upd->legacy_seg_decode = fdtdec_get_bool(blob, node,
+ "fsp,legacy-seg-decode");
+ memory_upd->enable_dvfs = fdtdec_get_bool(blob, node,
+ "fsp,enable-dvfs");
+ memory_upd->memory_type = fdtdec_get_int(blob, node,
+ "fsp,memory-type", DRAM_TYPE_DDR3);
+ memory_upd->enable_ca_mirror = fdtdec_get_bool(blob, node,
+ "fsp,enable-ca-mirror");
+
+ node = fdt_node_offset_by_compatible(blob, node,
+ "intel,braswell-fsp-silicon");
+ if (node < 0) {
+ debug("%s: Cannot find FSP silicon node\n", __func__);
+ return;
+ }
+
+ /* Override silicon UPD contents */
+ silicon_upd->sdcard_mode = fdtdec_get_int(blob, node,
+ "fsp,sdcard-mode", SDCARD_MODE_PCI);
+ silicon_upd->enable_hsuart0 = fdtdec_get_bool(blob, node,
+ "fsp,enable-hsuart0");
+ silicon_upd->enable_hsuart1 = fdtdec_get_bool(blob, node,
+ "fsp,enable-hsuart1");
+ silicon_upd->enable_azalia = fdtdec_get_bool(blob, node,
+ "fsp,enable-azalia");
+ if (silicon_upd->enable_azalia)
+ update_fsp_azalia_configs(&silicon_upd->azalia_cfg_ptr);
+ silicon_upd->enable_sata = fdtdec_get_bool(blob, node,
+ "fsp,enable-sata");
+ silicon_upd->enable_xhci = fdtdec_get_bool(blob, node,
+ "fsp,enable-xhci");
+ silicon_upd->lpe_mode = fdtdec_get_int(blob, node,
+ "fsp,lpe-mode", LPE_MODE_PCI);
+ silicon_upd->enable_dma0 = fdtdec_get_bool(blob, node,
+ "fsp,enable-dma0");
+ silicon_upd->enable_dma1 = fdtdec_get_bool(blob, node,
+ "fsp,enable-dma1");
+ silicon_upd->enable_i2c0 = fdtdec_get_bool(blob, node,
+ "fsp,enable-i2c0");
+ silicon_upd->enable_i2c1 = fdtdec_get_bool(blob, node,
+ "fsp,enable-i2c1");
+ silicon_upd->enable_i2c2 = fdtdec_get_bool(blob, node,
+ "fsp,enable-i2c2");
+ silicon_upd->enable_i2c3 = fdtdec_get_bool(blob, node,
+ "fsp,enable-i2c3");
+ silicon_upd->enable_i2c4 = fdtdec_get_bool(blob, node,
+ "fsp,enable-i2c4");
+ silicon_upd->enable_i2c5 = fdtdec_get_bool(blob, node,
+ "fsp,enable-i2c5");
+ silicon_upd->enable_i2c6 = fdtdec_get_bool(blob, node,
+ "fsp,enable-i2c6");
+#ifdef CONFIG_HAVE_VBT
+ silicon_upd->graphics_config_ptr = CONFIG_VBT_ADDR;
+#endif
+ update_fsp_gpio_configs(&silicon_upd->gpio_familiy_ptr,
+ &silicon_upd->gpio_pad_ptr);
+ /*
+ * For Braswell B0 stepping, disable_punit_pwr_config must be set to 1
+ * otherwise it just hangs in fsp_init().
+ */
+ if (gd->arch.x86_mask == 2)
+ silicon_upd->disable_punit_pwr_config = 1;
+ silicon_upd->emmc_mode = fdtdec_get_int(blob, node,
+ "fsp,emmc-mode", EMMC_MODE_PCI);
+ silicon_upd->sata_speed = fdtdec_get_int(blob, node,
+ "fsp,sata-speed", SATA_SPEED_GEN3);
+ silicon_upd->pmic_i2c_bus = fdtdec_get_int(blob, node,
+ "fsp,pmic-i2c-bus", 0);
+ silicon_upd->enable_isp = fdtdec_get_bool(blob, node,
+ "fsp,enable-isp");
+ silicon_upd->isp_pci_dev_config = fdtdec_get_int(blob, node,
+ "fsp,isp-pci-dev-config", ISP_PCI_DEV_CONFIG_2);
+ silicon_upd->turbo_mode = fdtdec_get_bool(blob, node,
+ "fsp,turbo-mode");
+ silicon_upd->pnp_settings = fdtdec_get_int(blob, node,
+ "fsp,pnp-settings", PNP_SETTING_POWER_AND_PERF);
+ silicon_upd->sd_detect_chk = fdtdec_get_bool(blob, node,
+ "fsp,sd-detect-chk");
+}
return bridge_id | stepping;
}
-/*
- * Reserve everything between A segment and 1MB:
- *
- * 0xa0000 - 0xbffff: legacy VGA
- * 0xc0000 - 0xcffff: VGA OPROM (needed by kernel)
- * 0xe0000 - 0xfffff: SeaBIOS, if used, otherwise DMI
- */
-static const int legacy_hole_base_k = 0xa0000 / 1024;
-static const int legacy_hole_size_k = 384;
-
static int get_pcie_bar(struct udevice *dev, u32 *base, u32 *len)
{
u32 pciexbar_reg;
#
dtb-y += bayleybay.dtb \
+ cherryhill.dtb \
chromebook_link.dtb \
chromebox_panther.dtb \
chromebook_samus.dtb \
--- /dev/null
+/*
+ * Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+/dts-v1/;
+
+#include <asm/arch-braswell/fsp/fsp_configs.h>
+#include <dt-bindings/interrupt-router/intel-irq.h>
+
+/include/ "skeleton.dtsi"
+/include/ "serial.dtsi"
+/include/ "rtc.dtsi"
+/include/ "tsc_timer.dtsi"
+
+/ {
+ model = "Intel Cherry Hill";
+ compatible = "intel,cherryhill", "intel,braswell";
+
+ aliases {
+ serial0 = &serial;
+ spi0 = &spi;
+ };
+
+ config {
+ silent_console = <0>;
+ };
+
+ chosen {
+ stdout-path = "/serial";
+ };
+
+ cpus {
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+ cpu@0 {
+ device_type = "cpu";
+ compatible = "intel,braswell-cpu";
+ reg = <0>;
+ intel,apic-id = <0>;
+ };
+
+ cpu@1 {
+ device_type = "cpu";
+ compatible = "intel,braswell-cpu";
+ reg = <1>;
+ intel,apic-id = <2>;
+ };
+
+ cpu@2 {
+ device_type = "cpu";
+ compatible = "intel,braswell-cpu";
+ reg = <2>;
+ intel,apic-id = <4>;
+ };
+
+ cpu@3 {
+ device_type = "cpu";
+ compatible = "intel,braswell-cpu";
+ reg = <3>;
+ intel,apic-id = <6>;
+ };
+ };
+
+ pci {
+ compatible = "pci-x86";
+ #address-cells = <3>;
+ #size-cells = <2>;
+ u-boot,dm-pre-reloc;
+ ranges = <0x02000000 0x0 0x80000000 0x80000000 0 0x40000000
+ 0x42000000 0x0 0xc0000000 0xc0000000 0 0x20000000
+ 0x01000000 0x0 0x2000 0x2000 0 0xe000>;
+
+ pch@1f,0 {
+ reg = <0x0000f800 0 0 0 0>;
+ compatible = "intel,pch9";
+ #address-cells = <1>;
+ #size-cells = <1>;
+
+ irq-router {
+ compatible = "intel,irq-router";
+ intel,pirq-config = "ibase";
+ intel,ibase-offset = <0x50>;
+ intel,pirq-link = <8 8>;
+ intel,pirq-mask = <0xdee0>;
+ intel,pirq-routing = <
+ /* Braswell PCI devices */
+ PCI_BDF(0, 2, 0) INTA PIRQA
+ PCI_BDF(0, 3, 0) INTA PIRQA
+ PCI_BDF(0, 11, 0) INTA PIRQA
+ PCI_BDF(0, 16, 0) INTA PIRQA
+ PCI_BDF(0, 17, 0) INTA PIRQA
+ PCI_BDF(0, 18, 0) INTA PIRQA
+ PCI_BDF(0, 19, 0) INTA PIRQA
+ PCI_BDF(0, 20, 0) INTA PIRQA
+ PCI_BDF(0, 21, 0) INTA PIRQA
+ PCI_BDF(0, 24, 0) INTA PIRQA
+ PCI_BDF(0, 24, 1) INTC PIRQC
+ PCI_BDF(0, 24, 2) INTD PIRQD
+ PCI_BDF(0, 24, 3) INTB PIRQB
+ PCI_BDF(0, 24, 4) INTA PIRQA
+ PCI_BDF(0, 24, 5) INTC PIRQC
+ PCI_BDF(0, 24, 6) INTD PIRQD
+ PCI_BDF(0, 24, 7) INTB PIRQB
+ PCI_BDF(0, 26, 0) INTA PIRQA
+ PCI_BDF(0, 27, 0) INTA PIRQA
+ PCI_BDF(0, 28, 0) INTA PIRQA
+ PCI_BDF(0, 28, 1) INTB PIRQB
+ PCI_BDF(0, 28, 2) INTC PIRQC
+ PCI_BDF(0, 28, 3) INTD PIRQD
+ PCI_BDF(0, 30, 0) INTA PIRQA
+ PCI_BDF(0, 30, 3) INTA PIRQA
+ PCI_BDF(0, 30, 4) INTA PIRQA
+ PCI_BDF(0, 31, 0) INTB PIRQB
+ PCI_BDF(0, 31, 3) INTB PIRQB
+
+ /*
+ * PCIe root ports downstream
+ * interrupts
+ */
+ PCI_BDF(1, 0, 0) INTA PIRQA
+ PCI_BDF(1, 0, 0) INTB PIRQB
+ PCI_BDF(1, 0, 0) INTC PIRQC
+ PCI_BDF(1, 0, 0) INTD PIRQD
+ PCI_BDF(2, 0, 0) INTA PIRQB
+ PCI_BDF(2, 0, 0) INTB PIRQC
+ PCI_BDF(2, 0, 0) INTC PIRQD
+ PCI_BDF(2, 0, 0) INTD PIRQA
+ PCI_BDF(3, 0, 0) INTA PIRQC
+ PCI_BDF(3, 0, 0) INTB PIRQD
+ PCI_BDF(3, 0, 0) INTC PIRQA
+ PCI_BDF(3, 0, 0) INTD PIRQB
+ PCI_BDF(4, 0, 0) INTA PIRQD
+ PCI_BDF(4, 0, 0) INTB PIRQA
+ PCI_BDF(4, 0, 0) INTC PIRQB
+ PCI_BDF(4, 0, 0) INTD PIRQC
+ >;
+ };
+
+ spi: spi {
+ #address-cells = <1>;
+ #size-cells = <0>;
+ compatible = "intel,ich9-spi";
+
+ spi-flash@0 {
+ #address-cells = <1>;
+ #size-cells = <1>;
+ reg = <0>;
+ compatible = "macronix,mx25u6435f", "spi-flash";
+ memory-map = <0xff800000 0x00800000>;
+ rw-mrc-cache {
+ label = "rw-mrc-cache";
+ reg = <0x005e0000 0x00010000>;
+ };
+ };
+ };
+ };
+ };
+
+ fsp {
+ compatible = "intel,braswell-fsp";
+ fsp,memory-upd {
+ compatible = "intel,braswell-fsp-memory";
+ fsp,mrc-init-tseg-size = <MRC_INIT_TSEG_SIZE_4MB>;
+ fsp,mrc-init-mmio-size = <MRC_INIT_MMIO_SIZE_2048MB>;
+ fsp,mrc-init-spd-addr1 = <0xa0>;
+ fsp,mrc-init-spd-addr2 = <0xa2>;
+ fsp,igd-dvmt50-pre-alloc = <IGD_DVMT50_PRE_ALLOC_32MB>;
+ fsp,aperture-size = <APERTURE_SIZE_256MB>;
+ fsp,gtt-size = <GTT_SIZE_1MB>;
+ fsp,enable-dvfs;
+ fsp,memory-type = <DRAM_TYPE_DDR3>;
+ };
+ fsp,silicon-upd {
+ compatible = "intel,braswell-fsp-silicon";
+ fsp,sdcard-mode = <SDCARD_MODE_PCI>;
+ fsp,enable-hsuart1;
+ fsp,enable-sata;
+ fsp,enable-xhci;
+ fsp,lpe-mode = <LPE_MODE_PCI>;
+ fsp,enable-dma0;
+ fsp,enable-dma1;
+ fsp,enable-i2c0;
+ fsp,enable-i2c1;
+ fsp,enable-i2c2;
+ fsp,enable-i2c3;
+ fsp,enable-i2c4;
+ fsp,enable-i2c5;
+ fsp,enable-i2c6;
+ fsp,emmc-mode = <EMMC_MODE_PCI>;
+ fsp,sata-speed = <SATA_SPEED_GEN3>;
+ fsp,pmic-i2c-bus = <0>;
+ fsp,enable-isp;
+ fsp,isp-pci-dev-config = <ISP_PCI_DEV_CONFIG_2>;
+ fsp,turbo-mode;
+ fsp,pnp-settings = <PNP_SETTING_POWER_AND_PERF>;
+ fsp,sd-detect-chk;
+ };
+ };
+
+ microcode {
+ update@0 {
+#include "microcode/m01406c2220.dtsi"
+ };
+ update@1 {
+#include "microcode/m01406c3363.dtsi"
+ };
+ update@2 {
+#include "microcode/m01406c440a.dtsi"
+ };
+ };
+
+};
--- /dev/null
+/*
+ * ---
+ * This is a device tree fragment. Use #include to add these properties to a
+ * node.
+ *
+ * Date:
+ */
+
+compatible = "intel,microcode";
+intel,header-version = <1>;
+intel,update-revision = <0x220>;
+intel,date-code = <0x1142015>;
+intel,processor-signature = <0x406c2>;
+intel,checksum = <0x21a02433>;
+intel,loader-revision = <1>;
+intel,processor-flags = <0x1>;
+
+/* The first 48-bytes are the public header which repeats the above data */
+data = <
+ 0x01000000 0x20020000 0x15201401 0xc2060400
+ 0x3324a021 0x01000000 0x01000000 0xd00b0100
+ 0x000c0100 0x00000000 0x00000000 0x00000000
+ 0x00000000 0xa1000000 0x01000200 0x20020000
+ 0x00000000 0x00000000 0x14011520 0xe1420000
+ 0x01000000 0xc2060400 0x00000000 0x00000000
+ 0x00000000 0x00000000 0x00000000 0x00000000
+ 0x00000000 0x00000000 0x00000000 0x00000000
+ 0x00000000 0x00000000 0x00000000 0x00000000
+ 0x17ce1b3d 0x74fb4eb5 0x2f27d633 0x14060671
+ 0x6b4d57b0 0xaa1ad327 0x6022d785 0x5fa91aad
+ 0xef44e4c3 0xf91d4958 0x230883b7 0x7382ab6e
+ 0xf14324ef 0xf94c28d7 0x9131d196 0xebcf2faa
+ 0xc049cb37 0xd1577abd 0x5edbe45a 0x17e1ca1e
+ 0xbe9a92c3 0x1c8e1790 0xb3c08b8a 0xca799851
+ 0x3f2a8c92 0x1b7e15d8 0x1f44ecb2 0xaeda1838
+ 0x0ace8669 0xae9d497e 0x424c680c 0x21b3a3ed
+ 0xd924acfe 0xddc126a2 0x26363596 0x21cd999b
+ 0x193f9df3 0x037d1953 0xf97a3dc5 0x4c94ad7e
+ 0x98b360f0 0xeb90461f 0x438e6d2e 0x30851a0e
+ 0xfd623681 0x18782d3c 0x702938c5 0x462df0dd
+ 0xf7d67cc1 0x161076a0 0xf06e5db3 0xd861a76b
+ 0xa40b06bc 0xed37c69b 0x2b25f98b 0x2b67887d
+ 0xbf0131b5 0x571b7c25 0x34eb3752 0x992e406e
+ 0x031ba8e7 0xccfc5b1d 0x33f487e9 0xeccc3098
+ 0xe452737b 0xb38cc286 0x817bc58f 0x852a7fde
+ 0xcbcd1b19 0xab11894a 0xa1f278d7 0x360829c9
+ 0x11000000 0x67a4c01f 0x3f863221 0xf4b82fe4
+ 0xf464c489 0x36b8d097 0xfa9ab17e 0x9bccf4e6
+ 0x9f836ffd 0x647c263c 0x03c7bede 0xf20172e9
+ 0x8bd6e772 0x8621aca5 0xbdf4eade 0xac27528a
+ 0xb562042b 0x23d0304c 0x964558ea 0xb5c03c97
+ 0xe0bd0467 0xe8a6d50a 0xe5d4b902 0xb164253e
+ 0x8306959c 0xd1cd57d5 0xf7d1d586 0x4eb5152b
+ 0xf488caca 0xaa47f32f 0x366676b3 0x96b27e47
+ 0xc8f4fdda 0x9f6854bb 0x89921eb5 0xbb7fe720
+ 0x59709d36 0x01a5880c 0xee526518 0x586055d6
+ 0xfac43c7a 0x7ce6da62 0x301be309 0xf48c261e
+ 0xdd7d6b27 0x6783c81a 0xf9151492 0x92a57bd1
+ 0x94607cfc 0xd70700ed 0x18136034 0x16d26594
+ 0xeadd5210 0xf2fa345f 0xba7e9be4 0x548b8db1
+ 0xd9d81a27 0xb361bae3 0xe2c5c033 0xd34d0488
+ 0x07925cd2 0xaf57a669 0xf7f634b6 0x58408a6f
+ 0x2c8b4c46 0xe71e9a53 0x65bc42be 0x77db4bf1
+ 0x4c839bf5 0xd6dbc641 0x4fbf6fef 0x6b71eb34
+ 0x808898b9 0x7ecea348 0x608a1d5e 0x81225ea2
+ 0x487a3d44 0xc2443f3e 0xff580d9a 0xefd915b1
+ 0xe867848b 0x73c48e53 0x84d211d4 0x77a45152
+ 0x146f95fc 0x088157cb 0x9661fa65 0x6b998636
+ 0xd8d8748d 0x16bb32b5 0x3eb3be6a 0x29a2aa6e
+ 0xcbd08ca6 0x74317789 0xe9e8f1ea 0x7c555679
+ 0xd7f19a7b 0xcead34da 0xe584403c 0xbfae80e2
+ 0x4e9a7a52 0x0eefa659 0x00eb4354 0xe6f0cf6d
+ 0x69374a24 0xdb59e992 0x2d4a51eb 0x4cdb46ca
+ 0x03613349 0x24d146ab 0x1cca9b58 0x6db9989a
+ 0x534dedef 0xab90d703 0x75a8331b 0xec865e24
+ 0x8415faf2 0x851022e8 0x4ee795cd 0x7af2b1a8
+ 0x65ec359a 0x0a16c7d8 0x76d51f56 0x7e1e10ec
+ 0xbab138d8 0x0d69389e 0x0a50fc3a 0x7746732d
+ 0x98f692d2 0xf97254ff 0xd31185d4 0x1a7104b4
+ 0x1382fbff 0x4660f775 0x187ed97f 0x880cb07a
+ 0x566157d2 0x1ec58c53 0xc1fff1e3 0x30cde9d6
+ 0x933993eb 0x365c5318 0x30a5df05 0x91744f18
+ 0xac99ae3a 0xacb5cc81 0x6af06584 0xcbfcb5dc
+ 0x10e3cdd1 0x8d31a621 0x36851aa8 0x718c1d81
+ 0x4a574346 0x70fb532a 0xc97b70e3 0x4e61d0d1
+ 0x9e5e2563 0xd86da543 0xb6c07a52 0x417e59f2
+ 0xee4c48d6 0xca38e12e 0x9188a73d 0x6624af3c
+ 0x62a1d33f 0xcf8afe37 0xd0173727 0x378470e3
+ 0x35067424 0x0775c48c 0x7cab8eb0 0xfeb84d6c
+ 0x187fbb8c 0xe2cab639 0xedfc3f59 0xbace1601
+ 0xbc2535e9 0x74b7d16e 0xbc351b20 0xf4a41f6f
+ 0x996a0c11 0xec1e5d06 0x8dae9d53 0xe92082ce
+ 0x8bfb678f 0xb4ae58e4 0xbecbf0de 0xfdbd1df9
+ 0x0cf5ffe2 0x362f4eb5 0x90cc7b4e 0x813a329d
+ 0xd6b5c9fc 0x19dea293 0x4bc51036 0x10570f4b
+ 0xd904d7b6 0x348da9e4 0x2fd7a32d 0xfc79b430
+ 0x0b9c30dd 0xe0289eb6 0xc6ef55ef 0xfae73fe2
+ 0xbd4a65d1 0x463804e8 0xc1d6c9d9 0xa94cea7a
+ 0xa23f954d 0x2d76b17e 0x5851be88 0xcf829e51
+ 0xe6c5c2a6 0x94f9772b 0xe6c22b45 0x3a6cb78f
+ 0xb7f13d24 0x4c45d9f3 0xa8c115ec 0x3156aea1
+ 0x8076cddc 0x191032dc 0xc7e3c577 0x04ff6b8e
+ 0x4b048a66 0x61645b1e 0x49c1f2da 0x428518b8
+ 0x5270837d 0x25aee268 0xa0d1bbaa 0x7c2b6cdc
+ 0x95251e7d 0x47eb8833 0x4b274412 0x9df92f4d
+ 0xc9165ad1 0x928605dd 0xed0ca542 0x59899c98
+ 0xbe0a0295 0xaa9cc0ae 0x1a03db3f 0x00adb561
+ 0xecfda91f 0xc4ba7882 0x38ec4207 0x55bc0855
+ 0xced7c3e9 0x3e783ec0 0xe5085047 0x120366cb
+ 0x56161c5b 0x2cda197c 0x4b855ae0 0xdebd39ef
+ 0xe077f8c5 0x831346fc 0x119cf5bc 0x1f856af0
+ 0x71be6741 0x94946c60 0x320ff78f 0xb24955bf
+ 0xcaeaa452 0xcf673cad 0x83dee256 0xc1ca89d6
+ 0x9a99b0c8 0x0506634a 0x43825141 0x93b261da
+ 0x110fc9e7 0x1fff550f 0xff64e483 0x8ab28045
+ 0xdc8a20e1 0x64f0125b 0x02b35cc1 0xae9a45a0
+ 0x1ba02775 0x4ca78c43 0x00492b04 0xca28b4c6
+ 0x2986d389 0x277de0ac 0x115a59fc 0x03c55ef6
+ 0xeb2d37d4 0x8f6091a6 0x5589954b 0xd6a76cfe
+ 0x52f90c11 0xc880f0aa 0x674e9009 0xd1cf458a
+ 0xcbf97f4e 0x8b1a7a5e 0x52aca0bb 0x7562f0bb
+ 0x27351468 0xf1ec9a0e 0x8300fefd 0x34358af1
+ 0x1c33380b 0x29c5eae7 0x8ad5fedc 0x1fd8288b
+ 0xb87a0fa8 0x0ed4830d 0x034a4536 0x9479d467
+ 0xe6d0aafe 0x941d6d97 0x4e3b0d6f 0x057a6b8d
+ 0x62cc8d8f 0xdcc01061 0x13217f10 0x6e5ddaa3
+ 0xd9ebc375 0x1d54b3f2 0xed12af1c 0x48ff2428
+ 0xe65ca319 0x6c699865 0x2d101e05 0xd28a495a
+ 0x8bd948d8 0xa0b503b1 0x447158c1 0x662e03d2
+ 0x0150fb5f 0x55288aa2 0x3e74f75d 0x5c111c33
+ 0x802fe4c9 0x4d90bb9b 0x8b0a9377 0x9c215cdd
+ 0x75602db3 0xf990e4a2 0xb41c8f6a 0x8a044b56
+ 0x56214d80 0x95a51d94 0x957256ad 0xbc4bcfa2
+ 0x82325276 0xe03231d9 0xb30b1dba 0x62974827
+ 0x75c311f5 0x73081c86 0x6caedca9 0xfd65a79c
+ 0x8a0a51b1 0x69f69434 0x1ec5f9ac 0x4379a9b8
+ 0x25ee82e2 0xb8de5ce8 0x4dddef11 0x1f287f04
+ 0x3438be45 0xa9f615c0 0xc4b4885d 0x4463603c
+ 0x17a51586 0xb941900e 0x55f6b1fc 0x827adf71
+ 0x2be9133f 0x98fcacec 0x7db549ff 0xf2172b4d
+ 0x389a1ee7 0x28b04504 0x091e5333 0x9b3d5323
+ 0xab29ddb5 0xf67748c3 0x838b320d 0xc2cd0deb
+ 0x40b166b2 0xafe61841 0xbb915676 0x060235f5
+ 0x68cbea2d 0xa7e4415c 0x9b67dcf9 0xd40da108
+ 0xa6f53ede 0x395f766c 0xfd2b8267 0x84cbdd78
+ 0x5dea645a 0x188cc462 0x471782c5 0x716f5c34
+ 0x12b64f0a 0xc4e5d287 0x008469cf 0x74023871
+ 0x280e14e8 0xa4cd2075 0xd6741c46 0x39228423
+ 0x1d33880d 0x0fe5a8b2 0x09a0d784 0x43f282e0
+ 0xe1fb9193 0x0c1d6d00 0x4618bb7e 0xa2346753
+ 0xac82efb0 0x50c97aed 0x5e08b6da 0x1540d8d4
+ 0xaaefaa57 0x0ae69a20 0x304ca040 0xc8e6ba4d
+ 0x43b79690 0x5955117f 0x31e602b0 0xc650acbb
+ 0x74fd2f1c 0xaa0ae398 0x83f8a97b 0xe2b2c874
+ 0xfcb179bd 0xe2c54c23 0x1fa7d92f 0xfbafaf63
+ 0xcc581a06 0x6a75505b 0xb1a35d63 0x9830e0e5
+ 0xfdb7327f 0xa806c4db 0x0f146d1a 0xe848b52e
+ 0x468a29bc 0x29ea4c2c 0x35ab0da3 0x0e81c222
+ 0x86567478 0x1e8e8296 0x565fbd9a 0x37028b11
+ 0xa477474d 0x97d39513 0x037b58a7 0x9c5b00eb
+ 0xa72d199f 0xa7435b0d 0x2504561d 0xabb17c92
+ 0xd4266638 0xcad2a41f 0x80527d70 0xcf6ced92
+ 0x66f2fb6b 0xb8c51f64 0xb6afb635 0x32ad2078
+ 0x117eab32 0x9a1304a1 0x0291a57a 0xea6bc7b5
+ 0x0bfaa751 0x1e07d4af 0x2e09ea27 0x84dee2e8
+ 0x6fe9e22e 0x3fc0a825 0xd34a7310 0x2e91e3ac
+ 0x72c41ca4 0xe054f5c9 0xd41cf7a3 0x1451734b
+ 0xf22c4d4c 0x6ff1ddbb 0x8322a1a2 0x169f77ca
+ 0x8d948d3a 0x6ea0b0f5 0x59688992 0xefe70251
+ 0x77dbfe62 0xcb4a6d76 0x765fa85c 0xb971b63f
+ 0xf0991fe5 0xd3adf7c6 0xcd96811b 0xa49d5613
+ 0x68263809 0xd97dd8e5 0xa402e5d0 0x4ee84e99
+ 0x5458f785 0xdd7c356a 0x8ab65316 0xfed03904
+ 0xa416a959 0x6507893a 0xc0efcfa7 0xf3f6c537
+ 0x1f36838f 0x4abd214a 0x3e7f80c0 0x8f806c17
+ 0xac8a7c48 0x92a9d45e 0xb923b35a 0x2e0dc4b5
+ 0x38033851 0x469df49b 0x9493372a 0xe9615673
+ 0x90d6cf75 0xc161311b 0xb58a84c3 0x03a5f485
+ 0x59aaf326 0xb7332227 0xeed2691b 0xe0151563
+ 0x90724196 0xda93f7bc 0x2928e854 0xeada9582
+ 0x650c43e6 0xaef61786 0xfbedec7c 0xc31eb425
+ 0x950719a9 0xa12c80d7 0x4024b15f 0xa9f81f31
+ 0xd1381f85 0xb7287ed7 0x5fb7679e 0x1933734c
+ 0x5ede6770 0x1ed50817 0x9b9e3605 0xf9432e65
+ 0xe5537255 0xa2216726 0x5a58b595 0x197b2a54
+ 0x36050287 0xebedeb87 0x362d920c 0x7b0a455f
+ 0x84cae44d 0xa8862ae6 0x85a968fe 0x30e77406
+ 0x36a4a4a3 0x94f0f11d 0xe94b7c54 0x6ca83879
+ 0x2612a797 0xcb794096 0xe865a5c1 0x2a0be103
+ 0x02e32985 0x476f701c 0xc71ba33d 0x4a028652
+ 0x9876c689 0x1c3a44fa 0x26ac3755 0xaff3b350
+ 0xadeb81ea 0xbdbd1786 0x3476e7a0 0xec4f3ad6
+ 0xe0c48b27 0xa79b18ee 0x97f483ab 0xc99f011d
+ 0x7e2eed90 0x7dc8b1db 0xa0cc452a 0xf6b42f90
+ 0x75fad6db 0x9c5bdca7 0x5a01f8a8 0x6014dd88
+ 0x0a01294c 0xbc5cea06 0xd503b150 0x6060d7fa
+ 0xe873dbf2 0xa325211c 0x933c6ef8 0x7ea9b2ee
+ 0x394f6927 0x56531513 0x99f0662d 0x86554329
+ 0xf3251f93 0x54c593f1 0xb5255252 0x26a7b639
+ 0x23ab770b 0xa6acb21a 0xe599b798 0xb95143f5
+ 0x8c806fe3 0x19978f7e 0xb4d37f44 0xd187235f
+ 0xe4bed961 0x6fa2eed6 0x9fc0c7b2 0xf893b168
+ 0x87b33909 0x78cd7ca9 0xd3f90120 0x0c807273
+ 0x26f6418b 0xd31524d0 0x714c9c3f 0x07eb97a8
+ 0x858bdb17 0x5a588101 0x5018f39c 0x74dda380
+ 0x8fbf21c5 0x3093a68e 0x8ff3944f 0x066a211a
+ 0x420f71b2 0x526a827d 0xfa801547 0x5087ccc4
+ 0xf137741e 0x0938d58f 0x3c69fe23 0x017c35e8
+ 0x029ded16 0x036dc14c 0x770c59a2 0xd4670464
+ 0x0c8d2275 0x45a911c5 0x6cb60b1f 0x3891138d
+ 0xc45336a4 0x1e86ff67 0xa4b0e708 0x2c273632
+ 0x43fbe16c 0x2faf304e 0x128c5e42 0x4ade9c9b
+ 0xcba7d896 0xb9b05e25 0x5b74586c 0x3b45d774
+ 0xdf6e3eb3 0xcbdba34d 0x5ccf0d19 0x9b957144
+ 0x6cf3b84b 0xa5277ebd 0x829c027f 0x99bc4440
+ 0xcb9ce49b 0x28b9b4de 0x34e39214 0x9602a143
+ 0xd4845084 0x4d728f3a 0x4dcf4ceb 0x5db80b4d
+ 0x430f332f 0xf543c3ae 0xbea87cc6 0x6fc493ff
+ 0xfebd2c95 0x943f53c9 0x3065b316 0x11dc1899
+ 0xb7d68855 0x97bab122 0x2184f556 0xf387584b
+ 0x320563c9 0xb1a979a7 0x5b97dfd6 0xa255e382
+ 0xa7c0df72 0xc5049fd4 0xe474318e 0x7a0c9551
+ 0xfc34bdd1 0xe05dfec4 0x6c9a6135 0x3c203dad
+ 0xc87836ce 0x9d1217db 0x05b32a0e 0x5b5f121e
+ 0xb3fc7b09 0xa1258607 0xd20cd31e 0x7f24127e
+ 0x7e949924 0x48b96fff 0x60ee0f36 0x4e3956ed
+ 0x20296c84 0xc0b681d1 0x69de56a4 0xf9db1b9e
+ 0xdf841982 0xaca92b54 0x3436bb28 0xf7863b65
+ 0x4e5b4b1f 0x95ab63db 0x6334f3d4 0x871d46a8
+ 0x9753f01a 0x7e10b06b 0xc376ab1c 0x260cdf6d
+ 0x5eab64f9 0x327a9132 0x7709826a 0x23f10786
+ 0x44c6dba1 0x871f6de4 0xe8ccf7eb 0x8bb6dc59
+ 0x69eff83f 0xaef98db0 0x1cd5adb5 0x1ed2ca86
+ 0x5a472d16 0xbae909f4 0x8f8afb96 0x75692a34
+ 0x8a2899e6 0x2bf5b8f5 0x13391132 0xcd42c72b
+ 0xf7e48375 0x7477eb4f 0xdd7419c3 0x84a9d605
+ 0x2199b9c5 0xd6b13bc8 0xd20d40bd 0x424820d5
+ 0x1d40eed0 0x018a94cc 0x40b544ed 0x24739fb3
+ 0x327d9b77 0x86a2f928 0xd186ea76 0xb6228cb3
+ 0x439078ab 0xae2f9ede 0xf974f961 0xaa3f8a1e
+ 0xd48adf10 0x1c8a527f 0x7b70c677 0x119c057c
+ 0x9ca80ada 0x8a61351e 0x232a873f 0x1c126055
+ 0x65737648 0xd9d9924f 0xceec4cdb 0x5278cd97
+ 0x91e7610a 0x87cb310c 0xe8a04120 0xfec45da1
+ 0xc8126edd 0x6ee53cb5 0x98bdeb53 0x899eef0a
+ 0xc89fbe7b 0x16433847 0xe42a19cd 0xda597cba
+ 0xb70e5b99 0x4fb5d111 0xe7a8ab60 0x7e6551d5
+ 0x353ee9d3 0xe84fab3b 0xe35e702c 0x2ad32196
+ 0x4f9e3670 0xc66429d0 0x64ce22e8 0x11e4ba05
+ 0x55224a16 0x76ec7d37 0x02e62543 0x04b1cde7
+ 0xbd3dc8ee 0xb6ad0b0b 0xb6fcf7d7 0x7881c834
+ 0x3df0cc71 0x537bb7e8 0x78f8df73 0x9923b5c0
+ 0x6a8d2f3c 0x97443072 0x8bb39bc1 0x5786d5c6
+ 0x48546b94 0x2577d9b9 0xb4f66e56 0x8abe2099
+ 0xfe70136c 0x17691bdf 0x88723f20 0x2870a189
+ 0x6427b158 0xb2684324 0x6a9bea0c 0xabf8f95c
+ 0x8bcfc326 0x92eadb59 0xf2b8a4cc 0x2b9ae0d7
+ 0x3c1a539a 0xbf09a99c 0x83d4cd4f 0x14eb71a3
+ 0x9cf5b5fb 0x7023baeb 0x2546c235 0xc7df8897
+ 0x57bc6c5a 0xa588fb47 0x1222afe6 0xe7a23d55
+ 0x031d9638 0x27128d7c 0x1dcc8710 0x6d596692
+ 0x1cff2406 0x768cd7f7 0xccbb7e3d 0x951a2e2f
+ 0xd8c57dc6 0xfa455cfb 0x4629547d 0xf2157f97
+ 0xb182bd3c 0x566937bc 0xe527b342 0x466f0a4b
+ 0xd66b033a 0xc0ae8a6f 0xf949ee60 0x9a7fc09c
+ 0xd1d021b1 0x4a6283f3 0x104ab7c6 0xa84b7fe9
+ 0x59af67a3 0x7942c3f9 0xa59f5b30 0x911f8e99
+ 0xca33c891 0xf8c0b06c 0x5a93223b 0x28e7f4ca
+ 0x08ff0a04 0x33f5debd 0x680656df 0x68dc25c1
+ 0x6d7dd94e 0x6bfec19a 0x14b0904c 0xd335e438
+ 0x01548614 0x0f7950d0 0x1cb1ebd0 0x18e8128e
+ 0x82b26a7d 0x59c0d22f 0x37c01e61 0xc0ff5ae7
+ 0xf600e19a 0xe08b235e 0x21558e16 0xe5af4c73
+ 0xaac86b6b 0x41871253 0x8cbaa7bc 0x61f54b66
+ 0x24303f07 0xaa03bb7c 0x90bb6890 0x90a847ba
+ 0x1f0a2952 0x3cd4c8d5 0x8f15edb8 0x46d70e56
+ 0x0e3bb3a1 0xc5502c65 0xd8ad6939 0xa5e878bf
+ 0x90e081fb 0x77f2b0bf 0x560b9d43 0x2fc8c14e
+ 0x94b1e73b 0x5b631347 0x3aa84950 0xe0d176fd
+ 0x0a786edd 0x844591b2 0x10c3d0e2 0xc4d98f1d
+ 0xe0a0e814 0xb2e0716f 0x940e9f05 0x186aeb7e
+ 0xba7a807e 0x57deb62c 0x7b265a97 0x01fd2f94
+ 0xd48e5d97 0x733d35ec 0x9a9d42dc 0xb6deedbd
+ 0xfa1a3fd1 0xc3d5f76a 0xbe067709 0x08fde17d
+ 0xdf9ecd32 0x2c674cee 0xbe20548d 0xf72ed4f3
+ 0x151e9726 0x77749b6c 0xddc2842d 0x640a0309
+ 0xf3b76855 0xf835db9e 0xf60dc4c9 0x0406794a
+ 0x29036a63 0xa8d17980 0x7564b51d 0xf9863792
+ 0x862f3df4 0x11139a39 0x77d1ce24 0x2669e680
+ 0xba710cfe 0x5836286e 0xd091dc30 0x185e7f5e
+ 0x94b61754 0x1498803d 0x8b1938bf 0x10e14a86
+ 0x52d03ce0 0x4a2e1dc7 0xc46e8732 0x3bd74fdd
+ 0x8601f3a0 0xe94df719 0x5b3e303a 0x73991fca
+ 0x3e94cb68 0xa189260c 0xe0c41caa 0xb5f4ce3c
+ 0x73aa5d51 0xcf254e72 0x9956a4d4 0xec1dc462
+ 0xc9d8bc09 0x31473e5a 0xb418252a 0x1b4ee56f
+ 0xf87bd290 0x431fbb01 0x0381c88a 0xcf32fbb6
+ 0x8d2957f8 0xc93752bb 0x983c2012 0x81fc1f24
+ 0xc1662206 0x6288cc5d 0x337172e9 0xe3a81a3e
+ 0x6f46ebe8 0x2fd1f276 0x2099a1ed 0x6c6f9e9a
+ 0x63cfcf1f 0x72f26afd 0x7f793c82 0xa7c1c388
+ 0x55152f46 0x3e65bc7f 0xa26cd264 0xe623a0d4
+ 0x0cab83da 0x3dc711d7 0x8d4572ee 0xf5017c41
+ 0x1cade528 0xc4b4978c 0x67d85f89 0x8507cf37
+ 0x1926fac4 0x0f4d8776 0x965166fd 0x81e00306
+ 0xe917c43f 0x27272e12 0x9ec2c54c 0x7b265343
+ 0x8cd58bba 0x7566812e 0xe9f66859 0xb6bec38f
+ 0xf3ee8826 0x60b03f12 0xa6dd812f 0x88f9307d
+ 0xc7c8061e 0xb7c2d198 0x445c3ff9 0xe346d33b
+ 0x68576e7e 0xbbdb20bd 0x1f113435 0xd5968e28
+ 0x8f9f2e07 0x7f5b3a96 0x711be59c 0x7ea8ebd0
+ 0x63c80b97 0x4b662d9d 0x0f02e59a 0x8d128923
+ 0x07e0cf69 0x7318a67c 0x190edc7e 0xcd2c9601
+ 0x53f49be2 0x5f6bf052 0x6bbda8f2 0x1a6331a2
+ 0x9dac0f1c 0x6c5efba8 0x6766161a 0x59494954
+ 0xfb1ed722 0x51005a48 0x05493ed9 0xb8ecb020
+ 0xf304a4d5 0x76944a7a 0x54073b20 0xe25ee0fb
+ 0x20b9619f 0xd25296d0 0xc6510a66 0x9834e366
+ 0x4f315534 0x3b34ee74 0xe73216c4 0xbdf56f95
+ 0xfce1057b 0x2315a5fe 0xeb2a061b 0xfcd4ea01
+ 0x5c6bddc2 0x0275f614 0xb9f9f7d0 0x1f10dd83
+ 0x48d0d8fe 0xccffd762 0x9321a2c8 0x8ff7a89c
+ 0xcf1a10b3 0xb5d2c579 0xad383da9 0xbb95d976
+ 0xf25f9da6 0x3fdb3f63 0xe8fa2d09 0xa2985c42
+ 0x27c6eeb6 0x25151b99 0x76201836 0x75d6362d
+ 0xf7905ab9 0x44126a2f 0xa0713396 0x848bcfb3
+ 0xa84d3466 0x1c0b9e19 0xe61e094f 0x112b9bf0
+ 0x619e22d9 0x03dbef62 0x59859152 0xec368e6b
+ 0xa651aa1f 0x3d66eea0 0xf67ea12f 0x1ba2e0f9
+ 0xedecff56 0xada3d57b 0xfbb21920 0xdf6f2854
+ 0xb3114298 0xa82045fb 0x937479f0 0x9d3b3b4c
+ 0xf26a948d 0x47b83b1f 0x32f02882 0x57a304e3
+ 0x00a6ab5c 0x1254cb74 0xdd115800 0xf32884b2
+ 0x6660b648 0x391661a6 0x5b038cd2 0x2d9c1493
+ 0xc181d5b7 0xcc734a9e 0x7d9d8f29 0xa35cc0fb
+ 0xe9903a5f 0xe646da45 0xb72e3546 0x16154cd3
+ 0x3565634d 0xbd15552f 0xafd6884b 0xd8108f87
+ 0x276f1bed 0x6b06c575 0xf65e35ec 0xfe0592fc
+ 0x0ae81424 0x423094ad 0xe3ad0717 0x9e91e5ac
+ 0x35d70ba2 0xa7c8cdcb 0xc95822e4 0x18777373
+ 0x9ad23679 0x415765c3 0xfb48eb57 0x3356c8ef
+ 0xf1efa441 0x24e7b6a3 0xb0445605 0x2dba7bc3
+ 0x6a76440d 0xd07c1cea 0x20b0d8e7 0xbfe3a37e
+ 0x9678c4dd 0x6d82de29 0x74ab2c66 0x00089f86
+ 0xe6add22d 0xe2889df8 0xedadf4ae 0x19b23cb7
+ 0x183ce9b4 0x77d73586 0x550fa098 0x974a7b9d
+ 0x25115b51 0xdc16ab43 0x616cbe0b 0x7ba015db
+ 0xd28c8bd0 0x074b507a 0xb13510f9 0x4ae4bfb1
+ 0x1ddac74d 0x98f81d84 0x7e2da21d 0xec8d8dde
+ 0xb713eecd 0xe75d0e49 0x55d42c23 0xecf1bf77
+ 0xbed9c1ae 0xbe1acacc 0x6e2b8f23 0x7ccb75b6
+ 0x001b686f 0xc914dfe8 0xa0a9e739 0x73e23c70
+ 0x903e23fa 0x7676979d 0x93ed84f5 0x5624b6e3
+ 0x574f0099 0x49dd6b23 0xa4341324 0xaeb24f83
+ 0x8034f882 0x3ca2b684 0x8e928752 0x8a6ad2c1
+ 0x8b26d97d 0x36814410 0xfe488fb4 0xcb4fe01b
+ 0x5a04e8da 0xfb61ec2a 0xe49d9eef 0x94f7ca44
+ 0x4166f73a 0x701ec6ea 0xce252ff6 0x04694cf3
+ 0x195a89f0 0x2175f03b 0xf395917e 0xe881c885
+ 0xfe159686 0x943e185f 0xb62a8327 0xed5b3540
+ 0x41dd84c9 0x4188c534 0xa73c3c92 0x38406b81
+ 0x7cc88362 0xced41beb 0x5ac6d56a 0xcb07c1f4
+ 0x3a7f14de 0x7d507fd6 0x17569413 0xc8ba1f3b
+ 0xfe57551e 0xbcff6395 0xe956535e 0xf1086750
+ 0x05379ce5 0xd2e013c7 0xe3743d76 0x7ef17c09
+ 0x16a2cdb5 0x5e91e546 0xe0fe9d3b 0xcb056e70
+ 0x1f686ad4 0x42a8c460 0x1666f3fb 0x9c3967a4
+ 0x5e2d882e 0x2e6aee38 0xc81e4ea3 0xed9569e7
+ 0x0cea0a6a 0x8249847b 0x91cf9396 0x2bb3eea8
+ 0xc7731e11 0x7d612f98 0x6b841102 0xad167aac
+ 0xc24bc27d 0xd38029b4 0xe9ccdf55 0x77636545
+ 0xa9928fdf 0x22907957 0x95a9cebe 0x37614f0c
+ 0x839cbf2e 0xbcc5f0ea 0x0fe941c2 0x44557efc
+ 0x04b7e364 0xaf443dc6 0x7cfc7330 0x4f48038f
+ 0x048be991 0x80afdf6f 0x96ceacb1 0xf939ad8d
+ 0x16f93fca 0x448e5e63 0x3825ad75 0x37eee5cd
+ 0xeb6d744e 0xaed3f21a 0xed455624 0xa9a8f6e5
+ 0xbafd945c 0xe4eb4ddf 0xd0dc4d3b 0x56f62531
+ 0xef005820 0x6b65368c 0xe2b2674e 0xd34cf592
+ 0xff62fd2a 0x6ffd6361 0x4b52670d 0xdef62e4f
+ 0xd7c2f9b6 0xbe9ac33f 0xc43fd67e 0x24144699
+ 0xff9bbfdf 0x8c24eb0f 0x45653dc7 0x2ef18a09
+ 0x51e53102 0x6032ac7c 0xef149ac7 0x73dcf922
+ 0xb52d4342 0xf03327e3 0x7a73e3f5 0x1b377d4c
+ 0xde916da3 0x559e414a 0xd10af3f3 0x8c7fee3b
+ 0x36776122 0x4f3207c6 0x1d27e08f 0xa21fbb0f
+ 0xd7c5229d 0xbf4788a4 0xd82a3f93 0x03903b53
+ 0x7f347a83 0xab4071c4 0x0a1ecbb1 0xb1e7d6bf
+ 0x5e828079 0xc019e2c1 0x0ec16bfa 0xac509265
+ 0x17de3777 0x99cfe9ac 0xad478dff 0x06c34fb7
+ 0xda68a0ba 0x9b4b7b6c 0x5b2f93d2 0x104bc05b
+ 0xa89442c3 0x27c3a2e6 0x8d5cc0e3 0x10e6d531
+ 0xc10ea99e 0xeb4fe96c 0x763f38f8 0x81ebddc4
+ 0x506b82fb 0x0b0880a0 0x87577166 0x398a310c
+ 0xba9e9cc4 0xc7f2974a 0xb486646a 0x4cdda979
+ 0x0e94c3dc 0x1964ef22 0xd97a63e5 0x6bca1047
+ 0xd56a9939 0x5bb91696 0xc20562d5 0x66f7dda8
+ 0xdcd24268 0x46d45d8b 0x3d44200f 0xc14319f2
+ 0x5e67ffe3 0x26069d77 0xb725d689 0xda0d0e66
+ 0x77dac019 0x49006c10 0xcb47615f 0x7dd57b9b
+ 0x36a36580 0x7a96b587 0xcc09597e 0x3a2a2bb7
+ 0x1bb88bda 0x845ecb94 0x30652a68 0x4b86fa95
+ 0x714ee97c 0xb9dcc74d 0x2dbbf5bd 0x9b004cdf
+ 0x317b9288 0x9bc26497 0x48c37e55 0xa1b606f7
+ 0x5fcc75a7 0x56286706 0x12a80a33 0x753d756f
+ 0x76043aa0 0x68485471 0x743a3148 0x1fb65fed
+ 0x820b616f 0xc5e7a29d 0xef3b7dae 0xeeb0bc3c
+ 0x5af0af0c 0x22596b27 0x67b89c35 0x9ad4bdc0
+ 0x4ba48492 0xde6bacf0 0xda7db4e0 0x194b5b25
+ 0xb9dd2572 0xa831880e 0x4cc498bf 0x19f82a38
+ 0x1b595c33 0xb104e1e7 0xbb7300bd 0x1aa80628
+ 0xb5f5a93b 0x62bd9398 0x0e44b29c 0x4eb6635b
+ 0x3a95b2da 0x7e5147d0 0x37bd2f57 0xc9da31db
+ 0x56984727 0xf3dcdd5d 0x5a53247c 0xed7d60f1
+ 0x6b852de7 0x50cefb47 0x1ee892ff 0x49dd4b99
+ 0xc6e50db0 0x41cbeec0 0x77e3d8db 0x3806f198
+ 0xf86abbd1 0x6faf3be7 0x31838342 0xb42bfec9
+ 0xf99b603a 0x612ce0ec 0x76512b53 0xab5c35d7
+ 0x8adf788a 0x659c62cf 0x959658c6 0x65671995
+ 0x0699df96 0xa37f6c8c 0x38361808 0xd1cf3052
+ 0x1a936623 0x08e62ea2 0xdde8b2d3 0x5ca766ff
+ 0xd43eadcd 0x55dcfede 0x6a8f1693 0x50c3e623
+ 0x2c2f7aff 0x013a0ef4 0xbe178125 0xede2c59f
+ 0x9430200e 0x335f2b92 0xc702fbc4 0xae049872
+ 0x5c4724da 0x9ba3f4a2 0x82f9bf27 0x6a8b9804
+ 0xe02d6803 0xf62f3e49 0x08dd271e 0xd621f3a4
+ 0xd898f09b 0x0dfe3196 0x0d979ec4 0xdfaf6a3b
+ 0x0ff88167 0xe75e4156 0x1d04e07c 0x85247846
+ 0x4f9e6bb6 0x4696c3de 0xc6e4c54b 0xbba3ad9f
+ 0x79be7de5 0x918cdf32 0x96e7e972 0xad0fce45
+ 0x18ddfc3c 0x704c30a8 0xa510cde0 0x04ddbf57
+ 0x72dac9fb 0x67e10a1f 0x8e2d9311 0xddc9a331
+ 0xbb49ee04 0x475a66c4 0x384e248c 0x0574a573
+ 0xa5e7afac 0xb064b73c 0x22026ef5 0xc556e9e7
+ 0x5390cfd3 0xce544730 0xd2f36326 0x2ff6ea1e
+ 0x9640deb8 0x1db8680c 0xd13f1600 0xb91c9a46
+ 0x045d0ce3 0xe5954466 0x905fc4f5 0xe64f1439
+ 0xa7bdae21 0x02e9dc8d 0x776eb13f 0x41ca6eff
+ 0x74073553 0xff4631a1 0x092048a7 0xc2971cc1
+ 0x599e6bfb 0xee9772b7 0x01e4906e 0x34d833b4
+ 0x7345b8a0 0x06466cef 0xf7c46eb9 0xbaeeb3c5
+ 0xd2117453 0x1ddc8818 0x04cb7263 0x2be9c872
+ 0xcc62bc18 0x136c9191 0x874fe5ca 0xc383ae50
+ 0xb679883a 0x3e1819d9 0x2d008f33 0x2bade1a8
+ 0xb89e6983 0x83c2c04b 0xc5a242f0 0x2814c262
+ 0x3372296c 0xe47a8643 0xee4a3e5c 0xfb51e2da
+ 0x0a624f5d 0xee5ba40b 0x5af412e2 0x4405590b
+ 0xd07f4584 0xed69ec96 0x55dfdb5a 0x41f83ecf
+ 0x2463f7af 0x266943ce 0x259ab0ad 0x65dae624
+ 0x03a9caf8 0xa702a063 0x1be78eac 0x1ab26eae
+ 0x6dd98b4b 0x448e144a 0x5daa692b 0x0ebf8652
+ 0x07c83684 0x40638efb 0xa6618691 0xead4007f
+ 0x7cceba52 0x9d712806 0x92017ff5 0x0b645ffa
+ 0xb908a27d 0x8ed144ea 0xa0a98258 0x6f1828d3
+ 0xc8e8e87d 0xf804f635 0x77849351 0x4edbbdef
+ 0x1375cd94 0x5ccdeb90 0x129783fd 0x4cef7ba2
+ 0xa9e20d3f 0x28a45fae 0x84e866e3 0x5b8e42f9
+ 0x649ae8d2 0x2b878cf5 0x220afb7a 0xa2037752
+ 0x6b4e0536 0x184c53cd 0x65483969 0xb25d4b7b
+ 0x094dde31 0xa0f8fb5a 0x352a48ee 0x431ddccd
+ 0xf83f2014 0x7a34377f 0x1aa432c4 0x8c5727e9
+ 0x42e36e37 0x570ea374 0xb4c4643f 0xa15445c8
+ 0xc6791cac 0xf827045d 0xf1e899fa 0xcd7c7bf0
+ 0xf19a1442 0xe65b96f8 0x2c49b75b 0x0f9a8e06
+ 0x8493333d 0xf120841f 0x7b357e63 0x9942def8
+ 0x32ecf6e5 0x2b7b7af7 0xf744ae93 0x8c04f43f
+ 0x023840aa 0x6d4336db 0xe2514620 0x83596c26
+ 0x2d519cad 0xe8b2c54f 0x30af842a 0x13d8331c
+ 0xee9b610d 0x25c8449f 0xcf654339 0x8690e7a8
+ 0x62f295fd 0xd328114b 0x79dd4e4d 0x8637a5f3
+ 0x31b71fce 0x40f48fee 0xf28f611c 0xa408fd38
+ 0xea4c449e 0x20589721 0xe6a88ba0 0x358852dd
+ 0xb5ee1dc5 0x8b9e6596 0xe51c70d5 0xd3ac891f
+ 0x3e09b78f 0x814b0301 0x8c392bed 0x5fd0351e
+ 0x20481f83 0xbf0fd0a4 0x19cf17a3 0x3bbbdcfc
+ 0xd7e0673a 0xd3a43eed 0xfa1a2862 0xe8b99bbe
+ 0x23f53922 0x35c68711 0x6b175228 0xb59de586
+ 0x3fb571e3 0x62cffd32 0x075402d4 0x65f1eea7
+ 0x2c68469f 0x67f58b84 0xa73e59d5 0x9ead311c
+ 0xf5c71938 0x3d9654f4 0x70481671 0x58b45461
+ 0x3759d4f5 0x376b3871 0x60733242 0x76a498c5
+ 0xe279b81d 0xb43df7dd 0x831117e7 0xc0fbeda9
+ 0x3784c4a7 0xe5f37177 0x8f500d62 0xe99c71e9
+ 0x7a4b3daa 0x9ed0d8b7 0x469aa7c6 0x9d899657
+ 0xb4069f17 0x31a69746 0x6aafee94 0xa14487b6
+ 0x9c00643b 0xe80ada25 0x5214ac22 0xbdb230c5
+ 0x6edfab40 0x01b5f94f 0x9f849d84 0xe93777a5
+ 0x4939d6e2 0xf4fc71ab 0xfa37c156 0xbc70404b
+ 0xfc1ce927 0xf9383d29 0x038d5717 0x4168bb8b
+ 0x71ff37a9 0x5cdd4c2f 0x3b72f3eb 0xfb24e3be
+ 0x35768d10 0x3a23273f 0x8abcc6a0 0x19e9bd07
+ 0x1a330236 0x11620bde 0xdd49844e 0xdc3d6de4
+ 0x1c281445 0xba0afcf9 0xd028ed33 0x9dbe4b86
+ 0xa19a7b55 0x9c8d38b7 0xdc309662 0x401bfc35
+ 0x3b5d1916 0xa5269114 0x8e412b76 0xf7647392
+ 0xf942b7d5 0x9260adcc 0x8afee875 0xfb118859
+ 0xd6804c4e 0xfb85a736 0x5dc115f0 0x3f59b455
+ 0xe929debd 0x63056252 0xa148034f 0x8402d095
+ 0x3e97b9a6 0xe40db503 0xf0386a46 0xed00b7b3
+ 0x39bb22fc 0xddb3b098 0xba16d44b 0x5e2dde16
+ 0xa6bda0f5 0x724402e2 0xb5124159 0x08e33efa
+ 0xcb7f9fe7 0x9e71664e 0xb23392e7 0xe2af1dc0
+ 0x0eb10493 0x968aafbb 0x28471024 0x3d381c3e
+ 0x1a9733e4 0x653aa7af 0x562d42b5 0x31d86c56
+ 0xca350054 0x457b1463 0x851fa734 0x44487bfc
+ 0xebb40fcb 0x2695d870 0xbdd9bd58 0xad69e109
+ 0xc8ef5141 0xd3c19c68 0xfd162971 0x4468a595
+ 0xbd54a760 0x4322f3d9 0xaddb735c 0xc825ed17
+ 0xa35f38ad 0x86deb244 0xd950d2b7 0xafe4cf81
+ 0xe07e1821 0xb95a97de 0x13a266bc 0x8f4d01d9
+ 0xe5276f4f 0x872f5acf 0xeebdc97f 0x7a43dee0
+ 0xc2c6a943 0xa5eb8784 0x4adf3352 0x3f9dc065
+ 0xe496d204 0x8af51abb 0x6475d7ed 0x667702a3
+ 0x7e20c88a 0x02776ed1 0xfa888f01 0xfeeb837e
+ 0xdd3d24b6 0xfba0362b 0xf03e3b68 0x74f25458
+ 0x903e8f1a 0x2d3de9d1 0x9fdf3e7f 0xe12a3e43
+ 0xf15bc9e9 0x3863c287 0x49004368 0xbe29845e
+ 0x0bdbf633 0x5a76c7ef 0x98c23cdf 0x0d7607cf
+ 0x89f7332b 0xef2be61b 0xb71c5847 0x0e27f5b1
+ 0x039cfe80 0x7e903d56 0x2255045e 0x544c6d81
+ 0xf94977dd 0xedfe79e1 0x50d8408a 0x73c43dba
+ 0x866128a7 0xdf2133c3 0x633d31c1 0xe5cecc60
+ 0x743b41ae 0xa0fabbc1 0xf1d18ab7 0xd103807d
+ 0x6830fa56 0x1dcf2890 0xdf7034ff 0xdd0460d7
+ 0xe4f433a2 0x682725ff 0x0a1ae47d 0x9faef3a8
+ 0x4cf5284f 0x1752bc7f 0x9013813c 0x729f3c2f
+ 0x920aaacf 0x1c4e03f2 0x0bce5e49 0x4a202b94
+ 0xa5d0855a 0xd35e2236 0xee7fdc41 0xfc8064be
+ 0xe1940fc0 0xa7dfbfb7 0x5af5c656 0xdb9d9fc7
+ 0x0345d8d2 0x63ef4246 0x109c3bda 0xa7705fca
+ 0x531f9f2a 0xe1824461 0x076fbcd0 0xa3f84478
+ 0x39c1e1fc 0xcd6d68ff 0xd683d764 0xfc9ee692
+ 0x8882a22f 0x5751ff82 0x7cf8ba19 0x9bf70f38
+ 0xfd552cc2 0x65e9a628 0x6efc977d 0xdb7c6cf1
+ 0xf0881a57 0xd858fa98 0x60249fdf 0x5d4c712b
+ 0x6d7de508 0xb1e94228 0x7bdd41e3 0xb0f587bc
+ 0x91b6ebc8 0x6fc8145f 0x560ccdfa 0xae26f3f7
+ 0x3bee581c 0xe16c2219 0x473b0210 0xdc6a823b
+ 0xff5e7b11 0x12787b53 0x5a1e1c1e 0x213604d7
+ 0x61248c6f 0xcbfdf1bf 0xd9fa23ca 0x1690dd8e
+ 0x61ef8046 0x48b6d372 0xc4569da7 0x89b2c805
+ 0xed56daaa 0x73ff7451 0x0a0701bb 0xe8af7ab0
+ 0x7419b74a 0x48c9abba 0xeb388644 0x02514f88
+ 0x8776a046 0xbf52785f 0xa65b7abb 0xb031db8e
+ 0x30722207 0x15647b89 0x300041e7 0x2c08eb5e
+ 0x7d05830a 0xd8e51933 0xddbaa66b 0x6b136c2b
+ 0x0fb77213 0xe7ee78d2 0xbd33b0a7 0x095e5714
+ 0x3bc7a3bb 0x578d0937 0x66f3a3fb 0x166f85b0
+ 0x58fa0ff0 0xaf952487 0xdc3c8a47 0xe5bd8ffd
+ 0x3b846c9b 0x38261e06 0x3f08e8e7 0x354bd695
+ 0xde0d33eb 0xbe505098 0x6732ef86 0x4fa4b8bf
+ 0x5fd1c5ec 0x816b4a96 0xd1bc334a 0x98311a2f
+ 0x3165282d 0x2dba4779 0x2bbe37da 0xaf23cf33
+ 0x67ba8ea0 0xdace3214 0x9cb27eab 0x6924268d
+ 0x69c19eb7 0xa89b662e 0xe9d5dc02 0x3fb9655e
+ 0xd5118c4c 0x6f2888bc 0x4678ab4b 0xb93276b3
+ 0xe5423906 0x1f00d0a1 0xab4e1fc4 0x64f2e39f
+ 0x1f207b02 0x70c940cd 0x4a3283f7 0x83343d9d
+ 0x5eed954d 0x74ba89aa 0x5ce4726d 0xdf17f716
+ 0x32a7a135 0x39973f63 0x0a791cd4 0x24565097
+ 0xd266128f 0x59d68959 0xc7588b8c 0x0486bb41
+ 0x86ba3732 0x3a3b6d92 0x153242a6 0x1dff0d91
+ 0xf79d767a 0x924081dc 0xd790fa0b 0x38f94b43
+ 0x0ac25566 0x19bf2f81 0x7104b31a 0xd23401d4
+ 0xc74eca0e 0xd3b49e65 0x5abf11db 0xa28bb479
+ 0xf34c8996 0xf3334251 0x10cf18c6 0xc8025f38
+ 0x378ae993 0xd92f6598 0xf33c3c97 0x8e3cfaec
+ 0x6e2a5de2 0xaaeed089 0x313f507c 0x4eba04b8
+ 0xb531d1c5 0x1f10901f 0xf8ea4c50 0xecdd5da0
+ 0x77772fa8 0x42ebec15 0x0974789b 0xb9e827b9
+ 0xa528577a 0x5c48609d 0xc0121c09 0xb1a8ccd4
+ 0x6cef020e 0x4a46ab88 0x9d719fdd 0x2adec1f2
+ 0x8b397d10 0x7d65806b 0x995f1f48 0x0ecb33d2
+ 0x7245161c 0x3444b266 0x999cbc96 0xa8d3297a
+ 0xc95212e8 0xab4204bc 0x30a2483e 0xbb8b2181
+ 0x0094cdee 0xeb347b37 0x0a1ac9ec 0x5825c9df
+ 0x5cc2fa56 0xfebdbbdf 0x6fa5c412 0xc7f327a5
+ 0x13777390 0x51c71bf5 0xf4a542d8 0x8cc0990c
+ 0x198e2bf5 0x419a8534 0x070d7f89 0xe7790bc3
+ 0x8d1a5ef0 0x3ce23a21 0xe01ea069 0x5b9f9a00
+ 0x2f8ed3e0 0x97332f38 0x001925cf 0x6e779295
+ 0x739fc4d1 0xabf9944f 0x343ed8be 0x2ebf63e6
+ 0xd51e34e0 0x1337d0fa 0xd7fe4c38 0xb08a0db5
+ 0x40bc7d7f 0x4c212f41 0x96d3bb7c 0xd2279ce2
+ 0x16eb515d 0xc110656e 0xa9e92d84 0xcedc22f7
+ 0xe8706dde 0x4a76e110 0x22c3fa98 0xdb211bcd
+ 0x957fc51c 0x36c29d63 0x1483afaa 0x5e39e758
+ 0x814d7e6a 0x5ac931fd 0x16fbe255 0x257eb0f2
+ 0x39cd3ceb 0x4ee4ba07 0x1ac38737 0xecda25d6
+ 0x6ea0bdad 0x07e7a879 0x0296f80a 0x7b958ed6
+ 0x575161b7 0x5f650e87 0x4289d79a 0xee7d22ab
+ 0x6ff67a68 0xf4dd0a9d 0xa34c4007 0xf0a5dab9
+ 0x85acc38f 0x76f87ae5 0x822abfe1 0xad687af9
+ 0xded258ea 0x49f6c703 0x353272bd 0xc75758a1
+ 0x6b48eb11 0xdc817270 0x4910311e 0x1cfc6962
+ 0xed766448 0x61cf7dba 0xf864aa30 0x8df293ee
+ 0x25c5b108 0xdd5d0fe4 0x086e588a 0x7c598f63
+ 0xe7089dce 0x215f3970 0xf6bef979 0x25df09d8
+ 0xa8ba0705 0xa14aec4e 0xa0ece62d 0xd99cebe5
+ 0x90dae17f 0x4c419379 0x86667d85 0x3dc66e8f
+ 0xd2292fc2 0x4180741f 0x5f03dacb 0xcd2f8d67
+ 0xc8057a13 0xff1393e9 0xb36b309c 0x8cc016a4
+ 0xfbfd12da 0x0feade1f 0x240e5e48 0xbf31d152
+ 0xf591375d 0xb65a5a81 0x83a06001 0x9965ae6f
+ 0x32003ace 0x7a53f92d 0xa1ded870 0x6dedb048
+ 0xb93fb122 0x766aed37 0xc55cea46 0xb67eb22b
+ 0x91325510 0x64a2d0f8 0x26388359 0xfb09be60
+ 0x6e016f6b 0xf0002197 0x9219ec31 0xf2dfa417
+ 0x819b3c73 0x6d0234d8 0x5ce80fd8 0xe8257515
+ 0x1a8a86c9 0xb3c27617 0xa69dacbf 0x9417e360
+ 0x40df8c3c 0x59f1f2a5 0xf75856ec 0x3ac2903b
+ 0x8b73d094 0x4521bbf9 0x0a845523 0x6dd5d385
+ 0x3fcf96c4 0xcecdacf6 0xc2a64486 0xf4e26ac2
+ 0x51187861 0xac1e7b98 0x9f02008e 0x17a2447d
+ 0x0b72467f 0x23e98819 0x4e1b81af 0x58aef855
+ 0x9d47d2f0 0x15515333 0xfec897ba 0xaee89cc7
+ 0xc0de21ab 0xc043e61b 0x548fe55e 0x3ea899d9
+ 0x01502408 0x81962698 0xffe9bb16 0x1ba4b3fb
+ 0x49f85b98 0x0540393b 0xfb173c81 0x863f9793
+ 0xde7cb7f3 0x6655e382 0xc0c49ccb 0xeb8d3b0c
+ 0x683b66ce 0x3d61caa6 0x78868ffb 0x392248cd
+ 0x9605b7db 0xa7c83840 0x4a87ab87 0x6370860a
+ 0xc350fa9d 0xd4a596d3 0xcd7c5a64 0xba6f96de
+ 0xe9c2a355 0x3b946d03 0x03a9c139 0x3b83ff2f
+ 0xb7483bb1 0x417c662b 0xc13005ed 0xc81c11da
+ 0x105191c4 0x6f03ce06 0xe358598d 0x5629fd10
+ 0x2c0d1d20 0x262f8774 0x856c333d 0xfdf25340
+ 0xb666a0b4 0x94ac4952 0xddc6b991 0x9cbde852
+ 0xd315c735 0x85179f2e 0x6fa62af8 0xb33ec55f
+ 0xd05b166f 0x6ee23870 0x352fea75 0x7b1b987b
+ 0xa87efa86 0x6d0602b5 0xfe94274e 0xeb649dfb
+ 0x3973b9a1 0x08cb32b5 0x5d68e7bd 0x809d8f23
+ 0xd3b679e3 0x951eb5e9 0xe2585b7b 0x1c7e73c1
+ 0xefb750d0 0xc422aad2 0xdc396e18 0xa4690744
+ 0xb4c36aa6 0x5fd5af3b 0x4b7cc0d3 0x4909d125
+ 0x4824fb79 0x7c339f14 0x28f59be1 0x363d3777
+ 0x2fc0f93a 0xbaf388ba 0xeb56afce 0x4ff249ee
+ 0x03661a38 0x4bf043f9 0x7b077324 0x957ea45b
+ 0xccef6c1d 0xea17b6bb 0xae8338d4 0x71dd5565
+ 0x8af88bf5 0x3a18b963 0x247044ee 0x5dff0975
+ 0x6a5c6636 0x58e57987 0x3416898d 0xf6343200
+ 0x44267a46 0xfa332076 0xf48cf90e 0x10133045
+ 0xa371e825 0x420517db 0xe55f8621 0x3d3dad24
+ 0xdaaa220b 0x52cacc16 0xea856a3f 0x9f67b308
+ 0x01ea7270 0x98b35b19 0xf6233e61 0xd9151928
+ 0x7c38a66b 0x89f7d1be 0xc443282a 0xc1950bba
+ 0x85c0cc0b 0x324eac89 0xa27ae909 0x31d9c4b7
+ 0xaaba5c56 0x60e58336 0x9b788ce0 0x0b133d63
+ 0x07dacceb 0xf2bb1e6d 0x42ee5003 0xbf4baa0f
+ 0x6500b4fc 0x1b4cce63 0x0b302ffe 0x14de241f
+ 0xbfed61b8 0x9db110b3 0xac57e0dd 0x2120d62a
+ 0xe8979a5c 0x9cb6e7f8 0xf7f49032 0x3e7c33a9
+ 0x780e310a 0x86e4ff19 0xda9d435f 0x84b24371
+ 0xd17a5e78 0xec3d82f7 0xfa8ab863 0xf7a8c116
+ 0xd9ca1c0f 0xa83ae454 0x8d3cfeec 0xf9051edc
+ 0x983f992d 0x4aa4d94c 0x1c2df5ca 0x637ffe63
+ 0x83df348c 0xf2af22b7 0x09ac1da0 0x41ff3eb3
+ 0x5ac05404 0x34977ded 0x0ad4bf25 0x905a460c
+ 0x95f35a7c 0x9cf479f4 0x681daf0a 0xe6a6eaa1
+ 0xdc566718 0xa7f7057f 0x48c0003d 0xddd3cb43
+ 0xb261a28a 0x38d299a9 0xd1fb08fa 0x138c965f
+ 0xdab5a4f2 0xeeffae4c 0x3b3c9be8 0x38d111a2
+ 0x43866ff1 0x386d136c 0xd9c4c955 0x3c89ae19
+ 0xbea88e6a 0x7289dab6 0x3bc4d0c6 0xb53ca927
+ 0x2585c917 0x9cb4a0ad 0xb06a4a22 0xc4b3193a
+ 0xd0eefaf8 0xd05f04f2 0xa1c01106 0xb9e3c86f
+ 0x870a4c40 0xf5ea7b8a 0x84b8b389 0xec2a0349
+ 0x02c58178 0x7641d24b 0xda5f8d6b 0xffaabbde
+ 0xf4c4b368 0x9841bb8d 0xca886f15 0xa50808cc
+ 0x87aef6c6 0xe191def5 0x62cceed2 0x7422822c
+ 0x9840460e 0x90fb5b26 0xe095873a 0xdf5bab2f
+ 0x4dcf7004 0x3b751ed2 0xa6ff671f 0x0d63a239
+ 0x2c947c16 0x8f791edb 0xd5e2e176 0x1897b16b
+ 0x788f26ac 0x4faf514f 0xdc131349 0x1cc91d38
+ 0x6cf64acc 0xecb6a4e2 0x3a920d0c 0x9df858f4
+ 0x0a346428 0x01edce06 0xa26d5ce5 0xeb8b4478
+ 0x5fe54d4c 0x9d59253c 0x5a2c2bdc 0xff52e133
+ 0xa5715f09 0xc46d07c7 0x2fe11c95 0x367037c0
+ 0x395c2335 0xa400d4d8 0xffbbcd93 0xf10589c5
+ 0x5fe05470 0x62dcd103 0x831bd594 0xf8042f6c
+ 0xfbd4e834 0x53f18136 0xdb37cc3e 0xba36b5ef
+ 0x932f8a0a 0xbfd2464e 0xd790043c 0x18cddf0e
+ 0xc9fe957b 0xeb06fcdd 0x658422ca 0x06105ad4
+ 0x4fb90483 0xf513562a 0xf8de755a 0x2b3f4a4c
+ 0x9ca4c51a 0xbe9895dd 0xc31b38d3 0x9c8bb7a5
+ 0x55c7c5e7 0x75fa0c7a 0xea27c61f 0xe5a176ee
+ 0x6ed35a19 0x4dbcf9f6 0xf9957451 0xc8069744
+ 0x682b653a 0xc6ffa275 0xe274804e 0x1f74a248
+ 0xdd1a6bea 0x61bfc414 0xa12035cc 0xeb4d91b5
+ 0xe908d527 0x7e1bd310 0xa5095e94 0xf1af1fe4
+ 0x79fc7ade 0x549c9189 0xc20aaf51 0xaadca08f
+ 0xa6bc836c 0xe6f304b2 0x614815c1 0x940d62f6
+ 0xb6a2e309 0xda518187 0x3fc3b671 0x6e596f6f
+ 0xecf24a59 0x5a6130fb 0xfe863237 0x3eab2f43
+ 0x008fd345 0xb84dbbb3 0x17f3df84 0xa77046b0
+ 0x80fe3806 0x2c9fd8be 0x98bd4be4 0xf0c9d9ac
+ 0x01443cc0 0x1fa6e5e8 0x3413872a 0xfbd252ab
+ 0xc4f1b4c7 0x178cc63b 0xf3a6e182 0xaebe4595
+ 0xc9de7c32 0x6c1cd5ec 0x6a0ab8eb 0xe83312cd
+ 0x012c7e93 0x7edd1c8a 0x4b6a751f 0x074eee6b
+ 0xb79259f7 0x93963d5f 0x7bd5cda6 0x22852976
+ 0x39f2e9a2 0x8f4bc0a7 0x0419312c 0xe4be5fec
+ 0x6c8dc91c 0x14e59f50 0x85f17c97 0x865604f8
+ 0x21c3bdd7 0x65dae217 0xb7071263 0xdb7f2d71
+ 0x85f83e68 0x67be49f5 0x2fa8b9bb 0xa6c09ed5
+ 0x49e9b467 0x871995eb 0x267a6ee0 0x7d7aa401
+ 0xf094e6f4 0x2bd0096e 0x05d4801a 0xff33cebc
+ 0xc54c1678 0x628736d4 0xb98cca32 0xfbfe5e7b
+ 0x277c98c1 0x2eba7546 0xa41a9b3a 0x5c232d15
+ 0xfc62c9fa 0xcb27f7a1 0xbb21a120 0x2987fa3f
+ 0xc20a868a 0x592f3543 0xf6ba1c61 0xe9aeead4
+ 0x0ced340d 0x484ea274 0xe8e7205f 0xf4d42151
+ 0x8d63652f 0x5df919ba 0xc782202e 0x00b5558a
+ 0x058ac4b7 0xf7ed3616 0xaaf532ca 0x0466f7e1
+ 0xc715de7d 0x891abb16 0xd3f1edec 0x703e7d46
+ 0xabcaff31 0x65da8b73 0xdb78bc96 0xb90676de
+ 0x5d7426ac 0xf19f71aa 0xaf3c8094 0xbe384c5d
+ 0xb1845940 0x058f5892 0x01f1e3cd 0xeecefb78
+ 0x216f47ef 0x83ce4dd4 0x99a2a92e 0x5f489e0e
+ 0x0030accb 0x10a522b5 0xc0e9bf92 0xbe72aaae
+ 0x2868b69a 0xe16d004d 0x68cdf097 0xf0c81e42
+ 0xfb771c2e 0x6c49e356 0xdf43fa86 0x6f8fdd69
+ 0xe8efde9a 0x61104a22 0x9314ea71 0x4f9833d0
+ 0x02d83ff3 0xb68e7a13 0x0734b8ec 0x8cebe42a
+ 0x995c5419 0x77dc758e 0x40926526 0x63d5e2ec
+ 0x53451011 0xdb095010 0xf04c8959 0x84fc2ade
+ 0x6a8d1f9b 0xab4a694a 0xb68e3295 0x2c33244c
+ 0xb756684a 0x8824b6dc 0xc7718d09 0x2c78a0b1
+ 0xd6df2d21 0x1d84fdc2 0xef8449dc 0xb84516b6
+ 0x1654ccf5 0x58d50227 0x775f49a4 0xa0efdc64
+ 0x2f5c7ab6 0x8d5cebe6 0xe005d427 0x9d5a2340
+ 0xf6960126 0xf7d1db59 0xc0d6d6a3 0x74cb7b1b
+ 0xf802dbca 0x90a9f81b 0x0e8bb4b6 0xe6a3ef4c
+ 0xdcc932d8 0x89b76667 0x8a6a225b 0x90762ae8
+ 0x0f1f6328 0xd3b7db8e 0x979d5e9a 0x5e617a2b
+ 0x4c3ee8e9 0x2af196fa 0xca0a130f 0xc013619d
+ 0x64a456e2 0x066900f9 0xbf5ed7a8 0x38a68296
+ 0x53ef7330 0xe823e118 0x6217d7c0 0x5e73506f
+ 0x42a7702b 0xce68f476 0x747461b6 0xc9ad8bc6
+ 0x6c189fb1 0xe9a4f518 0x7fa18264 0x01c1a852
+ 0x1344ca0a 0x29ca755c 0x63b7079a 0x4d8c8683
+ 0x0c0633db 0xa470e228 0x62cabbf5 0x9e8095b9
+ 0x119922c7 0x7ba0b8eb 0x3766faee 0x7cc8deba
+ 0xddf20b61 0x61b04695 0x03baee6b 0xe0246a67
+ 0xf10a42e2 0xa3dc8a00 0xdd5d9f77 0xe1f1dcc4
+ 0x3772369b 0xace130c6 0xbbf5fb88 0xdf454e32
+ 0xc25df6b3 0x83c2d8e7 0x9cd44e3b 0xf45e8cd6
+ 0x7b94d7bb 0x53b5f935 0x46006c16 0x5d342245
+ 0x9621d860 0xe4f4e4cf 0xe1788871 0x1045d508
+ 0xfd114bfd 0xec6966a2 0xeb6aff51 0xb03a7abb
+ 0xe3766706 0x757ed7fd 0xd18e949c 0xef3f6251
+ 0x9787316a 0x506cb265 0xd48cb59d 0xecb463d0
+ 0xbd84346c 0x4b8360d2 0xb26d8c6a 0x450ff5bc
+ 0x3ba3fbe4 0x93ee71f7 0xd2601c87 0x1aec2358
+ 0x844a5d34 0x80b40953 0xa9207cb2 0x26076dd2
+ 0x6a2a5343 0x589d94ac 0x3c1b0455 0x7e9c1526
+ 0x9e651ce4 0x756809f9 0xd67cfec3 0xa6e987a8
+ 0x74111b0a 0x95bf18d6 0x883ba1c5 0xb439a503
+ 0x47b994c0 0xa08ed9ac 0x299c05a4 0x6c4a726a
+ 0xdc15ec63 0xc2548b1b 0xc7b6d9c9 0x1e3fca68
+ 0x8ae69b33 0x0d534ee8 0xccbc545c 0x69d8a57c
+ 0x5f024f9e 0x453f469a 0xdfc42c44 0xd4a9346b
+ 0x4dd997f4 0x5cd6e314 0x449335b2 0xfab68310
+ 0x5a8a47e2 0xbdd8071c 0xeffc2195 0x18b06efc
+ 0xfe7f3523 0xfa086966 0x7c006f79 0x87a0bcc3
+ 0x693a04c3 0xf0950720 0xe0bea427 0xa12e6b4b
+ 0xe3f1e30a 0xc1a2cc7b 0xbf95627c 0x123ad686
+ 0xb253fb89 0x124f86ca 0x59c98e2e 0xddd47f2f
+ 0x2dbd08c1 0xd0f061e2 0x3d41b8ba 0x86c36a10
+ 0x24e75d20 0xa93674ed 0xd50f71e4 0xeac56eb7
+ 0x5e95e65d 0x6ebe1bec 0x5f0f3adb 0xd30659cc
+ 0x1ed0f17d 0xab3d79f5 0x906ec76b 0x0617fc88
+ 0x126cef95 0xc7191ce3 0xd89e162e 0x4fbd2727
+ 0x17b7a6a1 0x06151f52 0x73f6f1b2 0x37d20679
+ 0xea9a9e5f 0xf483a7a1 0x37bb2981 0x300afd63
+ 0xa168aa2f 0x0f1b60c8 0x73cd1a34 0x3ede2d95
+ 0xacfa2c19 0xa6ef9928 0xb5410e65 0x5679d314
+ 0x3b9ec3f1 0x0873a9b2 0xfe3eed93 0x01909bea
+ 0x1c062fa3 0x9f4f9dee 0xad180d14 0x3a77f62e
+ 0x903cd80b 0xdd716284 0x5d3a17e3 0xf33557db
+ 0x5593cd64 0x280a25e8 0xf27720d7 0x016386e5
+ 0x3eaa11dc 0xafe1dbab 0xab939bcb 0x10505da8
+ 0x80f18377 0x5adb5fd6 0x2a80f194 0xf893c3e5
+ 0xc575996b 0xbb898847 0xb9911094 0x3052115e
+ 0x1b5be836 0xc7ff13be 0x34256191 0x159c5ea2
+ 0x3a09a25a 0x5f6fe241 0x234a29cc 0x0071906a
+ 0x9c3dceba 0xa0eee574 0xf7b2e1fa 0x7b16551a
+ 0xe603659e 0xfcdfc6a4 0x85e43b4d 0x0c926271
+ 0x615365fb 0x89e17565 0x07ab1a68 0x64555432
+ 0xa0a4797c 0xa16ecc13 0xd8e6fa59 0xce8476be
+ 0xc736b7c5 0x9ea33c44 0xb0097071 0xc4344f6a
+ 0x9984f945 0x3a147fc2 0x59c59ff7 0xbd0af922
+ 0x85dbb525 0xb57272e5 0x7f1ce809 0x3c5998e3
+ 0x961b649f 0x5bc2b19a 0x272cc085 0xb0440956
+ 0x0755da18 0x92c90f51 0x3efdc205 0xb3ad184c
+ 0xf27700ea 0x56cb6d6f 0x8e931a0b 0x8b54c662
+ 0xe12ae153 0x0fe92413 0xa4fb9a0b 0x5ac60a46
+ 0xeb0da138 0xe0cbe58c 0x3a916aca 0x7eb879e0
+ 0x2d000d97 0x2bdbbcff 0xd114dc63 0xd510235f
+ 0xc5651eb6 0xc936dda0 0x3695d532 0x92e3d72b
+ 0x5e298a2e 0x32064f5f 0x74b1d5bc 0xe499bb8f
+ 0x9e69b8a6 0xa2ba91b1 0x665e010e 0xf540755c
+ 0xa4481061 0x6a8b6038 0xefcd2326 0xfc35b7dc
+ 0x2a9ff1e3 0xeeb9fb5a 0x3e2e55da 0xe666d0b7
+ 0x425febc6 0x5e43d9f7 0x530bcc47 0xd0ff91de
+ 0x4c69f7bf 0xfbd112b9 0xe09693c6 0xa3b840aa
+ 0x0cdff6e4 0xb7c110ab 0xd0610264 0x1c358890
+ 0x2ae72b61 0x2c777a83 0x03d82504 0x773df708
+ 0xc055721f 0xc0469e23 0x9843663b 0xe6f8ba58
+ 0x32a3b083 0x00c04321 0xfff85d06 0x9811ad10
+ 0x7e084d4e 0xb51271c3 0x73c3e909 0x6f4dc689
+ 0xed6bc204 0x6bfcf9d6 0xae6badb3 0xba47a39b
+ 0x956a9ae2 0x2fbfcc3d 0xa7c82312 0xa997e4eb
+ 0x084f5bfd 0x49e42545 0x0149311b 0x8f2565a3
+ 0x6b59cf2f 0x350d5b66 0x44d703b5 0xc7c1a080
+ 0x23e7718e 0xa94c33f8 0x6b3449f8 0x35dbe5d5
+ 0xcd64f37e 0x0653ccd0 0xfeb5ffc3 0xa1cb2c2d
+ 0x29d709ac 0x9f7f92c5 0xd39970bd 0xa6941c48
+ 0xbeea817d 0xb16290b2 0xe7fa1175 0x04eb43e6
+ 0x1738a55e 0xd4bb4d56 0x93e37393 0x062dec67
+ 0x2beda16e 0xa10873fa 0x2e6c8434 0x794a42ff
+ 0xb07934fa 0x7b6ac0c5 0x1ea05365 0xe3f1bbda
+ 0x20b2363e 0xc03fa440 0xaa2936e1 0x5c08a05b
+ 0x6a39c1e5 0xd6f678d3 0xbd1cc401 0x93ac898a
+ 0x20942d76 0x7852a50f 0x544139ed 0x1537e6bf
+ 0xf0539bf4 0x0a2708f3 0xd2f83a02 0x1cba26d2
+ 0x86443e0e 0x62d0229f 0x4b2d945d 0x1f1c1f28
+ 0xb497e8ca 0xba3e04e5 0x522509c7 0x192f77ef
+ 0xef7da5e0 0x7a759321 0x41b83ff4 0x6c646590
+ 0x30f48620 0x6a5612fb 0x42832c7a 0x2574928e
+ 0xd6e388a5 0x9345eec0 0x167ffb91 0x4168d51e
+ 0xb8b646d8 0x75646e79 0x974db936 0xc02a6e1d
+ 0x3c995264 0xb2d0c32f 0x29822c7f 0xe74eeb5d
+ 0xe03580eb 0x8319b856 0x0d1d271d 0x8ad42434
+ 0x96651fa1 0x5564df67 0xc9ef4ef8 0x71302d3f
+ 0x72226833 0xc97b6c5d 0x20610c32 0x01f874f3
+ 0x622fcc68 0x081e4913 0xf830a20c 0x11a7964a
+ 0x85b88912 0x52358837 0x90acc6da 0x5c0bebee
+ 0xc40bfb78 0x83adc676 0x454f72b8 0x1776e8b1
+ 0x0f298261 0xe2e4e4ec 0x2b3130df 0xaeee0c65
+ 0x33ce26e0 0xb3577250 0xbeafcd81 0xc6c7138a
+ 0xd700eb30 0x3bb1b274 0xc71598d7 0xfd7a7f26
+ 0x38add452 0x8574241b 0xf596bf98 0x6785b542
+ 0x4631cae3 0x2220df5e 0xffe77fd9 0x87fba210
+ 0x6b145970 0x144c0e9c 0xf5bd939c 0x41d32ae4
+ 0x43b35b0a 0x59c8f792 0x355355c4 0x6a2b17bd
+ 0xcdcfefcb 0xdbf1dbc0 0x609e35ac 0x0ecb8b52
+ 0x9c3a4f1b 0xa33870c0 0xa381d6ec 0xb386f4aa
+ 0x5ae62eef 0xdf19932f 0x4d76d341 0xf26cfcce
+ 0x83a36919 0xf6738880 0xaa9228cd 0xbff13a9d
+ 0x6d8e63a8 0xc75f28eb 0xde816caf 0x21b1c98b
+ 0x134ac097 0xbfc29aa6 0xa393e847 0xe1795918
+ 0x8c5f1b5d 0x18f10df2 0xfd98960b 0x82176151
+ 0x7509e711 0x73b9ee6d 0x2c11cad3 0xb8e5b028
+ 0x2ab11953 0xda19e17b 0x3fe13700 0x96cc4c45
+ 0x19612a6f 0x6b216822 0x4dc650e5 0xa0f67fe6
+ 0x2860722b 0xebbfd77c 0xe9f8306a 0xbd1cfe5d
+ 0x9f8520c2 0x4826927b 0xa6e8c777 0x91cf868d
+ 0x2ef6e415 0xa66db818 0xb5c371d1 0x3d2e27f6
+ 0x3c85744d 0x4fd2deaa 0xbdd81f53 0xf652b345
+ 0x87ca0ec8 0xf9b7373d 0x19859129 0x71872f82
+ 0x9efabd33 0x1d965b6a 0x8d4bbb05 0xc69dd6e6
+ 0x0cc18042 0x4cbf6954 0x0ffffcba 0xec26cc1a
+ 0x134d3aee 0x7224df40 0x701f74df 0x80b0d9a8
+ 0xc835f80d 0xfee03bb0 0x67e78ebe 0x8daec7b4
+ 0xb0999490 0xfcddb4e8 0x19a339f8 0xadb71117
+ 0xf1ac4cbd 0xe83402f7 0xd0404953 0xdc6e386b
+ 0xb0331448 0x7a80ea7d 0x1cf9cda7 0x9fcd458d
+ 0xfd023527 0x66e58053 0x573800d6 0xdd2c9579
+ 0xc387c6c1 0xf4bf2199 0xde150280 0xd22eac26
+ 0x50cdc5fa 0x8ca12024 0xa90a1e65 0xa7393b56
+ 0x8314e967 0x08deee83 0xff1b467b 0xc57ebb67
+ 0x3a94253c 0x859efcdd 0x8d0a085b 0xda771c92
+ 0x846af9d0 0x8005a917 0xe0985eb5 0x82ca31d7
+ 0x9e862be7 0x182365f8 0xfbde08db 0xe2070ffb
+ 0xf789f749 0x43e284b1 0xfebfe41b 0x43c24bd8
+ 0xb5b96980 0x411ad230 0x5d2d20ae 0x6a81b066
+ 0xb9d7499c 0x5f2ec4ca 0x7c0743ac 0xa66bb574
+ 0x9dd48615 0x5d7d7e96 0x9fec85c9 0x8e61a725
+ 0x206c4d3e 0x73b5d242 0x1359bdbb 0x61a357a5
+ 0xb95f058f 0x3e519639 0xe8d4cfee 0x767253b4
+ 0x3bd93d26 0x1310035f 0x172fe3ef 0x44d5f736
+ 0xf8218b94 0x4e217ff7 0x7b889089 0xb1cc6b4e
+ 0x1094227f 0x4a8f39c7 0xb9767d40 0xc0d8a4d7
+ 0x983431d3 0x7688316b 0x2a37d76c 0x92c14d2e
+ 0x395db078 0xc682c142 0x2e16782e 0xfa052bd5
+ 0xd1248d63 0xcd9d1fb5 0x0ea954ae 0x2a378a49
+ 0xc32815e9 0xc1381b26 0xf2f2ea46 0x7e0ac5a8
+ 0xfc8b9b7f 0xa09d0266 0x511d3d2d 0x9488f11e
+ 0xbfe7037c 0xc3dd86bf 0x0d368472 0xff07b3b0
+ 0x3eaf3450 0xda9995b8 0x21af9375 0x4ad5b401
+ 0x8e874afb 0x17358bb5 0x20905355 0x994a56f1
+ 0x6c0d0b46 0xaa2c474b 0x92e7c153 0x7a0f16ef
+ 0x9a5b5068 0xbd9bf73c 0x0e62a1b6 0x1337bd97
+ 0x1c575823 0xc9d3a4f3 0xd4dd3f92 0x670048d8
+ 0x7bccbcd4 0x2cc48caa 0x6391a9fc 0x504b86ba
+ 0x6afda937 0xe11a8b22 0xb3a9b260 0x4870e243
+ 0xa895fbb4 0x6dc3fa91 0x3f0f87ed 0x552b7c53
+ 0xf5d866ad 0x9fd0c9b5 0x330e3e93 0x9366084a
+ 0x427e792c 0x2ca2e653 0xedc14ee4 0x62a4fdb0
+ 0x9a4fb34d 0x49c9ef8b 0x9dd9dbd8 0x287a5863
+ 0x5338e4b9 0x09de2dff 0xde64dddc 0xc4dde910
+ 0x1f8e9962 0x144f6437 0x9848dc67 0x2674682e
+ 0x8f914818 0x04b1971f 0xfdb3ff8e 0x585d9e1d
+ 0xe365dab8 0x84ea6149 0x54933b51 0x1c92c025
+ 0x43c4475c 0x066e4d9b 0x2d7e837b 0x6b8276ba
+ 0xfb0ba618 0x2386546e 0x2d3cfd88 0x354a0896
+ 0x9a4dbc00 0x321910dd 0x630ce2e3 0x8fa81a9c
+ 0xd2e03c87 0x73119e29 0x45352381 0xa9682006
+ 0x1fb516df 0x64d22b4d 0xeac1648b 0xc2f29243
+ 0x693ce48a 0x7c7db02c 0x7a32e833 0xeb0bfd4b
+ 0x3b7fa87e 0x478665dd 0x021813b9 0xc044ccb2
+ 0xb3e18708 0x455f2e57 0xd62563ff 0xb03fdee5
+ 0x295320d1 0x4b9b793d 0x8e3b1d3c 0x4df2c6e8
+ 0x1bc7ccea 0x200cde8d 0x9f4a1d1c 0xcf52ac9d
+ 0x1e9f3758 0xa2039bf4 0xfd21eb46 0x501c1fad
+ 0xbe8b9a79 0x244c6179 0xa141d6b2 0x458acb5e
+ 0x05e036a7 0x56bd83c3 0x488946c3 0x1723be53
+ 0xac579ab1 0x72c9ab9b 0xd299736c 0xa46d18bc
+ 0x05f29f68 0x330856e9 0x9c3cca59 0x6766f4e8
+ 0x2442ed07 0x4302b7aa 0x95b73fc2 0xf7f70673
+ 0x47f8006b 0x5445fa8d 0x535338f6 0xac29315e
+ 0x52df8cd4 0xc5f86670 0x33b5152d 0xf3c3fcee
+ 0x45d6b944 0xdb4ef73d 0x5f4e2d47 0xfcb182df
+ 0xe0415c05 0x5e423d91 0xb2a77337 0x8ded2af1
+ 0xfd2a41b6 0x38b6da43 0xeb08fde3 0xa8b92f71
+ 0x6033938b 0x916fc8fb 0xa1cb0bb9 0xd43d0dd8
+ 0x265ccaf4 0x6ab46630 0xb5b7fca8 0x1cdc8fab
+ 0x5d57f907 0x731b1c98 0x13f06a7a 0x52d40403
+ 0x90838f2e 0x174c3545 0x79a5bfda 0x9a61823e
+ 0x74057ca9 0x352c1c28 0x9423416c 0x04567712
+ 0xcf8df7ca 0x788ad050 0x79eb1e57 0xe480f4bf
+ 0xe666c03d 0x7f764d8b 0x87b54e90 0x4ad4c310
+ 0xc76f14fc 0x8d31c3cc 0xd385c7de 0xc3c62ea3
+ 0x756a84ed 0x6093ba49 0x865a843b 0x15a21f31
+ 0x491e7d8c 0x6a85ead4 0xc23d7071 0xfee65ab3
+ 0x4dbb128c 0x8756a2c8 0xe41bea19 0x6b646205
+ 0x4f612363 0x102f1b65 0x50c42444 0xd66b72ac
+ 0xd0a5d189 0xbbb48835 0xfaed0f85 0x35299dbd
+ 0xae520e37 0xbc62d5b6 0x9fc997ce 0x4285c1f2
+ 0x144b2062 0xdd2bfab3 0x34ca7ad5 0x5b0b96b1
+ 0x4f5f5030 0xc6235ceb 0xbda53252 0x8d9d9c6a
+ 0x91e27091 0x584cb5b4 0x118a16fd 0x6e7307ec
+ 0x967dc77b 0xe25f67fc 0x71df26e3 0xf2140483
+ 0x950ab226 0x98565d79 0x13c1dc8d 0xa7bbd9b8
+ 0xfea3a85f 0x0514f498 0x67a9ae82 0x0b794d65
+ 0x910cf547 0xac89285b 0xb7d20b88 0xdcb0d698
+ 0xacec261b 0xb85e4354 0xfeb44708 0xe16daab6
+ 0xe39ea8d7 0x270d9917 0xf4c443ba 0xca1ee7c6
+ 0x3b772ba7 0x5db5b518 0x30743f87 0x89ea8485
+ 0xebe34ec9 0x92e785bb 0x9bab88c5 0xa567d991
+ 0x0834a6c7 0x3bf34a62 0x5ea7165d 0xfd765d50
+ 0x1d339374 0x393ae576 0x44615546 0x94966490
+ 0x522d0d58 0xc3f84daa 0xff9b3090 0x0a2b777a
+ 0x9d147f93 0x7484b82d 0x7e42ce9a 0x2479cbf2
+ 0xed5e8671 0x48a3fd5d 0x8c0efe67 0x57514a6a
+ 0xb2d59c23 0xac1bce8e 0x9d865295 0xbf2d52f9
+ 0x99eb3289 0xe9ec608d 0xdc8865fe 0x62a1d008
+ 0x09e75fb8 0x14eed62f 0xb1d983c1 0x18ffc5dc
+ 0x676dd012 0xd5ad1d1c 0x24089ea9 0x7b6b886b
+ 0x5b597f41 0xbc45f33e 0x0607aa61 0x4c24a7d5
+ 0x7c95d063 0x95bbdb62 0x54e9359a 0x64ca6b54
+ 0xa8697963 0x3ac8c630 0x659a0575 0xdcf3f3df
+ 0xc85e85e1 0x0be24ca6 0x754e3262 0x2ae09cc4
+ 0x141edd9d 0x293850c7 0xc4d06e42 0x1db7681d
+ 0x509c1d65 0xd4d25a9c 0x8b62e86e 0x7bf06aad
+ 0x577b51ab 0x546dffe2 0x68a1cc2d 0x4dfbfaa4
+ 0x900b86e9 0xd772e5b6 0x53b2cd20 0xd429c80c
+ 0x4df53704 0x7c591d73 0xc37bf9cd 0x405de0b9
+ 0xbf61eefb 0xf78d710e 0x771bfc4e 0x295bbb57
+ 0x57e03c7f 0x458dcf94 0x6cfa44c5 0x8b37c19d
+ 0xf6b700cd 0xee83a2e0 0xa69e0524 0xb5e8c23b
+ 0xfadd16fa 0x92103411 0xf7691e93 0x024d5d01
+ 0xc8f1a6bb 0xc52ae4b6 0x1481a804 0x76c3addd
+ 0x4a5b380e 0x05a06be2 0x8280fad0 0x7eefcb56
+ 0x6e7dbd22 0xe368006d 0x2bf09a2d 0xf19dcdea
+ 0x28bed5fd 0x4a5c7584 0x3f27e5cd 0xd93992d1
+ 0x05f76867 0x783a60eb 0x207ef64e 0xc55256ff
+ 0xe5d8982e 0xde4fed52 0x5c407fb2 0x693745b5
+ 0x67b5e2ba 0xc5141e02 0x7f8a949d 0x4bdecc6e
+ 0xede07b33 0x36190f68 0x67e701a2 0x05498bb4
+ 0xf320cb59 0x7c38504a 0xb6d4d813 0x2c1c0ec2
+ 0x70d1628b 0x69fe9eb2 0xce721143 0x3bc1a755
+ 0x22d0f125 0xbd270909 0x75fd4507 0xc86bc8af
+ 0x668d01a0 0xf5f15c8f 0x46a790f7 0xb4b1cc3d
+ 0xcb1e47a6 0x49f6ac3d 0xc749f955 0x71dfb5b5
+ 0xe69aa8af 0x68ea10ff 0xdeeef051 0xd28eca7e
+ 0xee70f434 0xdfc239a9 0xf32e58be 0xc7e4c16e
+ 0x009ea4f0 0x3c704ace 0x998ba989 0x90303963
+ 0xa881bb08 0x9fe1a2a8 0xa9302aa3 0x8e12260d
+ 0xd8344e74 0x0b2229df 0x1de95390 0xa69dc5fe
+ 0x4d2448c5 0x592dd6f9 0x66a0ff0e 0xcae3e34e
+ 0xf5692970 0xc8f6a8c2 0xef6d6cc6 0x995781d9
+ 0xb9b19cf2 0xf29ca8ce 0x805b80b5 0x566996a3
+ 0x20c14749 0x7f7dc821 0x33b1048c 0x1d77e93f
+ 0xc9924712 0xea25b7de 0x54e82316 0xbad33995
+ 0x7ce5f207 0xb89032e4 0x970a6002 0x12f0cee1
+ 0xfa5ff132 0x2f7c4ce8 0xa09d3c01 0x5d584790
+ 0x0f019e8c 0xc140fd07 0x2ada9dde 0x3beb0ad5
+ 0x0f5324f7 0x400dc16e 0x9fcaa586 0xb7cafe7e
+ 0xc329b81d 0x2a52a2fa 0x41cfd08b 0x8691f7b2
+ 0x88bd93f5 0x01846265 0xe5dde3dc 0xc0acf5d0
+ 0x4f4951ac 0xe12d4537 0x8f897a4e 0x4e61554b
+ 0xbc9daab2 0x82b1de59 0x77aa65a9 0x78dd3dcf
+ 0xc457dc3a 0x8df6cdd6 0xafa82b4d 0xf892d037
+ 0x15659e6f 0xd1da82f5 0x51b1da6d 0x8f8a0058
+ 0x8f3da547 0x3a4c96a1 0x6c520f93 0x2560ea69
+ 0xff562ca0 0x8849e4ab 0xb94bd186 0x81d83d63
+ 0xd62100f2 0x10b53f77 0x3f2f3e10 0xea85a3fb
+ 0x3c14492d 0x94972b24 0xee409e55 0x3fe09f34
+ 0xe5bc0387 0xdbf6ed07 0xd2a13228 0x1342a4b3
+ 0x8c1e9332 0x67460ce5 0xedc055ef 0xb33c3a6a
+ 0x1fecac27 0x105c822d 0x38e69161 0x8ad10c3c
+ 0x6c409f8c 0x10f13a50 0x9bfaadde 0xd547a844
+ 0xe604518d 0xc97c118c 0x7a962a31 0xcc3f7448
+ 0xa53cf973 0x39608fa7 0x2efa96ba 0xf0a05821
+ 0x5054d76a 0xb17f737b 0xd7e00db5 0x5fdfe3e6
+ 0xa28102d2 0x2b94e4e1 0x0f39bc76 0xdd012a05
+ 0x2fb574f4 0x16395501 0x74130e6b 0x328629a6
+ 0xf9fb7d2b 0x3d68bdcf 0xc5f03b6b 0x918f5026
+ 0x9cc0e54d 0x246c0133 0x3b2cac9c 0x198d8cba
+ 0x165c8ae3 0x4e1222fe 0xe3358ab8 0xbb920fa6
+ 0xd3efae9b 0x9b1ae032 0x71ef638d 0x37c980be
+ 0x683b26b3 0xcfca82d6 0x8daae26c 0xca7952a2
+ 0x6c1f14cc 0x0c125b4f 0x6088cd18 0xca6fa30b
+ 0x67a717d2 0x4af87e50 0x0b8d486c 0xee99aee2
+ 0x8211f817 0xda042d81 0x4d4e8b3f 0x5ed4f785
+ 0xb735b1e5 0xa221f19c 0x79c8c3ef 0x5f534751
+ 0xe687519a 0x9c4b3c01 0x3e2e8920 0xc3fc6c9a
+ 0x1fe57afe 0x042d100b 0x6704bb3b 0x385ae3bc
+ 0x7a95f242 0xf063b32e 0x446a6205 0xbdea4286
+ 0x89590a8b 0xf29abccd 0xab76135b 0xe3c51cf7
+ 0xfe3d8718 0x9af8d666 0xd741a492 0x93f745ae
+ 0xffdd5db8 0xe98f3ab4 0xf7f41efa 0x6cc9cbda
+ 0x236ebf0a 0xde0b085c 0x2da1474b 0x127ef5d8
+ 0xd3400d6c 0x7b9835d4 0xea2ccd18 0x7a44dbf6
+ 0x20344986 0xd04719b5 0xfddecbde 0x4b3bc441
+ 0xfb3ef6fc 0x3ba485e3 0xc9745a29 0x1d11db63
+ 0x4b7beb71 0x5c3cc855 0x30b18cb9 0x2f0875ab
+ 0x821b49fc 0xb67545d3 0xe8224e1a 0x7bc30424
+ 0x08a741b1 0xb1d782e8 0xf5f92b42 0xf866a709
+ 0x9df02c1e 0xb90be338 0xcfd3b7d0 0xd363a325
+ 0x75ef0539 0xe6ce8816 0xed1a6ed8 0x0276b3d3
+ 0xf8410ec6 0xb34b11a8 0x1a1feb78 0x37059c61
+ 0xd9fc291f 0xa907066c 0x0bb622f7 0x4b5b8394
+ 0x3cb593b6 0xa85f939d 0x3e752988 0xcc036b5a
+ 0xaab617ed 0xdb4c7404 0x3112ffd8 0xa64d7ed1
+ 0xe3e21689 0x100c07f6 0x88712b27 0x5ff60870
+ 0x5ad52931 0xa588761b 0xe27bba56 0x40290b22
+ 0x81c2ec99 0xd96dc1fd 0x743bc863 0xa9bc83b8
+ 0x6c1f57b1 0xb3e49963 0x0e68216c 0x3b91e56b
+ 0x0d0044fb 0xb771b566 0xb9bfb5e6 0x539c1238
+ 0x6537f6f6 0xf3212291 0xca9a7eee 0x94fe56ea
+ 0xff23247a 0x18845146 0xa9b4acec 0xbf88cd08
+ 0xa8bd56db 0xbc48ddd8 0xc9e534e5 0xfb26bc94
+ 0xeb2aab50 0x083e1f38 0xa1cc8db0 0xf6b7388a
+ 0x07ab2148 0x08102d67 0xfbc9db3d 0xda9309ae
+ 0xe1566f9e 0xa5b5013c 0xe95f5cbe 0x5a2f0891
+ 0xc407cd12 0x72f2541c 0xc73d9dc0 0x000326c4
+ 0xf5df8f04 0x04a46fd9 0xda0b0045 0xc0db427d
+ 0x279e6218 0xf65ecee2 0x54207683 0x5f2136d1
+ 0x31db49a4 0xbee12a37 0x8aec9367 0xae726b4f
+ 0x79926b22 0x7b8d6817 0x3566839f 0xaa6778c4
+ 0xcbf46909 0x2c4db79d 0x9cd111b2 0xd06c19a8
+ 0x4e05be08 0xb385e8ba 0x1a97778d 0x3a999b16
+ 0x1f27e052 0x360a451b 0xcecd5085 0xd3b98b80
+ 0x60de8dc1 0x9492c191 0x6dfb20b6 0x82a2845e
+ 0xfa474090 0x2f639c3c 0xb7778b58 0xe70b3e08
+ 0x92e7ed04 0x16330fd7 0xa60979ce 0x37db1b61
+ 0xd5b1c551 0xa1750ddb 0x35cabc02 0x7017d4d5
+ 0xd7b489ca 0x385a53c0 0x5140692f 0x137807aa
+ 0x4d5c15ca 0x4d8e2959 0x7309d85f 0x56620777
+ 0x3b94136c 0x45cd588f 0x16175db0 0xb0189180
+ 0xf7d77e22 0x72bf5c2b 0xd72bf217 0x4f440f3c
+ 0x55efeb82 0xfd328176 0x991c948e 0x18db77b4
+ 0x8cb7c363 0xa6db597c 0xbc0eae6e 0x5314ad9d
+ 0x9e9a823e 0x0ad007b3 0x7c14dc3d 0x4fc184dc
+ 0xcf15e0d5 0xf32b2740 0xf5cde28e 0xc71bb3e6
+ 0x32710afb 0xce14c151 0xc8e1f0dd 0x4f79c217
+ 0x224c6f25 0xa638f90f 0x9960b361 0x3bafdd53
+ 0xee1e338e 0x74a43972 0xe917e85e 0x68f6623b
+ 0x779950ef 0x35f45667 0x4d9f7b72 0x306cb60e
+ 0x96be7043 0x82574ab5 0x51ecdf6f 0x5e89a588
+ 0xeacbd163 0x8c1a51f5 0xc0cc9b39 0x0d9e650f
+ 0x947a3e4f 0xb2f964ef 0x9db5a2e4 0xcdc5d80e
+ 0x27491175 0xbb7e60f9 0xe3f1352d 0xfc06d400
+ 0x45efed2a 0x80416fb8 0x5d391fbe 0xd9e790a7
+ 0x3c62de10 0xe5b340e2 0xd7586e54 0x0bba5041
+ 0xcfdb2dae 0xdf6d5e8e 0x86331542 0xfd291355
+ 0x4804bbef 0xcb119296 0xcaf2989c 0x2ede7994
+ 0x2b8b67a5 0xf21f05f4 0x4ffbfcd7 0xf11da934
+ 0x2a725603 0x01340ad6 0xbe618780 0x404eb1e3
+ 0xb5b9fdea 0x1117c89f 0xe5a203d4 0x2f518cc0
+ 0xf5de0b36 0xc010b1c8 0x583c3089 0x5df76333
+ 0xc1114ae8 0xb4baa895 0x7d57dc83 0x46e9a215
+ 0x9ae829bf 0xea95a2ec 0x641bdac5 0x27c1b542
+ 0x9776ecd8 0x673f1573 0xc59e6618 0x62b7b3f4
+ 0x89f41db6 0x0e4cd877 0xbad7e43b 0x999863fc
+ 0x0508928a 0x87dbb0e8 0x346aacb8 0x0ea45e00
+ 0x89372f68 0xba63fc87 0x2ca89806 0x6b1150b2
+ 0xefe81331 0x75b64ff8 0x653271d2 0x7c4a369e
+ 0xff84d22f 0x4498d4d7 0x9819b64c 0x13603c8a
+ 0x0a11e11f 0x83829df2 0xfbe75676 0xa0956257
+ 0x3925356f 0xc58c2253 0x52fb552e 0x65cc18bb
+ 0xcb96dcf2 0xf0ea23cf 0x09e63554 0x6ac78cc6
+ 0xcd928046 0x56967dff 0x11d6e16f 0x68d423a8
+ 0x0ea348fe 0xc11fffc8 0x554dc1c1 0x63e81f0c
+ 0xf5a5b517 0x7a145d8d 0xe6764ad1 0x9ebefdf2
+ 0x1ea700ba 0x7a41e49e 0xac6ad2ec 0x32430937
+ 0x78c0c0a9 0x0d186685 0x12311c87 0x12334cef
+ 0xa8f981cf 0x97e3f9fd 0x6466f308 0x7c834042
+ 0xf56281b7 0x7f3a48b4 0x7f875a13 0xd5ac8188
+ 0x1b284be4 0x48c0db67 0xbbf1dd5c 0xb048cb42
+ 0x5fd646ec 0xddc5b07e 0xecd7dc52 0xfea93ba0
+ 0xd6d2876f 0x36c646a4 0x05234f63 0xfda3b2ec
+ 0x0d5e885a 0x289442d9 0x1b84cebc 0x24c57b27
+ 0xcdc7af90 0x0d9054b0 0x102b9fc5 0x7c3b7851
+ 0x4fc9b680 0x1027ac0f 0xe9d33d07 0xe70f0d86
+ 0x0b67a11f 0x7b00c993 0x7b944198 0xe9473d98
+ 0x9dbb331f 0xfc68a0df 0xc2bfdff4 0x2645cc1c
+ 0xa432b05c 0x5ff0d00d 0x094daa97 0x86110404
+ 0x13152e68 0xfe61af26 0x73585153 0x5d5d4bf3
+ 0x1e72e7f6 0x29158039 0x67d827fd 0x28891d12
+ 0x277fb2e8 0x688f2cfd 0x6cc5b235 0x2a91ad07
+ 0x73ea8da0 0xdf0b3ea0 0x3483725d 0xe6e8e3de
+ 0xf78e1d07 0x94568c0b 0xfff3f1ad 0xd7ef83bf
+ 0x93788ec9 0x4a85764d 0xe055935b 0x6d4c35ee
+ 0x015ac081 0x3a7d7f7d 0xfbbab5d3 0xd6ba93f0
+ 0xadf23210 0xb3972a33 0x3b27aca8 0x14129a04
+ 0xe054246c 0x49773d16 0x53ef69e4 0x543fab09
+ 0xa3db9f24 0xa1905890 0x603a7878 0x46971d2b
+ 0xb3aa0701 0x71439a8c 0xb1160b2b 0x2500f535
+ 0xeb529914 0x09bc681c 0x886a22ca 0x029839c0
+ 0x24f6fa9d 0xf273b94b 0xd4ed1fc0 0xa725fb0a
+ 0xc1288834 0x298c0de6 0x7ccedef6 0x475cdd4f
+ 0x9b74fe73 0xaca142f1 0x3b90630e 0xafcc14f0
+ 0xa7b9176a 0x18a78adf 0x3717feaf 0x8dfca953
+ 0x964b191f 0x4b2292b0 0xa0ada75c 0x439c2150
+ 0x1b6bc949 0xfd7de88d 0xcafeaee5 0x1b47ea7a
+ 0x4886a9bb 0xcf4f8cb5 0xdafee879 0xffa4f85a
+ 0xbbc7d17b 0x386e6a18 0x37a76a81 0xe71481b2
+ 0x0be3cc58 0xd1abf083 0x6f863841 0xba25ae41
+ 0x7d897088 0x141ac561 0x55636cba 0xa1c6d0f4
+ 0x00f9adb2 0x401e9d6a 0xf82a5978 0x7d75b4d5
+ 0x38f52ee9 0xc9bf7776 0x57e541ec 0xa7326049
+ 0x4eb310db 0x7a911090 0xe980d24d 0x4e4928a8
+ 0xc341da19 0x160d50fb 0x52b629ed 0x36e373e1
+ 0x03156b52 0x7dda6394 0x9016c191 0x10e1c2b2
+ 0x745f2fa5 0xf97a0fd7 0xed78e2dd 0x52cb1fb4
+ 0xf3f5a357 0x7bbb6eed 0xd49494f3 0xd5d282e6
+ 0x331457a2 0xe0986390 0xabd4ad46 0xffd32433
+ 0xc6760132 0x17edf947 0xef74541c 0x6c633d01
+ 0x1bfc8944 0x66ae5f06 0x49180ca9 0x9439b3a5
+ 0x0109ab6a 0x9988841b 0x3138e4b9 0x0c041259
+ 0xdd2d6cdc 0xba4aef87 0x00b54150 0x1af1eb60
+ 0x17362972 0x4e9e7391 0x2a4c8c0e 0x86e366c6
+ 0xc4d32a69 0xf9682136 0x89a37daa 0xab0f206b
+ 0x4bc10c8c 0xdf1448c5 0xfb04128d 0x801adf60
+ 0xc610756c 0x427fad0c 0x94e62b1e 0xab472ed0
+ 0x18390093 0xa57beb73 0xf76ef93a 0x47f81306
+ 0x6a1f16b1 0xb5a3cb25 0xce9234b3 0x7d7be393
+ 0xefc9352b 0x20469b4e 0x78d2d7c0 0x52d5a924
+ 0x8dc1e477 0x9535e2a7 0x14a76758 0x00c3b32f
+ 0xfc9b912e 0xe199d9ef 0xefe2a54d 0x9fe26d7e
+ 0xe782325f 0x225fff1b 0xa57f1197 0x9156e416
+ 0x194055ea 0x0660af3c 0x658a517f 0xc90f5346
+ 0x4dcd36cf 0x5e225bb0 0x6e52580b 0xf12142b3
+ 0x20495447 0xe75f4145 0xdfeda257 0xaae519ad
+ 0x0b1fafa9 0xd70bddc9 0x66131cd2 0xea6513e5
+ 0xdb3e7f2e 0x393388fc 0xc712bc66 0x5dcfd28e
+ 0xa6c8ef27 0x6e82503a 0xc8fed6cc 0x37f04c92
+ 0xf0bb837a 0x8adf1397 0x2c2e09db 0xe6ebdd65
+ 0xba2f5430 0xcfa2d541 0x398ef4b7 0x1c1a1525
+ 0xfed5250b 0xc8ea4537 0xd9285c99 0x4ee366c0
+ 0xf00ce3a3 0xe36d4ae1 0x41a85806 0x3b26c890
+ 0xb5f8bbbf 0xef64d87d 0xb7983644 0xef77edd7
+ 0xf0c98c90 0xea55a358 0x3243d74f 0x8e7ecc0b
+ 0xfd6e5cba 0x4ba3353b 0x2b71f634 0x068abf5c
+ 0x2c7d2629 0x5ca26d59 0x69558629 0xef7dd3e4
+ 0xc5b45181 0x9b8dcc34 0xd42804fa 0x97863a0c
+ 0x33e67d39 0x4964aed4 0x8ddf1f63 0xaf56235e
+ 0x395e9cbf 0xe4e312d8 0x54a95a58 0x1a20df2f
+ 0xc020be59 0xf766cc8b 0x90f0a8fc 0x975e7117
+ 0xc9c67436 0x47a32de8 0xc8b4b4ad 0xd7ad6e3b
+ 0x7ea90e0a 0xc888c20e 0xa7b34096 0x49408ad6
+ 0x196a44a2 0x0c976185 0x3661073f 0xec9f2ff6
+ 0x363e340e 0xf5bfa91a 0x460b2797 0x8d31424f
+ 0x92067803 0x4b8ea711 0xaa64e9e0 0x99af04e4
+ 0x5f4ec94d 0x984ecc59 0xb46e3237 0x94ae2df5
+ 0x406aceb0 0xc2db3748 0xa2ccce68 0xe4aaa783
+ 0x848d3790 0x9310ceaf 0xf03f5227 0x5cfcfee2
+ 0x86f79341 0x8ae74083 0xcdcfbd57 0xb73c78b8
+ 0x46d53ce7 0xaf63127f 0xc8af1f62 0xd9345e73
+ 0xd5a843dc 0xdfe408ed 0x2b0a5a74 0xfc5e83b6
+ 0x02b82383 0xd11a8304 0x9eb33f49 0x780258e1
+ 0x10ecc11d 0x3d86f81a 0x4135e11b 0x7b3c13fb
+ 0x9d497a35 0xc98a53b5 0xa2662751 0x67411a3e
+ 0xb7b2ec7b 0x4df0fa7a 0x27f27874 0x0e3180cb
+ 0x9ce8a228 0x52ed9080 0x7419dcf4 0x39b6bb03
+ 0x5f2fc03f 0x9c0b3310 0xc71ae18a 0x596789fb
+ 0x0f5b72fa 0x93d2df5c 0xa1b39822 0x972f2f23
+ 0x3dbab78b 0xf58f6c2f 0xc6641558 0xf4c4c4ee
+ 0xc8bee865 0xec52beaf 0x25cfcf49 0xf9effa32
+ 0x4da772ca 0x550135cf 0x135cd4b0 0xfb3467a1
+ 0xdd9375e8 0x1bb87880 0x2212e688 0xad1cb275
+ 0xc3ec168a 0xf673b7b4 0xa37cb4ba 0x496b8bd5
+ 0x040481ef 0x32952c2b 0x694d71c3 0x224c0566
+ 0xd53264ce 0x4151ec8c 0xbaa0aecf 0xb86f2bd5
+ 0x7de90b99 0xf2f8e815 0x04ed273f 0x36587931
+ 0x4d15c3c4 0x17de4bac 0xdee68b3b 0x7a2b0434
+ 0x6a2c7cc5 0x1b73fd40 0x35eb37b2 0x23e52371
+ 0x73b31abf 0x7bb9e3f0 0xecc6fbe1 0x88c73c81
+ 0xee50ceac 0x6721d013 0x4adc7e60 0x598f6e88
+ 0xcc7826ac 0x37b443ce 0xa0e46430 0x51a848e1
+ 0x75990dd8 0xd9dc6164 0xaa8ac8b1 0xc68ae7bb
+ 0x5d424bf5 0x6f3f6adc 0x7c5c5112 0xd4052c5d
+ 0xfb5930ea 0x899798ef 0x3612772a 0x3d09d7cb
+ 0xa4e4bf10 0x32539b0c 0x13dc2f07 0x3d0a5dee
+ 0x4e8b1433 0x8f0299c8 0x84398672 0x8fb4eaaa
+ 0x3e0ea530 0x928f9160 0xd0c59a0b 0x63212ea5
+ 0xfb58f129 0xd23cfebc 0xecc0d9a5 0xaa19360a
+ 0x0d8d5cda 0x9cea8440 0x3302fb43 0xfbe4cc65
+ 0x84c87f41 0xdc887170 0xce6d073f 0x6b1f95d5
+ 0x32cd021e 0x1238650d 0x46a4b16b 0x969889d1
+ 0x05066b32 0xe5d5db39 0xe61132cf 0xc83c73cc
+ 0xd9a26b2b 0x1e8514d9 0xa4ee1099 0xee5b0979
+ 0x809c85d1 0x7c915969 0xc19de1de 0x5dc57999
+ 0x05aaf1aa 0x9bf127cf 0x5500e2e4 0x0b58a12c
+ 0xadff8f92 0x97fd18c5 0xb65ca67b 0xac997c27
+ 0x183a2353 0x0d4885a0 0xbf07de7f 0x7acd2fe0
+ 0x1305967a 0x73ffb3f6 0xd56bfaae 0x8bb522bd
+ 0x4ec60a1c 0xd15e73a2 0xf5d5e543 0xd1936082
+ 0x0e5f1e3f 0x82b630e5 0xacb42758 0x60457204
+ 0x4db21d80 0x63268543 0xa74445eb 0x4da0ba72
+ 0x86a911fc 0xff6eeea5 0xd9b841c2 0xcd8eeff0
+ 0x7d5f71d4 0x79276494 0x7fc1532e 0x35b84999
+ 0x3ae06442 0xdcb11206 0x220d92cc 0xfb716e84
+ 0x106cf027 0x79265724 0x420c10a6 0xb76ebb4a
+ 0x19ea9fff 0x9b4c6e5a 0xd7362c61 0x2587a379
+ 0xea661035 0x33f2b5df 0x24fb5e4f 0x350973e8
+ 0x3e7acc52 0x97fefe48 0xe9494f9f 0x490935bb
+ 0xb570c9b7 0xff52cd9a 0x925bcd3c 0xac372cf2
+ 0xf8a77b40 0x7ebc3984 0x9b61852c 0x81e07c63
+ 0x7992e762 0x07517eb2 0x7b2ba667 0x09bb1d78
+ 0x0514bbfb 0xb1783dc2 0xfe4e7fc3 0x76822498
+ 0xf67c8bd8 0xe44c8216 0xfc0d30c9 0x99660ddf
+ 0x87bdabef 0x5f0aff39 0xa8cf6af9 0x3d1b8f76
+ 0x17f475b2 0xd08c6d1c 0xf431aeda 0x76c43999
+ 0x7f101532 0xa09e63e2 0x6fbd3a20 0x0456123f
+ 0x23d69239 0x389e916e 0xf13efcc8 0x2a00281f
+ 0x8cdd42ad 0x5ae6f695 0x6ba7f99c 0x4ea30128
+ 0xaa10f592 0xaa7d8d67 0x73159f38 0xad352429
+ 0x42e49d5c 0x66595b5c 0x46dd2f35 0xe321a946
+ 0x0b9e476f 0x97d89aad 0x6c774f9c 0x6a78c7c0
+ 0xe9db7e8e 0x936b0794 0x7de947c6 0x86c2d7f6
+ 0x4088019c 0xf2ae9570 0x3f766b87 0x74a306b2
+ 0xe287dab3 0x789504fd 0xff9ea9ea 0xc71002bf
+ 0xe162c8be 0xe59a08fb 0xd24079d2 0xdde8e548
+ 0x5a05697d 0x6043463a 0xb730f504 0xbba93972
+ 0xeb63ce5b 0xccdcd737 0x1c0403a9 0x0e22357c
+ 0xa6eb5b59 0xde4ac8b2 0x8678668b 0x8e21df3d
+ 0x6fe75aba 0x42554c7d 0x58cd2a81 0xd503c6c5
+ 0x7bb58d0a 0x1dee3f4c 0x8b971ca4 0xe8222a21
+ 0x59f67b2d 0xa8ae44d3 0xc1023b05 0xac1950ca
+ 0xa3879faa 0xc2b4e30f 0x87109909 0x19497132
+ 0x33dede03 0xce3bb967 0x78f25931 0xb7b6f9ea
+ 0x7e04ac4c 0x2205aaf0 0x58542633 0xbf829e22
+ 0x5b1888f5 0xe354dfc6 0x76459dcb 0x0ca1ec70
+ 0x5c9fbd45 0x3e70df73 0x9d73570e 0x81f6b1b3
+ 0x3ff497b8 0x3c6c1409 0x1a0d08d4 0x0dcf49ac
+ 0x324f8fcb 0x08d7ff92 0xb5631b97 0xc3490c90
+ 0x969d4cdc 0xcb5ba099 0xda817065 0x07862b6b
+ 0x32fc8988 0x2cdf060e 0xcc4dd974 0x9c42baec
+ 0x9b2a2a21 0x1e2241a1 0xb0e1cb78 0xd62e1d9a
+ 0xff793d44 0x953863d2 0xf0da874b 0x1d60a9e7
+ 0xbc91e4a4 0x6e782750 0x1621cef1 0x99282d4f
+ 0xf7e0e472 0x9f6fc05d 0xae4f5395 0x09f8f78a
+ 0xc3f194de 0x8f4233d4 0xd4850906 0x05c0c011
+ 0x12a9a805 0x0058c2fc 0x7cf4c088 0x785c0d53
+ 0x202f7fd0 0x5562e41c 0x4b78c95b 0xc23b4cde
+ 0x763b6697 0xa5ed06ea 0x04e24f13 0xe4b2088b
+ 0xb1adf6c0 0xfe2b4df4 0x63dafcb2 0x7d86b66c
+ 0xa2012dbe 0xc39c7866 0x27530159 0xc7f0a0b5
+ 0xd22971a9 0xc092c6f3 0xe7de0bbb 0x5bb3572a
+ 0x7b0800da 0xdf370aea 0x4006f1dc 0x09518047
+ 0xdf8ea9ae 0xea791ff3 0xd256760e 0x103a8d26
+ 0xa96153c3 0x68b46384 0xe1e33cfe 0x7f9d352d
+ 0x6251e36f 0x58519610 0xf16b6040 0x37a9baf8
+ 0x81c0026c 0x0588afac 0xfba288cc 0x1dc42a1a
+ 0x5d41af78 0xea4fdcec 0x66ba98ad 0xce81a06b
+ 0xe85dd4b6 0xae8998ea 0x700cc21e 0x8d5df4b9
+ 0x8e4388ef 0xc5d566d1 0x3cbb3fa4 0x3b8ef9bc
+ 0x15017d02 0x5064cc6b 0x74248edc 0xc1f0affc
+ 0x6888e988 0xf6b7b234 0x87f41320 0xffa17183
+ 0x77924fd6 0x789785ee 0xf3613ee6 0x393ed47d
+ 0x03ee805b 0xe5469529 0x53299ada 0xd555232c
+ 0xa561286d 0x21d41ec6 0xd58f7665 0x61a5b849
+ 0x6b8fc21f 0x715d1cd8 0x1b295302 0xf3856fd8
+ 0x87e12015 0xb77a43f5 0x73f2f8d3 0x565fb49a
+ 0xdc064b4a 0x5f8e28ba 0x14de6a35 0x397fd796
+ 0xf2713e96 0x9b410701 0x47942eca 0x89d3dae0
+ 0xf6255e2a 0x22af994a 0xa63d0e33 0x4a85cccb
+ 0xab341593 0x07f73cfb 0x07f06a61 0x675bb9da
+ 0xeeb2ef7d 0x69320097 0x3580f4b6 0xc2ccb1e3
+ 0x0b0ecf68 0x3a9ccb95 0xf7b12b91 0xe678a5c1
+ 0x2e2c3616 0x1cd5f11f 0x57e69fc2 0xe7d784d2
+ 0x633fe3ce 0x498cd506 0xec34675d 0x4c06b624
+ 0x02c81653 0xb8f19413 0xa448a3d4 0xa29eaaa7
+ 0xb82040ca 0xba43097c 0x44771e12 0x3c210021
+ 0x9a6ef1f1 0xb41f5d76 0xe46be509 0x59ebfa66
+ 0xf0541902 0xd4f116bb 0xd68e1c39 0x6f6ee876
+ 0x2a95733c 0x4ab04908 0x54433296 0x6ae55d87
+ 0xa4297ea1 0x3d5ba5e7 0x4874794d 0x91dfacba
+ 0x61e3868d 0x4934786c 0xb5d08504 0x0b589e13
+ 0x20ed8fe7 0x8928b007 0x74231e4d 0xd08ae28c
+ 0x214a2d90 0xb4e86908 0x87e9ffe8 0x4379fe18
+ 0x5613c5f3 0x92556af5 0xe057ac38 0x5c706fdf
+ 0xad5ab3b2 0x614c247f 0x1a1ae839 0x6a12e0b9
+ 0x595d02ea 0x4a3784c8 0xdcd10560 0xa9fdce4e
+ 0xde30047b 0x68044489 0xe8c6a3ed 0xee2e9140
+ 0x1c9786b0 0xe923e849 0x4253cdc6 0x2a88805a
+ 0xfe3cf21c 0x3e0fd06a 0x1de52860 0xd9bc4766
+ 0x7fdd8310 0x85b81370 0xd4515cbb 0xd8c4529f
+ 0x3a6b0087 0xaf7b3eab 0x35a9f9c5 0xcb2dee2d
+ 0xc2dc5eba 0x4fad7365 0xe949f027 0xa661918b
+ 0x7de7ac66 0x79a79781 0x2fd7a72d 0x106f0863
+ 0x9944ba95 0x774719d9 0x96fab1e7 0xb9f5e57b
+ 0xafa42488 0xd60053da 0x195b355f 0x00a488cb
+ 0x6bd8ac6c 0x68f42580 0x9b24e1b7 0xe051d90a
+ 0xcc303b59 0x127fb687 0x75aec9da 0x41b2172f
+ 0xc212cdff 0x44dd927d 0xceabdb0e 0x7c5a5ffe
+ 0x78ddaaf2 0x0dfda5de 0x2e2f3645 0xf8c23d24
+ 0xf9cef11d 0x1c11f3d9 0x49748cc6 0xe168353f
+ 0xe32b5678 0x23135d35 0x5d18c760 0x83500ece
+ 0xa4ca1521 0x64da0411 0x73f7c159 0xc1450c89
+ 0xd678fb9f 0xbe61b22f 0xa7dced66 0x75bc6601
+ 0xb9bb83b8 0x0b2dbcc7 0xb037f875 0x28b67597
+ 0xa5494bb3 0x77f73fac 0x460e3ea2 0x8d04b992
+ 0x1a5473ed 0xe15dc011 0x4358b9b6 0xb841bd32
+ 0xebfd0cf4 0x1f154cd6 0x5472d51a 0x5868057e
+ 0x0e6ddf96 0x56167f00 0x9366e9a4 0xb910f4b6
+ 0x1ce725c0 0x19e47c3e 0x2b7def54 0xa41ba975
+ 0xb18d73b4 0xa8928f7c 0x42d41b6a 0x36e45805
+ 0x6acb9862 0x9f9e3faf 0xd210afa3 0x531fdd05
+ 0xc700476a 0x0d20590d 0x634abb30 0x6fd34f59
+ 0x31270c92 0x61281d99 0xaaaf0d99 0xbef01a81
+ 0x911ee0db 0xd4dd34e6 0xb4ed321f 0x836e0456
+ 0xfafe9ee6 0xcec3d176 0xc8feacfe 0xaa78be42
+ 0xfcd2a6c9 0x85c52e32 0xc00e0b2b 0x23ae87e1
+ 0xfdab99e9 0xc2403118 0x7df6bb22 0x5ccd1c47
+ 0x84d08ce6 0x45937da1 0xb3df11ef 0x6462dd41
+ 0x32af313f 0xda1266cb 0x08591f3a 0x862fd070
+ 0xbe9176a9 0xb7934784 0xbd323ecc 0x550be9b6
+ 0x45f912d6 0xdfe9d0f4 0xea84ef59 0x394bce1e
+ 0x42e94a55 0xb81ffa90 0xd741bba1 0xb690207b
+ 0x2b120333 0x7548a8fc 0xc089f30c 0x288443a0
+ 0xf3bd8eeb 0x31e37bb0 0x6c5e755d 0xd311b84c
+ 0xeaac7adc 0x07c23f8e 0x11d1699a 0xcd207b08
+ 0xc6407bba 0x9827894e 0x46c91baf 0x82e21b56
+ 0x76bf2c72 0x0f55bd2c 0xfc5d6853 0xf88d1e03
+ 0x94c643ec 0xa708c4f6 0x21dc5dbf 0xe59ac098
+ 0xc80ebf22 0x3324198b 0xfb45f988 0x0226a02d
+ 0xbccc6f40 0x89e6a1de 0x59f7c39d 0x4694469e
+ 0x693d3d5d 0x0b38d0a0 0xeb0a72b5 0x7208517b
+ 0x40310537 0x436c9a71 0x3c479b18 0x17e4b154
+ 0x3b41580d 0x450991d7 0x4d76b0d3 0x46e34079
+ 0xa27bb1b0 0xb99a5c34 0xb96c40c2 0xc63b7a4a
+ 0x442a9d21 0xfb6db7c0 0xb31a89c1 0xe7f6bf0b
+ 0x5528a8ac 0x8eed191a 0x10e6d50a 0x1a9bd4f0
+ 0x5436b0e5 0xabcaca12 0xe82490aa 0xef7bf6ba
+ 0x54376519 0x6368263b 0x4a125ac8 0x4bf533c8
+ 0x09f9355e 0x64eb02cc 0x4fc27ae2 0x8bd26def
+ 0x64fd9ef8 0xe314729b 0x7a2adcc2 0xbba495c1
+ 0x1e747882 0xf569aa01 0x08c48bc4 0x3c75d45c
+ 0x6e75c728 0x7fb98e42 0x5a254bed 0xf97ad9ee
+ 0x3c740138 0xaa031c23 0x63a64b23 0x90b6395c
+ 0xa527fad9 0x525434ae 0x9404f8e7 0x873f3702
+ 0xe8d7acb5 0x174281c4 0x83f5ca85 0x5b37aab8
+ 0x612c5543 0x91cf3160 0x3ea20c63 0x6099e8ee
+ 0x4d834d4d 0xd2210d3c 0xa692ea70 0xf01e8904
+ 0xefd7d188 0x04b10c7d 0x418fb623 0x7d2fc0b0
+ 0x1b5278be 0xb693d7c9 0x60fdf6ee 0x7ece8c37
+ 0x92eba7f7 0x7a925b1d 0x344552a4 0xdb2cf628
+ 0x4d2a59b8 0x6da97a8c 0x322529d3 0x59140695
+ 0xea6b9f9f 0x1b863b1d 0x2d5fd42f 0x5434d15c
+ 0x642c5645 0x32cf7bf5 0xd4c04783 0x13e6f185
+ 0xc32e96ed 0x1bd13970 0xb35313d8 0x392a0151
+ 0x22488ad2 0xad9f285b 0xfdd7ff53 0xdb554e65
+ 0xfbcc1e43 0x1a37ad95 0x12d38316 0x68bb1b6f
+ 0xfd975bfe 0x3687c1dc 0x4563b4d3 0xc7a94f02
+ 0x85722a8d 0x78320fdc 0x77662dcd 0x3a3f3642
+ 0xbcd5b65b 0x113ec4c8 0x173268d6 0x3ee59f92
+ 0x19b8dfe2 0xa83377cc 0x83683889 0x659befaa
+ 0x4485df8d 0x7708fabf 0x44dde54c 0x3af23cbc
+ 0x7e4d3048 0x737a865c 0x7160e23f 0xca21b20a
+ 0x0433eae9 0xdaf47e67 0x24f18868 0x1cab7482
+ 0xdf05b48a 0x69a42384 0x63a7a43e 0x316cc018
+ 0x74f34be0 0x170dea21 0xec9fcf44 0xceb0e68f
+ 0xc7f0e924 0x7d8bda46 0xb2c20026 0x1571a800
+ 0x1fde1a61 0x3e3a22b3 0x62ef6e0e 0x984336cd
+ 0xfbf0e5f5 0x70b67258 0xdf903425 0xeb54f70f
+ 0x886b58d6 0x4b10d7fe 0x849b310f 0xcd39e60d
+ 0xff41ad90 0x6a0a3df8 0x3cf8b078 0xb38ac71d
+ 0xb5facad1 0x65a70948 0xa26997bb 0x8c92c2b4
+ 0x7471c53f 0x9323b393 0x0cf70ab9 0xa37c8ecc
+ 0x4a807b5c 0xbd83950a 0x6ec9e16d 0x40d62e3b
+ 0xdf11015e 0xa7ff5ee8 0xf5585b3a 0x1fbe36b3
+ 0xca132fc9 0x41958f29 0xa7c7a1bd 0xd41b88e1
+ 0x8b723fb9 0x122db730 0xee76db7f 0xb13ea7c2
+ 0x288f3d79 0xd10d82af 0x4a8a62d9 0x79bff991
+ 0x5dc3301e 0x7f1a25e3 0x7636784d 0x8578642d
+ 0x5afb8f70 0xcb5a7515 0xc5e74b59 0xfad50e55
+ 0xd4e30207 0xb3d96b9e 0x1fdc91b9 0x87493d65
+ 0x84cbbf69 0x7d7182ab 0x27d0ef36 0xcfda02f5
+ 0x40fdf283 0x2de373e9 0x7562fd72 0xa84f70fc
+ 0xf5d0d0b1 0x320a765e 0x7e643413 0x2a53592a
+ 0x0de440dc 0x3d74cf31 0x74a2a3e2 0xb23d6788
+ 0xbf7a95e7 0x9825884c 0xeee45682 0xb5b4c7c8
+ 0xc3a7f9f2 0x5ece37f6 0x292a0559 0x719b0312
+ 0xe567988a 0x93ab533f 0xe533370b 0x7bc50a08
+ 0x41dcf01b 0x28ae927c 0x630ea007 0x49656cd3
+ 0xe5bedbe2 0xfce7631e 0x6846ce25 0x708367f0
+ 0x43a67c95 0xe92cd7fb 0xaabb55fa 0xfe4acc1e
+ 0x2ca611a4 0xbe5dbdd8 0xacc6e736 0x04841338
+ 0xde45a48f 0x2bc5183d 0xf5d35047 0x3eb2eecd
+ 0x5418f40a 0x7d16472b 0x14d207ce 0x54a36e56
+ 0x65008a50 0x212bc84f 0xcad5e399 0xd25dc624
+ 0xe7b0fddf 0x60aa4951 0xd17a4a74 0xd1e18d5e
+ 0xd48ee4c7 0x1e888f6e 0xc928e8eb 0xc43b64e8
+ 0x2a11df73 0xf6dd3d0b 0xca850c7e 0x474d4db1
+ 0xe8bf9ae5 0x22b41c6d 0xd1f1ef6a 0xc126ca17
+ 0x407b7517 0x55a6dde7 0x804f6d7d 0x7c08faaa
+ 0x72c998e1 0x7fc79a9a 0xda06e2b2 0xdabf393f
+ 0xd9276c53 0x74e7e4c2 0x0d4bf502 0xd1d7c5ea
+ 0x875cbcb9 0x6cfb2c10 0x64c2b561 0xea10e25f
+ 0x26d6de7e 0x4725b565 0xcd3781a5 0x7c03ed14
+ 0xa863085d 0xc07843e3 0x158f686a 0xa05ea8a5
+ 0x9b6c89b4 0x56aaeb67 0xf629081c 0x43cdfbe0
+ 0xf60a231f 0xd9994447 0xd4328af1 0xf2b771d9
+ 0x5edf23af 0x98ffc84a 0x7942201d 0xad44cb25
+ 0x8f9d2422 0x7278c6cd 0x5f62c6c5 0xcc41eac3
+ 0x4e71353b 0x273af945 0xbae89c3b 0xf63349f1
+ 0x5b44bceb 0xf37bedc3 0x2698fdc1 0xbaac0de3
+ 0x6acbcd11 0x27b5ddd4 0x1df197ea 0xe2a576c6
+ 0x50783d87 0x8eab25ab 0xd79d476d 0x8532782c
+ 0x37ee030b 0x6e638e06 0x8650c83e 0xa1ae3206
+ 0xd72abd48 0x55e94bba 0x2dfb25e1 0xcff3d98c
+ 0x9936fcb5 0x8959a486 0x5bd30cfe 0x53dd356c
+ 0x3443ce5d 0x91337d8b 0xd081222f 0xd14fc07b
+ 0x68609843 0x572ace06 0x28b96e42 0xbba7c9cd
+ 0xafdb8edb 0x2cfe192e 0xf8cae44d 0x5bbff8d3
+ 0xcecc6bb5 0x9edac99d 0x355e6d71 0xabed645f
+ 0x8085fb33 0x565d74f4 0x2c8ee192 0xba7276b2
+ 0xef1ae1c2 0x433ec40a 0x564bbb47 0xc74e9dc7
+ 0x6fcccdb4 0x4e01308f 0x16d945a7 0x29ed35fa
+ 0x9328cf10 0xad3d658a 0x3d2f6aa9 0xf7dea386
+ 0x2b14c435 0x259d417d 0xc25061a1 0xcbb30944
+ 0x07457b0c 0xa5f352e6 0x76dc8156 0x82cddb23
+ 0x8c4f163e 0x9307db9a 0x9c1335fe 0xbe7ab810
+ 0x84d8b6c3 0x4bcf6fb8 0x78456523 0xed825b19
+ 0x0007364b 0x56c39a7c 0x407e5e5f 0x7e50b91b
+ 0xfb1b4da9 0x62e94e3f 0xc1c34997 0x20c6d4e0
+ 0xce9d05ce 0xf7558b1b 0x097b99b0 0x66c2cb97
+ 0x71189bca 0x4144f358 0x12a70cb2 0x179fa9b4
+ 0x94d4acba 0x44a77a51 0xa815e160 0x00ba3204
+ 0xbd41d6e5 0xedbbf7be 0x53c62fce 0xde596636
+ 0x6dcb0bc7 0xe5689e30 0x3557eb61 0x32fa1131
+ 0x0b71f616 0x41b11371 0x9272079a 0x7d91456a
+ 0xbe58797e 0x5a42bde7 0x5545cbf9 0xb26db577
+ 0xac1b10d3 0x723b95d9 0xb40d3998 0xbf75126f
+ 0x84e2bdff 0x50ed4d3b 0x918a974c 0xf8d9649e
+ 0x35d76697 0xb262e991 0xc15bc480 0x654a6404
+ 0x7a76a020 0x039112f3 0x64d9e8c6 0x45bd67f6
+ 0xc8cc5187 0xed9fce97 0xf47af956 0x188c783f
+ 0xd7d163ef 0xfac2c447 0x251feb6d 0x1bf02539
+ 0x2f039ba0 0x4cbb7532 0xa9bc6043 0xfc669e51
+ 0xe84848c9 0x8dececc2 0xa0cce802 0x64dcc7f3
+ 0x8bfbdc32 0xcc39105e 0xc7041c56 0x1086785a
+ 0x6378e1c8 0x472b1153 0x660ffc42 0xc0b5220c
+ 0x68a76c49 0x0932e082 0x5a65df76 0xe90028e0
+ 0x94083531 0x3cccbcdd 0x5843d223 0xae6d84e0
+ 0xb491638c 0x8a5d5e27 0xc256865c 0x55f8474b
+ 0xdf49d454 0x2f0c8ead 0x0775d272 0xdec275ee
+ 0xcc2dcad1 0xd9375085 0xc5bfb607 0x787ddf25
+ 0xed50f8d2 0x791cc44c 0x9813ef08 0x53dc5349
+ 0x64388d8d 0xcc973f31 0xaaa4e3e8 0xa0a62f9a
+ 0xdc807786 0x9f08060c 0x7f3215e4 0xdbe18ffc
+ 0x2e3c472b 0x75af4ce8 0xb970b528 0x24ff6c05
+ 0xd8765bf1 0x66bb3062 0xd9beab31 0xdc3f67ec
+ 0x3626c356 0x5b7fff0e 0x3b69f0f3 0xeeec7672
+ 0x458dd8c7 0x01fc98ff 0xd77b54a7 0xbb977768
+ 0xdd8cd676 0xd3aadb42 0x4cf8146c 0xa1995736
+ 0xdfac95dc 0xfeed8d4d 0x6374914b 0x332112b7
+ 0x763fac3d 0x05574470 0x17dfbbe9 0x82366ce1
+ 0xabcec744 0x0415e04b 0x514997ee 0xd5352b1b
+ 0x61380140 0xa6f58b5f 0x4ed4d7aa 0x0bd94f3a
+ 0x1d77257c 0x2faced14 0x3208775a 0x5106ea55
+ 0x63f6638b 0x5487c618 0x09bb75e4 0xc7016e51
+ 0x7a4b97db 0x49ca9b5c 0xd5935595 0xdf4c53b1
+ 0xc48a8bf8 0xfc918e77 0xcc8f8391 0x5e01ccdc
+ 0x76f8eaf4 0x65fdf363 0x9f8ff68b 0x374e0972
+ 0xcd3d2b3b 0x705fd33e 0x4676be98 0xe55dd0b3
+ 0x5d320643 0x0177236a 0x191f349a 0xc509f6f6
+ 0x24ce75a2 0x0e89ab61 0xc645e5f3 0x70abbe8d
+ 0xddb3100c 0xcb3dc211 0x21cdc6c0 0x39c180b7
+ 0x7dbd7a3f 0x10096c5e 0x51aa0e57 0x374e1c24
+ 0xad4499c3 0x9c147248 0xf7d71841 0x7dc43952
+ 0xdf44e196 0x240af2fc 0xc0480049 0xc4349b93
+ 0xf197c246 0xd635758f 0x25ef779a 0xac9f2109
+ 0xb6f62ecb 0x2bf07b64 0xa8b4685d 0x36979990
+ 0x6887d9f5 0xd2612a38 0xb015001b 0x1f5b3fb3
+ 0x5222d20d 0xda1b8a2e 0xb67a3bb0 0xe3594883
+ 0x1fca07d0 0x99e19d74 0x4ccd57ae 0xffabd989
+ 0x12d7abb0 0x9a601f63 0x386a592b 0xf9875f84
+ 0x09a668a6 0xb084ffe3 0x18767678 0xd274125a
+ 0xbad57d37 0x995de6fe 0x510e22e6 0x4f609bf3
+ 0xac7fa65e 0x2d01f56c 0x702ffe23 0x95675930
+ 0xecf6c705 0x60b3999b 0x592edd95 0x225dd441
+ 0x307eaf9c 0xa266d125 0x535f54bd 0x3fdd8447
+ 0xb50232fe 0xbd529b2c 0xa18f4b08 0xcb5e665f
+ 0x855a893f 0x62b0f1cb 0x05a6b7fb 0x5112f3f3
+ 0xa8282b3d 0xad79d030 0x18291569 0x50cd76c3
+ 0x5b72b8d2 0xf873d71a 0xfe8238ca 0xa286370b
+ 0xbe7a6071 0xf19e8646 0x03915270 0xfdf96d7c
+ 0x0eebabe1 0x737acaac 0x57ae375f 0x34f6470a
+ 0x00e0956b 0x2280c408 0x18a7f080 0x4be2761a
+ 0xc20c3c03 0x652f61a1 0x681cf2ba 0x90a76946
+ 0xd9e81d1d 0x6c935503 0x0243964d 0x4d6548c2
+ 0x7b4a5973 0x12cc8e36 0x248da3c8 0xb21cebf1
+ 0x809343aa 0x78a4e27b 0x2fcc02b0 0x09ad9174
+ 0x20b8f784 0x7dea74df 0x0440f402 0x61961b3c
+ 0x2ca4bb12 0x4a04d9b6 0xb28242e9 0x410d5237
+ 0x7aa0bd8e 0x8ea39021 0x0e65c9cd 0xb01500b8
+ 0xaaa7dcc1 0xd08390b8 0xa4b8a97a 0x8cd02001
+ 0xecaccf41 0x633c7006 0xa9c2346d 0x526e9446
+ 0xf959c633 0xcfe32892 0xf7d7ae52 0x345e1dda
+ 0x03d22449 0x0d5a42cc 0x10605e60 0x89c7c14f
+ 0xccd10bc8 0x1a83309c 0x0bc3108c 0x331ef896
+ 0x11089de5 0x579b7061 0xe78c6535 0x186b50d2
+ 0xc0257051 0xf0954f4b 0xe97bd497 0xfa80c57c
+ 0x5fff084f 0x94a4d534 0x58cb76c9 0x2b6833e9
+ 0x596c0b17 0xcdf9b85e 0xb3bd39ae 0x207bb792
+ 0x9b9faf14 0x3ca7bc61 0xdf563ed2 0xcc047ccd
+ 0x5210afee 0xff010b40 0x5720ed85 0x21d51621
+ 0x3533cb99 0x0aa899a0 0xa0deaec9 0x08bfab41
+ 0x39247564 0x41efb3c1 0x4164db69 0x1652786a
+ 0xab748ead 0x5d10bfb3 0x5efc86a3 0x7cbda76f
+ 0x65636fa8 0xdfecccac 0xfedfcb07 0xab2328d3
+ 0x42dd5dd5 0x5b2d84b0 0x55531305 0x699bf734
+ 0xa8261501 0x4e2070bb 0x0b927703 0x06748069
+ 0xf9a1b399 0xe08b5427 0xba31583c 0x967ceb20
+ 0xd187f5d2 0xcfb55282 0xb84f48e1 0x5d35fe15
+ 0xe785b043 0xd0dc77e2 0x85df4fb2 0xdb77f89c
+ 0x6b2accdb 0x58a47118 0xb0f8d24a 0xc39e7f23
+ 0x52944e9a 0xd1006214 0xd9aba59e 0x42bd3bd9
+ 0x8b7e1cac 0xf2c23db8 0x801ebde9 0x41cbb528
+ 0x1b0c84bd 0xafb6487a 0x79b44529 0x1ddb236d
+ 0x7035b8c5 0x7191ff1c 0xccff144a 0x5c3e8e08
+ 0x7685dcac 0x6fe12e13 0x05097918 0xc2116c7c
+ 0xc22b04eb 0xce3b93d1 0xcb0182a2 0xa0a7e1ea
+ 0x9bf205f5 0xaa86e3c6 0x4f8b42ae 0xc0818993
+ 0xa331cd1b 0x220686c1 0x63100651 0xfc69d85c
+ 0x91281ba5 0x376d0dbc 0x04cbc901 0xfd1469e8
+ 0xbcefcc0f 0x56653d6a 0xc2154d39 0xb4327949
+ 0x4198bfa8 0x32613648 0x9ae013b8 0x656431b5
+ 0xd8bd20de 0x6ffdd852 0xfa6c2024 0xc5b94dd2
+ 0xb1d0d9f6 0xb660a472 0x4ff02e71 0x0d31712c
+ 0x6abac5b6 0x42f10492 0x786d6dd7 0x4f20c20b
+ 0x5e968a66 0xafb3cb2d 0xab055fdd 0x658f820d
+ 0x2c66f544 0x53bf2921 0x6d0f63da 0x438bdb0c
+ 0xfaa07652 0x5b927896 0xb33bfd4f 0xfe9bbd43
+ 0x101c0e0e 0x30867a78 0xde68f671 0x391fa524
+ 0xa4b948d0 0x2437e3c1 0xd9d96470 0xba321aa4
+ 0x3e5b5566 0xe39a53e3 0xa82ce2d8 0x9d8ba8cc
+ 0x575630c6 0x506c705b 0x2277c9d6 0xa31bac1d
+ 0x37976219 0xa5e21493 0x8fd041df 0x4d2af032
+ 0xe75de268 0x98699fe6 0xf3b7cfa4 0x97ac7dc4
+ 0x5ff1d2c5 0x8e33fbd8 0x010772a9 0x6c93d48f
+ 0x899512dd 0xf7d53c91 0x97fa8288 0xa4adab19
+ 0x63717d7f 0x5e6ef885 0x66934b06 0x3dc6fa91
+ 0x29f89f47 0xcd4f90f6 0xff792638 0x799c3fc1
+ 0x77217e24 0xb5a6225b 0x3cb8f8f4 0x2973d35e
+ 0xf3de75c9 0x3a8dd99b 0x576658b3 0x398766f6
+ 0x6f3a6d60 0x1c0d85bc 0x3545d4e0 0xdc374f57
+ 0x26299056 0x15385f9d 0xc4e8004d 0x12b2c69d
+ 0xdc62264a 0x3fc24e10 0x0fdccc5b 0xd4d80c5a
+ 0xb78c30d6 0x88e84b5c 0xaa58163f 0x3bc39155
+ 0xe0df56b3 0xa93df4da 0x7c599726 0x5dd21192
+ 0x1113bafe 0x95819953 0xb29234f6 0x80e1192c
+ 0x3eb8a7c0 0xaa099bd0 0xc520b607 0xb4c732e9
+ 0x94bbc8d2 0x5dabd0f0 0x81817835 0x50c90c43
+ 0xbd61a919 0xd0604736 0xd5d59332 0x5df77937
+ 0x70756f6d 0xb97c959e 0xb12e3ee7 0xfa0f8e6c
+ 0x8edf86b0 0xbc55e121 0xffe36f9b 0xc5b18418
+ 0xa5695abc 0xfd78db88 0xa5abb701 0xf3106a23
+ 0x2a25b674 0x92149d92 0x75f554f6 0x15711825
+ 0x4018223d 0x6cee4a7f 0xac49f2a4 0x8b7cbc1b
+ 0x0021a126 0x5a82bb4c 0x95517060 0x5bd1c72e
+ 0xef0aa703 0xded54efb 0xb0d70e26 0x5063c928
+ 0x422c2cc1 0x21ca6d4c 0x5380165e 0x69a350c1
+ 0x0cd638b6 0x27f70fbe 0xa666ede2 0x63dd6867
+ 0xa8266be3 0x000b0b78 0x6b19ab23 0x0d00f83c
+ 0x16e78848 0xd871978f 0x47602cec 0xfc687f98
+ 0xf3e79da2 0xab10e9b5 0xaf437a53 0x28094fdd
+ 0x1a6b4dd0 0x70375aea 0x0718d285 0xf78ef2d2
+ 0xcbcfb3ef 0xedc5fdf1 0x0da3a7b8 0x233a162d
+ 0xf29e56c5 0xc94f4a19 0xa8fbe895 0x28f9e994
+ 0x1b32b3d1 0x1786c3c3 0x8ba9469f 0xbbe72c2f
+ 0xf662f439 0x307c6b2c 0x95d354cd 0xc7c7e94c
+ 0x27f3c237 0x4e52b116 0x9cb00e0d 0x952f9f0c
+ 0x8fc1ddf6 0x88537027 0x8b0d8999 0x1939fa64
+ 0xb72b6f2e 0x9039fe55 0x21df947c 0x21884ed3
+ 0x54ad873d 0x292c5416 0x83548712 0xf8745d3e
+ 0xc1c283e4 0x9d073b08 0x9e8da326 0xf859614f
+ 0xf427a00f 0x45ee737d 0xe33a7d69 0x807148ad
+ 0x669f1957 0x7b1f9f20 0x784c5c0c 0xded902c0
+ 0x82934e64 0xc2e2a0b6 0x87a55058 0x95fe7792
+ 0xff7084b8 0xba3f604d 0xeda549c7 0x2527db18
+ 0x3131ec59 0x32285503 0x0d7b69de 0xa87b760c
+ 0x721b0978 0xc2632bfa 0x4ee58616 0xae73bb41
+ 0x7794bd9d 0x130a7b9c 0x59427c7d 0x5326fa67
+ 0x7f496099 0x30e2f463 0x28df3ac0 0x6b9ea8de
+ 0x842220ca 0x25a5d22f 0x0a6c931b 0x6064ee13
+ 0xf3646b94 0x69ff9348 0x6663c7d4 0x6d4b1bf2
+ 0x31dc6f14 0xbf8a0e0d 0xfdf341d9 0xe5d1100f
+ 0x6eb5f2dc 0x9c966ca9 0xe6e58d17 0x73f020f6
+ 0x069cac60 0x7b7669d0 0x39e66b48 0x6122e1ca
+ 0x54bb1c31 0x413ac58a 0xcf9dbe59 0x0cd7971b
+ 0xc998891d 0xdd341b08 0x670496e5 0xd46e8408
+ 0xf7a7446d 0xe41b5248 0x43dbcf5a 0xba655675
+ 0x886b0044 0x52399478 0x553f8eac 0x68ccfb1f
+ 0xdd9d2e22 0xabee0f09 0xe897717c 0xb86cc2b4
+ 0xa8db1d3f 0x2d478c2c 0xbfa07903 0x1d589a1a
+ 0xd2ecb496 0xfd803a9c 0x44c95165 0xb3f0b5f4
+ 0xe4423f2e 0xcbfa628e 0xf73c7e83 0xf1799aa6
+ 0x9cb2acbd 0xd92d4814 0xe2e1fc1c 0x4a52d4cb
+ 0x8b961bc4 0x291986d5 0x8497e79d 0xf5c9e19f
+ 0x00970532 0xc4e9076f 0x683bd9a0 0x94d62993
+ 0x3acffdfe 0xc54379d8 0x62746505 0xc3dd7ea2
+ 0xe95e5ffb 0x0ca0c1f7 0xcdaa6c1c 0x1ed34d31
+ 0xda1cc033 0xf361f4e2 0x6e798025 0x43add425
+ 0xfb22a33a 0xfa2d2df9 0x32dad85d 0x8aa337c6
+ 0x5a3ea801 0x28990c71 0x9f1f5086 0x21e8177f
+ 0xd5763e1a 0xbe0b4887 0xd8cec934 0x94cbd176
+ 0xdddd5e67 0x6dbcfde4 0x70801d55 0xbe62094e
+ 0xb27820a6 0xf7455932 0x7193ab84 0x3ae710a5
+ 0x01647022 0xd6c94ac0 0x2c7ebe04 0x0fba5ad2
+ 0x21540f9a 0x0bf66866 0x7e88d875 0xc99e6f8f
+ 0x912768ce 0x39939ec8 0xb0e09efa 0x52fb6226
+ 0x1e539887 0x786bb585 0x12a61463 0x7e5dd8c2
+ 0x871c00ac 0x171b39b9 0xed1f9a1b 0x38c19931
+ 0x5d308052 0xddcd7646 0x7518280a 0xa310bf55
+ 0x139d10fb 0x0b60d41b 0xb7e08b37 0x40fcedaf
+ 0x510f5550 0x9e47ca8a 0x5c6b396b 0x04c36bde
+ 0x6461629b 0x86ebdb46 0x689d0983 0x905ce4b8
+ 0xc6112a75 0x890557dd 0x42b6d408 0x32fb46ce
+ 0xd54112fb 0x03f7629a 0xc9d04969 0x632538b8
+ 0x2fc3ec04 0x4cc3433e 0x06e50f4c 0xc0db9cd2
+ 0x2d7f8994 0xd8953273 0x01861f5c 0xbbc42f81
+ 0x8f8ba543 0x39727f2e 0x69c3af09 0xb0448177
+ 0x6eb6bdaa 0x75de88f5 0x3871f3c8 0x9d6c8586
+ 0x116cf51a 0x8a6abbd3 0xa5004cba 0x3c8d1766
+ 0x51285b03 0xa00d5a46 0x83755d99 0x2d91fd87
+ 0x42f0ab84 0x14c6fa0b 0xeb0a98f5 0xffd02f56
+ 0xd35546d9 0x290be482 0xdba0a9d2 0x201501ff
+ 0x5c753f02 0xfcefe14f 0xb7153dbb 0x6f56f22f
+ 0x8779937d 0xf049ad79 0xc7e56474 0xdfc45382
+ 0x17844149 0xde6612ed 0xddf3b1ea 0x88f64bb4
+ 0x2dcafc21 0x3f5ba161 0x77abc313 0x0157ee00
+ 0x450ec000 0xafc523c1 0x32eb6523 0x1d320c0c
+ 0x5a72fb83 0x2ba7e97f 0x13ac3668 0x7b0018e8
+ 0x64f4c130 0x4a4f9c9f 0xeb84e0b5 0x8c8b14d5
+ 0xaa72c45a 0x47ee1a96 0x322c599d 0x2dd7faa8
+ 0x55ca08be 0x9b3917f5 0x5e376234 0x476c916d
+ 0x6a3f57bd 0xe4ea3874 0x168dc270 0x9357f9aa
+ 0x3d600539 0x258a1ff5 0xdd634c31 0xec5d8b7e
+ 0x493cba14 0x6021950e 0xd64befe4 0xc026327b
+ 0xab7f248f 0xd8f340d3 0x5b7bc0b4 0xa3c306a1
+ 0xdd6463d2 0x62e96662 0xa5656cef 0x772abeb6
+ 0xc2ca1677 0x5f8b5aad 0x5098757b 0xbc8c8acb
+ 0xee9806f2 0x48c6f749 0x7265ae20 0x13819e0e
+ 0xe6da83a8 0x38b743fb 0xd024009e 0x0779eab0
+ 0x324c7ad8 0x2cd02206 0x6dc4a51b 0x5c51762e
+ 0x7d8c7b92 0x5ad2f586 0x45bbee73 0xb0b4018b
+ 0x26ee139e 0xb1fadcd7 0x24790587 0x0dd9cbd3
+ 0x08682c61 0xbd3982a2 0xd5884224 0x94a0cde5
+ 0x16b5e484 0xe043a35a 0x2326d176 0xc47d6b68
+ 0x15621681 0x1cb77fa1 0xdb86c3e1 0x283a89fe
+ 0x7407d5e2 0x3e7473db 0x177764bf 0x2592cc46
+ 0x9f907da4 0xa07f27a7 0xb8727679 0x49adfbd0
+ 0xcc4e5196 0x1d5be775 0x78494187 0x74886d39
+ 0xc13bccec 0xe1bf1652 0x583d5f23 0x2921f74b
+ 0xf521fa1f 0xb3c6d0c7 0x9e34749b 0xe55fa3bc
+ 0xd5bf2524 0x040df0cf 0xc83f244a 0x20271f12
+ 0x0c9fa1fb 0x8551ada7 0x1036de92 0x5c7cf42f
+ 0x9bcb3652 0x3987784f 0xcfa8d354 0x98659e8a
+ 0x7c6462dc 0x9381913b 0xf34e5b3e 0x36df8a2d
+ 0xb4faf4fd 0x60fb5e03 0x04158eec 0x8979dbd1
+ 0xd2c21a33 0xcf6d2fcb 0xb12ea899 0x5253b50f
+ 0x5e594c95 0x7284bd1a 0xe746ca53 0x06f96d59
+ 0xe9de6b3e 0x03803410 0xa1d858f2 0x8b8657f7
+ 0x0d4162ab 0x95a60f33 0xf1ab053d 0x7128c15b
+ 0x2f79db78 0xbdc7d174 0xd8dc9ea9 0xa3f59785
+ 0x74c6ff33 0xddf28b34 0x591511ac 0x4d8a8d37
+ 0x0de29c2c 0xfb9f1e6a 0xe6cf02e3 0x539939a2
+ 0x70947caf 0xfdf4270f 0x1100a164 0xba859bca
+ 0x97dee242 0xcb0ab915 0xc28a0031 0xf76cdc57
+ 0x6e66c36f 0xa797fe6f 0xcb6df78a 0x6ebb2e97
+ 0x0ee6bb91 0x8de4af0e 0xa0d2fccd 0xeae7cb84
+ 0x15f23995 0xcd674ce1 0xcddc0174 0xb952b1e8
+ 0x71782504 0x1f747c66 0x19e32685 0x84a56908
+ 0xa1f4a5be 0x8e6a987f 0xf222b162 0xc9930437
+ 0x42e1ea32 0x2c2eeb4f 0x4731b176 0x9bc3e607
+ 0x37f5515e 0x2b8e4f9f 0x2aba8550 0x50f9ddd1
+ 0x58ddc1b9 0x75947cbf 0x0abfba8e 0x841f9f1f
+ 0x069dadc6 0xe83cd9e9 0x759789dc 0x7f5c5ca4
+ 0x07c29225 0xccf67318 0x97de839c 0x4e1df148
+ 0x7a20ad44 0x31cb8a85 0x7f490a28 0x7d1a1656
+ 0x57152c0c 0x7d55b186 0xf1cefcb3 0xf131eb0d
+ 0xbc8493d1 0x17fbaff2 0xefcee9db 0x5f5a5a95
+ 0xb92004b1 0x21449267 0x63ecb05e 0xe49b7a31
+ 0x540647a9 0x49fd1a23 0x9ed5c174 0xa244a14d
+ 0x4c9472a1 0xc708f592 0x17dab705 0x4274f9ab
+ 0x08ab5c9a 0x602ba956 0xbbf687bc 0x1717007f
+ 0x6e23568c 0x55ea4fc8 0x723dbdeb 0x0fc5e36c
+ 0x64523bbc 0xad1a6b55 0x9837bbc4 0x6e52a3e7
+ 0xd03441ca 0xbbb6df8c 0xd6697252 0x6f2da4aa
+ 0x94de656e 0x10c12624 0xa5f244e8 0x72c7146b
+ 0xe3014425 0xe041df93 0x9a521efe 0x86b2eae1
+ 0xd095d69d 0xf6bbd12d 0xba43a859 0x282ab87e
+ 0xa0ebff78 0x69e0c87f 0x7d14ce42 0x44027851
+ 0x3edc8505 0x15347503 0xcad522a4 0x4f9b766b
+ 0x16d657a4 0x33ff32da 0x220bc839 0x92ebc7f5
+ 0x9219ce4f 0x2afe097e 0xaff96207 0xd307c69b
+ 0x09a7f3d4 0x4554abc6 0xa9502f07 0x477b01d7
+ 0xd20b932a 0x2c35f23d 0xd5ebc780 0xf9546079
+ 0xe84e9405 0x25ac1f6a 0xcc3c443f 0x9d386146
+ 0x33a1d55e 0xe422f8e5 0x777aa2a8 0xf3e897ec
+ 0xa34b0838 0xcc9643e2 0x41702834 0x80e5fda3
+ 0x5d814095 0x54702ff6 0x4f91b16b 0x98ae0b0c
+ 0xf8cf2d5d 0xa200b65e 0x48511821 0x2e8722f5
+ 0x147acd39 0xeac2f68b 0xc2c178af 0x0d5155f2
+ 0x40c5a98d 0x2ea9cdb7 0x58589cd9 0xa76c4d0c
+ 0xf1b2eb41 0xa169ebe1 0x9f59d297 0xf50fabad
+ 0xc20acb23 0x19674a49 0xee4532f9 0x2e925d1a
+ 0x24486eac 0x53aec881 0x8ad74637 0x779562c7
+ 0x70aa2712 0xc0899db3 0x7fca4ae8 0xf8eaea9e
+ 0x881926f3 0xdfc3a498 0x1c791816 0x7b09cea9
+ 0x050667e6 0x370d6873 0xf7814892 0x618980d3
+ 0x2f99b029 0x9bc8f6bb 0x625dbb01 0x3ec0567c
+ 0x05a5fc45 0x71d42160 0xd2628efc 0x04ebfbee
+ 0xedfdf421 0xa9300f58 0x54f9e2eb 0x499d5699
+ 0x293ae3e9 0xc8cf35ad 0x9ece5019 0x4d24d1a5
+ 0xd5167c3c 0x452a94a9 0x9b44e0a9 0x2ab9c19c
+ 0x08537165 0xe2f91115 0xd4a4152c 0xbaaacaaf
+ 0xc3e05300 0xbb0baa45 0xe9634182 0x09a6e09c
+ 0x961b864a 0x992eaf99 0x92e33a00 0xcb8c1c1a
+ 0xca1d7d4a 0x0a7dab83 0xbd60ec53 0xca708bd3
+ 0xa97e98f8 0xed558fc4 0xd51267e4 0x57794652
+ 0x133d4aad 0xe1b861ce 0xbe168102 0x007a1b16
+ 0xdf08a40d 0xe761a6cc 0x71daebf2 0x73a60746
+ 0x7929cbba 0x7ae763b9 0x0af8bd6c 0x98ef76e7
+ 0xb463b22b 0x47ed2bd0 0xe50af1a6 0xe6337225
+ 0xa09b632a 0x78496068 0xc8b89d6a 0x712da1b5
+ 0x13147914 0xb03c4207 0x9725c5d9 0x6b114015
+ 0xe98ace26 0xa3306ef0 0x926cd96c 0x3fa48ddc
+ 0xb953f5dc 0x2e0c843b 0xb1c264db 0xe0f26270
+ 0x840b08f3 0x6635f8f2 0x304b1728 0xa2c49b4f
+ 0x07469866 0x622ffe72 0xd10d7143 0xb00e0d18
+ 0xb76d4fc1 0x0c8e95a1 0xe0204bef 0x7cc1a000
+ 0xc3f63f6f 0x50c171e2 0xb84ef3af 0x9f3364fb
+ 0x02391e8b 0x6a062144 0xd8735f9c 0xbc448212
+ 0xe6e1f61f 0x91750601 0x618c0642 0x3ea60e7a
+ 0x5f1fd7f6 0xc4df14b0 0xc1470e35 0xcf0698d7
+ 0x4b35c08c 0x8087143f 0x8fee4146 0x4563f24b
+ 0x91f56e26 0xcbb627d6 0xac7fe373 0x8eccaa77
+ 0x233d6d0d 0xeefccf2b 0xed159025 0x5dec09ab
+ 0x6caedc10 0x8619b172 0xde79e560 0x9cd63d35
+ 0xa6833e63 0xcc681535 0xec1d231b 0x5499eb3e
+ 0x31ce53bd 0x39dfe672 0x63d8335e 0xab9cb671
+ 0xcc5c0cad 0xd2b42d3d 0x51001000 0x01c29cd4
+ 0x7b3a886d 0x93ff5435 0x4257aad8 0x957e557f
+ 0xee6a5ff2 0x4601c423 0x691ab5ea 0x9f28e47a
+ 0x2e441c07 0xb46dfce2 0xb85dba4d 0x2cc93e79
+ 0xa29c90d2 0x239479ae 0x24459955 0x71958e73
+ 0x1821725f 0x43781d53 0x57ce2d7a 0x09cbc141
+ 0x52ed544d 0x765b4384 0xbfe1e539 0xaff3928d
+ 0xc6533387 0x15c1de88 0x49a84665 0xddcf0d9e
+ 0xde8e8287 0x3b495d4d 0x79d51f19 0xe6b93066
+ 0x53dcf1e2 0x8e16e857 0xd42d5fe5 0x0864f760
+ 0x27eff8c5 0xc728cf7f 0x67a46f77 0xa0103ff8
+ 0xcf855c1d 0x0b2856da 0x2ef36701 0xf87d2a8a
+ 0xa88bf5b2 0x44270459 0xc222c218 0xe3472c8e
+ 0x147294e9 0x17d90558 0xa8b2839b 0x2da18106
+ 0xbbc8cdf9 0x7986d8f3 0xa7b0dc4f 0x60a65a4b
+ 0x93651766 0x9aa797d0 0x81630734 0xbdcf497d
+ 0xd778ae9a 0x25dde16f 0x371b6fd6 0xb97f89ab
+ 0xc54476ef 0x1566ce6b 0xa2849ad1 0x806a7c56
+ 0x44e04e52 0x74cb5a8c 0x867c5d3f 0xdcbcf8c5
+ 0x71dfd15d 0x0858e63f 0xc1126eee 0xf517cde1
+ 0x3a6f8284 0xeeb9229d 0x7957295b 0x6b3cca9c
+ 0x60c303cb 0x0ed8144b 0xdb28da39 0x8306abce
+ 0xacb727f4 0x986057d3 0x86098196 0xd2b16b02
+ 0x1090efff 0x5159e82d 0xf9947295 0xf5f6c667
+ 0x9da3a5cb 0x1e48b098 0x6d5c6c90 0x383d4fcc
+ 0x03d3a6b1 0xc8735258 0x389cb7d2 0x1e036542
+ 0xdb037e85 0x27d2e476 0xdd9af5d2 0xd7ed3f8a
+ 0x280c5e82 0x999392ca 0x749a0263 0x7810c063
+ 0xc865ba64 0x896a9beb 0xb673e866 0x5caeca39
+ 0x4cd2a62d 0xbb6b0b92 0xc71835f1 0x165b9305
+ 0x3016ab9b 0xd3e0b3c2 0x217c94d4 0x19f842bd
+ 0x5f125f2d 0xc1ee0904 0x465bd564 0xc460f787
+ 0x946c6008 0x4a0d0533 0xd5c6bd32 0xf04f24a5
+ 0xa9c993fe 0x6b0864a1 0x187d904d 0x86eb48d5
+ 0xd79dd986 0x397f7e62 0x819367fe 0x65fa193a
+ 0x272d28b5 0x30d3ae72 0x002f4db2 0xe4655566
+ 0x90ac4aca 0xb5e53d29 0x4822cf23 0x56f8385b
+ 0x338a06f4 0xadf089fd 0xeb9f1bfe 0xc09399c7
+ 0xd29a120c 0x934328e7 0x51383456 0x01314dd4
+ 0xe39975fa 0x6987ff55 0x4e3caa02 0xe67779e8
+ 0x9dfbe6eb 0x3d19a794 0x7aca1062 0x2c1a1e11
+ 0xcd2c5175 0x9be23364 0x229492a0 0x02fec171
+ 0x2d8b1b44 0x7e606375 0xdbcfee13 0x04a33a9b
+ 0x6ffcd7bb 0x7341f372 0x58f5c94b 0xf7b0cdf9
+ 0xb5ba43e3 0x87f4128b 0xf2b5a2c7 0x3d3879a6
+ 0xad1e477e 0x1236fe8c 0x664e0f88 0x41dfc0a9
+ 0x31b4c69d 0x540c82ff 0x46fbe172 0xa06214b0
+ 0x37529df4 0xd2bf7135 0x5d4e5e34 0x5d0c7d00
+ 0xd2db4358 0xcf8688a1 0x0c711fd3 0x50fd0c71
+ 0x4ec2e1db 0xd7a365c5 0x308c0a23 0x8d158bed
+ 0xb600514c 0x8e133cf0 0x05af2138 0x3e1e6e62
+ 0x2fa12834 0xf4cc4a63 0x22f00f7b 0xfd1daa6c
+ 0x6623db43 0x95651a73 0x72e5e9e7 0xd42aad46
+ 0x394043d0 0x58c741dd 0xbb56d30a 0xebe05fb1
+ 0xbb8969a7 0xdd2b4af3 0x278c9406 0xb2b5e33c
+ 0xee0d55f1 0xb6cdfa03 0x74826a93 0xef76b508
+ 0x2c11ce20 0xdd49ed67 0xc562d228 0x67afe7eb
+ 0xe76f1b01 0x80610fd8 0xd8656007 0xddc51ae3
+ 0x99bff49f 0xbdca6ef8 0xaefd4e9c 0x07c8427a
+ 0x5b5ada45 0x97bc8bf7 0xb4a27da5 0xaf3af444
+ 0x5594b6e4 0x391beed5 0x09fc21dc 0xfbc8f199
+ 0x6777a987 0xf33d15c2 0x1243b8e4 0x869188da
+ 0x0b778b61 0x85959d28 0x4f9babf8 0x14fa33a0
+ 0xea86de6f 0x5f2578da 0x14d30f79 0xe733ffb0
+ 0xd913fe78 0xa523a7d6 0x5363d7b2 0xa3473e1a
+ 0xb8adba3a 0xe144c2f1 0xe2b1f2b9 0xa3a2f9b3
+ 0x842ef087 0x4c2b6680 0x16d2efd9 0xed96c3c7
+ 0x683da5dd 0x9dd9c1d4 0x91457265 0xf987a602
+ 0x34c042f2 0x21d69410 0x43c88084 0x554e55c9
+ 0x7acc992a 0xb6da3604 0x006ef86a 0xe31a28aa
+ 0x2770ba09 0x918a852d 0x79cc7c4d 0x64fbb9ab
+ 0x01f8b85b 0x9443c44c 0xa6c3d2ce 0xb54cae74
+ 0x1213c6b9 0x0858483d 0xe6f47844 0x5376709e
+ 0x4b256846 0xf49c6aa8 0x25c81e4c 0x25999396
+ 0x9b54415a 0x788d4226 0xebbe2262 0xc3bcb748
+ 0x543af883 0x69c08baa 0xd54a656d 0xe0b039aa
+ 0xac046b7f 0x84177c31 0x356c736a 0xb770fcf6
+ 0x4b000b6b 0xf9b48dcf 0xf7657f1c 0x31b1e8e4
+ 0xd8e994e7 0x34ca54ba 0x4911adee 0x7e5cc517
+ 0x550806bf 0xd7fa5263 0x47e6ee14 0x1c49c943
+ 0xeed7bcf1 0xb900ce8f 0x99777ef8 0x3baf54e7
+ 0x2548ef59 0x17d9af8b 0xc676ada7 0x8f56dec4
+ 0x1fa7bc61 0x81ab1dd7 0xce8f5df2 0xa3209c87
+ 0x851f0c02 0xed3ac326 0xe0529344 0xd9306aa9
+ 0x6b7d00ba 0x79426849 0x0ed3b6f4 0xae3e8af1
+ 0x1e255fce 0x56eb5b59 0x07bf8950 0xa15d9b22
+ 0x7dd6aa5b 0xa84faf46 0x74a1a06f 0x1a480b82
+ 0x4fd0aced 0xe83372e5 0x6e6947c8 0x8397ca58
+ 0xccb2423e 0xb264a888 0x13ac9e1a 0x0ef1a3b3
+ 0x8e1afe87 0xd52bd6ad 0xdbae821a 0xc180101a
+ 0x72ccbf05 0x210558b4 0x00ae1034 0x9340d9ed
+ 0xfe6223ee 0xb8acbf6c 0xedc343d2 0xbac97e9d
+ 0xa587fc40 0x3748b829 0xdae6c133 0x93a5521a
+ 0x0f6e6c9d 0xe0d0e2ac 0xc2ad2d8b 0x8cab1489
+ 0x24452aa3 0xd3e7fd52 0x08c5a8dd 0x3ef6d86a
+ 0xc6a3c1bd 0x63a6d745 0xaf2ca5cc 0xccdc8223
+ 0xc49c5c36 0xed5f1553 0xff5db9d1 0x82966ff0
+ 0x8b8bd5b7 0x058fef40 0xe1ee6bed 0xbd645268
+ 0xc89a4ffa 0x797baef7 0x2b4376f7 0xb61ed7c1
+ 0x83ab37d7 0x72c77f78 0x9f79d15a 0x5d1951b1
+ 0x114359c7 0xc7b6c8a0 0x15169406 0x6fec157f
+ 0x1410a4c3 0xd1c2ba26 0x26fcf2ac 0x083e3f5e
+ 0x9eb6cd4a 0x441e1768 0x6e540aa1 0xb27dbd7a
+ 0xc8e42721 0xa2db5137 0xa7265985 0x169a754c
+ 0x9e420ca7 0xc5c0f227 0xe437cc64 0x95aef99c
+ 0x5e72ab86 0x8acf1554 0x257637f6 0xefa6e471
+ 0xc58947a0 0xe7ca213e 0xbd2256d7 0xa59c1096
+ 0x4d7c13d5 0x0ffe8534 0xf21f0220 0x7d485296
+ 0x6977386f 0x9e240b43 0xc203de0a 0x570c75f0
+ 0x7fc32645 0x618a34a9 0xdf2aae4e 0x1ae6e5fa
+ 0xd624fb58 0x2df35718 0xd4b1dbb5 0x01b66636
+ 0xf60ece48 0x1c2b5666 0xba1e4ff0 0x5bae1854
+ 0xcfc26662 0xfc16d190 0x76ee7090 0xeae95c1a
+ 0x6e76ca24 0xc7107724 0x7724006b 0x46cb66d5
+ 0xe06ca426 0x44746684 0xecf7b1e6 0x1b24b877
+ 0x6f88c894 0x4c9cec34 0x58cdf298 0xd899e510
+ 0xdc1d2e48 0xe854758b 0x5ba5924c 0xb266ab1d
+ 0x273660ed 0xdf07e034 0x4b5604e6 0x50dcbff3
+ 0xef34afec 0xc056102b 0xaeba9d1e 0xb522ded9
+ 0xe8908747 0x6cffe77b 0x1bde6b95 0x1e3786f4
+ 0x95a8460e 0x77e0f421 0xf5908c99 0xe89b4c58
+ 0x4aca0c69 0xd7c0b9a5 0x619bbb02 0x921b1d0a
+ 0xea6579fc 0xd95bbb3c 0xc63bd462 0xa1e8e5a0
+ 0xed0c345f 0x46b84170 0x34117047 0x0387a17e
+ 0xf8d1a23a 0x553cbf2c 0x11c979de 0x3cf65056
+ 0xf4a25aa2 0x605091ea 0x02faeb4e 0x97555584
+ 0x3443e2c5 0xa9aaf9f8 0xfc6971d7 0xbf08de21
+ 0x79f139a8 0xffe80b0f 0x97ac6bb5 0xff425410
+ 0x4979eaa0 0x6d009b89 0x2c8ffde8 0x94b047e2
+ 0xc8365227 0xa43a41b6 0xb2dccea4 0xdbbe4876
+ 0xb54243de 0xe697c776 0xee033277 0xd27a3701
+ 0x2a299b40 0x083de408 0xf34636a8 0x205d473c
+ 0x749a26a7 0x7be9dc36 0xa97f3934 0xe14b3e44
+ 0x0bab208e 0x7b264b81 0x291257e9 0xde72ec36
+ 0x4574e269 0x57796910 0xb70e079e 0xf26fb4bb
+ 0xfed27420 0x2f8774e1 0xcdfffbdb 0x079d7d6e
+ 0x7103090b 0x42aa43e2 0x43145060 0x1507ed7a
+ 0x796546a8 0x5b7b7273 0x70049828 0xeba1607b
+ 0x6b10fff1 0x80ce2259 0x077c7b5c 0x65743d3a
+ 0x7ef79050 0xb837dcf8 0x97a4525b 0xb0b2de90
+ 0xe83727d8 0x6b6b91cb 0xe5a2dec8 0xeb46fde8
+ 0xfd0662ca 0x4e41fd86 0xb6dfc704 0xa196e275
+ 0x8ff4c3fb 0x0e9a9f98 0x9b346734 0x03d3e037
+ 0xbc9688c1 0x79e2341a 0x5fa428c3 0x4965486d
+ 0x3b7502f6 0x1d75af58 0xda593f8f 0x78b75ab7
+ 0x6e70c385 0x0210b6ef 0xa9e9c0b3 0xf3856c36
+ 0x6cb020ee 0x019797cd 0xbb6e9b95 0xfd1ce108
+ 0xfe0b08e5 0xec225a0e 0xc2d4ad33 0xdef719ef
+ 0xffaeeea6 0xe1243771 0x3615c3ec 0x72cdbaae
+ 0x566bb86d 0xd8845192 0x86f125cf 0x7898db6a
+ 0x5dcbc672 0x285dd79f 0xe23b16f8 0x014114d5
+ 0x516ae99d 0x785c3fc2 0x4cd36c31 0x288a6976
+ 0x14124dcf 0x5cc7f2ec 0x5b8d8ecb 0x0301d1e5
+ 0x4982c681 0xd9a1c7ce 0x4f94fb85 0x90ccd5a5
+ 0xdbbf99da 0x650fd62b 0xfdc4f3b7 0xbcd913f5
+ 0xd013d980 0xd8f89a26 0x761fdae3 0x92313163
+ 0x9118c987 0xad2b0584 0x0b5b89fa 0x315f8457
+ 0x2c9e481a 0x5209ad43 0x4e9ab303 0x060e92b1
+ 0x0639f966 0x9d4fb6cb 0xd57b371b 0x15a162b3
+ 0x39148221 0xcbe014bb 0x407307dd 0x8ba26aa8
+ 0x3be5f416 0xc43a9c41 0xd332b1c6 0x0af92f10
+ 0x45467e20 0x6db14b18 0x6b13fda6 0xee416fe0
+ 0xc27e01a8 0xcbe2df1b 0xd202f12f 0xcb9538f5
+ 0x16344446 0x44edb8da 0x9e685ee7 0xda2e7ea1
+ 0xe2a9cabe 0x3aaed424 0xeef7b952 0xfc5ee770
+ 0xf6f6352a 0xff0b30be 0xe9655fa3 0x8313d64b
+ 0x43703914 0x7106d5a7 0x6435d631 0x607ad042
+ 0x4bf0dfd2 0x385492e1 0x48b348b5 0x38c35b9a
+ 0xfdb51c06 0x66346026 0x9c192cbe 0x504ca3cc
+ 0xdf1f5d15 0x05df6fd5 0xa7f21311 0x83c216dc
+ 0x96b7f3fc 0xe63fa223 0xb56d4d98 0x025628d9
+ 0xe0b9029b 0x8a7d4fe8 0xdafa0c44 0xaa612564
+ 0x7a79883e 0xca986c55 0x40421bed 0xc038c502
+ 0xbd051dfc 0xb0b49027 0xece58167 0xcba46998
+ 0x34ba0fe1 0x5d187c08 0xdc47004c 0x6d74842c
+ 0x2ae5624a 0xd50830c6 0xd15ecb95 0x17ce8d88
+ 0x6e9276db 0x37736b67 0x6c76df1e 0x93dcd47d
+ 0xc8d79fb2 0x0588b459 0x69a1bd05 0xceb86a87
+ 0xd870509d 0xa2182729 0x7cb99aa1 0x2f2b6056
+ 0x4869b722 0x8a46e79c 0x60d2ea42 0x0a0ef7bd
+ 0xdb0f19d7 0xb12f65b5 0x7cc51707 0x3f21c663
+ 0x2b1f67d0 0x6b1ed5e1 0x4333b92b 0x7d54a7a9
+ 0x03a9ebf8 0x329601c4 0x4d428e4b 0x2a50477b
+ 0x40a92952 0xbd58f69b 0x2d18cb43 0x331d4674
+ 0x500c3cc0 0x501e3415 0x4efcf36a 0xcfd2291d
+ 0x3c8657cd 0x00f687ae 0xfb3a3320 0x2d1854f5
+ 0x5e6de7be 0xda36f143 0x5275dc99 0xd025b4a6
+ 0x0b4bd9eb 0xf9ee3514 0x57abfa48 0xa81dae71
+ 0x53845138 0x67ef4067 0x5480eb95 0x6dd8d7e2
+ 0x7005155d 0xeeebabdd 0xf7a27c90 0xadee3747
+ 0x314f2207 0x5001c5d0 0x0bc6e690 0x5ac451fa
+ 0xb2cec227 0x84a7adfb 0x42a217bf 0xd3817dbf
+ 0x32b7ff64 0x4c029b42 0x2717b9ec 0x4cdfc875
+ 0x29db73da 0x70b48751 0x81a370e5 0x34726efa
+ 0x4bfe99c2 0x252b678e 0xa2f811df 0x00413042
+ 0xd0d1b87e 0x87f0d2da 0x5c380bd0 0xffb9e978
+ 0x107ae818 0x15dd6a54 0x05d83a7e 0xa69448f9
+ 0xe05d10c0 0x5f3b283c 0x3542204c 0x4dcc0839
+ 0x0c5f54f5 0xf31ebdeb 0x5c1b87cb 0xeaaddddd
+ 0xb4d61728 0x9b22b56c 0xad635da5 0x890aafdd
+ 0xb2b77d91 0xf1ca2170 0x93029f39 0x21bdba33
+ 0x736fd17a 0xce304fb8 0x6386fec6 0x01e91644
+ 0x9be9c0a6 0x339ac4e4 0x1f980bf7 0x4d3277ed
+ 0x75f7c6aa 0x4268086e 0xf934105c 0x45231df8
+ 0x4c29625f 0x636c44c3 0x5bc247a5 0x6dbd584b
+ 0x91192c3e 0x2cc14b07 0xc2234991 0xbfea0822
+ 0xeb9687ef 0x1a1de5a7 0xa93f8b2d 0x7f1e8c33
+ 0xc98ad887 0x0bad541a 0x766213a3 0xe2260c29
+ 0x3de6c95d 0x8ec8963b 0xb2dc9bfb 0x9c08dacd
+ 0x30ec7579 0xe9c6cc98 0x7b9a3234 0xf22ab140
+ 0xd6984299 0x1f37764d 0x858a694e 0xb716b059
+ 0x0bf8efb5 0x86d575e4 0x88dd61ef 0x2ca7b6fb
+ 0x106af38a 0x4e35d588 0x327d4501 0x190a11d3
+ 0x81e0288b 0x748a0223 0xecc2d2aa 0xbc958592
+ 0x0b271e73 0x721eca15 0x375daa70 0x78c9033b
+ 0x35643a59 0xf7f8b522 0x876112a4 0xba2bc70f
+ 0x6478efdd 0xfdde22fb 0x7c3dfed5 0xd7fe1862
+ 0x96aeee40 0x800855c8 0xdd37a6ad 0x3a84bc05
+ 0x476c96b3 0x313b0837 0x5f499ed9 0x7d2e36ba
+ 0xceb15da7 0x64cc6357 0xef5ff7b9 0x4bace9d8
+ 0xc3de5315 0x6a68b3f0 0x3628f647 0x7a01c17a
+ 0xae62464f 0x3a8d3185 0x2b78e14e 0x85a5e84d
+ 0xde213afe 0x46cb8306 0xb19edd23 0x86d647ee
+ 0x92e1fb05 0x89fca641 0x2700fd68 0x9abe7af7
+ 0x41a0c32c 0x81898e73 0x5ff48040 0xb54580a2
+ 0xeb5186ad 0x507375c2 0x0b4848bd 0xb07fe901
+ 0x0d93ea1f 0xf991e92b 0xe9676946 0x747d6df0
+ 0x56a6bf32 0xe6a63b17 0x5a296a56 0x112b3537
+ 0xae4c7a7a 0x3fc1caa1 0x932ee139 0x0d345fdc
+ 0xd46cd214 0x5e8323b8 0x6346c206 0x0c9f152b
+ 0x5e1f0f95 0x6230e379 0x400f60bf 0xecc113ba
+ 0x5975e3fc 0x62c9f9c5 0x5ba85502 0xca610496
+ 0x582ea53a 0x05e7ecad 0xfa3f762c 0x412b2a6d
+ 0x71670f10 0x4fcbee0e 0xf09cb82f 0x4d76c70c
+ 0xdfdf510b 0x44c52b3e 0x907283fe 0x2a3d9481
+ 0xc9bdf0ed 0x1798c4a6 0x68bfc2fe 0xc940dc1c
+ 0x9354742b 0x31d55875 0xdc416900 0xce9331ec
+ 0xae9f8e06 0xc0daa781 0xcd848a26 0x2f0b02aa
+ 0xc0eb3783 0xf256f4e4 0xcdf477ab 0x7f66be8a
+ 0x4f8baf5f 0x6157a7b8 0xdb2482bc 0x2a85231a
+ 0x5c2b7eb8 0x0f49f740 0x6af5f4c9 0x732fcdd9
+ 0xae01bcee 0x55f142bc 0xfad20f99 0x0e156e61
+ 0xa72243a1 0xf187ff0e 0xe0ffff47 0x6d6e5238
+ 0x42980807 0xb7e51b3a 0x2e54e824 0xacd9a4be
+ 0x86b05c24 0x53d3aa13 0x08031859 0xdff1d3c1
+ 0x25e00058 0x861c7a0a 0x1f1e3258 0xd4cb2853
+ 0x6c86a0e4 0x158b6074 0xe30ddaf1 0xc4bbc48d
+ 0x8bcf8953 0xc1372083 0x18073359 0x5f9cf737
+ 0x5c3c0d12 0x9f5389e4 0x91a038fb 0xe8bf9dac
+ 0xef60f867 0xa81b58d4 0xbc45f8c5 0x56b97f8a
+ 0x6bb92b76 0xdc2aa293 0xba0b6502 0x7425f0ba
+ 0x612c13a6 0xa2f2960a 0xddca243c 0xfc89a041
+ 0xdd3c1943 0x5c5fd16d 0xab313c5a 0xea4d057f
+ 0x8a4af66b 0x20257eb2 0x08d37adf 0x5919c7a6
+ 0x4851f6b1 0x492e2f2e 0x36b0d4c0 0xb114f9ce
+ 0x2e3f772b 0x942d340a 0x9e82414b 0x8fe95909
+ 0x182ac3bc 0xb61a79e5 0xea2b7e3e 0xd6c24248
+ 0x8c05863f 0x5380cd65 0x73bae4c5 0xa89a3972
+ 0xe6c7b775 0x992a0588 0x11074bac 0x09132399
+ 0x7cf0c30a 0xbe0bd1ee 0x8cf6e461 0xed196e5c
+ 0x9a852385 0x26109fd3 0x91fa3ea1 0x2b5b312d
+ 0x5caaac5e 0x6f65ae60 0xa2f21e6f 0x01dbdcd2
+ 0xeb9fe559 0x1f77a3db 0x84a3fc80 0xf5081861
+ 0xedbbabcf 0x2b582fc4 0xd873c137 0x38949a47
+ 0x14cb2d76 0x8b82464b 0xf307f8ed 0xc4ed602c
+ 0x6d4c4962 0x60483dd7 0x8b74d774 0xe3b273e0
+ 0x54cd6692 0xcbdf06d5 0xc76ed302 0x4072048f
+ 0xf2e67b28 0x1d8f25cc 0x8eb3820d 0x9dce8211
+ 0xfbb5b706 0x4911c664 0x498cb190 0xeb086e18
+ 0xaab32d7d 0x77659ae5 0x0d33a0d2 0xdb3b58fa
+ 0xd95a0e2d 0x41bab52c 0xdf8cb9a7 0xe5be76ae
+ 0xe5d3959e 0x545f4f88 0x0d810eae 0x42086f42
+ 0xe9951149 0xeb280219 0x9f89757a 0xd85fe39a
+ 0x8caf75ea 0xe605030c 0x16cb8151 0x3f10871e
+ 0x70ce960c 0x7497c71b 0x1dc2df1d 0x718f8a11
+ 0x88b5d93a 0x61ae0176 0xf7b06d8c 0x5b975445
+ 0x8173b27f 0xb6bb1bd3 0xe428b56f 0xf2757513
+ 0xc4eb2c1b 0x0f480969 0x735e7378 0x45b51ed4
+ 0x13628703 0x7cafcab7 0xf59661ba 0xd509df58
+ 0x9c89f68d 0x22f2d3e5 0xb63e3b55 0xcb381ad6
+ 0x6fb7756f 0x9227a63a 0x08fc0721 0x5a39461d
+ 0x7ac6ed7a 0x2145aaea 0x6a91b4d4 0x17e7847a
+ 0x62b65666 0x953c8d6a 0x25ab7103 0xe92e3b09
+ 0xbd95cb19 0x776def1c 0x707cdb78 0x2557b7df
+ 0x8ec44671 0xe4f4b4dd 0x9ed1fd8d 0x8ac6138a
+ 0x383542f7 0x621ac3d0 0x529446c6 0x57de60ab
+ 0x159f06fc 0x03e234e7 0x7c95c8b5 0x9000e809
+ 0x914a2724 0x94693755 0x54ed28a2 0x2ab5669d
+ 0x9b1210ae 0xa565f56e 0xe6f4370b 0x1f8999ff
+ 0x16f8b9fe 0xb0f889f0 0x722b4d96 0xe47322a2
+ 0x086734e4 0x02944b1e 0xf158227e 0xa2867257
+ 0x87a261de 0x82ccae09 0x4e263f28 0xd34a3206
+ 0xd519172c 0x925e3840 0x2dd5fcd0 0x2fd51f10
+ 0xfd3db761 0x8b1b7678 0x113e3438 0x077d715d
+ 0x3513f8ce 0x177d0926 0x3203a088 0xaa01716b
+ 0x522f474b 0x380d61e4 0x3ebd3255 0x0fe370f5
+ 0x1be5edf6 0x6738fa64 0x759fcb14 0x87e19f53
+ 0xd2fab90e 0xf612b889 0xdf8a32bb 0xea93eb69
+ 0x75f6c1c7 0x63cb06c5 0xd673a63f 0x62512736
+ 0x68f570ef 0x8912b248 0x11b08705 0xc431e781
+ 0x57cc81b1 0xde5fe207 0xf524334f 0x82d083b2
+ 0xe9d5733b 0x56b09eab 0xbbc76a27 0x5c1f4192
+ 0x315f95c9 0x11784e77 0x4b2dea04 0x06e3c08e
+ 0x693e4455 0xb3b21fbe 0xc2359f08 0xd38509c4
+ 0xdb8be759 0x84aa9e41 0xd0187e39 0x9ca1aabe
+ 0x8336e963 0xb5753fb1 0x36d35860 0xb4901721
+ 0x673e390f 0xb15d8744 0x08611d98 0xd113b5e0
+ 0xae88b81b 0x6a3986f4 0xa5b078ea 0xd809237f
+ 0x632e0ec0 0x5da21e6f 0x17a19bd0 0xfc067354
+ 0x8a4b39d7 0x878b4dee 0x38d9bc60 0xedcdfdb8
+ 0x02e2dcc5 0x7e793f70 0x545cfd75 0x231760e3
+ 0x3b06b558 0xd1ebec25 0x3bbc4561 0x1de5c33f
+ 0xa8be3608 0x496ec301 0x8a60ff90 0x0b464864
+ 0x24355c7d 0x0df4ce8b 0xcbdb764a 0x888d8fe1
+ 0xb3048d2f 0x0efa5175 0xc41d4cc3 0xfa6bee3b
+ 0x353c9949 0xdb191cd5 0xdb7a24dd 0x9a501902
+ 0x38a8c55f 0x0b68d5b1 0xe6bfc496 0x75d094f8
+ 0xf61aeb27 0x3f2442ea 0x31c65668 0x854f3c74
+ 0x038480ce 0xd0e38812 0x5c591451 0x7e8e5a92
+ 0xe16d372e 0x410b345f 0x80bd6abf 0x478eba91
+ 0x08affe8b 0x0b866ea9 0x8ac35b00 0x8060c27b
+ 0x0f9c9112 0xd655d30d 0xca7b6889 0x5cc6255d
+ 0x9f073643 0x4c947c23 0xbfe3e6b7 0x17efd8ed
+ 0xbb3a9850 0xb156dca7 0x0bfd2388 0x88bffee0
+ 0x00a6440c 0xf995eceb 0x4f707603 0x23d57780
+ 0x7bec0bf9 0xdebcbfb3 0x4ef065fb 0x1a302ba3
+ 0x04192dca 0x946bee85 0xb0b7e7c6 0x320f8d45
+ 0x38deb95e 0x33c79be8 0xe5eaa420 0x7f92daf9
+ 0xe6cb25b0 0xd40f40bc 0xb84add83 0xc5c2ca98
+ 0xc6daa9e3 0xd6ca4704 0x6354e6f0 0x51c5d31e
+ 0x729d120b 0x8a2196a9 0xe61aefdd 0x80fe491c
+ 0x3558d507 0x68feb980 0xbfd332e4 0x0da57078
+ 0x6eb13214 0x6f614ae1 0x945830db 0xcfd3d7c1
+ 0x30b376e1 0x856075e5 0x4b23527a 0x4ebad274
+ 0x78747fdc 0x9af54a7b 0x12ac6d0c 0xb1b54096
+ 0xbfdda75f 0x128ab19b 0x27df8b10 0x8c7c4129
+ 0x3f624e9c 0x8ad257a1 0x1ef6d4a7 0x975c7886
+ 0x0f6bd612 0x14ca9031 0x7de145ce 0x9bfb1a63
+ 0xcbb5e614 0xe7801eda 0x9285d689 0xad984119
+ 0xf1ee771d 0xa33ed630 0x9ac8e735 0xc6fa6871
+ 0xf08bfc19 0xc712cb28 0xc86cf1a2 0x2ccdd60b
+ 0x17b8c249 0x5fbddb03 0x97994dcb 0xa7cc6bb2
+ 0xd78f3ef1 0x975f3e5d 0x00b8214d 0x31ed6277
+ 0xb36cd683 0x479c1b64 0xdde3e419 0xf05836c9
+ 0xde1b0549 0x34c6f410 0xb09ba104 0x6d30517a
+ 0xe99a3a43 0x144a1632 0xd84c5846 0xa43d8850
+ 0x4edbe0db 0xb42f8b4b 0x2179a398 0xb7e6d28c
+ 0xfb0b43c8 0x0125ea28 0x39821135 0xca96637d
+ 0x16f5173a 0x3231e220 0xfdee4613 0xf95f5d6a
+ 0xfe690577 0xf4c46861 0x7e29b629 0x50e9ab1a
+ 0x546e6d9e 0x5d79fd8e 0x93c67ec1 0x98309faa
+ 0xcbb2bd86 0x606467ce 0x0814890e 0xd8770236
+ 0x65f538cf 0xf2dcfcc4 0x4a39b0a7 0x436d7323
+ 0x64ae68c0 0xdccc2654 0x7443744b 0x66be2a44
+ 0x699957c4 0x93b62946 0xacf624ab 0x175fc132
+ 0x3e89d209 0x1555ac25 0x62a25b70 0x0673a851
+ 0x8132cb98 0x917c1ced 0xdfe51ea3 0xbc2d7718
+ 0xa9d20408 0x0f897a72 0xd47719f0 0xef6fe253
+ 0x24a754bb 0x999fa777 0xccf547ed 0x2b7d4539
+ 0x74b58a9c 0x8106cac6 0x08ceab23 0x1c5353ee
+ 0x7755a6d8 0x5c540708 0xeb4db8ac 0xbe274621
+ 0x1aad9fe8 0xc4730db6 0x071c4042 0xe7604f3c
+ 0x422dc9c1 0x7443db5b 0xcec0c201 0x56247323
+ 0xd7841a1d 0x2e7b4062 0x33529c42 0x195bd16d
+ 0xab2908a3 0xa380e98c 0x3458650c 0xce7321b6
+ 0xda2ccbf6 0x81c2cbcf 0xbf1a6632 0xdda7af3f
+ 0xd837f6e5 0x1af3fba7 0x799dc943 0xd338b93c
+ 0xd53cbe53 0x1ea14b1b 0xd14983cd 0x5c128b83
+ 0x67b4de12 0xe1953066 0x363304ff 0x8d721875
+ 0x4872a85a 0x95a1c4be 0x1ec36a87 0xfa01837f
+ 0xa9a5c3a5 0x66eccb5b 0xc5ad6d97 0xe8f3c55b
+ 0x31d7786d 0x554c65d4 0x8d9dad06 0xa8079ee7
+ 0xe7858df3 0x9947190a 0xf6933767 0x9451bff3
+ 0x62ae5373 0x5ed0cc9c 0x45a002f7 0x264b46a0
+ 0xc6844f34 0xa609e1a0 0x6cb4f75e 0xcf949485
+ 0xe51115d6 0x7e9c3921 0x07ce3eee 0x0a324524
+ 0x9c438342 0xaf75882d 0x16ae3a18 0xf239ee69
+ 0x9bd67ee9 0xa4fccb48 0xd3a3452e 0xb9591408
+ 0x61a908f5 0x8caeef9a 0x5f60734b 0x16dd888d
+ 0xb12fefd3 0xe1633adc 0x559f7c6b 0xb233acf9
+ 0x7b31c9b5 0xd8f67ac2 0x52f43eac 0x1ec42085
+ 0xadb38845 0x3e93dd26 0x237b5838 0x049c5841
+ 0xfd0c9e22 0x89fcbd6d 0xe4ec3767 0xed69deaa
+ 0x32e0def7 0x5e6838a5 0xd148bda5 0xd93cc961
+ 0x51c6e231 0xf0f8ff84 0x07d71241 0xbc827db9
+ 0xcb0f66c6 0xdd559f7f 0xcdb23b06 0xa312dcfa
+ 0x25451423 0xf1937dee 0xaa8392e6 0x28a40c5a
+ 0x22ee9b7c 0xb134936e 0x802a1c38 0x15f289d5
+ 0x49f7584c 0x41d79fe1 0x852d4371 0xf16a1bcb
+ 0xf6d56ff1 0x3f030117 0x91240da9 0xd89243a9
+ 0x255b2462 0x919c2dfd 0xa9ca3fad 0x9410a730
+ 0xcee4d4a7 0xd1ff1629 0xe4e949cd 0xb792a0c6
+ 0x4557b3d8 0x7f35f4ff 0x0fc40751 0x815a6254
+ 0x9599e787 0x67d63390 0xb85cd4d4 0x49cf0026
+ 0x1b77297e 0x1ea09e33 0x52922842 0x88850b80
+ 0x15602291 0x0e102d47 0x3b9017d4 0x7c69cd81
+ 0xd0fc8695 0x89b66f04 0x644b0c26 0x5d9c1f6c
+ 0x2b439fd6 0x2b4c7754 0xdb12e51d 0xe6425b31
+ 0x213d40b9 0x5cff5b94 0x36d37893 0x42157be6
+ 0x8187955d 0x226c75ed 0xc11ba2d2 0xd08e7034
+ 0xd71c8f16 0x100cd39b 0xd22b9c90 0xabbf1b20
+ 0x96cb5b9c 0xc2bf3c79 0x153e2dce 0xe4e09907
+ 0x669b62eb 0x318c4d63 0x0f020ab9 0x97eda6bf
+ 0x4aac44d2 0xe6a48e8e 0x67b2c4eb 0x8c6951b8
+ 0x25b56bca 0xb1b86107 0x0f896429 0xfda27789
+ 0x70f6ee52 0x04e4b8cd 0x39eab79c 0x680a97f0
+ 0x57cd1f78 0x03a7be3f 0xe7bc5154 0x90c21bcf
+ 0x29c5f3f2 0xe651bedb 0xbc60e231 0x26fcd61d
+ 0x77e29bdb 0xe1f7632e 0xd0542216 0x5c20409b
+ 0xbf04c9d2 0x42494839 0x69cd5d4a 0xa13238f0
+ 0x37ee6e57 0x92f0692c 0x895db8b9 0x11618b3f
+ 0xbf84f1db 0xff26cf0f 0x39fd3e89 0xcdae196f
+ 0xa6e4fc99 0x866a0f26 0x1e5064e0 0xc8cb2c35
+ 0xe027c58e 0x7826835d 0x23102f37 0xdb2e2ae4
+ 0xf991ee0c 0xc09d41ac 0x1d35bd25 0x2cc7002e
+ 0x16fe24c9 0x550acd8c 0x698049cf 0x5ac6f2fb
+ 0x8b42e909 0xd54c7bba 0x6d7e0bd0 0x827ac5b3
+ 0x515741d6 0x4b68ac60 0x5dc21b9f 0xd550920d
+ 0x30dc43c2 0xf66a9f00 0xdf0653b9 0x25e44abe
+ 0x37de97bc 0x539fdc3c 0x814d3d35 0xa7321b72
+ 0xa7d54281 0xd1343cb2 0x335685bb 0x4e026598
+ 0x959a0af7 0xe9d9347d 0xe1428335 0x4aea4d28
+ 0xe291cd87 0xfb3455bd 0x9bf6ca76 0x407bfd48
+ 0x7bd8199a 0x1cdbea77 0xe77bfba7 0x30d4d97a
+ 0x5d319b28 0x2bdbb1be 0x1d0c4b1e 0xc2b8987e
+ 0x16609582 0xc8179734 0x078b4be3 0xa600e314
+ 0x946f5e54 0x0eed6f63 0xa78b90b3 0x717643a4
+ 0x6293fe4b 0xbde73e0d 0x011ee48a 0x4302e756
+ 0x24d15f56 0x89c5ffc9 0x4481975a 0x81ea1ffd
+ 0xba958ba2 0xb434fca0 0x72459be0 0x80c84042
+ 0xc5162b2d 0x3a1b24b4 0x9a0b30b2 0xce47289b
+ 0xc7300404 0xd1be44cc 0x67ea5c42 0xf6c97d46
+ 0x63a5dc05 0xea5fcd0d 0xe095cb46 0x6a0849fa
+ 0x50f172ee 0x39809f1f 0x79d7aa5b 0x3658c931
+ 0xe6861e96 0x6ec7d014 0xfc481f9e 0x5f937642
+ 0x01843f84 0x343565f1 0x54876cf9 0x442cd4b7
+ 0x883a07db 0x99c484bc 0x95f15b01 0xa1574a2b
+ 0x4bc75f62 0x93644ba0 0x1ba23bb0 0xb4acbdbe
+ 0xa1b9e321 0x70e96254 0x1be5b668 0xf3df4e76
+ 0x1ec1077d 0x53a1755a 0x235f32b6 0xa43e6554
+ 0x247708f1 0x26ac0aa5 0x21d0e0de 0xe56c8157
+ 0x579bdbf4 0x36f1e4eb 0xfa9eae74 0xa72b378d
+ 0xd8ae11a2 0xbf7cd65f 0x5878079c 0xab1fda3f
+ 0x409d08a6 0xf7e21f8b 0x07fd0685 0x1104254e
+ 0x4f4cce2c 0x6a3fe8b9 0xd7a3a98a 0xb49dd0b6
+ 0xf6c622bd 0x40dc74d3 0x92a5efd4 0x8132d6f7
+ 0xeb789b86 0xe372562d 0x9c191f01 0xec41e204
+ 0x7f72233e 0x6a97a91c 0x7548c957 0x23e77111
+ 0x1669d8ee 0x26065766 0x93edbc5e 0xff1befbd
+ 0xc9703895 0xb66287be 0x48cc29ca 0x65c800a9
+ 0xaffe3b20 0xabbc2173 0x11610d2c 0xdc6b71c6
+ 0xbc7b05af 0x2d390968 0x295bf334 0x64372651
+ 0x461c260c 0x776d6dbf 0x39dd11a6 0x5af6beaf
+ 0x2fd67fe3 0x59b8b4fe 0xe002655e 0xd998d7e8
+ 0x4e2e26e5 0x1c490af0 0x633fc9fb 0x4f3bc077
+ 0xa34f9f58 0xd4dad154 0x65c97188 0xb37b225d
+ 0x04027ffd 0x4b6300a3 0x478742df 0xb7689dd4
+ 0xea6377a6 0x850fa531 0x9de3c417 0x11c5b298
+ 0x87d695c7 0x1adc2a5c 0x88455398 0xacefd3ff
+ 0x34e32daa 0xd1b9008e 0x808afbaa 0x559120bc
+ 0xdbf49720 0x9c5badf9 0x9c34258f 0x8018ee25
+ 0x2b93bce7 0x779ca04b 0x6e0a3b48 0xdfbe13df
+ 0xf123f183 0x4277cc2a 0x6c2e48a8 0xd3e3f81d
+ 0x578cc007 0xaa81a4d8 0xd48d4ff8 0x7cf48c52
+ 0x12b11d11 0x3c7002dd 0x434817b3 0x9a57ff3b
+ 0xa19ad130 0x14a2590e 0xb973ee61 0x03e2fb13
+ 0xd2ce4893 0xc8874799 0x114949d2 0x76e77375
+ 0x078de0fa 0x55ce0761 0x3d544841 0x5b025388
+ 0xcf3c4773 0x803ef761 0xb2e053af 0x7c523650
+ 0x19d21655 0xef79ab2a 0x76ddb493 0x6dfffdb6
+ 0x2ba16dd0 0x43c032c8 0x73efba26 0x963c8bda
+ 0xcfed3f28 0xa5050b0a 0x05da3600 0xcba16a30
+ 0x46bff28f 0x15ff5bf0 0x723ee92a 0x7d30a9e1
+ 0x04c0b56e 0xb2784bbe 0x12e22ea1 0xed9765bb
+ 0x98122b90 0x12f11308 0x16cc0f64 0x0d1684d8
+ 0x27636750 0x2f423c1c 0x2d232bbe 0x4e3074cb
+ 0x5ee7a3f6 0x70a07522 0x0fa51377 0xbea2a52b
+ 0xcbcbc9c1 0xa0e9445a 0x342bf8a6 0x5ff44d0f
+ 0x5dbba578 0xa486b64c 0xd333f02e 0x94166eba
+ 0x835a2f39 0xea4144d9 0x1adf550e 0x922f5f14
+ 0x4bd6842e 0xcc5508fd 0x509729b8 0x97e3a0da
+ 0x1502d681 0x54133718 0x76af6c05 0xee5e68ab
+ 0xa9032f6b 0x1b35fcae 0x37f9101d 0x29fa9067
+ 0xee63a074 0xbb8fabc0 0x5bf66de5 0x9de88092
+ 0x49c256ac 0x798c5a57 0xe47b5d30 0x273739af
+ 0x6dd98eac 0xba8aba44 0x943ceae7 0xb51cd54c
+ 0x9c44196a 0xfb8d5174 0x962f59f1 0x4b993f12
+ 0x8c7866a9 0xa80e66bd 0xd619e562 0x7526df66
+ 0xcbe7248b 0xe58056fb 0x21959ce9 0x7cc51a54
+ 0x56e87a27 0x3a9c278f 0x9cec3ea9 0x66b8eab3
+ 0x0667bef0 0x8375b748 0x5d9138d8 0x86e91bc0
+ 0x24185745 0xdb2f13d3 0x01b2b0dd 0x9a358fdf
+ 0xf30e3c7d 0x304b0dbd 0x440bb690 0x0b711e8a
+ 0x6056cb97 0x30ae756f 0x5fb1e8c8 0xb2384413
+ 0x879931ee 0x5aed1a79 0x3c859d95 0x7af6f363
+ 0xcbce37e9 0xdf2be0f8 0x7f12d56b 0xcf915753
+ 0xac8e345c 0xd7df8ee4 0xd9b5e1ee 0x8306ccc4
+ 0x9e5b3fc7 0x38bf4e27 0x63475afc 0x4233edc5
+ 0x230ffb77 0xe13918d4 0x1ea05a03 0xf845750c
+ 0xd417f2dc 0xb6d25158 0x219039d4 0xbccaf9d7
+ 0xb1e44727 0x6dae7c78 0x47549388 0xeeb315f3
+ 0x79aa11ad 0x88a50a8e 0xee3cac93 0x6a51924c
+ 0x04a4b799 0x9106db64 0x42b4a099 0x9b2901b6
+ 0xc2e3aac4 0x586d472d 0x2a789813 0xb95a7af4
+ 0x01d13bbb 0x5f0b8e41 0xf95f3182 0x641dc9e9
+ 0x265779c9 0xa713a2f9 0x5cd19f4b 0x27aa226c
+ 0xeddd652e 0x3a07395c 0xca22ac57 0x4ad147e8
+ 0xf43ed399 0x5fce4508 0xaa1289ab 0x22b1df6f
+ 0x399520ba 0x09f3a4bc 0x59bf9f38 0xd8bd704a
+ 0xa64ae533 0xfbb34b9b 0x4aa9d05e 0x2ab62f9c
+ 0x0dd361ad 0x000caeea 0x37267540 0xab66045b
+ 0xedf23eff 0x54d08375 0xa0d56a23 0x8eb27a52
+ 0x44d900a9 0x3d922854 0xae577189 0x8a7f6af2
+ 0x05dc4fcd 0x44abada7 0x8243f96b 0x2b748f8a
+ 0x483e7ef9 0x8862cbe2 0x39d0b695 0x2cb8216e
+ 0x4d9fe0ed 0xbe5193ab 0x77187f01 0xc1ac2739
+ 0x45caf4ec 0x0f87807e 0xfacb08f1 0x6a1713df
+ 0x65413100 0xbee9fadb 0x8dfddbad 0x6c5b94a4
+ 0xa672ee8f 0x6caa7dde 0x28f1c33c 0x591d41ee
+ 0xa5cd15fe 0x4a193248 0x3cbfdcc3 0x1f2deabc
+ 0x3bf46283 0x44ef7fe9 0xc2746149 0x08959fbd
+ 0xe24dc276 0x7671f2e3 0xf1530519 0x1a6d6dc9
+ 0xe50f31b6 0x7b8dc105 0xb888fb09 0xf61d2497
+ 0x9b116244 0x0f66d30c 0xe7f0dd57 0xf3d57d01
+ 0xca0249b9 0xbeb19bec 0x08651ab9 0xd4ed5cd3
+ 0xd69286bc 0xbe88a628 0x6c65d515 0x3504a143
+ 0xc5058619 0x244e9c08 0xac47e987 0xb9d6c7d7
+ 0xe70c1d95 0xaeed74fc 0x11958ba5 0x8e6e335d
+ 0x632d8338 0x8935ff5d 0x4ac507ed 0x3352bef7
+ 0x797e7b7a 0xbee98206 0x832a50a0 0xc4a1a343
+ 0x97b85530 0x41e6364d 0x168f4fb7 0x7aafc495
+ 0x4d151df9 0xda375844 0xce336f4c 0x9da29b59
+ 0x544e4bca 0x2a342322 0x64669f0e 0x964f0e3d
+ 0xc08b95ba 0x9c3dcb9a 0xdfbd1d47 0x9b3ed679
+ 0xafb6ace8 0xf126b860 0x54135b76 0x021216bc
+ 0x50828699 0x0a7ed42d 0xaf94229c 0xfa5d6724
+ 0x9eb496a5 0x80d45fe9 0x2736e370 0x2ce968ab
+ 0xbb04396f 0xf3af6073 0x151b4e88 0x79186842
+ 0x8daa7f9f 0x8f58396d 0x5dae83bd 0x5e2ff686
+ 0xf8ce141c 0xa63764fd 0xf899c2b0 0x4f4566a6
+ 0xd9265d15 0xb462bb9d 0xe9dc819d 0x976b3bf3
+ 0x089e1788 0xb818e7ca 0x8e7ea97e 0x5d751541
+ 0x9d3eb2e2 0xd492ecc6 0xe13b3113 0xecab5969
+ 0x148fc8e5 0xad3ce50e 0x76180016 0xfcefbd01
+ 0x7fdb6d60 0x12b4f0a9 0x2c20795c 0x8d9cfb96
+ 0xeb6a9c96 0xe52d4229 0xfff76799 0x5257131d
+ 0x9e519097 0x976dda55 0xb9f1ee47 0x9ae4c7a3
+ 0x0066626e 0x2d761ad3 0xa126348c 0x211c5d8d
+ 0x4b04d2a2 0x17623762 0x50586c7d 0xdd1a458f
+ 0xa7a75592 0xe07db4fb 0x1c734db9 0x7a93cf62
+ 0x9f36c801 0x8e690d73 0x66384386 0x54c6b876
+ 0x207e9d7b 0xf37c3e97 0xc578a411 0xe882fd44
+ 0xc635590e 0x3245084e 0x0a32171d 0xe16911de
+ 0x1b7333a4 0xd6b1f15a 0x99231acc 0xb47744e3
+ 0xf9d870c2 0x20ea41c0 0xc5a758f6 0x96c2e9bb
+ 0x21cdc437 0xab9e4714 0x895c8b0c 0x4cd96082
+ 0x552c42e4 0x631d677e 0x584af198 0x7b8986d3
+ 0x7bcb6916 0xac597320 0xc6bb955b 0xab3fbb95
+ 0x73e18e2c 0x35a123db 0xe29ee696 0xa47e25c9
+ 0x7694ccf4 0x07e0312e 0xa98668c1 0x25ceef8e
+ 0x208b4cdb 0x5d52d0b4 0x73eb5d34 0x101d2bc4
+ 0x6efb2462 0x6fc5cb2b 0x03eaae45 0x43e0ad16
+ 0xfbe69890 0x142b491a 0x8fdd772f 0x2b16d31d
+ 0xfe9d9330 0x22e85f18 0x65ec872a 0x64871a65
+ 0x36ca658a 0xc0b57a2a 0x04d6a752 0xa698f526
+ 0xa1114058 0x8fea9ab6 0xe8a7edaf 0x6fd0093d
+ 0x18448c52 0xd8a462cd 0x5a67343c 0x01b15967
+ 0xfe12ac1a 0xf54f606b 0x688163c1 0x622e372e
+ 0xffdfe4ac 0x6f01351d 0xc5ea04eb 0x7a51dd8b
+ 0xd7631eee 0xadefd7a8 0x5c5caecc 0x2980fb70
+ 0xbfb74ae7 0xfc7261ba 0xed4131b7 0x9f74fee8
+ 0xe44ce2f8 0xd62e9ad4 0xff5c5f3e 0x36a8a6f4
+ 0x0c16614b 0x9fa3ca8a 0x178a2e2a 0x3d2c2500
+ 0xec1e3b87 0x2bed0c6a 0xc8c33d5b 0x52759bb7
+ 0xb2662e95 0xaac07365 0xedd4ca11 0xbc89b970
+ 0x2f3ee0d8 0x35ab53f2 0xffb12a47 0xb808e006
+ 0x09e3b477 0x9cdf9eda 0x6fd3da31 0x959ada45
+ 0x316c6a4c 0xca919150 0x1156bf37 0x04414cbf
+ 0x068df2d3 0xe1e8e0bf 0xfbbf9e6c 0x91221c9f
+ 0x39bd5ab4 0xd2b1e6e1 0x2362f14f 0xad545262
+ 0x701c0a2b 0x772464ad 0xffcf8891 0xcdcdb1a9
+ 0xe34e80e9 0xce7eebfb 0xde299e34 0x615e2ed8
+ 0x52a7f9e3 0x6cc1020d 0xbdee7e4a 0x569e7fc2
+ 0x59c142c8 0xf7c20e96 0xf20fb631 0x6740687c
+ 0x4d68fff2 0x5a2cd053 0x33b257e8 0x7b4f088a
+ 0xa4f176cb 0xfd328e24 0x3e154e03 0xa43b5b87
+ 0x11c71071 0x7257bfe8 0x2a535d61 0x36c78202
+ 0x722d168b 0x6890769c 0xfe42ecfa 0xa831d7c2
+ 0xb29d1ce9 0xb5aeb94c 0x37565794 0x2539f681
+ 0x5e591752 0xcb418994 0x835a9582 0x268cd714
+ 0x1e3609aa 0x6d61ca85 0x9e9294dc 0xd80dc7ff
+ 0x62fe6445 0xe1ea3101 0x5ad5adff 0x0db24cfe
+ 0x80a30b66 0x88d2bc06 0x9274e673 0x434cc675
+ 0xe9530b4a 0x269c98a0 0xc22c1ee9 0xf1a3a9dc
+ 0x51fb0a56 0x7547d9ae 0x867b1489 0x508c8a12
+ 0xdf8cd4c6 0x762bd1ba 0x80794fb2 0x2e923a11
+ 0x6c00d0bd 0xc3bb10df 0x8c5f12bf 0x6ca706f3
+ 0x7fe862e8 0x0d1518f4 0x61c8eec6 0xf201b867
+ 0xc3faff2a 0x3c8e0c74 0xb57f2e79 0xf84a69e7
+ 0x3f29ffb6 0xe4460c7c 0xb93854a0 0x826ccfb0
+ 0xe5bac7c8 0x8fae6291 0x9a481041 0x4fbd6c9f
+ 0xd565e22f 0xc736254a 0x7ac9ac60 0x57e9395f
+ 0x8324d3a2 0x19aedcb5 0x458ec2da 0x6f2bcfa2
+ 0xabf94fc1 0xf090b920 0x52a32453 0x8df5ca69
+ 0xa6cad8ad 0x78b946c8 0xc2a66495 0x6be3328e
+ 0x661d82cc 0x792206ef 0x9a23f795 0x87a4358a
+ 0xc095f84b 0x3b55b6db 0x61e9fcc5 0x193df332
+ 0xeea4ffb2 0xa948c000 0x33e4c69f 0x63e18e34
+ 0x15d54588 0x95fcd9f6 0x5b802518 0xd29163f5
+ 0x33e0c0d2 0x5d55f78f 0x4670d87b 0xdde32267
+ 0x0caee58b 0x97adfd07 0xba82b888 0x1309f9d5
+ 0xbe324ab6 0x52f3bc02 0xa65c5525 0xa6689f03
+ 0xb18bac07 0x51267e61 0x49f82171 0xddafed58
+ 0x37b59cec 0xd78152d2 0xc9e15f7c 0xad73670a
+ 0xab87d97c 0x2b8ee545 0xc53aed3f 0xe3dcf6ba
+ 0x760bac69 0x77063b2f 0x75358b30 0x1edc6db8
+ 0x7cf2ef97 0xa15ffb60 0x6ab73f6a 0x29832e6b
+ 0x47a21751 0x8589bea3 0xf2cc45d8 0xdb3d8cec
+ 0x8f89316e 0xc92e05e8 0xf908701e 0x05ca02fb
+ 0xca9055af 0x98261ed8 0xc20ca7fb 0xa818983c
+ 0xd6afd167 0x0c23b117 0x7b14c760 0xeeeae6ce
+ 0x2d6d2df1 0xe8b97dd6 0x91a146bf 0xc45c2822
+ 0x18edb5d2 0xf4322067 0x344eca4d 0x7aa61d1b
+ 0x6b7bbcb8 0xdaaff992 0xc7f1d9af 0x004a5488
+ 0x4056e400 0x68720a32 0x07020016 0x6d9508e1
+ 0xe67fafba 0xd3192f4a 0xeb75feb8 0xf70f0078
+ 0xe9d4e113 0xd6ad19d7 0x0a57fa5c 0xacd3e0af
+ 0x3b2f8dfc 0xe60fa073 0x71d022c0 0x60cdc1cb
+ 0xff6f3e3b 0x6f56876d 0x02da7761 0xdba11240
+ 0xcb6946a2 0x0c1cd2f5 0x5e58b320 0x031e6018
+ 0xafe088a6 0xb945aef6 0xff9ba07e 0x22f2c150
+ 0xa06ea588 0xb7c84ee2 0x021832d5 0x15bab1e3
+ 0x5751e3d7 0x0ed06781 0x0ac46714 0xf2b83cba
+ 0x82974ac8 0x572d7f6c 0xc0b2dcc9 0xb74267ad
+ 0x01b5f663 0xdc669a6d 0xe54de2e1 0xc489e3be
+ 0x8745a0e2 0x02bbe7a8 0x78ef8353 0x70611454
+ 0x49487788 0x5539e7c7 0x24cf1183 0x1d8afdd0
+ 0x119f6314 0x3d8a6f88 0xb21cba2c 0x8fa40360
+ 0x9346fe4f 0x41a673bf 0x0480b244 0x35ea4016
+ 0x16a555bd 0x6053a483 0xba8b89f5 0xf01dfe8b
+ 0xd034f390 0x3dc8d073 0xb62c428d 0xc157396f
+ 0xb80fe4ff 0xf8ed4318 0xd77e5827 0x6e25f621
+ 0x741ca755 0x1a230108 0x812cd8fe 0xc16b06cc
+ 0xf8c7e326 0xef900c87 0x55182109 0xeb49c8bc
+ 0xe4d64da5 0x159f165c 0x6b83712b 0x727d0a0e
+ 0x54295c6f 0x512e128c 0x5f64ae6c 0xb6e0b9a3
+ 0xc9bca0e5 0x74acac20 0x5133cc55 0x53854fc1
+ 0xc53b1a16 0x8e3737b4 0x0ae1c226 0x82bb4958
+ 0xd076fdfa 0x61bbc3d6 0x9bffc907 0x8884ada7
+ 0x61653261 0x9dad1561 0x94f09e29 0x039dcb7f
+ 0x2254661a 0x341d1877 0x1be7116d 0x4ec98bdc
+ 0xe4c65bc3 0xabebd063 0x47589b3d 0x9cc879f5
+ 0x15982c8b 0xa77020c7 0x3538b713 0x370c64e1
+ 0xc74fb9f2 0xf8b41ed8 0xd2ebb5bf 0xb017d73b
+ 0x97ba1ff9 0xa67b8a27 0x6d0c8a44 0xa105b7a0
+ 0xb37a34db 0x0fe7f07a 0x1c148611 0xfa53072d
+ 0x3171bd8b 0x2650cfb0 0x80fb7709 0x701a10de
+ 0x97eea655 0x59ae138c 0x742dc115 0xd631b80e
+ 0x39592e51 0x46e17975 0x84d0086f 0x1ce1898a
+ 0x7dfc4667 0x97e090d0 0x1af1f5cf 0xb901056b
+ 0x6102fa9b 0x8b091ff9 0xe6b04608 0x50d42eb4
+ 0xc34910eb 0x6420d46f 0xe1c63a02 0x1545563f
+ 0xca592437 0x9bb5a862 0xa9adaa9d 0x6b63f3dd
+ 0x2e8421d1 0x4436c8a1 0xfe069f0a 0xec241501
+ 0xc0372dae 0x381b7153 0x8f81e0bd 0x43d5e80e
+ 0x5784effd 0xa2b6e1ca 0x2ecf57d9 0x69fa2072
+ 0xb75cdb16 0x902b9782 0x8167bb38 0xfd05e6cd
+ 0x21f6e01e 0xf3f9c0f6 0x788d65fa 0xc957a9be
+ 0x9470c32b 0x718470fd 0x93593bed 0x50ed8943
+ 0x33088cd2 0x69f3ca47 0x66d28d9f 0x038c2c08
+ 0xa8ece07a 0x3e2d4144 0x6a676915 0x5e2e1d63
+ 0xf3ad8ae3 0x1b9725c8 0xe037d675 0xf1e80565
+ 0x3d40fa7c 0x30f6e383 0x0a39dcd5 0x60fab0b0
+ 0x515e34b5 0x58eb39e0 0xdd81d1f8 0xe3ca488a
+ 0xd17ca1b8 0xe6b69eae 0x64847000 0xd6885f81
+ 0x78417c1b 0x32757661 0xaaf7bc36 0x9122e930
+ 0xfbd61074 0x1d53bf81 0x60a449c1 0xe743eb61
+ 0x288768f6 0x4f549549 0x557b2e14 0x358d1fa3
+ 0x3aaad4c8 0x985986e9 0xd36a1f61 0xdc2ae2e0
+ 0x6e96ff1b 0x7b6c4f31 0xe442671e 0x32879a8c
+ 0x5833b991 0x45de1989 0x4811924d 0xdb23156d
+ 0x2d4f2b8b 0x554979bc 0x5fe9829e 0xfaec643c
+ 0x9323dff7 0x38807f08 0x0e255d02 0x2ad3f7e8
+ 0x9bfa7c5b 0x0beff56b 0x5c992f75 0x92540340
+ 0x46d25820 0x8db340f0 0x452cf847 0xea8f58e2
+ 0x41091440 0x6399d1a8 0x8a2264ac 0x9609e3ba
+ 0x263fba61 0xb1923d79 0xcd9d5fd3 0x4a5b670a
+ 0x2d5bb9a6 0x7fb0f958 0xc3c50eb4 0x77ebc5b9
+ 0xd0656774 0xf8047773 0x309dbbb4 0x0395875e
+ 0xd03f9414 0x541cdf9f 0x1f28cb35 0xae620c69
+ 0x714cfe74 0x131f5c3d 0xe1a1276d 0xb4797d11
+ 0x1824aa85 0xf695b531 0x30973b73 0x5f95c0ee
+ 0xe6722704 0x5d73a400 0x66f06a52 0x08a42726
+ 0xd5fb4ce1 0x9577bf82 0xbdfbe01f 0xaf1045c6
+ 0x170bb145 0xa40f9795 0x88da4c37 0xa8417263
+ 0xc0b19124 0xca1e4aee 0xe16a930c 0x5708231f
+ 0xceef40b5 0xce8a8658 0x8d77f697 0x56d8c708
+ 0x682fb701 0x062f7bef 0xcdd06d3f 0xacbbce6f
+ 0x4e3377d0 0xc8d08a3b 0x07387e43 0xf5738441
+ 0x34e27cc7 0x2959d4bf 0x6e798e68 0xe2fd29b2
+ 0x95e8b685 0x972bad63 0xac3e25b5 0x57e61037
+ 0xc265f8bf 0x697b6f8a 0xf0cf5f0c 0x8733e846
+ 0x7a70f93e 0xf370c803 0xd7c74e5c 0x9caccb57
+ 0x021cf7b2 0x0c104e67 0xab6f3c9b 0x71000592
+ 0x9ba5fc98 0x07060ad5 0x0fcd94da 0xb7cd6659
+ 0x54e7be2c 0xfda3d365 0xe418f91a 0x0265bf0d
+ 0xa87143e1 0xdf948a49 0x161dfc21 0xb91c3822
+ 0xd17f1149 0xd88d6db3 0x02b5ee68 0x306f9e00
+ 0x70082a00 0x201722b0 0xfe921c36 0x946a098e
+ 0x2c85aafb 0x3feb3e95 0x023d093f 0x68c3fd43
+ 0x49796b79 0x215b7bb9 0x7d899645 0x53e0b6f3
+ 0x01275119 0x89ef5092 0x0bee6baa 0x828287ef
+ 0xf2cdcbbc 0xcad0a642 0xd7dd58dd 0x8507b066
+ 0x4867bd5d 0x17735ee4 0x3d8c84d6 0xe7bbfc25
+ 0x4afe54d8 0x76a67be3 0x90e22d33 0x7af2edc8
+ 0x340d131a 0xd6169ca3 0xfe9c531a 0x80d4a781
+ 0x9f0ad542 0x23b90fa5 0xf3e3b2ff 0xdbdd4a15
+ 0xe885ffb3 0xe83f06dc 0x36d01664 0xccac8eb9
+ 0x0e2fe658 0x8e32fb03 0xf0feb948 0xab0bbc6d
+ 0xa2ebbb23 0x82f5a9f1 0x025b340c 0x3a1537e2
+ 0x3353e8ab 0x5d461c01 0x8c0fa939 0x7233d4f3
+ 0x2d77fcc7 0xd39fadff 0x8756fc45 0x48cbfcb8
+ 0x6ba0c1bb 0xaf826bca 0xe471a042 0x2a073d41
+ 0xdfff768d 0xe9e7e40b 0x4e26ea1b 0x471d13ea
+ 0x3e41db9e 0x2de0a5b5 0x52fe94f9 0xdd74f6df
+ 0x303b55b2 0xbcec507d 0x093e8352 0xce8c109e
+ 0x5b9e3ecd 0xe0ab45cf 0xcf7e5d4c 0xc96c12af
+ 0xe07f086e 0xcf6c6d70 0x3618958a 0x9eff845e
+ 0x35d4cbc3 0x68eb4585 0xf20f85fe 0x599d4cc0
+ 0x32293be1 0xaae3a3a4 0x76ece22e 0x22e032c2
+ 0xaea4cac8 0x563cb9ef 0x85dfd3ac 0x744b495e
+ 0x41913409 0x1553da8c 0x1778e480 0x350155b0
+ 0x9c1517d2 0x4bb4ff82 0xe8649a4a 0x8858b0be
+ 0xd5de22f2 0x4f8485f5 0xcbbb7992 0x0f4bfd5a
+ 0x48f9feff 0xee2b26f0 0x3dc09391 0xc8caaf8c
+ 0x3e64f3c3 0xf7a299da 0x9285b5f6 0x94a0bed9
+ 0x5cfb559f 0x5c152fc4 0xc3ac4928 0xada954e6
+ 0x8b0890cb 0x35c8e9d1 0xbe8f23b6 0xa752a66b
+ 0x3153a838 0xdfa3ac41 0x2d01f9ee 0x15b6a289
+ 0x3a59c616 0xa62ba845 0xc9fceb0e 0x894d02d6
+ 0x59bbe43f 0x8999cca5 0xb7e3b015 0x1c56389e
+ 0x1a4d8fe2 0xd8093920 0x2ef7b14b 0x4d09fc33
+ 0x8148f366 0xb33afb8d 0x62a121da 0x012313bb
+ 0x42fcef59 0x69f66472 0xb8539ce5 0xf56a9e1a
+ 0x7e8f0b38 0x55a7d94d 0x72ca77d0 0x33eb0192
+ 0x393552d1 0x1ea5b260 0x63d751e3 0x59cc559a
+ 0x765ec596 0x07dd4159 0x783419e2 0x84870e85
+ 0x6fe93a6d 0x1c4fa8d4 0x845a9b43 0xf83c406c
+ 0x01bb3657 0xb57f03fd 0x7a43accc 0x25086537
+ 0x2749c2e4 0xa74612e9 0x214c1c64 0xff5baeae
+ 0xf9718add 0xf45ac774 0x1f709894 0xdd07661a
+ 0xad8bded0 0x016f598c 0x85728daf 0xcdf2648a
+ 0xba9b05bf 0xc5915f4a 0x0e636683 0x782a41d5
+ 0x92258d0d 0x76879ddd 0x4dfef931 0x43c6294d
+ 0x9e0a0f33 0x3baf914f 0x82ea0ccc 0x2417f36d
+ 0x933d283c 0xd49064df 0xaf705fb4 0x292ff209
+ 0x104ecbbb 0xf7161f37 0xf1a32b65 0x440d9e20
+ 0x99b1f14f 0xdd7c40b0 0xfe1454b5 0xb66c6234
+ 0xfdbe13e7 0x46c99139 0xb8479077 0xf7779973
+ 0x8c960fb6 0xa194e586 0x3c720cbc 0xee20add6
+ 0x28506fbc 0xaccd5f81 0x80f6cdbf 0xe1c52a91
+ 0xc4ccd59a 0xaf1e28de 0xd89853fa 0x85843b1d
+ 0x04c1e2ff 0x5c0b4616 0xbbd12336 0x9fa7b839
+ 0xc7deed28 0xc2ab5517 0x89cfe951 0xebbdb0b0
+ 0x598f7687 0xe928e119 0x3f03cb67 0x985af6dd
+ 0x5d54a64c 0x96f70d4b 0xdfe127a3 0x0cc32534
+ 0x3fdf00bf 0xa5490101 0x694635c9 0x1d181afb
+ 0x195e7dae 0x08d1b01c 0xe50b7f44 0xe0c66ff8
+ 0x3e7d7df4 0x29dfa54d 0x396d4d56 0x5a5fec29
+ 0x2f0b1ea3 0x1c429153 0xf873906b 0x6eb926ef
+ 0x1ed0626a 0x2e783b2c 0xeb16668e 0x54ce6f8d
+ 0x44346c9d 0x223594b1 0xa676ba72 0x52e6aad6
+ 0x43aac9f7 0x7c3a943f 0xf3b3ac65 0x40406bad
+ 0xffe83b06 0x78aa8653 0xa1fa7542 0x6ce5804e
+ 0x5460f9e2 0x2d71b525 0xb7326a91 0x4ec206d4
+ 0xf527fc96 0x11772a2e 0x2b40b840 0x39d3f9f5
+ 0x8b0f190f 0x8644fef3 0xa5ff3268 0x52f86ffd
+ 0x0f018df7 0x42540a92 0x7bfc5d35 0x964c0a00
+ 0x018bf8cd 0x3ac4a3bb 0x46d91e99 0x34864b57
+ 0x9b27684e 0xf52848c7 0xe9f499d7 0x5ed9520c
+ 0x325d3019 0x54b74933 0x10bbcdbd 0x843d5ce8
+ 0x1350ac4a 0x10054476 0x0c434aed 0x6e401c15
+ 0xeac89092 0x8928ccef 0x4b3ceca6 0xb79327e5
+ 0xf68b937c 0x8284deba 0x5787d3e9 0x171732af
+ 0x2dbe7ee5 0xe7a0c06b 0x95615d4f 0x8f8c11a6
+ 0x13b2e6dc 0x55df9fe4 0x087a97a1 0xaf7bd784
+ 0x9b9e74d8 0x26a90a74 0x7f4f506f 0x10eecf92
+ 0xedd22425 0x490a9ad2 0xc229a4df 0xfba84966
+ 0xe7a61de1 0x5bc09b37 0x09114d32 0xda88bc90
+ 0x8f445360 0x69b19ba7 0xb9d2a4fc 0x1d971264
+ 0xf9da43f3 0xee9cfc18 0xbd336645 0x3bb51d85
+ 0x3a9a2600 0x58599a7a 0x48bd1dec 0xd8e78ad6
+ 0x40bbca73 0x92b149af 0x063f99b5 0x4647638f
+ 0x7d175128 0x140aa819 0x6fe74eb6 0x94691c2f
+ 0x317fac5b 0x98a645cc 0xda37bc6b 0x6b3d5ddc
+ 0x4ace45cd 0xcd36c61f 0x2e5c5b6e 0x7f5906e3
+ 0x0784d3d2 0xf4b96726 0x077559dd 0xe068de7b
+ 0xb32065a3 0x630e552c 0xf8f58a90 0x397637d5
+ 0xe73aa63e 0x97cc9bc9 0xa4d6d2fa 0xdbbcdbd5
+ 0xdd8f2653 0x0c81184f 0xdc1a58ac 0x3b420612
+ 0x47c5eee1 0xdf8b7c86 0x12ad08db 0xbdda9dfb
+ 0xe15bcf9e 0x98fb6b80 0x1e0abf93 0xdcd32013
+ 0x5ff178a4 0x74bc98fc 0xbc942107 0xf84dd8c9
+ 0x6f65042e 0x30be145f 0xb6d4fa39 0x54ef9dd0
+ 0xc67654a6 0x5a4fbe86 0x97431a93 0x29be3abc
+ 0x61f8d807 0xd629e228 0x2d348c64 0x40d53c5f
+ 0xb32f8f6b 0x9d7d19d1 0x91c295e7 0x0900015b
+ 0x3bd8edce 0x643a6dbf 0xdb9c134e 0x052d2348
+ 0x3985d783 0xe6214b3e 0x0ceea115 0x8a97ef33
+ 0x1951fd0b 0x05672f90 0x24b61c0e 0x32aa09a0
+ 0xd56e1a76 0x9b43c0b4 0xfdf5c115 0xac8854a6
+ 0x4574d2eb 0xc3b1fb64 0xfb318b58 0x1b61932d
+ 0x645d1434 0xac9c6028 0x68db8a50 0x695e0986
+ 0xb9378c0e 0x5d9753ce 0xc5801b0c 0x2b914f4d
+ 0x69362da3 0x6dcf0bba 0x3dba091b 0xd81155bf
+ 0x2ae6ceaf 0xbc5d3ea6 0xb3696a31 0x0d910d86
+ 0x61e9f818 0x11966945 0x7e808dcd 0xd6c990a3
+ 0x23fed067 0x7f98fe99 0x38c05e9b 0xfac83319
+ 0x6f40f294 0x99225033 0xa04177da 0xabde8892
+ 0x09bb36f3 0x7a958cd8 0xb74932bf 0x2efaf9cf
+ 0xfcdf2bcc 0xc5baeafa 0x289ad862 0x3eb0f9fb
+ 0x524bd500 0x66182e9f 0xab892c38 0x64d7ec97
+ 0x510aef95 0x9f7cee10 0x415865ba 0xcd86791c
+ 0x17c3bdad 0xe214512d 0x3fc96df1 0x93b8d658
+ 0x4e817981 0x74192d57 0x1718380b 0xc3b266e1
+ 0x3c29d04c 0xed3f09b0 0x3f336186 0xc74a44e4
+ 0xd30e15b4 0x3fe5cf4b 0x38e02365 0x87da8d5f
+ 0xa6918ee3 0x1f58d143 0x7d762103 0xfb1b37e4
+ 0xc9ba17ca 0x29105a84 0x01c6f74c 0x577de9e7
+ 0x270ed2d2 0xdd28071a 0xc66d7707 0xc9250b61
+ 0x11521c10 0x9efab61b 0x94ef5452 0xc2a8847b
+ 0xc4eb4a70 0x75549c80 0x5a398a60 0xf27cf77f
+ 0x162ccca7 0x6cea6d46 0xf8724576 0xa7715f1f
+ 0x83472f4c 0xaaaf12e8 0xe5f3225a 0x602188f3
+ 0x8e10688a 0x477793c2 0x055a94f5 0x989004f4
+ 0x50538cb2 0xf758cf09 0x5b3e1f0a 0x9d3be1ef
+ 0x78b3bb3d 0x283429b7 0x5904b82b 0x7791ec90
+ 0x4f62f742 0x85910cb2 0x88227cd9 0xab20b554
+ 0x9e181a23 0xe4ca55f4 0x415ecf0e 0xfbba25b9
+ 0x56dc4d43 0xe491fb91 0x008dc964 0x8528b622
+ 0x9538ab29 0x1fb56a06 0xcf6b791d 0x138b53ab
+ 0xf37d6d8c 0x38f813a1 0x59447c80 0x9ec08e62
+ 0x551d8684 0xc30c28d2 0x4f7a7e94 0x2f1a6fba
+ 0xb03d5bca 0xcea3cabd 0x1c3c66e7 0x89b412d3
+ 0x31eec879 0x51d9c13f 0x8d4e64dd 0xacaffbec
+ 0x1e978596 0x6663f425 0xf344dd59 0x5254ff1b
+ 0xa6bc460f 0xc4fdb022 0x3d5e5d4d 0x411f5f91
+ 0x8c574d13 0xbe2ae560 0x0882307b 0x26a703f0
+ 0x77a928f2 0x1c65e6e7 0xab26ad92 0xa370c465
+ 0xc92aa2c4 0x3ceb0899 0xcbf6c098 0xf133da7a
+ 0x4ea55ec0 0xe80a19b7 0x2c44ac08 0x76a7f23f
+ 0xbd64ba33 0xf3ead7d9 0xb1638c82 0x2959cdd0
+ 0x0a7646f3 0xbf2857f7 0x355605cd 0x54801112
+ 0x45622ed8 0x9f1ea771 0x63a53f12 0x81d63a7a
+ 0x0a989e59 0xc3fe2618 0x65762357 0xeca3af22
+ 0x138494f7 0x17795305 0xefaa46af 0xe5a3d0aa
+ 0xff654c04 0x4f9543ff 0xd32bf76c 0x90a9c531
+ 0xd72ef592 0x47396347 0xeb3902d2 0xbb67ba7f
+ 0x9885fd57 0x663d6975 0x4ffd1507 0x465c7749
+ 0xa09ae051 0xf1ac19cb 0xae4a58ff 0x8d51f111
+ 0xe6cfd107 0x183241e8 0xe1024212 0xa6a1be30
+ 0x0d6fb8cd 0xa9fdfc68 0x682db3de 0x600a1191
+ 0x6576b836 0x1cfb2dbc 0x81edbcf7 0x6724d6f7
+ 0xc953334f 0x8beb8c32 0x1cff827e 0xa1b64518
+ 0x94bd5568 0x9645ea51 0x1b17cb54 0xb4537111
+ 0x4ee6404b 0x4a9e390e 0xcc3f0596 0x3b40e328
+ 0x0a8a46ee 0x18a2497a 0x4ebe7b10 0x4734ed23
+ 0x4b5b780d 0x2d58b0b7 0x4f003454 0x106ea2b0
+ 0x96338a78 0x99a2d258 0x3bcd3c24 0xe9171f98
+ 0xf53f28be 0xeb4c6bdb 0x7873f13b 0xadfa32bc
+ 0xfd9a5c9a 0x8f9c0955 0x74a20e95 0x0e5ceb7a
+ 0x6cb22f73 0xa0e403a1 0xb3b46888 0xfd897d09
+ 0x75a7571f 0x6f57ee02 0x6ab0b730 0x5ec25c97
+ 0xb7ad96a0 0xdf8c309b 0x1ef43910 0x8aa0762b
+ 0xb837ae11 0xb8dea241 0x48fd99dc 0x7f172ee6
+ 0xa601708e 0x73db75de 0x992c9983 0x63712a44
+ 0x4959af0c 0x7e2918f1 0x171d5d78 0xd08a48b4
+ 0xd4918738 0xa793aaf7 0x75ba7d1b 0xa7906816
+ 0xd2448c66 0x2dbb4c5b 0x06bd992f 0xac8e6248
+ 0x0598d56b 0xb270c2d4 0xb30e6c13 0x8e4d5737
+ 0xfa6d2ff0 0xd9b814b2 0x67f8c96c 0x25eb6d9a
+ 0x84ab30a7 0x1bc02a16 0x1b7490b4 0xf15f3b88
+ 0xff30e664 0x93923f25 0xd7d16d36 0xae8a6386
+ 0x5d570513 0xde712ee8 0xdf6f779d 0x69f99aac
+ 0xc08c2fa9 0x2936303d 0xb827825d 0xeb572a57
+ 0x889f4adc 0x88f7a156 0x8e55d08b 0x6ef07e2f
+ 0x85197e9a 0x84ed69da 0x9f71b333 0x541e5ca9
+ 0xb50378ba 0xfb378085 0xfb70ab90 0xea0118cd
+ 0xf2af9e45 0xe3cc28ba 0xe23dd167 0xca4ca7a9
+ 0xb0dd538c 0x06200f5d 0x5cf68a66 0xf91ea9af
+ 0x69679e3e 0xa119c1a8 0x1381e5f4 0x4dad271f
+ 0x44e96569 0x7f4c0a70 0x48b1f70f 0x3ed120ce
+ 0xa9a14283 0x848cddc8 0x29bff7d6 0xcb3818bc
+ 0x6b9cf285 0xea21693a 0x2bfe9e1a 0xd675777f
+ 0x964c311f 0xa916619c 0x271395e9 0xf18749e6
+ 0x6e490302 0x75d6a3f4 0x1a7a5cdf 0xeda3ed50
+ 0x04fc7264 0x42b53a21 0x82f2706c 0xe5a6f0f9
+ 0xa0636220 0x4249c3b2 0xa5e01986 0xd521df61
+ 0x8f5107ea 0x18bdae9f 0x3a685b33 0x5b68b069
+ 0x81842215 0x3477440a 0xa4ea6722 0x4282ab6d
+ 0x95438aad 0xbf5c89a9 0x73caf622 0xdbe07f84
+ 0xa0b36e6b 0x9ee5fc76 0x371a4e80 0x0dc46f3c
+ 0xfbe25193 0x0a416bb0 0x3ac9ffad 0x42ab52d3
+ 0xc2c7ba93 0xce3914ab 0x7cbd49de 0x39cecd8a
+ 0x6c6e19f5 0xae1cc215 0x68647865 0xb9878bce
+ 0xc69e46ff 0xbe330e8b 0x9b26e30a 0xa023d085
+ 0x39d91fc7 0x4401e719 0xd9f62ad9 0x6d1aef5a
+ 0x234c8a27 0xe4f8e6e9 0xa6c63d04 0x601da433
+ 0x359bc185 0x96a6a1d3 0xeca09192 0x1bb7b4d9
+ 0xa6b66bb9 0xa20f2686 0xe08e66fa 0x83e105f0
+ 0xd0d3070c 0x56e6f3e3 0xb52defd8 0x89e3b8db
+ 0x87f5dbbd 0x82ae6cb3 0x5133abdb 0x722ad75b
+ 0xfdc790ca 0xffcb2097 0xf5a5f8c2 0x598a62d9
+ 0x69abe5f5 0x3cd812b2 0xc1ead283 0xf308a524
+ 0xc69a652a 0x60bf3daf 0x7e8c3c8b 0x060c78af
+ 0xa427b01a 0xb7002ac2 0xee11e506 0x3b1f02b5
+ 0xfd6a99d3 0xf68673a2 0xfea0aceb 0xb7e3129a
+ 0xcd6be898 0x1e350a9b 0x00087306 0x651027d7
+ 0x96f67b85 0xfddd87e2 0xcecd9ce1 0x23914f19
+ 0x2baca7a7 0x59e98966 0xe3d40395 0x0d474a28
+ 0x21a45fbf 0x180cce5c 0xb95349cd 0xfc33ab53
+ 0xfed5c534 0x31ea17b3 0xf738b5b8 0x3c7b1c2c
+ 0xb4ff97fe 0x2991d2bf 0xa161c7d6 0x0b8d0e28
+ 0x2bb0845f 0xa18ee08d 0x3cbb23d3 0x272d2fde
+ 0x979f51be 0x402a856a 0x2e2e684c 0xc0725c5e
+ 0x151498e0 0xcd3b3ca0 0xc284884b 0xc35eb429
+ 0x7011a50a 0xae111112 0xaa6b3716 0x583738ce
+ 0xd3233b6b 0xeacf9269 0x500c7c5c 0x5ba9c133
+ 0xbc02b573 0x7f324a4a 0x0da91320 0x8481fe8a
+ 0x86bda1fa 0xa0644d02 0x42ec50ee 0x3cc0dcbc
+ 0x91782c66 0x49e0bc17 0xb72ac376 0x2a599d01
+ 0x72666f91 0xf28b3a2b 0x2e1d4883 0x9eef84fd
+ 0xeb1156fc 0xb82fb5e7 0xc1d31b05 0xd0e66645
+ 0x17936957 0x4e70a725 0xf2104854 0xfb1a8aa3
+ 0x33dd7589 0x7cf3351e 0x7be5be6a 0x69f1efc2
+ 0xf6bc5444 0x71b15520 0x23bd7f80 0x5f9b8652
+ 0x74ec2e77 0x8a7475d4 0xcb055568 0x56638ae9
+ 0x059d2310 0x61d0ebaf 0xdcdb9ad8 0x80d3ed00
+ 0x691d72aa 0x348fdef7 0x82f12704 0xfb9f8298
+ 0x1e6dd716 0xe43a1bbf 0xb0d9fc3e 0xf041bd37
+ 0x55663cb8 0x58c507dc 0xdeacc350 0x95d01a50
+ 0x0a5a1a98 0x3bca74f9 0x5b83fa01 0xd29a2529
+ 0x80dd918d 0x152c46d1 0x70d432af 0x60f8283a
+ 0xf5c4866c 0x4af696c1 0x03059ee5 0x2d5ef125
+ 0x56138f9f 0x3192ee6c 0xc8c0fced 0xd527524a
+ 0x3547f3ac 0x681877d7 0x85ab46d3 0x150c4b81
+ 0xe6f18306 0x434c8d75 0x1d1c9390 0xf3e81419
+ 0x8d3d8764 0x7dc75ec7 0x75c3b569 0xcd03a1c4
+ 0x9d3f41e9 0xfe19b33e 0x0e67a028 0x79401e87
+ 0x0e037b98 0xc58d76ca 0xe0f18cb7 0x8c560033
+ 0xa4665500 0xc4bb78cd 0xad95ca98 0xd68fb836
+ 0xfdf57060 0xd80497a9 0xa7a421ea 0x96d32db5
+ 0xa66fc3b2 0x95cdb8cd 0x23d0f185 0x91efb9be
+ 0x7d9e1f37 0xef1c892e 0x1d486e24 0x476682b7
+ 0x0a050d32 0x88d9c829 0x541c8537 0xfd710cde
+ 0xcba5a430 0x2439f385 0x72fd21b2 0x2ca554f3
+ 0x614f7729 0xec985291 0x0ca509cb 0x6d6e05b6
+ 0x08dd92de 0xbd192b92 0xe8ccb7e4 0xaf07cb91
+ 0x799ad4e5 0x5b4c6bf5 0x1a96cc14 0xcd2ae345
+ 0x17c15ee4 0x6197b941 0xe24b83b1 0x7d9d6993
+ 0x70f9691f 0x60bf2e52 0x1d01c51d 0x3bee5868
+ 0xdfd72783 0x8a0f4233 0x866a6236 0xc2740cc1
+ 0xdbaf339e 0x559cf7c6 0x96de364a 0x9c7cbcd6
+ 0x7217baa6 0xd82daa51 0xcf0c97f6 0xd0db73ec
+ 0x4f14d278 0x4669fa19 0xcf5d110c 0xe2011982
+ 0xd1bb97b0 0xce81f96f 0x8bc01310 0x37156ed0
+ 0xd77a974d 0x2a9073fe 0xb5f0d732 0x8a813bbe
+ 0x971eb766 0xca2c3d14 0x4c96d317 0xca6b323a
+ 0x85935552 0xf9f02c07 0xab3740ff 0x067505c2
+ 0xf5d79a6e 0xe0f07b19 0x84078681 0xec6f3957
+ 0xe440ea84 0xfd6e6309 0xa6179eb4 0xbec35610
+ 0x8174ddc6 0x6c748197 0xc731de2e 0x49ae5123
+ 0x7f467990 0x19f1f7ed 0x59ea5f2e 0x325c88c3
+ 0x833d42ce 0x621d7c1b 0x6ca406dd 0xa5680ffe
+ 0xd1c7b2d3 0x5a0bf09e 0x513d1f59 0x30882bf5
+ 0x5a3cc060 0xdc71a26b 0x70289e32 0x236092e0
+ 0x25b2423f 0xeaea4214 0xf8a027f9 0x67bc07a0
+ 0x860f374c 0x52c05b05 0x3cd08d35 0xe402c8d6
+ 0x3e3bd1a8 0xe2719582 0x095e06c8 0x17c0fd86
+ 0x6bc76611 0xdea59bd8 0xc34b8f1e 0x763a1679
+ 0x8c26c74a 0xd9a379b0 0x13aba746 0xfea28b8a
+ 0xeebd68b6 0x7c4be527 0x53e05cbe 0xd4696042
+ 0x8d2aeaec 0xcfffe2d7 0x2f668a74 0x79eebfb7
+ 0xb0b47728 0xef935a45 0x40776fa7 0xa4dc6e68
+ 0xc134bcb4 0xf56a1c7d 0xd7b188db 0xfccd1513
+ 0xd5fa1cdd 0x0da42ee0 0x917f9565 0xc85997bf
+ 0xf3e0f227 0xe09dc49a 0xca311aaa 0x574b0177
+ 0xd9e5882a 0x0f2ff3e6 0x1b9769f5 0xcb86228f
+ 0x3530ef4d 0xc0065320 0x55c4a52c 0x56bcf2b4
+ 0x28d6b879 0x4f6bca0b 0x8c13384a 0xa1ca5361
+ 0x48532265 0xd6167805 0xa63e0df7 0x1c83982b
+ 0x367bbf0d 0x14e4797d 0xce1f56c7 0xa04a254f
+ 0x0100bff2 0x253f6912 0xbdab9fa3 0xdfb39d62
+ 0xc61c6b98 0x328b68dd 0xeaa264b6 0x892578f4
+ 0x0ccb1952 0x9f21a8b8 0x38484927 0xc35a4a04
+ 0x901e27da 0xea2b1952 0x3a04a54f 0x22c27e88
+ 0x536408bc 0xe40b9d2b 0xf97afa03 0x2425f1de
+ 0xbe9e79cb 0x5c656ea4 0xcd9f53d7 0x7c2459c8
+ 0xf2cf492e 0xd66ba4d5 0x932c54a0 0x682dd6dd
+ 0x1fd9d2f4 0x7a4c719f 0xd3102aea 0x0ee30eb7
+ 0x26328baf 0x828ef58b 0x8a78a330 0x00c1742f
+ 0x6a918626 0x9de34f8c 0xbcdef508 0x260901a7
+ 0x7ce3d9d7 0x3b2ce881 0x872791ce 0xb877f248
+ 0x208c6741 0x3926bb9a 0xf6ef56c4 0x71e95a98
+ 0x6e65ac48 0x32655c5c 0xe17578aa 0x7f79bc19
+ 0x5f2214eb 0x2fdc1b96 0x1339f21d 0x2b9b682e
+ 0x766f751a 0xa63dcd95 0xd7a19033 0x3dbf3738
+ 0x6f1caa22 0xb2145b92 0x27350daa 0xe36d8963
+ 0xcb6152bd 0xaadba327 0x3264e5a5 0xcde388d2
+ 0xbe051823 0xf812b0f6 0x0dd2725a 0xb18d071f
+ 0x55f11010 0x0131337d 0x773fd32a 0xb2cef0ec
+ 0x8c777bb7 0x536358dc 0x3ac5b6f1 0xb0032579
+ 0xabdd5210 0xa2ea314e 0x73a3906d 0xeb00bd25
+ 0x1fdbb407 0xa395c963 0x6be88c57 0x49697e3f
+ 0xc45e7d24 0xe7fb738a 0xf461814c 0xc8e10092
+ 0x0d7b6ef4 0xe30c0ea5 0xbf3d6067 0x6a341bef
+ 0x7eb252b9 0xe353e73d 0x84a72fa6 0xa1d7799a
+ 0x0b28a100 0x3e979814 0x0a01e9ba 0x041213e2
+ 0x9682d08f 0x97db936e 0xbd038ed4 0x018805bc
+ 0x5744f72b 0x293acae9 0x33361db6 0x51dad2b4
+ 0x71444411 0xf734afdd 0x2fd51800 0xaf887d8b
+ 0xb8650c96 0xddec4e1c 0x4c20c82e 0x6844bfe5
+ 0x1b4e3911 0x4376451c 0xfd8a040a 0x42203ede
+ 0x5ff4a30e 0x033125e5 0xee955d8d 0x60bb6fcb
+ 0x88e683e8 0x2c64e94c 0x7fd60fb7 0xdf71ff7f
+ 0x56e0b50d 0xeb80f2dd 0x8b51a6f3 0xc84563d0
+ 0xde6339e1 0xca9527ae 0x24c47d25 0x1bd828dc
+ 0xf0bcb594 0x8663ed64 0xa1c7b5b0 0x1c586cfa
+ 0x7a50799b 0x74c48f60 0x631183a7 0xa432410c
+ 0x410977ca 0x222954b0 0x8263a564 0x41acbe9b
+ 0x561b3f37 0x89e3ae92 0x9cd9d49a 0x4301b667
+ 0x985f3ae6 0xe2e3cb2b 0x9e9c9095 0xb46966c9
+ 0xf4103b85 0x911c3159 0xc7d3e024 0x8f315d21
+ 0x0509d166 0x9f915cf3 0xd20cce6f 0x93f3af79
+ 0x0f91111e 0x1d8830b3 0x983caba4 0xfebe1539
+ 0xa3fd7366 0x99a86b87 0xfb009453 0xf0e5c885
+ 0xff8026f6 0x191d065a 0xd98a7da3 0x6d2eb3ad
+ 0x46d35a1f 0xd0bba3ae 0x4310dfd1 0xf603632d
+ 0xdd07ff8a 0xf2cb72ff 0xd9643599 0x2e020a79
+ 0xb964ee0f 0x2211f75f 0xb3729296 0x9124d4b5
+ 0x7d657de6 0x542b4144 0x59cfad0b 0xe106d924
+ 0xa6ac25fc 0x4f4dcf4c 0x09a03e2b 0x2593cfc1
+ 0xeb51cebe 0x3c52ac75 0x4c9091b4 0xcde9d0e9
+ 0xefca538b 0x6e4ba953 0x91b2f850 0x8ac76d62
+ 0x7dd300ce 0x113b588b 0xf4d90739 0x6efa3b7d
+ 0x69bf858c 0x36fbe931 0x78ce8a1f 0x44c13036
+ 0xb5cda075 0x952b5f83 0x58e926e7 0xc33b1d22
+ 0x4678b660 0xc534c50a 0x6b045967 0xbc593b62
+ 0xd529ca82 0xddafd549 0x534a4675 0xc5f2810b
+ 0x010d724f 0x9bdcc4d1 0xac25d0c1 0x3337462a
+ 0xfdad1b5c 0x942d2ef3 0x5bc00f04 0xc1c0a1fd
+ 0x2cd752a4 0xbc9ddbe7 0xf9fe8983 0xe7f62a40
+ 0x5ecbc1eb 0x97215bf5 0x7d4ea578 0x9fa60471
+ 0xdfffb2ba 0x6e2e0e99 0x55339f5d 0x89a6fc60
+ 0x784585c0 0x5f3f1cda 0xd9b9eb32 0xcb6392cc
+ 0x29ccc5e1 0xece21770 0x60160a23 0xc1a4cb2a
+ 0xc04c2c5e 0x7d11d3b7 0x4e508c61 0x252d370f
+ 0x61ca2fe3 0xb8893354 0x156a1bee 0x8cfbb425
+ 0x0ec00ff3 0xb2d2c12a 0x744e9a40 0x9b1e322e
+ 0x20a00e1b 0x41f36133 0xbbf6844d 0x899998e9
+ 0xb61bdcab 0x9f099e9b 0x17f82e06 0x7be263a8
+ 0x49da5051 0x8e6c0a37 0xffe21180 0xedd1b2df
+ 0x9ea4f41d 0x52b90d0a 0xffe84c6a 0xa8a98e48
+ 0x10b792c3 0xc671854a 0x04d6d76e 0xca21a927
+ 0x69562081 0x42ba970e 0xa47d3ded 0x11290900
+ 0x1bce8523 0xd23d507b 0xf9371906 0x68fefac7
+ 0x86ba4afb 0x178b9522 0xb1b26fad 0x6c4bd4e5
+ 0x87f32b9b 0x4bc26f5b 0xa8c1748b 0x7bdd23b9
+ 0xca098aae 0x6f816727 0x83eaa588 0x3ac77f98
+ 0x8d417845 0xfe66d122 0x80c414c3 0x506db940
+ 0x79c972b2 0x84c4b037 0x6580b38f 0x1cd7ac85
+ 0x96eeaa0d 0xf718544f 0x756626dd 0x617b2315
+ 0x00d28310 0x3e5a31d1 0xe05f100b 0xfa00bea2
+ 0x3d1ce179 0x1da00cd9 0xe1cc6bc6 0xe07a17c5
+ 0x9f4fd5d9 0x64809f2c 0xb5a71c87 0xa0b89200
+ 0x12fd1d30 0xb026eb38 0xe84069bf 0xed556b2d
+ 0x48b71126 0xa6fc59da 0x4801cda9 0x54323a0d
+ 0xac881a6b 0xd6b8b66a 0xcce5dedb 0x36bdd0ef
+ 0xbbe0dbca 0x8267f1d0 0xc7144609 0x8c4a5a8b
+ 0x9b4bfee5 0x2400014c 0x51da7bc8 0xaa980c19
+ 0xbc6bb101 0x4ec052fa 0x382f14f4 0x1d3d0d99
+ 0xbe93b2bd 0x4541bdf6 0xb96df961 0x0db074ba
+ 0x3d930ac0 0xbac1dc8d 0xec705170 0xc682e13c
+ 0xae6373da 0xd8b872ff 0x815dcf44 0xaa0bb85f
+ 0x2a08228e 0x50d4d118 0x8f158f8e 0x9344b454
+ 0x40cfeb63 0x8711d963 0xa00597cf 0xffa6c123
+ 0xfea36087 0xf1127531 0xff5b516f 0x49ab591f
+ 0x66a4f2c1 0xe46f9f84 0x895384bd 0xb10cc9a9
+ 0x58aa653e 0xfc456ba5 0x7bb6eeb8 0x7af7745f
+ 0x2322ddee 0xe972a8d7 0x5c202012 0x009c983b
+ 0x47086cce 0x23f78f4b 0x932b8ec3 0x49e50004
+ 0x9240886a 0x4a173bc2 0xfa3164aa 0x1d9d2288
+ 0x29e23199 0xb08d8bf5 0xac5274c3 0x55486b55
+ 0x2c0d04c4 0xbd357b9a 0x766a55e1 0xa3a59052
+ 0x4220d9dd 0x82b1ee57 0x0bb060a4 0x78150cf6
+ 0xd037d758 0xb5aa59ed 0xae9dae85 0x80426176
+ 0x72f8ffc8 0x7380897e 0x56ae8a52 0xe86a04e0
+ 0xfe3d33be 0x4cc78b31 0x16ea75bb 0x40a64a3a
+ 0x4ab21ffe 0x8509097b 0xdf89f438 0xd0a8df88
+ 0x9b06018e 0xffda7f12 0xb6412342 0xa2234c5c
+ 0x073c54a0 0x54ab932b 0x54f3ba7a 0x767d27d1
+ 0x0e823a8f 0x206e93ab 0xab7b029a 0xd1e6fddc
+ 0xc56aff85 0x11fc8e64 0x104c00ef 0x1cdb304d
+ 0x669861d5 0x2fb3c3c1 0xcc3e829a 0xa4e01628
+ 0xfd07ac4f 0x311062b3 0xa82b6834 0xba8a782d
+ 0x5d139ca3 0x092f4c64 0x97a138b1 0x671bfe84
+ 0x32395323 0xb4811fe3 0xe4e1fdeb 0xee692025
+ 0xf9489f39 0x676f1f08 0x868dabc2 0xf9284790
+ 0x12fe33ee 0x4bf3eb4c 0x180dd059 0xa205262a
+ 0xb6054936 0xcbdc411b 0x7ef444c7 0x6f709eed
+ 0x75869b11 0x7a1ea66a 0x43a5c950 0x4050e2f4
+ 0x19a0cbcb 0xda1245c6 0x46bde7e9 0x4624cdac
+ 0xef1f2c6e 0x0cfdd195 0x22c250e3 0x6dfbabeb
+ 0x65d6dbfe 0xc32560b2 0x83817d15 0x2334666c
+ 0xb2c7847a 0xe33a2456 0x74c202d0 0x6ee768e4
+ 0xdb5adcfa 0x575521cf 0xf35166a3 0x38a1e16a
+ 0x5e52b85d 0xa9105dea 0x3001f463 0xa81282b5
+ 0x40f621fb 0xe017ed72 0x53179b07 0x5fba0fe6
+ 0x273a09cd 0x33c59783 0x36e46a18 0x2444bd0d
+ 0xca7bfbcd 0x72126bae 0x8e73e4f4 0x19b8327d
+ 0xde5ed4cf 0xc69f7abd 0x39e087ca 0x867bef14
+ 0x44412cca 0x8bd477f7 0x7b454f92 0xd29dcda2
+ 0x3985521a 0x3d057f8d 0xb4f25bf7 0x5ddf53a2
+ 0x2dbb000a 0xcc769706 0x7c509a35 0x7536d0e5
+ 0xe6fb28c5 0x78e9ca32 0x11c593a7 0xdc654c6b
+ 0xc536316b 0xa0bf76f4 0x73a446a8 0x18b86ee7
+ 0xbcac6e11 0xa3d419f1 0xaf64cbca 0x9f51f8f7
+ 0x5eeb5c32 0xd0fe97f2 0x88d1121c 0x3b22fe5f
+ 0x720a79e7 0x30bef458 0xf83ea136 0x96b9b18f
+ 0xd5f7c727 0x85d43ffd 0x0d33c6e6 0x18a0e37a
+ 0x210e8a58 0x638cc461 0x3ac82eb5 0x0d3a098b
+ 0x2e844cc0 0x97fbdaff 0x4be281ab 0x539ce211
+ 0xd431c84c 0x1d5606f9 0x92ada3b2 0xc351847b
+ 0x7595a55b 0xfd20526e 0x7f7da312 0x50ee5988
+ 0x86619923 0x58c93c12 0x48de7c9d 0x8951775e
+ 0x86c58dc6 0x7c11bb9d 0x1445cc73 0x4a5fb963
+ 0xfb67eae4 0x715bad5d 0x5b5282e1 0xe6005c13
+ 0x76aff50f 0xe1ed4e10 0x8ce7f4e1 0xee046339
+ 0xef369f23 0x88f8dcd9 0x277b7f26 0xf8afc49e
+ 0xa7114f15 0xb77f54a0 0x96a890d9 0x89c723d3
+ 0x6bd5c7b0 0xfcf80514 0x46ac6c44 0x58159bb4
+ 0xfa39868b 0x305e3d31 0x8dbb8ea7 0x2172f94b
+ 0x86f7674b 0xea2c4e84 0xe7122ae8 0x030e2111
+ 0xf4bb22fc 0xa6d86557 0xc25553c4 0x11022c02
+ 0x60bb2490 0xd072401d 0x1fae9bee 0x8843ad22
+ 0x8166238b 0xe26ad06c 0x5b96a160 0xab9ba04b
+ 0xbba87fb5 0x87a089a2 0x3c443686 0x95cdb795
+ 0x2070abd4 0xb66fae78 0xd2cd443d 0xe3f960f7
+ 0xf01a5190 0x0d8e29d1 0x812d7ddc 0x436fddf7
+ 0x85da3ee8 0x3c5da6a1 0x98e3063f 0xeab3e9dc
+ 0xb19c265c 0x148e8255 0x7f1c1be5 0xfe9a28c4
+ 0xc6642072 0x79db6955 0x36a653fc 0x7387416a
+ 0x963963a3 0xa384062d 0x2f523d8f 0x4c17cb15
+ 0x1ebeeef8 0xf3251237 0xd3562689 0xe1261014
+ 0x0277fa19 0x4eaf04fd 0x3c1a02cf 0x7f2d35c8
+ 0x71838b3a 0x89bf3914 0xc2e1167b 0xe30f07a1
+ 0xc1ddd568 0x6b760cc3 0x12e2bd8d 0xc81cc476
+ 0xf95424d7 0x48166ebb 0xae89af8a 0x4eb2b613
+ 0x05c0499c 0x43f7ae47 0x49b26a4d 0x70efebc7
+ 0xe6458dc0 0xd931c67f 0x564d09fc 0x3f5b48c5
+ 0x49113b37 0xfae8eb42 0x340f6fec 0x722f8f0c
+ 0xd8329272 0xa623e80a 0x3547cab4 0x266b501a
+ 0x6e762890 0xc1484a56 0x54a9801d 0x37acde5f
+ 0x4709ff9e 0xa7d6455a 0x55d30ab6 0x7fe5dd42
+ 0x79dc6301 0xb597d3cb 0x1cfafa97 0xa9a46412
+ 0xfec0a81f 0x9285ceaf 0xf1f1519c 0xdd50d7ae
+ 0x1c64953f 0xf3e172e3 0xced17f5f 0x1cc66c02
+ 0x44022f6a 0xffd7ecec 0xacad3192 0x24fcd3c7
+ 0x54c193dc 0xa698c52e 0x55f7a806 0xf200e68d
+ 0x7c5649a1 0x91595665 0x176f5f43 0x70ddcab3
+ 0x34603fc7 0xea739a38 0x0972dd60 0x846544f7
+ 0x5499b006 0xe4f7a0d5 0xdd6c9139 0x9c25e62c
+ 0x88f53b0d 0xbe1074e8 0x160b4f39 0x698352ef
+ 0x5aace662 0x1bd05b38 0x873e3b22 0x6a368f2a
+ 0xf2a7c13b 0xd4d5b269 0x255e6546 0x3ec84e52
+ 0xcb0fe661 0x0dcfd5db 0xb5fc18b2 0xa66c333d
+ 0xd947a7e0 0x1d6e598d 0x01190e16 0xa02b5a31
+ 0x83389457 0x068520cd 0x5492f8fd 0x36261168
+ 0x1f46a505 0xefb43fbd 0x1079db7a 0x1959e999
+ 0xe68a7bf8 0x9f4df5bb 0x58724697 0xd2144804
+ 0x69478ac6 0x1f40cec6 0x3cb38516 0xd34988f4
+ 0x834f7d76 0xf5e7fe32 0xef2c015a 0x18eae9a8
+ 0x1acdcf92 0x8c8d43f2 0xbc4afdcc 0xb94060bc
+ 0x085ca92a 0x60f68fa0 0x58e8df01 0x8cbfd008
+ 0x9f3bf0f7 0x41bf92c7 0xe15a791b 0x820cd473
+ 0xd85604ca 0xcf461ecf 0xbf4dcf27 0x21d0b4b7
+ 0x5b8f7cb5 0xb0d8720a 0x93108f23 0xda9cc89e
+ 0xdc20dd9d 0x26cad1b2 0x7863489b 0xd8b7881c
+ 0x7d4fe255 0xa568cb77 0x7cd793c2 0x97369021
+ 0x4f0192ee 0x80069294 0x56231744 0xe896631b
+ 0xe90773bc 0x60dad8d7 0x30774647 0x4615aaf4
+ 0x4d6b8af2 0x1ea00762 0x4ed2a604 0x17da0aba
+ 0xe683308e 0x181cf60b 0xdcf9852f 0x8425e6f0
+ 0x0a0fd062 0x2caf198f 0xd73456c4 0xf01ae7a1
+ 0xd35a93e2 0x73039b16 0x0898e624 0x4fce54ed
+ 0x35a9acce 0x7fe8568d 0xf07fdfa0 0xb24aea3a
+ 0xa7cf4dcf 0x71e9147b 0x5474a30c 0x4400103f
+ 0x70f1ed1f 0x2fba3216 0x318139a0 0x2d97bd43
+ 0xabb875cf 0xe5c48965 0xa617b7ff 0x605f5312
+ 0x657a4913 0xae5c7a1f 0xd7278db5 0xa727c6ae
+ 0x23237019 0x1bca1cf3 0x4ce7d75e 0x3d6260de
+ 0xda7542fb 0xfed426b5 0x584aacd2 0x409d7f66
+ 0x0cb12eda 0x32045830 0x3ea4cef8 0x23f1ae12
+ 0x82b55794 0x88476e1e 0xf5e6fabe 0x9dd24014
+ 0x526dc5f9 0xd5330e74 0xf564e324 0xb7ed3a40
+ 0xc666a437 0x8e621109 0xb0bb5c5a 0x882ec891
+ 0xd2ec223c 0xa4e014f1 0x18c986f4 0x37b091ff
+ 0x99d834d7 0x769c83e7 0x2cefe61b 0x568a793b
+ 0x2323c761 0x89a5b8e0 0x6362f58f 0x45be41b9
+ 0xddca518b 0x6b75c740 0x3dcea7ab 0xaab3321c
+ 0x84ac6e36 0x151aa4bb 0x5ef8616a 0xa8a6f4f5
+ 0x8971c6d6 0x4ba09733 0xb00ac1b6 0xcecc0a8e
+ 0x3902fce3 0x99cd7764 0x49635cb2 0x61285d7b
+ 0xe864c399 0x2888ae44 0x8456ae24 0xf4309ff7
+ 0x44fa0710 0x068ab156 0xcdccae46 0x510a3ad7
+ 0x00fdcbe5 0x707b0b45 0xe2498381 0x6d5b5891
+ 0xb7840535 0x916e2105 0x75bf1f3b 0xf1a9b91e
+ 0x22059373 0xde5f66db 0xca763395 0xac7368db
+ 0x094a11b7 0x00de9249 0x3b028a80 0xd3bbe38a
+ 0x020c4fac 0x15b1a7f4 0x823fd68f 0x7aedb2c8
+ 0xda1dcf88 0x8167363f 0x5212c8ad 0xcc539c32
+ 0x9a592ed8 0x739d5dd7 0xb07487b0 0x44cfb5a6
+ 0x4b7e9b69 0x6d955dd2 0xef11d8c9 0x1801ff87
+ 0xe538e687 0x837d77d5 0x5dd3dcf6 0x763dcc25
+ 0x8ba97294 0xa59a0e1d 0xc545bdbc 0x459b4722
+ 0xbf6e6ca3 0x923e279f 0x21469de7 0x915755c1
+ 0x779d24ba 0x82f39460 0xbd7ba86e 0xd410a466
+ 0x27e5aeaa 0xebc0bce9 0xd3952d25 0x7639086c
+ 0xc92aa304 0x1912539c 0x9ea5299b 0xd63291f6
+ 0x9fd17cd9 0x12689c75 0x0b2475ba 0x2f29f0b4
+ 0x1686610d 0xb7908df6 0x7e018220 0x6a9d967a
+ 0xb8853d2f 0x8f17d277 0x8ee35c9e 0x5bb52123
+ 0xcdc51b2c 0x11ab24ea 0x97a5e07e 0x16ae2ec5
+ 0x9d89b449 0xe0cd155e 0xb566de07 0x3da387d8
+ 0x2b163524 0x04a4e8a2 0xc08632ca 0x74346654
+ 0x334a0eb5 0xe0fec033 0x0f07e557 0x579cb55e
+ 0xc6a3b9c6 0xa96c9277 0x376ee1fa 0x44868b46
+ 0xe7f1b1a1 0x573319b5 0x7f7dac8d 0x6bc19580
+ 0x3a090d03 0xfc314db0 0x979d1515 0x13778534
+ 0x4449b939 0x0a8313b9 0xf8428aaa 0xb97a50d0
+ 0x7dbd8c53 0x76b2ffe6 0x15fffaa2 0x63c4df79
+ 0x3b282acf 0x2c751b03 0xaa6ac19c 0xd0ebe2a7
+ 0xd309415f 0xc6c76dd2 0x1f983341 0x8aabd53b
+ 0xdb5b4aff 0x12c283d2 0x62ae51aa 0xf30240c1
+ 0x026336e8 0x538067a1 0x86fa2b2e 0x247758f9
+ 0x42ef3f1d 0x930ea01d 0xadc11695 0x8a5ad5ab
+ 0x961378d8 0x815dadf4 0x89d6726e 0x9974f509
+ 0x9467085f 0x3f737b8d 0xe4b7e85b 0xa127a188
+ 0x43859791 0x04509c12 0xa908227e 0x4e881c59
+ 0x146a901b 0x36043abf 0xe0249d3f 0xb8b40360
+ 0xbc0e5905 0xd0897708 0x5bdbae08 0x2b9b4a5e
+ 0xf4f0f498 0x0d74ecf3 0xbdc2b65f 0x0cdbeb32
+ 0xdd8a336b 0x005a5f0f 0xd2c3b52f 0xe819f7d3
+ 0x181f7af6 0x18d77153 0xb951173e 0xaf0efbb5
+ 0x139c0df5 0xf55b2391 0x67f94504 0x625534e3
+ 0x7137d0cb 0x4581b79a 0x5e3325bb 0x8a881e6e
+ 0x56a92630 0xc5f640de 0x89ea6941 0x8f989fd6
+ 0x3ca31a74 0xcb271a85 0x6a387c51 0x3102c3bc
+ 0x84b11081 0xd0495826 0x601f3eba 0x317dd032
+ 0x3707a5e6 0x849fd348 0x558923cf 0xc1d6a6da
+ 0x9ac208df 0x0051eff7 0xefd7b696 0x53bc0b4d
+ 0x4e13e187 0x8bdc8c38 0xf63cc938 0xccd0fc6f
+ 0x3c246414 0xbe9f7feb 0x34f0f93d 0x41b1a8f2
+ 0x4cb44be2 0x6c59845b 0xfdd370a8 0xffdf9058
+ 0xf392f759 0xd09732a6 0x4bc3b395 0x344051b1
+ 0xb18f6e3d 0x734ffcd6 0x1318ba1f 0x0c13962c
+ 0xb1cd74e4 0x439423fc 0x833d7d7c 0xe9b7adc5
+ 0x2ce75959 0xc340708f 0xa57d4b03 0x9ea09ff2
+ 0x4c239371 0x879a996b 0x2a783a36 0xe7f95df1
+ 0xd814e58d 0x4fde6bf3 0x2f1b853e 0x71a60eed
+ 0x74368f0e 0xd518e17e 0x4f4d152b 0x5797fd43
+ 0x682c1380 0x652dee62 0x5cdd2d7f 0xb1a51c6f
+ 0xc0bf2a05 0xe96126ba 0xc03e1206 0x383d8f98
+ 0x61a97ed4 0xf1f8a5d8 0x449d44fc 0x4b61a046
+ 0xc228957f 0xc4a4791b 0x15f89e9c 0x0a18a2eb
+ 0x1c6040cd 0x4a7fd441 0x68d22682 0x9dac9a1f
+ 0x63a7ed73 0x66662c99 0xe9661636 0x438ece88
+ 0xc7cc5dcd 0x0ab73e2c 0xa3c05809 0x237a7be1
+ 0x9da8d9ca 0x3a678df4 0x174b2325 0x6699eb6e
+ 0x6ee6a1e4 0x15cf3d9a 0xc186100f 0xc48e80a4
+ 0xa216d214 0xb0abfdb6 0xfffdd485 0x59b8a696
+ 0xbe0b2bad 0xf32fb091 0x1ad71fb1 0xee001c7b
+ 0x48ce3760 0x11bef465 0xa6908b71 0x92516d61
+ 0x07c5ff99 0x0cef4a87 0xc799692d 0xd6684783
+ 0xc1aa46bc 0x2d254b12 0xa2ba5de8 0x313faf01
+ 0x05507d1b 0x29e1c622 0x154e0e98 0x4d76bcae
+ 0xad7a5459 0x4602faa9 0x8d325944 0x20d1c574
+ 0x4d9fcb7e 0x6b95443a 0x3ad64f33 0x0700ad1c
+ 0x0f162bb4 0xbe52b28d 0xc3fd2f6a 0x3d9348e8
+ 0x8a2e44a7 0xf2cce16a 0x00493d5c 0xe6e9ac80
+ 0xae579d23 0x7fcf2669 0x15d5197f 0x09c806b9
+ 0x808001f8 0xe2c0af54 0xa00fbe07 0x497f4f5d
+ 0x2179b3f2 0xdf4774f3 0x5326f7fb 0x53ffbc38
+ 0xb0e193fa 0xc96c9187 0xca82fbbd 0xe522ccd6
+ 0x5114b610 0xf3269b98 0xa86ac6b5 0x884238d5
+ 0xafa0865c 0x46b6cdcb 0x1e237e25 0x5df49865
+ 0x54a55227 0x103fe9fe 0x5e79b7c6 0xba5d1624
+ 0x48f6acdc 0xaa1060a1 0xff201401 0xf1c72711
+ 0x83bfd484 0xb9477bbc 0xc3094039 0x3fe23c1a
+ 0x254f9f9e 0xcf4de256 0x75ee4a50 0x6b04ff22
+ 0xf8065074 0x8208977e 0x0cc05238 0xe1bb9163
+ 0xf064f24c 0x1ea1de47 0x24359038 0xc5c17857
+ 0x9a61f46c 0x0380618b 0x1602b8c4 0x8b506160
+ 0x281ffe9e 0xae6a64d5 0x52911d06 0x08628fc2
+ 0x09b0bdfe 0x91d7e488 0x5dfeb2b0 0x554d331e
+ 0xcb4910d7 0x0f02630b 0x645a0d0a 0x8799a9fa
+ 0x1e90c160 0x5dfacd01 0x6e5b651c 0x43001211
+ 0xd9272dd5 0x3b4c1989 0x31d1b76e 0x0431c48d
+ 0x9b649d96 0x4018ead0 0x0f020d41 0x1fabb251
+ 0x7d379f56 0x59ab5470 0x29fab0f3 0xf502e9b0
+ 0x79c30707 0x165b1c6f 0x3bb4bf59 0xea326857
+ 0x892a2637 0xcac37abf 0x8f87756e 0x1dd5d05b
+ 0x2986abf8 0x7da8f9c9 0x163fcbd0 0xea0f6a42
+ 0xaa56217f 0xe82b10c1 0xf8581e2e 0xd6171338
+ 0x32d21d55 0x6ff99536 0xed2e3d73 0xa2d18f07
+ 0xa1660bf6 0xa89c770a 0x183afffd 0x280d0489
+ 0xfaf77ceb 0x020c77e0 0x9b3e113a 0x99b11be4
+ 0xb4d41ae4 0xb82cfa1f 0x1945a22f 0x4e156e72
+ 0xb1e8b7ea 0x943e0da2 0x309d01b0 0x103d0233
+ 0xec37b78d 0x0e37e6b6 0x274db293 0x1ccbc327
+ 0xea19b9cf 0x1cfef210 0x4298488e 0xb22277d8
+ 0xee59c14d 0xc539649f 0xfccfe8c1 0x5c989a10
+ 0xeaa9317f 0xdc2dbb6b 0x2d07ace5 0x32e3487b
+ 0xae086d5a 0x01d5d8ba 0x005cc847 0x2a6692b7
+ 0x5f5ae5f9 0x19c868da 0xeaa1ddab 0x1f849493
+ 0x3cd98fbe 0x6f02973a 0x885df640 0x033503d3
+ 0x4d65cecc 0xb6f97983 0x52ec0648 0xfa8c83e3
+ 0x43afcd52 0xf3fd8ad9 0x579ee672 0xef2511e1
+ 0x6376e64b 0xea4f5e23 0xf13075b3 0xab7c9c5f
+ 0x5304165b 0x9d6cdb33 0xfe463417 0x3d94bd5d
+ 0x13b55b93 0x3afffa8e 0x69f7629e 0x7ec208ec
+ 0xad17abc0 0xabb2d616 0x5641f14c 0x6a22f368
+ 0x3ae5000a 0x95f98b76 0xfd8b7ba5 0x7eea947e
+ 0x14850a2e 0x2811b9a8 0x4c60bc75 0x41867697
+ 0xd0a319ef 0xad739b60 0x0000b49d 0xef7a2838
+ 0x4b307ffa 0xe8a43fb0 0x15d00666 0xd9c686e9
+ 0xdd559522 0x950cf282 0x22637302 0x3aa53b0f
+ 0x80b1c08a 0xe96ced73 0x91e61c84 0xa0d0fdaa
+ 0xbd8fe413 0xfd36e042 0x5a09087b 0x41ca8ba5
+ 0x5582ce5a 0x942347ba 0x8f543e4c 0x8d0883c6
+ 0xf3b7900d 0x97dc4923 0x782f0938 0xab8d31fa
+ 0xce074404 0x517cd3ac 0xad20e6ba 0xa0e32f62
+ 0xce282013 0x23506bed 0xd55edcd3 0x8a949f33
+ 0x98357070 0x947df2a6 0xc2749533 0x5fd1b6f5
+ 0x783eb10e 0xa27d4380 0xfea7ae04 0x5fe3cf02
+ 0xe811a8f3 0x84b02fe8 0x0ae8b270 0xab5e39ef
+ 0x09cbc1ea 0xf3fa86d9 0x1257493d 0xc4fb830c
+ 0x82684855 0x681a3998 0x116c7625 0x109245d2
+ 0xa97679eb 0xdbaa6a73 0x1b548c81 0xa800a3d4
+ 0xdba71824 0x2d6ac2f0 0x97fbb83d 0x44ac16bb
+ 0x086466c9 0x068e445a 0xba067266 0x6a92d113
+ 0x4622b9b1 0xcea3ad3c 0xe4f18a40 0x358bab3d
+ 0x29d3f843 0x51574b32 0xed4fa591 0x84aad130
+ 0x61c97e51 0xe7e4f5e4 0x568d72b5 0x7e0376f9
+ 0x85ba9b6e 0x723dbaae 0x6a0e7b64 0x1d33f4a2
+ 0xe8117fe7 0x8f49b0c2 0x30538efb 0xcc7b34e8
+ 0x5be8af6d 0xba290732 0xaf3fdeff 0x83ba0ee9
+ 0xa4038c56 0x82d06778 0x8c365bc4 0x36921cd9
+ 0xf81b3664 0xd1e32720 0xa29e3f29 0x585dcf98
+ 0xdacd4790 0x902909df 0xbb803811 0x18859d23
+ 0x066726db 0xb1ea7f6f 0xd25699f1 0xafa83cc6
+ 0xd8b63456 0xa8caebdd 0x65b2a477 0x718f24ed
+ 0xcb22bc40 0x92c64ba4 0x11c00c0c 0x706874a6
+ 0x42a3e5e5 0x923ee55b 0xdecf3447 0x34a09608
+ 0x4963b9b3 0xba0a416c 0x4ce8b1c5 0x54a684c1
+ 0xbdeeadbf 0x9c4689c4 0xababefe0 0x8552a932
+ 0x9da36835 0xefe736ff 0x61dbdc19 0x42c8da6c
+ 0x9c9ea5c3 0xdda59588 0x50d16f05 0x9efbbf32
+ 0xa7aa127e 0x9a5bf19d 0xea2f6f3a 0xaf023974
+ 0x6d41a00f 0x94698a5c 0xa843d04a 0x92f305c2
+ 0xbb1a189f 0x51381238 0x2cd0d86d 0xb5271901
+ 0x0614ab8e 0xf11d1c5f 0x8bc6ecfd 0xb72a944f
+ 0xe5e37c3b 0x3d2fb190 0x5be6ff10 0x99e5b7fe
+ 0x08fb6b43 0x1b05d96f 0xc1e363c3 0x3b4ea153
+ 0x055fa866 0x63560a08 0x48d508b5 0x2fc84522
+ 0x9e497947 0x5da46000 0x08fe7486 0xb71af89e
+ 0x96682b28 0x4d1b01dd 0xed86a5b3 0xbde56a90
+ 0x59d66d6a 0x8d9ae73c 0x6b50cfe1 0x5af5b3e0
+ 0xb42d30e9 0x63630d25 0xd4e07404 0x00410f7a
+ 0x1af01c86 0xf0392f92 0x4e24573e 0xe267a029
+ 0x9e368723 0xebc0de48 0xea1799a7 0xcaa9591e
+ 0x3eec15b0 0x49147a3a 0x8398a992 0x0d846394
+ 0x383132c7 0x83b0cdf8 0x37be77d1 0x7451051e
+ 0x14596202 0xf47654ab 0xdd72e4c1 0xe5f6b03c
+ 0x174fe6c6 0xb2ec3331 0x553add25 0x824fe0ca
+ 0x743dd64a 0xa1f6a9b4 0x30e7f63c 0x541e4e26
+ 0x224e59df 0xe65c2718 0x7f663d27 0xa02a37e8
+ 0x3f46ce0d 0xda16ac30 0xeadebbe5 0xa1f631ac
+ 0x8e9a2524 0x01277d97 0x96ee64e5 0x868bf692
+ 0x42a67eaa 0xe8852162 0x965f701a 0x19f3eb75
+ 0x8f4c8a81 0x0c3d787d 0x7268eafa 0xe2aeb9ab
+ 0x96f2ced9 0x832314f9 0xb20bf783 0xf96cd573
+ 0x6912cfb3 0x843deb68 0x66b3b4d3 0xd51c896a
+ 0x83c9640d 0xdd44eb6d 0x49499ae1 0xed73fb90
+ 0xbba34589 0x9a9278d3 0x58ad6ea0 0x043ac283
+ 0xd9406ccd 0xbcb9bc65 0x7b60a064 0xbc84931f
+ 0xfa292d20 0x800329ab 0x27bd926e 0x69915eea
+ 0xe5725af1 0xdd498125 0x440a3c54 0xa4cd0026
+ 0x985de162 0xfbbb4d53 0xb0268b1f 0x475ae7e2
+ 0xdf9072f8 0xa0c61765 0x250d0ae7 0x65478dd8
+ 0xc799678a 0xd2c4d218 0x862ce7a2 0x96919833
+ 0x203b20e9 0x215e010e 0x80128487 0xf1c23e63
+ 0xa04fad4b 0xb8daf933 0x15f80914 0xdfc12a54
+ 0xf09894ca 0x0dbf802f 0x4822f4d1 0xff8f6c06
+ 0xdbd955c7 0x75bc50dc 0x3b2ee099 0x962cc2d6
+ 0x584684ea 0xef781e36 0x7f1cdc78 0x526cbd59
+ 0x71c3b647 0xca9da3a9 0xfceb24b9 0x5eb4ebad
+ 0xea05e523 0xe393ebf8 0x2234a837 0x5404fc94
+ 0x75e1f0b9 0x3893aafe 0x5df94edc 0x7a263e44
+ 0x529927d1 0x0a6eb683 0x829ee381 0x76c6317c
+ 0xd86bea02 0x386e83ad 0x3040f550 0xc7431de1
+ 0x3a554676 0xc08f78cd 0x3c906410 0x7d644738
+ 0x250809eb 0x0357ffc8 0x278792ac 0x1fbd32d6
+ 0x8b0c0c67 0xc87b2153 0x03dc960c 0x82f8befd
+ 0xfa807046 0x120ddd29 0xd90feab4 0x326df8d1
+ 0x37413bca 0xdc02be11 0x900b85f4 0x124d3924
+ 0x078b6666 0x1e84d3fb 0x3b7b556c 0x01db9222
+ 0x3f67bac4 0xbaa2092a 0x9d3926f3 0x838a7e8b
+ 0xd6ec9093 0xc7b28ae8 0xde908167 0x84b57590
+ 0x7d970261 0x3a3f7ac0 0x24ce07f6 0xe12fa1f5
+ 0x2a475218 0x21856d02 0xa889915a 0xf0076ddb
+ 0x5cbc303b 0x2ce1af10 0x4ff9772c 0x09ad5c1f
+ 0xf9da31dc 0x072110b2 0x2637530d 0x3445b14b
+ 0x72361261 0xa56d991d 0x5a3fdef8 0x8472cefd
+ 0xcfe469fa 0xf979bd1a 0xb13015f8 0x52dedd85
+ 0x7b2b4aea 0x3162f491 0xd191644f 0x06389e18
+ 0x59d35a49 0x14fc45e6 0x762a6757 0x8d73f8e2
+ 0xfbb66183 0x53664f34 0x21e39aac 0x1df6c044
+ 0x6e0b37e1 0xfd1d6be6 0x1e45cafe 0xb70f2cea
+ 0x95703ace 0x7def955e 0x060ed2a3 0xda4ecd97
+ 0x862f2017 0xf77a59a7 0xaf00f288 0x6a8a3c55
+ 0x5db5ad58 0x3871535e 0xd28ca2ce 0x19077968
+ 0xb6b3301f 0x6caac995 0x6f19d03d 0x93cf25e6
+ 0x4a5ef7d9 0x503a517e 0xb9128085 0x0b906ccf
+ 0x46c12827 0x03198651 0x51633fd5 0x57f76542
+ 0x7b2f000d 0x53d75ad1 0x2726e127 0xe64b4b7f
+ 0x0446d85d 0xd7b27611 0x014c2d86 0x04ef2c99
+ 0xf994c14d 0x7c8dd60b 0x87840031 0x33b59fa1
+ 0xa1b74cd1 0x0663e464 0x097c78d0 0x39517e7e
+ 0x8e439670 0xee73e23a 0x71191747 0x9d28f80d
+ 0x64a576d6 0xb93fe03e 0xbca46b86 0x03616ac5
+ 0x4d6f28e0 0xa42d5c11 0x85087dc7 0x7605084e
+ 0xe10664ea 0x348d8b18 0xc52546ed 0x3a0686b0
+ 0x0d6fb15f 0x70bf33a6 0x01a19964 0x0aaa4b46
+ 0xbaff2780 0x65537512 0xc4da57e4 0x18a089d4
+ 0x66170517 0x9154bc38 0x3fd4a883 0xfae08ded
+ 0x79997728 0x5e328a8a 0xe5168164 0x148a3df4
+ 0xae1e000b 0xa957e0a8 0xadefd9ce 0x758ae4c1
+ 0x5fb16b90 0xe2f91327 0x7267d2bb 0xc472d002
+ 0x8cd3b22c 0x55637951 0xa7563abe 0x5857990d
+ 0x94401edd 0xec2fc270 0x3ec524cd 0xf85d4e63
+ 0x3eef221b 0x450894f0 0x2734d776 0x0dd4735f
+ 0x2223521b 0x459c8947 0x2d0815ce 0x44940b29
+ 0x6583d5cc 0xa03f028b 0x8c7b685f 0xad0cff56
+ 0xbbd27ef6 0xc1c3e146 0x2f1cdbad 0x9ee51a3d
+ 0x95b72a44 0x21ce3ac2 0x7bfccdd5 0xa3cf0bab
+ 0x15d9a1f6 0xca4362ce 0x34a700b7 0x8b4b5da6
+ 0x6548fcb6 0xf4a08e6d 0x775e8ba2 0x0191759a
+ 0xf80eabaa 0xce4f7f89 0xfb96fd51 0x6ea99f33
+ 0xc27e64ba 0x7654419f 0xecfbaa6c 0xcb0736f0
+ 0x1b80c5e0 0x689e27a5 0x7cc27bff 0x3f936593
+ 0x00063fc7 0x111c3681 0x3b3b81a7 0x35e94cb2
+ 0x4a49e1c3 0x17f666a1 0xc7e4ae56 0x9284c4c2
+ 0xd8286ab2 0xef43b783 0x9c65b2cb 0x722fb1a7
+ 0x6f2efb2a 0xdd60ea32 0xf472389a 0x616d9bae
+ 0x48a7c9a0 0x0bd60952 0x93ae5e33 0xb6060df6
+ 0xb9e59956 0x13069152 0xf46a7f8e 0x2851630f
+ 0xd3ed8188 0xaf7dd5f1 0xc29090b6 0x8578215c
+ 0xd6f6a05b 0x95db6cde 0x2cf581df 0x9a99ad77
+ 0x2b313890 0xc9463b1c 0xadbc3748 0x6e790f05
+ 0x9bf484d9 0x34c6d5dc 0x75740b8a 0x7d3fdfab
+ 0xb9f8ba17 0x8d3b35d0 0x5ff294bc 0x6f6c874b
+ 0xfffe2c94 0x62fe0257 0xf2e24887 0x350b5bd4
+ 0x3fa99e5e 0xb7f2c2c7 0x0ae1cc93 0x333c2900
+ 0xb38e8042 0x51fba3ad 0x1ceccae1 0x71c8c270
+ 0x6a043a3f 0x936b478a 0x777651ad 0x450df7b7
+ 0xd1089e90 0x809d789c 0xfd839654 0xe6496898
+ 0x49217884 0xf50869c1 0xf2748a8b 0x0bec9aef
+ 0x770f7fa1 0x76655775 0x009b2bde 0x5676ca7a
+ 0xc1e143c8 0x4ee4fcdd 0xe91f1074 0x6736ad3e
+ 0x4356fa89 0x495e75a5 0x0b741ec6 0x449a3b61
+ 0x452ff00b 0x2ed81694 0x70f03ef9 0x964329cc
+ 0x5dd12754 0xd81bca72 0x3f86b58b 0x400ac496
+ 0xad12b3dc 0x5764182f 0x0e45cb09 0x7e7beac9
+ 0x7dd95c4a 0xad7df1d1 0x1bac39b4 0x5bb6e943
+ 0x87d1b391 0xfb54afd3 0x79b2d767 0xd84bdc42
+ 0x0066dc1a 0x55b3ad75 0xf2c112a0 0x580f45ec
+ 0xf62b463d 0xf60ba3fd 0x9b2c6028 0xa5b43f91
+ 0x1f2d50bf 0xb8f66b8a 0xf986f887 0xd65f68be
+ 0x40b82be9 0x9a43449a 0x591ef31e 0x12dbcc88
+ 0x317e9176 0xa6c6c909 0xdae0d9e4 0x6bb23ee9
+ 0x4ef2788f 0xa80f8192 0x3ae4b944 0x1b3f2a9e
+ 0x4711ee6c 0x84eda57a 0x3dc2a8d8 0x13162de4
+ 0x05aaf176 0x8d64b2e6 0x92f66278 0xcd2673e5
+ 0x79c0f52d 0xf9b3c1e9 0x5ff67a66 0xf39b87df
+ 0x525a32ce 0x7245ab37 0x68f7349e 0x2936377e
+ 0xd6685b43 0x71c2d0ed 0x27ee3ee9 0xf3a1fac7
+ 0xbdb0181b 0xaac6865c 0x84c32bdf 0x4bc38fef
+ 0x3f096faa 0x1702e79b 0xae527c0a 0xb0248221
+ 0x3b56d999 0x21a0eb9d 0x08f57a24 0xa95c4146
+ 0x4dcaa3b7 0x80ad0104 0xd6dae67d 0x0683e683
+ 0x01ac7f00 0x25374859 0x90ecc466 0x440af6ca
+ 0x2321871b 0x02618fbf 0x8c7f98d6 0xd3938fe2
+ 0xf252cc19 0xdb423f69 0x76334fa4 0xb3e719dc
+ 0x8be5e174 0x6aa3b63b 0x1d2f3e02 0x2d01f7e6
+ 0x9509183c 0x549ab8e1 0x228c065e 0x7da315ec
+ 0xcaedb827 0xbfd6a696 0x4d38fa96 0xb316cf20
+ 0x933ebd26 0x193b8c86 0xd95627c8 0x7ddc2f7a
+ 0xb8605822 0xb19e082f 0xd64c7867 0xa7a3313e
+ 0x92be3149 0x8145fe85 0x409fc646 0x7f554a0e
+ 0x640e1789 0xd5e3576f 0x92eb074e 0xaeb34222
+ 0x901c5e43 0xbce455a8 0x4bc50c91 0x17ddc1eb
+ 0x80a18acf 0x3082a9af 0x8bb1d391 0xf47eed91
+ 0x46ef5720 0xe3cbe3fc 0x00d44d26 0x586a9c44
+ 0x12e92f06 0xfdae8b56 0x7f56e426 0x747caa6a
+ 0x1bfe8673 0x1d19d6b5 0x33583fa6 0x77188754
+ 0xb283f9a5 0x6f51a2e2 0xaf3112eb 0x320cb85f
+ 0x43030267 0x81754867 0xdc41223e 0x98945de9
+ 0x1390f612 0xcfdcb91a 0x2a0bf7d9 0xee8e6b80
+ 0x5b33912b 0x8b46d712 0x42fb5637 0x5c7f42c4
+ 0x39e78445 0x6fb87bb3 0x0f051cae 0xa61678de
+ 0x3bbf0faa 0xc870c052 0x4b142a27 0x0e550347
+ 0x0c5382e9 0x195b9b2c 0xeba1d275 0x7096f4fa
+ 0xfa22ed77 0xa05e5b84 0x778d7db6 0x2b60f32b
+ 0x6e748cc3 0x334d3f23 0x75cc287d 0xf7d1644b
+ 0xc97a13df 0x4bc06771 0x1306660b 0xd3c7dd1b
+ 0xa142efd6 0xe68f0d22 0xd5ff232b 0x94fb5e41
+ 0x0ec6aa34 0x6da358a0 0xc02e995e 0xcaaeb52c
+ 0x2835ef52 0x99bd2258 0x5f1d9529 0xb8092431
+ 0xae849d31 0x15316f12 0x42b1c0ab 0xa1569054
+ 0x34fcd6af 0xd798b2b7 0xfb2cff48 0xfec896d6
+ 0x7ab94809 0x2030174e 0xc186a684 0x5f4a8817
+ 0x84bdf2dd 0x0a291522 0xf6ab50b2 0xa9439e0f
+ 0x44d7ea23 0x5351ba4b 0x928dec2a 0x0b9dd63d
+ 0x5a76913a 0x079a5164 0x8e0777ee 0x4374b399
+ 0x6f34f567 0xfab69db4 0xde38e38b 0xa2e5ebe3
+ 0xcf6dae0a 0xd898148b 0x476e3296 0x5e7ab451
+ 0x2fe45cde 0x929624e9 0x2203c854 0xfd8b8626
+ 0x17376cae 0x32501bca 0xe6fcb278 0x7953d8de
+ 0x9752e1cf 0x341c1601 0x00d3ae30 0xb3739e58
+ 0xeceff6a6 0x4ed58c80 0x459a63ea 0x5cfc1899
+ 0x9e6b410b 0xe4da8646 0xd75c48d0 0xd404f4bc
+ 0x33825d6f 0xb9855c82 0xe90a0e4c 0xa989b633
+ 0xfb2473e9 0x7f10fd55 0x6e0768f6 0x7c6d8450
+ 0x7cc93a19 0x76475dd9 0x0b778a1a 0x29cc2a70
+ 0x91caa9a7 0x49655d56 0x1c64596b 0x52d61f69
+ 0x53bff6f9 0x44d9c1d4 0x2ba15c62 0x382dbeb4
+ 0x56cff583 0x565c1803 0x5893fc7f 0x6a94cda8
+ 0xe95ac193 0xaf3b09a1 0x795697ae 0xff624c67
+ 0x56e611f2 0x9ba437a6 0x8b7d27a8 0xae8c1565
+ 0xb28b944f 0x9c895b81 0xfe787519 0xa0ca12c9
+ 0xd23c5ba9 0xb730d089 0x302d12dd 0x9af1a4c7
+ 0x69599341 0xa8b17cb7 0xc573e9f3 0x4fe015d3
+ 0x3b3286ef 0x591128a6 0xbf0bea82 0x466d79cd
+ 0x3076347e 0x9c7ca61c 0x13e8aa93 0xbb00d00b
+ 0xbfa86c94 0x56f38137 0xd727a03d 0x1a41b362
+ 0x5331fc0d 0x113d1d31 0x09e3c464 0xf54b6824
+ 0x40ba971d 0x2f1d4b53 0x2832f814 0xafdf91ec
+ 0xe2d77aba 0x44f0e00d 0x2f376938 0x6d47f1df
+ 0x9bef11f9 0x3f9aca74 0x197d855f 0x5d899fd2
+ 0x0174123f 0x63cfbf61 0xc85eed10 0xf11930cd
+ 0x163dc199 0x49f8ad22 0x1b5e4fe5 0x4ff6450e
+ 0x942489f5 0xb11bff2b 0x600f4652 0x31a37809
+ 0x99be777e 0x343bd797 0xc7bd34a2 0xf2b1a60c
+ 0xe106e486 0xd179808b 0x1419645b 0xb34771c0
+ 0x3ba7d144 0x15791097 0xbc5928ca 0xc9cc7cf6
+ 0x1f17fd5b 0xba686d51 0x9e6d912b 0x20e4a194
+ 0xd8c32654 0xf8937d4c 0x533007af 0x04696e3d
+ 0x8207c2c8 0x7b739e0f 0xb67d066e 0x3726cf3d
+ 0x62d4b3b8 0x75aec6a8 0x44469ec9 0x91406a1d
+ 0x4f5ae33b 0xddcc9105 0x3387b59b 0x87c6a066
+ 0x14d769a8 0x448c6139 0x476ed45c 0x8232fe75
+ 0x7cb6d1d1 0xa670320b 0x28098df7 0xb94dabfa
+ 0x41c51c73 0xbdfc4d53 0xd70a3aef 0xe1c8f70c
+ 0x077da48d 0x441bb268 0xcd2bc13c 0x78a46a1c
+ 0x84bd17dc 0x31597b9d 0x623fae1c 0xe24170ff
+ 0xcf8cd6ee 0x11df9820 0x3e480b36 0x4a7eb051
+ 0x3203f70c 0x06b348c1 0xf4e33bbb 0x24ed5413
+ 0x1ed84552 0x3772588a 0x4ea84347 0xe1250dfb
+ 0x8bfa3adb 0xe59afa8c 0x44ca1357 0x1145a5a9
+ 0x0df9a86d 0xe6ab249a 0xbe151d80 0x3e7bbf3b
+ 0xc1ebfa83 0x84348d05 0x8b65deac 0xdeeabbb2
+ 0x6b9e5b0c 0xe1d19302 0xb0b01cec 0xd69a98d4
+ 0xe42edc62 0x261ea15e 0x4c546ae1 0x74f85d40
+ 0x9a9db547 0x33e07898 0x4422af20 0x5999891a
+ 0x83e63253 0x7f7268c1 0x4429c438 0xab119869
+ 0x1f1bd091 0x2a1652ba 0xd4dfc9ab 0x2d7b18d6
+ 0x2d87faa6 0xac590208 0xcf6e46ca 0xb1c9e615
+ 0x73d3bb7e 0x09573088 0x3d91165c 0xb688a3ff
+ 0x7a4346cd 0x2360cc0c 0x494d1f13 0x1e4244b7
+ 0x1e057f8c 0x7d3e15ad 0xee6cbca3 0x1ccf470a
+ 0x9c7fb86a 0x2b694405 0xc1ceec27 0x2f4a8555
+ 0xcb722c5d 0xc0756c77 0x3c2ee8ca 0x7053fe01
+ 0x51dbf675 0xfe1e166d 0x654cc429 0x191d8fd0
+ 0x9c6d2967 0x9f0eca60 0x6332bcb2 0xc161dd34
+ 0x459bd9dc 0x89815a1f 0xc9cee790 0x7b577e3b
+ 0x7b57a18f 0x1fe6c630 0x8d25db6b 0x09bd8d7c
+ 0x48635a97 0x6360756a 0x9177a3d3 0x111b800f
+ 0x5ebfc6d3 0xdb865f41 0x7c168244 0x32e5d8d3
+ 0x91109a8d 0xa20a3590 0xd0a933ea 0x88f5df2e
+ 0xccb03537 0xdb41eebd 0x5c8dbbe6 0x4c2644bb
+ 0x4c65b98a 0x742f1134 0x60fde8d7 0x1cde9854
+ 0xb1ea0f52 0x8a4ca4da 0x44783953 0xe0243e19
+ 0xcd8cd441 0x1e042b06 0x2ccaf99f 0x5ed2d15c
+ 0x3deb43f0 0x8e34c18d 0xd5be1491 0x70b793fb
+ 0xaf8acf24 0x5d38b1a0 0x1630ac4f 0x182237ea
+ 0x627ddbb6 0x2ea22ef5 0xd8dedc3c 0xa51830bf
+ 0xda49f488 0xd2fa2c85 0x721615a3 0x1208ebe9
+ 0x85048c1c 0x58acaadb 0xe7eeabb3 0x81e9430d
+ 0x63346e2c 0xbb26215b 0xf83c4194 0x015cf67b
+ 0x44d93f48 0x0bc2900a 0x10df11c6 0x061db4b1
+ 0xad2c0350 0x52a8d223 0x0b9af5e6 0x112cba32
+ 0xd5c0611a 0xde0c5af5 0xbf369309 0x2005c01a
+ 0xe7e4bce4 0x253a7515 0xa66c38b2 0x6371a674
+ 0x033a39bb 0xb99f4a73 0x9a359731 0x0724e9dc
+ 0xd9944bb4 0xedb01d0e 0x85fecafb 0xd75f7e73
+ 0xc72c37ab 0xe9b59fa2 0xf8f85487 0x09704e58
+ 0x0ffe8d54 0xf8162535 0x6bf16af4 0x8f46df6f
+ 0xf0e33411 0x3e177d34 0x730009ab 0xa1631939
+ 0xabe65f95 0xd90633fa 0xcecf66a3 0x79cc15b5
+ 0xcb28d41d 0x4861efdf 0xe7de0dbf 0x9722f417
+ 0x572088db 0x7f511819 0x318b7d8b 0xce84e61a
+ 0xa01a4c75 0x600c1a0f 0xc0286e02 0x1af83c30
+ 0xbb64bc49 0x7a0f71cf 0x2554129d 0xc5a154f6
+ 0xb842f910 0xe710460b 0x5d86e6e3 0xe414c0da
+ 0xb61ad875 0x669fef0e 0x58fa944f 0x16ca9eae
+ 0x1fc6f838 0x3ffe0098 0xf6be0d22 0xa2f381ab
+ 0xd995847b 0x16fbc1e2 0xcc756a1a 0xd89f7485
+ 0x1d0abb0b 0xffcd8cb0 0x71989ea7 0x60e19b0f
+ 0xa8a56589 0xf097597f 0x942a4e88 0xeab31855
+ 0x8af2fd0b 0x078a03ed 0x62025b1e 0xaf19cb9c
+ 0x8c1ab68d 0xc262628b 0x62083c6c 0x874688bf
+ 0x5b512007 0x310e1d4f 0x5736b0db 0xdf96874c
+ 0xf0648345 0x5b3b2da9 0x075ed4cc 0x86f0f05d
+ 0x211b38ac 0xe41c1462 0xf36b3395 0x63a19aff
+ 0xc271872b 0x3f11e6a4 0x209ffe67 0x42def127
+ 0xe22ef2a8 0x6a4624b5 0x61a19475 0x149dee80
+ 0x286187be 0xf5e381aa 0x53a6bb60 0x84ba5a64
+ 0xf33ed14d 0x6f2e992b 0x24ad13bb 0xbf0739a1
+ 0xdc312f28 0xcd45e42f 0x63d233cc 0x8d86ec61
+ 0xf8e5d0be 0x26e15a81 0xa4f6d30f 0x2cb1f3cd
+ 0xa64c7b81 0x1950fab1 0x97dfa1d9 0xb437b47d
+ 0x53de79c3 0xd8ebe484 0xbd655b1e 0x39de3925
+ 0x51747cff 0x4a238541 0x80ada60a 0x02296598
+ 0xdf23b02b 0x3ffbf18f 0x52feac43 0x01ba32ed
+ 0x6bd49cbf 0x8b4bda59 0x92697191 0x3632a5b5
+ 0xc060d9e1 0x124b11fa 0x61602a46 0xec8a28a7
+ 0x01b67d7c 0x63b03988 0xa4591fec 0xb23e8594
+ 0xa5f7633a 0x84d8a66f 0x7f06a567 0xf38b81ae
+ 0x1efbd58d 0xdc476674 0x88205063 0x04ce4533
+ 0x880ed70f 0xe9011878 0x58a3824d 0xdaffbc02
+ 0x66941b6f 0x9e132bf9 0xf3eff9a9 0xb3d2ac15
+ 0x766e0ebd 0xfd469d3a 0x678eb9e2 0x8c65bd29
+ 0xebb204da 0x2875a82e 0x41341882 0xc1fc677a
+ 0x111cff64 0x9af5f6cf 0x9d57bf72 0x0280048f
+ 0xdb4d1bbb 0xb7aab40d 0xc953ce3b 0x9e9dc79e
+ 0x291772f1 0x90872d54 0x158a2ce0 0x87da1ff1
+ 0x8c4867e4 0xafbc5845 0x2d62d991 0x0ddaac95
+ 0x28295d76 0x5c2cbe25 0xd9661876 0xc2438e8f
+ 0x4cff1d7d 0xedcafc76 0xdd01e779 0x7facce7c
+ 0x57058402 0xda77d4dd 0x53b4bb50 0x65391cb3
+ 0x8152d72e 0x5d01c98b 0xff747405 0x19e6f055
+ 0x1ced591b 0x525d28bf 0x121ce275 0x38539d0a
+ 0x996008c7 0xa71f9800 0x85284c36 0x0d5ca4e5
+ 0xa315c804 0xc4fb1ce4 0x76c8a106 0xef84c812
+ 0xadb11f71 0x86d1095d 0xddd4b1e1 0x065cd8c0
+ 0x99b9fe1b 0x921403d8 0x95f05195 0x1d726ca0
+ 0x0fec4222 0x36aa98d7 0x2206a9a1 0xf2905f96
+ 0x9502d27d 0x192e5af1 0x6b030782 0x3083d3d5
+ 0x079ac64d 0xde9b04ee 0x3e1a0eec 0xbe3410ff
+ 0x380d770b 0xe51dec70 0xfd45046a 0x60e9b5a8
+ 0xfcee7db3 0x9407fcbc 0xe54f8a33 0x91bbcac7
+ 0x1ff989a8 0xb626741b 0x086a7934 0xf6318222
+ 0x8047f0dc 0x4bc04243 0xd8c55fd0 0x71019f76
+ 0x2ddb9237 0x40948af4 0x0910ee25 0x9b89252f
+ 0x18364ebd 0x079ffe04 0xd76db709 0xf97538b4
+ 0xdbc20ced 0xa3fb6b50 0x787f7229 0x1b54a67b
+ 0xb706e1bf 0xe2218739 0xa9ce7e63 0x91de8423
+ 0x78aa8a85 0xb4b2297e 0xef3625d0 0x2c6618cd
+ 0xe8908b71 0x678fedd7 0xf33b04a7 0x83cff4d7
+ 0xafc00ab3 0x9e006bd3 0xae11c467 0xf8005ae8
+ 0x3dc3c0e4 0x9615fea3 0x3cda278e 0x77f1adf4
+ 0xcde0963c 0xbd3d6e5e 0x630de1a1 0x841fb94c
+ 0x396b32ed 0xccdea70d 0x308edf0b 0x71acfcf6
+ 0x2f07d226 0x531b1985 0xd08b58ea 0x47127332
+ 0x2813e4e3 0xa3266030 0xe27c82af 0xfb03fbaf
+ 0x408f9dfc 0xbad7ed47 0xd6beb8fe 0x229c79b5
+ 0xe91cc6b5 0xd807be50 0xcef683cb 0x44f87410
+ 0xb891c4b8 0xef29d1af 0xa93c8894 0x1e7d3a69
+ 0x1acfc11b 0x4a29db04 0x983d185c 0x68ce4131
+ 0x2e9cb1ee 0xe91510b5 0x621c1ef7 0x0f14a520
+ 0x35cdf015 0xcc767e0a 0x2476d5f9 0x68d558e3
+ 0x6932d432 0xc980c74f 0xa23e9608 0x3161023e
+ 0x64a5c93c 0x9fb3985d 0x538bd7f3 0xeb8256e3
+ 0x65aae455 0xb1b16e5b 0xb41b906a 0xa3e1c623
+ 0x5ebfd20c 0x472ab0c7 0xb862ec5a 0x677caf94
+ 0xf12f50f4 0xd188afed 0xf3cb7e39 0x53e924c6
+ 0x42e0eb39 0xc60b822c 0xd8661fdb 0x72b0faf0
+ 0x6aa3c735 0xce48dad5 0xc8201232 0xa4d95ef4
+ 0xe80626ad 0xe0a47835 0xd6854983 0xc2b7e630
+ 0x77f32e03 0x21f00e02 0x622eb8dd 0x37103875
+ 0xe9c7416b 0x83db0965 0x7375fe36 0x192b127d
+ 0x62794f9d 0x5a451860 0x594cdffd 0xd5e7ef9d
+ 0xc782917c 0x6f9e9141 0x46a8b7a3 0x181df7e2
+ 0x6dad09f9 0x15a1937c 0x99d80e91 0x63e92c73
+ 0x73e43728 0x179e1573 0xfdcc276e 0x46112bec
+ 0x137d0f85 0x8435213a 0xef04615e 0x01dbbc7b
+ 0x505ce560 0x16f833ce 0xaa8d3688 0x47b4669b
+ 0x0f354a7b 0x12c0dbd5 0xe77a9efa 0x930a3567
+ 0xa011b706 0x85fdfcf3 0x7ceb2c48 0x429d7349
+ 0xe61b9120 0xe080e78e 0x50f6d453 0xd63f20ce
+ 0x4e18a840 0x613b4431 0x2afa105f 0xde138b58
+ 0x77336868 0x5214293c 0xf6fdcdf3 0x5e63d611
+ 0x42d0a5c0 0xcd01f451 0x1583eb33 0x95c699e0
+ 0x21893a08 0x704facdd 0xb4ead18b 0x7c6ddaf1
+ 0xbab85cc3 0xa2b9344f 0xa8657896 0xb63babb6
+ 0xfaf99f20 0x73dc0349 0x38dd90f6 0xbe1a118a
+ 0x76d8d230 0x2b6fc0eb 0x485a22f9 0x233df23a
+ 0x894d1b5c 0x0afb3e50 0x71e7eaa9 0x88923872
+ 0x085033c7 0xcb3c83de 0xbf38a300 0xfa018e69
+ 0x50a4549f 0x06422587 0x0dc263ae 0x5e048686
+ 0x64587a45 0x69fcf415 0xcff7a01f 0x4224983a
+ 0xd2f00e53 0xbc50202f 0x56c2c541 0x716a3f01
+ 0xeb97c469 0x545cf2ab 0x8a5fafe7 0x9ca6b167
+ 0x7d24b6b5 0x5b9c6061 0xb7f4d550 0xf3651821
+ 0x42e3dd52 0xd96e98e2 0x28b6006f 0xb30d9122
+ 0x62954242 0x3b824f4b 0x97010e45 0x63caf666
+ 0xf1852f27 0x5ac1018e 0x5261907c 0x8e2062d6
+ 0x9bb98a7d 0xf73121cc 0xd44d7ca3 0xd922ff41
+ 0xa2a7bd66 0xb60ad501 0x1042d3f4 0x464e258b
+ 0xf740d72d 0x3eb38eeb 0xd155dff3 0x89a80f07
+ 0x4b022bba 0x6647ef88 0xef3a7405 0x7e999fb7
+ 0xf0881841 0x72f7b9f3 0x5f844112 0x3c9b265d
+ 0x7ab280f8 0xf05ee4ec 0x0980072d 0x99997fd2
+ 0x0be19dc1 0xf4d8a16a 0x341ebdb4 0x134c79ae
+ 0x4caa6647 0xbd166e1d 0x0a3726ae 0xf6f19820
+ 0xb00aaa60 0x332d2567 0xc0668705 0xd5ac46b9
+ 0x0c27ef58 0x1f2a3544 0x16de79a8 0x1d4fb3e0
+ 0x22c094da 0x5780d40d 0xeffedd2e 0x98be7ed8
+ 0xdcd20eb6 0xcc49d902 0xee004f43 0x4db50bac
+ 0x2c48407a 0x158ae057 0x1007cd9a 0x4339f13f
+ 0xb25bda18 0xe3d5dc8b 0xc311b3ad 0xbf26f86d
+ 0xcb685e0a 0x4e09b6b3 0x8b7d79bb 0x602281f5
+ 0x56e4bb98 0xa59cbf03 0x68ac07be 0xa9565d05
+ 0xd2436522 0x40fb37a5 0x0671bdda 0xd5217560
+ 0x7547d749 0x3a1baa3d 0xda341a51 0x165317bb
+ 0x8b7ca453 0x4794f5c6 0x939bbb1e 0xb658d2e3
+ 0x4620a572 0x0d8f0169 0x15ee2511 0x20f2d2c9
+ 0x77d5514a 0x5c732436 0x235b6b69 0xe32db055
+ 0x609cee9a 0x60b02bf2 0xf6fef4b8 0x789f7d0c
+ 0x2251220b 0x3ea6e885 0x187101af 0xc99f3ce3
+ 0x171ce0b2 0x47ddb34a 0x05d20663 0x33ebcaaa
+ 0x095e9ddd 0xccfa1e7a 0xa388f304 0x369c1782
+ 0x811bf00f 0xab1c951a 0xe88f1480 0xbe71f874
+ 0xe34e8d5a 0xa574fa6e 0xf848a97b 0x157c3627
+ 0x76e11850 0xc922bef2 0x47d7f3c5 0x498c2531
+ 0x7a6f752d 0x462ae32b 0x290ae02d 0x6352395b
+ 0x03b5f70c 0xe66b9177 0xd006c3e0 0xc5302173
+ 0xa8fc59b1 0xbb39b0d7 0x9ba45a17 0x3a03547b
+ 0x28b1fc82 0xaaae00c8 0xa6723469 0x66b69630
+ 0xf50a3e6f 0x33ae1719 0x4c2a4520 0x2e84d3b1
+ 0xc2a6da1b 0xa8c63fb4 0x5ef3150e 0x62648121
+ 0xbde9f90f 0x2e348297 0x421be188 0x3e129c67
+ 0x0b72d6b1 0xdcef0ca4 0xb3f5180f 0xa3ab312d
+ 0x92cf1271 0xb0174d00 0x07c34185 0x96629df5
+ 0xb669f92e 0x48ffbb2f 0xce303a62 0x58758152
+ 0xff88c28f 0x740203cd 0xd8606fad 0xe0f49016
+ 0xe50d362c 0x8af053e2 0xe405b078 0x517db488
+ 0x664667dc 0xdac203d0 0x579e7a13 0xf75bb4b8
+ 0x2c465572 0xdebb0288 0x810ba79c 0xc5fb168d
+ 0x325eec36 0x12939e50 0x8978e795 0x4b26a562
+ 0xc0eb36e6 0xcdecddf6 0x74d8ab28 0x69abb8cc
+ 0xc3e49aea 0xf4302958 0xd49f47f7 0xf41884f1
+ 0x81431670 0xa6da9dcc 0x98d844b0 0x85f7dc61
+ 0x28746eba 0xeefb5d09 0xdfd17127 0xb90651b1
+ 0x960ff381 0x4dc2f826 0x93dd1524 0x5dda5d3c
+ 0x1fd68f6e 0xd4045aa4 0x2254d6ee 0x1f92cf67
+ 0xb2655366 0xf623e3ff 0x7b3d96dd 0x1871a30f
+ 0x954a44c5 0x2f29fd8b 0x62c27aab 0xdc46ddc8
+ 0xd44356ed 0x5bd8a440 0xd549484f 0x746e26d2
+ 0x65783d84 0xcab49250 0x7a1c8b24 0xc8063e68
+ 0x7609278e 0xb4f14286 0x27495301 0x2cd03051
+ 0x446a046b 0x0be32e76 0xb9171daa 0x4cdc88df
+ 0xcc1f34e0 0x7a81d4bf 0x6cb5743d 0x57450c96
+ 0x4a236466 0xe31357ef 0xfd9a4d3e 0x03d308c8
+ 0x33f21e03 0xe781adb8 0x88521371 0xd19164cb
+ 0x3caa33e5 0x0c65ea5e 0x8fcd4379 0x1194cfa9
+ 0x8937eced 0x7628f0e1 0x1016ee9b 0x6c43093c
+ 0xd562ec84 0x53daa34f 0xc64a0632 0x5768c330
+ 0x9b22d9a0 0xbabbc688 0xf83adf7f 0x9f454bfc
+ 0x436c3478 0x1501bae4 0x8bdd6dba 0xabd0d59b
+ 0x380ceaf2 0x698c8047 0x8646a825 0x69a0ef6e
+ 0x79a56c4c 0x2789d08d 0xc52f3a4d 0x2166f074
+ 0x59eb5fb7 0x43f2a041 0x43609bfa 0x9327c7c5
+ 0x6663ffdc 0xfcdef11a 0xc5f824f3 0xee0fd8cb
+ 0x2d6c495d 0xe280de34 0xf4af7465 0x0b157539
+ 0x2a7ab144 0xbab24805 0x562ad952 0xd230fec1
+ 0xe4167036 0x20a88433 0x24af7727 0xbf0622d8
+ 0xbb3abc8a 0x98190a0b 0x256ac6ac 0xaf4c6720
+ 0xefa7f106 0x75a16acb 0x44ea3d10 0xd696ed81
+ 0xd0b59111 0x766d8497 0x100c5abc 0xf1b95046
+ 0x6e69f5d9 0x66b6a5d9 0x2dd2c310 0x495dbe1b
+ 0x1d32d006 0x8c690d83 0x4fb1063d 0x92979582
+ 0xb385b386 0xbf0a3354 0x17ce9072 0xbdd59104
+ 0x7327ab1d 0x125c0791 0x4ac0e89c 0xc2b30c57
+ 0xe0686206 0x35c12383 0x10d5ae11 0x60730cbb
+ 0x57ddbbc2 0xafce2e54 0xf0856d8f 0xa9759bc9
+ 0x0d8f3f4f 0xa9febc31 0xe2f1b192 0x11b60587
+ 0x1c33d3e4 0x479c0a41 0xf037853e 0xab97a5cc
+ 0x1e1924a6 0x6d669b25 0x9b1f0d7c 0xce0407fd
+ 0x2f913715 0x17099510 0x704d3f98 0x9682966e
+ 0x45da3d7a 0x32d7ef00 0x36a1b717 0xc555e6e4
+ 0xe50350d2 0x5d50c32c 0xd8d37f54 0x03708cda
+ 0xac1e2a5d 0x257ffad7 0xd0f70b95 0x8f74af3b
+ 0xa0bf13de 0x9edf45a8 0x69665702 0x756672a8
+ 0x3cc067ea 0x00fe56db 0x85ae983e 0xaeb28321
+ 0x09defe2d 0xa8c13c37 0x5dceaecd 0x7bec1219
+ 0x4e7921c5 0x98cfe03a 0x6958c017 0x9087ef00
+ 0x95ea4dfe 0xe264c6b7 0x9a6810b3 0x05d7e8ad
+ 0x26a1f7b3 0xc78cf12b 0x7c4658cd 0xba02d02a
+ 0x4bf51833 0x31f10171 0xeedb6de2 0xa95fe8b1
+ 0x9b4e834c 0x6edb1df4 0x2eb374fa 0x599f21af
+ 0xd91c85ef 0x29bb5e50 0x40acfb6d 0x5188b56e
+ 0x7b371516 0x47336571 0x021a7e29 0x900ecaf5
+ 0x7aaac4bd 0x7c630119 0x51592e5a 0x984c316d
+ 0x99aaf2eb 0x5a5ef213 0x62972730 0x9db4c2bf
+ 0x36fa8158 0x9e83fd35 0x1e819155 0xcd7da0e2
+ 0x7b4b9287 0x7df42364 0x815ffec4 0x28a02a2f
+ 0x7645873b 0xa96a9600 0x86fe7360 0xe2429409
+ 0x0e81cec3 0x2837d531 0x3634694e 0x205f07b2
+ 0x92797dd7 0x431aaadf 0x54d3edce 0x02bab9c1
+ 0xff502eed 0x3f5cdb73 0xaf217968 0x65c7d614
+ 0x6c1fed64 0xc84ef92b 0x3335dc76 0x8a36f261
+ 0xe18cc99f 0xecb5a349 0xa60f9ac3 0xbad211ad
+ 0x414c5b7a 0x2427e2d2 0x06c840e5 0x5eb6c304
+ 0x81981cce 0x46fe9618 0x55b7e5e7 0xb0a84b4d
+ 0xb64f1852 0x1b91dcab 0xbdc34189 0x9954a8a7
+ 0x94353c4c 0x47c53c9d 0x55906e49 0xd957647d
+ 0xc695fe87 0x3cdc787e 0x10deb790 0xd7e646ed
+ 0x1277253c 0xe6ecc20e 0x2ecf2f7a 0x5b5deb63
+ 0x49b50f6a 0x6f9e13ef 0xfc1c3a3a 0xe43a9188
+ 0xa08e487c 0x7679f614 0xb2c75035 0x4ad8b606
+ 0xc2ca32d9 0xe6ecc606 0x12fa8dce 0xc07baf0a
+ 0x0e05a004 0x9e9e9411 0x130e9972 0xcd9ef9cf
+ 0xbefbbcc7 0xf96216b6 0x9aa77353 0xb43e54d2
+ 0x2df91569 0x0b16533d 0xef134eda 0xe986df3c
+ 0x9d9690bb 0x821d2f44 0x21fbabb8 0x79ce8167
+ 0x84f9ea38 0x2cf4434e 0x85644f97 0xb17722d6
+ 0x96c1a108 0xe07cc5d9 0x843e98fd 0x92f6ac95
+ 0x19f7e9f7 0x1f7602b7 0x09d94385 0x79ae50d1
+ 0x66a40fe1 0xcd01e167 0x22ffeb10 0xccb05daf
+ 0x407877d4 0x3dd335e1 0x7712a985 0xdb4c9f02
+ 0x6c109614 0xe0c09e0f 0x93c4dec9 0x8e9742ee
+ 0x10dbc990 0xaaff5f72 0xce73d6af 0x4d6ce4aa
+ 0x9d78739c 0x674ec129 0x45de755a 0xa122c199
+ 0x6fd9251a 0xb8a1979b 0x2a62ebbf 0xf6d19f54
+ 0xdfeba405 0xec19fde2 0x51950563 0xe68e02cc
+ 0xe2213039 0x9fad2f99 0x663ba91c 0x8044f595
+ 0x8451dd81 0x78df35df 0x103fd73a 0xd9f2f1f3
+ 0x493caf73 0xe5025797 0xdba6c5fb 0xcac85576
+ 0xd36dfa5b 0xcbf18249 0xd4053837 0x1f128937
+ 0xfbf049eb 0x83be2114 0xa69a8b6f 0xfbbeb881
+ 0x7a738c47 0x06a3f4d2 0x7b9a8b67 0xfe949d59
+ 0x8a8f15f9 0x483cba16 0x2d85aaa6 0x7285eadd
+ 0x06f66872 0x59e3da71 0x2ef8ffc9 0x9e419e3e
+ 0x10da30a9 0xbf052864 0xd55bb868 0x843663a0
+ 0x54302010 0xca056426 0xa413d44c 0x6cfa2f03
+ 0xeec3722e 0xc1b3d010 0x6cbe9937 0x4e28768f
+ 0xd85a8bd2 0x852d36d3 0xdc2bb17a 0x942adb65
+ 0xde0d232e 0xe7a3fdeb 0xa2effa04 0xe88f2956
+ 0x4df8bc13 0x90895e4d 0xa7817aab 0xf3248976
+ 0xb32d394e 0xda2db11f 0xe423fdb0 0xb09ef58f
+ 0xcc889395 0xdf875ef3 0x908324d8 0x62548201
+ 0x6fc040a5 0x5421e58a 0xcbed64ab 0xde8ad9b1
+ 0x46708788 0xbfd97b14 0xab421144 0xae60a0ba
+ 0xb6e6bbc9 0x09f37f60 0xf1135386 0x5164926e
+ 0xf2660ddf 0x45fe5b88 0xfd74f7f9 0xa586e2b1
+ 0x44bb2794 0x9ec54550 0x65ce44b4 0x6a326bd3
+ 0x59146d09 0xc74c4e5a 0x3be1b656 0xf67601d3
+ 0xbb69de44 0x6065d21a 0xe4463332 0x868232c8
+ 0x3e5e8ad7 0xd04eecdf 0xc89c34ca 0xa62c3540
+ 0x134bc86e 0x0fec76e9 0xb159baaa 0x419a1c49
+ 0x8d829ad7 0x90a19def 0xd71d7652 0x4a9d3846
+ 0xebd1c228 0x5d875423 0x0287924d 0x4ec52bbf
+ 0x752c7893 0x99a1842a 0x7c8e08f6 0x35ff21a2
+ 0x95ddff74 0x28bffb90 0xfe686106 0x628a1db5
+ 0xb2f59548 0xeeaaabb4 0xe7825340 0x3e9c0125
+ 0x1533225f 0x82e6aa5c 0x699430b1 0x2b79e86e
+ 0x70b259d3 0x71586bb0 0x26c4fd82 0x322d3e16
+ 0xd686454e 0xdbd4b583 0x6cae58dc 0x77b7e14f
+ 0x562d70ac 0x907e049e 0xc3c4866a 0x99ccfaf9
+ 0x6591a5ce 0xd35cba59 0x82d892f6 0xf6d04abd
+ 0x25595ff4 0x2b5e8b12 0xe4b3d932 0x3f8f3a16
+ 0xbf7f9ac8 0x4f54467f 0x41df7a1b 0x2c2002a4
+ 0x4ab82fa7 0xff80a896 0x22539611 0x642ab065
+ 0x4f293070 0x99ed3529 0xcb5945a9 0x7820d897
+ 0x59b2ff7c 0x7ecdab7f 0xb37a6005 0xd50bcf61
+ 0x4484ed63 0x2b28332a 0x101e8686 0xfdb32040
+ 0x8874ce52 0xe991bdcb 0xd99d48a8 0xef1654e7
+ 0x1a37d482 0xc3824d3a 0x338d6d44 0xe4f26648
+ 0x4ff10b7b 0x7e2dccc2 0x02c1b663 0xc6b5e51a
+ 0x327d0c75 0xff3f5359 0x55c407dd 0x7795732a
+ 0x4b033d1a 0x5e285c1b 0xffa99def 0x2cac8a65
+ 0x33d66077 0x8e3b374d 0xf70cde75 0xe342a9a8
+ 0xf8a8286c 0x26f21845 0x1c35821c 0x30480bd7
+ 0xa895087d 0x63e32777 0xfce580c3 0x62f97856
+ 0x505c22db 0xfab99f9f 0xe1099684 0xf62f8889
+ 0xec9b6b43 0x555e966a 0x462e70e4 0x2ae637d6
+ 0x3d6ba70e 0x37bdea88 0xbcb566b0 0x40a34189
+ 0xf3474e78 0xbb16e878 0x115dcbd0 0x6e379a93
+ 0x55605ebb 0x357d26a6 0xce1ce1a2 0xff38b240
+ 0x50b9e52b 0x66c12a77 0x99a25a6c 0xf9de1622
+ 0x471d103b 0x256ad08d 0x4fff9dcd 0x44685f25
+ 0x9a0e1396 0x88a2f2ae 0xc3f9f29f 0x4f9e8c90
+ 0xe294901c 0x4c2a3147 0x2c206563 0x6adeb562
+ 0xf9d839c6 0x801b3964 0xa61cb7cc 0x32a2072e
+ 0x3e2a1d00 0x1904f4fb 0xe1027957 0x9ed87c1a
+ 0x048aade5 0xe63aa9a2 0x5a460512 0xf3b85e58
+ 0x1960d9ce 0x11445aeb 0xf96645a1 0xa1ad34ca
+ 0xba376d98 0x5833c258 0xd7920fda 0x3a2658d7
+ 0x095b9750 0x4b3fe950 0x7e6b6db7 0x259b5be5
+ 0x98ee769a 0xa5fde88e 0xa6ecfc18 0xafd66bca
+ 0xbc9a9779 0x260e70f8 0xd24be5fe 0x53af1ac7
+ 0xec112709 0x76a4d04c 0xfc88a201 0x673f6cc8
+ 0xcfce8151 0xc328f56e 0x184f44b4 0x94f0d97f
+ 0xf34963bd 0x629ea5f5 0x99a6209b 0x6f11ce53
+ 0x6385b633 0xc2d2e97c 0x608d81ac 0x488268ee
+ 0xdddf7f90 0xa71b1365 0x332b2446 0x416a0ee8
+ 0xf34dbf77 0xbf85a55c 0x39acda18 0x7b6d076b
+ 0x51ab603e 0x3916cd25 0x862c27ae 0x941c4083
+ 0x206fbef7 0x116e6624 0xd386b8d4 0xf5d762c9
+ 0xe3aa182e 0x1c4cc0e6 0xb9d6a7fe 0x53834a40
+ 0x7bcd85aa 0x47e66276 0xc6a8ba31 0x93c75a1c
+ 0xdccdbe7b 0xb469a50f 0x92849b1b 0x797b14fb
+ 0x9e6dcd3c 0x29cb2bbe 0x3e534aec 0x96e19982
+ 0xf2c0cd9e 0x3604f523 0xb7320cba 0x1868ed05
+ 0x95e44be2 0xbd16fe0d 0xfbff21c2 0x64ad7cd4
+ 0xf9b88d56 0xb5224d1a 0x1271618a 0x1a5007ec
+ 0xf5781dc6 0xb87bb7b2 0x0a47addf 0x003a1646
+ 0xe5c57e01 0x0ddef18e 0x954de803 0xf6660d87
+ 0xc929d78a 0xef164296 0x1d3993c5 0x8bdad828
+ 0xafd5abf0 0xe9f3a99c 0xc925e16b 0xc1f2e4bd
+ 0xb8c84791 0x59ec0aac 0xd955ed35 0x760982e2
+ 0x56f2cf66 0xfbbb52c6 0x18aae748 0x3b245be1
+ 0x5c455748 0xbc824892 0xd26cee8f 0x932bbf5a
+ 0x1112c54c 0x75db823d 0xd8b7785d 0xc6a3aeea
+ 0x1efe5e62 0x5f06df56 0x4ca2a339 0xe1f7271a
+ 0xade0c55e 0x672d03d8 0x81101086 0x945d4701
+ 0x77658b7f 0x7ed8432b 0xbc196029 0x9d040e95
+ 0x86869faf 0xb625768b 0xda8b5870 0xb7c57dac
+ 0x5486f95d 0x29c43911 0x03f75c18 0x477d1f58
+ 0x43ed5793 0x0d3b9725 0x6a03401c 0x909a5bfa
+ 0xce10d526 0x7adca2a0 0x04ba72f8 0x17373ae5
+ 0x71c0e8ec 0xc09a855b 0xa46e5cfb 0x7d02e85f
+ 0x88c0f756 0x69373644 0x2e54aba2 0xacf37234
+ 0x70e33aa5 0xf560abfe 0x0fd8f883 0x7f01298a
+ 0x5af95b0c 0xa07ba2b6 0x67e34074 0x23d0bf23
+ 0x99a5c52e 0x1c6fc87c 0x31dbd46e 0xd291eb44
+ 0x421e30e4 0xa5ff0214 0x6abceca5 0x90933fe1
+ 0x45a72a5b 0x07a2b36a 0xe5313898 0xca7b9485
+ 0x6263c073 0xf5190740 0xdd80f0d8 0x432fa2dd
+ 0x69831440 0x6fced3b5 0xa314fbab 0x18b9ecc8
+ 0xae7235a4 0x08a267fa 0xcc4a217c 0x477440b6
+ 0x5877756d 0x862847a9 0x91c017ae 0x39292950
+ 0x21bd5cb9 0xf01d709a 0xcdc173ad 0x138e94d5
+ 0x53054d97 0x302bb5b1 0x0d264e98 0x3cc9d0be
+ 0xc92555fa 0x3e79530c 0xd48c4c4b 0xa06ba129
+ 0xb5f33763 0x39a37bd0 0x1e8d0d46 0x93b599bf
+ 0x0842efce 0x8d6ce60f 0x3432f84c 0x9d8ca617
+ 0xfec93e00 0x3389826b 0x61d2bcb6 0x6b15eeca
+ 0xa8f814ec 0x31fb1195 0x4d5784dd 0x9a0c7388
+ 0x39ee3413 0x7f858c65 0xfa9ea23f 0x6231f584
+ 0xfaf40874 0xf2c87fe1 0x8869c40a 0x04eee868
+ 0xe3bb8a66 0xc28c5aa6 0xea2cbe9a 0x3de2d5d1
+ 0x88ffcd76 0x47493091 0x310271dd 0x557e51a0
+ 0x6e0dc01b 0xdf812ce2 0x3b6da963 0x214f5533
+ 0x099c5441 0xc16460c6 0x8c55c47e 0x319d328a
+ 0xf230ceac 0x7dde560b 0x337b15d2 0x80678040
+ 0x1052d3ac 0x06db710d 0x0b54d93e 0x98987009
+ 0x254704e0 0x20650419 0x6118e810 0x4f52d866
+ 0x64d2e8a3 0x0480d5da 0xde5ef5b9 0xb03a703f
+ 0x379ffb82 0x76f87284 0xb0b7059e 0xb3d37671
+ 0x2b243a94 0x75a70d88 0xe242c806 0x30435090
+ 0x3ec06f3e 0xcc25e123 0x58db94cf 0x890826ff
+ 0x73057887 0x1e2e0740 0xf80ced81 0x924e6de7
+ 0x15a8e02e 0xde8ee51f 0x2dbb33d6 0x185567db
+ 0x8145bac8 0x0d14334e 0xd8bcd7d4 0xc18d3256
+ 0x57efede9 0x73ac6179 0xf6e98357 0x068c24d2
+ 0x3dc62465 0x70d47d94 0x2b249317 0xca89c2dc
+ 0x335e7372 0x78584f6c 0xc645bcd9 0xdd941604
+ 0x0e72657e 0x5a3ba416 0x86710900 0xcf2dbfbb
+ 0xa59814dd 0x8850b913 0x0c8d653c 0x2d220e4b
+ 0xedfed05f 0xc4688466 0xec54375a 0x3ab1c99d
+ 0xf64dba02 0x01499f01 0xbec76bba 0xf520292a
+ 0xd98d6fcc 0x9e8811b5 0x0d3e90f8 0x440928a5
+ 0x6df4dca7 0xd991e421 0xa80f7476 0xd39255f1
+ 0x747d717f 0x67536af2 0xcbdc6e90 0xb3ef075d
+ 0xc6b59f51 0xf3d2b422 0x96e646de 0x9f95a00a
+ 0x370d965a 0xa20df02b 0xe3326da4 0x97e96ebe
+ 0x62133be4 0xec63e8d1 0x7170458b 0xa04077ea
+ 0xda611b2a 0xd4541229 0xb262f2fa 0xa0280090
+ 0x04d9ff11 0xc4dd530e 0xaecc11d3 0xac5e8ee2
+ 0xe03303a9 0x45c74f3b 0x0a44e0a3 0x623c812c
+ 0x5a78acbb 0x174b6ddb 0xc15a6167 0xeb370d7d
+ 0x344742d4 0x95c36708 0x50b22ead 0xa8f66299
+ 0x240522f1 0x0c19352e 0x7aa5f269 0x7e349786
+ 0xefa03eaa 0x162cbd19 0x1d657093 0xe7e2d85b
+ 0x64cb8342 0xffed7a87 0x48877ee5 0x9861324c
+ 0x894e2a1b 0x0ed0ad9f 0x97ffdebf 0xd8e71947
+ 0xe9797767 0xd3a02dba 0x872192d2 0x9ba0166b
+ 0x8c6418fa 0xc9ca4562 0xd1c20f63 0x7c0827f7
+ 0xc55ebb68 0x8d7eec37 0xa0f2a179 0xfb121fb2
+ 0xb6496a31 0x54f7332f 0x37fec58c 0xde32ed05
+ 0xd8de600d 0x3384d32c 0xe49fdb04 0x6788cf7d
+ 0x4739394a 0xff02632c 0x81c5255e 0xfa67feb4
+ 0x06d7befc 0x9639b5ee 0x639cf17f 0xf9de4a5f
+ 0x02243882 0x8d2241af 0x90a2219e 0x48f9d0be
+ 0x3856b281 0x559afad3 0x4c73c448 0x6a19c2c3
+ 0x422b9934 0x19bf9591 0x3edfbac9 0x1410f992
+ 0x009c3964 0xcb2139b1 0x1f28d6ff 0xa96de3b3
+ 0x7436f1c4 0xe7a96628 0x4593df96 0xa360dbf0
+ 0x092edc07 0xa728ec90 0xd84eea82 0x8df6e4f4
+ 0x69342820 0x7a71afe6 0x8edbcb4d 0x41c381ee
+ 0xf4828f3d 0x8135dfc9 0xb7d60954 0x6ffcd452
+ 0xea6fc8e9 0x5d321983 0xe1961ede 0xa627d22a
+ 0x78e1fb4b 0x7cb48d21 0x45791225 0x9ed45669
+ 0x873cc9b3 0x226dd2ef 0x3bc8e0b5 0x73515ea1
+ 0xcfd1a0a6 0x3f0ef6a6 0x42698d45 0x24774846
+ 0x1b4dd33d 0x7ab567b3 0x4287a3d1 0xb3a340af
+ 0x5461daad 0x42d65034 0x79ce7d93 0x4de02311
+ 0xc9cfeb8b 0xfc31cb0e 0xf2783bd9 0x9f883599
+ 0x44d25fc6 0x2d0ac361 0x2314756d 0x6204058c
+ 0xbb89b0c5 0x466ed73c 0x9dbe3d75 0x8ec6447c
+ 0x89853f2a 0x452f289d 0x59ab32d1 0x664ef2b7
+ 0xf2feb1ae 0xee84c078 0xfd352da2 0xf4bb27c5
+ 0xf946c061 0xecc515c8 0x89f15047 0x7305b158
+ 0xac79b70a 0x4851a92c 0xa60cda46 0xc36b47a3
+ 0x1fe96c82 0x775c7496 0x7ff0ef05 0x3b902ee5
+ 0x3d63a012 0xe9a59d17 0x990dc562 0x3d28b2e7
+ 0x463f45b8 0x2cf93af1 0xc0b20323 0xd2f2a727
+ 0x2ab30093 0x7b3067b1 0xb1084167 0x9359b6e5
+ 0x2bfc7ee2 0xa433704e 0x2534cc30 0xb7eeb3ad
+ 0xe6433dab 0xfab7ee93 0x8fe1baf6 0x7c9d1cab
+ 0x0b37489b 0x21f29bb2 0x1fbe19de 0xa9fd5655
+ 0x18cee72a 0x54444e6a 0x7b8e67bd 0x4733851b
+ 0x1edc5cf6 0xc4058d84 0xb17b3474 0x635842ce
+ 0x87dc13e5 0xc85c88a8 0x6465d06d 0x3651a206
+ 0xf221335c 0x8f829f04 0x0cfd2da7 0x3f8a1f5c
+ 0x9d7fd530 0xecebbebb 0xac20b927 0x0931c838
+ 0x04f4da8a 0xc604e560 0xb5a32b43 0x92578126
+ 0x086e4838 0xe299f931 0x405921ff 0x1bf3b424
+ 0xe330e775 0x32a8b2e8 0x8c398e8b 0x4c1b9be4
+ 0x3d6bbc2a 0xe16749d5 0x3f711d29 0x167679b3
+ 0x67753943 0xbd19e4ce 0x8a01927b 0x7ed9db48
+ 0xeb810bed 0xf010bb3b 0x0c619dc8 0xda2b4ee6
+ 0x97f72cae 0xb1e50373 0x86a56b38 0x42564171
+ 0xa42e02ea 0xf9a73535 0xa090a1e7 0x36c5f132
+ 0x2be425e7 0x99450cba 0xaf895b37 0xea338c07
+ 0xb5173364 0x87cba1b1 0xff17a025 0x926c143f
+ 0xc1bd8ed0 0x7dc43a1b 0x409201a3 0x37435a42
+ 0x6fa2c185 0xf6b63721 0x36e18dad 0x65fcabe3
+ 0x047d6f6f 0xabb8de33 0x36edf818 0x5240f1c2
+ 0x2a74bfe4 0x23bd88f6 0x5277ef4b 0x661eff54
+ 0x63c1912d 0x5ec4b96a 0x80ce9176 0xd93f4b74
+ 0xdaa4a9c4 0x4fe89560 0x4ad9f1e2 0xcf39d5ab
+ 0x78a71e58 0x7fc8c792 0xf8524dcd 0x2ad0224d
+ 0x80397618 0x91a5956c 0xe6d93642 0x16e811c3
+ 0x115e8e88 0x01b33913 0x6019e327 0xa5394792
+ 0xfaace8e9 0x984b2b11 0xa7dc9448 0xc947698c
+ 0x8b191b70 0xb47def7e 0x504a792b 0x6a1e6978
+ 0x8f697729 0x87e133ad 0x98b112ad 0xf4cf8898
+ 0xde515d35 0x5e534596 0xbd8bf459 0x783d26c1
+ 0xf021a2e4 0x2a15a509 0xa314f1db 0x88fcf5fb
+ 0xcd0ab684 0x24fa6b87 0x3bde9c04 0x3a5381f5
+ 0x0b035c86 0x5d8c4134 0x7131d67d 0xad193dcf
+ 0xe8b949ef 0xa241ca53 0xc6a522ba 0x08214572
+ 0x0f8b6327 0xd744cc9c 0xe626ba3c 0xbcc8fa71
+ 0xc8889a16 0x4101e6c4 0x013361e2 0x81afc6f5
+ 0xd47afc84 0x594e2007 0x46a03c82 0x6ed8e69d
+ 0xc395debd 0xdf10a851 0xfdc1968e 0x35fb989a
+ 0xc5c8f333 0x4bab2dcb 0xe145c017 0x2ec93db8
+ 0x993415ca 0xe1fb3144 0xf111e25f 0x52cbcd55
+ 0x0691a307 0xa535bda0 0x8f0f5921 0x4250306c
+ 0x65307a53 0xf7c8a4bd 0x606aa819 0xaa534324
+ 0xf9cea68f 0xe4152914 0xd5fe89a6 0x5199e351
+ 0x82322d06 0xa9a7ccdd 0x859d711f 0x28fa34c0
+ 0x405d0a0e 0x31622b61 0x5205acc2 0x658e0d8c
+ 0xbf87f2f4 0xcc6309f0 0x0ac483d3 0x62d61d0a
+ 0xc29ee1cb 0xe719d1be 0x44b8140b 0x9bcdda3a
+ 0x4533c26b 0xb42060a9 0x58853442 0xd876d55f
+ 0xf13165f3 0x35ed56e8 0xea1a5415 0x4c920d34
+ 0x191ceeb2 0xc8ddc82e 0x3922fd04 0x978d6ab9
+ 0xa087551e 0xbb616dc2 0x86d8101f 0x2c6e98b1
+ 0x28fcd44b 0x67daa758 0xc19c6c89 0x28338d0f
+ 0x9a173526 0xf1c32e1f 0x42eafaeb 0x697bf44a
+ 0xb677045f 0xe902a9db 0xc96cc214 0x476ff77f
+ 0x5419cc3f 0x77b86c5c 0xd95d783e 0xadf630d6
+ 0x1fee8ae4 0x4e6f2f89 0xfd784caa 0x00bcc110
+ 0x785fdec4 0x4b8ea519 0x93f2031e 0x69d42d67
+ 0xb6a0c4f7 0xdde15f78 0xe106753d 0xd4319e3d
+ 0x9f033801 0x45d214cb 0x89f0bbb6 0x0b68e9a1
+ 0x0b42f46f 0x97d81d3a 0x592a0992 0x70a18d46
+ 0xbd75f408 0x5fb94e1e 0x894505a4 0xd84edd3b
+ 0x951f996b 0xcb7a6410 0xa9bb75fe 0x17269ed7
+ 0x797e64e3 0x5385297a 0xc2e0ffb8 0xea3e7cdd
+ 0x34b70c33 0xd879e291 0x6b2be9f6 0x615ef9d1
+ 0x17f93517 0x29e19ec2 0xde62a1a0 0x552675ef
+ 0x991f0dac 0x2decb2aa 0xf90b2cdf 0xaaeafa85
+ 0xba1395be 0x552431b8 0x46b5c459 0xa95dd0b8
+ 0x3da73cd1 0xb493eed4 0x4b2c1292 0x72437c8d
+ 0x1fa3c029 0x3c846098 0x91f628fb 0x66c3083e
+ 0xbd8674ec 0x2ad21c30 0x0755b90c 0x7c1c02f4
+ 0xdea8981e 0x173c3099 0xdf5eb473 0x821bac29
+ 0x2d83fed4 0x06a8eb69 0x7d3f8bad 0x5629edc3
+ 0x7c4593b6 0xba8c76ee 0xf8b0d46b 0xccb41bef
+ 0x571e8d7e 0xd99f20bd 0x0af219a2 0x89750f0a
+ 0xfc0a9b8d 0xd0dca061 0xab6383db 0x5e095be9
+ 0xc116da10 0x0850f5d4 0xa01f6c33 0x2b4b8a62
+ 0xbc96338f 0x338cd044 0x6da96fd0 0x0d5c7042
+ 0xffd4c56c 0x4ef92fee 0xc2f3d4e1 0xb81b2901
+ 0xb0cfdcfd 0x7e68076c 0x6a48b418 0x5ae173be
+ 0xa42af94f 0xb5aeaedd 0xd0a2ca28 0xfe301cb9
+ 0x64616a36 0x9b63ce32 0x17e895eb 0x8576a9a1
+ 0x23d14337 0x019c592b 0xef031722 0xfd6e5b19
+ 0xc23eba8c 0xc64e6794 0x3602e7a0 0xfa9b4a62
+ 0x806f61cc 0xbb1ad0c1 0x8253edd3 0x9e3bd367
+ 0xbd24ea1b 0xcdc3507e 0xd98eed4e 0x8edd45cc
+ 0x08fbf233 0xcaca956d 0x273ba326 0x49fa6eaa
+ 0xd0fb7870 0x9ee56e1e 0xe675f026 0x47c4249a
+ 0xd15ba3f7 0xd6a2090b 0x50b33122 0xc7bf73b7
+ 0xc33cf621 0x73f17107 0x2de0b8fb 0xb8131d55
+ 0xb0f18745 0xe4ed1a78 0xaf5dcc10 0xb56a7d51
+ 0x27544a20 0x34188d9a 0x4d565903 0x9bfb8895
+ 0x0e0ff1b1 0xd8dbb9de 0xc5b073ac 0x06499ced
+ 0xdbe6dd00 0x051bc5f6 0x460e37b5 0xba525f13
+ 0xf54a5470 0x227d4bfe 0x462105ac 0x43141f50
+ 0x11de79f7 0x9f1821bf 0xc2aaf461 0xd5042606
+ 0x7f7823cb 0x37374cd8 0x5f40c496 0xfcca9b0c
+ 0xc9061b3d 0xc4887c54 0x3f9ac089 0xc7ebe1ba
+ 0x933dea63 0xcf1de178 0x63713e5d 0xddf92c47
+ 0x0ad1cd99 0x0ba92d8e 0xcdfcb995 0xde9d0007
+ 0x8d11f064 0xb16073ac 0xcaf71f3f 0x3c220cd1
+ 0x9afaebf5 0xfaa8b8d4 0x013085d5 0xa701c1c3
+ 0xde4f97b1 0xe98fdf11 0xfcdf5165 0x704f0326
+ 0x3aa9c333 0x5eba9c4a 0x8f17ad1b 0xefc9d59b
+ 0xa8d6f56d 0xc5ba175c 0x33e332c7 0xf234bf43
+ 0xf7478a19 0x62fc6fe6 0x8c205e86 0xeb21b117
+ 0xda68f6c2 0xc35e50d0 0xaed255fc 0xfafaccbd
+ 0x68bf6e7c 0xaedc2f85 0xb4963f95 0xb3bcdbde
+ 0x20319ef8 0xa8e0c197 0x7be0aa53 0x77dd2f2f
+ 0x27c5d672 0x4c9d8630 0x5b259176 0xecab82ec
+ 0x0566cb79 0x35f099c5 0x2a915c42 0x2ac9e371
+ 0x7137e3fa 0x4f43b99d 0x11c4dc00 0x8fc8cdf2
+ 0x20e0dcd1 0x0234a137 0xa7226b26 0xf71df5a7
+ 0x2c80994c 0x50f43827 0x97248143 0xdf8d811c
+ 0x63168f49 0xa885ac8e 0xe7e6fce6 0x7b1d8b68
+ 0x51378009 0x51eca507 0x7c862ee6 0x3a907513
+ 0x339c2fb1 0xfb24c06c 0xb16c9630 0xec9327a1
+ 0x790d3884 0x3053bd28 0x52a58115 0xd4071422
+ 0x0e71ae93 0x446e0c55 0x917dea8c 0xecd558d4
+ 0xc34e9011 0x0e3ab373 0xc74a7f70 0x1def7cc6
+ 0x70e00517 0xae5bcec4 0xa491b7f0 0xa990d6f3
+ 0x35322ee2 0x250d253f 0xf41d19e3 0xc8219293
+ 0xf7aad70e 0x420423df 0x17947be5 0x1770183c
+ 0x2d7b019f 0xac55ab96 0xec1b5070 0x6e9ae72f
+ 0xf45ef9f8 0xbd99d8f5 0x5720a49d 0x4b26724b
+ 0x5f7b899b 0x431d8946 0xdc9f5bb0 0xd9df764f
+ 0x74fd696b 0x8ac6f8cb 0xe655113e 0x2178fb00
+ 0x3ff85fbe 0xbe052b5b 0x51dd6484 0xd4f79bf6
+ 0x15f60a65 0x0390aec1 0xfb6776d2 0x92f54e91
+ 0x46b7b912 0x29638a41 0x36d4a299 0x817824a5
+ 0x8d1f8eec 0x69fd819d 0xa2e2a133 0x54635a65
+ 0x770c410f 0x4e02d788 0x3e0bdf87 0x3c98d2fb
+ 0x63010acf 0x96cfa678 0x81b5b497 0x16ff2913
+ 0xb8f90d11 0xd32d3085 0xd5a9a46f 0x05f45932
+ 0x0694ea00 0x0d039ee0 0xa309cb9a 0xc506fe28
+ 0x6d5af6e6 0xcf7e16f4 0xebb5a600 0x10b66a7a
+ 0x07b0e164 0xe4466d8c 0x02979c1c 0x22e44ad8
+ 0x0eba1199 0x7e007291 0x3e6eaab3 0x6bd3459a
+ 0xf3072e5b 0x60e0e63e 0xc4c7072d 0xe23a1451
+ 0x4fe5cd8d 0xb7cf3759 0xc415ef02 0x2ac8ed21
+ 0x32d8a07f 0x630f2355 0x95f4a1f3 0xebb5fc49
+ 0x766ee7b3 0x5195461c 0x652f7115 0xa5284de9
+ 0xe9c3b41f 0x392f6792 0xc2997b44 0x55551481
+ 0xd3f21d99 0xf0785862 0xbac2eddd 0xe1a58663
+ 0x1e847578 0xd5345e0c 0x0680c68e 0x1d987ba8
+ 0x94337413 0x9708920e 0x47a0683f 0x09cbf028
+ 0xa400dbbe 0xe3d6cf1e 0x3d2264e3 0x82a0844e
+ 0x5c6d61a0 0x29ed71ae 0x94d67091 0xa6d18fac
+ 0x143550ed 0xbf002e96 0x5791faad 0x5c910726
+ 0xee2a9fb8 0x92f476ac 0xff288092 0x580b9f47
+ 0x2496ae51 0x6c979248 0xcfd508cf 0x24e1ed75
+ 0xde92ee9a 0x227b8ea5 0x1a58fa12 0xab8990f2
+ 0x9e16b990 0x9902e4f4 0x926e8f63 0x7d163d87
+ 0x745c3611 0x16bb1ae9 0x8d169535 0x8a0cf1ad
+ 0xf4b0ed16 0x1db04987 0x844a1644 0xde883736
+ 0xd3ea88b3 0xf602cfc3 0x60be8c98 0xe94f8d25
+ 0x9969ec2f 0xea40781b 0x9a51d49d 0x247539fc
+ 0x396a391d 0x403bfcc4 0x460eaff9 0xfb50e4d2
+ 0x88942d26 0xdc84dfd1 0x8ae3e0a2 0xed47755a
+ 0x9719345b 0x84d5c24c 0xa27ae8c4 0x6bfc3ecd
+ 0xb533222b 0xd9c2a3b9 0xa068909a 0xd334506a
+ 0x5f8969e9 0xea577574 0x4fd7c372 0x79ebedfb
+ 0x519b857e 0xe5a3b57b 0xa9c66d58 0x622d9e75
+ 0x184a3f0c 0x8353e40b 0x67dffdeb 0x96f28a6a
+ 0x69e3d77f 0x837ad601 0x45adb16c 0x95b7103d
+ 0xf8de8e34 0xe5d897b6 0xa19aa999 0xf62b5b2a
+ 0xa21205fe 0x96e3d97d 0x2f8763d1 0xc1f5ac4b
+ 0xea03ebc7 0xf691c313 0x348842c3 0x5f8107ed
+ 0x4b4322c5 0x7356b08a 0x1f22322a 0x60cc8cde
+ 0x44d031d0 0x61832e25 0xa4405833 0x87900700
+ 0x42a7965b 0xa2b6b169 0xddd0d382 0xbd6b2ad4
+ 0x006b62d9 0x8cec67fd 0x8c54cce6 0xa9874881
+ 0xa34fec79 0xa8d13e9c 0x918a39ff 0x2027a461
+ 0x716dd8ae 0xda06d88d 0x4ec42f28 0xbb89f516
+ 0x65a813d1 0x2f36fbb1 0xd16b3d5f 0x36a6a634
+ 0xbafc79ac 0xd74feb8a 0x33bce888 0x2e97f521
+ 0xbf3b8afa 0xe51b3ec4 0xeffd67ce 0x257f5698
+ 0xc5ffbedc 0x922bfc28 0x8138e0be 0xf8f5d9fa
+ 0x0d446f83 0xd43c2cf5 0x0835e427 0xd0858e4f
+ 0x5d0c3300 0x9ce5e8ad 0x0238443a 0x383fe4e5
+ 0x409c65be 0x726f1549 0x3e0fcec0 0x660a684e
+ 0xd5959ade 0x3a07917b 0x3fd5346d 0xbe334d1a
+ 0x14e90a3b 0x345f134f 0xd737dd52 0x36558ea3
+ 0x66532c32 0xffda2d76 0x70c23a69 0x576cce17
+ 0x1bc0f11f 0xe7e2594e 0x5531b96c 0xc7115f3e
+ 0xc12d5d5c 0x61863f0c 0x953bbbac 0xf4fbc9d4
+ 0x26c8f68f 0x9b1ff5d4 0x2f72c468 0x84733422
+ 0xb4eaa65f 0x211fd212 0x8c3de90a 0x312ed1e2
+ 0xb37aa93c 0x31f32754 0x11c8acb7 0xdc485091
+ 0x6e4aa039 0x0cfa7399 0xdc5a7f7c 0x3f71ef24
+ 0x30df5838 0x4eef7156 0x97ea7b48 0x7c19ff92
+ 0x1bb85768 0x0fba8cf4 0xa4069660 0x7b24c4c1
+ 0x9e9bcaa0 0xe8a3ba7c 0x055107ec 0xfd592e53
+ 0x11d25c42 0x200bf193 0x342f7daf 0xcdfc8fc7
+ 0x6f32bfc8 0xf0079c0c 0x269d86e3 0x23e44431
+ 0xe1fbed2f 0x61ca39f0 0x4ac6264c 0x7b998418
+ 0xa98ece70 0x25ff9012 0xfcc59f7a 0x4bdbbfe3
+ 0x68bd284a 0xd49ba70a 0xe9771aaa 0x183fbdb8
+ 0x0cfb07c9 0xbed9ec14 0xdd2fbd24 0x79946087
+ 0x716a31a0 0x080e18fd 0x6504a5a1 0x2e4d22b4
+ 0xbdad854a 0xdaba04a9 0x6eac5971 0x1eae6100
+ 0x9fa5e77c 0x9e48a4ff 0xe26a35c2 0x34a7ceed
+ 0x48d0287b 0x9589f189 0x899e75a6 0xfcb6b2e7
+ 0x82181300 0xdb567ec3 0x215bd550 0x867ce1cd
+ 0x16aaf849 0x4a455636 0xf8dd943c 0x9fb628c2
+ 0xe70af387 0x2f3b46c9 0xbcd6bae6 0x1df9e892
+ 0xfa3a8acf 0xb8255dec 0xedd76ede 0xe926dc9a
+ 0x5bc71a93 0x792b9383 0x34c87266 0x026560b6
+ 0xa3e4f7fe 0x33cfc10d 0x84a0847f 0xdd682f5e
+ 0x14623fcc 0xd049aa15 0x48afe64b 0x3be26bf5
+ 0xedab7c7e 0xb21641ba 0x49953a88 0x6b37a7fe
+ 0xa0be5422 0xfb2bd2e4 0xf6565a3d 0xf946617c
+ 0x637176da 0xa1d905eb 0x59c02b62 0xb19ce441
+ 0xc04fbe15 0x40660e94 0xfdbb3c4a 0xfcbb64e7
+ 0x6428a539 0xa6bda0a2 0x10fd064d 0xd565719c
+ 0x3144002a 0x36d33d73 0x2f994a1e 0xd42d8bb0
+ 0xd5152b0a 0x0a9849a2 0x60326948 0x28440694
+ 0xcfa29f9e 0x314dc2be 0xa4620cc2 0xb7e82cfd
+ 0x5975c2e8 0x4e5a273b 0xca2ae9e0 0x4e6ce1cb
+ 0x25a341ab 0xec5bf801 0x4c85a32b 0xe2ec9a40
+ 0x371cd350 0x2d7dfefb 0xf1a7e1aa 0x3af9adff
+ 0x66788da1 0xab007648 0x6237e368 0xc20ab56f
+ 0xd3886e9b 0xa67a70e6 0x18b59e24 0x2ef31cb2
+ 0x1cbbe7cb 0xb94b0b60 0xce7edf06 0x14e55b20
+ 0xcf71b03f 0x86b5405b 0x79fee28e 0x5ce147a0
+ 0xdea14796 0x833d27e8 0xd8826ce2 0x9434b65f
+ 0x36bdc020 0xf0f6c4ec 0xc322ba9c 0xbf0d9370
+ 0x9b8a39b9 0x560c0742 0x317f2428 0xac3151e6
+ 0x1895a12e 0xc50bd4ee 0x79a5dfd9 0xc6b3d06f
+ 0x4221ca51 0xbc96d184 0x7721f26f 0x2a9faebe
+ 0x680e9559 0x4761117e 0x08d752d6 0x5117fbcc
+ 0xe23bb33b 0xb1d72955 0xc337218b 0x933b12b1
+ 0x57f83533 0x9a8bc464 0xba8a4102 0x1767693e
+ 0xfad687c2 0xa5b53640 0xf19ccc71 0xf05bf6e8
+ 0x47a7cb9b 0x9208a5de 0xe23d5578 0xcac29dfc
+ 0x96c58051 0x50463c0c 0x7048f2d4 0x409f78c9
+ 0x74da5bf6 0x759aedc7 0x852d1133 0xbc835c09
+ 0x3cb0672a 0xd9cec34d 0xfeabe3d8 0x4b1e1c6e
+ 0x6c9097ec 0x026b8e9a 0x4f858410 0x79c78cd2
+ 0x4381f237 0xcd7010c3 0x886e8f51 0xdaf6ce82
+ 0x003307d4 0x3e60dad0 0x4506368e 0x6e01f417
+ 0xee9b6003 0x8f36f3b2 0xb17c829f 0xe4fee189
+ 0x06b95373 0x530cf764 0xc99046ec 0x05b6c1be
+ 0xc9c164a4 0x58502c85 0x3186a69a 0xcac65ed3
+ 0x13bdb988 0xbbbfa094 0x5df20633 0xbeacd0a0
+ 0xc4b3abb6 0x7cd2ef9a 0x5838646e 0x800db131
+ 0x27440dc0 0xca15d49b 0x66ae0afc 0x92cc4e6c
+ 0xe347ed4f 0xfd8c0070 0x2537e7a3 0xb96cc468
+ 0x4bf4a0ef 0xcd4d5b4b 0x99c5d3fe 0x82c7ac9f
+ 0x13118704 0x5ba10fea 0x1d0972c8 0x3e9c0ab9
+ 0x28289b9e 0x0cd5bfaf 0x0d6d529b 0x6c38c0a9
+ 0x412e7a71 0x8b2670b2 0x9348ee40 0xf2f32dc0
+ 0x625f09d3 0x6fd62269 0x0294baa8 0xb0c962bc
+ 0x18298a69 0xa27dd181 0xbade6357 0xb5ddb668
+ 0x3a3824f9 0x1640cc58 0xf5157f35 0x8112eb28
+ 0xe3cc5745 0x1de85839 0xc3c928d7 0x9e2707fd
+ 0xbca1f90f 0xccca98e7 0x56b7087d 0xd497fa74
+ 0x6a01185a 0xcf937695 0x239a29bc 0x5e932d13
+ 0x03598809 0x00a335c4 0x61475568 0xfb446c9e
+ 0x54a56804 0x70e9920a 0x9d285d6e 0xab10cb35
+ 0xdc81decd 0x062c98e7 0x72e4fa95 0x0a8e9581
+ 0x361a5f99 0x26b8d16c 0x41ec0c3f 0xa8258ece
+ 0xffdcbfe9 0xe4dc0b7c 0x9a2dba01 0x94ecbb16
+ 0xe2c60666 0xd79195c6 0x6942afe4 0xed29d2a6
+ 0x453355c3 0x48dd90bf 0x9016f7c9 0x3aa79213
+ 0xf5528cd5 0x57e21566 0xbe79c184 0xefaecf61
+ 0xa240ce49 0x7d3a701d 0x3345c92c 0x7045dfbd
+ 0xf266997e 0xe4725404 0xacf00dc8 0x14fd44a8
+ 0x7480fb1f 0x469c63dd 0x630306a9 0xe74ff394
+ 0x115f913b 0x6beeff69 0x152ec535 0xe375b9dd
+ 0xf86b85e5 0xa642d387 0xd57270d6 0xd5e564b5
+ 0x6dcf53c2 0xf8a0cdf6 0xf10fa1b8 0xccdafb95
+ 0x18bcc1be 0x9b849014 0xe3108441 0x39c736e6
+ 0x07de210f 0x1e78f0cd 0xb25985b1 0x0ff9479d
+ 0x582348e6 0xed3af892 0xb80f38f5 0x19df3f10
+ 0x9fe7a266 0x54377947 0x87446ecf 0xc17b93b9
+ 0x48987f5a 0xd80286ca 0xa53f86a4 0x50e8870d
+ 0x5bf9bb0d 0xadfe56d6 0x54f7b96a 0xcbfd68e6
+ 0xd31258f3 0x640cbbbb 0x6cdeced7 0xb762b7d0
+ 0x3b9cd4d0 0x62ed874a 0x6c18c646 0x35181a11
+ 0x2b9385f8 0x2f52ee24 0x69c8bba2 0xca1e2fca
+ 0x298f168d 0x229faf64 0x00219f3f 0xf46bf47c
+ 0xcd9987b0 0xabc50e23 0x5fe20807 0xc7bffa5b
+ 0x5c64e801 0x8e5fdf7c 0xf22c3a58 0x6ebfcaf0
+ 0x18c04c76 0xb876d8b6 0x0d185e8c 0x15e87b88
+ 0xcc30f6ca 0xfebf9664 0xa26e41a0 0x7e1bff14
+ 0xdac4e629 0xf3a9b993 0xea7e92ae 0x32bba216
+ 0xf2b0c1b0 0xd649ab34 0xcea057ff 0xf07ab0ad
+ 0x6a0cc061 0xf9844196 0x8770cbf5 0x0d0ebcd0
+ 0xa137d921 0x01a0ac7a 0x6ce9b55a 0x851b7c81
+ 0x9d1a3c60 0x16f70264 0x960700ee 0xcd83b035
+ 0xf624d4aa 0x44831510 0x7076f930 0x558502dc
+ 0xcc14f4ad 0x49f5f054 0x245eb157 0x5d717aff
+ 0xb2945cd3 0x2ef2fab4 0x891b0abb 0xa74f7ecb
+ 0x2f60d277 0x4382d068 0xf5621a38 0xb701d8a3
+ 0xf02441a3 0x9a3bc4af 0x1fba0377 0x5585c7d8
+ 0x77c10914 0x4641014e 0x125b270f 0x3e1f1d95
+ 0xc5b5fa9e 0x608ef6e0 0x5287c20e 0xe5bc7622
+ 0x36d5a0fe 0x26cbe98d 0x96908dd1 0x0fec2e3a
+ 0x5eafa4a9 0xcdbc5730 0xdc874327 0xc4583395
+ 0xca8be21a 0xf42dd3f8 0x113aa82e 0x19bf7cfd
+ 0xb819ccdc 0xc8b0fd95 0x25a0b336 0xdfe23781
+ 0x2061f003 0x6c897f34 0x0f10770d 0x2e7c5862
+ 0x2b9b1b60 0x4a770d78 0xd7065b77 0xe5fe912d
+ 0x22e6eeb6 0xdc8bc5ff 0xb6d8737a 0x4b3e0d31
+ 0x9dcdfc18 0x6bd995e3 0x7d05cc1f 0xc5bf3600
+ 0x49b7cfe4 0x84c8bb06 0x0622cc72 0x0107b8ef
+ 0x91eb2766 0xa9bbe486 0x7076236a 0x2328014d
+ 0x852261bd 0x568a0a88 0x08b3bf20 0x691b28c8
+ 0x1b1ce35f 0x27bd4371 0xfb71d136 0x130006e0
+ 0xbf191bd0 0xe4ef4523 0x88835271 0xb464f510
+ 0x5508d73c 0xe8d62464 0x1aea93b1 0xa9d26d06
+ 0x5026aba0 0x5aace509 0x6d9f3bb2 0x205742f1
+ 0x4d0dcd05 0x45e0586d 0x6977274e 0x7478121f
+ 0x52d3281f 0x2678cd9c 0x19aaf2f2 0x7a6ca61b
+ 0x6ddd75bd 0xa4dd4b06 0x4db83b73 0x0f732c5a
+ 0x85a24c37 0xb87fc623 0x58da4ed8 0x77a67f89
+ 0xbf8b8cf4 0xdec76d60 0xa14e2e48 0x5e153c52
+ 0x879c421a 0xa76e650e 0x04881140 0x7a0bf61b
+ 0x38eb1c6c 0x53599688 0x7eee839a 0xd6bf2fcc
+ 0x5b83c794 0xd191589a 0x76f4a38e 0x223c94e6
+ 0xd6e7080e 0x9254461a 0xbd2a7952 0x7bc4b6c1
+ 0xfddf9eeb 0x074aef50 0x32f61578 0xe7c3f32e
+ 0x77bd22cc 0x3b72e014 0xf2b7b877 0xe9987b96
+ 0x79333a9d 0xaf9faa27 0xcde582e0 0x58ee0d11
+ 0x5bd8bd59 0x99853e4a 0x16158bc0 0xd7813aa7
+ 0xc16daba6 0xf017ab49 0xed1ddd5f 0x89aef3a4
+ 0x83c7ffdf 0x6c29d7f7 0x1eb83c2e 0xe030cf03
+ 0xf3a1810c 0x363ae113 0x43a6b42b 0x4e5ac2d4
+ 0x2a77c299 0x6c8bc618 0xedb0232b 0xdb3b2844
+ 0x2bc1a846 0x4a23f40c 0x684854ba 0x01d47692
+ 0x83aee0e5 0x28fa7c7b 0x851c2cce 0x7076ca67
+ 0x995d2fe2 0xc6c5e8fc 0xdca37ee2 0xfde28cb7
+ 0xa84895a7 0xe6a8e4cf 0x90b19069 0xa0003041
+ 0x0d9b07a2 0x56c92d5b 0xde206c05 0xa3a18ec0
+ 0x8b009bd2 0x24582152 0x3aa878da 0x85dcb3d3
+ 0x77f97c4f 0xdf418d92 0x4607940e 0x253b04de
+ 0x2ea6ee88 0xa8da5a41 0x170cce34 0x29d20fcf
+ 0x8cb7151b 0x0b647896 0xe724f612 0xa37c3d7a
+ 0x27be5ba2 0xc667d65e 0x80c0fc8c 0xb6231066
+ 0xe85fe1bc 0xdc8209ad 0x87605f6b 0x8e237dd3
+ 0x86c98159 0x991b9623 0x4e3f3beb 0x8929cdad
+ 0x6ea581e4 0xc5b8abe0 0x3f844e1d 0x143bd24a
+ 0x258b4f70 0xa407e2f9 0xac35a1e7 0xab93f86e
+ 0x3a6f7b70 0x9edda2e3 0xf021cbe9 0x853b9110
+ 0x8a61bacb 0x39b937d0 0x17b55c70 0x02dcae26
+ 0x3fc81c76 0xcaa89990 0x0d187f2f 0x5f15dab7
+ 0x6c5aa228 0xc584fe52 0x2d132795 0xe36d8b39
+ 0x51fa6bf9 0x1f635d0d 0xe0e58f26 0x3cbed7d5
+ 0x7d5a1214 0x84d7636e 0x3d09e00e 0x51f263ce
+ 0x1dc8bbb3 0xdad73812 0xf8018762 0x0eb149e2
+ 0x0a37a27f 0x649f893c 0xf81b17bb 0xbdfe07de
+ 0x3f186d13 0x944c3b9d 0x6089cd72 0x538064c2
+ 0x7d7b1940 0x857acbd8 0x441ae33e 0x612fad10
+ 0xf675c90c 0x4a2b9aaa 0x4bdc9d55 0xda87fc33
+ 0x3f530c81 0x8a0bfd0e 0xce301979 0x5fb8df8b
+ 0xf4f89658 0xf4ec3f3a 0xdcdb37dd 0x4ff70e33
+ 0xd001840a 0xa6c315dc 0x54415bbf 0x12c26520
+ 0x5fa5336f 0x5127274f 0x495d8b4d 0x95e0b696
+ 0x4e534571 0x259d92c9 0x04293543 0x7814a548
+ 0x4226c6a6 0x931c2472 0x5e03faab 0xdc77f1f9
+ 0xdf4e5b23 0xeb990f87 0xf2aee5f3 0x22ad49b7
+ 0x2eeacb2f 0x57635891 0x78bb20c4 0x71f950b2
+ 0x8b0d95cf 0x100241d7 0x19200510 0x57a07524
+ 0xc78fa596 0xae0952e6 0xceda63f6 0xa5957392
+ 0x72b6dbda 0x4c407c71 0x7bcb53ac 0xbf5536f4
+ 0xdd13d99f 0xdf096e1b 0x2a03e85c 0x145f4170
+ 0x7a826278 0xde53c72c 0x74ea07cf 0x0c1e956f
+ 0x98bbcd66 0x93d86c6d 0x6d2d4a51 0x09c96e1d
+ 0x88d7fae6 0x6e2cede2 0xc726e74f 0x964aa40b
+ 0xb8ef0785 0xd9bf9c5a 0xb8e9f8d2 0xa984653b
+ 0x9f33e37f 0x6031ca0c 0x479ffd41 0x31456b43
+ 0xc45c89c1 0x13dd9cab 0x653c4600 0x428daa03
+ 0x4b80961c 0x049c0b39 0x96f7f8dd 0x87c18aec
+ 0x95724423 0x5fea9835 0xb11f3437 0x6b9a69ed
+ 0xb9f0a440 0x1ae9f2e7 0x1d387b33 0x56cfc0a9
+ 0xd44983b6 0x4effaa80 0x0ec7ad1b 0x655fbffb
+ 0x06f6b8ca 0xcae05603 0x922bd43a 0xf4abd220
+ 0xfb9b6374 0x45d377a0 0xed58cabe 0x772cc460
+ 0x7ff5d59b 0x0ab67b08 0x1fc231b1 0xb04a0441
+ 0x4ea6735e 0x83ea71c2 0x91773202 0xe90c33c3
+ 0xa235b2af 0xa7d8afa4 0x18d523e2 0xa48b6acf
+ 0x56f62366 0xade89732 0xd5aa0f21 0x4b78914f
+ 0xb774fbc8 0x47e8458a 0xbc8c5b27 0xe79f809d
+ 0x37339143 0xfc5c2925 0x0a66dfc6 0x421a0c01
+ 0xc0a3b3aa 0x17b0dc02 0xb6b9302a 0x05d5544a
+ 0x50a3ca33 0xdbb31a0a 0x216c21dd 0x3e1eeeb9
+ 0xe031627a 0x17f60b7a 0x417e5944 0x79878636
+ 0x1566e37a 0x3c8aeb1d 0xcce8bfaf 0x85c1e11c
+ 0x2ded8d3e 0xb9f69ba8 0xd7b2509e 0xe320a03a
+ 0xa8da1ae2 0x0ce8a42e 0xf35334c3 0x0b16d14a
+ 0x0ec31ece 0x21d6fc90 0x357c6d53 0x0660c479
+ 0xd71b35d9 0x70b3dfc6 0xa04757cf 0xe7c480cf
+ 0xb5cefffb 0x815596aa 0xa4fe1233 0xd40b51f9
+ 0xcd65c934 0x9e410744 0x50943901 0xb9f64d34
+ 0x765892c4 0xc37dcf44 0x4ca52be5 0x4150fc1a
+ 0x6be637e4 0x09593fa3 0xf3c41aff 0xa2c5ab39
+ 0xb34d6c8b 0x4f5959cd 0x192f572d 0x465e28d7
+ 0xec9db016 0x4daf6f1c 0x8249efd4 0x54527d96
+ 0xf053854b 0xaea0ff5a 0x4811f2eb 0xb0cb3314
+ 0x015d9850 0x33f43296 0x9faa4a12 0x3c385258
+ 0xe11c11c3 0x1efd827d 0xe41ad89d 0x3bd99c18
+ 0xefb133e0 0x97727400 0x85c3e601 0x4ff46200
+ 0xa224b0da 0x640a9f69 0xefb53b38 0x78cc66ba
+ 0x24cf59a2 0xec0bea08 0x7e926b0e 0x2d921e46
+ 0xd8e2e2ca 0x4cd53cdf 0xb82d08ae 0xe78c1e4d
+ 0xca6734a5 0xe2e63cab 0xc5ba68fd 0xfa6cb0e5
+ 0xeec04de5 0x459c0ddf 0x4ec808d6 0xe039961b
+ 0x03696e0b 0x92c8caf5 0xa7e86d70 0x1f742b06
+ 0x1d5cbd78 0x92d5578e 0x2e51bdd0 0x23346eb0
+ 0xf05d39a6 0xc8fa8535 0x0384770a 0xce33dbcf
+ 0xb9044bd7 0x9afdb602 0x4f22c8bf 0x4fd59c18
+ 0xb04d1c2b 0x38b74c43 0x77a23a0c 0x579b9580
+ 0x4890fb00 0x58a2e345 0x22420ca1 0x82aef8f1
+ 0x4218f112 0xa0156339 0x44b5af22 0x96dafcb7
+ 0xfed244ce 0x0ec0d7a8 0xa52e86f9 0x694248ed
+ 0xd25870fe 0x34f93daa 0xe178d84a 0x70897ace
+ 0xdfec9960 0x061729b4 0x1941e2d4 0xe88eded6
+ 0x5657b452 0x5c98b677 0xf4f17162 0x996c3f42
+ 0x61e22ac5 0xbcc504c2 0x841ab74d 0x35630385
+ 0x0e5c2389 0xa77897fc 0xadd38e6f 0x03671090
+ 0x2a94d2cc 0xa866a8a8 0x381068a4 0x0d8f769c
+ 0x031cd3f4 0x43efbb62 0x65d26933 0x07c4c862
+ 0x08bfe63f 0x63cf80fb 0x2bc411ea 0x1e53cdbc
+ 0xccd46f61 0x7ae6f760 0x0a3794f2 0x7b8366b2
+ 0x8781320d 0x4d49b28a 0xfe700e14 0xac5c041a
+ 0x8a428c72 0xbeba1ba8 0x104ca0c9 0x2ecdd70c
+ 0x99f94dd2 0x8c9e8050 0x2cdc1187 0x8697667a
+ 0x39963209 0xbd6a1e9d 0xeb57f0d9 0x9c876cd1
+ 0xde6cc752 0xc5d81dd8 0xcb04f322 0x3675e023
+ 0x69f0ccaf 0xdc1c7299 0x66f6cc58 0x4af279a3
+ 0x2405daef 0x3cdc114a 0xf11c038b 0xed163d84
+ 0x8f915a3b 0x7a03313f 0x9abedf01 0xb828e02f
+ 0x05d2d07e 0x36799491 0x1fbb66ec 0x215f0d93
+ 0xa195c1f4 0xfd3cf434 0x4dd36fbf 0xfcbaeef5
+ 0x5fa49ada 0xcfef09b7 0x9ca1f00f 0x1094bca9
+ 0x2890356c 0x5535696f 0x3f786826 0xdfd166a6
+ 0x7cc2a7bb 0xeb9775f7 0xf1f1d015 0x6cb43330
+ 0x44f5103e 0x19cc238a 0xd802a783 0xa86d23b2
+ 0xfc6d5595 0x406b04f8 0x1f87e63d 0x7def0a8c
+ 0x66df4024 0x91291bd7 0xe7c9f664 0x3053efa6
+ 0x13ae9ef3 0x1ca9934c 0x635e98b0 0xd7c0e7e8
+ 0x951c1f5a 0x6a1f8310 0xe2e136b4 0x4fda9bf9
+ 0x3748e217 0x201a3128 0xa77450a7 0x68a164db
+ 0xbecaaa8b 0x39acdb6c 0xd72a8e99 0x358091fb
+ 0xcbd44198 0xf8abf8d2 0x460d979f 0x09779fed
+ 0xb066acb4 0xdd3b0b54 0xba6b34d1 0x9cd07e73
+ 0xded39eaf 0x4a86f91e 0xa1576746 0xef5535c6
+ 0x0d68d90d 0x9063b417 0x63764a13 0xe46589e8
+ 0x4c464469 0x01da5cd7 0xda3d955f 0xa9cb6bda
+ 0x74c5905a 0x022a3068 0x99785d4d 0x4aa81734
+ 0x65f0e347 0x38cae44a 0x41445dd6 0xa8d298e6
+ 0xe135a8c6 0x9e36cc39 0x450fd746 0xb4c9282e
+ 0x5f902e54 0x52047a0a 0x054dcd41 0xa7f54f76
+ 0x7e064c5d 0x1840b8dc 0xa42b3fc2 0x89959221
+ 0x3670527e 0x0033bf58 0x6d01b3e7 0x153a4523
+ 0xfdbede48 0xeb37591e 0xe9dcd198 0xe19b32b3
+ 0x0ce76cc6 0x07fd8a8b 0x7861aea7 0x0e6ef7cc
+ 0x295dcc81 0xeed43565 0x85e6b1b4 0x1c36176e
+ 0x4de5e5ea 0xad417cd3 0xa0b502d7 0x4f4f26ad
+ 0x55f0a11a 0x70414fff 0x578f513f 0x1a0036d4
+ 0x65cb54d0 0xdbe91469 0xb613a236 0x73c05182
+ 0x8da00dae 0xbc1c8526 0xff0ad02c 0x9289e4ef
+ 0x245d0636 0x162603db 0x0e5a40fa 0x0cfeefd3
+ 0xc355fae2 0xf2866c99 0xc65dfc8f 0xb7ab492f
+ 0xf811fcf6 0xceaef429 0x4ecdb0e5 0x54bf4e1c
+ 0x02c83d94 0x174cf22e 0x3c304b8d 0x9ad51572
+ 0x444ab420 0x7c41fcb7 0x70193210 0xdc59b8da
+ 0x9042a368 0x2c73167e 0x47dfb476 0xc07c86a0
+ 0x0341e3aa 0x8ee97f19 0x65a47f28 0xe9221e76
+ 0xac7ce5b2 0x5dc2293a 0x575436c1 0xb897b186
+ 0xb6722e1b 0x0cede865 0x641884f8 0x87784739
+ 0xb2cdbe39 0xf53210b5 0x819b5b5e 0x7e993c71
+ 0x088c20d9 0x1ff3c97a 0xe348600f 0xb9434df3
+ 0x4e2404ee 0x72ab1fb6 0x80922cc4 0x1239aa8b
+ 0x180c6d70 0x47f0e6c8 0x04c35fa4 0x861eee82
+ 0x4a5b0130 0xd29740e4 0x1200e288 0xd8aa1b4a
+ 0x45cf055b 0xf0970e66 0x7e82c921 0x038a1be7
+ 0x0f12a078 0x89ad1d6a 0x1c97ef2b 0xd3a3abb8
+ 0xd6026f4e 0x2b9e13d4 0x5d5611d7 0xb35b1222
+ 0x6a0715d6 0xe93cceea 0xbdc957a3 0x998dad9d
+ 0xecfec721 0x09f02421 0x4c971582 0xe4fc588d
+ 0x3a8f1c64 0xaeb5a6de 0x94bdd5e3 0xca0c1072
+ 0x352fd723 0x6257b138 0xfee44d09 0x9a3d6c87
+ 0x1031ae4d 0x6f2ebcac 0x97611fc4 0x37799303
+ 0x9566d4f0 0xf6a69a64 0xd089ecc2 0x06c7a3b0
+ >;
--- /dev/null
+/*
+ * ---
+ * This is a device tree fragment. Use #include to add these properties to a
+ * node.
+ *
+ * Date:
+ */
+
+compatible = "intel,microcode";
+intel,header-version = <1>;
+intel,update-revision = <0x363>;
+intel,date-code = <0x12182015>;
+intel,processor-signature = <0x406c3>;
+intel,checksum = <0x3ecdece5>;
+intel,loader-revision = <1>;
+intel,processor-flags = <0x1>;
+
+/* The first 48-bytes are the public header which repeats the above data */
+data = <
+ 0x01000000 0x63030000 0x15201812 0xc3060400
+ 0xe5eccd3e 0x01000000 0x01000000 0xd00b0100
+ 0x000c0100 0x00000000 0x00000000 0x00000000
+ 0x00000000 0xa1000000 0x01000200 0x63030000
+ 0x00000000 0x00000000 0x18121520 0xf1420000
+ 0x01000000 0xc3060400 0x00000000 0x00000000
+ 0x00000000 0x00000000 0x00000000 0x00000000
+ 0x00000000 0x00000000 0x00000000 0x00000000
+ 0x00000000 0x00000000 0x00000000 0x00000000
+ 0x6abbab24 0x789752cb 0x83003819 0x616df082
+ 0xf0952c2c 0x7fbf7fbe 0xe1ca9540 0x47bb7ec7
+ 0xef44e4c3 0xf91d4958 0x230883b7 0x7382ab6e
+ 0xf14324ef 0xf94c28d7 0x9131d196 0xebcf2faa
+ 0xc049cb37 0xd1577abd 0x5edbe45a 0x17e1ca1e
+ 0xbe9a92c3 0x1c8e1790 0xb3c08b8a 0xca799851
+ 0x3f2a8c92 0x1b7e15d8 0x1f44ecb2 0xaeda1838
+ 0x0ace8669 0xae9d497e 0x424c680c 0x21b3a3ed
+ 0xd924acfe 0xddc126a2 0x26363596 0x21cd999b
+ 0x193f9df3 0x037d1953 0xf97a3dc5 0x4c94ad7e
+ 0x98b360f0 0xeb90461f 0x438e6d2e 0x30851a0e
+ 0xfd623681 0x18782d3c 0x702938c5 0x462df0dd
+ 0xf7d67cc1 0x161076a0 0xf06e5db3 0xd861a76b
+ 0xa40b06bc 0xed37c69b 0x2b25f98b 0x2b67887d
+ 0xbf0131b5 0x571b7c25 0x34eb3752 0x992e406e
+ 0x031ba8e7 0xccfc5b1d 0x33f487e9 0xeccc3098
+ 0xe452737b 0xb38cc286 0x817bc58f 0x852a7fde
+ 0xcbcd1b19 0xab11894a 0xa1f278d7 0x360829c9
+ 0x11000000 0x34af9103 0xd674d0ce 0xa551e6a8
+ 0xa4ecdc9d 0x1cc02761 0x9c6e5450 0xa160c598
+ 0x52f99daf 0xec0347b8 0x3da61ab4 0xf567197c
+ 0xfd8bb83f 0xcc995bef 0x54d178b6 0x1671de11
+ 0xac092895 0x9debbed1 0x6c92142c 0x6323623d
+ 0x0eb91ca9 0x5c295220 0xfbaa9c0e 0x589cb9fc
+ 0xec23fbf8 0xa4a586a7 0x199f007f 0xdf3216db
+ 0xc0d57da5 0x5f4725e3 0x5726d9c9 0x17667c8d
+ 0xc1c79708 0x9e2256eb 0xfdd0d08f 0x60c7bed3
+ 0x5845511d 0xd7082ef8 0x3baa9a81 0x79e5bbdb
+ 0x5fa1d140 0x1a9dd574 0x65ab8603 0x3d09b760
+ 0x5d5370dd 0x20cbfc54 0x6bb53528 0xd0d59569
+ 0x3072c8e0 0x8d041e8a 0x393ff37c 0xa924e167
+ 0xdc321c2e 0x758ef7f9 0x75d45a77 0xa162493e
+ 0x541efc10 0x10adfa66 0x1ec98113 0x2adbfc4e
+ 0x6f72ee57 0xb6135602 0x6bb1aaa5 0x8b28671d
+ 0x52cd7438 0xe23e5714 0x541d71b8 0x1edeaecd
+ 0x66099798 0x273aafe2 0x94c4bcfa 0xd2a91918
+ 0xbfb900b7 0x7bffd9a6 0x98f3cc81 0x25418789
+ 0xe4827c24 0xf91a6587 0xa8f37dce 0xed2bb02a
+ 0x55e3d863 0xf75d0279 0x2d08e3a9 0x04447fc8
+ 0x5b8a7d2d 0x7feac814 0x49f424a3 0xf3875991
+ 0x7ba76639 0x15c5c756 0x351ce3b5 0x3f6c510c
+ 0x99f05511 0xbf82e8cc 0x3a08ff2e 0x27ce0320
+ 0x156823c8 0xea93277e 0xd4f644ee 0xed19db7c
+ 0x883aa3cc 0x477659d8 0x328f8021 0x5f5027be
+ 0xdc5dc6b0 0x7be0a222 0x3eeac5c3 0xd550feb0
+ 0xe536e7f1 0x286636de 0x853b327c 0x89c0fb10
+ 0xf3ca1f99 0xdfac434b 0x77629984 0xbf9089ab
+ 0x4c485305 0xeeb11fc0 0x287f76db 0x30930095
+ 0x6903c661 0x2b8cdcc7 0xdde71952 0xe608b18c
+ 0x92c949a1 0x8aad2b8f 0x65862768 0x9cee8ac0
+ 0x823d78c3 0x847136fe 0xd9310ed3 0xb8b42493
+ 0x29ace469 0x42888461 0xded8e619 0xdf05ba83
+ 0xbdff529b 0x200b50aa 0xa68969a3 0x852839f8
+ 0xe990c70b 0x4646940c 0x97d3cc15 0xfbc684fd
+ 0x670dc5bb 0x9221de80 0x4c8e6b5f 0x0d8e97a0
+ 0xad70fce0 0xeae31c56 0x285bf809 0xe8875db3
+ 0x90b80642 0xd3823067 0xcc83a749 0xf9ca429a
+ 0x67422236 0x1391a167 0x0bf82b36 0xc9765751
+ 0xe716e34a 0xe0a8a4f3 0x98c3a88c 0xc6e2f8a4
+ 0x7fac67f1 0x1dc95999 0x506bbfcd 0xca368479
+ 0xb40279c4 0x55bcf309 0xa33edb78 0x82136a30
+ 0x5b12a8f7 0x760c01d3 0x5db7a4db 0x74f5bbf7
+ 0x88d8cf63 0xbc44938d 0x3b8aa64c 0xa619841b
+ 0x938ef7b6 0x4e62db80 0xec29b936 0x12c88360
+ 0xd13fd368 0x049fedc3 0x980d670c 0x751d7334
+ 0xe275082c 0xa856923e 0xcf718388 0x91c05a55
+ 0x1feea2d0 0x973e9ef4 0xfdb50bdb 0xc9f0d356
+ 0x1fb535f4 0xac8935e1 0x54ca8daa 0x5236b3f6
+ 0x96077418 0x7cd145ee 0x4c3eac4c 0x96708111
+ 0x2d0d2818 0xdf8d4d8c 0x1e0dc74d 0x55563148
+ 0x8ded787c 0x8b23817c 0x2791cb6b 0xfe592eeb
+ 0xc291504a 0x594803f6 0x5cb40c93 0x0fb42830
+ 0xdc805110 0xa04177c6 0x5b196cff 0xa8389595
+ 0xc22006a4 0x48f63bed 0x956fe2ab 0x8326bac5
+ 0xf607d430 0x4db75e7c 0x5abe98f3 0x1ce11559
+ 0x9a6bf85a 0x38332b5f 0xd5d89037 0xc68921c6
+ 0xa0076717 0x7a8825e0 0xeca2298b 0x78202f5f
+ 0xe9fb2a84 0x0a190fbb 0xacd7c21a 0x7c1b5df8
+ 0x8bec1b4c 0x269507e6 0x8890150a 0xaba688e7
+ 0x3bfe89e6 0xa2b9f1c1 0xe073b921 0x8886f1ec
+ 0x8e70e13e 0x32a1a95e 0xaf7eb731 0x76ef3515
+ 0x4e90039d 0x8e469581 0x076c7437 0x136549ac
+ 0x357e3610 0x63a28516 0x19d505b8 0x43c971a6
+ 0x0472035b 0x756164f2 0xbe6062a4 0xa1c37b2d
+ 0xb07d2cf8 0x8476f6b6 0xc715da8d 0xb2afed44
+ 0x249f6d7c 0xb5d69bab 0xcebfac4a 0x79dbe92b
+ 0x27885a7a 0x36e23920 0x22974454 0xdb75e82a
+ 0x9ed157a9 0x66b7f446 0x8dd61b49 0x1ec542a6
+ 0x2f1602c7 0xfef7c1f0 0xf0e03fd1 0x7c5d27ba
+ 0x1aab9e49 0x320c70a0 0x8428e51f 0x6518c994
+ 0x4b1dd367 0x43e7759e 0x2e3a273b 0x02e96af6
+ 0x7d7fd596 0x76fb392f 0x01e0575a 0x34c3c159
+ 0x58ad09c1 0xff429aa9 0x542c728e 0x960c1be4
+ 0xd993a44d 0xbe66f3b0 0x097dffa0 0x63ffa221
+ 0x4e9d0eeb 0x059ac1e7 0xc8a98f69 0xba154f66
+ 0x4c32444b 0x16c6b875 0x90ece67b 0xac649e61
+ 0x9e8f0cf7 0x428e6df3 0xc9ceb8ef 0xa66bab0f
+ 0xd499148e 0xbc453d7b 0x10064f2b 0x839a2b6d
+ 0x8cf150bf 0xef4ff034 0x5f760dad 0x3ca17566
+ 0xc469b66b 0x59389505 0xe731e5ef 0x436cf37c
+ 0x07430a9d 0x4ec457cc 0xbb9b3569 0x39e66440
+ 0x51508550 0x14e9282f 0x9019d229 0x4f1f91a8
+ 0x52ed0975 0xb0f8c69e 0xc95dd930 0x58613f85
+ 0xef94c1bb 0x4763c396 0x0271e452 0x199cf8f5
+ 0xb5459017 0xd30a46f7 0x4a882adb 0xd81c67fe
+ 0x560d3066 0x1c54e221 0xcff36db6 0x10ba2ad6
+ 0x2a2f3b5c 0xb49815be 0x23d8e3a1 0x199ace76
+ 0x14cabe0d 0xdcdb74ec 0x7ba0ee4e 0xcd8ade16
+ 0x6fff6e9b 0xe7ebf779 0x3cd0d4bd 0x1d5988ba
+ 0x41a869e6 0x938f3f7c 0x1c32d1cb 0x32cd7d32
+ 0xd5f6c5b5 0x18f6ce02 0x355e6a02 0x1ce3fe19
+ 0xef2db61e 0x53569367 0x2143daf2 0x9ff48c31
+ 0xa8f2ae31 0xb942b0c5 0x5322e9fd 0x5c86f025
+ 0x4564eb04 0xbf84637f 0x72649b68 0xbcfa9479
+ 0x92160cd7 0x6a82f2ed 0x56e95854 0x8de8854e
+ 0x3a6f9ae7 0xc600810a 0x3b916a72 0xc7757b0b
+ 0x5c509f76 0x671a3e65 0x557be597 0xbfa43c40
+ 0x75ad1bd1 0xef6e4e5e 0xc925131b 0x0b23f0df
+ 0x8872d439 0xe7c68436 0x66948273 0x52c5820e
+ 0x8bcdd308 0x5961f832 0x8b9e05b3 0x1877dc15
+ 0x677c923f 0x9275f82c 0xb63ab226 0x2ebed52f
+ 0x709be956 0x029efa11 0x181b9d17 0x85b196bd
+ 0xd0ef2b24 0xdb40ed0f 0x64cd9131 0x6d4591ce
+ 0x39b07cad 0x5d93a4fa 0xc72ab75f 0x411c103c
+ 0x0e543f47 0x82326a56 0x97e74672 0x8ff175c5
+ 0xa4af4aa4 0x7d486409 0x3c4f0022 0x8c340a17
+ 0xbb78a4de 0xcd8347d6 0x3b413b09 0xc5ea0d4f
+ 0xc04924fe 0x775b3449 0x5177508d 0x7837f058
+ 0xad7585b2 0x04de4c25 0x62045a0d 0x795cdf60
+ 0x20895612 0x927248ac 0xdec3682b 0x5f624760
+ 0xd1eb3249 0x3c258434 0x5471ce68 0x63dfc40a
+ 0x972e356c 0x248921e6 0x2c6c68d3 0xc7934632
+ 0x21b3e041 0xe261b970 0x872c8f48 0xbc83ee9b
+ 0x7fc5365e 0xbf811695 0x7421fbf8 0x351251fe
+ 0x2fa69f93 0x1b0e076e 0x844620b6 0x34ae0b82
+ 0xb4397ce5 0xc8c334c2 0x3b83e4a3 0x9400ac98
+ 0x77ef3b8d 0x9e99a943 0xc9dea3e9 0xc79bcc15
+ 0x97adb857 0xcf3628a5 0x5fb9dcd8 0x1fb48b0d
+ 0x912814a2 0xd90cc6c5 0x8d41c708 0x31f3f996
+ 0xd3cdc511 0x3548427b 0xb61e440d 0xa37184ed
+ 0x4046b193 0xd4fa3e6c 0x49be92e7 0xffc4d769
+ 0x2a612567 0xc0e47c24 0xb4cd56dc 0x642e0d3c
+ 0x28f29fcc 0xade72ab6 0xb2b4e692 0x45f1d977
+ 0xf6cb5893 0xd5de01db 0x8e12fe1d 0xda7387d8
+ 0xe7ffe1a8 0x0b2dcacf 0x303d217e 0x755c391e
+ 0x182f0fad 0x5c3b4c52 0x005ea5af 0xce544cd8
+ 0x85a42ec0 0x5d7efb0d 0xb902ae0e 0x25dc0faf
+ 0x31f94bdd 0x4a3ea693 0xa3715564 0x356f9547
+ 0x10f6c847 0x306c053b 0x12a2b255 0xd12abc31
+ 0x692c4e07 0x26e8fe46 0x893e5fb7 0xd592abdb
+ 0x48135ecc 0x1c433483 0x83e52581 0xa984e767
+ 0xa65b1461 0x0d32513c 0x0932221d 0x0fcfb020
+ 0x20bbdc83 0x2fbad27c 0x9eb4a08b 0x947301a3
+ 0x7776ddac 0x04e8ac11 0x40e42a9d 0xaf74d77d
+ 0xc9e1e938 0x7af6c1d4 0xc8dc1650 0x24ad902f
+ 0xe009278f 0x905d5de6 0x638d3a74 0x937d4685
+ 0xaf0e95d4 0xcf1d2012 0xf9c608a0 0x6fce7bb9
+ 0x8b421310 0x23efaa4c 0xa52bdf67 0x1898d46c
+ 0x8f3834de 0xba7c2fb4 0xfe84eabd 0x0e66e78e
+ 0x1c636cef 0x8c9c5d30 0x665e1ae3 0x5eb5888f
+ 0xa832e9a9 0x8e9c37e9 0xcfb38ace 0x93ee97fb
+ 0x1c191d98 0x276c4d6e 0xd18ab928 0xf86a8dd9
+ 0xf975c062 0x8cc952c0 0x69c5f436 0xcd50d9d6
+ 0x916dd94e 0xfe6645cf 0xb7dacd07 0xb1bbc45d
+ 0x564b887d 0x587b5323 0xc0706aa2 0x14a7dcfa
+ 0xad918e14 0x27edb562 0x71467cc6 0x544931c6
+ 0xa003a9d3 0x9d5bc429 0x891c3a2e 0xa838c8ca
+ 0xf2e664da 0xd6e6fccf 0xa4a65c77 0x845eaac8
+ 0x5f15eac0 0xa0c6f671 0x6a506930 0xcc44355e
+ 0xe379041c 0xee2434b6 0xcd186246 0xf7ca9b32
+ 0x6150775c 0x6b8b53dc 0xc1c929fa 0x73747210
+ 0xa96bbd50 0x5e3fbb16 0xb10042d8 0xe0214515
+ 0x572302b6 0xd501abb8 0x39250387 0x95dee388
+ 0x50c64c16 0x799e94bc 0x323bde9e 0x0148ecc4
+ 0x8fa3aca3 0xbbab92ef 0xeaaa2864 0x59fc47d6
+ 0xe9973a97 0xeff10530 0x2ee64dca 0x26549b06
+ 0x0c8c2e08 0xae8e5415 0x3c40bbf0 0x89c50b81
+ 0xb4fcfba9 0xb9c4c555 0xf2968416 0x7091257b
+ 0xc70896ef 0xb3086b29 0x5b224365 0x516c78cc
+ 0xc36c7b04 0xeae540ec 0x7b50490b 0x1c0681ba
+ 0xdbdb6bc1 0x1892d735 0xc55d1f7d 0x43a13e09
+ 0x64fb4fc7 0x63d9f7be 0xd94a1264 0x7c29c0c2
+ 0xbc80d0e5 0xcc0f8ba9 0xd9ffcbe2 0xe6cbbfd7
+ 0xa393ea13 0x9c1d2cb8 0xf6b30c8d 0x774ab520
+ 0x902f1f82 0x591e8fcb 0x54a49a0f 0xea92775f
+ 0x32db070d 0x46871147 0x71db3643 0x46ec5752
+ 0x60b676d7 0x000e6315 0xda2f8ed1 0xa02774f8
+ 0x5b10b0c9 0x745201fa 0x64cdb756 0xdbac8197
+ 0x8ccda850 0x03376e2a 0x30b1bd37 0x40879940
+ 0x0a94a9fd 0x45f5a94d 0xd291c228 0x63e8dce6
+ 0xc0e92d5d 0x94f4af95 0xa6493cb2 0xaf6796d1
+ 0x1b92305d 0x90cb1f96 0x52b6a25d 0x60adaaa6
+ 0xc39b1758 0x90365599 0x1fd8ba91 0x9d8142d3
+ 0x35de6e66 0x8c3c97c2 0xe080a68a 0x0c1212a4
+ 0x432e0909 0x4617fbc2 0x8c64a51c 0x83cadb95
+ 0x61e751bc 0x5a1f6e50 0xc18bf429 0x44796e3c
+ 0x9196cb25 0xaa458f0d 0x17a892e2 0x0fa38b9a
+ 0x27d433ad 0xbf81824c 0xc554ecde 0x3e0e0ec5
+ 0x3d0507fa 0x8e01868b 0xe9890628 0x95462999
+ 0x78d3c488 0x7c11e37e 0x744f486e 0x382b91a4
+ 0x92b5aaa4 0xe5ced181 0x538c6405 0xef665333
+ 0x0f2c9006 0x817b1d64 0x8ed18582 0x4762ebed
+ 0x793e8754 0x7ffc1370 0x83e97a2f 0x0097efbb
+ 0x3af550b8 0xe8b5d326 0x1328badc 0x1b876137
+ 0x87d0a5f9 0xa886af93 0x84d82661 0xd59c25a7
+ 0x9436457a 0x33657675 0xc2e84838 0xb69dfb0f
+ 0x7cd5f62b 0x4aefc230 0x55dfae89 0x09303273
+ 0x99df1289 0x91a8a253 0x308c3493 0x82ffc531
+ 0xbe46de4a 0x95018289 0xb3f1484a 0xfab68007
+ 0xda22a10f 0x52dc5477 0xc6c0cd11 0xd7432402
+ 0x66b3b9b9 0x2d9e453c 0x61b9f88f 0x7c0eb965
+ 0xcfea53f6 0x2128bef3 0xc70cd033 0x0b64e589
+ 0x83b6c8fe 0x90f7f205 0x746ad9a9 0x60dc76f9
+ 0x8853da22 0x77af258d 0x392bbcc6 0x4bbcee30
+ 0x5109f557 0x6a54ad0e 0x8f88d2a7 0x26b23261
+ 0xaacf9560 0x8fee9392 0x2305214d 0x700c4bc7
+ 0x5e6fa646 0x81c09c02 0x124edc15 0x0952d2c5
+ 0xac95aaa1 0xc942e831 0x59def5cd 0xf973bca3
+ 0x8804722d 0x35b6502c 0xee05d2d2 0x47df0499
+ 0xe9bb746e 0x3fa99f04 0x9b727ba2 0xeca8c402
+ 0xe17495bb 0xbacf5681 0x37b9aac6 0x210490db
+ 0x733b0296 0x946bb6c4 0x7dbf7cba 0x0faed4ab
+ 0xfdf0bdfd 0x376c755a 0x7b81d000 0x4dbd9803
+ 0xe86dec4f 0x69144ec7 0xb8fb18ef 0xc23f8e5d
+ 0xf4dcb6a3 0x32e22545 0x2404ad5b 0x6682c8e0
+ 0x65a6ca16 0x2ca8667a 0x1b54a478 0x7cc57603
+ 0xe3f94a87 0xc96d24c4 0x3aeaaa11 0x23ba93fe
+ 0x25855840 0x32ac7211 0xec0eed00 0x1d53723f
+ 0xb27942fe 0x8ec00760 0x97116503 0x68b22ca5
+ 0x36752cd5 0x61abc066 0x8fff56de 0x287f4a5a
+ 0x19f88345 0x712a09d3 0xec3be550 0xd08bd04d
+ 0x45e1d15a 0xde83aecf 0x0331b023 0x91b0075a
+ 0x70d39c38 0xbcf8b4ce 0x3365c4eb 0x71cf887a
+ 0x5c42404c 0x56953eaf 0xf804db60 0xf2d9770b
+ 0xed5b877a 0xa8ebc885 0x8dd2b361 0xa3f228b8
+ 0x3ce6b3c4 0x404dec04 0x32db0836 0x80805f40
+ 0xee0a6b4d 0xecb6a91a 0x65583189 0xd3fe005f
+ 0xff19d475 0xe030314e 0x852f4c46 0x340007ba
+ 0x95500a80 0x63761dd5 0x1751389f 0x7f611d78
+ 0xfab36f54 0x5f071822 0x43c70000 0xf1813b21
+ 0x7ed03c5b 0x6105ae85 0x8e1d08ff 0xbd4c223c
+ 0x43c39836 0x50172b88 0xa1b58d41 0x37f631e2
+ 0xbf956f52 0x77c8f43d 0xab796206 0x59e9e046
+ 0xcc7ada10 0x8a1c4541 0x08b733b8 0x0c8c7616
+ 0x90071b59 0x34a6e0c4 0x4625f3b6 0xb992ce0c
+ 0x8da6fb2c 0x5b659d0e 0x92428703 0xccf200ed
+ 0x3dddcdad 0xce4f2c52 0xf9f9679c 0xa3fc82f7
+ 0x06202e00 0x25f9de55 0xf0594e68 0x1cd670b5
+ 0x845386f1 0x10bdf789 0xe3ee4a05 0x1efda32c
+ 0x2a76a8fb 0xd0e71447 0xe77a41af 0x119b8c5c
+ 0x14dc63f4 0xe5e9d8ae 0xe8cec247 0x9029858b
+ 0xc0870608 0x1615fc71 0x05563b71 0x9cb09413
+ 0xb4ec6ff6 0x51d020c6 0x30d8bb6c 0x438b91aa
+ 0x38c35cc7 0x32b2e77f 0xf8b82f0f 0x41a186ab
+ 0xb9f51625 0x87384508 0xe269eb2b 0xf6fac07a
+ 0x4f81200c 0xa7534357 0x65fcc7b7 0xe4d7e5ff
+ 0xc8b32713 0xd1c2d99b 0xdcf6bbbf 0x9e037d0f
+ 0x39b70e51 0xdf43026f 0x347b7c12 0xc8e78974
+ 0xf486ff91 0x1bfd469a 0xaa1354b5 0x487339ea
+ 0x84ca7228 0x4955fd60 0xb57a9c21 0x84e74c78
+ 0xcfcea592 0xa8ddaa1f 0x6c00eb77 0x45bd61e3
+ 0xc629ef4e 0xcb46eec4 0x39c106fe 0xe3c17770
+ 0x13a0d721 0xd4e634e6 0xdb6809f3 0xc598c116
+ 0xf85738df 0x342ee0e4 0xe6161d83 0xe3691d5a
+ 0x37944585 0x1a9805e3 0x0680d08e 0x70e92def
+ 0x0cbe04cd 0xd962c766 0xd78ddd24 0x0e6e1994
+ 0x858139f0 0xea68a33b 0xae28354c 0x207ac2fb
+ 0x923d1a1e 0x2450832b 0x51f38454 0xc1fa8519
+ 0x8d0ed6c9 0x6e65d931 0x1ba4b87b 0x951d0bff
+ 0xbe90b5bd 0x0c110d64 0xd3f1276d 0x471d6f38
+ 0x3bb356e3 0x308139ff 0x92968f30 0x553d37e2
+ 0x60bc26af 0x8f72e058 0xf9d248fa 0x499d4f06
+ 0x106be129 0xd82dfa04 0x076fb7ba 0xe00575f9
+ 0x7876dc60 0x72b2a280 0x4953f9ed 0xcf8cf94c
+ 0xb216d447 0xdd8d68e3 0xf4eba871 0xf0623e64
+ 0xf358ecea 0xf22a1276 0x45f7341f 0xc1291cc8
+ 0xfabf1d5e 0x6cc3988c 0x3d30aa87 0xbaef31e5
+ 0x607603d1 0x87ec3e92 0xdf44a6da 0x4b97b845
+ 0xf011ca64 0x7597e4a7 0x950abddf 0x57793aff
+ 0x2572736b 0x2a85c40e 0x7b7f1d71 0xa288c516
+ 0x85be78cf 0xa3cc2834 0xe8eaab52 0x46b92d89
+ 0xe28ec2b1 0x0986bb79 0x0ac43504 0x340b3751
+ 0x7d07fb3b 0x23df6bc8 0xc696b021 0xa8901b33
+ 0x8f63e0ed 0x8402c0f5 0x31e1ba34 0x2b6f92fe
+ 0x863fef70 0x6aca166f 0x73c01ba0 0xb1a0465c
+ 0xf5ed2a7f 0x276014bf 0x09aeefaa 0xf4a04698
+ 0x7c72df4d 0xe6743589 0x39398783 0x6266778a
+ 0xc7bcb0ba 0xa83bcee7 0xb38fd684 0x9d49dfd0
+ 0xd0503d7e 0xa3f36b94 0x014f4481 0x60628909
+ 0x9c954bde 0x588f5938 0xf956dfa4 0x9a39b849
+ 0xdf6d3559 0x4b52c1c5 0xbbeb551f 0xba33f1e8
+ 0xb788be1e 0xb690bdcd 0xb9437592 0x020a4b65
+ 0xa26c8ab7 0xfda34a43 0x8365278d 0x5a13951d
+ 0xcdcf9e4e 0xe9362211 0xbff63b3a 0x7563ebfe
+ 0x16de12c3 0xffac1a2e 0x394dddf2 0x37239c14
+ 0xfebbf610 0xc8f5e49b 0xcc38813f 0x87bd1f2e
+ 0x9e32e4bf 0x39b20865 0x5b02b19b 0x401fbafe
+ 0x0a3cd931 0x3a76015e 0x3d7c7751 0x7f3f45c2
+ 0xad34d39a 0x9eed5a5d 0x495ab92e 0xec72bdc8
+ 0xa1659ec6 0x0d0e82db 0xcceeb7ff 0xc3a04c63
+ 0x09b44e30 0x8c68f5d9 0x78a1dfe7 0x8ae29967
+ 0x7a6009e7 0x7d7a57b0 0xb606debc 0x36db9de1
+ 0x91b23ab3 0x9bbbbb97 0x1c7a5812 0x053b493f
+ 0x21fb49e4 0x0e0c1170 0xc7519471 0x6ce8e6bc
+ 0xdbfcc87e 0x902ec5da 0x5ed1890e 0x67ad2554
+ 0x2b1c1e1c 0x535ae4ec 0xac637c43 0x1a601fed
+ 0xfef207e2 0x46ff3ba1 0x88e9e0a2 0x64d2dd97
+ 0x778e24c0 0x6052a550 0x95ed76f0 0xb3454d17
+ 0x01ee92aa 0xffefab6a 0xc3d8559b 0x0dba8de7
+ 0x068bedaf 0xfaef15e4 0x6234ae34 0x73ec4bf5
+ 0x43adf339 0x4b0f8de7 0xe764d584 0xe0760a24
+ 0xb3eb0c68 0x75b3f9b2 0xf024df28 0xda645aac
+ 0x0a6bc56e 0xb7260018 0xe615875a 0xa13a327d
+ 0x6eb423af 0xb033289c 0x1b738592 0x143e03a5
+ 0x14d84813 0x39fb3f9c 0x97563669 0x4bb8b9b5
+ 0x5d122b9f 0xf43aa655 0xcbf6bd89 0x513cd153
+ 0x5a720ac6 0x28edaf40 0xc6962633 0x09116fa1
+ 0x23b1dbaf 0x4ab7b1ce 0xe057f269 0x9245662b
+ 0x48f8ddfd 0xecc6a53b 0x1a02ac4a 0x3ec2ff1e
+ 0x498e52c1 0x97687f25 0xd8f37547 0x515b39ac
+ 0x6cc1b15a 0x65522e34 0x5fd144de 0x2571633d
+ 0x9d9da5d5 0x965a114f 0x40c991cf 0x8058ddf1
+ 0x84f473dc 0x51ae6d25 0xde9f9b35 0xa3e3c16e
+ 0x666156e1 0x829e6c3e 0xa5a38205 0x3592bc43
+ 0x52d75b00 0xa047e2ea 0x7e0bd672 0x7342aabc
+ 0x5f5059ca 0x9382e589 0x062931ba 0x0e0fbd2c
+ 0xd5223860 0xc940e45a 0x869f1a78 0xdfa5eeda
+ 0xd127bdcb 0x63940885 0x3274b29f 0xfcb77bb9
+ 0xa49feb47 0x8cbf77a4 0xbb5f6177 0xa1942c88
+ 0x89658f9f 0x400579e7 0x159b799f 0xa0b21b4e
+ 0x1906d38f 0xda44cef9 0x26b222c0 0x5218c63e
+ 0xb807726a 0x56227902 0xaa0e2b56 0xf9c690a4
+ 0x045a60d7 0xaead7431 0xdf43a28b 0x72aed6cf
+ 0x336aceaf 0x265ad71f 0x1f3e7c99 0x7e6030f3
+ 0x6d6648d8 0xb4926841 0xc7e0b902 0x7ce4540e
+ 0x70b972ef 0x17e40022 0x675e851a 0x42180d66
+ 0xe45dcb6c 0x54a4491d 0x72f7671f 0xef45a9d3
+ 0xeb9f8137 0x802f2db6 0x3ede9405 0x4b86c1e2
+ 0x9372d02f 0xfd63fec6 0x35020008 0x52114900
+ 0x7a1ad13f 0x2402f735 0xb1f6b7c7 0xd6d5b632
+ 0x154a9438 0x3e364d80 0x72f916e6 0xbfd36cad
+ 0x8714a353 0x4cd98007 0x319db6e4 0x9ba24eab
+ 0x65a72eb8 0xf575feb1 0x040c685c 0x5eb50e7c
+ 0x1e41c876 0xc93dcc6d 0xc5291538 0x59815560
+ 0x94d306ef 0xc9d44f42 0xe7415aec 0xc35479b5
+ 0x92e467c8 0x9782185d 0xc09fbcf2 0x8403181a
+ 0xa1b58b43 0xcc02ca17 0x634bf9ec 0x20882faf
+ 0xcfe6569c 0x5bb61be5 0x8de00bcf 0xd0abbb26
+ 0x9b239fb7 0x6491d6c8 0x1f86ff77 0x52d842a2
+ 0x769a9eb9 0xa9d7140a 0xf44acf53 0x8f679b77
+ 0xda12ab14 0x45849bd4 0xd4b8fedb 0x41d2f20e
+ 0x5119dfeb 0x0ab7ac95 0x85bb4fcc 0x8d5cd1bf
+ 0x09d78592 0x5d632ed2 0xb7a17164 0x0d86ae85
+ 0xb9ad5cfd 0x6de7be63 0xf5fe6344 0xf657f761
+ 0x38ccc981 0xf4050114 0xc5c65e8b 0xc8437cbe
+ 0xd61d858a 0x713f2780 0x66a26ca6 0xc2ba846e
+ 0xb9c0363b 0xca90c529 0xd97bdb85 0xebd51c51
+ 0xd25f339d 0x72a565df 0x3da5a9fc 0x6d8c4d1e
+ 0xbb0f9788 0x64c88ee2 0xdc4fab6f 0x739aac40
+ 0xb6cec86e 0xd3f1aab0 0x64cdfa8e 0xcfc2fd83
+ 0x3ff62c87 0xdcc78eaf 0xec1b3f33 0x14dd4c2d
+ 0x9669b3fa 0x205aa2e3 0x188ab67f 0x0383e315
+ 0x7ebae462 0xaf454af4 0x7f958e2c 0xc87727b4
+ 0x2451100e 0x6c0869e0 0xe9372939 0xd903f020
+ 0xd6db9b5d 0xea0aec89 0xcb9ee968 0x55e6daf8
+ 0x8e0c5fef 0xe0f285fb 0x3de5fd91 0x2737dc03
+ 0xa5123db6 0x5e1281b0 0x1494bed2 0x7d5e981e
+ 0xcd14b88a 0x70b3ef5e 0xdc22e10e 0x2d73bc09
+ 0x1720e7e7 0xa48ed5c6 0xc229e058 0xf2d51b6c
+ 0xe71c26eb 0x6903b9b4 0x42ee13cb 0xa4b8841f
+ 0x10bfaad4 0x3b41f550 0x45802cb9 0x9e9267a6
+ 0x23db6591 0xe5537ac9 0x9762de9d 0xd7da6111
+ 0x43d83e0b 0x6953ab95 0x8676fad4 0xa54d6833
+ 0xfbf56f8c 0xcbf1d10a 0xa0acef92 0x0e6a0856
+ 0xc78ba1eb 0xb4866d64 0x79ea0af9 0xe5ccbe52
+ 0x1d5441b2 0xffbedd4a 0x1a86b3e0 0x8ec6db6f
+ 0x0ce230c9 0xe2d6c885 0x36d28fc1 0xe4ed575b
+ 0x36aa0795 0x809c85a8 0x3d1e8a24 0x275871b3
+ 0xa83143d4 0x4d0b8458 0x486621c2 0x3f3715ec
+ 0x5539614e 0xcec52cee 0x2b1535bf 0x77242e14
+ 0xedd93846 0x33217bda 0xab6f9a65 0x4c861cb6
+ 0xc9813f7f 0xda359ebe 0xa2f24cf2 0x6f733200
+ 0xcbf36590 0x7af00123 0x408b3c8b 0x1ff8bf2a
+ 0x8d990131 0x464287e5 0x2c4007a2 0x5a25ac0b
+ 0x8f17ec59 0x3b3292f1 0x1aac8dd3 0xd3e7bd12
+ 0x36a71bf6 0xbf17a12e 0xea40b62b 0x60368c5c
+ 0x0e999db3 0x6f5231f7 0x7d8e89b2 0x0f514e1e
+ 0x50cf103c 0x0639c099 0xb1dd19a7 0xa2998698
+ 0x3267ab50 0xfe09a5a8 0x6eda6c63 0x1e0dbd6b
+ 0xbc83c163 0xecfc0b8b 0x07c4ecf4 0x207096e2
+ 0x89ef2adf 0x30363e99 0xadf28af4 0x22dacfe2
+ 0xb1e0a489 0x62bbb325 0x493930ea 0xf1ffee5a
+ 0xa57777d0 0x44c9ad84 0x02e8c23e 0xab4819aa
+ 0x02afa569 0xbb1b40d0 0x8d471322 0x253f299b
+ 0x99263b6d 0x408e631e 0x0a307e49 0x80eab591
+ 0xcfd02a10 0xe0f2fee0 0x627851c2 0x74c0f9ca
+ 0x4b0b5736 0xfa6c461b 0x52477f06 0x1921c6ec
+ 0x47538b96 0x87216ab5 0x68daa276 0xc201e54e
+ 0x6a0ffcb0 0x6c38f828 0x267d3508 0xf1c7a93d
+ 0x99988b01 0x43ef71fd 0x56659310 0x66cebb0b
+ 0xfb59ef57 0xb11445c2 0x8cdbefc6 0x89927126
+ 0xcc246095 0xea6c0e77 0x6fa82a03 0x40b81e9d
+ 0x44ce6618 0x2f683915 0x7234f37c 0x04f06fae
+ 0xe3f58d38 0xc5e44f9b 0x9faa5509 0xa3251387
+ 0xd2bacd98 0xcc01a7ed 0xcd75beed 0x0543feeb
+ 0x8a733b71 0xcc4b4ff0 0x9a328688 0x0e00ae47
+ 0xd4c3291d 0x123d394d 0xe8aededc 0x67905689
+ 0xcc88cd05 0x3dc25d0d 0xfcbe2d01 0xc25cb130
+ 0x77668e7f 0x1a76e00c 0x2913ccad 0x623371fc
+ 0x46786b97 0xe2c24f6d 0xa6f28a6d 0x311dacf3
+ 0x5a0f5312 0xd0a19821 0x7415811d 0x4aad5d43
+ 0xb69b186d 0x9296aad7 0xc8627e27 0xe1b2c304
+ 0x138b78f2 0xa5cc26ce 0xde5c3b06 0x6a30d0c7
+ 0xf4c74a52 0x61cdb6b1 0xe30a5cfd 0xb32aa583
+ 0xba26805f 0x77e33257 0xbf08b9b8 0x09829ccc
+ 0x248b0942 0xa6ddf03b 0x62bc5d95 0x9493b6f8
+ 0xdd952082 0x1d33c2da 0xa788160a 0x8b39d3ba
+ 0xdfe00bcc 0x2fd60d5e 0x1363968f 0x9f859918
+ 0x71eb38a5 0x5f0519f4 0xd8f6227c 0xfe496054
+ 0xb5fce544 0x8e6f6ff5 0xed51f072 0xa95500a5
+ 0x952b9803 0x52deadb6 0x927e1eac 0x2f93f3a1
+ 0x12e3978a 0x31b458ff 0xeae4aad2 0x8d257c5c
+ 0x1b5c24b8 0x482fa692 0x7d8260a7 0x3297e1bd
+ 0x1aa499be 0x58fa7e01 0x3f22da1a 0x41707c77
+ 0xb474c077 0xd3ee8670 0x6eeafb6f 0xe97f6353
+ 0x12c43638 0xdd846a87 0xa5ad486d 0x5b10e299
+ 0x11d1fe2b 0x410f5e33 0x33a1f43c 0xa728a8dd
+ 0x4197784a 0x46db1576 0xd170a6ad 0x1bb97415
+ 0xbaaf2e8b 0x46c4f1b6 0x563260ed 0xf121ce91
+ 0x0f02eda8 0x4b9c4db1 0xd15b1fd9 0x28a9c018
+ 0x48f3a184 0x64d54afd 0x0d619290 0x45488d7b
+ 0xc9ba9f92 0x5dc66623 0x4ffb5ab9 0xedd36a35
+ 0x3464bbc1 0xe16e5a72 0x88f092e7 0x865a393e
+ 0x4155f5fd 0x6693bfb9 0xc11be46b 0xbfb59ec6
+ 0x0ddd5033 0x9a2bb34e 0x4b09421b 0x8f3363cd
+ 0xd3bf4f74 0x6126f624 0x8649f98b 0x8631b39c
+ 0x5d9b705a 0x6c7508fd 0x6598a753 0xed03e0f5
+ 0x265586fa 0x47e2a475 0x22df5b1f 0xfd697213
+ 0xf8343c28 0xfee82a3f 0xbd52e7fb 0x3c55ae1d
+ 0xaa7e3726 0x9e113891 0xad1178e3 0x7c79b062
+ 0xa6182e3e 0xab5cbad3 0xfafc5b49 0xab4004f0
+ 0xfe9e29b4 0x2ececfb2 0xac222317 0x7eb04c5b
+ 0x0bb3d6b5 0xe65e6be1 0xb6f4776b 0x854d0f09
+ 0xf373c8ab 0x1686e6d3 0x4b0c5b13 0x96a5af0e
+ 0xd19f784a 0xf4084e77 0x0baaf70a 0x885251fa
+ 0x3211962a 0x648092a8 0x9b9cb4ba 0x15dd84a2
+ 0x210f3225 0x90e32ede 0x08fe39a1 0xc3f77b81
+ 0xa66164a4 0xade3cc77 0xcf101d91 0xcf32381e
+ 0xf7947fc5 0xd2069d22 0x3400bff5 0xb2d092a5
+ 0x17f1d109 0x2df9e6e1 0x9ecb56ac 0xbda05f04
+ 0xe4f87413 0x2cb25b92 0x3830daf5 0x4855e79a
+ 0x2616db3d 0xaf2e7354 0x6e4e1965 0x0bcca840
+ 0x6df2d311 0xa685a6c4 0xbf1d9d04 0x0c45f1fa
+ 0xfefa97a2 0x56acf5b3 0xdf253591 0x9840f77d
+ 0xd939872f 0xc21a4032 0x61d3f315 0xd0f3872b
+ 0x21d79975 0xe71f07af 0xfdb46980 0x1e0f2472
+ 0x84dca328 0xccc1f96a 0x68b8ce74 0x666d9f20
+ 0x0cd78628 0xdea393b2 0xe79cf948 0xd9a30305
+ 0xa6f6e661 0xfac3a529 0x43867c2b 0x3b51873f
+ 0xf83332a9 0x8083120f 0xb0c8310e 0xb2aae08c
+ 0x1aaa878a 0x755bf6e7 0x046b6877 0x6d87925a
+ 0x2e170b79 0x1239578a 0x6195eab2 0xe3f66cea
+ 0x766fab12 0x45da58e7 0x7f4569df 0x0888ea36
+ 0x8bf6feaf 0xad9cc5c0 0x21bd9bc5 0x9ea4aea1
+ 0xf85aa451 0x825a4e79 0x8cd4e36d 0x5150b082
+ 0x4bb0fb31 0x0dde5a88 0x973592d1 0x14eb8fe1
+ 0x75174bfd 0x74847459 0xce7b6c3b 0x94c33d40
+ 0xd8690898 0xf2b0b665 0x918cb951 0xc6ca50fe
+ 0x2b99e7f3 0x1a346961 0x8fe21508 0x04fcf521
+ 0xa9538384 0xe47fb4c2 0xd2ab26ae 0xe641ce82
+ 0xd534070d 0xe156d957 0x9e98e20b 0x87e261e1
+ 0x1bf87d39 0xbae63c29 0x51dc5625 0x99fa08df
+ 0x29a87254 0x3ceb0e63 0x52960cb5 0xa2b429e2
+ 0x7bd0cb97 0xbfece039 0x43ea635e 0xd879205a
+ 0xea8557b0 0x8af0b125 0x21bece00 0x265b663b
+ 0xb97bacfc 0x012a7dbf 0xf79bcf53 0x3855e394
+ 0x8e095c6d 0x11842e8c 0x91c4e8d3 0x496f6dc1
+ 0x67e8be94 0xeda3085b 0x0dcc7e57 0x31f1bc9f
+ 0xf945ba14 0x67012d13 0x2a927c55 0x6ad89f60
+ 0xaf6d62fa 0xd2b538dd 0x22961c16 0xe7c469c7
+ 0x3e814b2a 0x975e033f 0x8e11e47b 0x76aa7f86
+ 0xbd28d9af 0x2f52bd9a 0x04f14a37 0x03c10ea5
+ 0xd109a0f1 0xeaac7a38 0x182b8b7a 0x63df0f9c
+ 0xb4437ae0 0x00277618 0x92a9653c 0xc761c1b4
+ 0x4b8d723b 0x0de967b3 0x8418132d 0x8766fddc
+ 0x2176c33a 0x6d46b1f5 0xcef94f44 0x06499ec4
+ 0x41de9284 0x40b846d0 0x609737fd 0xae574bed
+ 0x7f48ddbf 0x7037a488 0x0930579e 0x70b86289
+ 0x72c960d9 0xcf307642 0x333b4536 0x3208af9a
+ 0xff7bdb38 0xa834082e 0x6f5586fd 0x1e033254
+ 0xfec00a53 0xd4bc3747 0xea7689ea 0xce66a07c
+ 0xb88dbbd5 0x8b3632f9 0x85081be5 0xe0984f27
+ 0x39b71d03 0xf5cddb75 0xd32cca39 0x7a450b08
+ 0x52379b99 0x5ba9e7b2 0xba19bb5f 0x138a1cc0
+ 0xf64b0ccb 0x6fd1d6ee 0x81637094 0x25066f8a
+ 0x8d7b1af2 0xabf72360 0x1cd5f0f9 0x2c2787e1
+ 0x73eaf8d4 0x3d8875fc 0xce76c829 0x40959f26
+ 0x8bf720f9 0xbf270ee2 0x0aa2bdad 0xf425fe98
+ 0x7a3dbae0 0xae734299 0xfaecb714 0xe205e383
+ 0x3c162cbb 0xb54f19e5 0x82f7ba9e 0x86527878
+ 0xcebda01f 0xd86ced7a 0xcae432f9 0x4b07cfa4
+ 0x81ec3e6b 0xec1aeb5a 0x4b2330ea 0x6fde9ffe
+ 0x33aae610 0x7d371b76 0xecbcc9e0 0x0f8bbe77
+ 0x139c11ff 0x53ae1dfb 0xa1053b22 0xa6d12006
+ 0xceb6a898 0x049abc80 0x6db27bc1 0x8d4df3eb
+ 0xd8f8a2c6 0x611d976d 0x8c4eae6f 0x7100a396
+ 0xc5c1a942 0x8442bed7 0x26dbc801 0x93fb6838
+ 0x367c1af1 0x769f9df3 0x1701917f 0x7d858d20
+ 0xe79a4a6c 0x2313a971 0xc2621a21 0xc461a40a
+ 0xc6b632df 0x4e2f0dfb 0x973564be 0x971f499f
+ 0xc86f6402 0xe2e82d0c 0x2e70e676 0x25fbeb1c
+ 0x05342bd9 0xbbc68474 0x02398a0a 0xe14ffeff
+ 0xb0fbb75d 0xf72d7aaf 0xf5e93e34 0x02df0dd3
+ 0xf336390e 0x10718585 0x66d48328 0xa94d8885
+ 0x376c9cdd 0xaedcd73a 0xb7983c7d 0x9a4941a3
+ 0x3a1f5677 0xd831409e 0x847c7ddb 0xcce1a9cd
+ 0x91da6966 0x41dd20ba 0x14f45c08 0x3ad73dcd
+ 0x566987ba 0x0ffb5606 0xfa307a12 0xcbaa12aa
+ 0xe77c1800 0xcaf6803d 0x8d14a697 0x5fcaf843
+ 0xf64337e7 0x923221b9 0xf3fd2ae0 0xc07434bc
+ 0x55374784 0x94e00513 0x0a75c488 0xe3d21454
+ 0x4d778a55 0x4aec547e 0x3afb918c 0x21b7db37
+ 0xfc771fb2 0x041f4889 0x14d2d362 0xbcc9d9f6
+ 0x5bd50edf 0x753ed319 0x5b8abcf3 0xb875a346
+ 0xce7669f4 0x348957a2 0x9684ae1c 0xbc19e9b3
+ 0x8790be92 0xc6cc9763 0x3c082777 0x617f4ca5
+ 0x6fa609a1 0x9405e535 0x41094a74 0xeb925ff2
+ 0x0f4f8e24 0xee2a20e4 0x381da058 0x9fe70438
+ 0x7f1161e7 0xdb54d051 0x190b1779 0x21466eda
+ 0x3b6c810e 0x0e0b8114 0xb497c673 0x4f644bfb
+ 0x19a46e35 0x4a4eeab4 0x4b976b6d 0xa087157a
+ 0x6d1e6349 0xc78eb29d 0x165225db 0xe666f808
+ 0xc5d8f270 0x8267633f 0xba1265a3 0x4be87190
+ 0xf8c520fb 0x9370a515 0x4bf66dac 0x950d23fb
+ 0xfd63a000 0x44100c9f 0x04c60526 0x4c06cd8c
+ 0x0677dfab 0x59bedc3d 0x94dc14ed 0xc0771551
+ 0x4456060f 0xba490544 0x62fd88ac 0x5f5c9628
+ 0xe1d30606 0xdb74bffa 0x875d1eb8 0xf08c15f5
+ 0x09d59196 0x74411971 0x522cac21 0xc4f8e753
+ 0x882bcec6 0x686491cd 0x9a6d2132 0xcc82e038
+ 0x379115c6 0x2b398972 0xc80ef665 0x8fef530a
+ 0xd77eeff3 0xeb5b3d42 0xbbdea33f 0xf7cbc015
+ 0xf4dfce22 0xa06f23cf 0x07006697 0xf556def9
+ 0x5b53668e 0x871ce2ff 0x640b7be5 0x21e3a27f
+ 0x50bbeff1 0x12c5b662 0x3493f835 0xc2379e8a
+ 0xf455167e 0xb0b7052e 0x0d8392cf 0xcbd6e6ce
+ 0xa6d47313 0xd543a23c 0x5fd4b1cc 0xf41165e0
+ 0x29c74588 0x4b1a4e76 0xa710a86a 0x32fd6f8c
+ 0xd6f18e0c 0x7a33704f 0xfffa38d7 0x65e3524b
+ 0x6eb533d0 0x680e3b72 0xa6a5278e 0x1334fbeb
+ 0x4b37a445 0xc75cbb1d 0xa3414ca6 0x826ced4e
+ 0x44c2dfbd 0x486dd171 0xac300a00 0x5a0e7367
+ 0xe2db128b 0x2b9eb0b7 0x2a7c6c40 0x1a22daf2
+ 0xee429275 0xc1d37a9e 0xb6bb1b69 0x98642f28
+ 0x169a17ad 0x80c499e1 0xe8228188 0x74b9d65b
+ 0x378fd8b9 0xf608cfe1 0x8299d0dd 0x1e4c4f02
+ 0xdc45635e 0xd94a3b44 0x40671628 0x378e2949
+ 0xdaf573f7 0x73c29e3b 0x3bfdad1a 0xca154ac2
+ 0x999ef0fb 0xd7d19f58 0x7a4ddb26 0x613f2678
+ 0xfea80fb5 0x6a85d7ed 0x9aa90f39 0xc8bf26ca
+ 0xc325cce7 0x89328ef7 0x59a19dea 0x453b40b5
+ 0x16d3f3d9 0x41215f42 0xce8d0110 0x83b79c31
+ 0xfecfa5e6 0x9da5153e 0x0d505941 0x9f3582bc
+ 0xd71f5c26 0x74f3e604 0xc9fe57d8 0x14394881
+ 0x82cc16f8 0x3f656a38 0x5cde1d58 0xeb3505bd
+ 0x27ed1c07 0x7de82a2d 0xa20b44a2 0x4bfbffe4
+ 0xf306e134 0x3d8900f2 0x401b307f 0x90d666ef
+ 0x2524fcfe 0x4e5deb9b 0xe53d0a84 0x873f8c55
+ 0x32e7203b 0xc221ee56 0x1a2b8b2a 0xce64dfae
+ 0xa367000c 0xe32b29da 0xc35fc2e9 0xc5d223a8
+ 0x765d240e 0xb12e76c5 0x8652b6f6 0x8a5622f2
+ 0xe069cdff 0xd7a29ae8 0x8e6b1c5d 0x3df93d30
+ 0x5e19ed46 0x3f41779b 0xe7578355 0xbeba23d8
+ 0xbf74fff2 0x93c39591 0x453990bf 0x0fe4c433
+ 0x693bfe7f 0x6265fe37 0xd046f718 0xe7034449
+ 0xf7084ee0 0x29ff71af 0x3397c1e4 0x3f0627a6
+ 0xedffdb2a 0xa7f3b3a0 0x8917f4d7 0x2376ca2f
+ 0x91028844 0xfecdca85 0x19879720 0x2e3a92d3
+ 0x93839b26 0xbcdcf470 0xb9d25259 0xb85a15ad
+ 0xf9ff7edb 0x46d4e283 0xe0239cc4 0x76c51481
+ 0xd7e83208 0x6d6660c2 0xf8889044 0x5501d81c
+ 0x0369307a 0x5aa53905 0xb728237f 0x06124625
+ 0xeda46bb8 0x0e418323 0x487636a8 0xe153e0d7
+ 0xa91106ca 0x24d8bef8 0x89d4d734 0xff8af7d8
+ 0x6611efc6 0x70fc6dcc 0xb406b914 0x7c37ea68
+ 0x4b0453d9 0xc4ec6bc0 0x6a25b97d 0x8ee010dd
+ 0x1dccc74f 0x15341da9 0x62708075 0x9168d676
+ 0x0f7ef6aa 0xdeff3a44 0xb54a28ed 0x1d2d0aed
+ 0x28cddc63 0x9ab141fe 0xeed7550c 0x933f3834
+ 0xac5e9e28 0x1ef0068d 0xec789605 0x303d24de
+ 0xdcfebf7a 0x3642e133 0x076756ff 0xa76f1a4f
+ 0x5cb3458b 0x3c87d40f 0xbe5e5339 0x53607f72
+ 0xd4f628c8 0x053afd01 0x2e5f55a9 0x32a6f765
+ 0x91168ba3 0x3bca077d 0x056250ec 0x29074f83
+ 0x1c65eeb8 0xcae51635 0x41980e14 0xf6032fc0
+ 0x62f5475b 0x546b384d 0xe33f4fb5 0xe95a0bc9
+ 0x6be2cce3 0x78ba9a41 0x9341244e 0x568580ab
+ 0xdfcca0fd 0xca3cbb24 0x1fa3a05f 0x9d62ace0
+ 0x61697465 0x9819c572 0xcd26dce6 0x9761b0dd
+ 0x05fdea68 0x8a8068e1 0xa8a5dd29 0xa3855d2d
+ 0x18f83355 0x3ddf22c2 0x57bbec09 0x4e6c9d19
+ 0xdd11d921 0xab279dcf 0x21fba151 0xd1992b47
+ 0xc9ac75d8 0x6bb91d86 0xb7684d46 0xe1c1e196
+ 0x9b02d10a 0x7034338d 0xc3e4a66d 0xd714ad9d
+ 0x53a38f0f 0x82577d3a 0xbe396553 0x80c01189
+ 0x65e59020 0x3f5e139e 0x5b474bd2 0x8fa77f3c
+ 0x5b8ba009 0xfb31f5db 0x3a3750b9 0x2ea7b5e9
+ 0x70967373 0x12af64ad 0xa88933e7 0x266e913b
+ 0xb9b5ac81 0xba7eb48d 0x5f538d3a 0xcef65fc4
+ 0xb87596c7 0x1841d61e 0xaddbfe29 0x357b84ac
+ 0x0285ece7 0xfc4029ee 0x20f68f16 0x0570df7a
+ 0x01d5fac7 0xd27d456f 0x921ee30b 0x7f3e1080
+ 0xad13face 0x69890c00 0x3c11a1d9 0x14314c2f
+ 0x47ec8d26 0xa64ac87a 0x9b375047 0xf1da938f
+ 0x9e525923 0x83340489 0x2db83950 0x0d0df33b
+ 0x2457985e 0xb5ac76ee 0x0b5d5892 0xcecd03a8
+ 0x1146ca0d 0x54c28037 0x8fb9a6a7 0x1f626a66
+ 0xdf0b6569 0x6d4bd562 0x1703d847 0x42f38af5
+ 0x40c5f6bc 0x3806c13a 0xa52175a0 0xfd2f4814
+ 0xa1a87143 0x5a3df656 0x12c937bd 0xe1108f2b
+ 0xbd2af1cb 0xde4b3129 0x680cd797 0xd2d56d49
+ 0x8a06d1de 0xb629e1de 0x73539c32 0x25b956be
+ 0x817d8963 0x6d997e12 0x9d26c5dd 0xe0a1174b
+ 0xa4233f86 0x9e1694a3 0x4fc8067b 0xbd1e7860
+ 0x98af3007 0x65029e65 0x9658fb2c 0x7474ea1c
+ 0x61883b2b 0xc0d95154 0x9a4fc748 0xcf9b6c01
+ 0xde96d302 0x19f1ef0a 0x0dfac53e 0xb8bd5069
+ 0xd596a1a3 0xb57273bd 0x39642eca 0xc252601c
+ 0xfad293e3 0x9e8a64e8 0x55187031 0xfd13aeeb
+ 0x940f07a6 0x818dab99 0xb9482ee7 0xf396a9d1
+ 0x19eb94d5 0x72064a70 0xaa9c3266 0x814a7dec
+ 0x3e138363 0x6e348287 0x8f70398a 0x8363ea0b
+ 0x7737edcc 0xe08adede 0x87efe04e 0xb5e792a2
+ 0x66311793 0x86a663e6 0xcd0bc4ec 0x81617887
+ 0x8c93d56f 0xd0eef3fe 0x7c9a9c0b 0x37985c27
+ 0x131db40f 0x2226f0fe 0x4829b9b9 0x24f9f28d
+ 0x687ddc5b 0xe02e3d91 0xb9a50924 0xd1faf2f8
+ 0xaedcdfc4 0x15d9de80 0x73974337 0xb3a8f3f4
+ 0x2787eadf 0x164f12fc 0x093b2cf1 0x274f0718
+ 0x7f98d839 0x92a12eb8 0x553db255 0x645fd979
+ 0x7c37aa09 0xc70f7ebd 0xe1f39374 0x7ec2ba46
+ 0x46e871fc 0xe3e15703 0x12324d6b 0xbf8625b1
+ 0x1be2baa1 0x7f6ede5f 0xad6011b3 0xa2fe7edb
+ 0x3d2ce3a2 0xbef298da 0x7ae87965 0x3ce8f403
+ 0xfc0a9fc4 0xcd70601f 0x87ce5750 0x97ce7f79
+ 0x1e832ab4 0xa2e82726 0xf8e7efd7 0xe40154ec
+ 0x4f2b50f5 0x60012916 0x84b94bf1 0x34244ca5
+ 0xb0a5a186 0xe1deb138 0xada43194 0x678ca2c4
+ 0x121d9204 0x93676935 0x6499f72a 0x84d07869
+ 0xf1bc1b7d 0xb89bdc40 0x69f37106 0x2863c0a6
+ 0x00e15275 0x7d640b71 0xeb5193b3 0x87a20844
+ 0x09c03e15 0x9646f0c8 0xe23a0644 0xa468c1a1
+ 0x916a42c3 0x23b15ede 0x39e40968 0x117a2262
+ 0xac044026 0x32585734 0x774db481 0x436c93ba
+ 0x02a88471 0x83808b1c 0x1b2b216b 0xcfd03aad
+ 0xe5448453 0xa0cc7d64 0xbedf4877 0xc7c3a2e9
+ 0x76d8aab4 0xf7ff3890 0x97b62db8 0xe84cc1eb
+ 0x55d64ada 0x9dba0059 0x2f473a5c 0x1e34bfeb
+ 0xf0cc6002 0xee0e7062 0x9442a9fb 0x88b12c79
+ 0x46fb7118 0xa15d7181 0xb30f5ce3 0x3e17a5ea
+ 0xa15ee2ca 0x45aadae0 0xae610e36 0x71f26322
+ 0x3fc3e51c 0xc714957f 0x2c7b54a2 0x23aa0fdd
+ 0x942fae8d 0x0e8fee54 0xee846617 0x73305ad8
+ 0x39d3d521 0x36224232 0x2b73f92e 0x27e962f9
+ 0xd8193d48 0x2e0187bf 0x6d461b15 0x4b5207d0
+ 0x8308ffaf 0xe1d7adaf 0x1a076838 0x0c795196
+ 0xdccf9dca 0xb5e09b6c 0xd5522d96 0x532263ce
+ 0x0fdd41fb 0x2216fbad 0x89a4e893 0x870930ef
+ 0x1356e0fd 0x9c65a038 0xfa6e1d6a 0xdd0d8d0e
+ 0x3dc5fc13 0x5014cafc 0xc82b0070 0x9f099b5f
+ 0x7a39d54d 0x439b563b 0x9cb03122 0x0cfc9e04
+ 0x7c017cd7 0x03f725d4 0x4d51f12d 0xc2fb3abd
+ 0x9859c799 0xdefcdd82 0x5d9a9477 0xdd372929
+ 0x8df7d5e7 0xdda4f6d6 0xa29031e3 0xe957cd15
+ 0x4997f6d1 0xa24230d6 0xf920f6ec 0x392e930a
+ 0x4bd3c02f 0x5a3fa5d3 0xde4fc5a0 0x145a7a72
+ 0x578c39d3 0xac5fed2e 0xbcbe3739 0x75135d4b
+ 0xcf7f58af 0x9971dd3f 0x2ed4365d 0xa38a79fc
+ 0x74e3e1ab 0xc6bc1825 0x618896c0 0x0d517d78
+ 0x3a87c682 0x1e08260d 0x8f45cf39 0x9ec155ed
+ 0x134aa7b0 0xd6cabfc3 0x3cad6ac1 0x3e4e0de9
+ 0xd2c0cd91 0x44845ec2 0x814f443c 0x9e1c4db9
+ 0x4616ef30 0xca3c78bd 0xa211ee1f 0x08178d31
+ 0x3a2ad599 0xeea97244 0x3648329d 0xe92f887f
+ 0xd410f135 0xf617be72 0xf744f3ee 0x9c490092
+ 0xe9d63d11 0xd5e07b97 0x4567fe12 0x7f9144e8
+ 0xf2b8ce45 0x8e013339 0x7cecead2 0xdff53155
+ 0x7a2ff59f 0xf02eaebe 0xfab33d15 0x5eb4bf88
+ 0x28a72b4d 0x63fff963 0xabaa1c52 0x6177a027
+ 0x9c14b8b0 0x335557c8 0x2b33180e 0xb613732d
+ 0xbe08b72b 0xb197c710 0xd42c2c3c 0xe4ec967f
+ 0xf8c1e10c 0x907483a3 0x57a9ff5a 0xe9ae9d13
+ 0x1e0e42af 0x9c82cb11 0xde19b06f 0xe7379b1d
+ 0x93ead83a 0xde52a625 0x763fd504 0x526816c8
+ 0xd317a1e1 0x80158090 0x280d1508 0x24d45c2e
+ 0x1bea6c69 0xa52fa27b 0x59322181 0xc1633372
+ 0x8c8a03ad 0xdda781e7 0x67d994f6 0x1fe753ff
+ 0x02e07f9d 0x3bbacfd2 0x448b2282 0xfcc0f1d4
+ 0x579dc5ab 0x8166a776 0xb35ea37c 0x729add2d
+ 0x17442ebf 0x46949807 0x3d863a9c 0xe83b9c92
+ 0x9e9b6078 0x1323c135 0x0630bb03 0xc3adad8b
+ 0x062fef3d 0x00256ee2 0xec5aca51 0x80d772da
+ 0x81caf683 0x0bd30f14 0x90bc3205 0xb6f69582
+ 0xe77536de 0x531ebe48 0x1ac226b4 0x10384a9b
+ 0xb4b8148d 0x6fd5d330 0x88ee3876 0x92056102
+ 0xbdd947af 0x9a7ad0cd 0x02312b78 0x93d9ce9f
+ 0xfa703409 0xcf61b3f3 0x19b1c925 0xa7fff41f
+ 0xf7d24b53 0x58565238 0x7b9318ee 0x0d4dbf70
+ 0xefce22aa 0x8dda1627 0xda1c2d5e 0x5c30e824
+ 0x9974a148 0x80f18dc7 0xe5aedeef 0x7754225f
+ 0xcfe917de 0x8c52d64f 0x391f00c6 0xc2beecf5
+ 0x7a78794e 0xf947b05e 0xaf33f3ae 0xbf97fcce
+ 0x9565380a 0x6e35c159 0x47008d6e 0xa643d183
+ 0x51bf5509 0xb9f530bf 0x2b7626ae 0x7f99d145
+ 0x4a9b7027 0x72e4c211 0x908f5921 0x33b6d752
+ 0xa338ccd8 0x42516085 0x342285e0 0x7421a747
+ 0xf3946993 0x96bafa36 0xd2f47ff0 0x466d760d
+ 0x0de58397 0x9a60732a 0x51da69dc 0x5e75833e
+ 0x06bfbe37 0xee1b0b16 0x1fa9e22a 0x1471ac29
+ 0x91c17bd9 0x61019572 0xda534447 0x5c8bacc1
+ 0x2f21d658 0x88dfbbfb 0x4513522e 0x48e757c0
+ 0xf01afc25 0xd2f2e9f6 0xb26d6dc0 0xed7228b6
+ 0x0c14e015 0x166667f4 0x93b72285 0xc15004ba
+ 0x583a442e 0x1a32a22e 0xe68d3f1b 0x98428797
+ 0xf6642555 0xe31b2450 0x408bc05c 0x6414a0ec
+ 0xe240c794 0x8e5f2799 0x82433391 0xd6ac689f
+ 0xdf4da142 0xd4b138c8 0x38d48ccc 0xfe8de2a2
+ 0x1e006414 0x93b20007 0x4a8364a8 0x157eb018
+ 0xa2f9f92f 0x615fef5a 0x87b855ed 0x759eb5e4
+ 0x39abe477 0xd7a3ebcb 0x2e80ccf7 0x94dcf71d
+ 0xee4abe26 0x20585e99 0x654b270a 0x1cd75ca0
+ 0xc67ea827 0xc5fbe73c 0x61dfa344 0xc4484973
+ 0x3af93dfe 0xfee9add4 0xf4ee580d 0xb89c9012
+ 0x4c40846d 0xf36214f8 0x3f3a51d7 0x26c06a31
+ 0x43a86900 0x46a43d66 0xae1c5e8e 0x944153b5
+ 0xb484539f 0xed2ade58 0x7be6ef52 0x224ab290
+ 0xbaa44cbf 0x1de20200 0x3909df18 0x003e0d4b
+ 0x09f04a8b 0x5c00be4b 0xc95caadd 0xa3cec080
+ 0x732baefe 0xbf6ea34f 0x80232801 0xdd600fd4
+ 0x1b33bfb0 0xe7fef75d 0x9b6fff5d 0x7cedaab4
+ 0x158ffc0c 0xd8437113 0x8cc693d4 0x31358783
+ 0x4242f7a7 0xca4004f6 0x212c48ed 0x54c1cd26
+ 0xc15b9401 0x47a58cb8 0xb7d3b18e 0x269363e7
+ 0x47bb4e32 0xe522fbf1 0x537da9db 0x9c7fa5a4
+ 0xc5d61a7e 0x2baa4230 0x6bb65617 0x3a2197a4
+ 0x57eaba91 0xd28da650 0x58e52bf1 0x2496e235
+ 0x9d6e8b60 0x2a027aba 0x566e7d1f 0xa036dc49
+ 0x83f8c580 0xdf4e378e 0x04ada75a 0x4d0dab78
+ 0x0d8bbc02 0x86d2ff63 0xdd27ee32 0x0ae082ae
+ 0x15343e58 0x8eb50be6 0x83b77044 0x3b521fe9
+ 0xeb61da85 0xd507cae1 0xcf000a6b 0x6fc9726e
+ 0x0a62b7cb 0xdcdd7c52 0xcf5508fe 0x91ef5bf9
+ 0x4f44740c 0x4ea45d80 0x9a76c0b0 0x6d103972
+ 0xd869146a 0xa5142a9c 0x0341497e 0x8643a451
+ 0x34ae7a68 0x5abe7e76 0x1054c9ef 0xbbc48bd6
+ 0x7cdce445 0x55717c41 0x0f85655e 0xd6d0c389
+ 0xd0e4ea04 0x8e6738c0 0x0aa9d964 0xbd0714fe
+ 0x83a80b5c 0x0584b1f4 0x8f15a37e 0x7e7c9032
+ 0x298b2db6 0xc9c3d8e2 0xcd7bc65b 0x75fcac55
+ 0x1a43278c 0x399666c4 0x624dd366 0x2a0288a1
+ 0x7b84f00e 0x6721d3fa 0x155bddc9 0xa5832bf5
+ 0xf73d2bce 0x29b9523e 0x4c1cd6a1 0x5e8d8b89
+ 0x701c5e9d 0xb57001f7 0x0a84f98a 0xe30922e8
+ 0x58026df9 0x5d4107be 0x237dab8a 0xbcb893e2
+ 0x93931352 0x592aab19 0x95b5bc39 0x0ec276e5
+ 0x3c609401 0x922036a2 0xadb4cfcf 0xe6521586
+ 0xe1640a6c 0x24bf8313 0x4ba05eeb 0x56ef987a
+ 0x33b9f215 0xb65797a9 0x1536019b 0x723536a0
+ 0x25a6b487 0x2db59f88 0x7746718e 0x0cbf4fe8
+ 0xe632ceca 0x3039f430 0xdcf6fb51 0x573d18cf
+ 0xb4cf7b89 0xea361eef 0x85f75a46 0xb77f2f71
+ 0x55d2d1a3 0xe8e4d3e9 0x17932aee 0x3e42d407
+ 0x807fead7 0x27c406c0 0xbf6cbdf9 0xf13b9496
+ 0x20fbfdb1 0xa4b6e59f 0x1bb32d9f 0x758dd09c
+ 0x27d79394 0xa1c38206 0xc9ffa516 0x8f143420
+ 0xa7a954a2 0x15e24879 0x4157d333 0xdd08fe8c
+ 0x7f8f4c7c 0xd9929f79 0xf08c56ae 0xa89ccc7a
+ 0xa4512c38 0x4ca4810b 0x1c61701a 0xf3c85c94
+ 0xbf07823b 0xf757db8c 0x28e3dc21 0x249065ff
+ 0x5a64d769 0x8d6281c7 0x2d058499 0xd8730aab
+ 0x808506c8 0x720c3a2d 0x817dff34 0x0de91ab2
+ 0x7d93c64a 0x8849feee 0x471f53a0 0x07aa5a0e
+ 0x5f8a8da1 0xda8888f3 0xf2e18c3e 0x57abfbde
+ 0xcbd09b52 0x587b1a74 0x643d5a15 0x7395720e
+ 0xb2189014 0x37b43781 0xa1841e74 0xcbf7f9b2
+ 0x9d9304d0 0x1dbf98c5 0xde999d02 0xdc1753a9
+ 0x69160a3b 0xaf3519d4 0x0c866572 0x5130921b
+ 0x5c6881de 0xbc1bd626 0xe2b955f1 0x69948d87
+ 0x054b2369 0x20f9ffdf 0x480b0fe9 0x756ffee9
+ 0xc0771524 0x7e6aabc8 0xf7500779 0xf13ea1ea
+ 0xb67c8e04 0x29366e64 0x841a3277 0xb7eed14e
+ 0x0589cf6e 0xcf893298 0xfff9adff 0xb70798ff
+ 0x062db27d 0x5f6a647c 0x083bfc45 0x3e18c09c
+ 0x36febc70 0xe36a0092 0x7d493db6 0xdaf466de
+ 0x979f8206 0x1cdebec4 0x3cd78f6c 0x4fb52a20
+ 0x874bfd02 0xf59240a0 0xa95ac48b 0xcd89c378
+ 0x298099c8 0x52ab614d 0x48278ee4 0x8f16c49b
+ 0xe9a16134 0xc36db612 0x51d2d2e4 0xdbfa3c70
+ 0xbcb42a2f 0xc16f2b27 0x4246c14b 0xdcb73b13
+ 0x1d1dc6a4 0x002e5926 0x6708e93d 0xfc3aba78
+ 0x90f75cc7 0xcf937c0c 0x9cba6d7c 0x6d3fb343
+ 0x0674f7bb 0xf9b34e66 0x93be5de0 0x78ba46c1
+ 0xb194b20a 0x0fef85b4 0x1d3ffd61 0x7badb331
+ 0xfda07586 0x6731dc9e 0x675da1ed 0x0ba561a1
+ 0xc0425299 0x1e4baad7 0xe3d32df7 0xc8b37cd9
+ 0x0c4c44ba 0xd5da35ce 0x68cbeea2 0x3e387b81
+ 0xd4ef03df 0x3e3a3bfc 0x1ad8316a 0xb6e40b8e
+ 0x0ca7e866 0x6a6cd5c8 0x97665bb7 0xae5952ab
+ 0x5cb5e9fd 0x27c81a79 0x3f75d956 0x701fc9d7
+ 0x093378b8 0x5985d0d9 0xa9935020 0xde7b61de
+ 0x3d9dc834 0x54a5095d 0x9fd6f41a 0xe4d9c24a
+ 0x51b1b8b6 0xffc2ff47 0xe6685ed7 0xa5fd8248
+ 0x9e18046f 0x289e9a2e 0x09f657bd 0x482cacb2
+ 0x4dc32fd0 0xf9b458a0 0x23027c36 0xad32d113
+ 0xc5036fb1 0x6b2a8e3a 0x3eb74ccf 0x77b4c572
+ 0xecc8d2f8 0x92f44900 0x90048b89 0x9cce0583
+ 0x6dcdfe85 0xca040af3 0x61df87cc 0x5beddace
+ 0x11877f8f 0x512943dd 0x21e2bf44 0xb7517252
+ 0xc9785d37 0x5d2b9a4e 0x13e202db 0xcd3a137f
+ 0x0293505f 0x41ec9a3c 0xeed2b586 0x183b40bb
+ 0x14c48ee7 0xc2876c20 0xcd7dec3c 0xa459edf6
+ 0xdd67d9a6 0xf706894b 0xd9818e07 0x8a461cf5
+ 0x15adfd23 0x7cb4cd17 0x39aa1f7a 0x4df5d26a
+ 0x840f184a 0x9686d301 0x31d29c9f 0xa7180296
+ 0x965002c6 0x3e9544a5 0x1206f370 0x75c18c0e
+ 0x57912849 0x053fa29b 0xffd30572 0x2e6fbd99
+ 0x17eb3a5f 0xe18c6318 0x2d07ca7b 0xafbd5771
+ 0x58fb3970 0xdbf048ed 0x718e0239 0xdcc0b959
+ 0x22273bd4 0x1f8f1eba 0x62fa54f1 0xe056c81e
+ 0xe3a51e11 0x5dc1fc3d 0xa8e39e23 0xce488068
+ 0xed91ea12 0xcd3ccd6f 0x7046dca6 0x337a781e
+ 0x688269ef 0xa4668369 0xbd83be39 0x347ba242
+ 0x19d996b9 0xdd0fea66 0x23f9b272 0x6a16d880
+ 0x728089a6 0x5e5bdd31 0xed31e22c 0xceb72578
+ 0x79ea1871 0xf0b3c9ce 0xdb305b7b 0xb54bf9a3
+ 0xcfa7f7f3 0x40e28548 0xb803bf79 0xff547750
+ 0x2fa6362c 0x9b1d1389 0x09b7495a 0x13cb10ea
+ 0x9ad42dbe 0x37aef678 0x12530cda 0xeae3e2e0
+ 0x65925024 0xc6de6ce8 0x1ffd7394 0xfb0f2364
+ 0xdc169b6c 0xb76fc725 0xc6c3a74e 0x78d79ee5
+ 0x730a3ef8 0xd7a0ec86 0x42d7a185 0x66428e6b
+ 0x1094381c 0x845e1941 0xc4b1a33a 0xf0925496
+ 0x1ed09d84 0x1ecff42e 0x1e3387d4 0x37d647f5
+ 0x5936e0c4 0xdb4f3ef0 0xd38b44f3 0xd5149695
+ 0x06047449 0x837b50c1 0x421328f9 0x1bd9ded5
+ 0xd784284a 0x0f5d63aa 0xb326ce4b 0x3fecef33
+ 0x75122695 0x6f30c185 0xa29f84d1 0x39f76a0b
+ 0x9443b53c 0xdc90f13b 0x70047cfb 0x67f6c4f1
+ 0x1ed2d922 0xce38688f 0x3f141c9d 0x0d4f91d3
+ 0x375ac756 0x482c7cab 0x90fbfce9 0xc3490ae0
+ 0x3a69cebd 0x6d099850 0x91c349e6 0xf526002c
+ 0x5896d0e2 0x6ac50c7e 0x39dfdbe3 0x7c40fcc3
+ 0x379cad28 0xae961cf4 0x6a758433 0x841a4d85
+ 0x63861939 0x0a946680 0x6da8701e 0xd550bdb3
+ 0x201496f2 0x62ca33ca 0x7ae7bf3e 0x198f5463
+ 0xb22fbd34 0xdd39f70c 0x25263379 0x9e95c66c
+ 0xd84bf5a5 0x2b9aded9 0xa6147b6e 0xb89c2b3b
+ 0xf8b10abd 0x3003ca93 0xcbe94d2d 0xd9617213
+ 0xa931de10 0x33f1ebfe 0x23fe0186 0xc24d7340
+ 0x5d614af4 0x6cc048e8 0xac818a18 0x52fa7af2
+ 0xa09419be 0x2b7c82f2 0x770ee19f 0xbc7e65a8
+ 0xbbbb8a4a 0x6d146b52 0xbd6211e6 0x15c7da07
+ 0x0cf2faea 0x8b2cb87a 0xc916bc44 0x6d66d212
+ 0xb5968598 0xb3e99615 0x347947b9 0x87492f23
+ 0x3eabb960 0x2b91e737 0xc0c9b619 0x766f8e74
+ 0x25b476f6 0xe3a24df7 0x23f981dd 0xc9fbf78a
+ 0x0af89fe4 0x45738d27 0xd489af00 0x5c061815
+ 0xd12b2164 0x57bfbd74 0xbfef9b7d 0xeb511275
+ 0xd2898c5a 0x06be111b 0x4731a2eb 0x456b42a5
+ 0xb2cf1dda 0xfc4deace 0x7be324db 0x9babddb3
+ 0x01a14e3f 0xf7ffaeb1 0xb04125b7 0x9b7b86d3
+ 0x9c5fa4cb 0x9f797971 0x854823da 0x2022e056
+ 0x0a8ba859 0x8a1934d0 0x619e7f51 0x0f4fefc7
+ 0x54afe297 0x2393e4ab 0x719b8926 0xfce7747a
+ 0x771f92f5 0x006e53dc 0xffcb61ff 0xac5a4741
+ 0x43d4b5b8 0x7728b3cf 0xed066443 0x99c09a5c
+ 0x8f42a70b 0x5e51ea91 0x187fccae 0xec4dac4f
+ 0x07d0e8b3 0x16fcc343 0xb0590a64 0x8d649106
+ 0x1877d52f 0xb6e45491 0x10d0ac72 0xaf06409e
+ 0x3f9cf640 0x5413ddc6 0x02a31403 0xd288da1b
+ 0x32847b74 0x8622b38f 0xfcbc1c7d 0x148985a3
+ 0xb6344b5b 0xaf7eb8cf 0x3384f1fd 0x8a4d913b
+ 0x3172065c 0x23bb59f6 0x3c2fc870 0xf4c76793
+ 0xfc5aa31a 0xa0ee8d53 0x85efb8a1 0x72466119
+ 0xd7a3d404 0x22f99ce9 0x97d0f88f 0xe4e07da6
+ 0x88163c96 0x051b66c7 0x6eaef0ca 0x75f52358
+ 0x9f3178f3 0xf5bd5fd4 0xfa6c0e5c 0x780729b1
+ 0xdd39de9a 0x31780770 0xc584ce18 0x71ecd3a7
+ 0xe82629d0 0x2e7a76a8 0x3a2dd546 0xb1237f4b
+ 0x7487891e 0xcecf432d 0x58265ae3 0xe194d5a5
+ 0x3aac66ef 0x6b4bd7b5 0x323a3d50 0xd01e60c1
+ 0x699457a1 0xcd489c34 0xe4adced4 0xd34cb642
+ 0xb94a4d62 0x80887b89 0x8ea234ac 0xfc88385a
+ 0x8c146f06 0xae8777f4 0xad46cd3c 0x401fed10
+ 0x8467748c 0x41c40b78 0xbbc37f38 0x18c84e06
+ 0x4945938e 0xa2908255 0xf687f4ff 0x2e732e2f
+ 0x1cdfeded 0x92fffab1 0x7ebc780b 0x979889b7
+ 0x8489f724 0x3945b49a 0x7aee3355 0xbb674afe
+ 0x828780af 0x971413eb 0x0902a6af 0x042c45df
+ 0x7f4af12e 0xe5f5249d 0xe25468e3 0x97818fcf
+ 0x1451cae4 0x30062b26 0xe8630a7b 0x8368771e
+ 0xbbc6a3bc 0xefc83f27 0x4934280a 0xabdfbd97
+ 0x1feea1ee 0x9f7897a1 0x6156bffc 0xdd8b58bf
+ 0x76395beb 0x7c338f9d 0xbc83133e 0x3dad63ec
+ 0x35742863 0xe1a1d456 0x7f5e7be6 0xd0a82ccd
+ 0xa7b16e9d 0x725b7f04 0x1339b223 0xe3e47cc6
+ 0x83cec424 0xbf3f0513 0x90d0f35a 0x8488188e
+ 0xf5c34eb7 0x7c82bc37 0xcc18d1ab 0xb443dfc2
+ 0x8493c257 0x7900420f 0x558a7c66 0x520148e3
+ 0xdbc027c0 0xf0bdce00 0xab02c2bd 0x80599ae7
+ 0xe620de2c 0x57c571a3 0xc5174627 0x2fde78b6
+ 0x9e01c562 0xf1bfe2fb 0x4d7e6cbd 0x2c56832c
+ 0x8fd80c09 0x3f55416f 0x3fa0fcff 0x483ba427
+ 0xc3ad39c4 0x5c408df6 0x34f755fc 0xcf3a5b6e
+ 0x4874f343 0x7c3a9bc1 0x5a4b01c7 0x4b31d661
+ 0xb50e957b 0xb2015fc8 0xfa64a6fe 0x6a082854
+ 0x4843c2d2 0x0c0571ee 0x45440895 0x75c11e5c
+ 0x212f11e3 0x88f95e34 0xfb266b4b 0xf0ddedd0
+ 0x8974aef7 0xd0fc9e68 0x1bd8add3 0xf682e0e7
+ 0x812b5c0d 0xf80b04e6 0x6daf3553 0x14b781e2
+ 0xb8a82efc 0x1329ae71 0xe82a99b9 0x79049efb
+ 0x76e72456 0x85f4eff3 0x87c9c832 0xb91c8318
+ 0x6ca9b268 0x8148b2a7 0x8510a526 0xbf2cd1a0
+ 0x347d4302 0x0b461b0f 0x544e2e94 0xf164b15e
+ 0xd1c77890 0x49852d4d 0x6c843c90 0xc4ffcb5a
+ 0x498c8fc9 0xc84ce753 0xba759251 0xa8c79423
+ 0x52342dd3 0x0f8e0153 0x37b28a54 0x7902ea4f
+ 0x8b525eb1 0x87ea4eca 0x76957985 0xc6bd5dd6
+ 0x663d215e 0x09ebbd86 0x39c9926c 0xdb36c2c3
+ 0xa11cf17e 0x7eb4d71c 0xefa5a070 0x78dc513e
+ 0xc3f162ee 0x5b84a5da 0x206a3d2a 0x27f8f48c
+ 0x659748c4 0x7ef8623b 0xbdf27ebd 0x3dfec3c8
+ 0x90a3b8de 0x5fd6e300 0x438697b9 0xca0c237e
+ 0x50cc24f5 0x22561e83 0x5b25c46c 0x2be72162
+ 0x0711a609 0xeceb1b54 0xa12431f4 0x09e8916f
+ 0x2b6f666f 0x99664c04 0x570ced8e 0xa9a98f8b
+ 0x57bf0caf 0x1a745ac5 0xa74c0abe 0xcadd1e86
+ 0xd33c0b9d 0x1e9051dc 0xcfccf19a 0x5c2137c6
+ 0xa867c560 0x936836fb 0x0f23b44c 0x738bf270
+ 0xee440dad 0x4e391beb 0x314caed7 0x1aaa607a
+ 0x415bbbb7 0xc04a2145 0xc9702577 0x39f63162
+ 0xa10b9b1b 0xaf3c2d1a 0x0f72e304 0x51a79bbc
+ 0x32d1995a 0xe34a9575 0x9bdf9dba 0x85101f2a
+ 0x9d8276b6 0xb8b879f7 0x0ae3ca65 0xe3d66918
+ 0x80aa293f 0x43d82c64 0x393deec0 0xab56cd2c
+ 0xdddc8a45 0x1267081b 0x295f8dfd 0x767ab942
+ 0x115379c6 0xc5a4585e 0xc07a66fb 0xe45c5d75
+ 0xb1a842ee 0xa9236277 0x9770c838 0xcf9c4134
+ 0xe16c0094 0x38f0ea9e 0x57b1eac2 0x8e6fcb6b
+ 0x7f0d3305 0xe774ef92 0xbd5503c8 0x97c8e8ec
+ 0x975be29d 0x146418cf 0x3a3adaa1 0xff5ef035
+ 0x723accc5 0x66aff96b 0x380204df 0x47587815
+ 0x1aa400ee 0xa08ceaef 0xcaee738a 0x16f03cdf
+ 0xe4256ac2 0x135739e8 0xde31864b 0x82cd4032
+ 0xc5265659 0x9604a7da 0x5d8afd1d 0xaad5ff28
+ 0x1c00e2a4 0x1581833b 0xa968b62d 0x8b38d1b3
+ 0x593410ef 0xe7e8a71f 0x1e1c9fb6 0xf925cbbc
+ 0xdd3e85e8 0x3b3aadd5 0x84d9f74c 0x581eb7eb
+ 0xe63cfd53 0xff75c2e3 0x013c6dc5 0x0ae97c86
+ 0x7cb6d0c5 0x6ec256b7 0xe8b4eb84 0xd96b8306
+ 0xe36a96c5 0x2e7b1b9a 0x6a49a9cb 0xf28e3f2f
+ 0xb41a1c16 0x375eeaf4 0x9a9dd4b7 0x8c32449e
+ 0xe622e795 0xab519da3 0xb2d48b0f 0xef484cbf
+ 0xd5864f8a 0x2e393970 0xdbb14998 0xa8c1a6fd
+ 0x6112642c 0xf5870498 0x3a8230be 0x54b4bb44
+ 0xfc88a620 0x29fbfd7f 0x5801330a 0xd78180b0
+ 0x6521f702 0x3f3e78be 0x86a68549 0xf6c5986f
+ 0x9def0e3c 0x9e55bf81 0xbf0bb5d3 0x712547de
+ 0xc2d5d10e 0x9b675f25 0xae6a4781 0x91031255
+ 0x6143136c 0xcf05f24b 0x61695810 0x1bcb6f26
+ 0xb9e6ca6e 0xf678e6a6 0x4df61b82 0x87c54c86
+ 0x2505beac 0x118b81d4 0xfca2c297 0x4b7a4453
+ 0x8ce182ad 0xf10f4e80 0xf99b11c4 0xc5f5caa3
+ 0x216d0e58 0x3db50acb 0xbf96e2ab 0x618fa2d1
+ 0xb38f35a2 0x0f0f74de 0x8dd58c72 0x00d9b368
+ 0xfe320abd 0x49b6ec6f 0x4030acc2 0xbef8a356
+ 0x2bd9bfc5 0xef8dbffe 0xf13b0244 0x00188161
+ 0x25406dd2 0x2f4f3b56 0xf203c447 0x0a1fb4a6
+ 0xc2334ae2 0xb9e4053b 0xdd5c2ebb 0xbdc81af9
+ 0x3e263722 0x92c82d89 0x0a58d018 0x0badb1ac
+ 0x1a4bd0bf 0x0b865ec3 0x5fddb3f5 0x7153dbbb
+ 0x2c97c00c 0x86037016 0x36b52725 0xd6e0def9
+ 0xd837759c 0x07531fde 0xc680b671 0x30966b39
+ 0x934fa92e 0x35ca8826 0xd1c24287 0xc0cdccef
+ 0x8192b827 0xc1af2fed 0x98cebf84 0xc04d894a
+ 0x2118989b 0x564e4b30 0xcffb342d 0xd0da699c
+ 0x7aefca3d 0xb83d950d 0x8a8ed0f9 0x7ef0b8a2
+ 0x2f84f600 0x0611e9ea 0xf35eef74 0x6e9772b4
+ 0xefc0dbe9 0xa21a7716 0x460e247b 0x94837360
+ 0x55237b02 0x90cec742 0xf0678d6d 0x5dec7e87
+ 0x5a851a95 0x6fe8198b 0xbfb9d8f1 0x95f301d8
+ 0x4ad12482 0x8b6d3161 0xec76075b 0x86ce5788
+ 0x0bed2394 0x6951b46a 0x718d9222 0xd4c095ee
+ 0x601a6a12 0xf29fc33c 0xcdec895d 0x2246a903
+ 0x436a9939 0xd04706b4 0xd60feeb9 0x3f1ca1ea
+ 0x899ba86b 0x20d1dbb9 0x10ba8e23 0xf2072cb9
+ 0x2c196fa4 0x43771b0c 0xcbbc9f73 0x67508afc
+ 0xfd73af1f 0x6fbc312a 0x8bc64a14 0x03acba7b
+ 0x7e8df10b 0xf8cc4ebd 0x0ee3a40e 0xc41665bb
+ 0x3b6ab57f 0x36e15963 0x4c995096 0x5ec9e1fd
+ 0x615c80e4 0xae174d53 0x24f02023 0x234d7be1
+ 0xd843e2c1 0x38f04f48 0xb737dd73 0x6c4abf98
+ 0xa0c250b7 0xd6e1276a 0x9ccbd1f7 0xd220e1d8
+ 0xe84ad760 0x8c8e7b85 0x05a8e087 0xd3af7af5
+ 0xd63d7b73 0x41dc53d0 0x173b1805 0x1a8292e6
+ 0x2e5efaea 0x09a26302 0x44574882 0x925c5b49
+ 0x6c9d4585 0xbe6e6701 0x344c5d7a 0x31f138d2
+ 0xf4747381 0xb6acc603 0x7409221b 0x1c326479
+ 0x0c5ff2de 0x0b736e2f 0x7ed9ec3c 0xc0cd899c
+ 0x31d35abc 0x2273ecc8 0x07abfa00 0xe9de35ae
+ 0x3a1c9f3f 0xd26041a6 0x35f9ea8d 0xf1d83b6c
+ 0xfd1c4592 0x61a951ef 0xbee8a672 0x45381d14
+ 0x7dd69c43 0x01c366f8 0xa6ccdab8 0x1882f58b
+ 0x8d59cc58 0x4a09c9f1 0xd736634e 0x0558b347
+ 0xaf9b4711 0x61e6cdaa 0x32632483 0x5487d992
+ 0x237f49e2 0xefd0e0f2 0x7dcf0e32 0x70f61400
+ 0x63773baa 0xc650192e 0x580ad366 0xe693dddb
+ 0x77b85837 0x2e40ea78 0xc21ca746 0x445d70e0
+ 0x8624ebe8 0x7024de3d 0x7cb47e65 0x2190aa52
+ 0x2f065d3a 0x83c321ca 0xb7fd28f1 0x5af8cd99
+ 0xc7668eac 0xff944a06 0xef3b6fcd 0x27596de4
+ 0xcb47335e 0xc6764e25 0x1da450ee 0x11033a43
+ 0xc4b6613d 0x9333b968 0xacf9c56c 0x811955a2
+ 0x97c36cc6 0xf7d1a167 0xd444df3c 0x8be97e7b
+ 0x4bceb48a 0x36b72f60 0x7e468e7a 0x6512aa67
+ 0xea90171f 0x0fca7605 0x47ad8dea 0x4e37457e
+ 0xe2cdcb3f 0x4c37177f 0x765af06f 0x7bc40e00
+ 0x07c42553 0xd7080699 0x427d7a9e 0x0198c797
+ 0x1ff1f142 0x895a24ab 0xb8c244b8 0x9efdcfe6
+ 0x3f51da58 0xd8c589a9 0xf3d2799f 0x2144e2cf
+ 0x67024f6b 0x6b8d7b7b 0x9124fcf7 0xd85918f8
+ 0x689cdb05 0x391478f7 0xccc51204 0x0eb5602b
+ 0xf6ce4b1f 0x62359edf 0x22c7d65f 0xf487e7ef
+ 0x0581f150 0xdb1682da 0x820c8de7 0xc8bd9662
+ 0xa4b44927 0x54f052d6 0x6e36da6c 0x5236de3b
+ 0x033b779a 0x453b5329 0x5623f6a0 0x932bd405
+ 0x23b8ea2b 0xb12cdfb6 0x75a58619 0x30ff7414
+ 0xce0d2b7a 0x8116a90c 0x9a3ab506 0x85b458f6
+ 0x6ef7fd0d 0xa3347c26 0x677f5d8d 0xa49943d2
+ 0xe7d0451f 0xc5a2344f 0xbd93baeb 0xb602539e
+ 0x67eb6c3b 0xb49f9d0b 0xfb1e5678 0x2227adf1
+ 0x85d0aeb1 0x9186533b 0xfbed8d1a 0x982393ce
+ 0x3991dfe6 0xa46b85ba 0xfa66fc1d 0x7a08974c
+ 0x1ebac9d5 0x81e389ed 0xc9fdef00 0xe245f8b7
+ 0xeaef6ef1 0x9869d841 0x49605657 0x79484187
+ 0xe784d76c 0x2048836b 0x08d186bb 0x71e1c341
+ 0x8672925e 0x3a92f29d 0x63511a07 0xe5b99c9f
+ 0xf1390106 0xedb7e533 0xe3810327 0xcfeae39e
+ 0x3543a1c0 0x4035f741 0x6a0e6e5b 0xa992edf4
+ 0xcd5075f3 0x5aa0588c 0x1156081a 0x2e658154
+ 0xd9d802fa 0x307100ba 0xf551fdce 0x3ac37a44
+ 0xd12d492a 0x60fd1a36 0x0de5da06 0xd1566fbb
+ 0x5ddacb3b 0x58154da7 0x5cf2c397 0xba7b2f62
+ 0x99c49d68 0xc62621ed 0xccdb1ece 0x011ebe69
+ 0x6e089b29 0xd994627b 0xbfbed610 0xcdafbaf1
+ 0x528085c6 0xad428c6b 0x4f161e6d 0xb679f4fb
+ 0x6a4c28fb 0xc507e998 0x8676cd92 0xc8a46ebe
+ 0x1182919b 0x21f8de23 0x5787fb73 0x88f1e5a5
+ 0xdce59fa4 0xfb3bcdaf 0xbaba656d 0x2fcc5b3a
+ 0x2c034c87 0x43b672c5 0x9648b968 0x8960ebf2
+ 0xf9a4536e 0x235e54ab 0xf3355fcf 0x1ad9631d
+ 0x91ffbd7f 0x24178b15 0x6741ac6f 0xce41b802
+ 0x46fb00db 0xf9916002 0x25d7bc7e 0xaa260863
+ 0x696ec48c 0x8fc4c555 0x8ab04e22 0xfdab9946
+ 0x1860a1a7 0xa54b2749 0x866eae4e 0x0d2960ce
+ 0xd11b2ff1 0x35a30836 0xe0e977b8 0x7a1b0cee
+ 0x3798eaed 0x043d20b2 0xbab6f830 0x143620b6
+ 0xba51c31a 0x97d71294 0x67aa7e3b 0x82377a7e
+ 0x64ecaf0e 0xe88947d1 0x81a520ae 0xdcaa9b97
+ 0x02620cff 0xe48f7d0f 0x98f41ed3 0x4f176760
+ 0x17b3d315 0xb5622b46 0x41e2d4a9 0x39dd3a8e
+ 0x44005aca 0x417a4b70 0x88dc7def 0xcfd427f5
+ 0xa2a728a5 0x07946606 0x8c1d8be5 0x14460fae
+ 0x78ac2a44 0x589583ca 0x3742ede8 0x9f2c5d2e
+ 0xe64ce0c2 0x86ab899c 0x21a5c3ab 0x8726195c
+ 0xe75e2f14 0x80806d99 0x41b041a5 0x35cb36ec
+ 0xec62882e 0x8c03147d 0x365af3be 0x5c798fe1
+ 0x47be4bf2 0x3e8c84b0 0xa718d0f2 0x8b7e1ef6
+ 0xbfe89676 0xa0252b85 0xee3e6cad 0xf4fce8ab
+ 0x24951aff 0x2a352a61 0xd2a74ae7 0x1dfd5343
+ 0xc15702cd 0x33486702 0x7ad81d76 0x38ab7636
+ 0x0c7f4c95 0xf4094ee7 0xb99baa10 0x77cb9d3f
+ 0xd2161629 0xba35abcc 0xe9611023 0x66cbe446
+ 0xff956a02 0xd71625b7 0x89db7f99 0xe697f643
+ 0xed4272c7 0xa6651c16 0x7477c7ab 0x1815fc23
+ 0xc475b6af 0x652f761e 0xfc9e3230 0x0953cf95
+ 0xf87d8ceb 0xa78a341f 0x4c6fb1d3 0xfce381c7
+ 0xd0cdf3a2 0xd96c1310 0x3b1f32da 0x66699230
+ 0xdd8fa942 0x4f99eae5 0xecb6f129 0x64e1ce70
+ 0xde40daf6 0x3f295bc0 0x76aa3066 0x3a228445
+ 0xbc4c5910 0x309aed06 0x20fc3956 0x7a9c6582
+ 0x98f3c114 0x13996295 0x620dd144 0xe11bec57
+ 0x0cd0bc65 0x7fe3fe69 0xd59bcdb6 0x05f2b5cb
+ 0x20bf1ffc 0x3898ad90 0x0e42fa17 0xc697b4b4
+ 0x594ec2fe 0x34aa0c86 0x0b79c42c 0x267e6ed2
+ 0x29f55757 0xd6ffa5d0 0x155d861c 0x0a71f478
+ 0xc048e6ff 0x381b2716 0xdcf4874e 0x73ff9095
+ 0xb94331a0 0x8a6e4b25 0x1f5f0681 0xbc348b6d
+ 0xa96a67fc 0x392140f3 0x869c68d5 0xc22ad0e8
+ 0x9d1d8c92 0xc1879dda 0x1d996cf2 0x24606e73
+ 0x4c34247e 0x4de6c562 0x51e2cbe4 0xb7bd266b
+ 0xd11bd794 0xa31c2cfa 0xf8463471 0x6e19c4f3
+ 0xc800068d 0xf06e8679 0x8b03ad40 0xbfaa42a3
+ 0x98b1042b 0x01a1433c 0x51119333 0xcfefb50d
+ 0x33197716 0x5f4b5198 0x9045452f 0x705f8baf
+ 0x3143b8ac 0xd1a97568 0x945fe0d1 0x9eca20fe
+ 0x944320f6 0x8364d909 0x9e837057 0x270dd85f
+ 0x464e1cbc 0xf8a096e7 0xc82abe62 0xd9f20af7
+ 0x3c3678e8 0x232f4829 0x919f0bfa 0x361fd9ff
+ 0x9d645eca 0x81f28a57 0x953bb917 0x3bb21f02
+ 0x17160c9a 0xfbdbe204 0x34952372 0xe24e2feb
+ 0xcf946f11 0xd573ba3a 0xa9d15745 0x1c6d7bcf
+ 0x877bd4c8 0x150119ee 0x9103a2bf 0x44070992
+ 0x5a3418d2 0xecd4c8bf 0x7e7a8fa6 0x11f4e04f
+ 0xba9069b4 0x71b77487 0x3ba09dc2 0xe4bde5a1
+ 0x20e3611e 0x98d8647a 0xb78c7046 0xde91346f
+ 0x68ffb9b4 0x7d01b221 0xf779cc1d 0x27b35ff2
+ 0x0ca094de 0x19befae2 0x36b66504 0x338a990c
+ 0x2b50e06e 0xc2066c0f 0x819abe30 0x628baedb
+ 0x2bac03f9 0x4e477b68 0xa297fb12 0x35d4540a
+ 0x30acc8d7 0x4090e4f3 0xbfac512b 0x7f4340a6
+ 0xf01b5a5b 0x877e9140 0x44d87f50 0xd874d7f4
+ 0xad9801d9 0xeee50e0b 0x0cb32eed 0x9400e0d1
+ 0xd8ac5a17 0x27bd037e 0x7cba2a3d 0x2a3951d5
+ 0x8f25428f 0x4a605d41 0x16f489ab 0xbc799c85
+ 0xbc69b822 0x51b315ce 0xe74603a4 0xd0c0c52a
+ 0x092474cf 0x3ce4f32c 0x9fe627ed 0x7d20a42d
+ 0x1adf5396 0xdfa06d63 0x13cb8d88 0x7662cb37
+ 0xa95f4c87 0x424102a5 0x8dd27019 0x873d08eb
+ 0x615a6652 0xbac7f0cb 0x5fb19bf8 0x221331a9
+ 0xca573b32 0xf8550c24 0x40be12b8 0x1094694c
+ 0x53fa3885 0x99b40ca2 0xfa6eac06 0x3a9a479a
+ 0x421fbabb 0x770221ef 0xf34bae93 0x846eec91
+ 0x34fbf8a7 0xa08f3c79 0xd2d784bb 0xb81c5306
+ 0xbd479e8b 0x9dfbed60 0xbc375a3f 0x618f10c1
+ 0x82146d54 0x98a4c283 0x6200b4e1 0xe90e920c
+ 0xa57a25ce 0x5921a075 0x19004d24 0xaa3d1c31
+ 0xa9185a87 0xabb99eee 0xbb657b87 0xf975d31d
+ 0x342cef63 0x75bc7574 0x9e4fe8ee 0x23a2836e
+ 0xda9e131c 0x18492ee8 0x6643425a 0xc8b5cba3
+ 0x468eb004 0x7aaa857e 0xcd503368 0x1607235c
+ 0xffe96110 0x1596128f 0xcc1ebf3b 0xeb46d018
+ 0x5b05336a 0xce241af1 0xcf71cbea 0x491db611
+ 0xef516c09 0x4fc4e1e7 0xb2762ba4 0xfec8cc8d
+ 0xc0d243c6 0x64aa0029 0x59ec36e3 0xcbc12453
+ 0xa6af3186 0xa36d80de 0x7bd57003 0xb7c1d83b
+ 0xc6faf4de 0x4e57b3ac 0x3854c0e6 0x9cde6e92
+ 0xf7be88f8 0xf99bfc54 0x81faba59 0xe2e98a84
+ 0xbb648cc5 0x5fb76295 0x0764a71f 0x442db4c1
+ 0xe8ff003e 0x03466725 0x1eaefd90 0x50321f63
+ 0xf644e2e6 0x6d534da8 0x6dae2669 0x81dc8bfb
+ 0xfff6073b 0xa86372ff 0x0ead4d0e 0xf11714df
+ 0x4e9705af 0xf608fda3 0x25729bfd 0x5db11661
+ 0x5ef3cfe4 0xcc146a88 0xf91ecc3a 0x50733fd7
+ 0x3cf50543 0xde49cdfe 0x611cb9cb 0x93ea5a66
+ 0xbdd95966 0x2ccc917a 0x19d1ee2e 0xa2b5aef9
+ 0x241cabc1 0xafdfc7f3 0x80895cb4 0x48c93472
+ 0x038ba423 0x3c5f258f 0xc15c2ad3 0xd26cf152
+ 0xa8f00a7a 0x7c430545 0xb8eaab99 0x5c3d449e
+ 0xee42eb2a 0xb1961033 0x9cf87c89 0x21145d40
+ 0x81a037d2 0x38e40261 0xbd56bb28 0xf9e8dbed
+ 0x46514c0c 0x3b97a0da 0x944f86d5 0x77c9999b
+ 0xdb87d7a8 0xc03ce15c 0xdd3269d9 0x5fb76adc
+ 0x65cfb61a 0xc8152ae3 0x0f0d5f27 0xb5585e2c
+ 0x4744d600 0xe4385327 0x5c89f731 0xe1096acd
+ 0x5d8fc264 0x093f63e5 0x2d3c19d7 0x5cebc066
+ 0x1f0655c7 0xc1395fff 0xc40f0c11 0x56016d53
+ 0xaa383e0c 0x5db7710c 0xe6be574c 0xaa2be895
+ 0xef0dce09 0xa8240a4f 0x9c5a33e5 0x7be3a281
+ 0x2dc5c082 0x9ae1dc16 0x42a49f6a 0x3e24b386
+ 0xb7c923eb 0x497593aa 0x1cd99918 0xcb000c44
+ 0xa40b0763 0x9719e9bf 0x9eedafc0 0xf493ff35
+ 0x55ae26f7 0x3cd58778 0x68b59e30 0x1f4697b8
+ 0xbe0f10ab 0x35f44468 0x9da6c1cc 0x365e542f
+ 0xb02409be 0xdea3f90f 0x36df462d 0xe4eafba8
+ 0x03dcde13 0xe57a1eb4 0x47ca29e9 0x818c952c
+ 0xfc34a27d 0xa170b2d9 0x1ce39622 0x68244a2e
+ 0x371c7726 0xeb077fff 0x4eb089a3 0x395c64aa
+ 0x9756b333 0x68da35ff 0x43dbe173 0x2ab61b97
+ 0xdbb99ec2 0x972cb31a 0x250aacee 0xd5f6e367
+ 0x246d3c8c 0xebf892a7 0xd3769f8a 0xf6321d4a
+ 0x8951b942 0x7130e776 0xda497251 0x5b04bb53
+ 0x40758cd1 0x70d1c6da 0xe8dad90c 0x65f403c1
+ 0x24b0d323 0x588af410 0x92b835be 0x8377f84b
+ 0xdffdcd3b 0xb9d59608 0xafed6cf2 0x173e9dad
+ 0x5aff2885 0xdf79aeb2 0xbfd84988 0xc7cc7459
+ 0x7f06424f 0xf9474eb9 0x0809e3e8 0x2442d5d7
+ 0xa21b3e56 0x55875de1 0x9806a895 0x351f212e
+ 0xa57e1a51 0x68f04da1 0x2a84e833 0xe27b77a5
+ 0x3ca3292b 0xa61a1fb8 0x49740b7b 0xbfb5569c
+ 0x1046bd22 0x5b476ee0 0x6296a26a 0x357cb225
+ 0x40da65e8 0xb325f52d 0x629dd277 0xb24242de
+ 0x56d51cef 0xe71fb9bb 0x76f7eb8a 0x0259cfc8
+ 0x4cbbe47a 0xf1237f7e 0xf5fd440a 0x8984d330
+ 0xf2daec44 0xad9db68a 0x3d52247b 0x00cf4338
+ 0xafb80404 0x98c1df9d 0x74d3aea5 0xdd756dcb
+ 0xde16a5c5 0x242e270d 0xb751ed97 0xd5caad99
+ 0x2fb67de5 0xc85683a1 0xc32777bb 0xc6dd06c9
+ 0x1e6c342e 0x3f211514 0xef96a291 0x19bcdf8a
+ 0x58cd072a 0x6f9de153 0x38418da4 0x0527e346
+ 0x8355e14a 0xdf92720e 0xf958b32f 0x190145ef
+ 0x1745190c 0x0285e8e3 0x7b6b7aa5 0x544ef530
+ 0x9d5296b5 0x3f5e113f 0xa5c85c4a 0x1e8a3c6a
+ 0x935dab20 0x6858d152 0x4618ed8b 0xa2a137b4
+ 0x7b08d9dc 0xa6d60f47 0x357fbaca 0x449351ae
+ 0x99f91683 0x24a56e7a 0xee480687 0xdbe356f2
+ 0xa5ee5986 0x37463d5f 0xd44bebe6 0x46cd2c4e
+ 0x5445d044 0xccd76946 0x8923790c 0x7d136437
+ 0x4a330ae2 0x415689eb 0x2f61d0c8 0x3d16fe12
+ 0x78efadba 0x8281fea0 0xb834b5df 0xa9fb0d25
+ 0x70d7bc60 0x140e82db 0x4d41874a 0xc20aeebf
+ 0x5512fadb 0x0329ff4f 0xc837fc56 0x2966e442
+ 0x60e9272f 0x5c274f74 0xa1b7c7d9 0x1a455e99
+ 0x252ab092 0x8eb3342b 0xb8f3942a 0xabd4e1ea
+ 0xf4544aea 0x1a613b41 0x9e98b5a6 0x82bef7ea
+ 0xbe465e94 0xac1f3d52 0x191ab8e8 0x047cc1c5
+ 0xd418ebfa 0xd6638536 0x31d8d719 0x0a1fdb7e
+ 0xe7555120 0xece47d38 0x69cfc4e3 0x5f96de68
+ 0x87eaf094 0xcded6048 0x0180d5f3 0x291186a5
+ 0xb0b29bd6 0x82459eb7 0xf85f79b4 0x822408c3
+ 0x83d75e39 0xa3288963 0x1d5e50bc 0x48bb63a1
+ 0x156ba375 0x44cb00cf 0x7ce58e27 0x10f2b467
+ 0x5d246aa4 0x6bd8bbd0 0x816c152e 0x3e5eee98
+ 0x44791155 0xe6ddb7a0 0x12bc6e0c 0xd93be5eb
+ 0xac98a9f3 0x3988215b 0xe1aad8de 0x3d978c7b
+ 0xc0e6d8a8 0xd9cfdd65 0xb93e2e9e 0x539eaba3
+ 0x2c7f4f92 0x05a1f15c 0xbdbcfc9a 0x9aa52400
+ 0x3df183c3 0xfb3655ed 0xf9596b88 0x01286991
+ 0x429b807a 0x50806501 0x6e5a4966 0x9efb7597
+ 0xbd4c57e8 0xeafa1a6d 0x8903d162 0x7bb40d8c
+ 0x423f899b 0x33f873d2 0x82487c9a 0x2d7f72c1
+ 0xbdde0886 0x358dd6e4 0xf9144435 0x83780cb9
+ 0x8d1b0ff9 0xbab38bce 0x8914fba7 0xc6a57afe
+ 0x2f946753 0x9cd6d258 0xfc8dcadc 0x0e8dce12
+ 0x87411620 0x58ca5b04 0x686f7ea6 0x89e8f315
+ 0x4f3de4c6 0x81e09d6c 0x40e60225 0xce6e0584
+ 0x97d586b9 0x5ece30a8 0xc5dbae59 0xa3821324
+ 0x420799ae 0x2307200e 0x7b5689a2 0xd7a61685
+ 0x9fa7f042 0x854c1b08 0xb78fc244 0x6980c696
+ 0xd5218ad3 0xfa259d5d 0xec0df961 0x5b956c2d
+ 0x6dd986be 0x63de9edb 0x18be4cc2 0x6499b8c2
+ 0xba41cfb4 0x38e3aaa1 0xd7cfaaa5 0x13182793
+ 0x68b21f98 0x9b2db84a 0xd9aa1d69 0xfafa3520
+ 0xe5fc7365 0xb71f70aa 0x3d959892 0x46950845
+ 0x0e35a6c7 0x1d356229 0x664d9ea7 0x85e7b139
+ 0x0c0a288d 0x219f5dbc 0x354b6862 0x2e08b2d6
+ 0xa04cdfa0 0x1c0c9535 0x3c7b382e 0x75741964
+ 0x6c3a4da1 0xd36c4560 0x1c8aee89 0xb0776546
+ 0x333e78b0 0xe8e0015b 0x7b5f5416 0x84a02be7
+ 0x538f045e 0xdf512ed9 0x87860bf6 0xae791e66
+ 0x051f3632 0x774ef031 0xbf64967d 0x74e3f460
+ 0x824be685 0x39aa94a1 0x921e59dd 0xadaea534
+ 0x9198c5e5 0x6fba31d9 0xa4a37005 0xbf054ccf
+ 0xf5b2a9fa 0x9de511f1 0x2acacb40 0xbae1b52f
+ 0x1cde721d 0x32b05dc3 0x0d119372 0xdb5cf890
+ 0xd345e8ac 0xac335030 0xe7af918e 0xf6ee2b7d
+ 0x004f636e 0xd068b99d 0x615c97a6 0x10236e8c
+ 0xdd58f2b1 0xf6bc1e23 0x3f11d896 0xc30ea16e
+ 0xa5004ed4 0xc7405f8a 0x320646ee 0x8b7d9a9b
+ 0x5b4fc5e6 0x51609d94 0xb833d2d6 0x3c75f456
+ 0x786be713 0x035a3105 0xabef806f 0x17788e0a
+ 0xde88134b 0xaf029542 0x58fa003c 0x052c1f84
+ 0xf37dde54 0x52fc32d1 0x96b72579 0x9dd1b0e0
+ 0xa4a39564 0x8aed127e 0xa47c630b 0x388e786c
+ 0x54f9d309 0x1910ef02 0xb59425ed 0x026cfa61
+ 0x6e0f95a0 0x3ebec1bb 0xaa89972f 0xf70c867b
+ 0x4201d9b1 0x8c573cee 0x2310ead1 0x82249efb
+ 0x62a322f4 0x873eb079 0xabce9df4 0x996c6f78
+ 0xca0f3ff9 0x75698aad 0xff5762e6 0x4e52ccdd
+ 0x40689a6a 0x257d8355 0xd90ce88d 0x16809385
+ 0xdb41d890 0x5d5c0f25 0xfa7b0543 0x8cb8cb05
+ 0x811b1779 0x62ab96aa 0x84e6bef8 0xe0f7e758
+ 0xe7e52cce 0x5ebec748 0x9b68ad1c 0x1362c049
+ 0xbc5cde27 0x68445b32 0x35117d00 0x741c982f
+ 0xe254f07d 0xce0b9466 0xb6940a37 0x6559d627
+ 0xf324c0c8 0x101fcde6 0xb9731c06 0x71a6e9e7
+ 0x18b9143e 0xef938ba0 0x74c23b69 0x99bd8ad5
+ 0xf77aaa12 0xea095a6c 0x0d108239 0x3f6cdb99
+ 0x3dbfa345 0xf0334210 0x026298cb 0x4804b3b6
+ 0x38b7cc2e 0xbc386020 0xf09f2756 0x0447e4ca
+ 0x9add32d8 0x25389b9c 0x2749f04b 0x9269f823
+ 0x33d4ebbd 0xf3ac8dd0 0xef63c582 0x521aff63
+ 0x8e0d75c8 0x920e7cbf 0xa6fcb2bb 0x27c00509
+ 0x4b37a1f7 0xfca11e3c 0x331e869f 0xcc3fb236
+ 0x07e7c054 0xe97554d3 0x89bea7cd 0x488db07a
+ 0x8fb18918 0x3aa3dade 0xf257738d 0x68eb51f4
+ 0x03c4635e 0x90300007 0x3dccd582 0x0ced580f
+ 0x2d99a51c 0x1299ea42 0x798a3b7e 0x91b52c3d
+ 0xa8fc9be9 0x4bf7c900 0xbe332555 0x555e4742
+ 0x2b5d4ae8 0xa91f5e85 0x244776cf 0xbf54f159
+ 0x0d0b10ff 0xf0616048 0xfffd60ac 0x4004016f
+ 0xb5280641 0xec6dfcd7 0xc5db16d4 0xd3ed3319
+ 0x4a991c5d 0x3a72e0ad 0x624776bc 0x6b2a46a0
+ 0xc8a04e73 0x94e8cce5 0x76405dc4 0x14d6e67a
+ 0x97aef6fa 0xb779a41f 0x90cc1391 0x1cc168f7
+ 0x33b87c53 0x44aa57b8 0x3fe7d204 0x6727e569
+ 0xf9083a86 0x181d935a 0xabda2133 0xff7784d9
+ 0x9808d117 0xf89ba19b 0x8d27632a 0xf96fcd9a
+ 0xc7a2c826 0x686ed065 0x066705e1 0xf30580cd
+ 0x0e84642b 0x66330ea9 0x3a526904 0x5450a3ce
+ 0xee0ede87 0xf37940f4 0x68746ef4 0x813cf9bd
+ 0x67e297f3 0x19e7f602 0x51d7c429 0xe3d3b4d3
+ 0x06955ad9 0xbf2b1c4c 0xbc090d0b 0xca870e3b
+ 0x5314e9d6 0x459e2f44 0x246c1ea5 0x341cbe56
+ 0xba0d09dd 0x042310bf 0x77c0bba2 0x08993ad0
+ 0xef12acff 0x7ed654fe 0x7fddd922 0x846887f4
+ 0x966891f9 0x36136123 0xb44850c4 0x6e195454
+ 0x50e04902 0xb2715177 0xa2b41fd4 0x5ce22c86
+ 0xdff8b6ce 0xfc554058 0x0e2935cf 0x9eca9263
+ 0xaa96f95a 0xb09e52a0 0x7b27970e 0x623be3d7
+ 0x6bdef7e1 0xe495efca 0xf744c829 0x3aba1bc3
+ 0x8d56b59e 0x44759deb 0xbfb30205 0xb9cb3a1e
+ 0xbe6461b9 0x39654447 0xc42dfd3a 0xb5a79f79
+ 0xc4a90b9a 0x4f01a59e 0xcbb71c35 0xa31d22ce
+ 0x49bc206a 0x6e04046e 0x8ee74197 0x97215f67
+ 0x034db94e 0xc11eb716 0x1459f3d0 0x9b14b5ee
+ 0xc45693c6 0xcb2c182d 0x3565d2f4 0x7ee32c58
+ 0x58dc30f1 0x8630c6d2 0x719010ee 0xbe012e71
+ 0x8271a456 0xed652511 0x882f40ce 0x4ddf02d7
+ 0xc67a8e0a 0x4811c88a 0x72cee120 0xa08fab13
+ 0xca3a64bf 0x4e5a1278 0xf912ba7a 0x393c008c
+ 0x1cb7080f 0x07a469fa 0xa8f74a4f 0x633eac50
+ 0xa41a0c86 0x72f0ffc3 0x1c6bcd6d 0x4f7b5ddf
+ 0x6c481d42 0x8bf6e5ba 0xd574503f 0xceed8e8a
+ 0xb5f6d809 0xf37b2260 0x24d1b6e9 0xc85044dd
+ 0x95f5677b 0x9d6b1640 0x45328493 0xe5253a77
+ 0x49a7cc7a 0x8d9be125 0xde28f113 0xa7d7795b
+ 0x7fb7d42f 0x069f3287 0xc1fea02d 0x698307d2
+ 0x5a3e7c2d 0x278e7f6a 0xa18d5f7d 0xfbdb9ea8
+ 0x8fef2832 0xaf9f309e 0x2fcd2656 0x4b50c851
+ 0x98fad9d6 0x9a44a31f 0xbcb0e851 0x3a85043a
+ 0x24e82166 0x051b1dd0 0x7f89a562 0xde1bc7c2
+ 0x1eb95680 0x429433cc 0xac6c5f6c 0xafbc3411
+ 0x79bf3735 0xe2048733 0x14a2afc2 0x80069a16
+ 0x30d483db 0x58742e73 0x6fc8ad56 0xb503881a
+ 0x8f141424 0xc8167c63 0xbd277b7f 0xfac019d4
+ 0xd0ca6c57 0x5f5398f5 0x2f45edf7 0x9144cf57
+ 0x23f3a679 0x5a64dd70 0x35ee3e79 0x1b7d6b5f
+ 0x48c9639a 0x1bfacca6 0x9e089b85 0xfa65c048
+ 0x32f4730f 0x5f2464f0 0x4df941bf 0x6bd6f2b7
+ 0x05292b73 0x320af866 0xe828ac00 0x3af499ea
+ 0xada16128 0x432f4299 0x01dcc1a8 0xc56f07af
+ 0x7d84f35e 0x46be77d1 0x7270a955 0x496f4d42
+ 0xd90dc01d 0xa2e77cea 0xc5a966e0 0x3c5b9adf
+ 0x37e08155 0x6d52cbec 0x52feb4f0 0x4f2a7434
+ 0x1fce299c 0xf6d188f8 0x53f4af1c 0xf89e8b9d
+ 0x3993aac7 0x8cea8f26 0x2ee2090f 0x1619d4d2
+ 0xe45da14e 0x94d55488 0xf4c6b2d9 0x826d3015
+ 0x7af57189 0xf6ace4ad 0x2f46056b 0x915037b4
+ 0xc2222334 0x55b796cc 0xb65a044c 0xb2fb399f
+ 0x8ce60200 0x6b37f137 0x26fa3366 0xbe302fbd
+ 0x9277949e 0x3cf1c345 0x3841c52a 0x2e3a7512
+ 0x3130de1e 0x7961d00a 0x88c9b862 0x5a630bcc
+ 0x43e7d5f4 0x928f5358 0xf5c34089 0xe92d42e0
+ 0xaed2fffd 0x094ee05a 0x7274ba00 0x75a9f3b2
+ 0x6ef65875 0x7d00bc88 0xc609d7b6 0x8e90c34d
+ 0x241833e0 0x5d2ba7f8 0xafb64328 0x9df08520
+ 0xf0eeb551 0xad42d417 0xb8e17033 0xf851c449
+ 0x29b19535 0xff7d0fc5 0x2b30645d 0x92ace5c5
+ 0x4a66a2b5 0xadcc90ad 0x7b29189b 0x038c5470
+ 0x88d32f2f 0x312882c8 0x985c5602 0x7ee684e3
+ 0x28c09d9f 0xfcaf86df 0x230feb68 0xb56f0671
+ 0xcf591176 0x05ecf079 0x638c253c 0x28736801
+ 0x20b8a3f5 0xfb1b1f2f 0xb4385544 0x53348dbe
+ 0xfc2c878a 0x711999e7 0x659d946a 0x1521af64
+ 0x0812e71f 0xc8203d37 0x29a7f5d4 0x958f34d8
+ 0xb6cbed8e 0x4358f076 0x2a423f75 0x3c356d5c
+ 0x197f3fee 0x032a0d70 0x56000bc5 0x027fa2f7
+ 0x8eb13b65 0xb89d6266 0x8493e74a 0x11b1eeef
+ 0x2ef00f51 0x03e757df 0xfc2c1678 0xbc6e9977
+ 0x9a38df8e 0xcd11cff0 0x2c269834 0xb997958f
+ 0xb32ff8bb 0x9bcff1cd 0x801dbce5 0x9768f02f
+ 0x38231c6d 0x338f7b3c 0xf12cbc4d 0x60e9c44e
+ 0xaa09ce8f 0xd6b58269 0x75ff5b6e 0x7039abcd
+ 0xf2cb9471 0x1093a2b2 0x618d39f1 0x47a7752c
+ 0x862e26bc 0xb8600cd3 0x0ce5a0b3 0x2afae97c
+ 0xf0053c3d 0x2e4003ab 0xa672060e 0xf06a2be6
+ 0xb97f0b4b 0x92375a88 0x037bcb1f 0xfd9a4b01
+ 0x15f8f271 0x9a9d186a 0x3ce6d235 0x2f1d18c3
+ 0x126a57e5 0xb1b44c87 0x78948684 0x843898d8
+ 0xa79e8665 0x222947ca 0xecb9d548 0x10d7625c
+ 0x4a3695a5 0x9ea5b48b 0x01299640 0x7951fb14
+ 0x4dd34ffb 0x1c654f92 0x8970cef4 0xdca89d00
+ 0xbff56ca5 0xda5c53a3 0xd860080b 0x58fb736d
+ 0x8c61a830 0x1a12dbd8 0x42b588a4 0x779da738
+ 0x3e92ee98 0xabd14a57 0x276193a9 0x48cbd267
+ 0x4c126241 0x665d83fc 0x2078bb6f 0xd3848b9a
+ 0x53b7f977 0x2edd260f 0x6b477827 0xdd7ebce2
+ 0x2c044944 0xf091ead1 0xa39aba93 0xadb6ad6d
+ 0xa02ad5bf 0x41ab5d42 0x375224c7 0xf42f3e7d
+ 0x1c0b528f 0xc3c2d705 0xe7c09e2c 0xea2fe19d
+ 0x85bfc53d 0xfe2b0e47 0x94df7ec6 0x7ab703ec
+ 0x407d00e6 0x47d61156 0xc0b7527c 0x98a3480f
+ 0x91061b8e 0x8d52a8c9 0x7126ba2b 0x55f44b5f
+ 0x98e1d428 0x7dc3d2e5 0x1e4c1d39 0xf5feeb85
+ 0x28f76e4b 0x3822f307 0x054a14aa 0xf267738e
+ 0x34a65fe6 0x2b1757f4 0x6beeffbe 0x350b4c49
+ 0xb890d208 0xbd8e0a6c 0x673b7408 0x42894542
+ 0xa3a87f72 0xbd39c48e 0x8d306798 0xaa9b91dd
+ 0x1aeece30 0xc00883c8 0x01803861 0x54f91e34
+ 0x45981e4a 0x8b818484 0x0332e964 0xf918582a
+ 0x99c4f34a 0x890afaa0 0xc6f6dc3b 0xa9271d74
+ 0x5a8453de 0x5e92554f 0x479bf1a9 0x7c6f8358
+ 0xaa0b8bc2 0xa5199f81 0x94a91e08 0x30008ece
+ 0xfca46e08 0xb519aa53 0x4a341f4b 0x60698887
+ 0x1e00cb4b 0x8905ccbf 0x87fcd005 0xe6049bc2
+ 0xe8264448 0xfa2fe06b 0xae981189 0x2c40f71a
+ 0x51011676 0x80a7ce52 0xebe83473 0x33f6e6fc
+ 0x7673fdcb 0x7cac2b00 0xd3256641 0x5f2a9578
+ 0x41cc8670 0xdf5f662c 0xd42c59d7 0x4564e3de
+ 0x62a51e7d 0x9ed383a2 0xa2fa5977 0xd7b906f5
+ 0xbc1af102 0xa2cb35c3 0xe596af48 0xeb584e54
+ 0x8df8da61 0xbbe11869 0xba5e3a67 0xcbfa3acc
+ 0xa432523f 0x98ec0105 0x0c4d3f23 0xe839e993
+ 0x3d380d3d 0x8501b0b1 0x233ed8c3 0xd67e434d
+ 0x6b56fef0 0xfe376708 0xc2ea0f72 0x9f8dcc30
+ 0xac2c85f0 0x35283c61 0x22e354c4 0xb6a15eb9
+ 0x6f237d7e 0x8f6ebbeb 0xda1a2754 0x648647d9
+ 0x07404cb4 0xaf22c410 0xf14018e0 0x0af8cfa7
+ 0x9faaa273 0xe60a36aa 0x056e738c 0x719a0d68
+ 0x09ce5c5c 0x692fa9e5 0xafe860d9 0xf595c31d
+ 0x0de5bcf9 0x7df5ee42 0x5d53d0d1 0x3313aa5e
+ 0x78ba479c 0xcb33cf99 0x217b1838 0x18a19803
+ 0xa8c1c26e 0x282aa101 0x5f2bd95c 0x7089f922
+ 0xf061de08 0xd4b41ac6 0xd7f696fd 0xb40b0be3
+ 0x3f152cb5 0x2efb8244 0xd704a6af 0xe7556418
+ 0x6846f530 0xba3b5fbc 0x450ecdcc 0x98f656fe
+ 0x3fd2bf30 0x4ff4f378 0x7da84334 0xef205a74
+ 0xb1611f37 0x40d6418e 0xeeb3fa8f 0xf316ce17
+ 0xa52c51d0 0x7f05d21b 0x705d8557 0xc2555ce9
+ 0x669eff19 0x2894092d 0xb8232046 0x5e23fe50
+ 0x34189bd5 0x0ff4ef8f 0x7a7a1e52 0xe801f840
+ 0xf452159b 0xa55d67e0 0x582552c1 0x9c22979b
+ 0x046c821f 0x6d5e4c26 0x31173819 0x43793399
+ 0xb125da6c 0xa3ff301f 0xc2b336bb 0xee8946fb
+ 0x978ee873 0x9400f42b 0xac4ee454 0x6e5763c5
+ 0xfd1a8190 0xe67c691c 0xcd9012c9 0x1b3c8bc9
+ 0xc83d9eeb 0x8a2b8818 0xc130bb2a 0xb3b84e6e
+ 0x9da3b263 0x2b2bbe17 0x82892688 0xa4e415e4
+ 0xb34abd61 0x199ab6b6 0x7a98c614 0x82cbd39f
+ 0xe6fd92c2 0xc34c59d2 0xdc1b98da 0x260667db
+ 0x85e38107 0x06f7fcfe 0x694ec698 0x536b8a72
+ 0x2c520c3a 0x3a635176 0x75cf01cb 0xe49840c5
+ 0x26cb9b25 0xe14e4656 0xb78fa730 0xa52107f2
+ 0xb2ab5e5a 0x039cb57e 0x86d19969 0x35a3d367
+ 0x10ef5a1d 0xdafe5c52 0x2b1641ee 0xb1003ede
+ 0x6f9dfb48 0x552de3b2 0x42f6481c 0x265e4243
+ 0x68f80be8 0xab240b69 0x1040ba15 0xa4f537c1
+ 0xcf902312 0x7e87036b 0x24908e7b 0x317fcff0
+ 0x11ece36b 0xdfecefcf 0xae6d315b 0x6b755b77
+ 0xc16fc4e5 0x94a2d8f5 0xb256249e 0x3e195cbd
+ 0x51921ffa 0x4fe77749 0x7dba7c6e 0xd1d204a4
+ 0xa1eeb4eb 0xf54d8122 0x64df07ad 0x7b4ff6a1
+ 0x2c15619c 0x8e06336c 0x58807c29 0x8f91e547
+ 0x57c7fe5e 0x9cd6dc5a 0xcb196fe4 0x0f8bbc9e
+ 0xa4fe9a7f 0xda247b8d 0x46219462 0x04030f72
+ 0xe9278418 0x1c357565 0x415d5bb5 0xc6969fa9
+ 0xe5408809 0xe1993b26 0x7e50ad6f 0x0fab56c4
+ 0xe561f44d 0x3dd422b4 0x3718be1f 0x4e3c1589
+ 0x341494e8 0xb1e17790 0xd5a4aab1 0x132ffbe3
+ 0x5dcfa00c 0xe492eb3c 0x6ef3d999 0xa3b15e11
+ 0x2382a161 0x27fd8575 0xc2f47571 0x2b6e8acf
+ 0xf16eafa8 0xe0a4d3de 0xf1ac66c7 0x3f344de3
+ 0xa21f3ad5 0xa16dfb14 0x98b8cc07 0x3f835cc2
+ 0x88522657 0x728c8017 0xd5ce1855 0x950d3c49
+ 0x3ecbda68 0x20d59694 0x7e4ecee9 0xe7b6948a
+ 0x6e40d777 0x5cc5bc4d 0x940563ea 0x847719c5
+ 0xf1c3e4bc 0x90b7078a 0xeeb9ea16 0x4d70ea7d
+ 0x2de86bac 0xe9d44bc7 0x8d5d5f83 0x337be334
+ 0x8709f043 0xfc548262 0x7c288102 0xe306c122
+ 0x4c3706cc 0xccf4e0e0 0xe0e139ad 0xafcd392f
+ 0xd6d46889 0x22ac5b40 0x40630668 0x46e0364e
+ 0xe3fc723d 0xf2244f2f 0x23b9ccdd 0xcaa416de
+ 0x491512f1 0xb81e2a55 0x6a4e13cb 0x68a92102
+ 0x1acb5d35 0x9dd4b349 0xbc79a6ee 0x53486c8e
+ 0xc0b782c0 0x38ba5b65 0x083856ce 0x8bbc8166
+ 0x832ae44e 0x6d1a7821 0x9440a2b2 0x50856005
+ 0xd58acb6f 0x8458be69 0xb5e3e12a 0x8fe5c418
+ 0x2bab1868 0x5fdce26a 0xb055b5b5 0x3347963c
+ 0x01778244 0x94632954 0x0bd2f410 0xeea46465
+ 0x5f2e6606 0x3d3b5b8d 0xe22cf626 0x22b05fe0
+ 0x985a8242 0x37f05e43 0x081f8f7e 0x48160fe0
+ 0x7b31d3c8 0x9131115c 0xfdd4d60f 0xe49b7cbf
+ 0x8d1c324a 0x03dcb09a 0x4b075ec5 0x2161f6bb
+ 0x22a73927 0xa03df0b0 0x3312f32a 0xef29918c
+ 0xb4f45af5 0x08d7ad75 0xe3b10cf6 0x9f038cff
+ 0x38187cff 0xe6b8640a 0xe25e6816 0x09f360e6
+ 0xe723e6d8 0x3e54a97d 0x839833b2 0x50870a6d
+ 0x15d28f5e 0x1502d9a6 0x09e3a446 0xf384e317
+ 0x0b52d1d8 0x7bdac6c2 0x9bcafa94 0x6130a3e0
+ 0xaff0a77a 0x455e3f06 0xe7ec673d 0xb6fd34a4
+ 0x79586f9f 0xf8a774f1 0xbefe2e7f 0x0c1f366d
+ 0x723ce30d 0x9ef5c33f 0xe6291746 0x928494a4
+ 0x8f36fc92 0x00b4cae2 0x2662aaaa 0x14025de3
+ 0x6ca2e231 0x465da855 0x7dcbaf24 0x438ecc22
+ 0x6405847c 0x39bd34d8 0xb9102808 0x52adc27c
+ 0xa436b8a6 0x1c8e9627 0x7c514a11 0x2c95eaed
+ 0xf3d78737 0xcd70b289 0x00ecae75 0xf48a5c2f
+ 0xcfc314ae 0xd4d23c1e 0xbd3611c8 0x41dfb4b0
+ 0x09321b0b 0x49d323c7 0x0ac45ced 0x92d8a2e9
+ 0x45649117 0x38289144 0x98b60c78 0xefbca700
+ 0x8385eeaa 0x150d1d18 0x9fe76248 0xd040677c
+ 0xae640755 0xa27263db 0x0bb183c6 0x3cc9e42d
+ 0x4395c88d 0x358a8380 0x7e123cdc 0x6cf3d1f9
+ 0xfdc6215b 0x949ee303 0xf417ac31 0xc3b90a56
+ 0x9ecba65a 0xbfa39c82 0x834a7416 0x2872d073
+ 0xc7e45f1a 0x5e265a4f 0x57dd0057 0xda31d555
+ 0xc2e3125f 0x154a94ad 0x7a257e54 0x21afa615
+ 0x1bf7d2e2 0x9c53ecf0 0x03644304 0xfb272d9e
+ 0xa1308603 0x7b6a6995 0xa7b53c52 0x99785141
+ 0x717ec8c2 0x90a3a34d 0xaf773803 0x13149c46
+ 0x84969711 0x650bc0b2 0x090e7282 0x5f5b52f0
+ 0x317765d4 0x1eced54c 0xcdacf3fb 0x1a4d998d
+ 0x96dbe788 0x2c83c1c1 0xc3c6060a 0xb47b022e
+ 0x7f0a2461 0xb2c6833f 0xa28ef21e 0xcc7f08cd
+ 0x6276cab2 0xf2c28561 0x3f8a341d 0x0dc2ce23
+ 0x5a7c6095 0x0de2c81a 0x30b2396a 0xdb9f1abd
+ 0x77aa1c88 0x0b1a58d7 0xeb65b5a2 0xe8a8c26d
+ 0x1fd13326 0x98f9b8da 0x0b60d4c4 0x283d53d9
+ 0xf2c85b54 0x959abd77 0xc1402998 0x82ec4bf9
+ 0x2b2822f3 0xdc3e5b73 0x4f9b363c 0xf0de3afb
+ 0xd4058608 0xbe225786 0x08ac049c 0x810c38b7
+ 0xfa275712 0x8a3b3b18 0xe2014f37 0x9d7e84cf
+ 0x837430fb 0x9d268d6c 0xdacfec30 0x4de714e2
+ 0x651d1443 0x83868ebd 0xd35f410b 0xa8189c28
+ 0x6eef00e8 0x133eb94f 0xff511292 0x48f7eda0
+ 0x586f5a01 0x1f35a55f 0xdc739391 0x5643e66c
+ 0xb203ce9b 0x02da8c64 0xd33f419e 0x9d3dded1
+ 0x1894ece5 0xe3044813 0xe30856ad 0x981090e8
+ 0x449a75fa 0x4741c87d 0xa3eeb1af 0xdebed7bc
+ 0x63d36cf9 0x0c662c7d 0xded8eae5 0x462cc7e4
+ 0xedea5e09 0x18de0808 0x2d45caae 0xaeb97a8b
+ 0xd77e497b 0x96290389 0x629bf169 0xf6e6f176
+ 0x7b824f3b 0x456d5afb 0x3ec297b8 0x02f66afc
+ 0xb06732d1 0xfbc15c02 0x31cd5d46 0x8d5f6836
+ 0xaf8458b6 0x63dff3a3 0x6a6778cf 0x6ccdd64c
+ 0x384945a6 0x9edea46d 0x441a7d5b 0xa36fa901
+ 0x713e66bc 0x1d7d2c95 0x465f8ec8 0x00940a0b
+ 0xbd5193ef 0x2183dc17 0xe580206b 0xc31829b9
+ 0x552b9c22 0x4cccc102 0x3e4c999a 0xbddf5759
+ 0x46818e3b 0x572278d9 0xd5d472b9 0xbf44051f
+ 0x5bcd9d4d 0x18b150c4 0x579b4f53 0x8e2d2284
+ 0x3d59efb5 0xbb29d05c 0x8142d678 0x3e4e009f
+ 0xda9d9683 0xc7624dc4 0x3c21df4a 0x5bcc17f1
+ 0xff19d9b1 0xdb4c6d42 0x45c43a0b 0xa1901783
+ 0x88dd43ea 0x3fec2821 0xb37ea79d 0xc48fed64
+ 0x7ced3131 0x0ab60cbe 0xaaad69bc 0x5b8e0945
+ 0xae8a56fb 0x5966785d 0x9ff02083 0x7b032ce6
+ 0x8efed925 0xbdd319b4 0xb46a1dd7 0x1ed4a73d
+ 0x679394d1 0x692e3cc8 0x1dbdc2db 0xc0e1f4e9
+ 0xe86c32d5 0x0cde1e9e 0x14c7d904 0x57b0b968
+ 0x646914fd 0x70984932 0x1d6e5da0 0x35ae3ce7
+ 0xc6b4b7da 0x3b103957 0x4ee8ea6d 0x3498c59c
+ 0x09ac5c5c 0x600f9a79 0xe74fd1cd 0x3b273adc
+ 0x4aaf4eae 0x664e6213 0xf828611e 0x3c7ec70f
+ 0x2105ad64 0xf16f02a9 0x7daf897e 0xdc3e4c8c
+ 0x14f49242 0xaa03a96b 0xb3015ffe 0xd1213cac
+ 0x82a51c21 0xe1859816 0x249d328c 0x7bd8a3be
+ 0x1874e84e 0xbf8ace44 0x8c052f76 0x591b6e4a
+ 0xc712e62b 0x350ebc97 0x330fc6c2 0xed4a2318
+ 0xc260d922 0xe66421fa 0xdecf6bbd 0x69537478
+ 0x8a4f6c68 0x7e33740d 0xb5c79fb4 0xe42fc7ea
+ 0x64986a83 0x4af721fb 0x4228fbff 0xe00db003
+ 0xdf9c785f 0xa833bce3 0x07a39f1c 0xa09077ae
+ 0x2c24872c 0x00ddcb5b 0x61689e74 0x019b570a
+ 0xe62fc616 0x6048d96c 0xe0879492 0x9f20adc3
+ 0x750238f5 0x00b30a8a 0xed16556a 0x7e0f2660
+ 0x04cde130 0xc48b7090 0xf6867ff0 0x9bcfa048
+ 0xcdc389df 0x15782910 0xa7fb9c4d 0x5df2ba44
+ 0x57f5f6cf 0x116e9d63 0x3a2a34fd 0x69ffb436
+ 0x4330770c 0x2623b655 0x92aa0610 0x146ed3ed
+ 0xe4f33f7f 0x12480673 0x791f1af7 0xe374c82b
+ 0xbc591988 0x73e19e74 0x4a692627 0xacb6599a
+ 0xb9e364ec 0x636b8fed 0x57aeeb35 0xdde4c110
+ 0x3d32b541 0x2c8ce305 0x1cbbb467 0x17e21691
+ 0x234ec6a4 0x5c2ab507 0xeca83639 0x81132994
+ 0x63cd6d05 0x52c7c0eb 0xb24bb6fa 0x6ca949b3
+ 0xe612b60c 0x637af946 0xa5eb9c8a 0xd8abf616
+ 0x5a3cc348 0xe2e97af2 0xc9404712 0xd18bcf2a
+ 0x8c2a45d0 0x5e6e0fbe 0x9fbd894a 0x86641a1a
+ 0x1540f11a 0x33bfbdb7 0x8411fcfc 0x2e028d1f
+ 0xa8eec52d 0xf8b4df05 0x6d95227b 0x67ee103d
+ 0x1e82ddc7 0x29bbcfde 0x846d2c98 0xcbb0b4a2
+ 0xf7d4014b 0xf1bf579a 0x31d8c825 0xdb8e5ced
+ 0x5fedd954 0xd34461d9 0xa30b43bd 0x270892e8
+ 0x39a0f23a 0x0294ac24 0x4b3f9eef 0xd1bde6c7
+ 0x19a2253e 0xef39ad0a 0x25667125 0xdc1f8783
+ 0x60663a21 0xea9a2dff 0x2b9b70ed 0xbda0f119
+ 0xd2bcc1ad 0xa6a3c214 0x7e110a63 0x03054fea
+ 0x38869655 0x665c6db5 0xb2e1598d 0x4af4544c
+ 0x9d5ad473 0x2813f572 0x5b34d77f 0x2b6a4991
+ 0xc02d2724 0x57aab26e 0x1e73ddd0 0x6876174a
+ 0x26b216b2 0xfd47c5e6 0x7637487b 0x83dd88c5
+ 0x84ed74a3 0xad0fd5af 0x7e54d329 0xb81f89c3
+ 0x096e31b0 0xca82055e 0x93fdd796 0xdde95e3e
+ 0x270f28c0 0x75e430ba 0xfbfa701d 0xcdaad076
+ 0x88f75410 0xd2f285ac 0xe7bb7afa 0x217cca34
+ 0x612f28e3 0xa8216d4a 0xfe499570 0x3a0f2239
+ 0x1d5822df 0xab511a4f 0xc89c8fc1 0xf2363058
+ 0x8db8c643 0x1a41f69b 0x91b92d7b 0xc3b594c5
+ 0xeef08b27 0x0ed4fd46 0xd1249b98 0xae503313
+ 0x42ef4416 0xb5c0c3e8 0x77badf2a 0xfc4d2592
+ 0xd03a8c29 0xfdcd34a9 0x5751fb68 0x10e9dbab
+ 0xea38b7c7 0x47013225 0x5734eeb1 0x664b9965
+ 0xdfdb5b24 0x42544b2b 0xb0368177 0xcdd7fd65
+ 0x0245a4d3 0x583c1178 0xb1daf428 0xaf7363fd
+ 0x454218d7 0xfd349719 0x518a639f 0x725e0f31
+ 0x0414577a 0x967e7d0a 0x555969b4 0x140e85e8
+ 0xe3938e1b 0x70ee21e1 0x86b18f76 0xe8108b69
+ 0xe3ae5493 0xf27ae045 0x873ace86 0xd48fb78e
+ 0xe7eddaa7 0x2b88f431 0x221a5d60 0x61c01e66
+ 0x82cd0a4c 0xd3e9dc97 0x266c18b4 0xfc585350
+ 0x0f120ef3 0xc4a24ad6 0x7f02152e 0xaf47f02d
+ 0xa9ce53b4 0x0f55b1f5 0xb9ec47da 0xcd673d94
+ 0xc4b60fe3 0x5f56bcbb 0x05f115fb 0x63444136
+ 0x8e588685 0x9555fbf1 0x1bdd435c 0xe188dde5
+ 0xe9738b16 0xfb2ae508 0xb2d9d78d 0x796982c7
+ 0x9e875155 0x60147d37 0xeb317502 0x92c29986
+ 0x639170af 0x56da3868 0x9912a537 0x9b63618b
+ 0xedfa5898 0xe151fb3f 0xcbd5427e 0x3d6dcd3e
+ 0x811273ad 0xaa90ba33 0xdefafb01 0x009d7449
+ 0x295ef072 0xd8b67355 0x529a01c4 0x74ca4584
+ 0x866664ea 0xf8c8b458 0xaa4ab16a 0xfe988c59
+ 0xc58d072b 0x54119dc2 0x50358fd7 0x54983d5a
+ 0xe6c15754 0x726a5f16 0x0ebe004b 0x9d623abb
+ 0x6c88eef7 0xcc851413 0x4307feeb 0xa5da6e33
+ 0x8457b842 0xc8a7332f 0x8951c594 0x0aaa4bb7
+ 0x3accfc82 0x4864f9da 0x56483d4e 0xc46053e6
+ 0x018c47ef 0xa279c96f 0xd1f3d3c1 0xd0b203f5
+ 0x35052ba8 0x70b32239 0x1df89081 0x7bfdf671
+ 0xc7996b1a 0xd5ed7557 0xed503f8b 0xc557f81b
+ 0xd048f722 0x554e29c1 0x936b0699 0x8aa23925
+ 0x4b3c7a7d 0xfabd4f21 0x2c02b0c6 0x5b8009f5
+ 0x0563c1a1 0x898aa452 0x73b29ce7 0x798fd3d3
+ 0xc5dc75be 0x7599dd0e 0x797ffd6b 0xccff6ec7
+ 0xdf73d8a9 0x8d1334b8 0x52710c43 0x6c0a7dcf
+ 0x9e855916 0x709b1835 0x1b44d0c2 0x22d8bb03
+ 0x12dc9286 0x5d2b739d 0x52d469d6 0x540d1947
+ 0x25f75edc 0x3fea9589 0x8dfe2007 0x892d4f25
+ 0xe67129d3 0xc358b651 0x4dc9b1ea 0x25761253
+ 0xb3098396 0xb068cc53 0xf8c8bf22 0x48e27cfd
+ 0xeaf19f48 0xc8a40778 0xaee9c616 0x0024a40d
+ 0xfede7631 0xad81dada 0xdb8cea60 0x929c3442
+ 0x250399f6 0x51f1c010 0x18ef9559 0xfa27cfbd
+ 0x163d0c03 0xd575a689 0x4d4594ab 0x6bd8bf94
+ 0x329a1f8f 0x81beacf4 0xe5af6537 0x737d254d
+ 0xf6bb6bd4 0xe70591fe 0xe7a2c66f 0x58661b43
+ 0x2b984d33 0x997f1f4a 0xe394e796 0x40effba7
+ 0xbfb54ae0 0x1c7dea09 0xed55d2a6 0xeebcee4c
+ 0x75a0fea0 0xb9649edb 0x68a86630 0x5a80f63e
+ 0x5e7dcea6 0x1a039cb1 0x22bb884d 0x6e0fc84a
+ 0x4b8e4a59 0xcd7367cc 0xb742cfdd 0x8a99aa92
+ 0xb2e2466c 0x48b5e5d5 0x8d39a375 0xc925f825
+ 0x728073b6 0x56970db0 0xf33dc778 0xf70a3c02
+ 0x9f1a4977 0x5d18d43e 0x508ecf01 0xb87cb169
+ 0x80e9f7ac 0x578393d6 0x1733c507 0x03cc47dc
+ 0x097de77f 0xf3da7314 0xb9d07a2c 0x1420c666
+ 0x054564e5 0xab2b429d 0xb5209da4 0x4112060c
+ 0xf413eea3 0x93813942 0x6a43af2b 0x1a68b0a3
+ 0xdf7a714d 0xa6324c42 0x539e4d35 0x6636118a
+ 0x943feab0 0xfb4eaa60 0x93c28171 0x467572a5
+ 0x5d4bfd37 0x0caafdfc 0xa3041fa3 0x90931037
+ 0xc44810e5 0x0dd66557 0xfdd770aa 0x5847a8c0
+ 0x96ddcbd4 0x4b6a4fce 0x9bcd061a 0x3932e8d0
+ 0xb69d4a57 0x9af47cf1 0x46736b55 0x29e55e34
+ 0x7300375b 0x179a9a21 0x307b0689 0x96ae5d9e
+ 0xa853f570 0xf841c73f 0xbd94ac9f 0xa64b9114
+ 0x947524f2 0xe38f6e68 0xf1ca7c83 0xce6b034f
+ 0xb9fde58b 0xa706e0c4 0xda3996c1 0xecd1f6b5
+ 0x161fb63d 0xe5536bc3 0x1c07dc6d 0x2805b076
+ 0x0903eb62 0x354107a4 0xe90ff4a3 0xa2054d33
+ 0x1f2a632e 0xd03cb8ac 0x1d8f344b 0xc1ec57fc
+ 0xcaacf346 0x23acbc65 0xfdf934ac 0x49033711
+ 0xc73bc97a 0x5b25c7b8 0xa1ee9a56 0x5a2f95e6
+ 0x9b486eba 0xdac28dae 0xbaed0e0b 0x3e6cab39
+ 0x2a95e4d1 0xc7a7dd82 0x74348dcd 0xbb95024e
+ 0x53bd88c1 0xee00d042 0xb5d577ae 0x6082285a
+ 0x484d5a35 0x2d93c0f9 0x9bce2a6d 0xe3955fb0
+ 0x428133cd 0x07377886 0xb3797f0d 0xa342fa77
+ 0x5834cde1 0x522c80f6 0x7bc9f92b 0xb2237d8d
+ 0xaa9bfa50 0xd00b0490 0x874c71dd 0x139292a8
+ 0x367145e6 0xba90a80a 0xce06e0dd 0x7cb49f4a
+ 0x5bc3e38b 0x4bf1dcf8 0x11213f42 0x99b0a5b5
+ 0x0458e96b 0x7c329c9f 0xc50c5e61 0xed935b3b
+ 0x2c94aef8 0xd9797f93 0xab1cc1ba 0x8a7dc27c
+ 0x2fda9eb1 0xfb865d65 0x9ea8f1f3 0x30a307b2
+ 0xc373502e 0xb3bb752e 0x0b609f6b 0x955ecfce
+ 0x946646fb 0x76b5f628 0x37a00871 0x7a3da0cd
+ 0x0e87e034 0x85500d3f 0x31db1de9 0x30f5832f
+ 0xe30224e5 0x4ebec8a5 0x99ca0ce8 0x418c26d4
+ 0xa264de66 0xec9ff883 0xb690b887 0xfd29d0fc
+ 0x68a93e17 0x3aa30ee2 0x070f19fd 0xd2005cc6
+ 0xd47a807c 0xb93ac4da 0xa3726bc2 0x88d58f3a
+ 0xa91555c7 0x8437fdc1 0xf462a9ee 0xb2554c71
+ 0x4ee039fd 0x361749b6 0x9176114b 0xfb339f0c
+ 0x85c474f3 0xcae87770 0x4c2e9f89 0x2e8b9634
+ 0x415568db 0xde7c55b3 0xbaa534b3 0xa211d29e
+ 0x05e95d73 0x95145b12 0xf1f095f0 0xa16d176a
+ 0xdd7497ea 0xa1079a8f 0xb3b445f6 0x04c63340
+ 0xcfbeb747 0xcfc12f02 0xa29d4ebd 0x70f97ab0
+ 0xcafc8b79 0xdaf6418b 0xd0dd9a11 0xe29dfdfe
+ 0x61615382 0x30f4d07d 0x6d0d520c 0x79624ad0
+ 0x41b07e2f 0x42fca262 0x97994ce0 0xd1a8e339
+ 0x42913134 0x18e4473a 0x893509ba 0xba73d8df
+ 0x90e342b6 0x2205f686 0x71f76660 0x41464649
+ 0x876b6481 0x06622a67 0xb16962ab 0xd709a0fe
+ 0x3f8169f7 0xbc5bf617 0x2ef29aea 0xafbc9dff
+ 0xc99285d8 0x1737fe89 0x7d32ee92 0xd841ccd2
+ 0xa18eb29d 0xb48aec94 0x039987b0 0xc3a9f403
+ 0xa3626dfc 0xfb71f00d 0x9629f7c7 0x612a19be
+ 0xf679ca41 0x89745a20 0x5a9767b7 0x124fe621
+ 0x55eaa08b 0x7dd29949 0x36850483 0x17473919
+ 0xe9a4d0cb 0x36f15505 0xb74c42ae 0x898c4348
+ 0x95f6e4a5 0xdb5c4f19 0x0d2c0fb0 0xd5e62865
+ 0x98d1822f 0x84fbf5c9 0x6a9d0dd2 0x98a5d7d9
+ 0x6b05ec03 0x61e1dca4 0x57681251 0x6bf77c79
+ 0x6bd89da7 0x30ea009e 0xb6479a71 0x11e737c2
+ 0xa619a10b 0x70b16943 0xce2a3af9 0xf29681f5
+ 0xa50db0da 0x2ce2522f 0x64806d0c 0x7e9a0852
+ 0x541ca68b 0xf5deba66 0x57e038f6 0xa1fe4d9c
+ 0x4a2c97ee 0xd1ccaf77 0xee5aa1e7 0xfcbbbbf1
+ 0xc59521e9 0x1d527843 0xbf08121f 0x72d67cea
+ 0xdd1c22a1 0x9d0c51a0 0xd3d5cc37 0xc6737e98
+ 0x0c33deb4 0x5ae1ea98 0xe3f6bb8f 0x0f9e4998
+ 0xdbe9da9f 0x8ecb8d39 0x6b98346e 0x7f229bcd
+ 0x4e1e1537 0xa8afb742 0xd58a85b0 0x232f6bd6
+ 0xa2672db1 0x05d64425 0x9a351d62 0xa8d4ceba
+ 0x28b10a12 0x9ea04603 0xbe969e87 0x238a228b
+ 0x6281a77e 0xf22ec5a3 0x88660a2a 0x81dbb399
+ 0x07106406 0xf3f8e110 0xb1b909c6 0xe5a86a1b
+ 0x0bff6f8f 0xf668d01b 0xe82e9a6f 0x0f7fae47
+ 0xbff65826 0xd31668b4 0x51d1a640 0x807cf8e0
+ 0xa9e7479c 0x1087538d 0x90c8e4c1 0x9f5bf12b
+ 0x50319e47 0x4ec285cc 0xac679b45 0x3a53c86d
+ 0xda2e37e8 0x6c42329a 0x3ae623f7 0x00df9e58
+ 0xa43a58ea 0xefb494e3 0x2a2ddf62 0x1ae04284
+ 0x1088fae3 0x8bfcee8c 0xc85c9efd 0x633cee0b
+ 0x95fdf98f 0xa38c4b7f 0x63da55e2 0x4f3bb32a
+ 0x51e939d9 0x499af23a 0xc09f5791 0xfd4a792c
+ 0xf511d3db 0xf28c1aa0 0x175fcb8d 0x83abc579
+ 0xbceca9b4 0x0ab223df 0xde6f2e30 0x16248550
+ 0xcd361a21 0xfe901788 0xb2e562f1 0x77ac5ded
+ 0xe0d06bc7 0x631c94d6 0xf31d83f7 0x42d22d58
+ 0xd8477e89 0x2c610d19 0x520022a0 0xdfb5ac06
+ 0xd463055d 0x1857521a 0xaa12bc72 0x3e125f69
+ 0x8f409c7c 0x50e55b99 0xa17ac715 0x28d0341f
+ 0xdd31dd1e 0x06632b18 0xf58f5ebf 0x69903d86
+ 0xa1c5b456 0xa783e4bb 0xc407bc15 0xba9f8619
+ 0xcf061535 0x69151522 0x99f5f300 0x8891be7c
+ 0x9fd407c7 0x67e56a91 0x47b89f11 0x0afeace4
+ 0xe5bc3fb4 0x3c8af0a0 0xb034e54f 0x3d0fae58
+ 0x7daf3ee2 0xcfc30806 0xedb46947 0x8f053ec5
+ 0x3bc38e12 0xc7405f8f 0xf7be65d4 0x1e60ba9c
+ 0x38136225 0xed02190d 0x9142a560 0x59d0c540
+ 0xc6b80e9b 0x818b36ba 0x5f63c642 0x4c420bc2
+ 0xd5347fcd 0xfb418dfe 0x0bd6be6f 0xcb978de7
+ 0xda009d22 0xc1bc14c1 0x63b2cf06 0x6e595cc9
+ 0xb0e51376 0xf8e16970 0xe7b14a24 0xc2fc0520
+ 0x8ef3442b 0xf8db738c 0x4e19708b 0x2b8e30ed
+ 0x6393b9c4 0xfb229c75 0xca190ae6 0xcedfd195
+ 0xe75bfa92 0x6e532cea 0x2429aaa4 0xf3b043a7
+ 0xc025b207 0x17d66042 0xfc5c8576 0xb298c410
+ 0x80710b2a 0xf1b32af9 0x5d63a95d 0xcff13167
+ 0x8c5ec446 0xf5927065 0xdc90ebda 0x35126e6b
+ 0xc9604d65 0xbb3742ca 0x7e4b726a 0xeb97d309
+ 0x7577a1c5 0xfae1831c 0x28297aee 0x395b3ec2
+ 0xcd3bf725 0xdb4573f0 0x41f3d4a9 0x316283af
+ 0x1c7deed7 0xb478d2d2 0xf379ff50 0xa447e404
+ 0x15465174 0x8104e6c0 0xe6880b94 0x89361cf1
+ 0x1378a030 0x2e29eaf3 0x911238b1 0x3b66bbd5
+ 0x9267486f 0xa58a4d79 0x43f421cf 0x4b74e99f
+ 0x4a837bb5 0x070b6cd4 0xdcfe2588 0xf26c612d
+ 0x1cb4cf0e 0x9544a3b0 0x81ec2db0 0xdc0b4b9a
+ 0xea69a377 0x3fa3c81d 0x576cf512 0xb5991f4a
+ 0xa0e39100 0x1b2fc704 0x3ae2ec5c 0xde55ad73
+ 0xe3de17ca 0x78455914 0x9e000992 0x602eebd6
+ 0xd53066ea 0xd2fea4af 0xc0808eff 0xe7571192
+ 0xb12fd785 0xc61a8a48 0x4876c57f 0xde3b4fb9
+ 0x21d59d1b 0x77e55c0b 0x47fea192 0x09ec05dd
+ 0x8cdda4ed 0xd07d827e 0x30792c19 0xe6a249a2
+ 0x0ab09c15 0x709b15d3 0x41f6a1b0 0x39222672
+ 0x9eb2db55 0x7cf9e5a8 0xdfc72e5f 0xbf53242f
+ 0xddaf4628 0x52fb1b29 0x212ba450 0xeca2ae62
+ 0x23a79905 0x830f4375 0x935a384d 0x741b1831
+ 0x1f5b374d 0x135eaaa7 0xa12d4801 0x688a49cc
+ 0xf3ab834c 0x2f437388 0x77051494 0xf7d5dc40
+ 0x73b9ae86 0x57cc1469 0x6e017e06 0xcd2a35c4
+ 0xd4b7d26c 0xbec9bfb7 0x6dbf6d62 0x5c802611
+ 0x251cbf05 0x0749f9af 0xea361170 0x9d5a561f
+ 0x22ee92a4 0x419bd3fb 0x6f0c10d9 0xb9c50f48
+ 0xbd6173f7 0x738a654d 0x00d606e0 0xaaafe42d
+ 0x1e5d141c 0x6a081224 0xf8f84471 0x9284a71b
+ 0xb36c9f34 0x5bc3cbda 0xbbd8296e 0x63dc9354
+ 0x4ee4e87c 0x7bcca0cc 0xf0431cc1 0x6244b0ab
+ 0x36df6624 0x985c6e27 0x3268c9d5 0x59fdb579
+ 0x974301b8 0x46cf11c0 0xadc121ad 0xdc3b8804
+ 0xe4c4be6c 0x75fafdf1 0x8a063c69 0x498cf19c
+ 0x0ad8518b 0x3c0d49a3 0x04124718 0x4b4af21d
+ 0xd88b0cc0 0x2a31dbab 0xd419298d 0xc625f2c0
+ 0x034c1ce2 0xc66aa1a1 0x47b5cf9f 0x2e2c0597
+ 0x448a266b 0x850e89e8 0x63fd2ca3 0x9d8d2798
+ 0xaa782d19 0x0e5772f3 0xad61cd01 0xd02548ec
+ 0xd9ba4c3d 0xfe11122e 0x45f6c671 0xa751459c
+ 0xde2f54a8 0x50b0a23f 0xa76c8331 0xd43865cb
+ 0xe682f57f 0x9576ece5 0x993008e3 0xb630ea07
+ 0xf4456220 0x6edd836a 0x3065f85d 0xdf3a879a
+ 0x50098784 0xb0d8ed1a 0xf7c5e468 0x67a3ac63
+ 0x6bbe8a10 0xd8a3fe90 0x95e59763 0xab20bf63
+ 0x917c2bd6 0x6cb8941d 0xe4850103 0xc01e8eb0
+ 0x8191a18a 0x957b65fb 0xc5386e7b 0x7ebbe153
+ 0xae923977 0xb8307243 0xdc249419 0xdffc3c54
+ 0x3ecab7ab 0x906bbfc8 0x8775aa1e 0x62476cec
+ 0x1fd5b9e0 0xca51a7fc 0x3c2b7f21 0x73c3ba73
+ 0x16197c1c 0xecfb2470 0x9afae107 0x476a3680
+ 0x0aeef302 0x10e6ff0e 0xf9d26c2c 0x321b693c
+ 0x6631a566 0xc3159f11 0x5220ca36 0xae16a624
+ 0x15228e05 0x3a0e0c7e 0x95abbf47 0x97d035b5
+ 0x3dfb2c57 0x1c449f22 0x161bb69f 0x4c9a334c
+ 0xb7cf2717 0x0066444d 0x6654a9fe 0x09591653
+ 0x8b5b70e7 0xd54200f1 0x0b73e933 0x72fb76f0
+ 0x28d263ef 0xafd00a3d 0xfa5dd759 0x08c4d2cd
+ 0x95439811 0xe819f8ae 0x2e4a8449 0x1f924127
+ 0x05b8eae7 0x65af5b24 0xa51f1b52 0x54d9dca3
+ 0xdedc6e38 0xd2dcba1b 0xdaecf27e 0x93c51700
+ 0xeea32dd3 0x9db8347a 0xa6a58eb1 0x7c097ac2
+ 0x040d3ded 0x8752cf61 0xcaf09da1 0x855d91ea
+ 0x90376107 0xccf430ad 0x8f5b608f 0x61b2d6c5
+ 0x3b7cbf6e 0x139c6b94 0x24794bfa 0x8c39d7c0
+ 0x1ef0a524 0xcf5b7d94 0x0209d271 0xdee02cd3
+ 0x0f1af81a 0xbe9b4cf7 0xd509cf9c 0x2fc088ab
+ 0x1b0d3a93 0x3be3df49 0x6edd166b 0x7b5f00c9
+ 0x6ad579e3 0x97ea1c1d 0x256d1964 0x4c450442
+ 0xf7d65fe3 0xe9f864c6 0x7b5b0cc5 0x02d13af0
+ 0x127b46a0 0x272e7f0b 0x9a4af66e 0xc1538ffd
+ 0x89438219 0xc5fbfda8 0xd7111981 0xc150fca0
+ 0x69cc6bc3 0x3f34a55e 0x3e54ee9c 0x20cf58ea
+ 0x4e4193bd 0x5e299bdb 0xb58d48fc 0x32b8399d
+ 0x4f54a5c3 0x066d0d6d 0xf0de2923 0xf2ad5145
+ 0xbd606fd0 0x2e94a5ca 0x44812a53 0xa54983e2
+ 0x7a371445 0xacb230e4 0xbf26afff 0xd2d6e689
+ 0xd19ef29b 0x687f6230 0x7c4d14e5 0xd5b3a33a
+ 0x9e35e3c2 0x4a431c1c 0x38beae5d 0x38f1d918
+ 0xf78bc898 0x996a8439 0x78ed60b7 0xf78dd0ae
+ 0xc01feb81 0x33800ee4 0x052f09e5 0xd247411a
+ 0x385464ba 0x11c3f9d2 0x305fd9fa 0xdff2def2
+ 0xa90c76e7 0x140945b8 0x10f33abe 0xc00f77e6
+ 0x54f6844f 0x826a12cf 0x33474a58 0xde2b7ebd
+ 0xe28abd2d 0xf8107730 0x410a0c2f 0x71902891
+ 0xff7199d9 0xa46e3539 0x6087cbfb 0xb123c666
+ 0xf246206c 0x81dddf8b 0x8d33ca1c 0x647d40b7
+ 0x7ff9e364 0x623aea75 0xb839bf91 0x78add7e0
+ 0x9554d372 0xa160cc75 0xe3b028ec 0x47059b9a
+ 0xb250818f 0x261b9303 0x3673e559 0xf26abc26
+ 0x2f94fbd8 0xfa815b57 0x17471b5a 0x28e31a21
+ 0xbf5b8654 0x08eb2da5 0x5ec7fe01 0x2607b68e
+ 0x65f7b4ff 0x60bebcc0 0xd7a7367b 0x29dd0f2a
+ 0xafd7aa3d 0x78cf6f36 0xf143f863 0x1f6bb8bb
+ 0x191e3d04 0x1c98660a 0xa13b16ca 0x5bb60bc5
+ 0xdb384357 0x078b2125 0xd85c1f6c 0xac0c0ddc
+ 0xd2bc3fef 0x9bdeba33 0xf2cc03a2 0x12c73d2d
+ 0xc8aa452f 0x641dcf0e 0x5b3144e2 0x26f3b3b6
+ 0xb8fa61ec 0x8be854f8 0xf8be5bd3 0x370ce815
+ 0x77aa5ef1 0xb4fdf0fc 0xb5006075 0x5752a3cd
+ 0x9d61154d 0x5b3d86c2 0x1760e58a 0xd18f5c6a
+ 0x6d6ec175 0x7f858ccc 0xc3df52a8 0x42f4dbaa
+ 0xc35573b9 0x5158f16b 0x8d5ca72e 0x85110274
+ 0x2fe27489 0xbd40ab31 0xa85ea42c 0xbfe3f636
+ 0x8c08b37c 0x0aea1ddf 0xa50cd8f0 0xe559318a
+ 0x2a280158 0x43847f6b 0x3a078777 0xec615237
+ 0xa56396af 0x696ae4ae 0x4d855505 0x007ff90f
+ 0x47d03918 0xa7d310ba 0x6e53e746 0x149e77d7
+ 0x975feab7 0xfe1c7b97 0x9a8abf4e 0xbb3c7a37
+ 0x84038c2a 0x954d20f4 0xee5d8ed4 0x11da739f
+ 0x20eecc04 0x5226db0c 0x8c5369d1 0x78ed6585
+ 0x8dd1cdf0 0xb46c10ef 0x141a96db 0x92ad7d97
+ 0x4e7e0836 0xf1cffda9 0xad2fdc2b 0x6843beff
+ 0x9c59468e 0x94217ef1 0x1d49c692 0xa498e16e
+ 0xa135ecde 0xe7adddbd 0x54bc7af6 0x6585df75
+ 0x4f7e2c7d 0x1c9a2488 0xd9dd192b 0x0b263684
+ 0x08be6e1c 0xab6002d9 0x2c6cf690 0xbba8405e
+ 0x4c3e7c5e 0x35dc1a2f 0xa56dd38f 0x5674802b
+ 0x41c87fbf 0x99fbc6b1 0x47b51a74 0xd51a67e6
+ 0xb499a89f 0xe0d1a3c4 0x38deb3d1 0x68f4c97f
+ 0x2422bda9 0xe879354d 0x57c1863b 0x10c6ce01
+ 0x1d9a72dc 0xe5cd2133 0x2ddb9094 0x6e92e0a6
+ 0x26f6dfec 0x0e68265a 0xb6c2f28f 0x08817db6
+ 0x3cfb4255 0xabe020c3 0x45259016 0xa8501b1d
+ 0xfaeade6e 0x7de9daa0 0x34e019b1 0xb22d2a5a
+ 0x84a6f3f2 0x1d970bc3 0x53ac86d0 0x177c49f9
+ 0x79ca257e 0x0657c1aa 0x791594c5 0xb15d7c7e
+ 0xcd111b31 0x20bdb043 0x3d31dee6 0xffd66121
+ 0x0a8f413d 0x7a1bd1eb 0x58340242 0x434aeb92
+ 0x03bc4a31 0x9471e1d5 0xd4f3c2ba 0xfff0d8b1
+ 0x9bd13e3e 0x7cd0a853 0xe3d6f849 0xe1017a2e
+ 0xd925ea81 0xb22e87ad 0x0512c884 0x58854850
+ 0xdd9f682c 0xe94b2977 0x2161cbc8 0x0e253a5a
+ 0xda691f0d 0x05c8e4fb 0xae2ba23d 0x8f5297a9
+ 0x279f4c37 0x63cc89ed 0x928d2eff 0x08c231a0
+ 0xc2748444 0x192845d2 0x0754964e 0xd2845816
+ 0x06933750 0xa4c9163c 0x634ebd9c 0x2a9cfec2
+ 0x477cb9c4 0x03f50d10 0xbdbe4f84 0xe9736708
+ 0x6e48bbcd 0x8837479a 0xcf8b2793 0xc4188ea7
+ 0xa342d8a6 0x94ea9d9c 0x8e44db11 0x9c086ff7
+ 0xd8b8678d 0x5c90df79 0xb7d837c4 0x839db0a5
+ 0xfa26efcb 0x5bff775b 0x8599f333 0x2e4c99f6
+ 0x32c3f18e 0xe6e2e6c1 0xaa2df9da 0xb346c52b
+ 0x24f2ff8d 0xe2da722a 0x1e163221 0x013bd00e
+ 0x72853bf6 0xdeff1305 0xb85f22ee 0x880ed484
+ 0x8a006bdf 0x8a5636d8 0x25b3559c 0xc76d7673
+ 0x63545968 0x13d65171 0x00a2ce44 0x06d87d03
+ 0x6ee7639d 0x9613e4c5 0xa93b5e85 0x100d6a2e
+ 0xa131e34a 0x1adf9840 0xc6654177 0x2f07a13f
+ 0xb7ef41e7 0x2230a4f3 0x810d8b9e 0x73851a6c
+ 0x05624fcd 0x9bd58867 0x628e8263 0x48c59a8a
+ 0x52758d7c 0x06f156ac 0xebd23187 0xec5a26b4
+ 0x66ee70a7 0xe6ef0cae 0xfe2d03ff 0x90d11944
+ 0x042622dc 0x285c0075 0xd4765aab 0x4bb300b3
+ 0x7138d3b8 0x40ad4f50 0x98095640 0x133645d5
+ 0x9ccf9b91 0x263756ce 0xf88d9aa2 0x18022ea0
+ 0x9fe4cd01 0xdb2dd0ae 0x43fea9ad 0x3e420109
+ 0xf4d75e7b 0x3a350693 0xba2af5ea 0x65ab5787
+ 0xf170d42b 0x3186e0b6 0x02003a01 0xf606588d
+ 0x0fa8746a 0x31c76bde 0x61dac6c8 0x2f8741e9
+ 0x10204434 0xef31c0bc 0x37862053 0x16f3aff9
+ 0xbdc93959 0x06113d52 0x05647a65 0x154ea551
+ 0xdb8c097c 0xa8a23927 0xeb4cd475 0x8ef48ef5
+ 0x7b8896c9 0xa9911410 0xdd9376f9 0x14a2c712
+ 0x8ee98697 0x00435529 0x96f1929d 0xf965796c
+ 0x868df4b5 0xa9a9949f 0xbaa8e792 0x8cec9579
+ 0xa2546f3a 0xd324b50c 0x76a77cbd 0x8e324208
+ 0xe4b0577e 0x9a10e51f 0x84746ea0 0xb90a795a
+ 0xc2664e9d 0xb5b5ecde 0x0e25e165 0x550ddc30
+ 0x2c60d566 0xd65327da 0x52ee1c96 0x5c99b4aa
+ 0x90582271 0x1beb1ef2 0x76c95767 0xfea6fe91
+ 0x446c8801 0x3e028055 0x4867364d 0xe4aeb591
+ 0x1c19ac36 0xc69a5dc0 0x9b611e0c 0x332c3288
+ 0x200a1cfb 0x0ebbb255 0xa5f61529 0x350c8644
+ 0xedccefa3 0x4385fb5c 0xba009b5c 0xa5de8f29
+ 0x70988978 0xd67053e2 0x6124b992 0x30499dc0
+ 0xef642b9d 0x8828a259 0x4edca94e 0xebbc2986
+ 0x37977b75 0x3501bc3c 0xbdd23c96 0x4bed7e8d
+ 0x2e80a7b4 0xe6cc07e5 0x15099be4 0x394497dd
+ 0x4e534eab 0x9afb903d 0x09036115 0x0a1d7a1c
+ 0xb5e0a5fe 0xf12ff4de 0xb22f3c00 0x0513ceba
+ 0x8b148c80 0x4ea14c55 0x2fc18fae 0x15a0e676
+ 0x1f408a3b 0x9678064a 0x350ec108 0x36f652c9
+ 0x9220195f 0xbe718685 0xe792afa6 0x259c3b51
+ 0xad820d8c 0xf9caf47d 0x32e5ff95 0x00e6f06e
+ 0xe81f1a95 0xa5f97ad7 0x350b2e6f 0x4838b3b6
+ 0xdaa037a4 0x6ce2194d 0x2b076b6f 0x27e7eee9
+ 0xb781298a 0x9990ae04 0x4a4f4708 0xeb7ce242
+ 0x2ab8ad07 0x52d044a2 0xac8d193e 0x6d791816
+ 0xad7c794b 0x44d78639 0x91b5162e 0x57aaa1ca
+ 0x5e6ff7fa 0x3873ad1f 0x41328c73 0x7d3c66dd
+ 0x4cd194c7 0x4557bc1e 0x27dac112 0xb617bd0f
+ 0xa24eaac4 0x069d5819 0x4e21ebd1 0x8f2a90c1
+ 0xe0b28919 0xfa11d5cc 0x66b0fd7f 0x6db8dd9c
+ 0xb747bfa8 0x43a3b201 0x0fade0a2 0x2d0116ba
+ 0x253f9ab7 0x6ae02746 0x01b7192c 0xccdeee30
+ 0xf3cf3221 0x5a983db0 0x97990f27 0x1438f1d6
+ 0xef7f94d0 0x2c393d1e 0x66c502c7 0x471fc8bc
+ 0xe3267158 0xb5582cd1 0xae56aeb2 0x54c43f93
+ 0x846297eb 0x58b6ad13 0x1df7d00b 0x8b1b5524
+ 0x01bf5010 0x93b77b5b 0xcce61136 0xe2793e61
+ 0xe673bc9f 0xdf16f114 0x79a1b96b 0x8c03a05e
+ 0x5c176d75 0xf75ea263 0xe3d750d5 0xce53b6b3
+ 0xd92e7564 0x000a1ad1 0x96f88a71 0xbd820682
+ 0x29c17ea2 0x4b36c1e0 0x21329442 0x248d464f
+ 0xc4c38dca 0x1e8f055e 0x9e599834 0x1004a6eb
+ 0xadb8b9f7 0xb9cf7630 0x913afa99 0xe0977242
+ 0x230eedf2 0xd126d72e 0x00d1fe3d 0x033acebf
+ 0xe416523f 0x1e9b5e6e 0xfdb78e69 0x9fff4953
+ 0x570b41c5 0xd2e47e82 0x22233676 0xb89da5b0
+ 0x9742b8b7 0x8d33deb3 0x07157406 0xc5114ab3
+ 0x787f2e65 0xad24323c 0x23f2911f 0x37c589b3
+ 0x793411f9 0x4d0356a5 0xc6cca656 0x3e4dd7f5
+ 0x8c2df38b 0x0b758f7d 0xd218e47d 0x39c1c194
+ 0xdb0e18fd 0x19a1518d 0xffaf2297 0x99f30028
+ 0x67951418 0x90b6f209 0xd5a711ad 0x4aadf909
+ 0x21e9e1ac 0x9f85f773 0xd76d159a 0x24994f98
+ 0x4c194536 0xdd86aaff 0xd0f74edc 0x741c554b
+ 0xc25a7fb0 0x8a4a4292 0xb133d05f 0x2b33fd66
+ 0x03cc58ec 0x09e15000 0x9f720886 0xfd131f33
+ 0x67f4b431 0x4bee4aec 0xadbbeccf 0x4d678c46
+ 0x42c9c72f 0x2b73e922 0x3faec5a7 0x0138b3e3
+ 0x443193de 0xf0b949ed 0xf283cb89 0x22b28882
+ 0xa29dcebb 0x8c0d1c73 0xc3daea22 0xf50acb6a
+ 0x67b06286 0x33094641 0x9e8fbe70 0xfc052237
+ 0xc538eea7 0x525cf5a7 0x1efe9ab9 0x8c21b545
+ 0xc9c0088d 0xbbdd52b2 0xbfc15c89 0xee8cf0f9
+ 0xc2916f7f 0x0a442773 0x1f067f1d 0xd54fca53
+ 0x1eecf171 0xfb4fa5ba 0x276f45a7 0x7510c282
+ 0x64cfb998 0xbd969384 0x264db253 0xdcd7ed53
+ 0x163a2bc2 0x6bd6bfcd 0x43735319 0x2228a09f
+ 0x7f4d28ab 0x8fd9e6d8 0xc18753ac 0xdf0df0b7
+ 0x6840ca57 0x17edb14e 0x8d2517c1 0xa7cd3870
+ 0x65940658 0x382b14f4 0xfb9ea817 0x817f16bf
+ 0x0c25f424 0x848ed419 0x4b7e7167 0xcebc30f1
+ 0x98f7bf89 0xc224284e 0xa99c99cb 0xb8b90159
+ 0xdbe97c71 0xadebf568 0x15b1a7c5 0xcb7c3642
+ 0x44c47cdd 0xc6c7b478 0x018ff834 0xbaa64b64
+ 0xdc0e482d 0xedbcb019 0x23589e7f 0x7166836d
+ 0xba733222 0x9d7ef1dc 0xf1d4ea52 0xbe21fa73
+ 0x41f00e61 0x8dd0fcf7 0x9ae06374 0xfa21c5cc
+ 0x6ba9148b 0x3ffee3f5 0x896c451d 0x1fe6b43f
+ 0x632ca681 0xa795b698 0xeeb0d107 0x9ff78e0f
+ 0x72971a84 0xbe663043 0xb001eb08 0x24e917a0
+ 0x7bdaf512 0xb40cd0e0 0x59ed30e6 0x2f635261
+ 0xcf762a6c 0xcf781328 0x08c7627e 0xd6e14cc1
+ 0xc03aa675 0xa376a246 0xaae23178 0x95f70090
+ 0xedf90ba0 0x8cda6565 0x2e6261be 0x5d4946a1
+ 0x60153db2 0xb54657ce 0x5d49d847 0x458449f8
+ 0xdc7c3328 0x561e2cbd 0xbad5cf83 0x8e99e7ff
+ 0x69008abd 0x84414ea3 0x63506a20 0xc524448d
+ 0xc276be82 0x6f0f31d8 0xd9c611b5 0xa127120a
+ 0x7f88a013 0xebd4f643 0x633a626c 0x35379824
+ 0x5f962a57 0x8a668612 0x3d246d96 0x95b47fe8
+ 0x546cded4 0xa9c6e986 0xe80774ef 0x78c678a5
+ 0x7275593f 0x111eb13a 0xf1a89c2e 0x5886db2c
+ 0x3af60fe7 0xa307a283 0x54ec2412 0xacad4002
+ 0x3690a492 0x4d670a97 0x1df719f8 0xd53736a4
+ 0x1ce1985d 0x0be32571 0xf50f4774 0xc8db8b5d
+ 0x37ff1298 0xeb95a35a 0x27ae0b93 0xb74430b3
+ 0xe8df4d1a 0x3bae1697 0xb69cc560 0x3a7d46ad
+ 0xf1a03663 0x98cd1809 0xc5c138c2 0xea8bf120
+ 0x5d238c1d 0x871bd60f 0x7cdb6d30 0xf744fa50
+ 0x90973d60 0xe8fed7dc 0x9081b4db 0x7ab73dfc
+ 0xae12622f 0x80430feb 0x7ac39c71 0x7a345a34
+ 0x672b0550 0x15fd64c9 0x5b9dbbe1 0xc2334a32
+ 0x8f0d1dbf 0x1cc62305 0x99a6a3ac 0xd24c1124
+ 0xc3f6c035 0x5ed2e9bc 0x82d59437 0x4f00d4b1
+ 0x146886da 0x5c21fbdd 0xa07f5135 0x1f018efd
+ 0xbd680c54 0xf02713b2 0xec5ef134 0x1bde8262
+ 0x2d2444d7 0xf9131281 0xa947d0a1 0xf4129df6
+ 0x89c35065 0x0c3d5ad1 0x60e696b8 0x0fc55db4
+ 0xdc758cd5 0x82a84515 0x814c1b5f 0x7498d93d
+ 0xfb3c4409 0xb832cd16 0xac239a91 0x49064edf
+ 0x59fc8e3b 0x0324c18d 0x30a36f75 0x9ef23737
+ 0xae3b6b8c 0x6896faaa 0x4cd93534 0xc8920a2f
+ 0x3fed0f6d 0x8e8d2da2 0xfeee93b0 0xffd4834b
+ 0x0b88a1b7 0x9aea4e4c 0xdf7b41e0 0xc9f35c19
+ 0xb3dae0c8 0x340c0982 0xf4070909 0x4664b23b
+ 0xd6734d91 0x9be09b71 0xc2a8e1a1 0xab15460e
+ 0xfc5bc1ab 0xcf95f3d8 0x09a83b2d 0xfe81cbd8
+ 0x0c06d827 0x0a8bb0c4 0xb1f0552b 0xde60c26c
+ 0x3abf0a63 0xca2afce7 0xaa11d850 0x28d866d8
+ 0x6d8a0e80 0x7bcc5705 0xadca3aa8 0x06a26ae3
+ 0xb1477649 0x7328d96f 0x7d483848 0x53082689
+ 0x7c0e5568 0xb49decdd 0x851de7e9 0xba15c25e
+ 0x0b9f0e30 0x465e4921 0x8152ab4f 0xe62880c4
+ 0xc3b6b869 0x1acda063 0x45733b33 0x4b40b8e9
+ 0x58f506d2 0x6e8be867 0xeef7fb60 0xb7ed8306
+ 0x30b4a0d1 0x0a3c07c4 0x91e3abf6 0x118fde6b
+ 0x20ed11f0 0x2978d6d2 0x6ab8dc87 0x16ab61ba
+ 0x556cf833 0xb2f5c1c0 0xe87dd9c8 0xb015c2f7
+ 0x1dc9ef29 0xd9f171fc 0xc9f5e442 0xb6912d66
+ 0xaf6dd636 0xf8582905 0x0faae085 0xc87d4004
+ 0xfa94e438 0xc2f1880b 0x154c7079 0x3e27171d
+ 0xfc248d10 0x1b595188 0xe415add8 0x4315d693
+ 0x724ebc18 0x2dfc4a77 0xded78c2d 0x570e4ddc
+ 0xd88a1c25 0xb11a0496 0x2ac230ba 0x864e053c
+ 0x3c376fc8 0x5afbe1ac 0xe0ccd689 0xaa9264bc
+ 0xd966fbb0 0xa1a4bb29 0xc6e9748a 0xcec607d1
+ 0xffa72d3b 0x5b61b779 0x18d55e21 0xf5a5e9ac
+ 0x13895dac 0x0c01e53a 0xcefe8daa 0xece628fa
+ 0xb2020ce1 0x895cd83c 0xe32d1283 0xfb192758
+ 0xa57d64e6 0x78ad9183 0x3ce3220e 0x6ee76140
+ 0xfd84b385 0x6016b54d 0xdfa35264 0x4cbdb8dc
+ 0x349fe6c1 0xf5fd349b 0x3feaa7f0 0x6a00146f
+ 0x69790627 0x19dba070 0x2e5ac7f2 0x44dc51d9
+ 0x0dc9964d 0xd1c8a3bf 0xbcb213e9 0x62708b00
+ 0x67c6e855 0x2fc3c32a 0x0ec04e0a 0x5053f5a8
+ 0x6f8411e6 0xb399d84e 0xaa5ae55b 0x05bbd2f0
+ 0x02b4d130 0xe88178bc 0xf2e68c0f 0x4aabdf1a
+ 0xb683e6a9 0x775ba61c 0x36633c31 0x67ec74b7
+ 0xf093c02e 0xc45f244e 0x46476822 0x4250586a
+ 0x516fabf7 0xb6377c04 0x5f278798 0xa1068782
+ 0xa55916d5 0xc4ad5f97 0x60a5e69b 0x98119ce5
+ 0x76fc3f59 0xf8e46ee4 0xaa28a397 0xfc325000
+ 0xa70f3091 0xa5ca51d7 0xd69bbab5 0x20c64fcd
+ 0x2b378365 0x80c58577 0xc0962ec2 0x48b0fb39
+ 0x054e046b 0xcde8e446 0x566f37f3 0x936fd623
+ 0xf18c729c 0x09220d87 0x929fb871 0x7a6c4db6
+ 0x62620ed2 0x5f9ce765 0x0d0c5d2a 0x6260a50e
+ 0xe7399a16 0x6357e512 0x6b781814 0x5d4d4a63
+ 0xf94b0172 0xa77bf890 0xaae5e81b 0xc1ebe8d6
+ 0xb4874555 0xe4263fb3 0x22030975 0xa50d2c79
+ 0x4faa81ed 0x81777d4e 0x9f7fbe6f 0x7448bbc3
+ 0x42ea31f4 0xc8c26fa3 0x6701902d 0xf2f286a4
+ 0x2040990c 0xe2058471 0xd58263fa 0xde37591d
+ 0x2870ca90 0x56881bea 0x09052b3c 0xd8de66f8
+ 0x3a8f1e47 0x9ca9676a 0xa6767532 0x5f3dfae8
+ 0x17f7a245 0x93bcffb1 0x192d9a5b 0x07f0c3d7
+ 0x9fca4550 0x7b97103c 0x1e7f070a 0xee31d420
+ 0x88f4fc4c 0x18df3074 0x4840065c 0x70801f9b
+ 0xf0d6f2bb 0x51995f3c 0xe2486bad 0xccc10902
+ 0xe6c9e135 0xa8224250 0x7f55294c 0x001884e7
+ 0xd6010027 0x572d3941 0x51eb6de5 0x3d25faf3
+ 0xcc1f170c 0xeb25e5a2 0xd8d10187 0xd91cc741
+ 0x63f5f7cf 0x241e556b 0x5875f757 0x2a86f545
+ 0x778ff93a 0x6643fbe3 0xdf07a6f8 0x3e11e40a
+ 0xd93c6e6b 0xe329e272 0x3f874626 0xdfe61dd8
+ 0x7fe956e7 0xde945710 0x0af24d62 0xb6554577
+ 0x7d874ee0 0x6c0cdf4d 0x9c0d53af 0x5b053be7
+ 0xa0c4529d 0xb6fed9d0 0xc01a138f 0x67c644b8
+ 0x57aa439e 0x0035775c 0xc9f8a8e2 0x35975f57
+ 0x14a11132 0xf0ed9e83 0x9c02cdce 0xefd3c079
+ 0xd740ccb1 0x6aa5e5a1 0xf4645565 0x0bfa46ef
+ 0x3a17a81e 0x5ffa56a0 0x94fdaf5d 0xa8e7afb2
+ 0xe5b7c2b9 0xcf6d846d 0x8655fecb 0xd4e8e697
+ 0x42e0b2d7 0xd96d8078 0xe7683d61 0xe00f6e63
+ 0x3ce9e37e 0xcc570a3e 0xca16e27d 0x56fe882d
+ 0x0e8b75fa 0x5b543aa0 0xa4ee347a 0x436fdd0d
+ 0xd10f01d0 0x996cbae9 0x1242e354 0xe6af0ffd
+ 0x8dee4a7b 0xd7b8c02a 0x1b600476 0xe3b9848e
+ 0x9f8638ee 0xbc6411fd 0xd2abe239 0xa911b870
+ 0xd25d8edd 0x9dac4009 0x415262ca 0x8086ac62
+ 0xeeaf0402 0x93ad90e4 0xa4b907ea 0xd82fa99a
+ 0xa3be7fc5 0xf3008912 0xa14a7be3 0x7f18097a
+ 0x98011536 0xfb6f5aaa 0x353b0592 0xb0099fd7
+ 0x7ce6ebaf 0x0a5d50ca 0x0e5170ad 0x55b9b7c4
+ 0x7647e14f 0x1c53ec4e 0x0f649237 0xf4c8a704
+ 0x0cb77104 0xa93b3965 0x1e0d4e4e 0x3f4c655f
+ 0xbbc12d00 0xebaf8942 0xd3a7d859 0xbd9c5ed7
+ 0x5dd26423 0xedaa0468 0x43ab3093 0xb1a592f2
+ 0x6376fbdd 0x0c09822b 0xee093680 0x9344f19d
+ 0x886f3fdf 0x156b18ef 0x0a68374a 0x9235b0bd
+ 0xc1b73296 0x23346073 0x95b1c61f 0x315ad69f
+ 0xe511947b 0xbbbffba3 0xd7bc8761 0xe391da80
+ 0xfd6b5f18 0x8e701be6 0xfd0e9497 0xd1dd69f3
+ 0x11162d48 0x7e42681f 0x3dc8f5c8 0xcfed2aad
+ 0xe398244c 0x72877aaf 0xad97fbad 0x9460384b
+ 0xef192c6b 0x475b0941 0xa71eaf40 0x126ac591
+ 0x6c09e2f2 0x70c1f80d 0x0a1e37e4 0x47e318d9
+ 0x2dcc4467 0x0dc45110 0x3790f0d6 0x9eec3632
+ 0xa1c9d51d 0x929233b3 0x70036b1c 0x3314c529
+ 0xc50b5feb 0x49a1c810 0x4390f561 0xaa2536e1
+ 0x3afa43ab 0x6d099434 0x1ba2d09b 0xcffb902d
+ 0x86a25119 0xcbbbc618 0x0416cc6a 0xde1e3001
+ 0x4fe993ca 0xd74274a7 0x287ba439 0x1ee5e5c4
+ 0x410c3fa2 0x10e7893f 0x6007874b 0xa7540560
+ 0x6d9b1a86 0xb9bfb618 0x8f68bc50 0xf96b9da7
+ 0x3c73bdfc 0xef2a83f8 0x616edf09 0xfb2160c1
+ 0xa27a35de 0x71287947 0x17722ae0 0xc670a323
+ 0xb96c4cbf 0xd2361a92 0xbd0c3913 0xb1315762
+ 0x4f462140 0x6b7a3473 0xb4cf5725 0xa9159313
+ 0x0ffec555 0xa8dc36c3 0xd3b855ce 0xd21e9b35
+ 0x83404c24 0x980a8108 0x92aa9331 0x8f46cd7b
+ 0x71a4fe47 0xdb707645 0xf6e61196 0xdd292a49
+ 0x0102d727 0xbf0885ae 0xd2731f27 0x1474503a
+ 0x393bb25e 0x3935f820 0xe27f70e1 0x863b68f4
+ 0x1f6a1476 0x0ca52e45 0xdf5c0782 0xcf837ef6
+ 0xb39f8ba5 0x983c4c86 0x2fd37a76 0x80cfbbd3
+ 0x1372c7e0 0x3fbf087f 0x9c6cb8dc 0x17c43488
+ 0x7957e195 0x929ccea9 0xf1e821bc 0x8b3f7506
+ 0x7046f2e7 0x4559cfea 0x853ba7b1 0xca19b920
+ 0xa6b2f987 0x41c7711f 0xbcf81c0c 0xcbb42d22
+ 0xaf132f3a 0xb8f46a2e 0x53a390d8 0x717b172b
+ 0x0582849e 0xe71702cc 0x2aebdc71 0x03b0208d
+ 0x887bbfab 0x7797e8d1 0x76bfe070 0x7550a939
+ 0xc33376f9 0x7cb173f6 0x931a578f 0x99960aa9
+ 0x758ff5be 0xc58beee1 0x63777d94 0x1220dc29
+ 0x4da97584 0x6c8d686c 0x40d46332 0x043f78ef
+ 0x7d602ee8 0x348fe2e2 0x8a3e167d 0xa5f2435c
+ 0xa9d1c73b 0x301363dd 0x07578742 0xc997b680
+ 0xb000c89b 0x981a8a9c 0x6567829d 0x4b9750e8
+ 0x27634808 0x811b5d35 0x5519c0ec 0xad00c70f
+ 0x417c2317 0xc8782d93 0xc9accc54 0xd867de4a
+ 0x6b9a83f6 0xfaf1546a 0xfc49986a 0x9c5c038b
+ 0x327cc0cf 0xd1290d48 0x3077ea8f 0xd4949041
+ 0x873bcbb3 0x7e9016e6 0x8a84424c 0x1b88c983
+ 0x3dfa44fb 0x8eaa7f32 0x05f5aabb 0xffe970cc
+ 0x7aa14ac9 0x666ab28a 0x4baafbcb 0x0642f672
+ 0x1e8bc896 0x7b8128ba 0x1be68a85 0x2696df42
+ 0xe8cf0ea2 0x8298c7b4 0x3425a85b 0xce460218
+ 0xcb65ea8d 0xc6200c9a 0x01a1672a 0xfd49e891
+ 0x18fcdb44 0xca73729b 0x4056a413 0x16dc8bd5
+ 0x87be0bf8 0xe3106ab4 0xe5319b2f 0x930a1b26
+ 0x254804a5 0x4088ac10 0x8581aed8 0xe40f6bad
+ 0xb9ead8aa 0xa7abeaff 0x500785e0 0x2c707afa
+ 0xa561968e 0x378866bd 0x55a67cf4 0xfaa68c33
+ 0x82055d2a 0xb4481f33 0x326b5fa7 0x1db474bc
+ 0xae894f21 0xdecdfafd 0xf9411b19 0x9a8947a6
+ 0x0c6baf46 0x215aba04 0xc2b175d5 0xf67300dc
+ 0x7f421ff4 0xfac75b42 0x101ff909 0xd57ad5b9
+ 0x7278981f 0x58065ac0 0x895e14e8 0x7896dc2f
+ 0x3ad7ce32 0x78fba2ff 0xa2d72bed 0xabec76be
+ 0x00fea962 0xdcc0c142 0x0804f109 0x978331d8
+ 0x8ac9bca6 0x590373c5 0x9a1e5701 0xbf14e8bd
+ 0xb7a7c018 0xa1f899cd 0x39aa72ba 0x115eae69
+ 0xa68d971c 0xd8bbd9c0 0x558288f8 0x5d23047c
+ 0x90a17c2d 0x865b74c0 0xf4002788 0xbbc54132
+ 0x8067d761 0x35e99e73 0xa54e4f96 0xfed8426a
+ 0x4fd78d1c 0x30d474e0 0x8a568169 0x1ee9566c
+ 0x7e029e9e 0xc2a01e4e 0x2d7c4cad 0x6d7ed9f1
+ 0x52c8f409 0xb294db7e 0x6786422a 0x1c72d1c6
+ 0x9d0eeef7 0x550189b7 0xf40e3406 0x433c7dc1
+ 0x01d9e35d 0x5481f069 0xe74f8018 0x48838c41
+ 0x3e9957c6 0xa8503414 0xf6956426 0x94b7ae28
+ 0xd2fec0d4 0x369fa1d3 0x3bece7fe 0x2fc55ff1
+ 0x8e778511 0xaf6f26d1 0x1793d266 0x10855993
+ 0xcfd10bd8 0xc42cebc7 0x8a823d22 0x0edc6d62
+ 0xdee868ef 0x75ee74eb 0x16ebd54e 0xc607e8ee
+ 0x7c279bb6 0xf4834322 0x9f788766 0x0e826e3b
+ 0x943cd7f7 0x0903d01c 0x6ddb7cd4 0x4f39e33f
+ 0xc893b860 0x79839901 0x77d1cdec 0x9be4a741
+ 0x9cd9e1b0 0xe5a560ba 0x23123fbd 0xe116354d
+ 0x65f7a549 0xfed35af4 0x4696626f 0xb5308a11
+ 0x99b6681a 0xb062578e 0x7692e3ba 0x9ffc6640
+ 0x6c77099f 0x2bbd6944 0x540b15c4 0xb87a5b81
+ 0x403854b9 0xa1ff1832 0x5c0d39ef 0xb0c2f3cb
+ 0xc88e7a47 0xc9d3a08f 0x0602ad28 0xed10a525
+ 0xf1bc7158 0x74fc3b5a 0xd27e2488 0x7d10527c
+ 0xe6564780 0xb047d1ab 0xeb3d26c0 0x8caf9cb8
+ 0xb4400f3b 0xa183efd2 0xe1fc540b 0xc7951df4
+ 0x6f4652e0 0x2cf8f3f9 0xe4b1135a 0x83c0e6b8
+ 0xa908b003 0x60ebf691 0x9a4e7b21 0x3ee9660d
+ 0xc9a0e97b 0x0a8dafe0 0x694c2d14 0xd118c90f
+ 0xc652e0cc 0x1eecbb3d 0x7722833a 0xba6ab804
+ 0xd8bcb08d 0x7631e04c 0x606ed699 0xe430a0ca
+ 0x4cd5344f 0x460ade64 0x365954dd 0x48a94382
+ 0x2ef6b381 0x307026f0 0xfccbbaba 0xa1cb149b
+ 0xcfaca235 0x7573cf3f 0x59e30226 0xc34754de
+ 0x4836647c 0x234f6b6e 0x296623b9 0x39f9fad5
+ 0x30fb6818 0x37f0caa4 0xa611329b 0xa305e080
+ 0x52518c08 0xd4cf686a 0xf9443a8a 0x2f2c6edc
+ 0xd7c6da54 0x508dad11 0x34c97df1 0xc9e112b5
+ 0xa4c55bf8 0xfde85123 0xec1995ad 0x4b159772
+ 0xcdb9a9e3 0x00e59bd6 0x949ff262 0x6870ea55
+ 0x53e01298 0x7f1af410 0xd612c321 0x50890531
+ 0xabdffeb4 0xe90e3a7d 0xb0a21b46 0xd8a4381f
+ 0x05efac53 0x7828ab6d 0x97ea883c 0x9b1791f9
+ 0x916c1312 0xe9a6a482 0xce2354f8 0x3f88ac00
+ 0x627f11b7 0x5146f6ca 0x076619ef 0xd12a9579
+ 0xb6bae5a3 0xbe467c99 0x373377c4 0x9f603c7e
+ 0xf94fa407 0xef84def6 0xe212c11f 0x5b367294
+ 0xf1b4d822 0xd41ffd05 0x796b994d 0xfdac8700
+ 0xaa9f21a7 0xaa29bd36 0x27f6a0c9 0xe3c24d00
+ 0x01457132 0xd365542f 0xabc67f64 0x22be8484
+ 0x96996a6f 0x491d1511 0x46119041 0xe4661409
+ 0xece6fea4 0xd8cc7bdc 0x1ebd7316 0x196342a9
+ 0x9a4b639a 0x2a3d4a91 0x40ed9b55 0x0f1b6e64
+ 0x1d87f823 0x0a39b16b 0xdadb12fe 0x17681fce
+ 0x9bc6d11a 0xd16b2739 0x140ae9b4 0xf7113bf8
+ 0xa46d1e3d 0x30fcad8a 0x74a51593 0xce47d530
+ 0x36147ece 0x9cc3d588 0x65cf29e8 0x0f53d6d3
+ 0x0e395cc9 0x95761b1b 0xb9d2459a 0xb731a236
+ 0x0c2e674a 0x7122028a 0xd97d5d6b 0xe8bf97d3
+ 0x20818d68 0xbfcdedfa 0xfbd356c2 0xf188ed5b
+ 0xde98b65d 0xf7cc0cdc 0xa9850a26 0xb72adde4
+ 0xfbdc55b6 0x25302654 0x96be612f 0xda23e5c0
+ 0x69a73ee1 0x8238db8e 0xa96dcf06 0xac59ea7d
+ 0x02c65753 0x4f70b819 0xe776a631 0x069addb7
+ 0xf490c4b1 0xf371c06f 0x6ec67932 0xa6330f04
+ 0x27cd9f4a 0xd83c1c5a 0xc5694a43 0x325dd140
+ 0x447db53c 0x7396f3ff 0xc7880953 0x5c549557
+ 0xe2f4b5ce 0xb0e76e9a 0xfc00d782 0x8486f191
+ 0xf233b315 0x0a012053 0xecab1590 0x44dbd9a0
+ 0xda6fdb6f 0x72fb14d9 0x29a510a1 0x872477ae
+ 0xb68c69b3 0x7bc5c5a1 0x65b8eaf2 0xb8df1f74
+ 0x763a249f 0xcac51253 0xb1262ba4 0xda0240b7
+ 0xbc5d5306 0x8145ffdc 0x18de6fa7 0xbad3d62c
+ 0xa4704d64 0x49937584 0xb6e23070 0x1a52daab
+ 0xee4d6d3f 0x114316da 0xcfe1f9ed 0x113f059b
+ 0x866276a4 0xb44bfd0c 0x9a3814e7 0x94cc5b56
+ 0x33d97b0c 0xe039e9e2 0x3a50af65 0x90d0a868
+ 0x8b0bef64 0x3bb9ad2f 0x8cd6c272 0x9eb8dc74
+ 0x28ef58af 0x7f148173 0x30ae7e14 0x2b195aba
+ 0xc06f2611 0x285dc687 0x4e478b83 0x68ba56a2
+ 0xc8621a4d 0x677c1ed4 0xea608196 0x56db4818
+ 0xeb1a991d 0xe831ce79 0xaf0a73fa 0x824af713
+ 0x716c7ff3 0xbada6d94 0x5c527a29 0x0fbcc995
+ 0x19e46890 0x98d9ed33 0x7346e056 0x38ef97ca
+ 0x61954b61 0xd7f6262a 0x66958560 0x7f819169
+ 0xb2b4507d 0xd3195569 0xb65343c6 0x8f41a137
+ 0xef451985 0x4c1d64d4 0xc11073b1 0x70fa9ad1
+ 0x9267ba0d 0xc81d9c45 0x6d1752d5 0x478c366a
+ 0x1012d652 0xee249e82 0x78e6ba3e 0xcb606c77
+ 0x183bcc85 0x981591eb 0x688dd24b 0x39c0dc8f
+ 0x18490bd2 0x2988f05c 0x0198a8a4 0xb726e7db
+ 0xb8b22960 0x5a98d5f5 0xdc573a70 0x0c067bd0
+ 0x14158bcf 0x0758e6aa 0x9540ff4b 0xe04d6072
+ 0x0a60b4f6 0x2e854f09 0xa661a639 0x7603ee18
+ 0x482ba591 0x5fd484d5 0xc7ac02b8 0x451e0fd6
+ 0x9f2664ab 0xddc1292b 0x983e51ee 0x083845eb
+ 0x58cba0cc 0xbcc0839f 0x95d80521 0x4ec6ecb8
+ 0x131f7f90 0xc80028a8 0x522e2f62 0x7913cdb7
+ 0xa0aedbe1 0x689ac9f0 0x1d18af9e 0x191a35a2
+ 0xeaad470b 0x31b9f01c 0x9876b1ea 0x3dcd966a
+ 0xb60c1c25 0x00e65e53 0x7d937058 0x2e364755
+ 0xbb51ade9 0x8fc87b67 0x97201168 0x74f62b85
+ 0x6b5535a0 0xb2fd7002 0x16d7259b 0x415845c7
+ 0x9ff14fa1 0xd1bc7f94 0x229902a4 0x6529a970
+ 0x8a8a5ad0 0xff260d37 0x6ef8b883 0x05909698
+ 0xa26166d4 0x2c80f99b 0x21dff93f 0x18d3a4b0
+ 0x2a22f2fa 0x450d310a 0xbc680337 0x3a894074
+ 0x4ab8f0c7 0x35f0ec7f 0x1e700765 0xc9b45e45
+ 0xc5e5cd92 0xb9bf35fb 0x2c1283a5 0xbc17d662
+ 0x36be245d 0x312c7793 0x173a40f0 0x2716b170
+ 0x18c94462 0x12cd09e3 0x1bbc3e56 0xbc2d8db1
+ 0x4f5c1910 0x5b03a6ea 0x4adbdfa6 0xf6510e03
+ 0xcffa5b3f 0x32f1dfeb 0x5151fca8 0xaa899aa6
+ 0x095163c7 0x034a2dc6 0x119ccc45 0x5089ba30
+ 0x8f605161 0xfca7b679 0x0b0d3cfc 0x17667004
+ 0x5991b404 0x168f0961 0xea0a6032 0x80a6e02d
+ 0x518dd20a 0xa33fba9a 0xb448524b 0xde77f2cb
+ 0xf0bb2fed 0x2e344125 0x8cd3bbd6 0x4be001c4
+ 0xd59940a8 0xd75b88ab 0xebc55155 0xe15a63eb
+ 0xb25b3baf 0x2a503a20 0x1cc7b5b6 0xf4781bda
+ 0x8fa6c80b 0xfe9bc60e 0xbbc20a81 0x34fc30e3
+ 0xc160951b 0xfedb32ec 0x6226dea7 0x394b55bf
+ 0x6ef58d68 0xda88652e 0x3dd7e95a 0x53eb3784
+ 0x023e6f7e 0xcf3fce9f 0x788d1782 0xc9cf4764
+ 0xec4fbd7d 0xba5ed578 0x3db7b6c5 0x4f9a2913
+ 0x692b39f8 0xe19fba7f 0x1e4635ae 0xb96750f3
+ 0xdff7f86c 0x266e0859 0x6fe19f49 0xf03c8d64
+ 0x411b1e7d 0xaf2d0738 0x949c2d8c 0x64dd3e1b
+ 0x88f857f1 0x7cd7d82f 0xabf654f3 0x7b08709f
+ 0x4d667d83 0x0dcf9a64 0xe9510ab9 0x1cac7a7f
+ 0x9ba52176 0x4b116870 0x653c69c9 0x4b04c2ba
+ 0xc264a49c 0x2a2d17fe 0xbf793418 0x9c43ebc0
+ 0xcbb51084 0xbe23359c 0x969bbda2 0xe8f18626
+ 0x9496cb51 0x49e4e3f3 0xf2a0e552 0x85f73f27
+ 0x2d73397a 0x67a9790c 0x30b56dd6 0x3d3c4339
+ 0xde7d3b49 0x35df9146 0xad463797 0x24ff300e
+ 0x70eabbad 0xec91b2d2 0x3edbddf9 0xc7d1ec6c
+ 0xdfd36d9f 0x0ef9f5d6 0x2c93a79c 0x0881c5ed
+ 0x1f917edf 0x83c9e7f3 0x7fe3a8cc 0x63ea6979
+ 0xeb2592c0 0xe34ea996 0xacfe886a 0x9841349e
+ 0x72d33942 0x3d7994d0 0xefb87989 0x5e919048
+ 0x117bf886 0x78c4bd90 0x2518dd07 0xa9f4ba8f
+ 0x824c7761 0x715e2b8f 0xabc1d28f 0xe8d11551
+ 0xa0ebfcf5 0xc4e8e475 0x4aedaf53 0x3eba506f
+ 0x9efbd03f 0x65930a1b 0x54162482 0x13bc5795
+ 0xf07d4219 0xbe96bb9c 0x3b0652a8 0xff9bc37a
+ 0xceb3361b 0x45ef9496 0x0d679c2e 0x54b90bf9
+ 0xe1e6f7ed 0x399fca25 0xa1edcc32 0x69da91ef
+ 0xfbb0519f 0xf939a80d 0x5b4418e5 0xb87c864f
+ 0x71f29282 0x8af506d5 0x0f6a1769 0x7a453a63
+ 0x2a1a4d28 0xe3af59c5 0xc343e93c 0xbe190abe
+ 0xda0cec62 0xf562b05d 0x1c9f969d 0xada2b4f8
+ 0x9f9d639f 0x0ca15660 0xd600753a 0xf10bdcbd
+ 0xe8d94653 0x27607854 0x0ec38c17 0xa2fcb299
+ 0x7bda5fdb 0xfda12488 0xa51d5737 0x61e276dd
+ 0xb203a049 0xa2253af6 0xed6a68c0 0x347fe408
+ 0x6c889e60 0x91537e12 0xd6b090ac 0x5241ec82
+ 0x46b47a47 0x22ba24cc 0xd390918c 0x57b7f9b3
+ 0xb28c2647 0xb0884c10 0xf9442a57 0xed297050
+ 0xc25a169a 0x29f969c0 0xc8e6e374 0xbe45f5be
+ 0x8254008a 0x03d600f2 0xe20b0159 0xdcf69252
+ 0x04a2f075 0x64cc0458 0x2a5d1e2e 0xa756d276
+ 0x45038103 0xa6946d8a 0x72471fc4 0xc32219ad
+ 0x123e790c 0x889ca543 0x274f179e 0x30a6dd69
+ 0xc3436de5 0x5ee6c85a 0xc98bb4dc 0xc7a1640a
+ 0x6d480d57 0x89ace207 0x0022e802 0x7baa70b4
+ 0xc14939cb 0xc82e3e3a 0x5700dd7d 0xae8a85d7
+ 0xfac3f05b 0xc660876c 0xa7acbad9 0xe64b9bd5
+ 0xa4a3fd88 0x96b5b5db 0x0b2c458a 0x350977b8
+ 0xf8ba5d2e 0x5ccf71bc 0x559f6cc3 0xa587703f
+ 0x79916dbc 0x1641d1f8 0xd95b6190 0x6b1adf04
+ 0x108b4f7d 0x639480d3 0x6e3e9153 0xb558d84f
+ 0x39bee031 0xfed4cf3e 0x0f926ee2 0x6f293d71
+ 0xadb974d7 0xa4af8308 0x04ebdfd9 0x4d72c486
+ 0x7189fc9b 0x88aac2eb 0x8075004f 0xa4cca679
+ 0x297683a5 0x404fccff 0xc81fa29e 0x869b42a4
+ 0xe6befa09 0x7988f040 0x7726b931 0x6f7ab84a
+ 0x65415536 0xff448bec 0xdbc9faa4 0xb8d99cc2
+ 0x05c4119e 0x8a71c8b4 0x77dfd31f 0x43965cc1
+ 0xf24b4a0e 0x607f9e17 0x1ebb9b1d 0xe0c8f95f
+ 0xb6677dc6 0xdc7813e5 0xb72ad65e 0x63aeb087
+ 0x2da79eb1 0x4f39c354 0xe28d2d2f 0x0f1e904e
+ 0xa84941c0 0x0deabd41 0xff332281 0x1ae46042
+ 0x54b90c03 0x77d5a3d7 0x4136b5a9 0x54055050
+ 0xbbbcad66 0x01237f9f 0x6796b0bc 0x72d4b550
+ 0xea1489e6 0x84127d77 0x685db4f5 0x1b579f48
+ 0x1b0cb80c 0x7ddeeae3 0xe1b04653 0x7cb328f6
+ 0x8b53c4b3 0x26b38fa6 0xd9ea9db2 0x97d07575
+ 0x5325e316 0x3e4865a1 0x7605f5b0 0x2b2c432a
+ 0xbf2a4911 0xd3f098da 0x8ec35801 0x972ff2a3
+ 0x7498b7ff 0xb347e5da 0x9d319a41 0x68d55b0d
+ 0xc38b06c7 0x06236699 0x5b50a289 0xb04b5593
+ 0x258220f7 0x52f79ed2 0xfae73314 0xbc146ffd
+ 0xc8ff7536 0x4a7bd89b 0x35d7820c 0xc52c327d
+ 0xad70c777 0xdc9ab7ee 0xf59059de 0x8a202a38
+ 0x841616de 0xb50fbb2b 0x15db36af 0xc6292480
+ 0x05d33a0e 0x2b8e0f35 0x270aa710 0x0d450937
+ 0x28fd506e 0x5fce3b04 0x0dcae2fe 0xef5e5d20
+ 0x7a123a26 0x21787b80 0x83ae38be 0xbb44f0ad
+ 0xbfe52dd7 0xbd8cb263 0xf08eee72 0x7d0b5481
+ 0xd67b0e59 0xeb83bf7c 0x08f45985 0x6db3d92f
+ 0xf7d444d7 0xde90570d 0x376012e5 0x103f6713
+ 0x6bbec763 0xa6a53541 0x6ab0e563 0x62c3a5b0
+ 0x3729c63e 0x5e5e5255 0x0956e38a 0xcddcce0b
+ 0x862029a4 0x43ce75f0 0xde44bba9 0x025a4bc0
+ 0xb56373bc 0x801d2752 0x7b8e43c4 0xc1c4f98e
+ 0x5b3ced72 0xb12b6d0e 0xf831eea5 0x86fe9cd8
+ 0x49e97afd 0xf57778ac 0x6ffb8af2 0x785c4068
+ 0x5028671f 0x6e0f7f2f 0x9fbc8287 0xe612d670
+ 0xbe06c51c 0x5961a0e4 0x296ab25b 0xe545f4c2
+ 0x8d6abeda 0x36236cc9 0xd42f13a9 0x9bfa1f5c
+ 0xc3dea740 0xe48a8ecb 0x24f8958e 0x6c47104a
+ 0x993a7ab5 0x5968bc52 0x424d7ca6 0xa4bab037
+ 0xcc874d2d 0xb8c035ca 0xee9dab38 0xfe6eeb13
+ 0xec2e2888 0x6f1a25ac 0x47079ed3 0x64448864
+ 0x9c3abce8 0x39554f34 0x4fdc2516 0x62e83b0e
+ 0x89ae118b 0x830dbe87 0xd690788c 0xc8cc9080
+ 0x3a42ed7e 0x183d66cf 0xbeacb93e 0xc1a7f489
+ 0x908a957a 0x3b26b582 0xea796e6c 0x0126ee1c
+ 0xcb1ddba7 0xd0abf353 0xb84f703e 0x320ae8ca
+ 0x294ef6c7 0xb5392b49 0x14349529 0x77d35a23
+ 0x8716cbd3 0x30366d70 0x4111270d 0xb0eab53b
+ 0x0af79f25 0xf5055b55 0xf0f405c4 0x1a4b5f3c
+ 0x834dc5c4 0x28a6a94d 0x66afc445 0x6b919abd
+ 0x879cb288 0x1302d221 0x8506e8cd 0x8ea7f251
+ 0xe630b16b 0x7f5ff8bc 0x025613c4 0x8e39dff7
+ 0x2f37fcf9 0xdea4d4a7 0x0d142386 0x3474db56
+ 0x6e3f8281 0xe85e9b0d 0x35802ead 0x78df0490
+ 0x9f07130a 0x1e5ebba4 0xe3c4eb8b 0x53a643fd
+ 0x3cacc272 0x9c350f45 0xa9ffc6f0 0x33505268
+ 0xbf9cb138 0xe84f5f72 0xa70b5d31 0x270d7255
+ 0x9b7d1b27 0xa3ae79cd 0x1a5daca2 0x64d248f1
+ 0xfde0526e 0xb6cfab0b 0xcaa5153c 0x8b5bc478
+ 0xbbd48c11 0xbce8c336 0xd9927e55 0xfb830699
+ 0x959cdc2c 0xf82c8dcb 0x6a0922c0 0xe0d731e2
+ 0x4ef480d2 0x6abfcdfa 0xb1fcac91 0xae5d5570
+ 0x93fd9108 0xd87be502 0xe66b673a 0xb423f9e0
+ 0x50312a00 0x8227fb4f 0x23f8fe77 0x045be66f
+ 0x949dfe02 0xd89ad331 0x01f0d93d 0x298b0bbe
+ 0x8564e712 0xa8a0c3dc 0x34da9c65 0xd98403da
+ 0x63583086 0x5ac590fb 0x388f235c 0xc7090997
+ 0x2359701a 0xdab76a4f 0xc501b263 0xb3306224
+ 0x77bdedb4 0xa1d5ed6f 0x83158d8c 0x108f24c2
+ 0x99bdb36d 0x62c37d36 0xa2ca0ad4 0xe2a7157d
+ 0xc1e42c60 0xebc6bd09 0xc64014a5 0x6e54c35b
+ 0xff07c3eb 0xe0224076 0x197d14ad 0x15ff9320
+ 0x57e80375 0x6dff371d 0x7ef4f618 0x56f3d7ce
+ 0xb5f5a648 0xa03a659d 0x228fbe9c 0x90a947df
+ 0x64e0c7ea 0xa048640f 0x81286c34 0xcb623e91
+ 0xeb3c3fd9 0xdbcfbb16 0x514e3d18 0x8e8949a8
+ 0x328a537b 0x78e6bc3e 0x644976d9 0xf594ed10
+ 0x9063943c 0x4a326109 0x5d22ca4b 0xa8a18e45
+ 0x3b595bfc 0x279941cc 0xaf068b0a 0xc4a187b0
+ 0xab6a6326 0xc2de2ee6 0x7818b4bc 0x7152e588
+ 0x3510f808 0x5a622603 0xea234cf2 0xdca5bcfe
+ 0x83ff3c4b 0xfbc24843 0xf025c9a7 0x57821ade
+ 0xfcc774eb 0xafbc2016 0x384cb8b9 0x83af43b8
+ 0xb2ebf04e 0x26713404 0x995d1dc2 0x900fa7e7
+ 0xa4deb71c 0x975dbf56 0xa48fa012 0x310620df
+ 0xc5598e91 0x6f45a7fd 0x5740bd08 0xbcd195d9
+ 0x9fc787a5 0x5f7b8497 0xd29dfd42 0xc90ff52d
+ 0xf343cdb2 0x1cfef760 0xf6a02280 0x36713753
+ 0xc0301693 0x621156a0 0xbe327c2d 0xbe57f87f
+ 0x121f3a07 0x4d2ca830 0x1a2ef579 0xe86282bf
+ 0x94b32361 0x1bb08daf 0x20fc1ab7 0xc51e1307
+ 0xe7c478d2 0x3c745aab 0xb10152e1 0xa9cf7c19
+ 0x89855a05 0x5b704936 0xe36c89c4 0xbca1a384
+ 0x91e82ff9 0x411b14b2 0x1552702e 0x80c5af7f
+ 0x16c3f0e6 0xb7d8c710 0xc5b230cf 0x2de00aa1
+ 0x93e5270f 0x329d3ecf 0xe83c3c8b 0x9bd37e80
+ 0x13bb17a0 0xae432b8b 0x59b7358a 0xdd84498b
+ 0xe9ea3be6 0xf9548f7b 0x43a025f9 0x6f3f3278
+ 0xac4994f2 0x29d409f1 0xfa324b13 0xf4bf0104
+ 0x4b868bb5 0xeba9cc94 0x74775fa5 0x4fdec109
+ 0xce1a1b1d 0x86ab89aa 0x5473e3c5 0x684b1ccb
+ 0xf68461ce 0xd006c423 0x097ea953 0x23a61db8
+ 0xc8c56849 0x337bc22e 0x78b0916d 0x5f0eb33c
+ 0x9a8e2d61 0xb8ab4e25 0x294f3db3 0xb5020fd0
+ 0x0f43b95f 0x23076282 0xdfd9f6c3 0xb6b208a5
+ 0x7df4b794 0x8d2375c1 0x18e026da 0x4f3522de
+ 0x910b4556 0x0cc98fb9 0x68589bd8 0x50bb610e
+ 0xf29788c7 0x563b4441 0xe7c4e0d0 0x68dbba01
+ 0xeb69f724 0x019944ba 0x9bc51602 0x67ad65ca
+ 0x31c651b8 0x3621cdfc 0x27a77d52 0x8a0edd16
+ 0x7418e206 0x1430bd7f 0x53759d95 0x460226b3
+ 0x30fa67f8 0x44c40861 0x3e22f99e 0x40f3e0d9
+ 0x4cc0e0f7 0x03b1a264 0x32e26344 0x4ef8f76e
+ 0xdcd4b02d 0x62484f68 0x904d89cc 0xe60e8ea6
+ 0x1823d081 0x77c356dd 0x38de841a 0x8f9c3276
+ 0xf73f3a7b 0x2c38808c 0x0b18b659 0x7cf5a2cb
+ 0x45c3f848 0xa5cd8536 0x9168592f 0xc5a7830b
+ 0x31d6e527 0xabfbee52 0xe4f41303 0xb1798316
+ 0x624d1b54 0x39acf8ba 0x250c9a4f 0xb1ec2879
+ 0xc51f3935 0x7bbe7772 0xde143dfa 0x35f62871
+ 0xa1ac9091 0xa9b4fe98 0xdd25a0b9 0x1a49582a
+ 0x42abd4d0 0xe68090f2 0x3be4e0c8 0xd7a98dfb
+ 0x9415e78c 0x0e2f25b6 0xe2517c54 0x8212fd75
+ 0xa1493204 0x57c6c0c0 0xa51c5338 0xa72602af
+ 0xe26e502f 0xb5cdc20e 0xd711026b 0x0d4744c2
+ 0xa75f1f5c 0x7e98dd5a 0xfeb81356 0x4ff292b6
+ 0x52858f48 0xfd5a2f28 0x05c1b427 0xdb5071b2
+ 0x4d9aa9e0 0x43e7b11c 0xfcf9da70 0x397ee628
+ 0x1325a404 0x869bf482 0x5d4284ab 0xe59039b1
+ 0xb2f472b9 0x6cccf2be 0xe5860615 0xe1c20ea6
+ 0xc30bffeb 0xf86aab5c 0x446775e4 0xb62213a0
+ 0x960f81b7 0x23ad7c64 0x8a22c1a7 0x4af56b4a
+ 0x39a5b6fd 0x5f16c382 0xcd54fbfc 0xf4a8047f
+ 0x708963c4 0xd1d91e1e 0x635e3948 0x3db3e84f
+ 0x9e38efa8 0x59031133 0x79599df8 0x83b7811d
+ 0x573a60f5 0x9fce4a92 0xe550dd56 0xa491f069
+ 0x7c50dc04 0x38ef5b6a 0xa88ee00a 0x4d021489
+ 0xf82d4f13 0xd2e795de 0x80bcbf5c 0x365fd054
+ 0xb862cbe0 0x634e92b5 0x1871c57a 0x55b6028c
+ 0xd2d70f4e 0xdeccb131 0x7888c633 0xc6486b0a
+ 0x67f528de 0xa710f46d 0xa84916f6 0x88188cdb
+ 0xbb72ec33 0x6685b1e2 0xafca9c5f 0x4b4ff1df
+ 0xb84a26df 0xb5fafa79 0xed525284 0x46d4932f
+ 0x69116a8a 0x49b167f4 0xa01ef38c 0xbc85cb0f
+ 0x25f77bd4 0x8f8a549d 0x1ca73743 0xf5757669
+ 0x2f302bf7 0xf5f89a9a 0x850bbabd 0xd85f2611
+ 0x1370b3ef 0x3194d277 0x4e9104f4 0x6c757e5e
+ 0x00422879 0xa5bedbd8 0xda29c3cc 0xda0df97f
+ 0x4986d231 0xd9a24305 0x35359723 0xe2e2fc93
+ 0xdfa20ccf 0xdb202187 0xdd4dd677 0xaec9fa31
+ 0xcc5de9d3 0x3d3460d1 0x48814829 0x72bb3ed9
+ 0xd33fea2c 0x9dd872b2 0x0878cfce 0x6dc204a3
+ 0x1a0dc040 0xfe15f8a1 0xeb165407 0xa9236b28
+ 0xbee03665 0xbf6fb1d7 0x4f3e87c4 0xe0c58e45
+ 0xa065b3da 0x5708d811 0xc266476c 0x9bf4e0ed
+ 0xa009cf43 0x7e1678df 0xdb1cd3bb 0x11a4d5a3
+ 0xb3721b58 0x4665e493 0xcf7b5bbe 0xdbdef294
+ 0x98d670d4 0xaf774cd6 0x66c1056f 0xa51d6b95
+ 0xbee90c56 0x6c2a920b 0x77822353 0x8b20fc95
+ 0xb2e9f29d 0x111bbbbd 0xacc7a3cc 0x5bfa6e52
+ 0xf548020f 0x306e7ba7 0xc14ede01 0x1a9a20f0
+ 0xfeeda674 0x441655fe 0x130b52e1 0x7fe59c0d
+ 0xd6e4a90d 0xa4653fa9 0xb4575119 0x64896de5
+ 0x475f2780 0xff765b43 0xadeb9ed1 0x989bdcd8
+ 0xf44b6c79 0x75549280 0xb093079e 0x9139ab67
+ 0xfa370961 0x9f0db1e1 0xb8b7a467 0x640ab754
+ 0x0d9e5503 0x23fde51a 0x55234ec4 0xd8174f65
+ 0x5665c027 0x43b50f76 0x95306f9d 0x7231c9dd
+ 0x30722113 0x19f4294c 0xe82883c6 0xbe15602d
+ 0xac3e5845 0x4dbee450 0x9bfcaa49 0x02a5ec77
+ 0xbeb8c2db 0x3ecd47a5 0xa4505c0e 0xb57a1dcf
+ 0x4e6157c6 0x726e81c4 0x724417a3 0xa845ff42
+ 0xd092f15f 0x457acdfd 0x021e4490 0x63d0ab88
+ 0xa91a2dc8 0xd4018359 0x37957d6b 0x03916903
+ 0xa9d4b39e 0x61ee3040 0xc0973510 0x876fe7c9
+ 0xa7829080 0x9f747a29 0xefd1fa92 0x4d4adf60
+ 0x96c15b07 0x2fb1a011 0xf0513da2 0x384992e7
+ 0x8b0eb4d8 0xa56f7d38 0x9f924e97 0x8f78460f
+ 0x7a3ee93f 0xe2831c12 0x3cdb42e8 0xeb44f1f5
+ 0x9883ab8c 0x29bc9b34 0xb1f32100 0x27ab14cf
+ 0xc13d9735 0xb5084ca4 0x340b41cb 0x94e588a7
+ 0xf95c347f 0xd9f09df4 0x1fdf7f5f 0x7a484ecb
+ 0x314abdd1 0x5d97adcf 0x8f9b457b 0x72d89c5a
+ 0x7ecd4d97 0x3e13b400 0xb4ae4fa2 0x26b28084
+ 0xc6b580eb 0xc59f8e20 0xa209204b 0x41486eb4
+ 0xdb34330e 0x5a2d83d8 0x9c194f64 0xa331ae66
+ 0x65b33445 0xdf5b0598 0x425eb210 0x011686eb
+ 0x0aac53d2 0x7de4871d 0x8053f014 0x518266e6
+ 0xcfe9855f 0x6c62e9f3 0xda2f8d5f 0x8522507b
+ 0x1aac59df 0x93ca496b 0xaf50e69d 0xfd4000d9
+ 0x91b4a050 0xdbc05f1a 0x1f16613b 0x365756d0
+ 0x314ecad2 0xed4da0c0 0x3f04494f 0x4d0487a5
+ 0xfe0b97f6 0x0e5162f4 0xcf57c254 0xf7becd61
+ 0xdb0d3617 0xbe713ff9 0xdb9d96b8 0x2b4168cd
+ 0xa2ac42b4 0x964cb886 0x150716f7 0xce8348f5
+ 0x503f4c5f 0x03a1a8e6 0x6b0e90f0 0x2ea85d46
+ 0x8204eee0 0x969c6d74 0x0e5b18ab 0xb683d620
+ 0xfc9b44b9 0x729b1784 0x2f843558 0xf183fe38
+ 0xe2e99f2b 0xa9ae04e2 0x3a60d35b 0x2d345909
+ 0xca2c5694 0x12f45060 0x7028db3f 0x07f99dab
+ 0x960585b0 0xe5dbc6e2 0x5b8333c5 0x2b77f77b
+ 0xc8e70635 0x3b0d7224 0xaa76a60e 0x543807ba
+ 0xbecc8819 0xf70cffc4 0xf0932f38 0x7f999e10
+ 0xc88672a1 0xd9b885a9 0x4b613e9c 0x7875a265
+ 0x2ac88b77 0x240d3c64 0x3de65ac9 0x03b8ce0b
+ 0x1c0a3859 0xec94f5db 0x6ceb845a 0x3e9d648c
+ 0x1e6c80f6 0x5ee477de 0x30d37b65 0x697b5489
+ 0xe8f84f71 0x3a5aad3b 0xd093bd75 0xf27813a8
+ 0xd850c6ce 0x7c699f67 0xb32b5d26 0x4604321b
+ 0x51a9024f 0xf817aebd 0xf27aaa31 0x20157d53
+ 0x866dbf73 0x72d2f58c 0xd5fae491 0x04cb4f4d
+ 0xf2c06b8d 0xbeefec8f 0x274302fc 0xde6e2b68
+ 0xee8520fb 0x44fa81f5 0x9e4055d4 0xa3dedb68
+ 0x9c40949a 0xcaa4b068 0x2ac6c7bc 0xab627d4a
+ 0x415a2c59 0x6e14347c 0x5da07b6d 0x1c1be5de
+ 0x8fc0f7af 0xc100947e 0x11db7ee7 0x120c92f4
+ 0xcd4f972c 0x590ff1d8 0xbc1e7a7d 0x51697cd8
+ 0xe48b3420 0x4ea3a431 0x7dd0c153 0x5391d2d4
+ 0xd5c5c82c 0x5967e1ce 0x3d44c2a2 0x80f79d91
+ 0xe90d518f 0x2cb4956c 0xd9ed5294 0x5cef41e4
+ 0xfadd2823 0x8974a1e9 0xd376fad3 0xb192a385
+ 0xe48e2a26 0xc8df7700 0x043c9ec4 0xda39fe0f
+ 0xea574fb0 0x7ad30f35 0xe9154ca1 0x474e3d20
+ 0x6e6af557 0xfddf5772 0xb96fc3e4 0xa39a3f3b
+ 0xfb108495 0xd891364e 0x6f8dceef 0x9f4921af
+ 0x3310b829 0x6670dfe8 0x0662e875 0xabfb9b48
+ 0xb5ae9c13 0x2603e556 0x88c7cd3b 0x9b1beb93
+ 0x254b9fbe 0x32042c8d 0xa5e305c4 0xe1a69795
+ 0x02b81164 0xe2969e8e 0x7a8334c7 0xf19489a5
+ 0x205e36f3 0xdc863e7b 0x513d2b00 0x66368a3b
+ 0x7088ab84 0x4907bbdf 0x318ec4a6 0xd89c5d2a
+ 0xb5a796e8 0xc0044431 0x017a5037 0x2d3b22bf
+ 0x53bb1800 0x2519bada 0x961b8b5f 0x6f8aa8b1
+ 0x13a0ec62 0x1e89cff7 0xcd6ab65d 0xb187e96f
+ 0xf09827b9 0x8972b571 0x09f1e590 0x7bfb46a4
+ 0xa49cbccc 0x71e0777e 0x33c08a90 0x9999922a
+ 0x7d18dd73 0x5dc04a9c 0xd578531a 0x9996dc76
+ 0x56e7e2b8 0x18e5c221 0x90c07367 0x353e133a
+ 0xfc70611d 0x5c89f9e2 0xe9d83fb0 0x42d8ce60
+ 0xc0fabf53 0x6481010b 0x6840f4bd 0xac103abf
+ 0x2e574f00 0xa3a2d595 0xa96bdc16 0x4627aa4e
+ 0x405f6973 0x4faa2d6b 0x861834e8 0x45b6aa35
+ 0xa8c437f7 0x13184d3d 0xe7a2d71a 0x2d8e591a
+ 0xc5315a50 0xff13cc9e 0x1a249f13 0x9748fd21
+ 0x8f17f18a 0xe86acedb 0x061fb9a9 0x43fcbd4d
+ 0x0013d58e 0xb832aa50 0x23dc785f 0xc2088707
+ 0x7a5a0011 0x93cb4118 0x30804a87 0xc0410f49
+ 0x96588905 0x2598c587 0x76a3e974 0x3ae34f59
+ 0x9e113af3 0x718ead7c 0x8a85d4c1 0x4fd9c57b
+ 0xf6b1d5a0 0x297aec3d 0x0a98d4b5 0x98c7e81a
+ 0xa1196f44 0x4e601b2c 0x09307ef4 0xb766e44b
+ 0xb184082b 0x9e2d9eb9 0xf8f96c72 0x2558ca03
+ 0x24598851 0xaab04461 0x0af930ff 0x5902e1ae
+ 0xca847d84 0x96cda635 0x5676016c 0xc4fc69e2
+ 0x8d86599c 0x3bb10688 0x7f574931 0xd4c1dc88
+ 0x2538bcc8 0x77bf368f 0xe9482551 0x205b869d
+ 0x8b226ad5 0x3e02371d 0x6b0640c3 0xe6c4d539
+ 0xb88fa4e0 0x98fadb9f 0xdc4884f2 0x049eeac6
+ 0x7412f993 0x7f04835d 0x337bcd06 0x492e1391
+ 0x118ad88c 0xb30a1834 0xd810970f 0x37b6ec63
+ 0x152c4a59 0xbc3e88f3 0x18ae1d16 0x86b98276
+ 0x4dd2c554 0xdfad199b 0xec00978c 0x7206c96f
+ 0xb440b8df 0xab8ab54c 0x0aeb14c3 0x6693147e
+ 0x952fd529 0x97e2311d 0x8f8be60f 0x06aa4644
+ 0x88c56174 0xf4f6092f 0x8b724d86 0x6e413836
+ 0x6376c213 0x81271734 0xe9ae97d0 0x58ea9606
+ 0x27ee585d 0x2de93684 0x1b4841b5 0x57be1727
+ 0xf1856cfc 0x10e169db 0x86c47dbc 0x846b1cea
+ 0x074cd88b 0x3ce62663 0x908149bc 0x85223107
+ 0x3e653140 0x2932e51a 0x61af5c5d 0xfccd7c88
+ 0x207b9a28 0x5fdb3d09 0x10e7253c 0x09fa8ca1
+ 0x4a5df2f5 0x634333d5 0xf8e69c5c 0x65a237c9
+ 0xcc54062d 0x12321c07 0xef854638 0x17b3d78e
+ 0x06142660 0xd0d7380a 0x8b13fe7b 0x56d2c264
+ 0x1382267c 0x1d1adff9 0x3f824692 0x15438a97
+ 0x0abccda2 0x96ea33bf 0xbbc8a37a 0xa393e1d7
+ 0x7cec239a 0x897b3a52 0x233158c7 0x095177cd
+ 0x1ec2739b 0x166fdfd0 0xd0d1e4a5 0xf6af17b0
+ 0xbd232dd3 0x18bd1a0f 0xe71b4284 0x4ed47f7f
+ 0xc4d85b74 0x35987b84 0xff192061 0xb1d857f0
+ 0x0b823de8 0x475261df 0x47af3bf8 0x117e5872
+ 0x0196dbc3 0xb91af7d4 0x849b43f7 0x954a4444
+ 0x9ee6c355 0x32be0405 0xb0db0ca9 0x3ad808f0
+ 0xe2fb9582 0x1c28a00f 0x71d0505d 0xe35ea260
+ 0x82ff9335 0xb8bb879d 0x255777af 0x68d92ebc
+ 0xc88d983f 0xaac601e5 0xb9c7abd2 0x04159fea
+ 0x1d07c075 0xf1d54b03 0xfdddb32c 0xfc66b0f6
+ 0x795938b7 0x943422a6 0xc3100357 0xf2eda566
+ 0x16e494f3 0x43482258 0x12de39d9 0xdc23e6ba
+ 0xf2faf851 0x27993ab3 0xb6060964 0x7b538f2f
+ 0x2aa982b0 0x56d36ebe 0xd6263aec 0xd07724ab
+ 0xa634f8b6 0x09ade1e4 0x9d810aa3 0x92a2506c
+ 0x9064204a 0x9988c438 0x3189d92d 0x444761db
+ 0x496b52ed 0x8c9100d0 0x73cc0243 0x03ff75a1
+ 0xd3a8fa51 0x225196ae 0xa0f436fe 0xc6bacf3c
+ 0xbb41be3e 0x51179e19 0x58d480e0 0x2a44db04
+ 0x3a315e9c 0xc06d982c 0xc9d23539 0x8ba55f8c
+ 0xa0c31f24 0x7d3fef38 0x43a887f4 0xbe7f6023
+ 0xb1c09c4a 0x5bc4ba37 0x2ce4ffb3 0xd5d61ba9
+ 0x2bff836f 0x9bbb9580 0x6f242a1c 0xd6d89009
+ 0xe983fbc0 0xaa970583 0x40eb3de5 0x7c40e189
+ 0xed9a773a 0x2a3134ef 0x2e8a8ac7 0xf5af3ad5
+ 0xa578b242 0x3e53c982 0xd2b771ee 0xf59f36df
+ 0xb88f203e 0x6067b8cd 0x0d64069d 0x52d9f38b
+ 0x56b494c1 0xb8d8aa7c 0x1fa90e67 0xa172b5f2
+ 0xf002343c 0x7bc06d40 0x58dbd091 0xe91e517f
+ 0xfc1e5577 0x0359a36c 0x8fd54f85 0x1144ba34
+ 0x5a3609b8 0xe910c559 0xe336a70f 0x1c21a8db
+ 0x4e3b75d1 0x50d1fff2 0x66117a25 0x2a02db19
+ 0xf959d30d 0x92b6a248 0x20c0706a 0x9b95885b
+ 0xcda96b17 0x86e17242 0xd1281912 0xff909d5e
+ 0x95da411b 0x22a43d49 0x1534c9f4 0xc2fa71d4
+ 0x717dcdcc 0xedc2e724 0x64ea2049 0x721429f3
+ 0x661dd588 0xf5da23cb 0x435fd9a9 0x7def1a28
+ 0xa3b047e1 0xee17b194 0x0d02202a 0x1b4acd9a
+ 0x0f557183 0x54538c92 0x7c6973e0 0x59a4f60a
+ 0x2994418b 0x7f7ec9e4 0xdddf6a28 0x2ce8de09
+ 0x896156d8 0x2b3544ba 0x0b3a4f61 0xef295210
+ 0xe68612b8 0x38ee0ed2 0xfdb842e1 0x4bb338ec
+ 0xe72f65c3 0xb06e48ac 0x9e5fd457 0x605cc320
+ 0x782a871c 0x25415859 0x03aa12d4 0xce27ed0a
+ 0x0fb5cecd 0x85cf5146 0xd92c6d21 0x693fd927
+ 0xa1154c7d 0x3076d66a 0x5a94ada8 0x56a77573
+ 0x7c821b67 0x666d549e 0x0976d365 0x547195b4
+ 0x22a6efa8 0xa5d79006 0x83722c02 0x23e3849f
+ 0xba38804f 0xa634d1d7 0xfca40529 0x0d99747e
+ 0x2e04eda1 0x62640645 0xd4eff1c4 0xdab1eb94
+ 0xbc2421b0 0x4f2816ab 0x5339df08 0x76717945
+ 0x3d90e768 0x2fc5ef40 0xa6d1a2e2 0x4670d792
+ 0x64d02442 0x56d8ebf8 0xbe8a1827 0x36f1ceb3
+ 0x4f8e962f 0xe39e58ec 0x8247a21b 0x957ab902
+ 0xf390026f 0x84cec387 0xdd1f248c 0x9c91a08d
+ 0xa4ce5c31 0xcedb63b8 0x55f7e028 0x8bf3cf8e
+ 0x124c7ee0 0x9005abab 0x0d4da93d 0xd54253a6
+ 0x4a6301ef 0x64d643d9 0x4ed41ae5 0x8e4c83a9
+ 0x21598234 0xf7389a30 0x100eaf77 0x5bdd2cb3
+ 0x88c39874 0xfcea8089 0x493acf72 0x57d25c5c
+ 0x3e2cc2d3 0x1b01208b 0x49eb120a 0x5eb7e34b
+ 0xf96a31fd 0x93315c7e 0xda6fb4b0 0xd2dd6beb
+ 0x48adcca1 0x5ef9a30a 0x6f94c49d 0x1f1ff810
+ 0x37eb4707 0x68b8ea8e 0x6b8a5847 0x8bbc9103
+ 0x2e6c4d87 0xb333cf9b 0x5b2c0178 0xacb02b34
+ 0x53ddfda0 0xf4fa98be 0x602e0fe3 0x2b3c25f5
+ 0xd27a9991 0x8c116b9a 0x43b35362 0xe25fe05e
+ 0xed9dead8 0x67c67277 0x43860823 0x094d4e78
+ 0x558ed96d 0x8382a93e 0x20c30e0f 0xcbd4ea8e
+ 0xb971c329 0xa8b7ef2b 0x7445e0fd 0xf6f1ef07
+ 0x23071d6e 0xbca31530 0xd27aad91 0x297d1b7d
+ 0x2559361c 0xf486d25d 0xb75bf444 0x2dab4bfa
+ 0x9d8db753 0x4aabda7f 0x81d11c75 0x3c4a859d
+ 0xd0b60f2a 0x6edbea57 0xd9f3b42b 0xd252f51c
+ 0x13875ff3 0xaa5c1b7c 0x979fb0ac 0xb40c9ce4
+ 0x3079d900 0xe952d852 0xeae46ae5 0xf0b90a1e
+ 0xaf518b37 0x9d52a851 0x2d8c1a8f 0x57780e8a
+ 0x50f9628a 0x1100c756 0x69d6192d 0x448988ef
+ 0xc3a3fea5 0x21803245 0xb203c756 0xcc5b1215
+ 0x9245c37b 0xa08e799e 0x0db9b26a 0xc5b66236
+ 0xb9311e31 0x4b19038a 0x1f3ff253 0x09d63d6c
+ 0x75f31ef0 0x76248710 0xa0099017 0x4250ac6b
+ 0x254a8707 0xa7569943 0x3b439a3b 0xe288d09e
+ 0x672f5a88 0xa68084b6 0xcba91f48 0x448db9c0
+ 0xdf10551b 0x84a10f35 0x008b4af1 0x4acc57ed
+ 0x36724f17 0x0ec2c1b3 0xc9b135e2 0x2c0638f3
+ 0x20c3f50d 0xf0c06eb7 0x1f6bbfac 0xec637e1a
+ 0x0145b13f 0xce7fe14c 0xb9381bb3 0xa136bff5
+ 0x7b2c9888 0xce8472dc 0x5057fd00 0x3eb0d7fe
+ 0xbb02fad9 0xc7916753 0x823abec5 0xe17b2320
+ 0x2c090cd3 0x815bcc43 0x99b3d95a 0x30034606
+ 0x6a15812b 0xd0f1e2f0 0x942b74bc 0x17ac6a8d
+ 0xd1a11423 0x2de79a31 0xd88cf121 0x9b36fed3
+ 0xb492889f 0x43c3fcca 0xdb7844ac 0xefbbf35e
+ 0xaa7d5b92 0x0b6f30b1 0x88e110c9 0xeff4f11e
+ 0x7633adea 0x3dda5e7d 0xd3c89c70 0xa3a07393
+ 0x9e3c59c7 0xb65578a7 0x7bbf4db2 0x6d5000e8
+ 0x7f870540 0x2362a068 0x101459b1 0x9d820d27
+ 0xe6b1d38d 0xe3f1a0a7 0x2ab84484 0x025bf524
+ 0xc61703b3 0x949a9e3e 0x9434c15e 0x8a5c91db
+ 0xb9ea0679 0xd2af96cb 0xc7a0d345 0xe5dff74d
+ 0xd3cf50aa 0x928eff16 0x8ba74a28 0xf3e8dfed
+ 0x20c2badc 0x0ec3a976 0xabbea975 0x527660c3
+ 0xa4011b5b 0xbea12a60 0x45148e21 0xacb6115e
+ 0x4260086f 0xbca635a2 0x5840c38f 0xb627d589
+ 0x6b192e20 0xecf49f5f 0x16e3aa54 0xcecdcfe6
+ 0x882f8001 0x63eef92f 0x5f9f7509 0x78cb7be6
+ 0x0f7ca5e1 0x1dbec4b8 0x28b3b964 0xf7ba8d41
+ 0x45f651e9 0x96ca3669 0x6037154c 0xd5ea1924
+ 0x3b96a8e0 0xf7d1cfc1 0xefb681f2 0x1e0c2da0
+ 0x18801718 0x52a4577c 0xe62d976d 0x0c91d3a6
+ 0xdd69ee59 0xf3d3e5e8 0xd41bf236 0x453139d4
+ 0x6331a2d7 0xd8199629 0x147d4a25 0xf28f9387
+ 0xd0b8dcb4 0xfbf0b395 0x48bb2300 0xbbbaab21
+ 0xc492db08 0x3f3dfd1f 0x369eee48 0xbedacfbe
+ 0x61757c6e 0xc38119f5 0x96e06a31 0x9f1484f8
+ 0xb3252479 0x4e81ecaa 0x779e1325 0xf36b14a3
+ 0xe1537d49 0x8d428cee 0xd3193ae5 0x9e9b534b
+ 0xb6220228 0x19669905 0xe45ddc93 0x375be8e8
+ 0xb8b48aa2 0xd7d66075 0xe85aae5c 0xde09b76a
+ 0x0017cdbe 0x05f4853b 0xa400880e 0x5eb1d8e6
+ 0x2942a29d 0x9f05eb18 0xf61f40ac 0x23c597d2
+ 0x88667773 0x9d115d43 0x1a7f9f37 0xf9eb4fc6
+ 0xb193c4fa 0xc498f6fc 0x758fb29f 0x4da3ed95
+ 0x5c703a90 0x090155e2 0x6a332a01 0x2c5c766e
+ 0x4ae57380 0xe84bd64b 0xf4f33a8b 0x8bc4b91b
+ 0xefd3a254 0x04bfbb7e 0xfead0e9d 0x8ac41203
+ 0xc7496ae7 0x84f274f0 0xfd1fb7c8 0xb2b3d329
+ 0xf3b37346 0xbdbd437e 0xafc67884 0xc0e6cbf2
+ 0x70a9cc27 0xf818e439 0xa637a529 0xd3f9e36a
+ 0x890751cb 0xbd75f152 0x4d8a05d2 0xf050a2a3
+ 0x56148db8 0x087b5cc7 0xd81c4fac 0x05ae220e
+ 0x6c609d1e 0x1238e2eb 0x6ccc9ddb 0x2e2b84f4
+ 0xd8b944ed 0xe3c13d24 0xdb178633 0x445b8c30
+ 0x9dd3c53c 0x6e12a4a2 0xe9707282 0x86f336f9
+ 0x0b82de22 0x723c4c44 0x29a19995 0x97590aa5
+ 0x4897f90e 0x1c9992f8 0x17ef1185 0x74a1edeb
+ 0x0e8599eb 0x963c882a 0x9d28dc60 0x2ca48e25
+ 0x75716ea7 0x73cd9332 0x50dfe0ea 0x91f44e55
+ 0x6b18b072 0x44f17e11 0x2b3c0408 0x8f167451
+ 0x1c96fc39 0xf5708789 0x9a67042b 0x53a55dc8
+ 0x00d62c04 0x6b4197d6 0xad4f8b95 0x31dd6a2a
+ 0x5ff83f8e 0x1a20b399 0x94e62de1 0x2b6707ab
+ 0xd8475628 0x1756e992 0x148f1514 0x8cc89880
+ 0x66df6344 0x075745ca 0xde2b3539 0x9c0daa3c
+ 0xe4f33dd7 0x66e6440d 0x340b259b 0x0e461961
+ 0xc5f9871a 0x48c13c45 0xf7de0700 0xd4ebc695
+ 0x5a81d5f7 0xf43f6a12 0x0dfecaee 0xa7258a8b
+ 0x029ab98a 0x09d335db 0x6d15b80a 0x561408be
+ 0x78c24a20 0x293fcb8f 0xb59d5c53 0x62e474a9
+ 0x8a16cac9 0xac96a195 0xda46263f 0x8ab714e3
+ 0x28eb2de3 0xaa6b2e24 0x4c28a02e 0xfbc0b03e
+ 0x015ce311 0x4fb4cb94 0x75e0ade5 0x295fd817
+ 0x7083903d 0x583b627f 0x9379517b 0x90aae152
+ 0xadc926f8 0xf729d766 0xb6308cdb 0x7457cd1f
+ 0x015acd84 0x6cf61675 0x20cae13d 0x9eacd8cb
+ 0x6ffdaeb5 0xfc75ba5a 0x9ca40b7d 0xc0bd650e
+ 0xd2920e28 0x3ba043e7 0xbfc24013 0x868e9d97
+ 0x2b8ec5c0 0x0e792e3a 0x019dcf75 0xc1ba6633
+ 0x4ed5d5b6 0x00abc7ce 0xa00ce6cf 0x09aabb6d
+ 0x3ca6bcdb 0x101ae811 0x3f1c8918 0xe3e8c440
+ 0x448ef7ab 0x09352730 0x531da8c6 0x71b6fc26
+ 0xf1c7205d 0x3b06f2d9 0xbbe6daf8 0x8ffd291f
+ 0x05e3a037 0xabdb19da 0x09b8dd0b 0x9458cd20
+ 0x1532c626 0xbe7857cf 0x30b00814 0xf9f58c9b
+ 0x8cfa3417 0xbfcb8dcc 0x04215266 0x62e7edef
+ 0xb8cbf96c 0x23177b29 0x41f114f1 0xc2040cb7
+ 0x56447ca4 0x1f2f3dcc 0x822ec94b 0xc23a7cbf
+ 0x32660e99 0xd7f16c48 0xf008d9ec 0xe13b7d78
+ 0x63ff83ec 0xce778320 0xd711836a 0x00f800b9
+ 0xaff6af4e 0x590fd4ce 0x6cd83b93 0x96b9a6e9
+ 0xb75f478f 0x295f9409 0xc6581fca 0x2b21290c
+ 0x2b4e7c35 0x84c0a1fb 0x41ebf009 0xb1272092
+ 0x8055e060 0x3ae9304a 0x2178abb2 0xb59c5b38
+ 0x33df9632 0x9b9c1fa7 0x76225761 0x51d5c9d8
+ 0x898e2c9d 0xe281ccf7 0x86a4f00a 0x673d0c4c
+ 0x32206572 0xca0f1317 0x5f29f948 0x6fb394d1
+ 0xb17ff591 0xef614b93 0x0e0f420d 0x91a6bc63
+ 0xab44427d 0x93268daa 0xd99882f0 0xd69565d7
+ 0xd892e0ac 0x5db25ff1 0xdcef6bbf 0x56cd014d
+ 0x880ac90b 0x2900c6ba 0xe4c200ed 0xfad2d057
+ 0x79fb4fc1 0x135d9bea 0xec59a73d 0xa6ebc18c
+ 0xda3ab47f 0xdb77c2a7 0x69c2caf4 0x83991de1
+ 0xfafe44e3 0x7e8d9a7e 0x934b316f 0x5e421ddf
+ 0xca24ce98 0x00d98df6 0xe46b5814 0xc6e081b5
+ 0xa776dfdc 0x3e3f6990 0x34f7ac2d 0xe752da77
+ 0xcb190e9e 0x59b28768 0x48221cc6 0x43619429
+ 0x8d1cb372 0xc9377ddb 0x83d7f02f 0xe3f48f16
+ 0x4ed6bd43 0x7d52904a 0x83de2c5b 0xd3d8f656
+ 0x63ce2cde 0xb38f2d61 0xd27031b9 0xdf3c03d4
+ 0xc68db5ec 0xb9e3514c 0x00795bb5 0x100a012a
+ 0x800e332e 0xe19aacde 0xd4b6038f 0x4be062dc
+ 0x4660a0a8 0xcc5759af 0x897878f7 0x22342fa0
+ 0x1e4d8aff 0x41f3dae0 0x5a7b62f6 0x3cd3cdf5
+ 0xea6f51ca 0x0e983e67 0x5b766696 0xf826b059
+ 0xf09a0b0d 0xd84ac2b3 0x5aeeb3e8 0x3bf5dbcd
+ 0xb79672e5 0x06fa7030 0x5ed30c20 0x5fcaa290
+ 0xb2c4f2a1 0xa75961cd 0xf1b4e982 0x7872d0fe
+ 0x8a62669c 0x33ed98f9 0xee12c734 0x1c70d204
+ 0xcd52cb65 0x12892202 0xee056788 0x70f99a76
+ 0xeb97991f 0xfff0bca1 0xb906b029 0x4963b1f6
+ 0x887c4310 0xdbcacc55 0x7725788d 0x8cc2e199
+ 0xd0ef5c53 0x6f44fad3 0x5287d500 0x05308b66
+ 0x9eb8ade8 0xf9dc7b1c 0x0d4d3ffc 0x7429fbca
+ 0x15af3491 0x9955697f 0x4228e39a 0x463a55a9
+ 0x00d95f8c 0xe51c9ae2 0xebdfccf4 0x3be66295
+ 0x629034ed 0xabad2be2 0x44aeabec 0x3d7080a3
+ 0x4143a1ee 0x5b9ffb49 0xc183639b 0xfad3fb69
+ 0x29f6f62c 0x36f226e9 0x5b703d69 0x18ab5b12
+ 0x5c8d77a2 0x98649f8b 0xd581758c 0x0cd7f8b4
+ 0x4327b2d9 0x95368a1a 0xd115fb1b 0xf40af796
+ 0x89d290a5 0x89492e3f 0xf4e43595 0xbd5b6fd0
+ 0x4f09a4ea 0x38479d4f 0xfc98aa54 0x6bec3ac0
+ 0x62488652 0x5582af82 0xa0a75ca5 0x43314a89
+ 0x6dbbf38b 0xb2788393 0xda27176f 0xf7254172
+ 0x2af59ed0 0xf5554836 0xe34b5b7d 0x6153404f
+ 0x4489677a 0xeff85730 0xb043b04f 0x53b5e756
+ 0xf0a03313 0x4a4be252 0x8386b940 0x51c826e9
+ 0xddf89c5d 0x2c71fdcf 0x5a108bf9 0x2feb29e4
+ 0x5a763c96 0x36296f86 0x4960f0d8 0x219d21cc
+ 0x7bb793b4 0x1326468c 0xef50e659 0x02f9fa0e
+ 0x28315921 0x92db3e7e 0x5d7d318c 0xd7bf1467
+ 0x61eab0f3 0x20891bf5 0x0f674975 0x9764cdbf
+ 0x6729d881 0xe2aba927 0x732ff326 0xb0e434b1
+ 0xe488f46f 0x29ed16cd 0x585515d8 0xd6a9aefd
+ 0x450eb992 0xe6950aea 0xe3857d2c 0x495e9d92
+ 0xba9435ca 0x42c8a4ee 0x940d4c33 0x10310bd1
+ 0xa7c3dab2 0x1b70c734 0x3f6b40a2 0x7917ecc0
+ 0xe3156ea2 0x01b359f6 0x3ea144da 0x9257bb9e
+ 0x6f0b078c 0x0b405c47 0x0f5619bc 0xf9f7a7b1
+ 0x89253558 0xc7f05fbf 0xbd7f1508 0x5dd43c97
+ 0xa88d03d8 0x7bf54345 0x93f4a4cd 0xcdb8d598
+ 0x781065ec 0x1a09d10c 0x4ed8699a 0x92420a61
+ 0xab559e5c 0x19a1ac82 0xb46595fa 0x7c13ac60
+ 0x013d2099 0xa7b46aa3 0xac24aa06 0x2e1d2dd0
+ 0x3bae2b03 0x32f2bb34 0xd650d334 0xa901f08e
+ 0x79e81800 0xe37017c6 0x8fc55b6f 0x8a12dfd2
+ 0xe52ce701 0x5c7f3dd5 0x1201ecbe 0x08d2dfe4
+ 0x0a2eb2a0 0x1af945b0 0xe6bbe773 0xe2d51489
+ 0x8b6a388a 0xecd81b15 0x0dad9088 0xc46537a6
+ 0x88f720e2 0xf63af877 0x52ef02bc 0xe99a2b37
+ 0x5c0c4616 0x5102326d 0x358b2295 0xe99ab5f8
+ 0xe00db448 0xe0a79207 0x25a9ff03 0xb038291c
+ 0x88b4c168 0xeb898740 0x103eaa80 0x058cfed7
+ 0x3fa4fd00 0x6908bd9a 0x4777e2cf 0xce7d4589
+ 0x114d4674 0x695d4ce1 0xe764f690 0x6fa820fe
+ 0x0f276846 0x8b4ec1d8 0x0c96ebac 0x03094822
+ 0x0c18d4fc 0xb291cb53 0xb7872f2e 0xa0993d96
+ 0x2e236716 0x96c8b169 0x662e6dfa 0xba55cbb1
+ 0x2d8fb09e 0x6d163664 0x8a9f5f48 0x81a94df4
+ 0x9eb4fc04 0xfd76098f 0xbf259198 0x0bac8969
+ 0xfa96ad2b 0xad00cc31 0x10ce7679 0xefe9617c
+ 0x0a5fd0e0 0xe475933d 0x0c78a62e 0x91c21a56
+ 0x788642c3 0x462802da 0xa1a1ab9a 0xa71ddeca
+ 0x1550359c 0xf029aee5 0xd0715dda 0xfe871504
+ 0xa687b423 0x2b09bbef 0x9c0fd356 0xd7637e14
+ 0xa32decdd 0x951b0fef 0x627f7a81 0xbd7a596b
+ 0x8bca5b3e 0xf64a3209 0x9f42065f 0x5a4f061e
+ 0x15d45530 0xb48d9116 0xe5e3e11d 0x487053b2
+ 0x8cbbd18a 0x4b44d87c 0x93e8d394 0xde496daf
+ 0x1755614e 0xd28c28a7 0xe26a4b69 0x03744bb4
+ 0xb0e9c714 0x77c3c4f1 0x0cbe3eee 0xa243a10c
+ 0xdacbc970 0xa262e44e 0x513a38d1 0x28c65954
+ 0xd875dc63 0xf35484f8 0xb8b991f8 0x4989b753
+ 0xaffa7212 0x32bd36b8 0x9b9e8a92 0x4fe36b10
+ 0x3f01653d 0x85b0b3bf 0xde42056b 0x51e6b399
+ 0xd4379c83 0x368aadd3 0x8753ffcc 0x37301bdd
+ 0xbaeb3642 0x5fc623c0 0xf7c7173f 0xd6ad14a2
+ 0x61da411f 0x28c6fb52 0x2fb2941c 0x0edb5b6a
+ 0x3fd16bb7 0xdf0c7726 0x74a2de09 0xe88062f7
+ 0x2bc7f6cb 0x90465a23 0x993ee4fd 0x5a269a35
+ 0xceada35d 0x3ee2052d 0xe0083e9d 0x247c577a
+ 0x42134fae 0xa93a745e 0xa703c551 0x31843951
+ 0xef4cc6f5 0xf566068c 0x1d55b4dc 0x42c1ed36
+ 0x350d2d94 0x6257c7eb 0x11f834d2 0x96bb27f9
+ 0xc88c66eb 0xe08a40db 0x468084b7 0xe9fa8359
+ 0x60b25036 0xcee481a3 0x452a6cda 0xfdca0d0e
+ 0x1c3bf3a8 0x3a971457 0x3d98531f 0x2c813831
+ 0x501964ea 0x349acb79 0x44e875b5 0x53a292eb
+ 0xf9588c50 0x6f423eef 0x040be49f 0x9b4e78fd
+ 0x8499d9cf 0x5b0d86c4 0x6a0f9858 0x42e458d2
+ 0x605a3d3b 0xabbf3f04 0x804f2723 0x5a769afa
+ 0xd1492b12 0x22a64c24 0xbd7e0c25 0x28086942
+ 0xf3c1e264 0x88b3278a 0xc9d3d58a 0x637e02c4
+ 0x1297f21a 0xfbffc9b9 0x2319b83b 0xd32407d4
+ 0xa14784ae 0x8eaede6b 0xef9cf10e 0x3d3e00c5
+ 0x5b1c1bde 0x9d91a209 0x69cbaceb 0x2c6f8b84
+ 0x59dc443a 0xd7e6b99d 0x416c43fa 0x3ad2958e
+ 0x3d1822d4 0x4c00d378 0xbafb167e 0xb2468dba
+ 0xe29e961f 0x24fe6e79 0xdaad60d7 0x2f011002
+ 0xd139c430 0xd23be70f 0x99254a89 0x9451c64f
+ 0x954455fc 0x05bd2f14 0xbfbc820b 0x66156aa2
+ 0x96934d0a 0x613ff796 0x30a64031 0xfd696ed4
+ 0xad6c8015 0x00ae5a59 0x04b44690 0xab7303d6
+ 0x227af390 0x93c13b09 0xb59763ec 0x4662c256
+ 0xb44526aa 0xa6467137 0x147e75ae 0x8a6c7ed1
+ 0x68b61559 0x995abc17 0x20545ce6 0xd712f95a
+ 0xc49d70d0 0x6e4b4f32 0x51b6b0b5 0xcf6b6fae
+ 0x912c5098 0x5311442e 0xe7f2c750 0xcc8f91d9
+ 0x0635e736 0x885cdf7b 0x5e96c066 0xdc32d35e
+ 0x0b94de6a 0x4063f416 0xdb0351d0 0x905eccf2
+ 0xf164d279 0xb3b28b2d 0x243fe410 0xe383f233
+ 0xebed9419 0x72d8ab58 0x5e0a95a0 0x2394041b
+ 0x51d0b849 0xd53dc6ff 0x135442b8 0x2b1a50c0
+ 0xc89aa5d9 0x366700fd 0xdd4b4e2e 0x36a5ba7b
+ 0x25c8735f 0x5b0689ee 0x014ad466 0x2fa0d27f
+ 0xe7677338 0xa29b9a7d 0x113f312e 0xf0a51d0e
+ 0xc29026a6 0x5ac62386 0xe1f08ba7 0xe2e352f7
+ 0x9530644e 0xc10dcb9f 0x96a4c1f5 0xdcf458eb
+ 0x807bbd1a 0x17a8ff52 0x5d21220b 0xb29d084a
+ 0xede98100 0xfe972081 0x905b9e4f 0x0c163982
+ 0x68b51b09 0x4c2d2ba0 0x6b19bfce 0x99db8997
+ 0x440039da 0xcda5a6e1 0x037b541a 0xc71fbace
+ 0x0ea0288d 0xa0521229 0xa4df10f0 0xf00963ca
+ 0x8910ad0f 0xbb969091 0x8aebec79 0xf3f23a4b
+ 0xe303ed65 0x7ac7a310 0x7d352efe 0x95ba541e
+ 0x57c12da1 0x3e71d397 0xec7cc279 0x5dbeaf8b
+ 0xfd328b05 0x4143c12b 0x5c1d47af 0x9b17b429
+ 0x4bdea442 0xd075af6f 0xc96f9995 0xad8883c5
+ 0xa4ae65e0 0x66cfe62f 0x1626ad8c 0xf90230cd
+ 0xa146cab2 0x3a12da95 0x516145f8 0x46a40261
+ 0xfed06327 0x5d01ea51 0x1f374eee 0xc53edd43
+ 0x3b05ded1 0x4fdace33 0x88d6008c 0xe5552e69
+ 0xbf839f05 0x2c048e0d 0xad48b0ab 0x8ee97494
+ 0x46ce2e55 0x271a1c6c 0x00b7c0ec 0x7749a5a2
+ 0xe362046c 0xe9b62470 0x02495144 0xadb16f01
+ 0xb39a0a84 0x0597a94c 0xfef71155 0x2b16a519
+ 0x39a08e03 0x32beade8 0x3a6c620d 0x52de396d
+ 0x58c4a974 0x8341dc8f 0xd2e0662d 0xc31313c9
+ 0x26b9d04a 0x45a09750 0x17ae15f7 0xfcdc102f
+ 0xa80ccdef 0x0c91eab3 0x8fc07faa 0xb3d49786
+ 0x71b50412 0xe1c5d21a 0x9de14c8e 0x020cda1f
+ 0xda603e28 0xd16d700e 0x2cd8d241 0xc4464b2f
+ 0x10767b1f 0xacf951fc 0xf1af4811 0x60f203ef
+ 0xfe2fdda7 0x587d2066 0x61ed0d33 0x999c2aac
+ 0x0c976170 0xf9ba73e6 0xa099d76d 0x0d0fd35b
+ 0x9d785bb6 0x29244f0c 0x18c1c4ef 0xad166abc
+ 0x305e463c 0x28bc7845 0xc37c2187 0xc06f9683
+ 0xa43a493f 0x5358d2e8 0x040e19c2 0xa2f5c830
+ 0x6a82664a 0x616c181e 0x5a0edf83 0x515c2d33
+ 0x5e0f195e 0x0ca1e76c 0xff5129a3 0x0f1e4068
+ 0x9cf970cf 0x6cb8cca7 0xe97060da 0x08568143
+ 0x3a1610eb 0x3524ddb9 0xb01ae711 0x414811ae
+ 0x93ab7ca7 0x0220578c 0xa6890d60 0x3ffc773e
+ 0xf2569e5f 0xfe7bc137 0xba54416f 0xcb09f9fe
+ 0xdfc9e943 0xd351ddcf 0x3804eb61 0xfd217c55
+ 0xe8e5312a 0x5d2f72c3 0x77d7c53c 0xcb928d7c
+ 0xa3e41d33 0x6654f69a 0xdb7305f6 0xc16b160a
+ 0xcccff80f 0x9f824e66 0x441a353a 0x092d18f6
+ 0x57287b8a 0x8e4f53ed 0x7ac092c1 0xab538ad2
+ 0x3ee0f6ae 0xfc5d2362 0xdd9886c9 0xefca45d0
+ 0x3bcf7d2c 0x3c13007f 0xb3486310 0x28d85956
+ 0xe73b79f7 0xb2826693 0x4a1689ef 0xc7c75bb9
+ 0xc6dcf278 0xb7e5889c 0x499a9294 0x40d3cbbe
+ 0xb192ba4a 0x07184194 0xc1c4b09f 0x3a56e539
+ 0x0b1d95e0 0x7f017eb8 0x34492123 0x87b49dd3
+ 0xd18f58b2 0xffeeb628 0x87f933a3 0x5064e080
+ 0x0f5ca746 0x0fa6a21b 0xba871262 0xd8e61931
+ 0x3b2ecb5d 0xb917a8f0 0x86db03d0 0x98c6ad13
+ 0x8af29fa4 0x31246abb 0xbf5fbac2 0x0f0bdec6
+ 0x000a67a2 0xda471b18 0xd2878316 0x8032555c
+ 0x07a0c57f 0xddef9dc1 0xbf93b2e4 0xccc53229
+ 0x6ac5694c 0xfcf56e7b 0x25dd8274 0x61bb506e
+ 0x9680824c 0x2108c113 0xc4b99502 0xe10c4403
+ 0x7e4a00dd 0xdd9dddbd 0x81b007b6 0xed0e2bef
+ 0xcde1384c 0x31ac9186 0x423466ec 0xfe3cf19d
+ 0x23fec5f7 0xbc43b9e0 0x168a64ab 0x778d537f
+ 0x31aab49d 0x0ef7f7f9 0x8e2972e0 0x7674399f
+ 0x06ba8c5a 0xa5d5aad1 0x233fa49a 0xd9ea5761
+ 0x34aaba4e 0x76292aac 0x0fd6d9f3 0x4aa42343
+ 0xd8a605f2 0x6c377ddb 0xe7cec8b9 0x5ca585e1
+ 0x381b2afe 0x56f2f0b9 0x7d6e7858 0x97e0f9b1
+ 0x107ce0e5 0xafe55426 0x39b22485 0xe09e7f23
+ 0x3edf761c 0x5bfaf7c7 0x777475f0 0x1f859031
+ 0xffc7695f 0x9a5921c3 0x70e526e5 0x8464b2c9
+ 0x034e8e18 0xbe1ff735 0xd102ec62 0x042f43f9
+ 0x3ebca006 0xdf556000 0xe36a069d 0xba211941
+ 0x11ccb113 0xd3cd8e1d 0x38720e11 0x6bdc393e
+ 0x58981401 0x55d99eca 0x9688007c 0x121e215a
+ 0xa0ceecdb 0xebc3685e 0x08ee9340 0xd9b6e22e
+ 0x03ffa516 0x758b7f83 0xccbf682f 0xb78a5f57
+ 0xb62f97ec 0xe695a1c9 0x2330f7eb 0x14fea517
+ 0x40461809 0xd4ccee15 0xd7f9ecef 0x8802908f
+ 0x4541cb1f 0x8a5e5b93 0x90febc1a 0xe7c4b957
+ 0x72e0d014 0x6706cb38 0x4f51b134 0xa1a42c4b
+ 0x83fa8197 0xa518fe44 0xbb486372 0x4c1b1c78
+ 0x034490b2 0x18a8b011 0xf554c068 0x5b61d5dd
+ 0xbba8379d 0x1d14c707 0xad1d2b75 0xf45d8707
+ 0x97bd03ee 0xa071851b 0x006e6b4b 0x0868372f
+ 0x8bab261c 0x0cfe4ee2 0x15b51279 0x82f9ccf5
+ 0x2cabbc6e 0x6e711b59 0x4891dac3 0x28e148af
+ 0xf2fe8b83 0x24c3188a 0x022c4bb0 0x2e248b82
+ 0xab97c5c0 0x7f68e907 0xeffa4236 0x0fa4201f
+ 0x16a00933 0xda13af63 0xa5b4fec5 0xa4bcfbd4
+ 0xb60bb5ad 0x8b32ab4c 0x578c127f 0xf586cebd
+ 0xd81f4378 0x723fc323 0x1d229f26 0x05152eca
+ 0x31cd4451 0xfc3ced8c 0x18a32d87 0x2d55977c
+ 0x0be31b1c 0x79d45df2 0x96c946e6 0x5ce56238
+ 0xd22c156e 0x65c2c291 0xb4002bc0 0x5d901028
+ 0x729cfe3c 0x47933bad 0x69b1e791 0xf513f3b4
+ 0xa325caab 0x23506c6f 0xc8bfc381 0x465fa544
+ 0xde615fe6 0xbfe24eee 0x932030a2 0x961a308b
+ 0x3cb79a7d 0x8a0250db 0xedec9ede 0x1939ef34
+ 0x0206409b 0xeb223f4b 0xdc1ad860 0xf08aaf2f
+ 0x67c8cdb3 0x7708d5fb 0x909da6c9 0x723e0e9e
+ 0xbf6c013d 0x8a4cf22d 0xb3819e44 0xd7dbc597
+ 0x46c72921 0x3ac0b590 0xc4b84c99 0xf8a92e97
+ 0x1ef40c6a 0x03203085 0xc346a05b 0x38a3de79
+ 0x933b2243 0x614536fe 0xc86051a6 0x88d033c1
+ 0x4df02fd7 0x717ad53f 0x98f037fc 0x3d4306bb
+ 0xeb1c9a59 0x94213860 0xa0c7dd34 0x6f27b633
+ 0xd1486b30 0xf86dd433 0x0b395d8c 0xce53a2f2
+ 0xa22fb45b 0x968facb3 0xacf297dd 0xd9c5703f
+ 0x576ba00c 0x9e7b9b8c 0x2be66d48 0x6508dd69
+ 0xb980c11c 0x93bf667a 0x1e881337 0x1ce801e8
+ 0xc1f5fc7d 0x273be22f 0x4fa2d821 0x0510c637
+ 0x5f6b635e 0x427d7347 0xf40c1758 0xdffe201c
+ 0x7a22edf2 0x25916bab 0x18a99236 0x623f2063
+ 0x41ca5444 0x63cf267b 0x6734b211 0x18f1c06d
+ 0xa104bd94 0xe9e62583 0x1a4da3b5 0xe048de3b
+ 0x80dd5832 0x0396017c 0x39dfab82 0xbbfa6fdd
+ 0x72e64ec3 0x1d3a6dd6 0x1f6d9460 0xf385f9bd
+ 0xdd076e5f 0xf11df430 0x435c9682 0xbc0c0ac9
+ 0xfe3b3b6c 0x4516edbb 0xc42aa77b 0xb7ae091c
+ 0x4c143663 0x14bf8df3 0x677383e0 0xcd548ba9
+ 0x93792f8f 0x3ad9bfc7 0x2f0c6751 0x133a1a3d
+ 0x7010a505 0xb1d48044 0x8a481507 0x13e3a32c
+ 0xc5fe24af 0x2b7476b4 0x5dd06527 0xd0f8389e
+ 0x25de4e9d 0x9fd61436 0xea7b7879 0xe1c5cd0b
+ 0x503d9ce4 0xcde0934f 0x1d9ea9ef 0xe7b2b1d5
+ 0x000e0491 0x5d78c53d 0xaa696cc5 0x37ad7f6b
+ 0x90df174d 0x9e9fe66e 0xab922d53 0x6a3d19fb
+ 0x4eb7dac0 0xf27589aa 0xd19af92f 0xcff88a14
+ 0x853f8371 0x0e4bf2b5 0xe1fd1d07 0x9d8f8570
+ 0xf4971b5a 0x4159ff3b 0x120a65fe 0xa1dd5dca
+ 0xe01663e5 0x59a0ef68 0xcb4dd853 0xaa83b180
+ 0x67f849ef 0xf54e52f5 0xca703ced 0x5c210fd8
+ 0xf47fe815 0xa25695ba 0x98e947e3 0xfa884608
+ 0x2f79457b 0xdf818a2e 0x96d2f2c8 0x61456df6
+ 0xc36f5523 0x9aedaf63 0x6fec7f02 0xaf753d1c
+ 0x354065df 0x06655daf 0xfe489775 0x194e2422
+ 0x1749457a 0x0463aaf1 0xf6ffa473 0x98b465ba
+ 0x1fa85d3c 0xb11cb5fc 0x66abff1f 0x55db4357
+ 0xd97d1609 0xe443de5a 0x286d07f7 0x5c0ce355
+ 0xbae53951 0x5e63e69b 0x7ffd7424 0xae841fdc
+ 0x1bb38220 0xa27200b9 0x579e44ca 0xf38b6216
+ 0x1d82a2d7 0x8337aaa7 0x8aee45f2 0x7fc829ab
+ 0x276b7476 0x695a124c 0x02aad7ba 0x7233cbca
+ 0x283e463b 0xaec6e3dc 0xb3af78ee 0xee8cba4b
+ 0x8c07a98c 0xcc4ebe61 0x0e86abfc 0xca32e797
+ 0xbd24baae 0xa1c5e302 0x658244c8 0x9e78627b
+ 0x450bcaff 0x7405ff5e 0x4bdb233c 0xde2995f3
+ 0xb3e8331e 0xab082e2f 0xea83479c 0x2a352f38
+ 0x3972637d 0x9ae9139f 0xb6a80e19 0xe17db52f
+ 0x4eac9610 0x81609e06 0xb50d2491 0x60d958b4
+ 0xfbc203cc 0xdb7d26a5 0x349142ba 0x0ab5f7b9
+ 0xf62ab392 0xb0f1e31a 0x8136e852 0x4a3d2268
+ 0xc584d58e 0xe224860b 0x58d79eb8 0xfbe5fe43
+ 0x3d18e4a9 0xac2f776e 0x6b131761 0xd5564fbe
+ 0xac7c3ca9 0x3a9d9fdb 0xf5fe28c6 0xd52ec196
+ 0xd030a6bd 0xeaf1b5b6 0x73bb036d 0x7a2b9257
+ 0x12b62687 0x844c8e63 0xc59291ac 0x8e1c87a5
+ 0xc4f0cc7b 0xccc30d12 0xe787d139 0x46b8abe0
+ 0x952f5853 0x72b48e77 0xf2e3f0d3 0x58800758
+ 0x686c8d8c 0x7dc80ea3 0xc55d2de5 0x8e14a550
+ 0x0e8de947 0xa74161f6 0xf6b320d8 0x3573a3a5
+ 0xff479169 0xf3137dbd 0x8dc20185 0x38adec68
+ 0x78a69188 0xdeab0159 0x4ad2a2c4 0x2d63666e
+ 0x1279e322 0x3925b58e 0x60a7c009 0x17de2a16
+ 0xebbbc69e 0xeeea14b4 0x6c54c727 0x3a307309
+ 0xce93b448 0x7e4c6dfc 0x669ae34f 0x35323865
+ 0x16bd8def 0x2937048d 0x16d8d64c 0x5d694add
+ 0xf6ecf6f5 0x1238ae13 0x6239dcd6 0xcc3b281e
+ 0xce0a63c6 0xb89621e9 0xebcbd980 0xa5cbf1d4
+ 0x70df4f8a 0xe0980438 0x4aa731c1 0x0f7975c2
+ 0xb0ead74f 0x61974f82 0x384db0b9 0x2cb4e9b1
+ 0xb5d8214e 0xbebe8264 0xe36f034c 0x2b753309
+ 0xfad36dbe 0x2620e3c7 0xbd66ce2b 0xc53a2e3e
+ 0x6714449d 0x831ebcd7 0xb7b5f2d6 0x57a69535
+ 0x62515a6d 0x1645c968 0x37b205b0 0x76675ce2
+ 0xde00e787 0xb036534f 0xfe1e054c 0x11f88e38
+ 0xab787e9c 0x5a158df8 0x161e1662 0x9f545e6d
+ 0xf3490aba 0x837ef55a 0xcd4bb007 0x61aae9a0
+ 0xba4ab6bb 0xd769baa2 0x42615ea0 0x0bde749e
+ 0x57d5ff9a 0x9b5497de 0x24be1c44 0x6d327458
+ 0x50e963ab 0xaaa5ecce 0x612f244d 0xe73db30d
+ 0xaa337f92 0x1995b6a8 0x50e157cb 0x4bad2f3f
+ 0x0c4316e7 0xa5d9b41b 0x0cec474e 0xabc9acda
+ 0xfaeed025 0xe274dd94 0x0b4925cd 0xf99467af
+ 0xf381ad99 0x812e58b3 0xe07afa8c 0xdbf890a8
+ 0x45961d55 0x27988b0d 0x70f0b2cb 0xfe8c512a
+ 0x7bd10263 0x8ec2eec3 0xc5555d48 0x99ab8132
+ 0xb070a5d6 0x9e172ffe 0xeb0e9e7d 0xa2a49fb9
+ 0x6c280b32 0xca6f5235 0x81c37eea 0x5662fae5
+ 0x4a4658d4 0x568cd6fe 0xde557c0f 0xe9db63d8
+ 0xc719ef53 0xe0faf84a 0x8af06cff 0xbe3e4346
+ 0x18f6bc0a 0x9706da71 0x54dcad4e 0xbd9448d0
+ 0x9555e097 0x884e4bb8 0xbe0f0c46 0x837db52d
+ 0x39d5085c 0x97578886 0xb933b7e3 0x013b4d7b
+ 0x987fd07c 0x4ea7e9d9 0x20b16946 0xbb48b9fd
+ 0x6aa637a2 0xf7ac0b91 0x85f198e9 0x2d4baf49
+ 0x24ec0411 0x4994aa7d 0xa7c7f51c 0x2393ac06
+ 0x5d4571c8 0x6e174904 0x63a5ccaf 0xf72a1a40
+ 0x59159d31 0x9a019d51 0x512ae9d6 0xb7e04828
+ 0x98fe54c8 0xc55d1c8f 0xfa4db367 0xf0ab2bcc
+ 0xbc8018ba 0x23f3bf8e 0xc2176f49 0xcf1e432e
+ 0xcdafd7c2 0x82e55995 0x7a9e080c 0x7658e1ba
+ 0x6a0f09ae 0x8f16a1e9 0xeba0f77e 0xd0c52ff3
+ 0x13a9c1b6 0x1a340c20 0xabe6e15a 0x3da73697
+ 0xf1b934de 0x4e52b7cf 0x752f59a8 0x7d76fdc7
+ 0x3bb20b01 0x9a8dd5b4 0xe4166bf3 0x98eec94b
+ 0xe4354c8c 0x23ada159 0x95a44d3e 0x15478874
+ 0x0d8ba705 0x2d4a4de2 0x708ab9e8 0x25e4e3a6
+ 0xc0f5f48a 0x52eb242a 0x1718fb82 0xa40cfd32
+ 0xd8734956 0x72cd9c88 0x2e208319 0x58c1d73f
+ 0x3f37c213 0x6ec72127 0x7fc2139f 0xf11f3bac
+ 0x4431769a 0xe4ca8f04 0xc30c02b9 0x57e3f89b
+ 0x4d1ab101 0x1c4962d5 0x1227c388 0x24253d2c
+ 0xc3d46a2d 0x82430c1c 0x7a0258c5 0x6c96d00f
+ 0x45a15ec8 0xff43c82b 0x6e014181 0x0132aaae
+ 0x006e4d97 0xeaae7c32 0x29d7df63 0x705a3bcc
+ 0x66741778 0x097ccf9d 0x3de6e616 0x5b3acd76
+ 0xaa7b79bb 0x34e3b316 0xc3989dce 0x25cda16f
+ 0x7d07a9aa 0xee780a8b 0x6544d377 0x07e3a1e8
+ 0x6295aa83 0x6f250b8c 0xb1f93f05 0xa2e17f9b
+ 0x3f1a3612 0xc8bb56bd 0xcd495e52 0xafe78658
+ 0x0bfc26a5 0x76ea5add 0xa8d8cbc4 0x45446df2
+ 0x7b19f465 0x546f5543 0xa0dc30cc 0x74de6501
+ 0xeecb9b6e 0x298935a4 0x885b1b26 0xb9143423
+ 0xcce93223 0xe5b5e087 0x13908140 0x6281677b
+ 0x7701c82c 0xad3d74a1 0x80bfa37e 0x33ed0677
+ 0xbd4168f7 0x4d3354f4 0xc0cf30c4 0xe3289b44
+ 0x0d47aad5 0x94747441 0xdf744f8a 0xa461d3b1
+ 0x87790d45 0xb730305a 0x0cafcf3d 0x5603c0f2
+ 0xd7173faf 0x81912836 0xca7a5352 0x8e49ff99
+ 0x89760ee2 0xc82e08dd 0x5bb91452 0xab382cb5
+ 0x83779503 0x92330d0e 0xcb5d625d 0x4ee912a2
+ 0xe1392681 0xc53a1814 0x13a53dbc 0x0d292998
+ 0x1b5fcae5 0xd0ba4d10 0x52b6c109 0xaee5c7af
+ 0xec6c5278 0x3f2fdcb3 0x7c306821 0xaa5dcd52
+ 0xb1a7d58b 0xe03556f5 0x766767b1 0x4c197a70
+ 0x6ac372b6 0xcff9741c 0x0edb006f 0x645ec6e5
+ 0x9c5c9749 0x2c03397d 0x98688628 0xdf6400a6
+ 0xb3f0a94f 0xb0044905 0xb58c8ed6 0x5fdf2ead
+ 0x89c6e941 0xe57f3640 0xf2991830 0xf81efe51
+ 0xc19a8bb4 0x3035fc08 0x77c8cfba 0xe821d2c5
+ 0xeb464e3a 0xbc585b43 0xdc346221 0x507e5859
+ 0x78123b69 0xcb9a448d 0x0682cc21 0xe1b0bc67
+ 0xe127f626 0x2cd2f1c7 0x858db418 0x019523de
+ 0x6fc85edc 0x58d67a6a 0x1c34ae12 0x1e0738fc
+ 0xd9e2b7d9 0x5956f0d9 0x76ffbb5e 0x8ea99a03
+ 0x4f28dc4f 0x4f377244 0xe295aec5 0x6ea98b60
+ 0xf00b2493 0x2260b535 0xc0810f7c 0x33188d47
+ 0xf105cf3c 0xd8ff2c55 0x205f5f16 0x69f94e83
+ 0x5e145007 0x07d02195 0x22f1c594 0xeb813738
+ 0x3ec889bf 0x344c6aa0 0xe3fa138d 0xc6776c53
+ 0x9a0941b6 0x57acabe4 0xf6b79e0c 0xc1a61dc8
+ 0x9c3a4175 0x9a525797 0x7ab647d0 0x815c5b02
+ 0x843dfd1b 0xc9124fef 0x7da29da3 0xd1cdb4e2
+ 0x7d653eab 0x5369353e 0x6b9ec980 0x50d1b2e7
+ 0x3bcc95ab 0xc6b78936 0xc0d6f8db 0xdaecd71f
+ 0xbd0233b8 0x362fd051 0x63aa338e 0x22902c76
+ 0xadf9081e 0x765a075d 0xe8d43ed4 0xdd6c35d8
+ 0x4ba6a975 0x119690f1 0xd7e6b01e 0xd8dca103
+ 0x4e22374e 0xbc8ec469 0x57b00417 0x18e8d991
+ 0xda02c93f 0xb0228936 0x6ab10d11 0x722b5a1c
+ 0xf6363195 0x75785c34 0x5139025d 0xf7a69b80
+ 0xb1492176 0xad952fe7 0xe82d0408 0x448916e6
+ 0xbdfea2b3 0x856e72cd 0x417e78a0 0xac28fab2
+ 0x27c13cdb 0x0b930623 0x12f7b26e 0xf0aed34d
+ 0x1f8f749c 0x35222817 0xcac9bacd 0x7f777e74
+ 0x97a3e115 0x8f85c9f2 0x1452e0fe 0x7e2ed8b3
+ 0x587ed189 0xbc188f85 0x0142c616 0x3444faa6
+ 0x01818417 0x2124ff4c 0xeb7197e0 0x63118334
+ 0xb29b2be7 0x5ca49b49 0x06f468f7 0x70179c4b
+ 0x1e9dd3c9 0x3c7a32b3 0xd92aafd9 0x4dfb63c1
+ 0x7fd439fe 0x4058c739 0x9b521f02 0x31825fb4
+ 0x3bbe4125 0xaacc1cb0 0xa514cce6 0x68d2cc09
+ 0x38b567d5 0xe227ecc3 0x0b24c16c 0xe06c6dc2
+ 0x46068fcf 0x5c00e286 0x944697fd 0xc5edfda5
+ 0xdf8636fe 0xf282f091 0xd1e8711b 0x6665c15d
+ 0x855da354 0x1e62debf 0xda022ca9 0x3c0c64a4
+ 0x7562ee7a 0x4acd07ed 0x22508388 0x70630601
+ 0x15a16675 0x57b86658 0x5a102137 0x480ad6ed
+ 0xa9184349 0xc705efdd 0x48999b87 0xf6e6ba1d
+ 0x749e7bed 0xacc5a5b2 0x310b2c7a 0x7861d6fa
+ 0xbc55a09f 0x19e737a8 0x2bc6513e 0x3fc6bca3
+ 0x4dfea26f 0xe24d8b91 0x83629535 0xd1052687
+ 0x20cc4383 0x7aa1e7d7 0x75b153bd 0x2f2a9ddd
+ 0x48873223 0x4791b746 0x8fe42fb3 0x9fbbedc9
+ 0xd43f965f 0x726a4e05 0x65185962 0x6740ba54
+ 0x0b656909 0x581f22c4 0x779c19b1 0xba293041
+ 0x26a745c2 0x8ea1971a 0x9ff74024 0xc227ddb7
+ 0x5b5ee97a 0x1ae82d7b 0xefc5dad1 0xb5ee41e2
+ 0xc8485664 0xd41e7c0b 0x8f8427df 0x6ff3e568
+ 0x362a80a9 0x6893e2dc 0x2bda7f0a 0x491e3fc4
+ 0x550e8b7a 0x185ca646 0x82760f19 0xe3f78d81
+ 0x980ac0a1 0x42933c59 0x88424db2 0x99a6e1c3
+ 0xeb739d1a 0x4aca1f81 0x795f7ff9 0x21d4e69f
+ 0x1d80bd9f 0x2be3a32a 0x3c0b3c65 0xfb303676
+ 0xff635b42 0x294744ea 0xc848d076 0x640370f7
+ 0xd35a60af 0x12417850 0xec1ed4cc 0x07667b00
+ 0xa76d46f1 0xf932cc84 0xb11f5ec3 0xbd9ac4ae
+ 0xf23dc67c 0xa66ea9cd 0xe7e7c4d8 0x492e5337
+ 0x5dfa2c73 0x0b4d7290 0xb50d334c 0xfcf14143
+ 0x86046298 0x4e1cd1b0 0x4f3a7b97 0xd073633c
+ 0x95814eeb 0x6c1fa6b3 0xed98842a 0xee2299bf
+ 0xe80ae8c1 0x78757d9a 0x6b053062 0x46ffcd36
+ 0xfa60e6d3 0x5390aaff 0xc81a0a94 0xd26e396b
+ 0x3cac31cb 0x4c381753 0x18de6247 0x9297661e
+ 0xd6825ce0 0xfa31f8a5 0x5e800708 0x737a5a11
+ 0x66dc1fd5 0xc67d1f7f 0x778da819 0xa049e76a
+ 0x5aab1c1d 0x05c6f21e 0x8b573cc9 0xe44fd3b4
+ 0x2490cb7f 0x65905197 0x040e1ff1 0x8a0192a5
+ 0x0d46ab54 0xde0e6d81 0xa093f87e 0x819d8b7e
+ 0x9b0f2745 0xb66b8de1 0xac8c5c80 0x0dc5313a
+ 0xd840809e 0xbc414760 0x4e06e034 0x9d8366da
+ 0x4ef6f4dd 0x7488a4c0 0x83ee53fe 0x2011285c
+ 0x98ab3f5a 0x300432be 0x4fdd5dec 0xb2748763
+ 0xe40d3aed 0x848d99ca 0xc86aaf2e 0x717ecb92
+ 0xba543092 0x3f440cd8 0xe4d927ec 0x9cb09261
+ 0x426c46ae 0xac3a9a36 0xfe83b64f 0x6947e370
+ 0xbc7663a5 0x7debc201 0x651093f0 0xa2962378
+ 0x619f6068 0xa06d007e 0xd0c48de3 0x785efedd
+ 0xd633152f 0x4ea99c02 0x33fad1d3 0x9c9b3c98
+ 0x942fe460 0xfca551f6 0x16a8f197 0x2ad918f3
+ 0x94f02ef3 0xd6524fad 0x72d470fb 0xf84e52f3
+ 0x8722801e 0xefe0a8a9 0x8e593529 0x019f9d30
+ 0x96dc0ace 0x1b768040 0xa49f11e3 0xcff9cbcd
+ 0x58b36b7c 0xe29ea1d6 0x455f4346 0x74f0c613
+ 0x5a8bf97e 0xda51b363 0x6c576397 0xe9252092
+ 0xffa92b65 0xdc2ccaa1 0x30065dbe 0x2b7f108f
+ 0xa84346ce 0xc91916ae 0xb4c5ee03 0x416f4879
+ 0xcdef4c5a 0x76332689 0xbd319e93 0xb8bcf385
+ 0x5e77a40d 0x05de0696 0x52fc9818 0x08faa0ab
+ 0x1e67d791 0x25ef893a 0x9f937fc0 0xbed5bfac
+ 0x93c5f640 0x0abf759d 0xc0d4d7ce 0xc4ddcfaf
+ 0xcd9befd6 0x20ffe316 0x1c07fd48 0x7cfb08fb
+ 0x4f28a8d2 0x18678aa9 0x1a2753c1 0x73006703
+ 0xb3fc95f3 0xfc0cd3e5 0x7fd92714 0x9fd4671b
+ 0xec12027e 0xcf9e56c7 0x7dc68849 0x31e717ee
+ 0xbe531bf5 0x94d45305 0xfb405c7b 0x9ad135e1
+ 0x723c100e 0x37e302ff 0xa036eac3 0xb3a77e75
+ 0xf4c34278 0x349e3c04 0x66df304f 0x2dcf838f
+ 0xd82a3e00 0x5bd6e392 0x83b9a9a3 0x14dfba4e
+ 0x3873144e 0x71c3347b 0x7a4e65fb 0xcd3ba935
+ 0x1153574e 0x83fdf44a 0x49a48aa9 0xe1f9083b
+ 0xa8119f21 0x05209f0f 0x14384d4b 0x27bcc004
+ 0x745fa1da 0xba6eed19 0xcb47e66d 0x91d6a558
+ 0xbad8add2 0x4f1d5fb3 0x4dc75258 0x966f48e2
+ 0x120c1609 0x9b13a6d6 0xf0a16805 0x1898766c
+ 0xde1b9ff3 0x5a9d507d 0x4a565e8d 0xbe88c31d
+ 0x16936be5 0x1f44c02b 0xc23f0825 0x9269546e
+ 0x00e3de36 0x5d47f411 0x0b46ab97 0x95e0f199
+ 0xe0b995a4 0xb8c3beb5 0xa4432016 0x10cea427
+ 0xd300cb4f 0x924d8a9f 0xaffcb88d 0xd1e1e4da
+ 0x7da61ca2 0x8bc8f183 0x780a0c28 0xe518dc05
+ 0xeba38ea9 0xeb7d767c 0xdaa2103a 0x23364f67
+ 0xf02ee3dc 0xebfcfb0b 0x0f22e18f 0xea8fda82
+ 0xa23ae037 0x3722e408 0x6738483f 0x33e8165e
+ 0x3e9c6495 0x5882f406 0x04ac661d 0x1e85cd16
+ 0x827d5265 0xff8d3fc9 0x3d948b6a 0x18801705
+ 0xd9347fad 0x30f8f3f6 0x1ea4d500 0xd5f3c765
+ 0x828b37f4 0xf15d533d 0x73df58f9 0xe870426e
+ 0x928607cc 0xcc5fd660 0x0fb578db 0x75db215f
+ 0x8fcebd47 0x48e3e363 0x0f5d9d96 0xa9d0116e
+ 0x1503a34d 0x1ff75383 0xe3e24a22 0xfda79fe0
+ 0x2661dfd1 0xc1d34c3f 0x971e62ff 0x817f1f64
+ 0xb03fc646 0x0c74b735 0x2e81d310 0x701fe3a0
+ 0x6d6e6b96 0x0ebf1774 0x604e3178 0xb3737445
+ 0x64d91cb5 0x990caa97 0xb977e546 0xabae4409
+ 0x4ccddbe4 0x34d7fa5b 0xfe227368 0x95c83782
+ 0x52b2408c 0xa20b8018 0xac5db689 0x3ee04364
+ 0xffc63f30 0xcc81d116 0xeea99fe6 0x61c785af
+ 0x15a718cd 0x24134c77 0x4146e78c 0x75dad204
+ 0x7ebc0c8c 0x39948f39 0xcb38fc43 0x9c1e1f63
+ 0x48168b5b 0x1c97e121 0xab09a405 0x1cdfbf29
+ 0x4334229a 0x9480fcf0 0xc34091d4 0xa44e0419
+ 0x546a720e 0x8ba3ee43 0xc8cb3289 0x9d123fd9
+ 0x1519a7f7 0x2a585ee3 0x69fc1b81 0xb42ab658
+ 0xd231f924 0x2b55834c 0xfae439cf 0x6816fed5
+ 0x4728350b 0xff2664dd 0xfe0d8f6a 0x3ed2f728
+ 0xc4e4ad5e 0x50347bf7 0xcb8231f2 0x82e044f3
+ 0xccfb78c7 0x5c022555 0x481136cb 0x79dc4fe3
+ 0xa687f0d5 0x07d65c8a 0x66bca01d 0x9bde6dee
+ 0x85a64c04 0x519940ca 0xb22f6e13 0x2b21382c
+ 0xbb81c8fb 0x64c04056 0xc73b33c3 0xcf9a79f4
+ 0xe6e4b7e4 0xb4152ee3 0xee23a4c4 0x157801be
+ 0x543017db 0x95bb0125 0x42511510 0xf557fdbe
+ 0xe374e3e4 0x31f68073 0x0de44372 0x38fed503
+ 0x57cabf0e 0x34288cda 0x7661344d 0xc2e63fa4
+ 0x7f3d4dd9 0x140190e9 0x15d48c13 0x784659de
+ 0xeb682991 0xbe375ace 0x2bc63394 0x0d19af78
+ 0xbf2bb9a7 0x282380e8 0x74ebb09e 0x11a6a055
+ 0x342a3522 0x33d85fa5 0x6c396814 0x303e6ec8
+ 0xde031b17 0x191695c5 0x5fe07830 0x62f1b548
+ 0x5438d408 0x2cfb1c0a 0x67920f0d 0x9d590b84
+ 0x16e7f74f 0x97828a47 0xaf4dcdb3 0x2f6317e3
+ 0x6a7a91e1 0xff788f24 0x8e940bc1 0x473842da
+ 0x0cf70214 0x7090b9e0 0x71261810 0x3b7df990
+ 0x3e669354 0x8759af39 0x77c72d8c 0x0bc8c22b
+ 0x7f1b8ba1 0x281fcaef 0xd16accc3 0xccdba102
+ 0x1e931718 0xcd67cb44 0xcd19710e 0x7a7f0f36
+ 0x375f6e2c 0xd78c5578 0xf55e87a3 0x3ef95e3e
+ 0xea710ceb 0x5a072489 0x61fbbf4f 0x5f1d0fc9
+ 0x598edde1 0xd7042d39 0x1673d192 0xe6973f99
+ 0x084c3ef0 0xbde1539b 0xcdd1bf5e 0xca42632f
+ 0x777a38b7 0xf8fecc39 0x8549e0a4 0x625dce14
+ 0x6655a073 0xb04e383a 0x44f016ac 0x866c7973
+ 0xbb46d5fe 0x994a5098 0x4c3bd918 0x21c73df6
+ 0xc1fd4b52 0xd0a9e113 0xa2f03acd 0x974451f9
+ 0xedd42ca9 0x38870eec 0x2f3e1b4a 0x79c69186
+ 0x15eea43c 0xc90855b9 0xace00357 0x60ce8e33
+ 0x80d117ef 0xd854a15a 0x84cd676e 0xa31d1739
+ 0xa0ca6d4e 0xe84a4524 0xde0136a5 0xdd79e656
+ 0x88b7eaff 0xbd93d15b 0x30ab675e 0x6207f62c
+ 0xd5490adb 0x7480e321 0xea81773a 0x387136b1
+ 0xd5c22105 0x6e706735 0xa4eb2744 0x0ad9a079
+ 0x83349037 0xc330d3fb 0xa81ee533 0x3125b1c8
+ 0xd1414bd7 0xa30afc4a 0xd99525e6 0xdaf73c51
+ 0xd3b98ee3 0xf5b290c2 0xeb799214 0xc7e9133e
+ 0xf8f0076d 0xf445bfe9 0xbdd0518b 0xa30c24b9
+ 0xc5d25b6d 0xa25ba659 0x79234f3d 0x86c8e684
+ 0x8066483a 0xd961e632 0x832d1959 0x44a38ea1
+ 0x9cd3e3a4 0x6b1abcdd 0xe4a7fa59 0x46841d79
+ 0xce38e676 0xc2757fed 0xea7f7e78 0x779eff59
+ 0xf7ee861b 0x0eb695d9 0x3fe9eb7a 0x6c6290a5
+ 0x63cecae9 0x7cedb7e6 0x18878277 0x8008091d
+ 0x1df089d5 0x9bbe0075 0x7f59089e 0xde5aa796
+ 0xd06bb3e1 0x02e9c5e3 0xcfba6549 0x1bd9fb0a
+ 0xb44ab1f1 0x35f7999a 0x95d63438 0x083b9457
+ 0xf328d4d5 0x16f37ae5 0x82beada7 0xe26e4fb1
+ 0x85864258 0x0192a536 0xd0f8b4f1 0x5ecfb19b
+ 0x025fb800 0xee2aaf36 0x792c49aa 0xdd0187c3
+ 0x498647b8 0xe1b41a63 0x09ebfd9c 0xc96f26f5
+ 0x3fc48981 0x8c68303a 0x47a867b4 0x643df6f6
+ 0x84892cef 0x28516233 0xe4c27a44 0xd3129381
+ 0x493d3917 0x7062877f 0x74bde3f9 0x72f9e8c6
+ 0xa2bb3b66 0x712c2227 0x386d2f0e 0x458392eb
+ 0xaebdce7c 0x22555760 0x37c7af5c 0xc651c231
+ 0xc8a649b4 0x7d15f31b 0xdcb9328a 0x36ea9cab
+ 0x3ada09f8 0xe01b773e 0xb7697f5d 0x917aef7e
+ 0x8190eaf6 0x83b98ef2 0xeef18e70 0x697c4607
+ 0x0906b079 0xdf06e862 0xf05b4850 0x2ce2f7f5
+ 0x0540ca6b 0x682a2bf0 0xbb8263da 0x1422b9f9
+ 0x17f35559 0xe2fbcfbe 0x7e8169a8 0x91b8db24
+ 0x42856196 0x0be5a1b4 0x28999d2c 0x2f6be076
+ 0x5269e8c1 0x48cf5766 0x03591611 0x5b72dbbb
+ 0xad300303 0x9eb1aa63 0xb7166a5e 0x6c274e92
+ 0xbe0c6a40 0x69fee3ff 0x5a8dc033 0x40cee68b
+ 0xab9b80f1 0x2395bfc6 0x4afb3b5c 0x9bfd39bb
+ 0x4aab7a4e 0x23df70a9 0xf6c340d1 0xf0f3848f
+ 0x90e7fd19 0x25e0a7ed 0x31074934 0xcddd2fb1
+ 0x6ea34d68 0xe0f3778b 0x7c860177 0xa26b92e6
+ 0x4437a325 0x70fd57a5 0xfc2cfa9b 0x13485039
+ 0x1bd4e4e2 0xaaeea86c 0x4de37971 0x75d20efd
+ 0x34e1ec93 0x5ad122f3 0x6e2f668b 0x6ea6aac1
+ 0x3b94f845 0x8f61513e 0x2e485e46 0xab7132fe
+ 0x5e9e8bfa 0x50ab19ec 0x0285e572 0xbe3ad39f
+ 0xc478eb3b 0x19a94c85 0xf557c5be 0x36597029
+ 0xd37529a8 0x5f0a58ab 0x6417f0ab 0x03d94597
+ 0x70120a10 0x2b6db78c 0x3943d9e9 0x66acedbe
+ 0xf6b6badc 0x471decb4 0xb73d3e40 0x69502e0b
+ 0x341820b7 0x3c2c79b8 0x0a7b038f 0x4a3343ae
+ 0x3ae5458f 0xf6848486 0xcbc982dc 0x2dee4059
+ 0x35a21444 0x7c8e0bef 0x8a8cfdee 0x1534c92e
+ 0xb432312b 0x05b6fa03 0x9b83cf74 0x379159ed
+ 0xc21f11b3 0x7282ff01 0xcf0740dc 0xd879705b
+ 0x173817fd 0x916f3350 0xa496225c 0x65ddbff8
+ 0xd61d525a 0x982e0fce 0xf58fa7e9 0xaf6312f1
+ 0x499fa2f0 0x1f793638 0xb03eb6dd 0xd821309e
+ 0x4f4a5ed0 0x0cfc458c 0x9b65653d 0xd7c822a0
+ 0xe46c1f97 0x5c27b2f6 0xe6354696 0xc4ea6beb
+ 0xaf06e287 0x6e8c0b9c 0x74175332 0x11cf494b
+ 0xf079ce99 0x4be03c9c 0xa95c2dd5 0xcfdafa90
+ 0x3177ca27 0xb2dcee84 0x9201dcd3 0xabebd63c
+ 0xd2fc184c 0x37f40e4d 0x77e93ad3 0x0112f0cb
+ 0x72f682b8 0xf6f3fc87 0xe6abce78 0xc7cf5e60
+ 0xabfd3462 0xe667595d 0x98870028 0x0982701f
+ 0x80b9062d 0x6e044289 0xbe7d907a 0x44d68dbc
+ 0xc9167700 0xf6c5ec5d 0xc5b4ce20 0x2e1015fe
+ 0x55442dfd 0xd7ca7610 0x841c88d3 0x9903db7b
+ 0x95ad7edf 0x9ebf0021 0x4fc157ec 0xf600c811
+ 0xf1ad1f59 0x0d77c2f1 0x89b8d3d2 0xdd9eee7a
+ 0xffb17d22 0x4fca690f 0xc4c1f2d8 0xc8afc94a
+ 0x0c7c1745 0x4bb621b6 0x3d75ceda 0x6f9746f0
+ 0xf44dbe8e 0x9b850efd 0xaab6180a 0x57527cb7
+ 0x3534dd3f 0x1ff6e803 0x76bb9cfc 0xcab36e54
+ 0xf385f182 0xffac20da 0x5b8a43bf 0x5fbf4d2f
+ 0x2b77642a 0xec1e5c93 0xb0504cac 0xee0e922b
+ 0x5e01b38c 0x42dc278a 0x843ab524 0x6992589f
+ 0xf6a2af67 0xf346ead1 0x505098e9 0xb00a139c
+ 0x2eb081d9 0x3b4cd203 0xd9413240 0x9990a5b6
+ 0x5676de55 0xf3adf5b9 0x830c656b 0x79c55512
+ 0x369b7724 0x1afeb32e 0x8118eccc 0x07c0c588
+ 0xb1a09254 0x2bfed2e0 0x214222eb 0xf502928c
+ 0x1bb4ca24 0x6187288f 0x670b0606 0xcbaf70c5
+ 0x807f7d2d 0xe78611ab 0x8dd22008 0xb73fd276
+ 0xa341efdd 0xb6d8127e 0xbe9fc22b 0x55be147b
+ 0xa695937c 0x7708e3e6 0xb725bf90 0xd7c3b12b
+ 0xb33f78e1 0x3955a329 0xff0958a8 0x743e23ba
+ 0x97e9de7b 0xcc7a689b 0xb151a7de 0xe4984eba
+ 0xf195140f 0x4dc261e4 0x6c71f17b 0x093af5c2
+ 0x60744fc9 0x0fa1278c 0xda239485 0x038c1f90
+ 0x87986901 0xd2357350 0x81fe692f 0x31124229
+ 0xc8203adc 0x815d2334 0xc5fd3cf6 0xe2b42ac3
+ 0x9c029ef5 0xfe7ac665 0x14e38a95 0x3ebddbef
+ 0x28a90740 0xac71efc4 0x94c6a80b 0x4bdf6813
+ 0xafee9d1e 0x7fadc051 0x73411618 0x764783c5
+ 0xf6060dda 0xbec13966 0xff5875b9 0x324a6ee6
+ 0xbf1e3746 0x8c3f5217 0x98c5c05d 0xeb471a9e
+ 0x39d7c5db 0xdb2177ca 0xe571d2e1 0x29c0d496
+ 0x2023e0df 0x2c96706c 0xe71db3a2 0x8cffa8ec
+ 0x8116a4fa 0xb4b69138 0x24b7f4ff 0xaa6378ef
+ 0x6046cba2 0x844d9636 0x7aab4c05 0xedc065eb
+ 0x19cf7b8f 0xae8a03bd 0x0ab6ab51 0x0bedbda3
+ 0x85b64a54 0xceac8f63 0x75125a25 0x955b497d
+ 0x465edb99 0x2007e0a9 0xeee988ac 0x1c0643b9
+ 0xc7f956f0 0xbf0630a2 0xf7a6c53d 0xa7432f9b
+ 0x80d2d9bb 0xe1787fee 0x0aaa4f57 0x06f4272b
+ 0xe7493a41 0x2dcd4866 0x30e70a10 0xe955370b
+ 0xf0235059 0x01ae1e21 0x963d6d77 0x960cfd6d
+ 0x75be5eeb 0x4a86dbab 0xcabc4b66 0x3236c834
+ 0xa45290b1 0x659787ff 0xc131650e 0x48d2d9dc
+ 0x1a8f7c4c 0x63998c37 0x06c454a9 0x1ef993e1
+ 0x41aff645 0x00eb2b91 0x101894e7 0xf9b1a117
+ 0x0ed070a2 0x290180da 0x9a14be60 0x6e3d03b1
+ 0x4d3d4ecb 0x80d8ef94 0xcf339b07 0x388cf142
+ 0x8cdb06fb 0xb617e890 0xfac0d770 0xd1fcf799
+ 0x95d67721 0x5ea6a7e6 0x85128e9e 0x7ec079eb
+ 0x29717fa8 0xbf09763e 0x0ebd8399 0x3f480024
+ 0x87d3e528 0x16dda779 0xb7ac97a9 0x86d52702
+ 0x936317c3 0xa5947d34 0xad5cbc91 0xdf5e64bf
+ 0x0a8eb1d9 0x715a4b03 0xb808be4c 0xe2765963
+ 0xdc2a6110 0xff7d6f90 0x5c739c74 0x155c8b7c
+ 0xf395f600 0xf40a488b 0x7fb36cca 0xe9682285
+ 0x83ff1c7b 0xe91b8074 0x2a46668f 0xe273d76c
+ 0x5dd8c7c8 0x3f8abd13 0xe97e90fd 0xbccca860
+ 0x6f0ccf46 0x9c188444 0x61999556 0x8b977e47
+ 0x46174143 0xdbadc2f3 0xeb6ba578 0xc4897ba9
+ 0xf07a464a 0x36f4753f 0x3364e813 0x36d5c7e8
+ 0x4bf18a52 0xdfc3a153 0x1ad55f91 0xfea1e967
+ 0x0c85fd48 0x5384a6b0 0x6b8de6e1 0xa151346c
+ 0x3e7a6851 0x152d49e1 0x78ceb464 0xca23843c
+ 0x6c9d37fe 0x260ce22e 0xcc079bc2 0x7d566992
+ 0x668a3668 0xf4279295 0x656265c0 0x400012e9
+ 0xc27edd8f 0xc152a52f 0x07bc0d7b 0xe6d35b5d
+ 0x8b03c2aa 0xb3766dd3 0xdc3bc28e 0xf34fb1f4
+ 0x38dedbed 0xafa38639 0x6e0fe8b0 0x2dd874d0
+ 0x5df7dae6 0xaf0d2384 0xeefe7264 0x6a478257
+ 0xcdf1ff32 0xa2334718 0x8dd5b342 0xee98b780
+ 0x617fb349 0x864925cd 0x46b3c744 0x8040c26e
+ 0x3353a788 0xcf239c08 0x02d1cc8a 0xe9dcb96e
+ 0x275423ee 0x644ee983 0x3ee92c68 0x89b5ead6
+ 0x4a602133 0xd9b3a33e 0x30de9de7 0x3eff27fb
+ 0xed3b1293 0xd5a05946 0x372e88c0 0xae88aaff
+ 0x91246608 0xce011ebc 0x94550884 0x9d3a85b7
+ 0xdda9250d 0x20542a8c 0x94e4af41 0xe1f80d11
+ 0x2d82a816 0xba9f7aff 0x582c84c7 0x5c43393e
+ 0x8ca04919 0xf5629c65 0x45054732 0x64385e70
+ 0x39383a84 0x3f0e29d5 0xfc1e597e 0x79177f66
+ 0x233e2caa 0x3ce767ca 0x79637b04 0x416d574c
+ 0xb9569e38 0x3b7dac61 0x2f1f86a4 0xe1360d10
+ 0xdf186d84 0x1543027c 0x98b43803 0x5b9b960f
+ 0x0a591f8c 0x8d76209a 0xc4cfca15 0x073a398e
+ 0x66dccca3 0x48719052 0xbf563d06 0x006b07ba
+ 0xed497412 0x084caf89 0xc7f1d375 0xf95e97ce
+ 0x2e5fa564 0x59c414e8 0x313a7bd9 0x3b8c87b2
+ 0xc4963711 0xd6a6f603 0x82ee462a 0xa88093bf
+ 0x67e41f29 0x4512ee1e 0xc38e3a82 0xb3ced654
+ 0xb75a798d 0x881ef18b 0xc204a60a 0x27f7cc5a
+ 0x8d35ad28 0x55594352 0x48a42223 0x259d8299
+ 0x499d2033 0x08f5ea05 0x886a5b5f 0x36b20afa
+ 0x9d49a192 0x01c82790 0x861342a1 0x60e0c409
+ 0x10805370 0x77d499ce 0xa4c7dd65 0xadcf7d07
+ 0xb1dde041 0x875c3723 0xd9dee136 0x2ef52a50
+ 0x4f604958 0x460a4cdf 0x90c070a6 0x717db9a5
+ 0x2fdb4939 0x93e75075 0x5299f7c8 0xa73e1cab
+ 0xdd00cf51 0x534c76b3 0xf2f7b53f 0xb1523453
+ 0x31e9493c 0xa3257b99 0x879cd2a4 0xd74ad3d2
+ 0x5919c860 0x4799f960 0xcf5d884b 0x3c6993c0
+ 0x10b6ea4a 0x86fbf23e 0x8c7be0e1 0x4d573966
+ 0x1a893b58 0x3d91ee3c 0xdf041806 0x7654f684
+ 0xcdb8a2e3 0x790b3d04 0xa9cb7d65 0xfca1b3ab
+ 0x143c2c58 0x7595bc5f 0xaf4b4a40 0x57e69cc1
+ 0x0dd31961 0x303d1795 0xa2a63e3f 0x20dcc683
+ 0xf374c161 0x72105c7f 0xbf2faa0c 0xdfb12f28
+ 0x8396721b 0xd75fbb08 0x6941bcfe 0x46c7fac6
+ 0xfd526b99 0x72e68fe2 0x0950f9b1 0xbf298858
+ 0xd8c0f08b 0x9bf1aa3b 0x21048aa0 0x8a90fb0a
+ 0x12036d46 0xe4ca93da 0x7e2cb27e 0x4beaf867
+ 0x8d62c893 0xea10003e 0xecac918f 0x86205028
+ 0x3b54abeb 0xff5d6617 0x1c267469 0xc68f5c5d
+ 0x1f1659c7 0xfd478aca 0x893e1748 0xc7998d21
+ 0xd230ec24 0x394ddb56 0xcca6aae4 0x3f2c2f4e
+ 0x248ae819 0x67b13e4b 0x5864309f 0x0beff2ce
+ 0x33198654 0x4baeb6f3 0x342ada7e 0x4803dd05
+ 0xea8892e7 0x5bb0efc9 0x19c01d97 0xa7aeafa5
+ 0x70fe7a60 0xc32bca1d 0xbf231477 0xfd38a5d1
+ 0x5dda8f7c 0x4f81a2c8 0xf1f60ac8 0x4e5ce4a2
+ 0x65e9d910 0x0c874bf7 0x74c3c85c 0x344f381f
+ 0x15030e53 0x70127334 0x51c5d7ca 0x044ae0ae
+ 0x66f10350 0x3aa8df7a 0x21880a75 0x260d14eb
+ 0x133da4c8 0xbbc8e897 0x76756741 0xfe69c06b
+ 0x6c95899b 0x411fd880 0x552b7d85 0x3b30d292
+ 0x77435e89 0x1355beee 0xdf003991 0x6a15a772
+ 0xc5d80050 0xd5c9382c 0x84cdda29 0x94cd9965
+ 0xb5a84a3b 0xa08abb0a 0x7a9d6141 0x9bae52cb
+ 0x8c07ff9b 0x28061f0f 0x5a0c5e6d 0x9eabdaa1
+ 0xc97f23f3 0xead6928f 0x7269206e 0x884229c7
+ 0xc7d771c1 0xa3aea19f 0xbbf0ceda 0x4140012e
+ 0x8cf90bca 0x5b2d3152 0xf287f031 0x41f8d35b
+ 0xa103ebc5 0x5aa73c70 0xacab87c7 0xdcaf712e
+ 0x78410214 0x2d9cfdaf 0xd39dfba8 0xadc67ad2
+ 0x73cd67c4 0x7aa75914 0x6571e799 0x39adddc2
+ 0x8546ffa3 0x6b4bce4e 0xc2e8a1b3 0x1b104196
+ 0x55cb07f0 0xb90bc06f 0x0f230543 0xfbadd0aa
+ 0xd098422b 0x0e34eafa 0xbee3ddd1 0x4df90b34
+ 0x3f29b4db 0xc87e2f94 0xeb54be37 0xc374ff38
+ 0xac22f71f 0xa8aebf4e 0xea310c0f 0x6c21369c
+ 0xd244dd2a 0xa68d4f48 0xdc6a92e1 0x37caf199
+ 0x66082e5d 0xcb124920 0x70af34bf 0xc5796cdc
+ 0x368a9147 0x149f376b 0x4e69caae 0x33f33e7e
+ 0x5724c343 0x05b13f9d 0x01b87bfc 0xfc263eb4
+ 0x3c5f38cc 0x0a5f6033 0x2e4a54df 0xf530e3ff
+ 0x3d1c60de 0xa4ba42ba 0x9726de09 0x0046806e
+ 0x9791823b 0x4d64cdeb 0x88d5e42f 0x597daa59
+ 0x1c55c15a 0x39e015a8 0xc538e916 0x00ab7195
+ 0x9071b51e 0xd97ae2f7 0x9807d116 0x5cea5164
+ 0x8d74c00c 0x6b251b56 0xbf58fbaa 0xac250c07
+ 0x945daadc 0xda7917d9 0x7c068d3c 0xc004802d
+ 0x0296b4fb 0xe1b1a5e8 0xd5ddcdf5 0xd7b6183c
+ 0xe5bd6c42 0x2299abf3 0xfa87e2cf 0x3686128c
+ 0x82cb8d29 0x6654136f 0x3e9ab17a 0x44dd6e32
+ 0xb44b0faa 0xfafa413f 0xec73d96e 0xce064861
+ 0xd411bf46 0x8e4e4621 0x2218e385 0xc535040f
+ 0x6cd85d4f 0x514bf4a3 0x9ea8d8aa 0x8ba6bb48
+ 0xf46738b1 0x3f04c9a7 0x52c13abe 0x83ced633
+ 0xd7664fef 0xfdcdc5ec 0xc1f2e432 0x889da687
+ 0x620ecf91 0x7af5d799 0xe69493b7 0x5b738999
+ 0x4d2cc130 0xa30be59f 0xe9b5473e 0x71896548
+ 0x906b8a23 0x5a76224f 0xda560e42 0x3b92f7b2
+ 0x4a90e2b4 0x6c2a9744 0x0a0219ad 0x845e3b08
+ 0xf3fe408b 0x4745a6dd 0xbfa574d2 0xfa49e8fa
+ 0x44940ff1 0x086b919f 0xefb7460f 0x550eb161
+ 0xb032a166 0xfa434888 0xc4cc385f 0xfd2ff664
+ 0x3d4c1f99 0x82c06f59 0x2de837b1 0x6b52dd0f
+ 0xb6ad23b1 0xd05151b3 0x0a2871e0 0xe85226f7
+ 0x9043c92d 0x79058576 0x33a962f5 0x17cff6fe
+ 0x0b78888e 0x6622d840 0xbbe1be04 0xa50efc0e
+ 0xb53934a8 0xb4ea37d1 0x9f4436c7 0xfb53b5f0
+ 0x6e68d93d 0x30184ced 0x14fcfaba 0x38a492a8
+ 0xe6f0a8cf 0x9099de6f 0x5765d144 0xe111d965
+ 0xa473138d 0x3be66029 0x1d365c34 0x4deb53d2
+ 0x5e9c4f90 0x68b67bf3 0x0c897ffa 0x93b561a5
+ 0x8f5eac9e 0x091c8c8f 0x4fa0298b 0x7e38101b
+ 0x34c62801 0x0f735c36 0x419ff5a9 0x9d8e68e3
+ 0xd8038989 0x1bee76c9 0x38089cfe 0x7d19097c
+ 0xbf31a9da 0x33bb0d59 0xc76b443b 0x1ee83f21
+ 0x807f8f06 0x0ee9612b 0x3f459f79 0x103d2f72
+ 0x8da89260 0xacee343c 0xa46b2d58 0x2a60396b
+ 0xd117b1b9 0x612c34e2 0x591fb909 0xc8144a5a
+ 0x0d779add 0xb6b76e8c 0x7d5e1708 0x55f21741
+ 0xeeeba67c 0x0eafa75b 0xde498575 0xd15fb914
+ 0x6ddf1959 0x7bc7b6a6 0xc144abc1 0x26afb10f
+ 0xb29b7512 0x7815d027 0xbec51943 0x7d6583b5
+ 0x8f26a407 0xb7bfd258 0x8cfcf59a 0x0a7a9e66
+ 0xde51a634 0x3f787f74 0xcaa26da4 0x736c83ee
+ 0x4634c5e8 0x66b64dd5 0xae95b8bf 0xe2bd2894
+ 0xfd8ba4ec 0x0c20a2c7 0x813a64ad 0xc60af07a
+ 0x732dc477 0x601e0197 0xe04ac001 0x564bc90f
+ 0x4a9d25e7 0x11f65eb9 0xe6fea958 0x223da6c8
+ 0x8581f601 0x88145d23 0x1bd42c0f 0x04f2d28a
+ 0xe24654c9 0x5b08d2cb 0xf6546ffa 0xa5a744df
+ 0x4cb791c2 0x61f5f89c 0x6b803a24 0x5f546567
+ 0xb1199d2c 0x2a22c0c7 0xd2ae5c0d 0x090c6055
+ 0xe1037d8e 0x7b41db99 0x7514e362 0x17fd5157
+ 0x34ad8c90 0xff662bf0 0x1f01570e 0xe6169186
+ 0x54d47ec5 0xdab4af4a 0x7fb2d49a 0x9e2e4a49
+ 0x32c44e3f 0xa6bf1ee2 0x1faf2814 0x29282a53
+ 0xd0b72abb 0x2ffbd0f3 0x21006432 0xcd46d7dd
+ 0xf64b0313 0x1d03fa9d 0x4389c1d3 0x3703ceec
+ 0x36aacd09 0xfef7884d 0x7047cbe7 0x8954f663
+ 0xbea645bd 0x2c6b3f10 0x029b36c9 0x96759c04
+ 0x10ae8d9b 0x4d85f973 0x756b5ec1 0x2eb35037
+ 0x3100e803 0xd01905ad 0x448c28c9 0xbabe98b7
+ 0x788d6d6d 0x71da1dab 0xa4927839 0xa56ab98d
+ 0x0087dfe0 0xe1337450 0x65585e30 0x99b63afe
+ 0xefcaf038 0x2d099c4d 0x32407de0 0x9b094c50
+ 0x6ece7c59 0x6d86ec20 0x6a2160cc 0x0bc3e325
+ 0xa54f792c 0x0544d34e 0xebaeb072 0x7638ba3d
+ 0xc8fc882f 0x0f532d93 0xd77dd024 0x65d4edda
+ 0x9c2e5637 0xf73c0d0b 0x16e3d323 0x7de101fe
+ 0x91f87849 0xefddd1bf 0x8b24af18 0x233cd450
+ 0x2785dca5 0xd2214427 0x59459371 0x7ae571f5
+ 0x48ce3223 0x080f86a3 0xd308cefc 0xed2e45e1
+ 0x5b6a4315 0x1466f286 0x83ac8bc1 0x5567eed5
+ 0x8090b29c 0xeae1d679 0xfc238d76 0xc1eb7c42
+ 0xdfdec1be 0x7fdaa172 0x8016c65c 0xe89476ac
+ 0x599236f5 0xaa124bb9 0x515ea6f7 0xf16851bd
+ 0xa3fa9be1 0x401feacb 0x516145f2 0x77b305e9
+ 0xd8cff8b7 0x4300572d 0xa6c42289 0x4a73a9f6
+ 0x21e2894f 0x4af4dd20 0x43fc544e 0xcfac2867
+ 0x66fc9def 0x7332fdfd 0xaaaed04a 0x32ce1d6a
+ 0xe6725a79 0x50206ae3 0x2eb4a6f2 0xd0c7df73
+ 0xd1bd6097 0x15774ebe 0x4e104db1 0x2f5cfd5a
+ 0x3e74d537 0x65716c73 0x08458a3c 0x0b74ce34
+ 0xce8d90f2 0x21afc2d5 0x72216251 0xa0f312e6
+ 0x253644fe 0x42b7facc 0xe3f4fd41 0xcfc21f7c
+ 0xc455fe9d 0x706fe56f 0x8c04af77 0x70751b53
+ 0x7df3a3cd 0x43712289 0xe5882298 0x8afd8557
+ 0x76462a24 0xbac24d74 0xe165ad81 0x23b9a538
+ 0xa71c0137 0x6fb1cbf7 0x0b51ebc8 0x114a447b
+ 0xd6e07bfa 0xf0a6c415 0x8cb99dc5 0x2e0e31e9
+ 0x1bc18710 0xe4b96a4d 0xdac3872a 0xb741211f
+ 0xfe9e7a77 0x76e645b3 0x4852ec86 0x1d6d982a
+ 0xfde19d14 0xb6da8f9c 0xa951999d 0xb3086f10
+ 0x8aebf978 0x8ee3286e 0xebd52207 0xf1e2a866
+ 0x228798dd 0xc8087195 0x2315b21b 0x9b500be0
+ 0x9ab8d442 0xf152d839 0x85a8e3ed 0xadcab2ca
+ 0x1ebe2197 0x5126e698 0x3dff6302 0x2941336a
+ 0x28326340 0x61880041 0xeb2fd2a3 0x3de1e2a2
+ 0x1234da0e 0xf3b1549a 0x1f283cd0 0xf3821c39
+ 0x59754e35 0xcbb933a2 0x4436d243 0x54ca0de8
+ 0xe632538a 0x23869338 0x4d35d0b3 0x285377d1
+ 0xbd299300 0x515d7481 0x09b2fc0a 0x98b5bf50
+ 0xbab2b7ee 0x8780f346 0xafdfeb1d 0x22ab972c
+ 0x71fce448 0xda57ebad 0xfe0a2785 0x01da0d77
+ 0x375aaed0 0xa3d414b7 0x4fb19891 0xc707aff2
+ 0x8ca1d94a 0xa6d23c03 0x04d6dd16 0xa6b3f879
+ 0x1eaae384 0x9b99d588 0xc689af4d 0x4fcc25c1
+ 0xcdd7eb3a 0x75b95712 0x62703e21 0x116d06dc
+ 0x631c9abc 0x2d3f0c11 0x696bec86 0x7c5c2fbb
+ 0x2409cde4 0x6dac2db6 0x3f9bee2f 0xe7e54a27
+ 0x56768bcb 0xc0368fbf 0x93fce0d3 0xe92313e4
+ 0x093a7b97 0x5d2af760 0xdef2ab6a 0xbf3863a1
+ 0x6106d416 0xc434bd1d 0x06d63078 0x2f1c8c81
+ 0x755f8476 0xecb494ca 0xb08c6ceb 0x5d593d08
+ 0x40c2e068 0x54d3308b 0x936c1d1a 0x4c96a092
+ 0x6fa95de8 0xc12a9b48 0x9eb5e5eb 0x98c087b7
+ 0x508ce106 0x0915df8f 0xcb43a306 0x05e72250
+ 0x21e16fa5 0xb00fd201 0x962639e4 0xb0893d78
+ 0x514b8a14 0x8b151be4 0x2fdeffdb 0xa450fe7f
+ 0xf0e63b7a 0x4aa0ebff 0x8a8275ef 0xef853a85
+ 0x7efab0ab 0x0a4fbd19 0x697ddf85 0x8df6998f
+ 0x5e69b745 0xc64c3a08 0x79829f24 0x460e3a41
+ 0xcccbdfb3 0x8da90a90 0x39f81dec 0xce305d2b
+ 0xbb35f3ff 0xe399aa1e 0xace951a3 0x1bd210df
+ 0x5ec90597 0xf325cd5a 0xcbd78d03 0x9d04c0cd
+ 0xa86595a5 0xfeefc2e0 0xc0d28407 0x4e9f69cb
+ 0x4d4f1bed 0xc970f33c 0x62186944 0xa6c6354e
+ 0xde435280 0xc8ea7a55 0xeab20041 0x0e95491c
+ 0x78b3821a 0x763ee3b7 0xc8100ce7 0xce83c316
+ 0xcc1a0c8c 0x13d1a74f 0x39ecbbde 0xe98145db
+ 0xe302f8f5 0x22eb6a20 0xa8f74af8 0x41ddf49e
+ 0x8433cd5b 0xc456c28e 0x6afb686e 0xa5db1c39
+ 0xc83cb0c9 0x4419fd52 0xd44db362 0x20cd4d63
+ 0xada966c8 0x3bacda86 0x437d4ac5 0x13973b39
+ 0x4a49b85c 0x99b48075 0x23f0c25b 0xdac8cf6a
+ 0xdaab7730 0x19a518fe 0xd95b8162 0x71902b5a
+ 0x70013771 0xae97283e 0x4444c4dd 0xfc275dfa
+ 0xc29f21fe 0xa39f3abe 0x7cb3e13b 0x35d6cc56
+ 0x056ef713 0xe2dc81cf 0x8fd0c22c 0x6db640d2
+ 0xfe3ebb1f 0x531c8302 0x80cdaded 0xa9fb8c4f
+ 0x274bcf29 0xf62eff4a 0x12bb82b4 0x7e4ad163
+ 0xd8b1f0d8 0xae5bae34 0x2165bcef 0xf50ba211
+ 0x68557956 0x7e67449e 0x99ee2ccc 0xb8b69f15
+ 0xd9b36a24 0x63b27cc6 0x4badcb12 0xea899076
+ 0xf975b6e9 0xfe58ebcd 0xc5ff654f 0xcaa7d6fb
+ 0x5ea2e405 0x90ae7199 0x72ec3b9a 0x2a453106
+ 0x47d3b1a5 0x361d8aa6 0xa149a23f 0xc8f8d390
+ 0xe5d7318c 0x326a2bba 0x9118a5a6 0x6c219a33
+ 0xe05fb376 0xc9004bd0 0xabe44e0d 0x3870fe2f
+ 0x3c728447 0x84406b26 0x318c800a 0x0235ac0f
+ 0x16c01806 0x27c4d984 0x8f14f125 0x658b3b5e
+ 0xdb28aefc 0x630b641b 0x3fb5ebc4 0x634a85cf
+ 0xe80ee19a 0x33e0826b 0x518e6a12 0x999713c8
+ 0x667f8d0b 0x0cc9a577 0x508fb0f3 0xa5d6e73d
+ 0x20e61c9b 0x50f4f2e7 0x236c8a4c 0xade76a7c
+ 0x0fa450c1 0x0c54f03e 0x72fe04be 0x8ff73d80
+ 0x392bee56 0x15b5b4c6 0xa62b7a0b 0xb796b3a3
+ 0xbbcbf54f 0x80417daf 0xe574a712 0x28001ea8
+ 0x5e30a497 0xa6a25c14 0x32ba16c6 0xd661e4a6
+ 0x817f509e 0xa496d2fa 0x1e4f8cf4 0x90f78f96
+ 0x163925c7 0xdcb0d33d 0xaa865639 0xd3e387a4
+ 0x14fcf5ec 0xc21eda73 0x923784b0 0x097bcd98
+ 0x0fcda2d8 0xbbb9ebad 0x5f064dae 0x40dc2c31
+ 0x7f0a08f9 0xe7dbc5ef 0xe77aac9a 0x591de70b
+ 0x2cc62bdf 0x47a345ff 0x81edc110 0x53d48b75
+ 0x566557e4 0x0c42d611 0x9edd448d 0xe5f4814a
+ 0x27dac99e 0x3f135f84 0x84f9493d 0xd4f2b218
+ 0xdbd3f692 0x78c3348e 0xb5af1757 0x763a3c8c
+ 0x876b14ae 0x806a90c7 0x4e7f5dc0 0xb4591516
+ 0xc91b6579 0xf3df296d 0x3dc74e23 0xa08e7b7f
+ 0x14057ec1 0x5871291c 0x5062175d 0x85a85b54
+ 0xebf56545 0xc0a81211 0x2598fcfe 0x7eb97d02
+ 0x9a854167 0xfd613310 0xfd850f78 0x1fc72c95
+ 0x45c218c2 0xd44e9a3c 0xca586f12 0x57c3f9f4
+ 0x44802040 0x80064ad7 0x23fc4c50 0xeb9ed0f3
+ 0xdcae36be 0x38f6e23f 0xf3385950 0x0e101cae
+ 0x1bd16945 0x232547a6 0xf42c3231 0x3711c4f3
+ 0x1f7e8a4c 0x31004985 0x12da4ae8 0x543c4828
+ 0x7f6818d5 0x921559f3 0xb8d51d29 0x52e0ff15
+ 0xfa8fe0c9 0xb828d1e2 0x4521a9d4 0x186f4757
+ 0xeaab0188 0x61cb1636 0x516a3dd5 0x9d3f2958
+ 0x02b28e7b 0x434d010a 0xb5169c95 0xb65d4e5a
+ 0x6321b3c1 0x890ac766 0x308f6b60 0xe54788cd
+ 0x9e90752f 0x7036f8bc 0x86f97de0 0x5ec031ce
+ 0x14857989 0x9da1e45d 0x5216f2b6 0x4c589080
+ 0xfb55177d 0xf671424d 0xfce77383 0x950281b0
+ 0x401609f3 0xd9516273 0x219e07b4 0x06a5a04b
+ 0x190f2f10 0xbd1c7956 0x0476d223 0xae30e102
+ 0x9c5efc75 0xe156c478 0x6f004a43 0x00333843
+ 0x6d8e6818 0x382ccf95 0x4c82bfeb 0x7ab758c0
+ 0xa459cbd0 0x7be79ec2 0x9cfeed10 0xa9d0caf7
+ 0x7192124a 0x902f0cec 0xaa932326 0xb8e7c76c
+ 0x130deb5a 0xeb354197 0x7680bf6e 0x54e7bf33
+ 0xd4307c79 0xbd907fb3 0xe72b54cd 0x32255b9a
+ 0x5a535257 0x3b9d7736 0xb30d0792 0x96b18203
+ 0xc4ea711c 0x97fdbc19 0xc59eda9a 0x69cc67fe
+ 0xadc51de0 0xfe2a0dd6 0x806cd25b 0xa466a58f
+ 0x200f78de 0x1089a442 0xeaa6bd5f 0xc84ac519
+ 0xf1e80f62 0x58636f84 0x48f3438b 0xcf725f01
+ 0x5a82943d 0x8dbd5a00 0x5c989265 0x60b58123
+ 0x80f6d70d 0xfd1d61f9 0xa171fd28 0x5618614a
+ 0x841f993f 0x705228f0 0x04016a43 0x56594302
+ 0x9828b756 0x50e2ea9d 0x118e59ff 0xc356bb3e
+ 0x9f946380 0xf715706c 0x885ef6a1 0xf5f81e59
+ 0x98b6f836 0x9a375f8b 0x2842891b 0x85462288
+ 0x0669f199 0x25fe39d9 0xec1eff0a 0x78d8116d
+ 0xc5973c6d 0x3008a2d8 0x57e18637 0x57ffae27
+ 0x3c4ad88e 0xd8e93dc7 0x52ff67e3 0xe5cd75a4
+ 0x421c56bf 0x6b15b0f5 0x7f41f7c8 0x60e92dcd
+ 0x67c81bd9 0x927b1693 0x245ae76a 0x809aa48a
+ 0x15b746ae 0x22bf4dc1 0xbcf5b625 0x9a3c4bac
+ 0x14451f53 0x5aad23ab 0x97c9c618 0xdc76caa4
+ 0x929066f9 0x4d3d818d 0x6611708f 0x3ce63234
+ 0x1b349745 0x5262efcd 0xaefab5a1 0x2306ce0a
+ 0x57977451 0x277663b2 0xf772cde9 0x384dd60b
+ 0xd8b4b7e3 0x5b3a187d 0xb7692fae 0x45bfff07
+ 0xa2043035 0xf851c7fd 0x1a8b848a 0x66b8f87a
+ 0x0ae0a524 0xad92f9d6 0xd7565a73 0x5ea51378
+ 0xa2319d9e 0x488c427a 0xe9a39c18 0xe2b183de
+ 0xfd778117 0xad88bc56 0x14f76023 0x6589b358
+ 0x257130a6 0xcb6184d2 0x4aa80502 0xcd5605b7
+ 0xf53e19a9 0x9953e7bd 0x669d6448 0xeea8c2ee
+ 0xc7b213b6 0x079a1cdd 0xad1d5103 0x5561fb0c
+ 0x3bbe50b9 0x9ffa0693 0x78051ade 0x7b73c195
+ 0xb414ddba 0x47899188 0x18026d9c 0x2bdbe5ac
+ 0x9f65cab3 0x91950d72 0x3dfea1de 0xdd61569c
+ 0x6604206d 0xf4ba96b9 0x20820f66 0x7f0b0243
+ 0xa6a0f325 0x5eaeb2d9 0xf789bc01 0x1373f654
+ 0xd4a47473 0x04425ded 0xdd9a7f3a 0x3abf275a
+ 0xe263ea14 0x8f6169ff 0x3a63a3b2 0x87ba15ee
+ 0xd0a5a156 0x26bde235 0x931edc59 0x03c4e928
+ 0x323aca3c 0xfedf8396 0x209f2f4e 0x1aef810a
+ 0xb3f2679c 0x3316418b 0xb553434c 0x8634c005
+ 0x30a100ab 0xc245675a 0xb206ea0c 0xedfa5ab1
+ 0x6b4b846d 0xfd5fd128 0x29798aec 0x5fc41f53
+ 0xb15722b5 0xbe1d3033 0x223adb78 0xc1fe8904
+ 0x76de3953 0xaee33aa3 0x10dfc850 0xa6e4a584
+ 0x8920dc0d 0x21174399 0x0a5afe74 0x94d90916
+ 0x86ecc3da 0xf656eb02 0x85857ecb 0xe3f5ca94
+ 0x7cf0e460 0x4e0bf7f3 0x1a04ae50 0x73372cc0
+ 0xcccf3b51 0xcdd169d6 0x22b9106a 0x1fa60507
+ 0x6925bc91 0xe36356de 0x359f7032 0xe86f8dd8
+ 0xc327a0cd 0x2ca53f93 0x6e315548 0xe73a3e92
+ 0x8c42965e 0x8645d7ba 0x4770dad3 0x1a7886dc
+ 0xec8e8307 0xc8ff6dcc 0x1557a35a 0x4c1b527b
+ 0x435da150 0x32bf6ecb 0x6d0bf563 0x3284be9f
+ 0xb9b23587 0xa33477da 0xfce96214 0x47972a39
+ 0x1fbbf2ca 0x25627d43 0x12f86a56 0xde86b0e9
+ 0x124c5903 0x6b86de58 0xf7952a1c 0x1a6b63d0
+ 0x9f8bc4d7 0x030e5131 0x44f06ade 0x4f71d355
+ 0x2e965410 0x40ca062e 0x70111389 0x660d6267
+ 0x678a5c80 0xdc1ad7a2 0xb29961d8 0xd2f26196
+ 0xcf275c02 0x3190a61a 0xd45b4aa2 0xbbf7b9db
+ 0x7829943c 0xb8f7274b 0x0c1c0585 0x163d0476
+ 0x6efc76b5 0xc5fef0f7 0xa75c14f3 0x2cb9fe8e
+ 0xd399ce15 0xd2a184a4 0x0768a954 0xcb80d980
+ 0xb95cd729 0x4e901b18 0x9eab3bf0 0x7237b401
+ 0x6225c6c9 0xc7495145 0x35c2942a 0xf447bcbe
+ 0x9a32be83 0x558e59a7 0xb5af8b87 0x0a2d2d98
+ 0x8374f2c4 0xf177c03a 0xbb19cdc1 0x01a613fd
+ 0xff39389c 0x0e17ed79 0x0475abdb 0x5de4a8d5
+ 0xf6b4171f 0x6e8edd0e 0x776b40da 0xb5509e37
+ 0xda6f8a3c 0x75fc2c3f 0xd53e31b5 0x66de7c7b
+ 0x3406c2f9 0x517bf87a 0xea6ecd3b 0xcfd09c66
+ 0xb72b24ff 0x37435510 0x90be4cf0 0x03a452b8
+ 0x553e8ca1 0x24214c39 0xe5c0fa12 0xcd1c9c3d
+ 0xec7a7231 0xb4fa832c 0xf5de6468 0xe784a3d6
+ 0xb9423f69 0x354f9fe3 0x41521557 0xfadd5984
+ 0x39ca80ba 0xcbe6c652 0xf3b45a2f 0x6992bbb7
+ 0xa4c72b39 0x6854594b 0x82d2ef15 0xd584e39e
+ 0x6b3b4fcd 0xdd492030 0x867cd856 0x249b821a
+ 0xb0379bed 0x4100e222 0x7312537f 0xcb521849
+ 0xceb72aaa 0xac51cc81 0x7586ae8d 0x71f92cff
+ 0x311fdbcb 0xd4116dbe 0xab717f42 0x791414ef
+ 0x70d4d8f6 0x91f1f135 0x30bc99b3 0x36da6d95
+ 0xc48c49c5 0xc803d576 0x5f495677 0xe4262583
+ 0x68e4b23e 0x976ba635 0xa0243fbc 0xab04ac6f
+ 0xfeaebdf7 0xa81d7fec 0x6b3d049c 0xc3221da5
+ 0xe96e56be 0xf858386c 0x562b0da6 0x3e4766ea
+ 0xb353cee5 0x94d008f3 0xabec8b06 0x51bf82a8
+ 0x7cc0d89a 0xb9cfd0f0 0x13e18bfd 0x6bd00069
+ 0x6daedd19 0x6abafb5d 0xbf34f37c 0x2d90a21c
+ 0xe9f4d292 0x0a66b943 0x7f1a60d7 0x59ef101c
+ 0x54fc6b3b 0xce03a480 0xa08d6b8e 0x06baa20f
+ 0xca03542f 0xf0ff27fa 0xc5ece348 0xe47d42c0
+ 0xa0d8b8b0 0xed01b33d 0x8dd63d7f 0x5fd02a8a
+ 0x81f83853 0xba341238 0x0a63ceb5 0x86406ecf
+ 0x7d665976 0xfeba74c4 0x258da3ea 0x204cc408
+ 0x11582f04 0xfe3cd7b4 0x3b714588 0x3dc97528
+ 0x7f9887dc 0xdd2f6d06 0x7e4d19c9 0xc552514c
+ 0x424e75fe 0x7ae62f2c 0xdd9222f2 0x3ba811e5
+ 0xd7a0ab49 0x625090f6 0xe5850c24 0x707013ca
+ 0xb8ace70d 0x95dac4a6 0x62577f26 0x01d632d1
+ 0xa3cf47eb 0xf9b4055f 0x32624c4e 0xff941d8e
+ 0x9e5af670 0x93f99de7 0xbbb3954a 0xb227af2b
+ 0x3e4ab087 0x02f16e48 0xf28c64d7 0x758792f8
+ 0xb21b32e1 0x8f24ee98 0xfd415342 0x456b2172
+ 0xdffa483a 0x2a38036f 0x21f6a971 0xdb479757
+ 0xbfd259ed 0xcd38e863 0x05279d93 0x09d71d11
+ 0xd8e0257d 0x494071d0 0xf157a892 0x4510edd4
+ 0x685357ed 0x0390b056 0xbd746b34 0x1d337902
+ 0xaeb9ed88 0x112f875c 0x0ed6bf0b 0xecb8fc59
+ 0x9bf72b5b 0xa4740376 0x0213572f 0xa8e00b6b
+ 0xdc393631 0x4963115b 0x1b6e6818 0x0e73d2f6
+ 0x8e954a23 0x9390c58e 0xa983e79c 0x7350ee9c
+ 0x96d8a259 0x4a01e546 0xf9868dc6 0xbdf42faf
+ 0x7aad50fb 0xbfbba165 0x4f51a747 0xb3bfa5bd
+ 0x53809dfe 0xadef7a2a 0x445390c3 0x67725c26
+ 0x9b260e5b 0xc2b8e005 0x8cddbee4 0x96d47ac5
+ 0xfb60e03a 0x8b52f81e 0x0995ab9b 0x84057106
+ 0x2becaca0 0x0fd09571 0xe01aecef 0xa119ab8e
+ 0x485f4536 0x595fad9c 0xb9b1ebdf 0xbce19699
+ 0x36731f9d 0xe4f16794 0xf6c5aa03 0xbbce3355
+ 0x5d93a8a6 0x33383e61 0x050f50f6 0x769d6b3d
+ 0x83212d78 0xd149ab11 0xec478081 0x54cc8540
+ 0x7201178d 0x1c843939 0x85c75091 0x4f6a9a78
+ 0x2759be97 0xf1376629 0x4ce2901c 0x02ec8e45
+ 0x6eac63c4 0xb22fa33d 0xb2a7f661 0xfaa77004
+ 0x01d9237f 0x10aaa035 0xff7f3513 0x196d1dcc
+ 0x7430bda1 0x69b71e23 0xd74a90b6 0x65d74784
+ 0xc6490de7 0xd6e9f2e2 0x0b87f40b 0xe8849c1e
+ 0x617a85a5 0x92b4512b 0x2d73aa4d 0x899d01fb
+ 0x8e982fb6 0x117b432c 0x715f3f5a 0xda4272dd
+ 0xf08ae063 0x1218725b 0x95377933 0x3c7b26b9
+ 0xf21d2042 0x45c2ba68 0x10809214 0x86daf0a5
+ 0x43f02612 0xa33e0ff4 0x3d695563 0x6689b249
+ 0xf3cf7710 0x9d0a39b5 0x2aa45670 0x85a326d3
+ 0x0af694e9 0x08a6b8b6 0xc8a83fe9 0x6914713f
+ 0x08f30177 0xd2c29d1d 0xddda35c4 0x769e7700
+ 0x1986d959 0x6689ed32 0x3fdac901 0x70caf3c5
+ 0xe63bcab1 0xbcdf809f 0xff6a878c 0xc3d343ef
+ 0xd6452e17 0x7177a0ad 0x32ff3fd9 0x1297df84
+ 0x9b84eba3 0xba5b1465 0x494ffd04 0x5dbe7244
+ 0x21e61112 0xb8b4cd36 0xc7dcd6ec 0xa6c0c3f4
+ 0xca16bd6a 0x00a6971f 0x835bc69f 0xd8dc4a5d
+ 0x98d10553 0x24f1d85d 0xf4a3956f 0x8ee7dcee
+ 0xacc0ed5d 0xe16d9960 0xbe3a381a 0xc0cc0d60
+ 0x559ef1b7 0x39d86162 0x93a4cb6f 0xafe29854
+ 0xf8b48577 0xbb9d2550 0xafb458ba 0x849c35a9
+ 0xa3e207a6 0xa030e543 0xc8e935da 0xe5f32787
+ 0x3ea91533 0x1745f72b 0xfdf08a17 0xe89e9f1c
+ 0xef67d2de 0x0694671e 0x2f5e3907 0x9fe6dd96
+ 0x925640ac 0xde272aa6 0x1dac04ac 0xf94a0f54
+ 0xdefabfec 0xe955871d 0x23a1aa04 0x6bf36852
+ 0x2211162f 0x5bc98c83 0x3f6924f6 0xb64e7f2d
+ 0xea3a8302 0x2110af91 0x75304d77 0xe82d2a4b
+ 0xdd7d4da6 0xa98c038b 0xe3a315c4 0x7e5b999c
+ 0xf025fa4f 0xf1b7b69d 0xbcb13965 0x96dfcbd7
+ 0xd41309a2 0x32ff856f 0x6d37bef7 0xc8bb6095
+ 0x66cb32aa 0x1f6162da 0x90bd942a 0xf412e06b
+ 0x776966e3 0x387582d1 0xd71a7e8f 0xd75f3b6a
+ 0x53734892 0x88eff90d 0x69220b7e 0x3045352f
+ 0xdf533e9b 0xc91845da 0x298cc6fa 0x8ba5e6f6
+ 0x0f9167de 0xc5978c4d 0x6ea85f96 0xc77f10cc
+ 0xd796bf8d 0x480d9931 0x56174c70 0x02174000
+ 0x6cc4521f 0x1715f38b 0x913546d0 0x84585357
+ 0xc83dc565 0x8e957fc4 0x07d3474e 0x42983e88
+ 0x0ff84d07 0xe56208a7 0x16709afb 0xd607f6d2
+ 0x6e445f5e 0x73d95fa6 0x712035df 0x4b8fc909
+ 0xe5af4df1 0xa758d797 0xf2b9273d 0xc4b62d39
+ 0x729c23da 0xc7253a08 0x62b12859 0xcb3fded4
+ 0x1454ea1a 0xe8e7e773 0x55924cc7 0xf73f5e6a
+ 0x797cac9b 0xbd48c20a 0x4ff6f18e 0x8407e804
+ 0x4ab04803 0x5a5334ee 0xfcd7cd6f 0x5ec80f18
+ 0xcd164a55 0x67ac6dc3 0xf6e49a75 0x2f69bc0e
+ 0x4c0f0211 0xd5ae1cf3 0xf5103445 0xf27bf657
+ 0xdf432f9a 0x6eef249b 0x0598d382 0x15109505
+ 0xe872af5a 0xd2428b36 0x657d55f9 0x04732810
+ 0x3cf097d4 0xb8ef402a 0x62bb44ff 0x665b05f8
+ 0x11abb02b 0x42d2aaef 0xa149aa71 0x529ecbea
+ 0x683cd7c7 0xb2f09135 0xade28ede 0xc8e59a7a
+ 0x803e4b2b 0xa623a7f9 0x3953e208 0x93d4144d
+ 0x842aca29 0x58caf86e 0x549d425e 0xf7709fc4
+ 0xb50284bb 0x6dbbce3d 0x7796d7b6 0x4899750d
+ 0x3382194a 0x19a7bea8 0x73e5465e 0x93ba1c22
+ 0x9aa1f2bd 0x7f5691eb 0x3b950058 0xf02cc3ee
+ 0xa8f28dc6 0x789cf720 0xd441c4d7 0x35b1c8b1
+ 0xc8e842a4 0xff10fe2c 0x425306ff 0x4d6a191c
+ 0x22daa4e6 0x519c5fb6 0x2cc4cb10 0xe7120144
+ 0x9f4a7d69 0xe6d5fc30 0x75ec0eea 0xa7de2cbe
+ 0x5fa59098 0x9df3a6dc 0x52de5d2a 0x82963f9b
+ 0x3709a412 0xd626c435 0xa8f00f34 0x3a512069
+ 0x006983b6 0x3b0a697e 0xe90bcaff 0x19297264
+ 0xf9fceda6 0x18d9d689 0xc9e69d7d 0xbd9710c4
+ 0x135279fd 0x4a359c26 0x11166e2d 0x804ad089
+ 0xe6d18178 0xd90f71c3 0x0d9a0a8a 0xb7180f54
+ 0x6d70facb 0x361be428 0x041f3f0c 0x4cb0c5ad
+ 0x614e8d27 0x6527e2fc 0x97ac698e 0xe58d7c00
+ 0x1cec1d90 0xb321bee4 0xf3beb812 0xc255076b
+ 0x2c4acfff 0x706b6ed9 0x7fad6b11 0xe306510e
+ 0x2fe3ddb3 0xb2f08024 0x62e0e2cb 0x5a4f90dd
+ 0x210d2a16 0x092c0832 0x9eb04a23 0x96838a58
+ 0x12caf300 0x63aa4aee 0x11b6a93d 0x7cb752e4
+ 0x435311b8 0xd00aba1a 0xef846a02 0x4ea790a7
+ 0xf29ebc8d 0xc336a707 0x630de4a7 0xe45708db
+ 0x20db2e1d 0x57cb316c 0xd479b609 0x9af6571d
+ 0xdb970db2 0xc9fce654 0x96f09aa5 0x225ba7d4
+ 0x2891a63a 0x9b9162eb 0x799def38 0xc6643e22
+ 0x44b31cdf 0x8c0a493e 0xaf71100e 0x84127a59
+ 0x6f91a01c 0x803ab9dd 0x28e9fb3d 0x161a12b4
+ 0xf59c264a 0x29b43833 0xa7aafcf2 0xf6c720d2
+ 0x5202b6e1 0x0318c41d 0x7d0ff022 0xe827a277
+ 0xf6abd6c1 0x29e0eb01 0x9ab11402 0x83328f75
+ 0xb7cb13bd 0x84fb5817 0x5e85ebc6 0x8d99fa64
+ 0xff2938ea 0xfa96fc30 0x038fef42 0xc90de80b
+ 0x71a9eae0 0x20049e42 0x049ac066 0xdf3e3519
+ 0x1b2d5a75 0xbab5f077 0x685f20d3 0x215b1298
+ 0x10a9e784 0xae8f4b2a 0xd8dca751 0xbe8c6ee4
+ 0x6773524a 0xb2f04d49 0x3c6bff85 0x799ef406
+ 0x5c656296 0x801122e6 0x6a1d81bf 0x595fccd2
+ 0xcc12da8d 0x4c5e3b60 0x3437b239 0x518f817f
+ 0x8e467efc 0x9869a104 0x2461a353 0x3c28f835
+ 0x0e67618c 0xc29e23b6 0xfaf34214 0x143cf0b4
+ 0xf5a69276 0x4feb63c1 0x704d989c 0x9db3e3fd
+ 0x6ba1398a 0xcf57d34a 0x725911bf 0xcf4c858f
+ 0x56d964cf 0x0d5fa849 0xe886cca5 0x8e9ea46e
+ 0xacd4b8e7 0x95bfe216 0xbb88491d 0x7c88e59c
+ 0xeffb9ed3 0x49a4b758 0xefb24fde 0xc0232164
+ 0xb4b7ccb1 0x679b78af 0x4d21dffe 0xd45a35d4
+ 0x160823de 0xf65e4066 0x341fb2ab 0xd6f614d6
+ 0xfbf17ba7 0x5afd13a6 0xa455273d 0x453821f8
+ 0xf8f37428 0x2090963f 0x88e8b836 0x38dc985f
+ 0x510c17fb 0xe2deebcb 0x069a2f4c 0x1ccee426
+ 0x8c443999 0x34eb5aba 0xae95c92c 0xb7f83819
+ 0xe4827abc 0xcf417efd 0x2ddc73d9 0x128a6e68
+ 0xf46bb0e8 0x64d7bdcf 0x9d8772ee 0xb943c873
+ 0x2b0f0c3f 0xab1fbe06 0xca0c4bb7 0xa300b28d
+ 0x0c8060b9 0x000484d9 0x5f274f61 0xf9358725
+ 0x1aaf33a0 0xb102f1db 0xe86b39cf 0x9e11d9b3
+ 0xa0881ca4 0xa3024006 0x46a99267 0xfff365e1
+ 0xd2d48d38 0x86d9d95c 0x49c0bfe8 0x1963c548
+ 0xe91ca0d1 0xb84e3c1b 0x195eb0a8 0xe3646e97
+ 0x916a186a 0x667a2a25 0xa7ab38d5 0x183d43f9
+ 0x70bffcc5 0xf154bcb2 0x14c046bb 0xf9ff26e7
+ 0x69d79ced 0x48a05fba 0x372a5f9a 0x35b5c9a0
+ 0xe0e358db 0x8b5f0dc5 0xc22f701b 0xe683f48d
+ 0x5b034911 0x0fed5e7f 0xdb683998 0xd6a9a700
+ 0x1badea0d 0x173f4bdb 0x83168ab9 0x1f1923f3
+ 0x32ba4e68 0x4c9e79ce 0x8f1f299e 0x7b4f20b3
+ 0x1243e98f 0x599dbc27 0x74f24d56 0x0f773707
+ 0x09f1e68b 0xa6fdb723 0x29e6e470 0xa3997247
+ 0xafa009be 0x742282a1 0xb36642d8 0xb8aa17b3
+ 0x3c9af066 0x50b94ed1 0x4761835d 0x8fe20805
+ 0x7b858120 0xe440c815 0xcd52cd4b 0x18d6edc6
+ 0xa41772fd 0xd148ee14 0x2009222c 0x46c65426
+ 0x2795c9df 0x21eb100d 0xc2bd3803 0xfe1d9d76
+ 0x7a9d1821 0xbdacbc01 0x1fa45260 0xfb631eda
+ 0x894eae94 0xf4b5070e 0xa8d7a16a 0xe98b428b
+ 0x1a476a36 0x741e97ed 0x1c77247e 0xc0a72a45
+ 0x5427f854 0x4b64d7dc 0x6242e4ee 0x55e328f5
+ 0xb248d583 0xcc4cfb27 0x8d86039f 0x7f41761a
+ 0x2efd22ca 0xc70922d8 0xc4b573a4 0x15820152
+ 0x1c0ba97a 0x6496dbf2 0xb76018bf 0xba84c083
+ 0xeff0e5f6 0x763db7db 0x775345a3 0x9b3c003d
+ 0x01dbf9e8 0x3cc5b87a 0x47684026 0xd63b0b9f
+ 0x0d83eb4f 0xece68b2a 0xdd07b7f1 0xd303743c
+ 0x630027b2 0xfef29b84 0x03683911 0xe707c285
+ 0x8ebae47c 0x5c19641b 0x35f08e66 0x6cdbc761
+ 0x65f0c3dc 0x760b9893 0x8025249c 0x8abb720e
+ 0x37dca4c0 0x9694f8d1 0xa1b5805e 0x091749ce
+ 0xd8978f50 0xbd4ad496 0xd52d5e2f 0x0fef221c
+ 0x6c867aee 0x56c39956 0x223895fb 0x8068532b
+ 0x60df98b6 0xb6dd366b 0x5a17e3f3 0x81fcce53
+ 0x488c6fce 0x814349f8 0x89cb9ba6 0x3b53e5f6
+ 0xe9da7bc2 0xf80568ed 0xab234165 0x371349e7
+ 0xd9a947d6 0x1cceec36 0x8573f942 0x7290f0d8
+ 0x5f161a82 0x70e3e105 0xa6c26088 0x469cd6ab
+ 0x134c630d 0xc5464ce6 0x571a0351 0x8e21b837
+ 0x3665d020 0x667bacd3 0x9d196b21 0x111a868e
+ 0x0aed7801 0xb97e3b65 0x6808e4a1 0x113eb51a
+ 0xa37bb421 0x7c56fd88 0xcd22277f 0xd9c895f1
+ 0x68ee5f3b 0xc043f5bf 0x41494580 0xd5b242eb
+ 0xc4825a66 0x7c7a56a3 0x0693064e 0xf12d515d
+ 0xee675338 0x7b86749a 0x02dd1685 0xa66647fe
+ 0x9f5d1795 0x473579b4 0x4ab09d77 0x0dc10dc5
+ 0x44026e86 0xdd35ead4 0x8fb96400 0xfdb30e9a
+ 0x0588e53c 0x39d80fc9 0x324ad652 0x913a457b
+ 0xe669b8dd 0x3eb47660 0x7041bf1a 0x62f98e20
+ 0x25968303 0xa02c8b5a 0x6c075fcb 0x1fb183f8
+ 0x2e9a679e 0x16edc9c4 0xbd2c4d02 0x422fe595
+ 0xa83913d6 0x383e0b59 0xd1447684 0x3cf2b3ab
+ 0x66e67b30 0x8cd1527d 0x80a9bb5c 0x4abc2c5c
+ 0x66d06ea1 0xb7a64fc9 0x2e539496 0x27555c5c
+ 0x9ec3ee3b 0x61a32d28 0x50a76922 0x45ed1f81
+ 0x38743d4c 0x9f1eb599 0xce331719 0xc995e2b1
+ 0x74dd1277 0x44743eeb 0x6521d577 0x8e76beb8
+ 0xea7af3bf 0xdb7f2ffc 0xa630105b 0x89fe0f28
+ 0x7a977152 0x9f092cd5 0x5b927403 0x28305b13
+ 0xab3c67db 0xcd7f3033 0x16ca25d7 0x8e3f57c3
+ 0x8caae435 0xce4b7269 0x3688b9d1 0x369a8493
+ 0x6df48a4e 0x0489dd7b 0x5b2e807a 0x3925185a
+ 0xcf305c92 0x986b562b 0x60c50830 0x0f4dbf84
+ 0x0576611b 0x3839e3ce 0x9af0007a 0x4709eaef
+ 0x3d1ad6c4 0xc1eab1bd 0x0a58b099 0x45c204cc
+ 0xbf2a5251 0x93cac875 0xd2cfbfde 0xfdd58e30
+ 0xe37bfd04 0x3a5263de 0x435cbcb6 0xe09e54f8
+ 0xf33cdfb1 0x0b5abf2e 0x0a3c3188 0xc5e37648
+ 0x9a7a5ddb 0x1159c4b0 0xe7be16f5 0x0116786d
+ 0x96657ab6 0x747e553d 0x5f4b9ec3 0xac693308
+ 0xb3415d8d 0x3b685a30 0xf1c42e72 0xcda1f5bc
+ 0xd687153a 0xe45ced9f 0x6b2d5657 0xea7c3117
+ 0x175104db 0x284929f7 0x13f1c0ef 0xc2a5f183
+ 0xeed273f8 0xc92f15db 0xd5f95bd4 0x69885d65
+ 0x9c3fb788 0x8b930eea 0x88086995 0x7aab4028
+ 0x8a14792e 0x257ec30a 0x2231b1c6 0xf91df891
+ 0x2fb015e7 0x1d4bb578 0xff4d6f2d 0xc2c3db5b
+ 0xad03584e 0x19a1b1c3 0xf153fe52 0x7ae7f48e
+ 0xb8f4c0f8 0xb5d48c52 0xa94fef1d 0xd43eff71
+ 0x7bbfd2ba 0xa5f8ea89 0x576fd7b1 0xb2903342
+ 0x4273485d 0x131e2843 0xb377d9db 0xfc8ff297
+ 0x30a2ddba 0x44a1b8dc 0x01bf515b 0xc0da16e2
+ 0x508d9f74 0x7a90a4f1 0x57568e63 0x11a09bdb
+ 0x51a604c2 0xfe12e1e8 0x6a9607d6 0xb1a0a789
+ 0x6a76e484 0x258166b7 0x8ad6b887 0xc444addc
+ 0x517ebf69 0xf79397ff 0x0049f65d 0x9e145a13
+ 0xe0068f55 0x027a0364 0x5a0057c7 0x1e6b6f8d
+ 0x41698aa4 0x58f4c1f1 0x641caa0b 0x84a9d59e
+ 0x8b651eae 0xfbf026a1 0x054304a6 0xbf66fd74
+ 0xc00a93fa 0xf863127f 0x52d37b5f 0x46c214dc
+ 0x630b5b22 0x091351c2 0xa247c4a7 0x1eacbcfa
+ 0x9bceaa14 0x4367f8ee 0x83b3d3bb 0x2b1f13e6
+ 0x69643070 0xafc8472c 0x17c26523 0x50edcc79
+ 0x3b15944d 0x3c5a1363 0xbf0b4701 0x4f194d5c
+ 0x3ba74203 0xf7e493db 0x13f070d4 0x4f42d64d
+ 0x5e7a6127 0xca3ba6b4 0x2ff001ae 0xe9ce2be1
+ 0x1c584947 0x917fa2fd 0x25b9c328 0x376192fe
+ 0xf8f9eaf3 0xb6ec754a 0x58d16bfa 0xf093cc7a
+ 0x9f9e6fbe 0x0e02ffdf 0x8dffad5e 0xd72e0790
+ 0x0151e220 0x91b565cc 0x7ad2c99c 0xc1955fb0
+ 0x12fd0a43 0x9efd7fb3 0xf6e3997b 0x3eb490fd
+ 0x708cbf53 0x5dcd89f0 0xd9cf7780 0x507d6bbf
+ 0xa7161efc 0xc3723ce7 0xdec81ada 0x276b5d15
+ 0xe953f82f 0x35f30ebc 0x1ab1dde1 0xfaeec970
+ 0xc7f3f073 0x14e819ea 0x21e2f1d7 0xd559bf86
+ 0x772e14e1 0x0eb88848 0x00e69e61 0x8a497d1d
+ 0xa963ee2a 0x8ff10aa5 0x37c194a1 0x6a000265
+ 0xb55dfca1 0x69f61cea 0xfb2c527c 0xe6d64f5d
+ 0xf732b4a1 0xba8c9ff4 0xcaa5d101 0x81053249
+ 0x6658aa41 0x857699bb 0xa2f13d14 0x1361bbbd
+ 0x2bf2a199 0x00398645 0x070abac4 0x5cce57de
+ 0x8267bf14 0x4543d732 0xe47218ae 0x30aef0bf
+ 0x2d5edd4b 0x440f9aa8 0x4126c00c 0xb6d99d96
+ 0xbb36d858 0x46d38282 0xf8a43705 0xa75557ee
+ 0x04327972 0x5bea1e19 0xff8becda 0x2e0a7a49
+ 0x574c643b 0x7a5302a1 0x7c2ff01f 0x1257edbf
+ 0x15bf9b62 0x03c74cd7 0xd22e143c 0xb891f41b
+ 0x533876b2 0xf73f9635 0x19dc3428 0x2c673ac2
+ 0x6b682d9f 0x1aeafa18 0x9af0a22c 0xdc43c8f1
+ 0x2b786385 0x10f98eb4 0x8aad0a78 0x77d5c4e3
+ 0x61a5f667 0xb4aa1847 0x8789a085 0x007ff3d8
+ 0x06c7a5db 0xeb3c591b 0xd0a8fef3 0xb9470f57
+ 0x9174392f 0x594f6001 0x017a8569 0x10aad33e
+ 0x04815079 0x69ea4901 0x076b6aee 0xed30c5d2
+ 0x06fc650c 0xf574a085 0xb9c1e1b1 0x3ebb08ce
+ 0x285e57fd 0xc24570ed 0x7460c123 0xfd985bb7
+ 0xc478bfde 0x877bcc7f 0x493062ce 0xb4cc6a9c
+ 0x880e2028 0xa589365a 0x962f15c5 0x703cbe4d
+ 0x0d56c4ef 0x193d4d90 0x276b4569 0x9ca9eace
+ 0x6d7a304e 0x7c50f0d4 0x5ff737cf 0x46bfd681
+ 0x59cdb9d1 0x1f437987 0x17177ff7 0x39e83454
+ 0x48fee875 0x5d48fa8e 0x2705b465 0x3c478202
+ 0xb199ec9a 0x0108d7f6 0xa43f30ad 0x1576cd45
+ 0x59849348 0x0701b1d2 0x32827168 0xf654bcf5
+ 0x288297a9 0x533ad0d4 0x9d9696de 0x0f498526
+ 0x8fe5ab96 0x957af30e 0x69ffbf6d 0x3b13652a
+ 0x46ddd99c 0xd673e4bf 0x97f13d07 0x51b78a76
+ 0xb220a001 0xad4c5bdd 0x99d90d52 0xfd892417
+ 0x60034f0f 0x1e412240 0xa8197499 0x9995f0a8
+ 0xa38cba7e 0xb800d542 0x0e783e44 0x88129fce
+ 0x4809663f 0xfec5cb0a 0x52f61a9d 0x14d12170
+ 0x2bd8cd03 0x09bf9435 0x73734b1d 0x219ea5d9
+ 0x74ed78b0 0x95994396 0x9415ab93 0x3d13a09e
+ 0x6fe96774 0xacf99169 0xb4f051c3 0x07f0ea49
+ 0x36980427 0xed285a17 0xde1a0009 0x1a7a5a29
+ 0x0d609fca 0xcd460bcd 0x7693718a 0x73f57373
+ 0xd48e6402 0x2d1d78e0 0x9a77cfc3 0x37909719
+ 0x1644b501 0xfd90123c 0xeb4251f2 0xb503e033
+ 0xff3e1f6b 0xbe265870 0xf3f21485 0xacb23ea8
+ 0x48225e94 0x2fa168a5 0x85fd8d79 0xd93d3433
+ 0x00e124e3 0x753715e3 0x493b849b 0x682a18cf
+ 0xc0018f99 0xc710e6bf 0xc8e3fa66 0x286bd828
+ 0xe17e8c66 0x4721a38a 0x70df0ce3 0x16bdc77d
+ 0x66a1f048 0x53328406 0x70f75e77 0x7cd05511
+ 0xca4cbb1e 0xb0fbe0ff 0x21f5dc79 0xb447587a
+ 0xbe077a4b 0xc6845495 0xad48a151 0x3765dc3e
+ 0x6a49324b 0x251b88c1 0xed59bad9 0x5f8f0267
+ 0xb59ce794 0x16452ef6 0x5c50ba3e 0x7ed68ede
+ 0x84db7efa 0xcaf2ea3b 0x5fdb4ff1 0x6a286fe0
+ 0xe94297d6 0x27590c49 0x6f3e12ae 0x19e41cf1
+ 0xa0f0502f 0x3cd2e909 0xb2aef610 0x78c5b2d2
+ 0xe49209c8 0x6ebe18c5 0xf137a7a7 0x4f4eb99b
+ 0xe6d79941 0x07d2bb35 0xd4b7d8f4 0xb25a1399
+ 0xb57dc708 0xe59b2408 0x1b5df50c 0x7e0b3879
+ 0xcf7b61db 0xe996a300 0xd4dde50d 0x2e55ba95
+ 0x8083ceaa 0x2fdf351c 0x6273920f 0x7faed796
+ 0x10958965 0xad134825 0x34c002c6 0xaaca47a4
+ 0x725f8421 0xac5a6cd3 0x75e0848b 0x5b0df598
+ 0xe8d27993 0xfa909486 0x2e298288 0xea3f0e20
+ 0xa6339ec0 0x54a648f6 0xa7a801da 0x7c710a28
+ 0x68f427a8 0x3af716a2 0x764ca04e 0xfde6554e
+ 0xec662cb0 0x8718d0eb 0x0471d858 0xb30d0f68
+ 0x80b04ea0 0x7d863a99 0x78f19cd6 0x4916d80a
+ 0x89175a16 0x730eea74 0x3746aefe 0xfa1cf6b5
+ 0x61adef3c 0x501f951f 0x13745487 0xd1b3ff32
+ 0x6884d5e2 0x02496686 0xf83c84d3 0xcae1b806
+ 0x83edc94d 0xc7d9566e 0x1433eb37 0x89969700
+ 0xa954cc67 0x8ef1253e 0xede17011 0x19f95b50
+ 0x170bfd83 0xa2f9ae15 0x1f7ab3ef 0x433b7cbe
+ 0x46542510 0xcb24c0c4 0xb6192b4e 0xab31ac5f
+ 0x12a28bf6 0x9b30c0a9 0x639cd074 0x6c7ab249
+ 0xb34a412e 0xf17389b8 0xf18dde36 0x633b6868
+ 0x78830066 0xbcc82cdf 0x60b934e6 0x9353d93b
+ 0x294b8e89 0xa81635bb 0x494b2335 0x0ab73edf
+ 0xe9252637 0x325fc7f5 0xb40a24e0 0x0523577e
+ 0x06b432d9 0x5fddc685 0xfd7acfac 0xace4443d
+ 0x569a1a6a 0xbc445236 0xecc5cc92 0x151182ec
+ 0xe574f5ec 0x2c56e2bc 0x2af5abce 0x4339c30c
+ 0xb55188b9 0x23698d98 0x60820baa 0x93ff7340
+ 0x94c3333a 0x20f0e87f 0xab1d9fba 0x35834bea
+ 0xd154a699 0xe320890a 0x85bf556d 0x42a2849c
+ 0x7ba110dd 0xaee94e55 0xc790062b 0x78a8c168
+ 0x66b1329d 0x0b527436 0x012da168 0xd2f0ee39
+ 0xb679c867 0xca0a6921 0x940ccadb 0x6946498a
+ 0x768d5174 0x5e7fba38 0x383f7c89 0x5c567fb2
+ 0x310f24d4 0x4db03e90 0xd1bf21ac 0x8f15e7d0
+ 0xa4d86530 0x8044a876 0x91f5130d 0x398f16ff
+ 0xc7c1e0e6 0x9938b166 0xe3268899 0xefc1713a
+ 0xe57529c5 0xfc878166 0xecf72ded 0x95ddaadc
+ 0x0b391002 0x48d721e1 0xc5d1c59c 0xe7b1bebb
+ 0x32fc2599 0xef46e6af 0x988769f1 0x71acab79
+ 0x490080ac 0x10056692 0x2e11eb27 0x5acacf81
+ 0xeae43c4f 0xc9e639d4 0x42d4c5c4 0x950606cc
+ 0x3724a3dd 0xaced0ab2 0xccf75ff8 0xa27ca076
+ 0x3bd73ecb 0x843f6982 0x48bc7011 0x460fa891
+ 0xff7040a1 0xefdec3b5 0x4e32c53c 0xee9410f1
+ 0xff88acac 0x38ceac92 0xcd7eee13 0x0fb5c53a
+ 0xe6051d62 0xae5cecac 0xe98ab365 0x3c6f4ab6
+ 0x3805e767 0xe0afc6cc 0xbb50a97e 0xd77e3cde
+ 0x11461b04 0xe3596b3e 0x2462e279 0xd3ce1706
+ 0xf5d951bd 0xac5d54e4 0xc5b0e96a 0x4d278b29
+ 0x32bf069d 0x5af0d8c8 0x774c9588 0x86541549
+ 0xb784a57b 0x62041d1e 0x84fec5e2 0xe7a02d73
+ 0x1d74f2a9 0x611e0553 0x3b1d3821 0x1145d1fa
+ 0x6c9eb1cc 0xa206315e 0xd144fc48 0x73847ca1
+ 0x5029d400 0x7cd55815 0x1b144927 0x9cf7c04c
+ 0x9643ea87 0xb16eb72e 0x3aa8837b 0xe8da7e89
+ 0xe7da78db 0x5e50528c 0x3da12100 0x1b485ad1
+ 0x1b21c0b9 0xb7bd623a 0x01350aa0 0x9ef31e71
+ 0x2fd41bdb 0x7c65f063 0xe643f189 0x855b2c38
+ 0xfd39766e 0xa29166da 0x85cb19c3 0x0553eec2
+ 0xc3981002 0x05c026b5 0x0e6d7f4e 0xe45eda9e
+ 0x4a8d4a53 0xf7c0d328 0x7ec10195 0x48aabc2d
+ 0xa5162132 0xd673f0d3 0x28370129 0x386ca94f
+ 0xc5e4fcab 0x63c14f79 0x156e44ff 0x4ef699dd
+ 0x636756ef 0x4e4d0bb3 0xd29b405c 0x91efa47b
+ 0x97ed6b3d 0x00f84348 0x0fcc73d8 0xbf412254
+ 0x9e13a7e8 0x4fe9d1e1 0xa5f6f2cc 0x41d448a0
+ 0x7ec7bad5 0x47656169 0x306ef8e0 0xeda02d50
+ 0xc2fe9304 0x7ea7402f 0xb2165f5a 0xe36f3293
+ 0xd2bf7174 0x64c1d01c 0x35331b08 0x8815ce43
+ 0x0a860ec0 0xf000b1e2 0x22bba533 0xd2466bfc
+ 0xfb50c4ee 0x59c255a6 0x08ede5c6 0xae11af6b
+ 0x21c567f8 0x2deda390 0xf582c770 0x32a71f68
+ 0xe5ca38bd 0x9911a225 0xeff94cde 0x66620d38
+ 0xab8bc0c1 0x1682c8bf 0xf4822ea9 0xbbcd0d23
+ 0x33bfde90 0xaee20724 0xa257d4ab 0x11802b6c
+ 0xb1b1b529 0x31c2d8e8 0x00aa517d 0x4289c462
+ 0xfa2fa42c 0x72557fc0 0xb0a54dbb 0xd5fc3e96
+ 0xc07e39c3 0x93c0971a 0xa3abd61d 0xb5ad71de
+ 0xb195e2c0 0x90e6594d 0xf86668b4 0x1c2f6270
+ 0xc77d4f3b 0x6a37da20 0x420517a3 0x1cb5a1f4
+ 0xdd65a884 0xd25f8295 0x7e4b9e1a 0xf9218723
+ 0x14c15112 0xf5494da7 0x115c0604 0x2ebe1653
+ 0x38a7a4c9 0x65d309e1 0x699bd062 0x3ac861b8
+ 0x27172a07 0x1bf1ef7d 0xe84020c7 0xf6789173
+ 0x9b74b780 0x925900b9 0xd05be0a5 0xccf0d5f9
+ 0x7aa80fbe 0x590af161 0x12d33a9a 0xc301a2bb
+ 0x27852617 0x277ba895 0xaf4925e4 0xed32ceea
+ 0xa577e5e1 0x7d8ee645 0xf7e7afab 0xf4399460
+ 0x0f2918e0 0x6f3ebf38 0x6b850f99 0x220658ae
+ 0xbbd7637d 0x650f7053 0x7cf7d110 0x9ccea7af
+ 0x79a727d6 0x80e9ed94 0x1bf513d8 0x1ab6e5f6
+ 0xb4d31711 0x7912ac20 0x9e27d831 0x322ffb9b
+ 0xdd8ef385 0x9738f2c6 0x2fd86982 0xf4e8c2c9
+ 0xde9db8b1 0x5539d392 0x677fc7a6 0x2c5eb135
+ 0x6db4c192 0x9da897e6 0x627d966e 0xed9b7993
+ 0x969ca010 0x784e3016 0xda8678d3 0xdc1f0963
+ 0x4e7ff6f5 0xb14d0966 0x552e1b93 0x68a43b8c
+ 0xa2236345 0xa9b56c06 0x2d07cd9c 0xb6956632
+ 0xd779e7a7 0xeccd2305 0x6bf60f0c 0xea0b32ad
+ 0x14ea130b 0xb30ee5a9 0x8e076029 0x473f2043
+ 0x051b275e 0x415bf046 0x9428b049 0xfa732499
+ 0xd8419bf6 0xd4841843 0x2bf32829 0x3fbe2cda
+ 0x6faa0fcf 0xfb282345 0x6ed0c2f3 0x08b172fe
+ 0xd78bb73e 0x850b4c41 0xd3e9b902 0xc606fc7e
+ 0x069dcaf6 0xc8ddc1f5 0x07f3fe56 0x98f43217
+ 0xd111880b 0x7280be17 0xc19c6d05 0x28546554
+ 0xb38a24cb 0x933951fe 0xef7b0e5f 0x2c0c01cb
+ 0x7a8436df 0xee6b863c 0x8f33f6d4 0x861541a1
+ 0x53685709 0x86f04b0c 0x7d592b84 0x04846350
+ 0xb67cede9 0xdc297b9b 0x08e1ed70 0xe9306e22
+ 0x013e379b 0x6635c475 0x00b95612 0x37514ad9
+ 0x8c86123e 0x69c21346 0xe7b3d1dc 0xc09150a5
+ 0x94b115c8 0x5799e5eb 0xf69cc4f8 0x3646b963
+ 0x05e73f71 0x056f7937 0x4858bd19 0xf0cdbcbf
+ 0xb7aac562 0x716a0b2d 0x849328dc 0x79bf0fa8
+ 0x5092c51c 0x4b43622d 0x10d60769 0x6f981f1c
+ 0x163b2b7e 0x210b0d12 0xc905e28b 0x139c2e1b
+ 0x39e7ac9a 0xfdea5974 0xd240ee81 0x00b605d6
+ 0x5cf6da6d 0xf6e5864c 0x538e2b3a 0x0b68a4d9
+ 0x1542f8aa 0x22fdc4b0 0xce0727d9 0xc00509c0
+ 0xe2e9da83 0x85e58cd3 0xc3a4cc2a 0x05b733d9
+ 0xd142b1b8 0x9b50b224 0x24a4f235 0x7e26e4ff
+ 0x72d74616 0xa8118811 0x845249c8 0xb385bea6
+ 0x9ae48f64 0x4f3fc38c 0xfb92d503 0xb348fd91
+ >;
--- /dev/null
+/*
+ * ---
+ * This is a device tree fragment. Use #include to add these properties to a
+ * node.
+ *
+ * Date:
+ */
+
+compatible = "intel,microcode";
+intel,header-version = <1>;
+intel,update-revision = <0x40a>;
+intel,date-code = <0x12182015>;
+intel,processor-signature = <0x406c4>;
+intel,checksum = <0x5807e19a>;
+intel,loader-revision = <1>;
+intel,processor-flags = <0x1>;
+
+/* The first 48-bytes are the public header which repeats the above data */
+data = <
+ 0x01000000 0x0a040000 0x15201812 0xc4060400
+ 0x9ae10758 0x01000000 0x01000000 0xd00b0100
+ 0x000c0100 0x00000000 0x00000000 0x00000000
+ 0x00000000 0xa1000000 0x01000200 0x0a040000
+ 0x00000000 0x00000000 0x18121520 0xe1420000
+ 0x01000000 0xc4060400 0x00000000 0x00000000
+ 0x00000000 0x00000000 0x00000000 0x00000000
+ 0x00000000 0x00000000 0x00000000 0x00000000
+ 0x00000000 0x00000000 0x00000000 0x00000000
+ 0x624800aa 0xf01ac54c 0x5a84228f 0xcc79131d
+ 0x9feff6a3 0x4a87b5a3 0xac874956 0x7dfe6197
+ 0xef44e4c3 0xf91d4958 0x230883b7 0x7382ab6e
+ 0xf14324ef 0xf94c28d7 0x9131d196 0xebcf2faa
+ 0xc049cb37 0xd1577abd 0x5edbe45a 0x17e1ca1e
+ 0xbe9a92c3 0x1c8e1790 0xb3c08b8a 0xca799851
+ 0x3f2a8c92 0x1b7e15d8 0x1f44ecb2 0xaeda1838
+ 0x0ace8669 0xae9d497e 0x424c680c 0x21b3a3ed
+ 0xd924acfe 0xddc126a2 0x26363596 0x21cd999b
+ 0x193f9df3 0x037d1953 0xf97a3dc5 0x4c94ad7e
+ 0x98b360f0 0xeb90461f 0x438e6d2e 0x30851a0e
+ 0xfd623681 0x18782d3c 0x702938c5 0x462df0dd
+ 0xf7d67cc1 0x161076a0 0xf06e5db3 0xd861a76b
+ 0xa40b06bc 0xed37c69b 0x2b25f98b 0x2b67887d
+ 0xbf0131b5 0x571b7c25 0x34eb3752 0x992e406e
+ 0x031ba8e7 0xccfc5b1d 0x33f487e9 0xeccc3098
+ 0xe452737b 0xb38cc286 0x817bc58f 0x852a7fde
+ 0xcbcd1b19 0xab11894a 0xa1f278d7 0x360829c9
+ 0x11000000 0x242e4460 0x190ba541 0xd3a20d0c
+ 0x7de0fc1d 0xafbe0a08 0x3233d6f4 0x82d82901
+ 0x12c67fea 0x927c5686 0x8d45c03e 0xdb650016
+ 0x88e39816 0xa493cdea 0x81a87c12 0xadbd5724
+ 0xd402794b 0xdde114da 0xa32c6058 0xd820b63c
+ 0x712726d9 0xf99787b2 0x1b8628b6 0xbd4c94ff
+ 0x70952446 0xa00d56ba 0x36911787 0x5f3ca7d7
+ 0x7cc87a67 0x10c77f6f 0x63bb3eaf 0x85f294d3
+ 0x3283b281 0x71c85eb4 0x69a72f05 0x5e0f08e0
+ 0xdedd727a 0x8f300d0e 0xe1998f90 0x340f0e3f
+ 0x8ce037fa 0x801f7160 0x671b364c 0x09c2ba50
+ 0x6d506296 0x4760ba91 0x046e581b 0xd5711e70
+ 0x58c7279b 0x4376b9b5 0x63cabe1e 0x9c22ec14
+ 0xb6752bf0 0x1b4da16f 0x09a0c65f 0xc6dbaf78
+ 0x04e7d9aa 0x20895400 0x9516e20b 0x8cb87942
+ 0x16f1e580 0x4dc7b3c0 0xec4ea2a3 0xd57a22c3
+ 0x51306f3f 0xa9ef572d 0x261efc37 0x9d9e7b4a
+ 0xe3024514 0x4a2e2c58 0x3a77c165 0xafab4790
+ 0x6ce34d1b 0x04f0ab75 0x2d437f08 0x1d790312
+ 0xbac94faa 0x976b9ce9 0xf770def7 0x6ed8427c
+ 0xce8a6521 0x1ec7251b 0x10379d55 0x882b8ef8
+ 0x58c4e197 0xb2c48b35 0xb3311655 0x8ccdf15a
+ 0xf4368e46 0x5e41fe36 0xc6eae59d 0xe4b01c2d
+ 0x506e5bc1 0x522095cb 0x32c19087 0x67d400ab
+ 0xc46ca675 0xd1b4dc87 0xc41aaf74 0xb75e5de1
+ 0x53588482 0x6e168b15 0x3cf9d2eb 0x2a26c991
+ 0x868d92e6 0xefd21291 0x0d7d393b 0xd28a6693
+ 0xbf850f8b 0x8bab78fa 0x06ef9ab5 0x96bf071e
+ 0x4de55407 0x72997fcb 0xc6416709 0x9ba6d026
+ 0xf8d588bc 0xbbacd314 0xdbb65892 0x49ce4e3f
+ 0x9f7f23c6 0xf3bfb271 0xe3b039ef 0x9721d9d2
+ 0xcfeff460 0xf9770555 0x8ecbd41f 0xdbc8de19
+ 0x7f16eff1 0x50702a87 0x4e893e88 0xd0fe5546
+ 0xd75c268d 0x3b325a3e 0xccb8f848 0xf116b116
+ 0xd53bc36b 0x69c3fbca 0x78fca5a7 0xde29e62a
+ 0x087fe22c 0xa2341056 0x4d8e470c 0x0897e8e0
+ 0x1231c549 0x29fe1948 0x1510df78 0x27dfdf9f
+ 0xfa7ac39d 0x02a2d8a3 0xf4e92fcc 0x65f8a856
+ 0x0a620586 0x9d8168c6 0xfc2b73e8 0x51aa73cf
+ 0x790d1ff2 0xe2eec1ee 0x2b6bf6ae 0x016d719f
+ 0x4299ce1e 0xf5b6fb08 0x616eeef7 0x58e7838a
+ 0x983a59c5 0xaab03473 0xb493c5cc 0x8f895d01
+ 0x7eeb95ed 0xc751e74b 0xd56b648c 0x73397d44
+ 0x2044779e 0x76ebf0ac 0xde6e453d 0x314e2211
+ 0x75da63a0 0xaebc257e 0x3ed500ca 0xcb90731f
+ 0x0e061298 0x202e853c 0x5475c57e 0xf7d590c9
+ 0x50d855ad 0xa9a1740a 0xad86458c 0xac935753
+ 0x443950f0 0x679449c7 0xfecdc458 0xda126f52
+ 0xf95db8ad 0xce83faca 0xd50e170d 0x8985c89a
+ 0x21300e90 0x45681348 0x77d41f24 0x7771eae6
+ 0x7c649019 0x776f433f 0x1176f3a2 0xba7771a5
+ 0xac9add02 0x80a77d73 0x9d532385 0x32a3bf43
+ 0x3812be26 0x5f0b64e2 0x661150bf 0x1cda3da3
+ 0x25901706 0x5566fc2a 0x4196324b 0xdaf55897
+ 0xa182d0d1 0x27753c5c 0x7ed91479 0x670dd712
+ 0x79f5e8c5 0xc2a882f7 0x99387af4 0xfbc30997
+ 0xb2cbb413 0xe205d416 0x9c380f50 0x3ba30c90
+ 0xf80b317f 0x06b74c14 0x5b8780de 0x98735ad4
+ 0x335d6f43 0xb2de8a5b 0xeab51ec0 0x6b9bb87b
+ 0x49f621d9 0x6dee0720 0xa5a5fbf8 0x576383ad
+ 0x8d9fb03e 0xc7c6836f 0xc2b98f2a 0x157973e9
+ 0xc3054865 0xb5d5a8f0 0xb2a939d4 0xda7d660c
+ 0x5bea5713 0xcd9fb93c 0xd04225a5 0x469c6ef5
+ 0x6e1b2189 0xec2038a5 0x48d864c9 0xf96ad8b8
+ 0xc311c9f4 0xf293d447 0xda23084d 0xc0cec16b
+ 0x4fa98f1d 0x1d65cb44 0x25241ce4 0xec6e71ba
+ 0x5c060508 0x864e7590 0xa7bdf4df 0x05fb9183
+ 0x70a2ed5e 0x8a7bdfd5 0xea411027 0x19a6c9ff
+ 0xcbbc17ac 0x401aa669 0xe6bf3370 0x72f681cb
+ 0xbe77a1a9 0xbc6ae060 0x8378299a 0x926ee257
+ 0xff603c73 0xdeecde51 0x519d6956 0x5c4c6dd0
+ 0xfd29f3e6 0x846667e5 0x2105ef33 0x158f5778
+ 0xb894867e 0x162fe780 0x70d1570d 0x27ce89cb
+ 0x3bad8e45 0x439d8dce 0xe8667d8b 0x4d47880a
+ 0x652c7019 0x5f414acc 0x4339c1a7 0x833ca27c
+ 0x32c92aa1 0x243b00bf 0x8e50fe5f 0x7efc7591
+ 0x2e0d41f6 0xc67c978f 0x87f2eb1b 0xdcf5e604
+ 0x801c6f5c 0x3caaf323 0x82d252d6 0x99fe2e39
+ 0xb76a1e41 0x134d9628 0xfc095714 0x45a0825f
+ 0x48c60f59 0x2c959a36 0x3d60f4d7 0xe24a8f04
+ 0xa3b5f596 0xd9e67450 0x186af1d5 0xa1a1bb77
+ 0x031cbf72 0x273f96e1 0x6938dbd2 0xc9613d71
+ 0x786056b4 0x41bfff37 0x90dc1359 0x88291b7e
+ 0xe087ea2f 0x2a307121 0x8f9ce425 0xeaf83930
+ 0x63b737a2 0x63e23ab1 0xbfd9e458 0x423603de
+ 0x3fc30a6f 0xcb6142e6 0xa64299b4 0x61c68b5f
+ 0x1ba06ed2 0x91887c3e 0xb9aff67f 0x64784f73
+ 0x34b0824c 0xc12f97e1 0x94441a34 0xd2080b65
+ 0xe1c21c9a 0xa74732a0 0xefa59483 0x5d8a01a7
+ 0x1dd6c22e 0x4d480d8f 0xb63a8354 0xa72c3581
+ 0xf1df301e 0x5b3f517e 0x26b2082b 0x2b41052b
+ 0x9154629f 0xabc7702c 0x1025b356 0x9e85e8ba
+ 0x1f544d99 0x2c8ec998 0xe4440160 0xb0deb1a3
+ 0x201e3fe8 0x70a7792c 0xfcf41de1 0xe2b2e6aa
+ 0x10fc055b 0x373e9fbf 0xffee3e7d 0x2d1baa79
+ 0xdb411a57 0xf30ea568 0xe30497de 0xb4682d8c
+ 0xb458fbd2 0x5d1d68de 0x02da095c 0x71471bce
+ 0x543edc68 0x52187bde 0x98743b08 0x0674aa49
+ 0x5dad1705 0x74b009a2 0x765840c7 0x3e1cf377
+ 0x3ecbb54e 0x6d5934b9 0x8a67c9ac 0xe1a15fbe
+ 0x6e096703 0x24fbe4b3 0x99c9e345 0xd2d520f3
+ 0xc5aefea5 0xe9e828b9 0x4e8f47b2 0x92653def
+ 0xa7b8249d 0x5f53eb02 0xe3233073 0x1c933c46
+ 0xcb682c30 0x7e6e4f1a 0x42015257 0x8cdb5897
+ 0xc9cb6caf 0xfd8834a4 0xf353bbb4 0x6a37526a
+ 0xadf7562d 0x151f071a 0x960a244f 0x7ca3adb3
+ 0x9408588d 0x54bfc516 0x8b66a80b 0x2ed849ec
+ 0xf408d6f8 0x20bf2961 0x38131c67 0x79f4be5c
+ 0xe439ce8e 0xa497411a 0x75e67d7b 0x89e55132
+ 0x5775d8d7 0x945cfe97 0xcb3fab49 0x0f776050
+ 0x6a6d6600 0x669e6d18 0x9e919045 0xa4fceac8
+ 0xcb9cbb97 0x44ff0303 0x5ab4c9f4 0x6356e012
+ 0x153c7cfc 0xd6e436eb 0xff02c626 0xb8c6b9a0
+ 0x649e7186 0x7ca5666b 0x7d79feff 0x96a659b7
+ 0x52c99b9d 0xcfc545ff 0xe694e092 0x0978951e
+ 0x23c1fa45 0xa196acc1 0xfa43a0e7 0xd02e58ac
+ 0xa437a7ed 0x928bee99 0xab7a4203 0x476afb0e
+ 0x85720b30 0x24c1aa4f 0xf0f5aa46 0xb370c71b
+ 0x72c28056 0x6476c6bc 0x371e15a9 0xf1dd6370
+ 0x20c99f9c 0xd41af717 0xed13673c 0xcb6c24c9
+ 0x76d3038f 0x13ca83ec 0x92f89264 0xf15f7b8f
+ 0xf58caccb 0x8c35c1e3 0x09ab9fbb 0xe43b29c3
+ 0xab4ea87e 0x38115de0 0x6907638b 0x42348cc1
+ 0x46c0541f 0xce20b070 0x85f96b9e 0xfa6a55e2
+ 0xde7508eb 0x9f8f1b4f 0xed64d64c 0x440fb418
+ 0x58ddfb97 0x13762796 0x7a19e78c 0x1f4532a2
+ 0xd77581f6 0x95d2e36e 0xb43f3e07 0x4ee36289
+ 0x8e02424c 0x59413984 0x25a857b1 0x85d7f421
+ 0xad16de66 0x89889e00 0x41a2419a 0xaa4d9734
+ 0x054c611b 0x163792a3 0x5024a4a7 0x28e8c480
+ 0xd8d0a170 0xac2789b6 0x9e901eac 0x8dd4c756
+ 0xb7e7a78a 0x09cb2f8f 0xcefbf036 0xd76d6b90
+ 0x97195548 0x2cb9a698 0x0d8bf470 0xd47a53c5
+ 0x7cde7ca3 0x86752d36 0x2b247ff0 0xf88824a6
+ 0xffa16b3b 0x6cdce7fc 0x3b4616a0 0xa10175d7
+ 0x9582056c 0x430e2b58 0x87fc2c37 0x9f6e818c
+ 0xbc1139f1 0x84760da0 0x27a89d38 0x71c5e1af
+ 0x131dc64a 0xadd87cc3 0x1e803420 0x742fd011
+ 0xd72bd1db 0x0fb75ab1 0x94b49dee 0x72c056ad
+ 0x5e6792a0 0x6d555dd0 0x74b1b90b 0x6ad51aca
+ 0xfabbeff2 0x100ac64a 0x4809c8d9 0xc34c3576
+ 0xea9e97da 0x16e7c254 0x67bb276e 0x051352b1
+ 0xa876828c 0xb9050b68 0x220b1342 0x194adca9
+ 0x91c155a0 0x13840fb9 0x3d84c855 0x0f556748
+ 0xec5c095c 0x843a3203 0xa481fa2c 0xfab143e4
+ 0x21644052 0x8c78b21e 0x9aebfce8 0xec06d25f
+ 0x3de84e4f 0xf6fcc4ff 0x14939e02 0xdbc002bd
+ 0xaf9bb5fa 0x2b2577ec 0xb58e2198 0x8695c42c
+ 0xbd4134b3 0x339ad83d 0xb068e618 0x55a79546
+ 0xa9d25584 0x8c2686dd 0x65c1fa6c 0x1b923e1a
+ 0xf85508f1 0x35405141 0xebc72b0f 0x61dad5d5
+ 0xd494ef56 0xce496144 0x95ac0f6a 0x22feb180
+ 0x314fa6a2 0x6fdb5569 0x3b545d45 0x04993ded
+ 0xcbde0b29 0x79f8402e 0x438f03a4 0x697a2395
+ 0xa60c9399 0x6773e016 0x0239bd45 0xb481fb75
+ 0x9fa5c550 0x411ef264 0x67860ed6 0x27b2c816
+ 0xb51d6798 0xad6fd700 0xc3bda74e 0x56aed35b
+ 0xd8c5ccc3 0xfe5f41e4 0xd6bf9729 0x823aced3
+ 0xea7be38f 0xab1dc712 0x5cd0bf3a 0x668a68bf
+ 0x28456fbf 0xa2dac02b 0x20ace936 0x95b0ba3d
+ 0x377b8a1e 0x0dd9c396 0x3c7f2925 0x76818503
+ 0xc359dc77 0x00ac4c3f 0xc51174cf 0xc75b0427
+ 0x9cddf343 0x5976c090 0xb940ae71 0x67b3149a
+ 0x2126db25 0xa0c32f5c 0x0d4478ad 0x7fefc9b0
+ 0xb142782d 0xa150a3cf 0x64ad041f 0x0fca8532
+ 0x0e8e5348 0x969950ad 0xdd3d8704 0x8ae1c3d2
+ 0xc9110da4 0x8d1d9e53 0xdcf5ccd2 0x283b2954
+ 0xe9bc7d4c 0x4e3dacfd 0x2101a11f 0xc8931fcb
+ 0x248a7c32 0x2f1bad2f 0xa4d4ba90 0x842d6a97
+ 0x9688a63e 0xca0c8ad2 0x9f580417 0x46e7fd85
+ 0x2d3ebc79 0x47aa9462 0xebbe843f 0xd78153e2
+ 0x909560b2 0xf46c5e3f 0x7c290a30 0x56b869f4
+ 0x41fd075e 0x0a5b6e52 0x36d2d38a 0xd18b2b9a
+ 0xce905361 0x421cdd95 0x8a12d791 0x95ffe01f
+ 0xa0164308 0x49a9ee60 0x1905f05a 0xd7d654a1
+ 0xf3231a7e 0xd0576e98 0xc24f44e1 0xe2860d3c
+ 0x391bd3ef 0x9e69bf4f 0xe72c6172 0x59500290
+ 0x3d34636c 0xbd04b4fa 0x895b8094 0x5cc90dd3
+ 0xc199504e 0xe9fd3199 0xbc45079f 0xe90b08d1
+ 0x73e17406 0x28173cdd 0x99cbd64a 0x7b6d0f22
+ 0x841d5dfd 0xdf5ac032 0xd4816d36 0x1f4a3984
+ 0xeae96366 0x50ed8bb9 0x4d33650b 0x7128cee3
+ 0x37277426 0x471cdd80 0x25fff263 0x6f474b74
+ 0xe9aa07cd 0xe1d7efb2 0xc22815f8 0xc608745e
+ 0xdbefd2d1 0xd153fcb5 0x6e6bc7f9 0x4882ccfe
+ 0xc81e1310 0x81cbd86b 0xbababff2 0xd907a1fa
+ 0xcd8cc1fd 0x6189dcb3 0xc09856b7 0x561b5eb7
+ 0xca1a86ca 0x44d14be5 0x09e0d9b1 0xabafa3ec
+ 0xb195d7ee 0x6bd4ac69 0xd96ca290 0x4646b3de
+ 0x946a8de5 0x62e7811f 0x8576b1df 0xd801d15a
+ 0xea3b3d1c 0x4b5d2213 0xac6d698d 0x4e6688ba
+ 0xa8bd3c7c 0x61b00447 0x636290b7 0x21ea494d
+ 0x3f54301b 0xf3fd3625 0x761ee539 0x940e3e52
+ 0x83170a07 0xd22f0a78 0x953dec00 0xa38ab91c
+ 0xf92c8998 0x67009969 0x87672384 0xe491f9cf
+ 0x6b6ddf09 0xff109fa0 0x76a8b76a 0x180ee54d
+ 0xcaeb9a0a 0x92c5648f 0x85ff11e2 0x9b2df67b
+ 0x4201d9b8 0x8aaf347b 0x4a9dbe10 0xec862b6a
+ 0xb71c8b69 0x18b610e6 0x74308a4a 0x48f932f0
+ 0xab89e3cd 0x7c8f0ea8 0x1bb5f1bc 0xcdb4357a
+ 0xaaf85d77 0xade08dcb 0x590d0607 0x193b1e39
+ 0x4a2c0ad8 0xb537ede3 0x18028be0 0xdfdc9b3e
+ 0x4ed44a28 0xd99088fb 0x5f463afa 0x30b3406f
+ 0x9a841acc 0xe99b8e91 0xd7b8a939 0x681ffaa2
+ 0xadbb1fd1 0xfcad4167 0x0112b6f6 0xdc7f9eef
+ 0x9fe2e8c3 0x2a6c0b92 0x52455d9c 0x6c8d1640
+ 0xbde4c4f8 0x898f0c75 0x888be513 0x547d135c
+ 0x1eb060b3 0x065d0c94 0x29dccb26 0x7e8c7b31
+ 0xa5447074 0x284dfd0e 0xbf1d6663 0x18c99457
+ 0x00347d9b 0xf61a7399 0x97295200 0x5b8496d1
+ 0xcbafa538 0x5d98baf9 0x90cee1e6 0x96ff22c0
+ 0x18c2a3ac 0x543af7ed 0xeea413c6 0x5bae5343
+ 0x8e448ca0 0x6e7d4242 0xaa3f43ce 0x28215051
+ 0xf64810cd 0xb5a7e727 0xd7f81460 0x35308099
+ 0xeebca740 0x01df1f57 0xb7e65871 0x3ab3b9e9
+ 0xee122b31 0x1ac1db5e 0x5e99528f 0x564692be
+ 0xea2b238c 0xfee52d82 0xbf986e8f 0x822c1414
+ 0xca6d9632 0xf9a2f73b 0x26991573 0xdf31a166
+ 0xefd371c8 0xe6a8c9e5 0x98ec2cd3 0xe36a2f4b
+ 0x64f72616 0xa7d08fd6 0x93363a09 0x05601635
+ 0x1f525f29 0xd63ac5e1 0x6a09abe8 0x3992b4fe
+ 0x1d0aaeee 0xb32d924e 0x2d364a4d 0xcc3676a1
+ 0xa3570ad3 0xcc42a28e 0xe1209e02 0x5a7a939e
+ 0x8baae5a7 0x37970d2e 0x9ad75409 0xc3fe31db
+ 0xcbb9e37f 0x00e73ed5 0x03d10ffe 0x7e1abed0
+ 0x6184e0a1 0x04dd9992 0xe1a4c0ed 0x1accdc34
+ 0xf75029e1 0xeb908c2d 0x7182338b 0x153c755d
+ 0xbd920e61 0xb7d99e35 0xd76b3cfb 0xc48e4427
+ 0x4918ffa7 0xc3f70d6d 0x7d5b47d4 0x20e585e5
+ 0x846d305e 0xd1953927 0x9ecd3367 0x7ea7af8d
+ 0xb99c02b9 0x9ff7bcb9 0xe2f9dd77 0x91f7c422
+ 0x0b6d6df5 0xb52ee017 0x0c7ac175 0xba7f84a3
+ 0x940030e8 0xf3361cf3 0x2c79691e 0xf9f4cbb6
+ 0x2adbcc7c 0x4e3216fa 0xeed50c23 0xdfc14253
+ 0xf773ac08 0xb7a8fae8 0x8d321ff2 0x9eb7ba88
+ 0xfdd06639 0x5edc8612 0x198977c7 0x8d8e1163
+ 0x47466343 0x32ef6f8c 0xd61e51c8 0x696e19a6
+ 0x03d0d4d8 0x0b06ce47 0xb5f0d0f6 0xc82a4f88
+ 0xaad06d48 0x663c5d5d 0x8af24640 0x07bfa68f
+ 0x886c17f6 0x6e3f131d 0x74f642e2 0xddcd55d0
+ 0x2f30f2f6 0x8411fd8d 0x6d16c414 0xef747761
+ 0xdcf2e965 0x005f15bf 0x3cb4cf17 0x47489073
+ 0x436c5651 0xb762078b 0xed30e15c 0x1a7d5f47
+ 0x908482ad 0xbb10cf3d 0xc11ab477 0x028d5ddd
+ 0xd312ea2f 0xe7dcf336 0x99b07e30 0xe3dcee9a
+ 0x4b93c17f 0x7b1a1423 0x2f23ae0c 0xb6913cfc
+ 0xb4a9c590 0xbb37ea60 0x5a914eac 0x476b180b
+ 0x942673d8 0x01f92634 0xf80a805b 0xb27dff69
+ 0x6ae95b74 0x29f3c9d4 0xc100c578 0x4bba9461
+ 0x84415667 0xc08eb87f 0xe9ebceed 0x0f81f386
+ 0x2c9ef4b6 0x7377e8a2 0x786a5395 0x240f944c
+ 0xc473d377 0x51e7ab41 0x9c7c062c 0x9ae8812a
+ 0x92e249b9 0xec9ecbbc 0x32ec3b85 0x1e1219b6
+ 0x5de07061 0x709f8adf 0xa2617686 0xdfc04de9
+ 0x2d9601a5 0x17b91303 0xc2c3b25c 0x6c68286e
+ 0x69b80bd5 0xe9170aa7 0xa4e769ef 0xcd59002e
+ 0x03c62f50 0xaecaad82 0xa0446f52 0x7235f286
+ 0x25842cc2 0x568daa6a 0x745f3c5c 0xb7da088e
+ 0xbb7ce303 0x5a26aadb 0x0f300768 0x8075224e
+ 0x041a1fc2 0xc42d3a48 0x65e1d2b3 0x0c425eef
+ 0xf0be77bb 0x158f5e71 0x4f3b7aed 0x4dc49cdf
+ 0xeabf7a1a 0x89ba777b 0x58633b37 0xa1ade7e7
+ 0x5636aae2 0x4fa6ebc2 0x53b69d2f 0x08045872
+ 0xe7aaa910 0x85b2a487 0xd0efc26e 0x74552637
+ 0x094fdaba 0x53d7892b 0x4bc020c7 0x8ade858d
+ 0x79ea282a 0xf26d298e 0x3b045781 0x934b0106
+ 0xc9079aa7 0x97119415 0x66e6a403 0x89537b45
+ 0xe73dfdb7 0xebf01300 0xde74994f 0x02088618
+ 0x1b0e2af2 0x5772ed57 0xb602065a 0x17d9a1fc
+ 0x1f586b71 0xa97c7aac 0x787bf657 0xc2624036
+ 0xe43d1b5d 0xff1a581d 0xd2a70d71 0xe5c6f837
+ 0x1b310855 0x58b1cfca 0xb16ac7c8 0xbfdcdbcd
+ 0x08d08749 0xbea8c9d7 0x54dd52eb 0xda29929e
+ 0x0520bac8 0x8069db1d 0x024e2433 0x2f58dd5b
+ 0x2675d219 0x07a63f8b 0xb434bea2 0x9de76b17
+ 0x42a9ba44 0x24643707 0xd44e6483 0xda2acc9b
+ 0x35ec2061 0xad77a18c 0xcb5297c8 0xe4205cea
+ 0xc6c373af 0xf54fa587 0xcd7e17da 0x746b1c4a
+ 0x6f2622fe 0xfbb62c51 0xe6c2e806 0xf0783a39
+ 0x310894c9 0xe45a1590 0x9e16bf7a 0xc8b3e0fd
+ 0x3926836c 0x7703d031 0x460b069b 0x4bfa3cdb
+ 0x8d5d2129 0x9785ecb9 0xe1e1599e 0x10ccdc77
+ 0x7523c7ca 0x04b71d48 0x460a5b56 0x20276dee
+ 0xd2ddb422 0xa647fac5 0x5a6b9c9b 0x7ae06c9f
+ 0x804a66b1 0x4198f056 0x54bd34a9 0xa2911284
+ 0x381172c1 0xfe4c4593 0xb3eee29d 0xf1df50b6
+ 0x1fa0521f 0x1bae484c 0x400bc170 0x2284b14a
+ 0x36378b02 0x474cdb9d 0x125ce7b4 0xccf8ca2a
+ 0xcad1435a 0x6b3ef3ad 0x07911869 0x5d2af5f9
+ 0xe890a391 0x84db947c 0x92a296bb 0x5e47a853
+ 0x8f8e9b02 0x8217b798 0x5d0c8fdb 0x4b82a1bf
+ 0xbb9d9ddc 0x5c3646de 0x38409ae3 0x5a0334f8
+ 0x0ca6ae23 0x7cf66ad7 0x0bc3c769 0xdd7e58bf
+ 0xee9348a7 0x29c5df89 0x310819f8 0x624f6de8
+ 0x08ed0bf4 0xa3c790ab 0x7289c4da 0xc1a68566
+ 0x7061e620 0xc0c7fbcf 0x13f31266 0x0644d951
+ 0x763284dc 0xb201e4f9 0x9b21465e 0xfa49ddcc
+ 0xe3af7f77 0xf27536fe 0x40f5e4ff 0xaa8433f7
+ 0x319dd056 0xeb2b211c 0xd588d768 0xef8c823e
+ 0xa743d935 0x107e2582 0xc23ce2ff 0x99fdb245
+ 0x0965cc02 0x73ce4b97 0x0118f1ab 0x28c575b6
+ 0xa3655e07 0x48409d8c 0x3bd10f75 0xd3634366
+ 0xcd293761 0x15db1b25 0x1fccb21f 0xe8141f3a
+ 0xbcd89ad1 0x53ceb99a 0x39e80422 0x95592406
+ 0xe56956af 0x26e87b88 0x47ef03f3 0x37220d2a
+ 0x092e1bab 0x5b5984c9 0x6dea2c0f 0x7cad0369
+ 0xb4f0dbb7 0xc18cc43f 0x4195b382 0x4f5f7d63
+ 0x0f6cfdbe 0xf5a3df66 0x9e25dced 0xfd2310d3
+ 0x2f137c49 0x33986698 0xd4ba0c96 0xae11d033
+ 0xe8b72cb4 0x70e814ef 0xe978353f 0x1b568ba4
+ 0x89889582 0x0387b214 0xc58d0ae0 0xaf8ca49f
+ 0xc3fbc17e 0xc30d40d5 0x9e74edac 0x12f94383
+ 0x68d6f1ce 0x8dc5d480 0x3a3d7eb9 0xf03046c3
+ 0x722aec23 0x6d4f55f5 0xf3ece7fe 0x6a8d9df1
+ 0x749060b1 0x9c170b8a 0xe6281454 0x748ce6d6
+ 0x2d91dc4d 0x5b173596 0xf359c629 0x2c6f17b6
+ 0x0aed39cd 0x31e749b6 0xd0b8f062 0x0813d11b
+ 0x189fb015 0x3cab2e97 0x058fba0c 0xfd1b6651
+ 0x9a8e844b 0x50524773 0xb2db8548 0xf254761d
+ 0xf0e00ce5 0x246621f0 0xc0bc81ae 0x035b8d5a
+ 0x5cd39846 0x65210952 0xde9c544f 0x94b50762
+ 0x959c2d0e 0xf7966e26 0xeb92273d 0x25fbb61e
+ 0xb8af3176 0xe0ee6870 0x86ee2b1d 0xd4f9666c
+ 0xfda83623 0x49c6fbeb 0xe14b19c8 0x89c83059
+ 0x5bc697bd 0x2e873505 0xb7763e5e 0x5d802426
+ 0x6aa1770e 0xa14f4b15 0xfc01f148 0xb55a8463
+ 0xc77766b4 0x83d46980 0xabc67a90 0x4581c639
+ 0xb24332ae 0x8a6a6a3f 0x45460e3c 0x2f979301
+ 0x9da26d46 0xf2d82fc0 0xfcb6d2cf 0xb43d6be0
+ 0xba5e1c4c 0xe4a12772 0x2ec2edd7 0x384bb800
+ 0x46463f92 0x1ecb6517 0xfe795d3b 0x2b813434
+ 0x7f07d577 0x58c2ef7b 0xf7ef6c45 0x5ef14dba
+ 0x68d32f84 0xfd41125c 0x1d60f95f 0x80634cad
+ 0x7cf1e3af 0xd8e0eecf 0x18ffe0e5 0xfac38b40
+ 0xa1470b5a 0xfc573f25 0x71b379e1 0x79ada1cd
+ 0xd6202f3a 0x2064d260 0xf81b4a78 0x78bcb6ce
+ 0x0a51176c 0xe6f9cca8 0xb6a412ea 0xad2a2046
+ 0x3d48bce8 0x248e5b1c 0x58730463 0x3eb87aec
+ 0xb2a5d6ae 0x7a6bd456 0x82603999 0xd0419841
+ 0xbf3382d3 0x841d04ff 0x31dae79e 0xb44d0cd1
+ 0xee88b3ba 0x1ef37747 0xf4e7b3b9 0x7f7588cc
+ 0x1ec2693c 0x4cbe2715 0xc1ec14ed 0xa2acbc8a
+ 0x5a929034 0x6a6f1665 0xf16a280b 0xf42a69a3
+ 0x6fadf80a 0xee4eb89f 0xd4dd24e6 0xc75b26c4
+ 0xf6a9f084 0x78eaec74 0x86201788 0x24ea2ef5
+ 0xc1d8fa87 0xcc5ff140 0x57caaad1 0xbdd82355
+ 0x742f0e34 0xe444c652 0x3e96b2c4 0x2c920561
+ 0x0577df04 0xb1f5c5df 0xcd5c19c3 0x9c725e0e
+ 0x2154c6da 0x400b719e 0x2bbd900f 0x6f2af9b4
+ 0xef235247 0x34ff3448 0xa2203ba7 0xe95a3cac
+ 0xa3a75edc 0x0cb75c83 0xd4d58f54 0x9c5d8ed8
+ 0x2e198c12 0x68228d38 0x0810e408 0x8f6fc1b6
+ 0x17375775 0xbf9b8b3a 0xa4b20362 0x271de049
+ 0x27d66314 0xdb8eff9d 0x472b462d 0xa2753e61
+ 0x4b08a2e5 0x003fd8a7 0x7132b0aa 0x86cf745d
+ 0x04a74a16 0x3f187b59 0x3dec12b6 0x1685ae21
+ 0x09cceb45 0xea3f4249 0x18896fc2 0x7b596781
+ 0xc3b00701 0xf45b2348 0x9157f33d 0x373afce0
+ 0x5ab0f7e7 0xd11dd144 0x789e4a3f 0xa2cf8cc8
+ 0x2763e381 0x297093ef 0x1e18ee87 0x5670f2ea
+ 0x3870a085 0x7bb26ecd 0x8be4ae47 0xc90a2838
+ 0x90253b64 0xb64f3213 0x90316e77 0xa1065312
+ 0xc701bfa2 0x78b8b393 0x195f8062 0x455ffd63
+ 0x256cae7d 0x14e41781 0x89ab05a3 0x9d06f374
+ 0x13ce2d15 0x02e9c362 0x32e3f1cd 0xb5b721cb
+ 0xdeadbdcb 0x204cab64 0xbd778fd8 0x8f9099eb
+ 0xe99a4ed0 0xbdd90d0a 0xbd00b922 0x8eb31a92
+ 0x87bdeab3 0x6b9cf5f0 0xe021d51f 0x2474352e
+ 0xd901ebe0 0xd04c0ec0 0x1cfb5498 0x3ef1da8d
+ 0x9f5ea3cf 0x919b794e 0x2234462d 0x60a12913
+ 0x2b516e1c 0xeb5d63ef 0x59163e77 0x9d0b6c15
+ 0x06d29864 0x0ab3e5ff 0x84e5c751 0xededa5d4
+ 0x6f2646b8 0xc5343089 0xa1274e11 0xc80fc0de
+ 0x25d198bf 0x0cc3c67a 0xedfd0e21 0x3d083ae0
+ 0x1e118379 0x5bf6e94f 0xa1d7e95e 0xde69bb24
+ 0xf413ebda 0x6230cf49 0x5d2b9510 0x53f7b612
+ 0x62c7eba8 0x0f2c0a46 0x68689315 0x66170fd8
+ 0x69e271a5 0x227f306c 0x070e6d48 0xcb363e6e
+ 0xac73d4e8 0xa86c53a5 0x521e4087 0x723e7829
+ 0x030d34ac 0x3a692250 0x7fe37a11 0xd222b160
+ 0xb692ab81 0x29711c32 0x63badd8b 0x0c5f88e1
+ 0xf9b84e79 0xeeb8d616 0x0fc9a7ce 0x3ac0a073
+ 0x04df6e70 0x653ba8d2 0xe7c0fc18 0xca5f74ec
+ 0x53b8a32f 0x41f20b6a 0xfa088ea0 0xc236a349
+ 0xeb2668ee 0x9a716606 0xb81026ac 0xede58e14
+ 0x93577dc1 0x26d623fb 0x2f46d6d1 0x36792a07
+ 0x6942680f 0x2eba3000 0x3eb54815 0x9662a861
+ 0x1c72420f 0x38ab7e35 0x046e8870 0x1b6ac99f
+ 0x9ef80a86 0xb4536aab 0x3018741d 0x4a5f6fd5
+ 0x9238b8e4 0x0fff6bfc 0xbc070e77 0x998c5bf8
+ 0xe5da6078 0x1f3bbd88 0x45ede937 0x5df05dda
+ 0xfadd003d 0x9dc951f8 0xf1b9ab8f 0xa61899f0
+ 0x824e94d3 0xc722d831 0xb5b589f5 0x260162b5
+ 0x37f56eab 0x28ddbb24 0x9099aae3 0x6a0569d7
+ 0x17521d8a 0xfebed88c 0xe0b17f90 0x459d1261
+ 0x71720437 0x7774706c 0xdbd8296b 0xe2e930fd
+ 0x533108af 0x4ed99a97 0xdb411394 0xd7fc6f52
+ 0x2d400e97 0x62179749 0x403b1bea 0x782b58c6
+ 0x721a8d7c 0xc16e050e 0x6fabfb33 0x3dacccdf
+ 0x1b44eaf5 0xccea00d7 0xaa9db3d4 0x2049ec4c
+ 0x8b8fdb66 0xfbe0ae38 0x30fb344c 0x2ffa90f7
+ 0x0d5124c6 0xde1167e7 0x75950723 0x7d04f094
+ 0x9b4fbfb4 0x30dd0a25 0x678d8e05 0x1593b586
+ 0xd6c681c6 0x334d4b89 0x52f1dfc2 0x555e1dd3
+ 0x1ef04ae6 0xf6abb115 0xade9597b 0x9a278bc9
+ 0x0bf22078 0x91c2e9af 0xdcca425f 0xaa3083d2
+ 0x6b743fde 0x50d7a3e2 0x2e896bac 0x99b328c2
+ 0xcf5f7b6e 0x637cc0f6 0x1697db57 0xf6861788
+ 0x5bc8c0fc 0x2efd58c9 0xe21f95e0 0xf2c37414
+ 0x1d6e3802 0x5216077c 0x935067ee 0x0ebda837
+ 0x0d9247ef 0xb80cf7db 0xb1d059cd 0x6a2f13a4
+ 0xd67a58e0 0x794bdff4 0x5d231283 0x61bf4994
+ 0x91b0d200 0x41535f81 0x5b16aac6 0xc07b7c3f
+ 0xd8fba065 0x12075029 0x6514862c 0x6b51c7d2
+ 0xf0a9945c 0x5d230573 0xe3e465a1 0x9f62b179
+ 0xa082de80 0x6f321158 0xd23d6f6f 0x52e89e06
+ 0x567a7a26 0x702f271c 0xad6d1773 0x868a4951
+ 0x12215303 0x90a03402 0x62cb847b 0xb27525ff
+ 0x49143560 0x91295f7b 0x8e55438c 0xf3b89dc5
+ 0x42ed6a2e 0x0034b9dd 0x2acdeca8 0xbec43836
+ 0x9fb17e97 0xe58b0fa7 0xfa145934 0x85fbb9ad
+ 0x95de5881 0x26b0a0d5 0x104f7aa2 0x854eb51e
+ 0xb933973a 0x731e627a 0x2993c363 0xcf786c52
+ 0x8a4fc24a 0xa595abdf 0x78384c3e 0xb9fb1df4
+ 0xf9e57ca0 0x65127da2 0x5a79decc 0xdf4cbeba
+ 0xb114bad1 0x337de172 0x0e3ea702 0x6b81da6c
+ 0xcd6fcec9 0xfbd9b0ad 0xc64ab9cc 0x7e4a2cfe
+ 0x57e95205 0x657ab502 0x5accf277 0x1929a188
+ 0x5da83ef9 0x80e6d771 0xf1a53333 0xcf6e37c3
+ 0x699e5a6d 0x3347df35 0x2622f61b 0x3cf94535
+ 0xa07ec501 0xe54f7046 0x63c5332c 0x2d3820e2
+ 0x053b6076 0x0b010f4f 0x7ec1d8c4 0x45b55100
+ 0xf30d9a07 0x40d20ca2 0x7f412a03 0xcda1dd71
+ 0x275ec460 0xa40f7f27 0x7864652f 0x9df5a051
+ 0xdf289605 0xb711264c 0x4361fbb3 0xa0d2f988
+ 0xbf6a36d8 0xecc6820e 0x4b55e0a2 0xcf2c9924
+ 0xe07bcf08 0x8c377f0b 0x99345c94 0x0134a900
+ 0x56f1c367 0x5dcfbfac 0x25360a09 0x49c5ccf6
+ 0x922aa36e 0x276eac5f 0x8710bcac 0xc6ea8cb0
+ 0x01231ef2 0x8ad4b783 0xc301b63e 0xe2050fca
+ 0x03bb94b4 0x4ade55df 0x9d352042 0x125b0dbe
+ 0x927cfc5b 0x2a1a4c22 0xa8df1087 0x48f4fcac
+ 0x11a9146c 0x9050d4b5 0x50ae4db7 0x3d55d36c
+ 0xcda2ab9b 0xaeac16c6 0xd2aba445 0x6e67bb31
+ 0xc5e2bc39 0x74b22d9c 0x9ab21d96 0x08c9d930
+ 0x644b849a 0x01afe0eb 0x404bc2da 0xc9a72a81
+ 0x99fb4563 0xe7c76b3c 0x85c61427 0x5f8965c2
+ 0xbac7e3cf 0xb0c0874c 0x5b74d24f 0x7c6b65b6
+ 0xad2a6956 0x9b28819d 0x12cb73be 0xb20186e4
+ 0xd620106e 0x541cd7bd 0xea9ecc4a 0xf13f0fce
+ 0x46c54ec4 0xd152c3ab 0xb2c3f44a 0x1fd51335
+ 0xe8700691 0xfb37e2d7 0x9b460ed3 0x02bc94eb
+ 0xe6d3c07c 0x5d14b59c 0x4caa9b64 0xc1d5e067
+ 0x091822f6 0xcc05772a 0x0582b394 0x26eface0
+ 0x2cc18131 0x9c185a07 0x85e1c51e 0x0002022c
+ 0xebfe882c 0x0a789198 0x9a08ba3c 0xde2cc070
+ 0x2bbd9cfe 0x284afed9 0x0c7379e4 0xf93de40c
+ 0xbd37bbe3 0xa9ecefe4 0xf9a158ac 0xbc908d2d
+ 0x2bfdd088 0xa361662a 0xb1c0d365 0x8beb7d9d
+ 0xfedbdee7 0xc79f3876 0x9960ba9d 0x2034d88d
+ 0x958e019e 0x41f39110 0x64da9bc2 0x816abb18
+ 0xe63629a5 0x20794d8a 0x662616b8 0xfe9f46d1
+ 0x071aac55 0x30d84d05 0xa06cc26b 0xa824df49
+ 0x5f14495c 0xabcd0785 0x83179f84 0xf8a0d3e0
+ 0xe55eaac9 0xa0c1d5ca 0x57bf9c29 0xa7c88077
+ 0x26a94994 0x1d24439b 0xe5bed5dc 0xeb7c690a
+ 0xa0b18552 0x7f76b756 0x750a0a29 0x558f21ec
+ 0x78bef53e 0x32ccb511 0x151c3954 0xef46ae12
+ 0x67ffef39 0x052a28c3 0x22bef7f6 0xf85d4c0c
+ 0x7f1f720f 0xf3f17037 0x46dd1bee 0x888db6e8
+ 0x341815f3 0xf06776e8 0xdb259c33 0xf9b0e8d6
+ 0xd4006773 0xaf315b70 0x9fae82bd 0xb0d94ef6
+ 0xe44e2e9d 0x3874a840 0x4b5edbd0 0xafbcf23d
+ 0x6f471b90 0xe20da874 0x2d2b5672 0xbeaf33f7
+ 0xafed4e5b 0xe8026760 0xf7d5816f 0xdb6a0104
+ 0xee342d91 0x3fd028e2 0x46c9d97a 0xfcbbfbb2
+ 0xaec52ec7 0x26a53cf0 0x2316bff5 0xc4437f42
+ 0x6375d058 0x58a6250d 0xca6a79a1 0x0aeb2a2b
+ 0x6aa9e430 0x94fd7d5e 0xb4febd86 0x2e2c543c
+ 0x487d8f6b 0x86456252 0x4f4f5113 0x3e754682
+ 0x9b06f61e 0x2cd59fea 0x75dfecaf 0xffa22da8
+ 0x8d19266a 0x4989fd18 0xeb914d90 0x51c5c90e
+ 0xcb93443a 0x5430cc60 0x7505ed40 0xc846f4a7
+ 0x6889f168 0x2e4a2483 0xfd343421 0x5f840378
+ 0xb1fd6683 0x72cbc8c5 0xa6c3dc64 0xa62b7e66
+ 0x0bd334ba 0xd3325eef 0x4995c33f 0x70807fcd
+ 0xc00f74f8 0x95bc9b96 0x5d5c427e 0xa4e61238
+ 0x4bd67f30 0xb5f77587 0x394d8fef 0x388f2157
+ 0x821f9605 0xd9d6c839 0x397448f6 0x909c7fce
+ 0xfa33419c 0xe76f2a93 0xd8d82a0a 0x958ad737
+ 0xacc2db98 0xde83b149 0x8fdeb3fe 0x22f50686
+ 0xf5f12f19 0x995ed87e 0x01e991ea 0x7de09abe
+ 0x709cb382 0x1889a44f 0xe08aadff 0x7baaad92
+ 0xeebdb9d2 0xd56d750a 0x695ea096 0x5a058e43
+ 0xda042ea8 0x65298703 0x9dd245f2 0xe9ad47f0
+ 0x7d190a49 0x830be058 0xf04924af 0xb870703b
+ 0xea03bf4c 0x9c0cc87f 0x7a17fe68 0x4d116013
+ 0x1054c702 0x55c3cf0e 0xa217a2c6 0x7d4ce193
+ 0x88b348c1 0x72a4ab9e 0xa354465a 0x766fe13f
+ 0xef614370 0x8a144eb7 0xf45c4941 0x6cbde577
+ 0x27bd3e2c 0x33858ccb 0x1ff580bd 0x43d9033f
+ 0x40836392 0x783ab27e 0x5706c509 0x18bcd812
+ 0xcc132c39 0xc3059b54 0xd3c5b401 0x9e0f318c
+ 0xffe7fd5e 0x3443ef1e 0x0263afc2 0xa782e17c
+ 0xcc606b78 0xe7e5ee02 0x148e0eeb 0xafe85cb7
+ 0x9fd7a869 0x46af1217 0xf50b4e8a 0x17aa5daa
+ 0xde454b83 0x56cee58f 0x96c2bac1 0xd12e1575
+ 0x81af14e2 0x8be3cf30 0x9aa3d338 0x1924840d
+ 0xf6e2f7b6 0xd48dd26a 0xf0107e1b 0xe477207d
+ 0x21ce17be 0x8cc2ecb3 0x0794ec9d 0x16939e22
+ 0xfbf477f5 0x77dae996 0x1b778d69 0x83f0e9b7
+ 0xb9864a5f 0xf235d47e 0x11881d8f 0x75250d33
+ 0x4ff84f64 0xe6ab23f8 0x3fe1e0ea 0xa1235fb9
+ 0xf794936d 0x3cb45af8 0x6741e3fe 0x267beb14
+ 0xe9feddc1 0x69644d8c 0x8c4c159a 0x81ef74cf
+ 0x7e32e357 0x4577b760 0x6c9f2a13 0xf2b40a0d
+ 0x9907e9dd 0x732dbd8d 0xb9bc75e9 0x97400142
+ 0xc3a04231 0x8a4b0c8f 0x0892560e 0xbe279fd4
+ 0xcbccef1a 0x3a7f36bd 0x6bb2bec3 0x74916369
+ 0x6750eb0c 0x0adab860 0x29caab76 0x22278996
+ 0x43044e80 0x01ec2031 0xb73889d2 0x883a69ae
+ 0xfa282963 0xaba2e3dd 0x28211b19 0x93d2d65d
+ 0x925a8da5 0x6938296e 0x56e4a090 0x55e01f10
+ 0xc1656a69 0x2ad00f4c 0xf4cc31a4 0xf482cc33
+ 0x4db0ab44 0xf7e2fcbe 0xa1b056a9 0x8dbc69d4
+ 0x94a0ab45 0x1039c33b 0x22ad0f89 0x96c324a4
+ 0x772e8e21 0x4be19286 0xc334d7d9 0x8fe52e6b
+ 0xdc575fc8 0x55e093dd 0x4072b164 0x455f5953
+ 0xc1be8a20 0xc909e3c8 0x4e014a31 0xd262c165
+ 0x3b8c6f36 0xb325686c 0x2a9a5be2 0x2c9d6391
+ 0x5833eb46 0x809a3e39 0x79afe57f 0xda8f5d9d
+ 0x20edcd04 0x916c1c5b 0x18a08965 0x1237b0e3
+ 0x1d306141 0x963c4107 0xe7d19f5d 0x3646a554
+ 0x70ddd647 0x347ae7e9 0x6c93751b 0xb8140f9c
+ 0xc87a899c 0x9009637a 0xa2121286 0x70274bc7
+ 0xfaa6bdd4 0x6a8058c5 0x69288fbd 0x5d99c8f8
+ 0x9c17265e 0x627758c0 0x3d0b4a49 0xa0e7e889
+ 0x896ca47e 0x2604f3d0 0xf74e9f29 0x5c67cbca
+ 0xd182c0c0 0xbb53e30e 0x1760ac60 0x8479de69
+ 0x81dc43c9 0xa3502737 0x7a494ce3 0xbf15690c
+ 0xf01bbc02 0x11b409ec 0x11f9ae61 0x5ea7db7d
+ 0xc6acad70 0x8354f8e8 0x33abdb39 0xc180c9f0
+ 0x1bb2bc26 0x8ace959a 0x47bfbf28 0x7260d8f9
+ 0x26718357 0x0baec766 0xde8a5471 0xb9363d8f
+ 0x7721337c 0xf3058007 0xe1943bbf 0x6c099927
+ 0x255ae5c7 0x40f53571 0xbf2730d9 0xb59dcbb5
+ 0xe5f30f40 0xb409cf50 0x59bcdad7 0x781c882d
+ 0x869ec8d8 0xb7c6da37 0xc90c80ae 0x0fa16b77
+ 0x4299f827 0x2994df77 0x5f4bc5d4 0x4fccc675
+ 0x18f3397f 0xf361abbe 0x4bab0e91 0xbd254234
+ 0x2dc1633f 0x260dfabd 0xdbcd00ee 0x8c4efd98
+ 0xec29b992 0xf64a1525 0x07c67439 0x4f94e202
+ 0x5faea3e0 0xb92afe2e 0xab4cdaa9 0x626ed8e0
+ 0x4dea08ab 0xf9f9bb95 0x7e7c464a 0x387bc35f
+ 0x7ff891cd 0x72f159a4 0x850a58d8 0x3ca73efa
+ 0x19f4c978 0x68ecb807 0x3a55cbfd 0x6d0befcb
+ 0xddd7fb88 0x8907e3e4 0x8b9316ca 0x0c526804
+ 0x04e2a4e1 0xe6171958 0x7e1c66b4 0x3541ddd8
+ 0xe343d15e 0xb2508465 0xf752e13e 0x6d0080dc
+ 0x1d8f4ae8 0x24da3465 0xeb5943f1 0x5fe28985
+ 0x6f982104 0x2d0d972d 0xaa8c451c 0xb7e48698
+ 0xf669229a 0x7195af34 0x67bcfec9 0xfc5799b7
+ 0xfc256d6c 0xc9095e36 0xc29020a0 0x9141b686
+ 0xac0ae23f 0x76f0b463 0xecb76e68 0xdca1c5a1
+ 0x2d4fca83 0x8953f692 0x31d1912a 0xd816f824
+ 0xcb04f062 0xfdbbd34d 0xcf163dcc 0xdb9cff91
+ 0x9db9bce5 0x4ca42841 0x4d88103d 0xaf6f09d1
+ 0x646928b2 0xb71056d7 0x32560e11 0x6454d746
+ 0x0c17c2a9 0xd265ab20 0x01f017ee 0xfc67c395
+ 0x5b1acd70 0x3a6c8cf5 0x71e2d110 0x2ca5bb0f
+ 0x626734c2 0xac0e5db1 0x4c7a3df8 0x0443be75
+ 0x812f4e5d 0x5535bd41 0xd64093bf 0xbcced37a
+ 0x37338d6b 0x83b901d6 0x8f13585d 0xa0c32a10
+ 0x850091fa 0x24864a2d 0x2daef36b 0x3c9b2a64
+ 0xe05bca8b 0x35c0c539 0x5b507233 0x588861d9
+ 0xae0000e1 0x12c4f5cb 0x2f6f1d92 0xf861b587
+ 0x4cb13ea5 0xc685fd44 0xaf3e79eb 0x6894ec24
+ 0x6cbdc6a2 0xe8043d1b 0x0bae6d8f 0xeaaf8aa1
+ 0xbd258899 0x6fcf2c4c 0x8c3b38d3 0x74479897
+ 0x02ef1ae9 0xf252194a 0x4305fdff 0x096dfe12
+ 0x52ce0e33 0x7a444340 0xb98aa819 0x8d402d73
+ 0x2324c799 0x0e383c16 0x4f5ea7f0 0x18f3f716
+ 0x079a5941 0xc275f1c3 0xf38a3b57 0x7967ba58
+ 0x24d824ce 0x870c135c 0x9147bfed 0x87446edf
+ 0xe6a5d5cb 0x6325e4f9 0xcbcc4a39 0x89b77802
+ 0x40ae8bb1 0x0e25732d 0xe146cd6d 0xe2857df0
+ 0x7d4c4d4a 0x5e015167 0x4b29072e 0x9de040ab
+ 0xfbe384d9 0xfa2d1bcd 0x6d15bd11 0x3d374222
+ 0x31ed6491 0xcfa242a2 0xcbbd5cf4 0x009a4aa3
+ 0xf03912a3 0x8206d3a2 0x57693b50 0x5dc3629b
+ 0xc4a557fc 0x8e1916ba 0x9a94d4ae 0xd8ef98d4
+ 0x60987606 0x5722c9ac 0x85dff228 0xefe455d1
+ 0x1b93dc34 0x3c3f5839 0x4794ed4a 0xe5f4cc96
+ 0x8d2be902 0xc766218d 0x7c5ca4fb 0xf75c46dd
+ 0x4c294ead 0x9c26cce6 0xa5af7967 0x33df7c94
+ 0x8a3ad2eb 0x7db3b432 0x6e961c53 0x38596cb3
+ 0x4c7401f1 0x174b07f2 0x3fddb615 0x8eb8fe06
+ 0xca1d5e31 0xc2e5b4f9 0x68cb83e1 0x157ab415
+ 0xfcd4f635 0x85a625b8 0x45a5d073 0xb8737726
+ 0x8d66d90c 0x22374ea2 0x5048665f 0x741d4084
+ 0x95ca85f1 0x3e9ec723 0x11020c1c 0xb197ffec
+ 0xe1f584aa 0x59a7b34f 0x7a8757a9 0xb49376a7
+ 0x0af698b0 0x2aa7ad32 0x5118eec1 0x805f60de
+ 0x7fcdecf9 0xd99f5243 0x6fc3f111 0x10b12af2
+ 0xa71778f5 0x62679d7d 0x8c648f68 0xa82ef346
+ 0x1af396a4 0x279b2f9a 0x9ef3ea43 0xcb5ef78c
+ 0x486bb8af 0xa619b664 0xafa5e5a1 0x9ad5af77
+ 0xc56f1a36 0x33fdbced 0x07a5e6d3 0x60988d83
+ 0x5cde15f2 0x58cf910a 0x670336cc 0x6a8ea3d7
+ 0xb2d3f8e6 0x107b7afd 0xa616021a 0xa1d95c02
+ 0x8bd9d9e3 0x31c99a87 0xf92136d9 0xd3e00422
+ 0x21f98c6f 0xccd4ca9b 0xe0b0b097 0x8f96cb8e
+ 0x1a241a03 0xc8451b34 0x9ab68eeb 0x89f27e16
+ 0xabfd9614 0xbb1e5d95 0x33add3a2 0x69ee5ea7
+ 0x2d525a1c 0x6ea2fa35 0xe2bcfd31 0x8d29feb5
+ 0x1bbf2ceb 0x4dcf92d0 0x31a28a88 0x33262872
+ 0xf9b2cc0f 0x3e17d56f 0xc4bd98ab 0xdc65811c
+ 0xd15ec7d9 0x2926cc47 0x17eff4a8 0xf285a14f
+ 0x5beddbdd 0x911bf1de 0x4d29d23b 0x5b2a57ab
+ 0x9b18d6c5 0xec838995 0x203ac465 0x4b71acc7
+ 0xc9d70c1a 0x1f42f685 0xf8d68e39 0x7b0be69d
+ 0xae2ad5f0 0x14861118 0xe4d67c0c 0x2a7a97ba
+ 0xd1dded36 0xb0aef347 0x94435d9e 0x6c77193f
+ 0xbdfee9d5 0xf2926e0c 0xe9cd2c1f 0x48b0a0b2
+ 0xecc37a3c 0x6a7357ee 0x35f26462 0xd4787e94
+ 0x85159c0e 0xd300df63 0x68fc81d7 0x70214c8b
+ 0x4d8eaf04 0x0ce45314 0x2a57e90a 0xefad38bc
+ 0x61d26191 0x538a438d 0x2a9bf8d0 0xf417e6be
+ 0xde2b8fa6 0x7d51432f 0xc953ebdd 0xa35e3d4f
+ 0x422606d2 0xf96ea32a 0xfd741ba9 0x3c1068b8
+ 0x83d7fb0a 0x820ecd14 0x8293f025 0x69eb4478
+ 0xb38688f4 0xc37c7c15 0x423c41a4 0xbaf87529
+ 0xf13a689a 0xc99683f4 0x5d307068 0xf540802e
+ 0x45e4e2b0 0x7461c823 0x9242c577 0x3bb20e57
+ 0x2f9b460d 0xb5ca4e7a 0x8f243f1f 0xcf2b115a
+ 0x02e42b62 0x1f735558 0x61de9c7b 0x3080e0cf
+ 0x56898a0c 0x286b4a43 0xe17d1858 0xfdb0d21e
+ 0x9a0998bd 0x6f3793b5 0xe7a4b2a9 0x1a9ef7a7
+ 0xf022a829 0x91a8220f 0xd35f6564 0x5689758e
+ 0xa9723d93 0x01e17c3c 0x9e797d6c 0x931448b6
+ 0xd4e8430b 0x0dba9b8d 0xecd995e4 0x95ec825e
+ 0x87aad51e 0xc9f158b7 0x32942d39 0x541a555c
+ 0xa4ff1310 0x60a03907 0x2194852f 0x111f4a75
+ 0xdb1c720a 0x095dcca0 0xf3dd7dff 0xc7ca3304
+ 0xb5eeb3f7 0xcf0d0c72 0xd808a0a5 0xac1075f0
+ 0xbc561609 0xdc72b6a2 0x54885b6c 0xe7efd131
+ 0xa1a5a25c 0xcbe4ff3c 0x28f97f18 0x4012e7ea
+ 0xb179d1b7 0xc809f1f2 0x03ec77bf 0x95e2b32b
+ 0x3037ee61 0xfaaaaeef 0xa962f075 0xad708299
+ 0x773e64e1 0xec4393b8 0x78f3a010 0xb64f4526
+ 0x0371e230 0x8190f9c8 0x6ebf110a 0xee32985b
+ 0x3d9224f7 0xda849ae1 0x0e374bf4 0x66d520ee
+ 0x19e8a010 0x3eed7ee7 0xdbf76747 0xa7da62d1
+ 0xeb485f92 0xf90297e8 0x36a32248 0x82a0b444
+ 0x0072c4d7 0xf31919b2 0xf63b3ca8 0x78729ede
+ 0xc2c3c36f 0xd170210d 0xc1d19649 0xad9eba3e
+ 0xb8ad7754 0x0af0eed6 0xf7c5a835 0x788ca836
+ 0xd9ef72eb 0xfdfa039c 0x88398d5b 0x20f22f57
+ 0xa9a8b93b 0xa5ebca5d 0x28f209ff 0x07e32e21
+ 0x9656f67f 0x6d3c5fa7 0x110eb8f9 0xe15ed9b5
+ 0x866d4470 0x3c60e896 0x156b88ad 0xe03f5d01
+ 0x4b71a715 0x5b635aef 0x233a242e 0xafaa190b
+ 0x4dabcdc9 0xca4f7fb1 0x2af45681 0xcdb6acd2
+ 0x445ea28d 0xeb2375ae 0x332b2a88 0xf4c09b6e
+ 0x9735d52a 0x05246fe1 0x155ec9ca 0x28e12827
+ 0x02eb26e5 0x5e34c38a 0x14f65c83 0x570c33ef
+ 0x083f8f84 0xafbed213 0xd8de70f3 0xb846bc36
+ 0xd9dbe621 0xafa979d1 0x3e1e9824 0x19042871
+ 0x32f7cb39 0x0855c3ff 0x6bcc596b 0xb1bd6c61
+ 0xf2eef2e0 0x4266114e 0x2af9f232 0x638ee7be
+ 0xead00f9d 0x1eb23029 0xb7a696f5 0x3dca0c76
+ 0x18d10791 0x6d0b8421 0x11265a7a 0xa94e0ba4
+ 0x7ead64f6 0xebe66308 0xdf484ae9 0x4bd2aaf5
+ 0xc4524a77 0xef077907 0xbf3611f7 0xdd200d07
+ 0xe74763ce 0x48471278 0xa16800c5 0x057a9c8c
+ 0x8351bce2 0x01f13e2c 0xea354df2 0xebab56c8
+ 0x35131ec5 0x91b89076 0x089a3f82 0x2febf67e
+ 0x6371f8e9 0x47875c38 0x68068d1a 0xa9ffaca9
+ 0x981fe8ad 0x3cbf3d90 0x0f595206 0x4819c74b
+ 0xdf34f481 0xbe9bee8e 0x75a32f6e 0xa2fa22c1
+ 0x831c50ad 0xe926e034 0x9eaabf41 0x85fc1fdd
+ 0xa0e03c72 0xc03afb52 0x714b2c07 0xcf6ea676
+ 0x4570c3a2 0xcc59d874 0x88b7bb1b 0x9f290e3e
+ 0xe1bc799a 0x7cb7feb1 0xf6cf2a64 0xee527235
+ 0x6fae46de 0xd1718027 0x8887b0a6 0x4d2ba919
+ 0x8ffe8517 0x23cf9380 0xd2740cc1 0x608bb9df
+ 0x10a6a677 0x40cfb2b3 0xda8f22fe 0x371fbcb6
+ 0x2930ffa5 0xa71d9c73 0xd30539d7 0xe5c2a5d4
+ 0xbbe79909 0x09c8dd8f 0x6ebb55d0 0x07987f3a
+ 0xfc2c9aac 0xeffd1fd6 0x0d3f17c0 0xc6202654
+ 0xaf1811cd 0x7a0ccefd 0xf6c0a796 0x9f26e794
+ 0x573bebf0 0x56e55fe2 0xcd7a3689 0xb9bfb1ed
+ 0x2b114c33 0xe7d85aa8 0x8e11b760 0xb7aa684b
+ 0xa9cea609 0x26e91a1d 0x36d6bd2c 0x7e4b06af
+ 0x990f23c2 0xa7c9b36a 0x791c6816 0xb7c873b8
+ 0xb9b22ba4 0x3b12ce3d 0x19c88243 0xa23c93b5
+ 0x6c879c45 0x612dee26 0x205ac600 0xc941d786
+ 0x5aec21a0 0x628a03cb 0x29f6b021 0xa9815280
+ 0x0b7f80ae 0x9626928b 0xce7fe692 0x74debb2f
+ 0x1b0f48b5 0xedf656b4 0xaf90977a 0x7f298c97
+ 0x599de972 0x2455b833 0x1b0e8a97 0x68e3cfb4
+ 0x2af88b8e 0xaf00bf4c 0x576f0615 0xac27d941
+ 0x3a3915c1 0x11980b31 0x36e6df96 0xcdce8ae3
+ 0x596aaa5c 0x9902fb8a 0x437c5dd8 0x78fa4402
+ 0x6e0499a1 0x20d91a0b 0x90185f3d 0xc7ec9381
+ 0xc09a6965 0x1332c6ae 0x533d678e 0xe0d5bfdd
+ 0x638fd40f 0x2413c57f 0xb4479fa7 0x8ce09a6d
+ 0x141a584c 0x9ad2e9ec 0xbce7d66c 0x66f87de2
+ 0x652ed9ba 0xe5a3e8d6 0x3438f95d 0x34455629
+ 0xa2cd73ee 0xc72352a1 0x861dec12 0x05657b8c
+ 0xb5788820 0x0f147d8a 0x58bd7e0c 0x95ec08d7
+ 0xfbba26b4 0xa8cafa3c 0x60679191 0xfbb5a740
+ 0xd062635a 0x27691cc5 0x19a7a5f9 0x0720cd0b
+ 0x5998bd90 0xb89b4377 0xc0b6cff6 0x9d2cef91
+ 0x10506588 0xbc6758dc 0x4d608503 0x5a699cd3
+ 0x4e1074f8 0x705ae566 0x693f055d 0x7fffa4cf
+ 0xa938f3d5 0x68d378dc 0xbbbcf3c2 0x3025fd31
+ 0xf11955eb 0x335580c5 0xc14fb547 0x8ca8b7cb
+ 0xbf488ec7 0xd65643d5 0x3ab48e8e 0xeb2a5a9d
+ 0x8d4634b3 0x53d3c415 0x26ecd313 0x45866732
+ 0x5ca6800a 0xa95a5003 0xb6a4a0ae 0xcf61181b
+ 0xecce7a4b 0x6bb2617d 0xe6f6cf30 0x2ca484f7
+ 0xfc041327 0xecfb38c6 0x8da2da87 0x04d6df0a
+ 0x1da682fd 0x7bcc8939 0xb3211ba6 0xfed462eb
+ 0x22d0bdb2 0xc81a03c8 0xc6cef99e 0x4a07f162
+ 0xf47081cc 0x6b9f9f79 0x5255ed2c 0xc6664862
+ 0x0a0d0fe0 0xce0a3c43 0xee29901b 0x08b1ebf7
+ 0x3f6e20de 0x29d73ca8 0x19fbef40 0x35b805aa
+ 0xe41c9fb3 0xdaab78c8 0x396eb246 0x7942b8b5
+ 0x94b3bea3 0x44addace 0xd8c3b55d 0xa07d52f8
+ 0x810d6bfc 0x84efa9c5 0x55cc3d58 0x31a721e9
+ 0x818b9866 0xbdb4e594 0xcf9ef3a0 0x3ec34d62
+ 0xc5f646ca 0xe03ff91f 0x5b7d6ac6 0xc965abc3
+ 0x5d0a4b45 0x523b07fc 0x4ad23688 0xeb25e21f
+ 0xec42f996 0xeac4a305 0xd083a034 0xf47e421f
+ 0xa57f6115 0xc89869e7 0xad127bac 0x5766f2fe
+ 0x73f8f406 0x66a164ed 0x57ce5b92 0xfe0543a7
+ 0x3d01ea2f 0xbb5c4582 0xa0187dc6 0x0bac43a4
+ 0xe3762160 0x53f709af 0x72a79d9a 0x8b131235
+ 0x40144439 0x7f4b638b 0x740cb6c8 0xa267d4ad
+ 0xe75e3d28 0x1936b8a0 0xf595f923 0x2653e6fd
+ 0xeeeb0a5c 0x126c218f 0xf787c637 0x6e68d9a1
+ 0xbb7a371d 0x70a542ef 0x6d6ca7ed 0xf4c6aeb0
+ 0x7ecd1488 0x29b9f964 0x033cf786 0xcd34a0ed
+ 0x4d09bf44 0xf94697cb 0x9fc11acd 0x4faec4de
+ 0xe427a1b6 0x814c4083 0x75b5bcf2 0xf77ecbac
+ 0x84f98a7e 0x67be3e94 0x547715fe 0x91134de4
+ 0x1a258be0 0x4f1b0657 0x5d9a5451 0x6184d23c
+ 0x2b0ebf79 0x45957241 0x327d3072 0x571b4e7f
+ 0x29a93f26 0xdd3b33f1 0xc764cdc2 0xfac837cc
+ 0x08dd03e7 0x7e20c4c2 0x2c706329 0x6a595b37
+ 0xa399940a 0xe62996dd 0x410a43fd 0x8422504a
+ 0x83c9047c 0xda9342da 0x0fd8d28b 0x10363a28
+ 0xe583b580 0x7f865d38 0x53049b61 0xe2244969
+ 0x1654cf74 0x3928b71d 0x92c56873 0x89c9f802
+ 0x700f0112 0x06294872 0x5398b3f5 0x7ea9c78d
+ 0x5e3dd947 0xdad37580 0xa4e7392a 0xe915e856
+ 0x9253d5ee 0xa6c48e3e 0xf3712d98 0x2617d308
+ 0x0b42e7d1 0x219ac5a1 0x934263c0 0x3b47e88d
+ 0x5be1bac0 0x1ceaafe9 0x3ff3404a 0x89566b7a
+ 0x68bfc8c9 0x8c7a1f86 0xfbbeab00 0xbd72bd86
+ 0xf095a97d 0x4001537b 0x7231e146 0x65323fd1
+ 0x29a7d447 0xbcdc2739 0xef8e77eb 0xbdec1572
+ 0xba8d38ea 0x8be0df9c 0x14c9e008 0xccb500fe
+ 0xf4f4aad8 0xa71ebae7 0x3e80c57c 0xb16084b8
+ 0xd697a5d3 0x4102600e 0x14b09a48 0x929600aa
+ 0x71f7d884 0x339dcba5 0x8b655661 0x68fd1ca3
+ 0x79e428a9 0x13b38380 0x6e03dedf 0xcfc74cc5
+ 0xd38273db 0x38f7e269 0xafcf0d11 0xe6efbc51
+ 0x07559ea7 0x184f0ce9 0x5a0f1eaf 0x0890f392
+ 0x0aac937c 0xaafe4395 0x635f04eb 0xbab57b9f
+ 0x25ffe623 0xe63b2795 0xb0f990bb 0xb9dd0f23
+ 0x72dd05d7 0x8b4afed9 0xad93aa8d 0xed6650dc
+ 0x961af304 0x79ed2e65 0x64baf219 0x59cac07a
+ 0x30a71753 0x6329158e 0x4df28920 0x4bccf1e3
+ 0xdbf26ce6 0xdaf5b01e 0xe6d6ddf8 0xeb3b0b8f
+ 0xf21c4078 0x383703b6 0x31b3eb29 0x8a4722b2
+ 0x6da9cf03 0xde9b68d5 0x9fb81a8a 0xb9b7b225
+ 0xbbf25f2a 0xfcbbcf77 0xf6b349e0 0x55e2a946
+ 0xaa0ec8e8 0xe0c3f755 0xbb5317f5 0x42d49d16
+ 0x955020be 0x57663a99 0x27f6472d 0x0db9e8fc
+ 0x73e868b5 0x221726cb 0xf88d7a67 0x1afabd43
+ 0x1c416d42 0xa7c8c7f9 0x2d53d211 0xa4b16994
+ 0x7994098c 0x1196457c 0x1041d6ed 0xc3f3b526
+ 0xdd6233d9 0xe5afe646 0x3eaa4645 0xb2f4be8b
+ 0xa041a2d1 0xf56f06b6 0xe1a2b3cb 0x10f2ee3a
+ 0xb4b80873 0x1f31a3c3 0x00a702f9 0xcc024339
+ 0x0f11db60 0xe41963e2 0xee888ba9 0xe68bdba0
+ 0x233f9cab 0x1011efb5 0xd0f9a956 0x63c01b4b
+ 0x8f86b442 0xba153a6b 0x1886f0e8 0xc8cd92b2
+ 0x6dee78a6 0x5425709a 0xb64fd26f 0xddd0d0fb
+ 0xf543b459 0x6c853b90 0x7510f0e7 0x76d8a652
+ 0x60ca661f 0xe9252e55 0x5a29d60f 0xe1fd802d
+ 0xb3e9acdf 0x9af447b6 0x5eaf51bd 0xdfb0d9f6
+ 0xa7c530c0 0xc8ecf367 0x0ed05b4e 0xc228d0de
+ 0x564b4190 0x7a4211d4 0xfb7a7c13 0xde76c43b
+ 0xb4984c7e 0xf3fe0221 0x066070ac 0x6e651083
+ 0xd05fc9ce 0x1233ddc5 0xcbceea78 0x2a5bd303
+ 0x8e085a72 0xede7cd74 0x3d62b29a 0x29774643
+ 0x64c254f9 0xf117a1b4 0x3b557f53 0x4f6eae39
+ 0x23da390f 0x6a8464b8 0x6ea39bb5 0x087f7f2f
+ 0x43842be8 0x586ef6e9 0x37d3689c 0xbec7fa83
+ 0xe85a0b9f 0x675c93ed 0x2d9f0762 0x4e7d5a3c
+ 0xe6e54fbd 0xad3b58b3 0x81a4c6b8 0xb2da4172
+ 0x4d992b63 0x8672774b 0x0f41f386 0x0d59a903
+ 0x37fe2435 0x1d0dacc7 0x3c44c47c 0x56e00c7d
+ 0x445d5b27 0x0ac7091b 0xb4b51593 0x21fb0537
+ 0x9134c389 0xa5f7ac5d 0xb94b47b2 0x7bad6b13
+ 0x573c7e83 0xcafc2dd1 0x09566a61 0x7b3d531e
+ 0x3f0f399f 0x6c74ffde 0x4ffb2bba 0x1c59ce82
+ 0x799d9fbd 0x3f64b5f7 0x595607c1 0x1366684a
+ 0xff162fbb 0xe682e121 0xe07eb26d 0x5193e3bf
+ 0x6d1d9de9 0x20c82cbf 0xc84a8e1d 0x73b5816a
+ 0x590e6335 0x452c8c1f 0x19b2335c 0x4fa2145d
+ 0xff0cd6eb 0xa5e683c7 0xc62b7cf0 0x66dbd8b7
+ 0x886af340 0x1d661d53 0x45c3407b 0xe258129d
+ 0x5738bc38 0x4e468671 0x8ef5dfbf 0x169d51c2
+ 0x5e264507 0x33bf23b0 0x83df12f9 0xb23ca69b
+ 0x050f29aa 0xf100c178 0x8eec6db0 0xafa51051
+ 0xa31b4988 0x90a05b3e 0xf39b878f 0x1489a7ad
+ 0x86726bf3 0xbc5679f4 0xcea42088 0x071984a2
+ 0x9116773b 0x374ea03b 0x58ff0b61 0xb1fc9e12
+ 0x527d73d3 0x2851a8fe 0x7dd6bfb6 0xe6df4902
+ 0x1bbba42c 0x99af720f 0x097b9713 0x7bb88ff4
+ 0x58f5f053 0x0f842f16 0x3d1e721b 0x887eed55
+ 0x5c041320 0x378f42b4 0xd3c1ea60 0x4daaa4a4
+ 0xa8ae1598 0x5dfd04c6 0x5e13f51d 0x8f2bc005
+ 0x8112d8fe 0xd980f816 0xe60ed7ae 0x6d81784f
+ 0x5ee9bbd5 0xdc72c993 0x5e4ffd01 0x2fdf5ca4
+ 0x364c7ba1 0x8b957fe2 0xecf88970 0x1c948513
+ 0x64e317f3 0x6d7ab225 0x70f168c7 0xb3d8f41e
+ 0x54727fde 0xc180072b 0x52b62642 0x53d59c35
+ 0x0756424a 0x84e736ea 0x403f01ef 0x7737edb8
+ 0x0968aa7f 0x629b8453 0x54f02e23 0x40cad2cc
+ 0x4712c678 0xcc0f73d8 0x9ce3491e 0xa93ad225
+ 0x4fc3c353 0x9702a179 0xcbd42840 0x2a2d55f5
+ 0xfb153530 0xd2aae06e 0x3b988b1b 0x215defa2
+ 0xb7cb3a4d 0x517e11bd 0x116743c7 0x60f89947
+ 0x96955aa2 0x8ef1616b 0xc7a86367 0x7962234b
+ 0x80da3dc4 0x33327b35 0x076a2bd4 0xdd7a4bbc
+ 0x685a08b4 0xa7fdcf7c 0x65bf1d86 0x1917a9d2
+ 0xdca93ed0 0x48a391ef 0xd70a8cd8 0x86d52919
+ 0x2dbe56b9 0xde8815b2 0xd5e0477d 0x4e111ddb
+ 0xf5ef2878 0x17c5692e 0xd4937594 0xc071b1c2
+ 0xd7151f2d 0x1ba686c3 0x54c38767 0x6501d7cc
+ 0xbc16a74e 0x909dd991 0x858cf3ee 0x4fad895f
+ 0x5975eee4 0x6ca600e5 0xabd86999 0x7a4c5051
+ 0x9e023f91 0x2a581273 0xfc1856b0 0x717a9500
+ 0xc814682e 0x868635eb 0x5567ee04 0xdd0fa821
+ 0x7dd71e2c 0xaa29e440 0xfe7fa170 0xa6975f2d
+ 0x7db13286 0xf80ea7cb 0x65440c80 0x1bbc88c2
+ 0xdeeb5a2c 0xc1477a30 0xafbf244a 0x198402cb
+ 0xcdee31e8 0xbba5e44d 0x83e50fc0 0x145c0c4c
+ 0xe28d07e2 0xec6292b1 0xf03845da 0x04f887df
+ 0xf8cf9658 0x9055eebd 0x7e433402 0x46b83e87
+ 0x32c1d8e5 0x953b989c 0x27f6253b 0xedfb4f91
+ 0x6f1ae0a6 0x70a2df8b 0x091a55f5 0x8758b4dd
+ 0x1bda1ece 0x7a284685 0x4d63c11c 0xf22826ef
+ 0xf0ff2763 0x4f10103d 0x8b9aad7e 0xda3a748f
+ 0x86ba49ee 0x4a48f0c1 0xb4258bb6 0xb892aef4
+ 0x2e1eec09 0x658af08e 0x03609f72 0xe067efef
+ 0xd599a0d8 0x27043e1c 0x76610816 0xbd1a9b56
+ 0x047cfef9 0xa7159a70 0xc82ced0e 0x44901cd3
+ 0x19dea1d6 0xea24e644 0xe645f856 0x6e8fd665
+ 0x25cd03ed 0x987368fb 0x95a04c97 0x4aaf44de
+ 0xd232decf 0xdd2131ed 0x6602bdc6 0x8a42bd18
+ 0xf839fb2a 0xb65785f7 0x7a6ff4c6 0x899830d5
+ 0x46e993fd 0x09973f39 0x83cf23cb 0xb2f26770
+ 0x8c531c1f 0xd97b41fb 0xf572173b 0x7a1404a7
+ 0x61d85f57 0xa0702253 0x48afa948 0x8f2aaba3
+ 0x1252a999 0x1a1e4171 0xe287d10f 0x121ff861
+ 0x544d166a 0x7adbdffb 0xc2dadb3d 0xf88b86db
+ 0x087f1dd2 0x3260bf71 0xa4b9881c 0x2b8f6795
+ 0x2812e4a0 0xce728d9d 0x9ab3081a 0x3d2fa8be
+ 0x61bc77dc 0x530464ab 0x36fda196 0x4efceb71
+ 0x04aa6f81 0x8032ce30 0xb9c33455 0xa07c5b61
+ 0xbfdddce1 0x16ffa34d 0x9f7f8efe 0xf6308df6
+ 0x071fa35a 0x948978e1 0x35124fb9 0x2786d40b
+ 0x62f06ff2 0x1409d3ae 0xc0223171 0xf524409c
+ 0xd143e8f3 0xe87832fe 0xf5f46599 0xd0302b71
+ 0x7259891f 0x83f9158d 0xa0b3ca08 0x37f0b6f7
+ 0x8da1abef 0x869bc166 0x0891274e 0x1c99caa0
+ 0x84f5c390 0x174eff0e 0x450caa3d 0x53704c05
+ 0x14e2404e 0x5a050d3b 0xe3e1d53f 0x059293f1
+ 0x4ebcc617 0x7278707e 0x3a0f589c 0x462178ab
+ 0x9448eda5 0xc7ec4df8 0xc104df6c 0x0e7651f9
+ 0x301ac757 0x5571a9e4 0xa1845d20 0x9bcaf8a2
+ 0xee184556 0x54cd32f9 0xc64d37bd 0x87821019
+ 0x0bf5eef7 0x88c05039 0x73f0c7ad 0xd9743149
+ 0xe8ac4c1c 0x18d90782 0xfc38561f 0x3478b897
+ 0x86ce7d3d 0xb465bea3 0x75101723 0xca9c4a8e
+ 0xf3eeb88f 0x47221789 0x8561f74a 0xc5c69e0e
+ 0xdff3c1d0 0xde80d4cf 0xe9098800 0x519678d6
+ 0x0eadd078 0xb85293eb 0x891b8db3 0xf13980c1
+ 0xd1ded2ef 0x57aba1f9 0x2be45501 0xe1e0b6d7
+ 0xce304444 0x03a5dc2f 0xc55fcc35 0x66f3e426
+ 0x507998c2 0x1ff98a40 0xd214ad6e 0x29f5da1e
+ 0xa09ba361 0x4375dcd0 0x17a3e9c4 0xf43aa48b
+ 0x279324fb 0x5355ef2c 0xd07c0a40 0x4a801679
+ 0x3ccce904 0xbd1fccb5 0x72d23024 0x40bf2d1a
+ 0xad66d845 0xd3b06ab6 0xa02e0454 0x6b8bb9f6
+ 0xa0f01e02 0x7083871c 0x22a240b3 0xbc595e6e
+ 0xec3ae893 0xc129dc83 0x305c6133 0x6478ca71
+ 0xc3e31f2a 0xa672d383 0x25d1cdc1 0xa43ad0cc
+ 0xc62762ff 0x524e0786 0xc8266cf9 0x4c1dce61
+ 0xf401db3d 0x4731884f 0x2e74c74d 0x580d1361
+ 0xced44e75 0x9cfbed1c 0xa4a118b8 0x3fc49536
+ 0xc7ed335d 0x557bd121 0x99f6096b 0x105313eb
+ 0x12d814e9 0x140bf537 0xfde60a3f 0x8fbb2142
+ 0x290c9253 0xde68576c 0x1b6a453b 0xff076026
+ 0xfb76b4b7 0x5e0b8e4b 0x1a5c4d8f 0xed50c7ab
+ 0xe769b705 0x359af5cb 0x3b59367d 0x354ecb98
+ 0x4779cbc9 0x19ed0073 0xc02a8af7 0xa7785920
+ 0xbbabe7a6 0xd6088727 0x8e8ab30c 0xbe870ea8
+ 0x4ba0119c 0x7d62815b 0xd2463123 0x07090f2b
+ 0xb0ddb91c 0xf7b729c7 0xc6de14fa 0x5858ed16
+ 0xd9ae0f53 0x413f2b4e 0x1d82480c 0x3d6ace1b
+ 0x40276887 0xdf499b6d 0xe2f27cbc 0x7e3f27aa
+ 0x881fbbd0 0x17f170c2 0x1b155736 0xb5474620
+ 0xc245161b 0x6e0b4d6b 0x002e9fce 0xf7f5dc75
+ 0x7110bf54 0xee5540ff 0x9beb5aaf 0x3140dd10
+ 0xca6527ae 0x1eff473a 0xc21e9ed4 0xb90e2c31
+ 0x1639bcb4 0x79299082 0xd8569456 0x9d55a257
+ 0x4cdf608a 0xb763062f 0x33132bb2 0x95048255
+ 0xfa7a56df 0xc4c25dc7 0x5acfdf09 0x01b4c169
+ 0x65a39270 0x6a07cdad 0x5c1322ae 0x0a547a52
+ 0x5b88ad05 0x2795f9a2 0xa878eb57 0x831c6d35
+ 0x8de77363 0xef454c49 0xcc483e00 0x98d30ef7
+ 0x5cee6411 0x59ddda14 0xdcad4568 0x63ce2a5a
+ 0xc78a4f40 0x56c6a389 0xdca6fb34 0x4019a066
+ 0x223145f1 0xc05df1e2 0xac849b7a 0xff73ca98
+ 0x76de09cb 0xbb4369ac 0xe7145267 0xb07b456b
+ 0x1fdf145a 0xde56e1c7 0xc5e9e8cb 0x64e69739
+ 0xe5a32181 0x55ee6c8f 0x86521149 0xabae431e
+ 0x10f5a7e6 0x2ad18917 0x12b1a65c 0x4ff84a9e
+ 0x8068860f 0x610a0bf2 0xd331b49c 0xc92487f2
+ 0xab54424f 0x968608ca 0xf6152bc9 0x17fbe76a
+ 0xfbebd48e 0x33eae855 0xbe20e3fc 0xff5567e5
+ 0x37cbf19b 0x76ed0c82 0x8b4607cf 0x4a659fda
+ 0xab5af02f 0x98dbab4d 0x0098bb06 0xd17b1f16
+ 0xe472636a 0xde2da4b6 0x6d9f8ed9 0x805ebfaf
+ 0xedf89d3f 0xdc4e2ad0 0x3a30d17b 0xfc41ce23
+ 0x4ff0c7da 0xdb3066b3 0xe60f5cf3 0xe6acb2c6
+ 0xae51c542 0xbef39ca2 0x2d38d866 0xd4d7998e
+ 0xff668ba1 0x577045d8 0xd3e7b383 0xf22ccabb
+ 0x75752791 0x61bdaaa5 0x0cf06032 0xb6373ff7
+ 0x0c074a20 0x09042638 0x92dd83f6 0xe4577636
+ 0x6d64a8be 0x597d896c 0x2fa05214 0x4d410aee
+ 0x6f3c5da8 0x611bd40f 0xfe674796 0x7b0f1129
+ 0x460e765c 0x3e65fdf4 0x5069c2af 0x6d7f7ff2
+ 0x2906295f 0x1541c107 0x8d7af680 0x700d4a29
+ 0x4ffebd8f 0x039bddc0 0x138c2994 0x84df9bcf
+ 0xe724df28 0xaadb2e86 0x8c31c7f2 0xd0b0cb77
+ 0x6c98a1cf 0xaf7d74a0 0x813f01b8 0xa5d49e0e
+ 0x49e7168c 0x00c8f29f 0x6ed79b2c 0x1fac71d5
+ 0xaa1d3e40 0x9ccaaa99 0x49d3cfd7 0x57e8a241
+ 0x2208c379 0x8a0d30b0 0x8379f733 0xc036439d
+ 0xba4f760c 0xfd17d48d 0xb687eff8 0xc16cb64c
+ 0x138be857 0xa7a2ba2c 0xea6bbaf8 0xa432e0b8
+ 0x2923df56 0xb9b4ff80 0xe78982a5 0x8eaa1315
+ 0x28492c47 0x8dad81e4 0xba11923e 0x0555126d
+ 0x5bb2ec54 0x4cb99eb4 0xfcc71c59 0xd4ea57f0
+ 0x96c8da30 0x08435ada 0x52062f62 0xb464f40d
+ 0xf8709791 0xca08084b 0xed31fd35 0xfc33d802
+ 0x7d3a3dba 0xd4cb5ded 0x1cf550db 0x3f720ee1
+ 0xf0c445fc 0xc1a92738 0x4d3604d4 0x378bc2e7
+ 0xf7b7dd63 0x336bdeab 0x7a778204 0x7828910e
+ 0xc2874bdc 0xa3c31510 0x9ab5c466 0x4f20578f
+ 0x8e73ff32 0xd0bf1bf8 0xc28d73a0 0xa39944af
+ 0x061d7674 0x7ea1ce1c 0x5a3cca8f 0x1a88f2be
+ 0xd88f6adc 0xccf0633d 0x30c3b802 0xdd71dee4
+ 0x8ae4d351 0x0a7738bf 0xf36e848b 0x6dec785e
+ 0x58988a3b 0xdbb8b887 0x18d080b2 0x58a86f9c
+ 0xcae797a7 0x96b255c0 0xd9379480 0x709d26ea
+ 0x9051125c 0x295d8682 0x97c2e475 0x7e5b407f
+ 0x6681fdb8 0xe16c2876 0x3345a959 0x1cad6f73
+ 0xef3e3ea3 0xcb3faa5a 0xd88ed048 0xe12448d9
+ 0x61295bf7 0x7b420d0a 0x1d439f5a 0xb5a9b50c
+ 0x8653bf6e 0xb2dc9144 0x93036dad 0xba7d6a4e
+ 0x055e559e 0x9c850951 0x6d31816f 0xd54a7969
+ 0x508967e7 0x6a76cd75 0x48229f7c 0xf94261fa
+ 0x4f1b2c60 0x30591684 0x619f5412 0x37a573d4
+ 0x27fe764b 0x7a146285 0x6c66e646 0xb1e2889b
+ 0xb0be8e7c 0xf0b6cd6c 0x0f9a006f 0xb015a2c0
+ 0xcd58c3d8 0x737b0710 0x5dddbeba 0xdc021827
+ 0x9208233a 0x5d325f47 0x965ac3b9 0x1fe61d1c
+ 0x8d7419fc 0xd483074d 0x9c58f815 0xf8dc14bf
+ 0x7adbaad3 0xe9e10bf0 0x3dc02504 0xf724d248
+ 0x22b0e801 0xb90d698a 0x5e5eff9a 0x9d961510
+ 0x2d9cdf4f 0x5c0088e0 0x309aa90c 0xcfa57d5d
+ 0xd4de3f7b 0x3338841b 0x98312bf6 0xbcf10b77
+ 0xea6c7b59 0x0336eedc 0x4fd84d28 0x04e0b906
+ 0x26aa6af0 0x391fea83 0x065f8c6e 0x051b9508
+ 0x4caa3453 0xdecc0ddb 0xa35dcda0 0x4ddda422
+ 0xdc98138f 0x46764b42 0x78affc7a 0x53a62634
+ 0xa8d37797 0xc777ba1d 0x5c682b96 0x07faf56f
+ 0xe50f7e2d 0xb7e94981 0x08b19a90 0x80480c0f
+ 0x1466bd8e 0x3f032f83 0x7bc67f78 0xb7f5259c
+ 0xf58d4330 0x7e1e3dd5 0x82fc00e1 0x35ee07dc
+ 0x384acde7 0x7cf91b30 0xc220653a 0x3e472880
+ 0x98b7737e 0x5a7828ed 0x3598f86b 0x65ff2395
+ 0xb057dc53 0x96819f8f 0xc6f5a8da 0x46cc05e7
+ 0x4e0066ee 0x1fdf6e48 0xc6cd3d59 0x991fb04f
+ 0xc359fd4f 0x2d7a356c 0x382adf55 0x7ade325c
+ 0x73779267 0x86c529ff 0x814cf15d 0xc5922d2a
+ 0xde99fc0e 0xeeafe58c 0x96692a4f 0x3053bdfc
+ 0xe5b78930 0x601e01ad 0x568a9dc4 0x67930925
+ 0x019c962c 0x4b0ecfd9 0x143c6181 0x09bc4d21
+ 0xcb2a7147 0x615faa33 0x5500ec44 0xfaa814f4
+ 0x4fccea84 0xe3464e32 0xbfbad0b6 0xf9126b0c
+ 0xc4cf5765 0xcaff573c 0x05677979 0x1ecaa748
+ 0xb2e05819 0x8e2613e2 0x91d7e9d0 0x28cf5075
+ 0xb1758e90 0x56f4304b 0xc3eae732 0xc6f9668e
+ 0x9f6bca3a 0x917baf38 0xb2a70b37 0x8204ee82
+ 0x3758fdf0 0xc9af6ab3 0xf7e210aa 0x82df501d
+ 0x881462ff 0xe4108709 0xbea770b9 0x142ce156
+ 0x3c3dcbf7 0x4587c97d 0x93a9beff 0x0be1a423
+ 0x8ffe073c 0x5bfac5d3 0xa37dd1ee 0x4c4b28c3
+ 0x6b746ebc 0xcebf1b65 0x6da9ae68 0xf6ccbd7b
+ 0x87259951 0x0df484b8 0x34d02cae 0x0cf57a47
+ 0xfb2626e7 0x0e4c7cbd 0x8a794c05 0xc5bc72a7
+ 0x1d5f8c05 0x8f74d29b 0xdbe61ade 0x2c40bae4
+ 0x52316fdc 0xacbbf330 0x24620aba 0xbd509810
+ 0xac7b2062 0xce960eb8 0xeb3cb3ea 0x951a3a3b
+ 0xcbe6919a 0x15121b2c 0xbe7b4001 0x4a2e857e
+ 0x60005d12 0xdfcea0a2 0x04411e0d 0x519dc985
+ 0xd7557722 0xf7031a53 0x8e6bd4ac 0xf7610a7a
+ 0x8c3285b4 0xd0bc660b 0xc2a35cdc 0x3e6fda33
+ 0xb947c465 0xb65d70c7 0xa0f0a4fd 0xd7a49801
+ 0xd43eff86 0xb0ea0425 0xc11e89e0 0x1cf1cfd2
+ 0xcf52abb3 0x0b877e5c 0xed0a4b93 0x60389dc6
+ 0x29e5550a 0xf09bfff9 0x6de1254e 0x76dc4048
+ 0xdd3ffa40 0xa3e5d68e 0x17a2ae52 0x48be8d4c
+ 0xd0ab3725 0xd22c0450 0xcc67629a 0x88f454ea
+ 0x107a0eef 0xce96d2c1 0xae8fbf50 0xe5fb6d09
+ 0x0057065d 0xdd432ef2 0x32a1bdff 0xb2c10866
+ 0x3884658b 0x1e15fcc3 0x7d2e25e9 0x80a5ba6a
+ 0xd41bce41 0xda436c28 0xa8dba199 0xe788932f
+ 0x47f7f0a9 0x6980522c 0xe97b47fe 0x9d9ed687
+ 0x54ccb0ac 0x1524ab70 0x86e84451 0xb466ab2a
+ 0xaff0031c 0x56230e36 0x662772b7 0xc3cac3b0
+ 0xf3801208 0x592050d8 0xa314a00c 0x23073044
+ 0xa2651660 0x5c141005 0x75c3a9ab 0x426fadea
+ 0x917b94b7 0x00e4d928 0xf0022117 0x459b8638
+ 0x4d252cf6 0x50f9672a 0x4ab3c6ef 0xc78ae924
+ 0x811252c6 0x71359755 0x4771731a 0xb814dfb9
+ 0xbc17a50d 0x21438116 0xdc97051d 0x293354c7
+ 0x989e5e5b 0xf32c7b44 0x509912ef 0x00778203
+ 0x761a5968 0x139bfd3f 0xfc10aa15 0x5144a561
+ 0x33e2e16d 0xb6121a7f 0xa0b92381 0x429d85fe
+ 0xc523496f 0xdf05031e 0x995a9d12 0xff983574
+ 0xd070af21 0xf2d0d735 0xbc2ac395 0x79f3cfd5
+ 0xc7cbe59c 0x15d4190e 0x8b41e26c 0x34273bf4
+ 0x08a3cb05 0x0db92689 0x80fcc3d2 0x1e44d756
+ 0xb2695d04 0x8fd1718c 0xdf54decf 0x31b02282
+ 0x73c559f4 0x6bdf32bb 0xb02a5d71 0x27feb1bf
+ 0x02a82f46 0x4dcc864e 0x4f55ffc1 0xb8d8f2e7
+ 0xfbb13ff2 0xfa097c0e 0xd8644d7d 0x7062051e
+ 0x4ba6fa07 0xbc929f5c 0x21b24366 0xa20fd863
+ 0xbfbe4678 0x6eb43570 0x57450ff9 0xad350484
+ 0xba606d11 0xb1b80485 0xaa5b6ae1 0x4fac0470
+ 0x77c3c5cb 0x802418c0 0xf5d108ae 0xd2436de9
+ 0xa7dc4291 0xf5bfe6dd 0x99a31c5f 0x61f481cc
+ 0xe32d2ac4 0x1caeefca 0x2028329c 0x2bba53e2
+ 0x1d415096 0xbbba9e95 0x6f16ee63 0x609517ed
+ 0xd2bc2b95 0x0ef9e1c3 0xf4d4c78b 0xe80f7dfa
+ 0xea9a2522 0x86154997 0x8c271ab3 0x607af865
+ 0x82a33550 0xde348c29 0x72414485 0x332d1fcd
+ 0x4f3bda6f 0x60d7bb1b 0x37591f18 0x3bb8a79c
+ 0x34df8a48 0xfd353ce8 0x9b2cc1b5 0x64849bc8
+ 0x42cb559d 0xbc1d0578 0x3807691b 0xfb80da40
+ 0x6224c0b5 0x2504790c 0x9ac5d31b 0x162a24fa
+ 0x4b242775 0xe67afa85 0xf3f6f5f8 0x619aefb7
+ 0xad5a1909 0xbe9cfeab 0xb19e8ff7 0x1778c7cc
+ 0x9b72f14e 0x5a232673 0xccfa7f0e 0xcedfa0c2
+ 0xa53b8a1c 0x0507bfe2 0x006a7e79 0x55e1a874
+ 0x2c6f2145 0x302f5ed2 0xf8eb1829 0xe9113acf
+ 0x7ed4acf6 0x8d120045 0x83d7777f 0x18806b1d
+ 0xe39cbc73 0x0e458dc4 0xd1dc4355 0xa917f91f
+ 0x06bd5adf 0x6700644c 0xfafedd5d 0x68597623
+ 0x85998d31 0xf0fde105 0xbb59f732 0xfa90c9a5
+ 0x77fd2cd7 0x58fac067 0xd1b0c8b4 0x477377ac
+ 0x077d7a62 0x2ef1f7b4 0x5aec6414 0xaf19d978
+ 0x78d46a78 0xfa173873 0x3181df8c 0xbb8d5af7
+ 0x561d830a 0x45e3c2ab 0xc729929c 0x3705eda5
+ 0x38a1ba3d 0xfceaeaa7 0xd9df7473 0x09129efd
+ 0x51d1c610 0x61287d3e 0x466b1c40 0xfafa9019
+ 0xba016f71 0x93f0fd44 0xf5f6dc97 0xfdbb8fa9
+ 0x869f225a 0xf375e880 0xcf69a3ff 0x4e6dd47c
+ 0x8b50ad80 0x76c6393c 0xc79c197a 0xf07f7fe9
+ 0xd5f7def2 0x9753c9c4 0x583359a7 0xed786492
+ 0x29c5ae36 0xffc244d5 0xbc59624c 0xe5272a4c
+ 0x9cf42a99 0x47ef2f4f 0x26ffd2ab 0x20ed6804
+ 0x6162d8f7 0xb5b41cbe 0xddbe5795 0xafa94d09
+ 0x2a98c884 0x36a36cfd 0x4f3d1939 0x83310078
+ 0x86defdfe 0xc6aa6db2 0x1fe02291 0x6a7ccc2b
+ 0x31b28d66 0x50be72aa 0x511dd793 0x65aed937
+ 0x1c0f78fa 0x955f24b6 0x182ae927 0x341c2a39
+ 0x1684910a 0xfba7553c 0x7e684210 0x466c4bb9
+ 0x776df978 0xe20a9283 0x1d59ccb0 0x12cdeb81
+ 0x07ed0938 0x90ae4179 0xcd380d07 0x203b2f9b
+ 0xae16b51f 0xc35acff4 0xcdacfed1 0x93690501
+ 0x1ddcac8e 0x28508191 0x7cf2dbce 0xed9da43f
+ 0x927b0860 0x91ccd0e6 0x0bf7dfe1 0xdc7d9ba0
+ 0x79a68763 0x9ef7572a 0x06165514 0x5799b51f
+ 0x633c76ba 0x9dd549bc 0x71ec2b95 0xff02fec3
+ 0xef70992f 0x837f108a 0x6c2145b2 0xcbd64dc3
+ 0x1c76ad74 0x0ec92535 0x3f44281d 0xe7906f31
+ 0x8f58019e 0x6f563cb0 0x2b02143e 0x0dc40ea6
+ 0xf46b09e7 0x8594fc54 0x9db830e2 0x6689da9b
+ 0x5d1729e4 0xe621d473 0x8f8829f8 0x1712d3a5
+ 0x8c5032d4 0xb36b8a2b 0xa08173a8 0xc719ca8a
+ 0x7437c799 0x08e991fd 0x22bdaa06 0x2d91e2f5
+ 0x85e1d68a 0xa610f97d 0x651efa62 0x346116e1
+ 0x78fa57e7 0x60a80baa 0xcc94cd1c 0xffdc8330
+ 0x669a8391 0x4c49cf5f 0xa28ec5b1 0x59d01240
+ 0x7b508f7a 0xcccfc915 0x306ac46c 0xbcb39059
+ 0xe90411da 0x505fb85b 0x66354da9 0x956c672b
+ 0xe2bc6473 0xd5a8ca2c 0x4e15c962 0x30b76eb2
+ 0x5df03137 0xe8fbd420 0x867bac76 0x209ec951
+ 0xd4c709a2 0xd865c07e 0x23e244d2 0xb3b45618
+ 0x5b02b3f8 0x292f0be8 0x67e5681d 0xe9002734
+ 0x650021dd 0xc596ea6e 0x300d4231 0xe6df79a1
+ 0x3412adea 0x64e19360 0x19e70926 0xe912da63
+ 0xbfa60dac 0xe194a62b 0x818fecbc 0x2209d4f5
+ 0x56072a4f 0x8ac44d25 0xb2a6f22c 0xd9a720cd
+ 0x0c7d37fd 0x28edcb42 0xfcbce7a7 0x31c5300d
+ 0x7b7a16ef 0x987e720d 0x4c226bd6 0x8dcebb8c
+ 0xeb01942e 0xa1eb5733 0xf888063d 0x4528ec12
+ 0xe5085215 0x1dd01b03 0x6eb87865 0x5f8e7363
+ 0x37035578 0x3fa2dba3 0x7ed02de4 0x01d3fc19
+ 0xc6a841d0 0xe656cc11 0xddfe564c 0x97af79f9
+ 0x2edb1cf9 0x8f5fb166 0x8bb807e4 0xac601010
+ 0x3b465d78 0x33ae7ec5 0x9b669db5 0xe3ef2d8c
+ 0xfaf2eec2 0xfcb39916 0xabe03aa5 0xa145f2fa
+ 0xdf35974b 0x73be668d 0x79a5ebc1 0xa53d89a0
+ 0x754988d4 0x687f673d 0x7a479719 0xda3b853d
+ 0x68f03ecc 0x6e6b0e44 0x740ed419 0x8fa9de3f
+ 0x4ff58f61 0x8a5cf063 0xb0226c8b 0x8a9cfb91
+ 0x5c9e6a52 0x75b6ad55 0x3f2c089a 0xdb7b23ca
+ 0x68844595 0x258c4964 0x6253c527 0xe3e6b34d
+ 0x5daa8920 0x849ccc19 0xa17fe037 0x700b8a74
+ 0xb4eabdfb 0x73b1dcba 0xa349bd25 0x57de9e42
+ 0xf1909e9e 0x95885ef3 0x9d395f5f 0xa38e326d
+ 0xca3f1ec3 0xf3708445 0x64de4b31 0x9cc93d9e
+ 0xfb69603a 0xd987080f 0xb8baa0f0 0xec3f33ee
+ 0xdfd52d67 0xedba3a6d 0x2a4f8cab 0x6e2dbeea
+ 0x12d24ed2 0x098bb00b 0xbb7f66d3 0xac78a277
+ 0x78018918 0xc582c790 0x4d3ef0d0 0xb46bc302
+ 0x2a70e09e 0xd0f7b22c 0x33ba2cbb 0x8b712476
+ 0x321d99a5 0x49891850 0x3d95aebd 0xcbb8ad7a
+ 0x1fc7cfef 0x30b0af9c 0x3670cfb0 0xbdbc245d
+ 0x2fa63a41 0xaaf27d47 0xdbb39c6b 0xd77f37c3
+ 0x0e07267a 0x5d3d8758 0xb49ad992 0xdb66d32f
+ 0x48e3d291 0x3a05086b 0x5917ca45 0xb6bf4644
+ 0x977d7e89 0xd8b7e404 0x7bd674c9 0x422ffff3
+ 0xdb431079 0x461eb2d1 0xb62f4fb2 0xf83f1852
+ 0x62c1af99 0xcb254f3e 0x801148b8 0xa98845a4
+ 0xa8838d10 0xd18389e9 0x64f0a8d5 0x456b72d2
+ 0x3cb4db66 0xb478700d 0x40133906 0x01477df4
+ 0x99714186 0x82b0f95f 0xfb59e846 0x780a0734
+ 0x0ab15793 0x5c7054f0 0xa88d1048 0xf038bc7a
+ 0x6c79d43c 0x70f1dec3 0xf6c18788 0xd9071d93
+ 0x02ec302e 0xe1102ac2 0x48f7f323 0xa8ac18f9
+ 0xe580dcf5 0x8d3adc67 0x419577d6 0xa2b2cd7c
+ 0xb8564eca 0xde3975cf 0xefd084b6 0x7a3fcf92
+ 0x93bb391a 0xa283dde8 0xef590884 0xd1322fce
+ 0xc9af1c92 0x5677501d 0xabe661c3 0x77faf3cc
+ 0xb63fa4f3 0x72eb0ce8 0x0e7364f3 0x474a4498
+ 0x1c33fa72 0x7caf20e0 0xa06d582c 0x5d730c23
+ 0xa853bf9f 0x89d46b32 0x95032652 0x82bee6b9
+ 0x71dfd466 0xc2f1475a 0xee3b8ae9 0xa4b97940
+ 0x745369c8 0x848c968b 0x80b11fe7 0x9640d4bb
+ 0xccb129ba 0xcd0ef642 0xb418253c 0x91b51140
+ 0xddb1eade 0x4a9d5b6c 0x0f655c9d 0x9cf66310
+ 0xad184851 0x811264e7 0xeb80b2d3 0xdc9400a5
+ 0x5c0be6fc 0x4f4c3128 0xf1478880 0x0aa6d75d
+ 0xaae40d65 0x1283ae73 0x93eb915f 0x17739d76
+ 0xd2bc76c4 0xc4c80b26 0x5c491d34 0x885b5d22
+ 0xe2bf7486 0xcec80dbb 0xb8fd71c4 0xeaa133d0
+ 0xb44306af 0x975bb919 0x9add2d65 0x6de21027
+ 0xbcd9c28a 0x74aec7f9 0x75f6bb9c 0x5ca8ffa1
+ 0x9189bc76 0x22e7f05c 0x14f56912 0x72ccf25e
+ 0xd2067b68 0x3d1f11aa 0x4717271a 0xd9d5d193
+ 0x3e2fe4cb 0x3bb466ab 0x9965fa51 0x172edc9b
+ 0xdade7440 0x0f6a748b 0x993413f0 0x0c1812d3
+ 0xc02cd79e 0x1f791c39 0xe189ef04 0xeb61e49f
+ 0x0ba3d9b0 0xa776a292 0x371aae0c 0x0250cd7c
+ 0xf41758e4 0x8b8ef384 0x71b28bec 0x620e9b36
+ 0x120ac178 0x6f8a854f 0x1471a913 0xa069fc61
+ 0x9c4513b5 0x7c776851 0x1aca6979 0x8d31f3b6
+ 0xf254b3e2 0xab44b76e 0x0112ff65 0x40eaa69d
+ 0xea0a2ed1 0xefcb2a4b 0xaebb74bc 0xfbc17af5
+ 0x03b74d58 0x3995bd99 0xe9f8ae4c 0xa0b5884c
+ 0xea69fe56 0x58edbf35 0xd0eea61a 0x2ad90dba
+ 0x118e2310 0x07218c60 0x8280e78b 0xe2afb938
+ 0x6bd3d541 0x0d305da7 0xc846e977 0x7aba7e7e
+ 0xcd4f2676 0x9292007c 0x739e4f6b 0x1e8d3ac1
+ 0xd42503ab 0x15f01dc9 0x572a6c4c 0x66535cd6
+ 0xcf9ce218 0x7dafcfe3 0xfb21c85a 0x85374429
+ 0x85307f2b 0xe1358f44 0xa742f5ac 0x0c4c3c91
+ 0x9143061a 0x24657578 0x5028f7d2 0x1a388256
+ 0x78bb6dfe 0x2e6f427a 0x32b3debe 0x65c48f0d
+ 0x1ead8389 0xd7c29256 0x0af9ab7f 0x8e78121d
+ 0x6500ad8e 0x7a38798c 0xa785e9d2 0xd8b0487f
+ 0xf06af944 0x55599828 0x416fa4ea 0x4a2438a2
+ 0x92da4518 0xecf9cc97 0xa4c2102b 0x547005a4
+ 0xa812d78e 0x346ecff4 0xc62b5671 0xa40fbced
+ 0x9fd7d46c 0x4dd8d8db 0x20baae36 0xd80ef524
+ 0x3a2454aa 0xdaaa7d0f 0xd2ecaa28 0xa20628ee
+ 0x30267d78 0x575d527d 0x747fe51e 0xa4842d47
+ 0x31b71ee5 0xf8f23f34 0x35f963fc 0x8f9ceb93
+ 0x52473b8c 0x4774804f 0xff4e9655 0xb5bbc63f
+ 0xadff0741 0xc07b443c 0xebe1961f 0xf9598ca5
+ 0x42352c37 0x369ac508 0x8d822d15 0x4d3e72b8
+ 0xfbfab060 0x62cbec96 0x5bdd24a2 0xa7a199cc
+ 0x738d6954 0x0eab5c0e 0x556e3147 0x7da855d4
+ 0xf253d1d8 0x9e69b00e 0x8753ce4b 0x162218c3
+ 0x533ddb08 0x1ee47916 0x37d4be4a 0x9752b0c8
+ 0x5c287bec 0x6d6b42eb 0xb8e72496 0x85caad93
+ 0x77191373 0xc54b5b9a 0x415c96b6 0xc5bbe4c0
+ 0x0751c53b 0xb352d2fd 0xf00bc102 0xcd84f522
+ 0x8447660c 0x62c3103b 0x27f36752 0x31b0e45a
+ 0xe4cd3555 0x90904327 0x88f68b9d 0xaa342e7a
+ 0xdbb54fa3 0xb871056a 0x3c4519a8 0x7953beeb
+ 0xf36e2f4d 0xd1a82d4d 0xbc028565 0xd5720d91
+ 0xdaaa9362 0xadea675b 0x9d07c8f6 0x9ae45c5b
+ 0xa3cbe112 0xf7d58045 0xca9b35d5 0x8f5bf9c7
+ 0x40bc3c9a 0xfedbc773 0xc916d4bf 0x7de7c9c9
+ 0xe398edc1 0x33339071 0xd8d088a5 0x34cedc7f
+ 0xe693824e 0x664ac04b 0xd3d86f85 0x8495e903
+ 0x0b7820b1 0x93cd84d4 0x73850311 0x6cc916c6
+ 0xb6b39ac7 0xf3abca13 0x3d01cd83 0x3a235796
+ 0xc4ecde4a 0x8954413b 0x1223b62b 0x4117c02f
+ 0xf4440a54 0xbd8c4c26 0x4422eddd 0x0dfe468c
+ 0xaa2ac23a 0x776747e8 0x31cc43d0 0xff1bc38d
+ 0xf7aa3359 0x90a68203 0xba162ac5 0xe5fb1d70
+ 0x0d7fa055 0x7d230950 0x0e555bea 0xf2c8e634
+ 0xce03f163 0x9841b4e6 0x55893013 0x56bf9792
+ 0xd62c89b2 0xf1b4447b 0x53ff76f4 0x39f94c2e
+ 0xe90cb414 0x22af74cd 0x5222553d 0x706afb99
+ 0x86b32a7a 0x83b54903 0x972d00e8 0x08a8cc23
+ 0x0e0b5dd7 0x4a23c583 0x777758d5 0x6b33509d
+ 0x915bf8b1 0xa818c224 0x5b38ac0d 0x1d3917fe
+ 0xf305d3fb 0x5c8a2f21 0xc3d42f61 0xaaa6a53d
+ 0xb7fef5a3 0x3aa1d7dd 0x8e93db45 0x221d653c
+ 0x12697f37 0x0e0b1e1e 0x48154723 0xac62a1e0
+ 0x019fe7a1 0x36cd456b 0xf2ca6528 0x040f4928
+ 0x6770a838 0x60a12ecb 0x548560ef 0xe31cef90
+ 0xdaffb967 0xc12d714b 0xca9e5b33 0x22944355
+ 0x09e705af 0x2d1b7a0a 0x9097cd6e 0xb2e9bfe7
+ 0xd640dbf7 0x14a44e97 0xb54347f1 0xa7a3e4e3
+ 0x08cb77b8 0xb53e473f 0xf803036a 0xddd720de
+ 0x85e5b1d3 0x321c8b53 0xf9a645ec 0xc19fc693
+ 0xd181890e 0xac6e6a5b 0x028b1f6e 0x718bf5ff
+ 0x2068c47d 0xea1ee003 0x24e5e6ff 0x0395ce67
+ 0x501472e3 0xcdbcaea8 0x7143f0c4 0x963473f1
+ 0xc2d32a61 0x25b77183 0x926f7391 0xc1b9bec2
+ 0x235ecbfe 0xce2bfd3f 0xf94c3482 0x7556dba4
+ 0x20b958fb 0x7696cbba 0xbdfffd80 0x931d15a7
+ 0x27899680 0x8843c47a 0x9b8bbe63 0x63d2844f
+ 0xb2c965af 0xd8bed411 0x5251f3ce 0xcc9a2b98
+ 0x333624f4 0x674b8921 0x630d672c 0x3c211d4c
+ 0xd3651499 0x5b6102f6 0x71de73cc 0x62cb38ac
+ 0x0b8ef96d 0x7c211efb 0x462d7fe4 0xfa427451
+ 0x3f0793b0 0xef1d32b1 0x75a6c7a4 0xb6d312d2
+ 0x8882bdc4 0x4cb44a2b 0x6c2dcc86 0xba3bee30
+ 0xe49d8fcf 0x6a6f6e85 0x4bad2807 0x0a90f701
+ 0x3bf0d0ef 0xf39c2c70 0x24c13f7b 0x32f91421
+ 0xdd86a8e5 0x5bd98912 0x296192b6 0x0a3161e6
+ 0x6c4bb90c 0x09074da3 0x844f7a00 0x43ea9d82
+ 0x261918ba 0x90a25580 0x427ea834 0x0a9b2df4
+ 0xcae515eb 0x86909d3b 0xd09ec51a 0xa437a800
+ 0xb3e2c472 0x1fffbee0 0xc287d852 0x90e69648
+ 0xed4af77a 0xc7863fae 0x09ccbc07 0x1e0dae50
+ 0x4dfdb2ee 0x63c8bfbc 0x6e3c4be2 0x0eba65bd
+ 0x2d3020f1 0x4185d9cf 0xfd307d41 0x38f281de
+ 0x3f52929a 0x45e7fc34 0x41b70485 0x46994292
+ 0x616183d0 0x4e97cdf4 0xcb0d3573 0x88ab95f8
+ 0x580d3343 0x2d899c19 0x934c2c83 0x996eb67c
+ 0x93af7041 0x76eff4ae 0x306bf9f6 0xf0583bbc
+ 0x2950854a 0x8cb6985d 0x0dbbaa35 0x94752d5a
+ 0xa960b2a2 0x99e7eeaf 0x04103312 0xc86ce32b
+ 0xd7328adc 0x455cb9ec 0x9c3a8b8b 0xb9570f3a
+ 0xb44e6dff 0x63a0e324 0x08ff5a24 0xfebbd317
+ 0x4d2d2250 0x35ba9a14 0x7f036830 0x0b5b47a6
+ 0x15613fcb 0x77773e65 0x13dd43a3 0x17dbf143
+ 0xddde6126 0x5e5eb3f8 0x4c227240 0x741246b4
+ 0x433fb072 0xbb816f4a 0xc2aadc5d 0xe099a124
+ 0xccbb1ae3 0xf6925d81 0x05bf98e3 0xe85ada2d
+ 0xb9d3cbb4 0xce98bffc 0xff1345ca 0x7c911c00
+ 0xcca8a7e7 0xf1bddf15 0x909e4cff 0xcf9e807e
+ 0x5158e784 0x1d277247 0xd04da5e2 0xf273e0cf
+ 0x7807707f 0xddc68a60 0xd19ce0a3 0xbff8416b
+ 0x1d8b4b63 0x7c0973f0 0x686fe206 0xd341d352
+ 0x1357f0cc 0x65b8ec3d 0xaf10451e 0x65792664
+ 0x6a2e7fd0 0x30e52919 0xd3d8334a 0xaa126b88
+ 0x03618083 0x66861d88 0xc9a6f447 0xa38f931c
+ 0xb6c81114 0x05ba6529 0xfc24abd6 0xcf965251
+ 0x3f2d6d3f 0x899d7122 0xa267e82e 0x86bc523c
+ 0xdc287579 0x41323ce6 0x8674328b 0xde39514b
+ 0xb73080ee 0x46db8f86 0x236d455f 0x948e8b31
+ 0xc617f609 0x8407e4d8 0x58898c23 0xaa0fee77
+ 0xe208a647 0xfe93943d 0x6142bee3 0xa5ee20ba
+ 0xba71945a 0x5d1319c3 0x2cde8323 0xddff5e23
+ 0x2938e99b 0x57781e69 0x65f18537 0x59d3813c
+ 0x612dcc67 0x8221186a 0x74346a0f 0xf9b5e8b2
+ 0x51a8a89f 0x3f719660 0x27e0a4ad 0xe1f53c48
+ 0x75071497 0xd89258c6 0x5df36dae 0xb088d1fc
+ 0x617d59d9 0xf6b02c55 0xf481cf7c 0x930ec40c
+ 0x840d9d72 0x324d28f2 0x866396ed 0x8c7008f3
+ 0xbe6562c5 0x6541389d 0x29032124 0x4a4b1bfb
+ 0x939ab296 0xaa3420db 0x51586947 0xc8080583
+ 0x74a53a76 0x3969c752 0xc316993a 0xc1865a5a
+ 0x4e2dff5c 0xd9e640b3 0x8afd0055 0x2df0df5b
+ 0x50399e64 0xbda466e8 0xd393eba2 0x64501f82
+ 0xb2170330 0x6905ca9c 0x9545875b 0x2a716bf4
+ 0x3d84fb86 0xfc6eb3fa 0xa3f19240 0x3fa1b1aa
+ 0x38a26342 0x36cc1a64 0xa9ea4a6f 0xfe1221f1
+ 0x0d2c0874 0xd039600f 0x4733ee63 0x779b9d0f
+ 0x1f6d5ba1 0xadce4232 0x7ef1d927 0xc7f50ab9
+ 0x1803224e 0x735ad0ca 0xf90ce6ee 0x43fafcd2
+ 0x5d18f867 0x8baede71 0x06b19914 0x4a2afb9c
+ 0x4361cbfc 0xe4fe48ab 0x2a30bb42 0x8d1793e9
+ 0xd2d2272e 0x93a2495b 0x30c3aa6d 0xf61d2d61
+ 0x9d03a325 0x1212f8ae 0x04d3d802 0xcdf17fb4
+ 0x1a2c3f53 0x631e5918 0xdd5da4ad 0x2049edd5
+ 0x4cf33d66 0x69fe3c6a 0x09fb25ea 0x14038f9c
+ 0xf35f8fc6 0xae85bf48 0x4f66dcdd 0x36a38ef4
+ 0xda7f166f 0x7a480d5e 0x2ee96e00 0x62aeacd6
+ 0x7db7afc1 0xef452e08 0x35fc1947 0x267c71c2
+ 0x32cd85cc 0x47fa693c 0x1c4451cf 0x69aa65f8
+ 0x892bc9f7 0x0ef79729 0x7341568f 0x0b097c7e
+ 0xba49383f 0x971c9a86 0xf087b5b8 0xd6633391
+ 0x13ae6f8b 0x4ac59d4c 0x3bf66d77 0x2c44ef5c
+ 0x46affdff 0x5d31ca59 0xb839227c 0xf17d0ab2
+ 0x61828055 0xe8627dba 0x86741273 0x3ce25788
+ 0xf93b9718 0xf607e235 0xc81960b0 0x09c83c2b
+ 0xa6dd7a55 0xbb442bc7 0x40996c51 0x79618023
+ 0x3baeb067 0x016145c6 0x35c74dd4 0x87eb8f72
+ 0x2533565b 0x6c677920 0xe98959b0 0x740600ce
+ 0xd3276f05 0x9cb59940 0x48206ccb 0x42d91f21
+ 0xd3fad546 0x2fd7bd71 0x4d0ceb21 0x2cf4bdb9
+ 0x49b7eb2c 0x1491b3d2 0x1d32a4aa 0xed8eddfc
+ 0xc46a4109 0x0ff7904a 0xa3fa1477 0x4b541901
+ 0x6d17d28e 0xc9f5e6ec 0x550f9aa9 0x5be73ffd
+ 0x527aa7a8 0x3dec2fbc 0x06f4e253 0x280c4970
+ 0x5b252fc0 0x28c7a99e 0x6be0ade3 0xc912fb59
+ 0x6df2b558 0x1e7115ee 0x0d3674d0 0x73982cb9
+ 0xd5130d14 0x95d2eb94 0x90e824c3 0xae63dd69
+ 0xdc1cc2f6 0x6f625222 0xb56650dc 0xa0804801
+ 0x83de64cf 0x300ee3a5 0xe61d6b08 0x8af407be
+ 0x2e3b5458 0x13d5d61c 0x96b97c27 0x3ff2b138
+ 0xf55f15fb 0x05367ca9 0x2dfe48d3 0xd475a775
+ 0x8adcddf6 0x08a87984 0xb9d8db95 0x4c64dc69
+ 0x7678e5c4 0x3f787436 0xe77f3c9c 0x51ead76b
+ 0x08a0a17c 0x38c26de9 0x393f7667 0x019e26fa
+ 0xdc18902e 0x8464c93c 0x9b2159d6 0x7bc83716
+ 0x02473747 0x22760f8f 0xba56250a 0x69d8b7f9
+ 0xcaef54f8 0x3ab04f04 0xb5d69ead 0xb557222c
+ 0x89d7407e 0xa2023064 0x9b12df4a 0x6e6e6282
+ 0x1e2c01a8 0x1f32ecc2 0x15b8d009 0xbcce68dc
+ 0xa73b44b5 0x67c5fa56 0x77b9a68e 0xdb309031
+ 0x89fd86c9 0xb5cf0533 0xb9767bc4 0x13706941
+ 0x6a371170 0x75c6b2d8 0x1a793e9e 0xa384a62b
+ 0xf2f10dc9 0x443d44f5 0xe50121d7 0x91427c16
+ 0xce395518 0x319a79a2 0x2f4ddc05 0x03e6038b
+ 0x84c351ad 0xdb75f333 0x16fe4d23 0xe069473e
+ 0xec11fee7 0xa6fbaa35 0x95562e11 0x00073ff6
+ 0x3a9cdaa4 0x5dddbdd4 0x6e811efb 0x245067f3
+ 0x2175c41d 0x1a2c9570 0xcfdcac6a 0x6d7f4003
+ 0x756539d9 0x286e393f 0x7296856c 0x0298c64e
+ 0x40583fe6 0xf56c48cb 0x79906451 0x69878ad7
+ 0xc89360d8 0xf41521a1 0x5468606b 0xf2ac0952
+ 0x05c2aaf8 0x0c281f8a 0x926d08d5 0x66500ebf
+ 0x8766c806 0x44940d66 0x24598745 0x2c751d18
+ 0xa1295019 0x2f5a4797 0x8f74a4a1 0x1d8f0938
+ 0x79cf29c9 0x6ed43a8b 0xa39f1716 0xef8d551d
+ 0x20396951 0x96b039cd 0x73c90ee0 0x3be74718
+ 0x3c6d6915 0x0d2bae34 0x115a48ce 0x7ae08b90
+ 0x75333b3d 0x2b1f77c4 0xaa2b4e8c 0x01771e17
+ 0xbdb3b763 0x53490c21 0xc413efe8 0x77eaef46
+ 0xbf241246 0x68b80f5a 0x68daeca9 0xda0d8421
+ 0x4d93cff8 0x8312ba53 0x59d221d7 0xdd9f993e
+ 0xe153d55a 0x5465c8a3 0x512cf45e 0x09817be4
+ 0xd9180ad3 0x3878720c 0x63cf7022 0xcf9a9000
+ 0xede3792e 0x09047d82 0x86a35e16 0x6a51c408
+ 0x99b14cfe 0x798b41c8 0x1014c9dd 0x99437aee
+ 0x43a41b04 0xc417b87e 0xe58fb27c 0x732b2e2d
+ 0x5d181e1e 0x69614981 0xdcdb6d12 0x4c2c4094
+ 0x2c134d4e 0x757b0752 0x14c8337a 0x8a63b65b
+ 0x767b11f1 0xe4597e9f 0x8d2f8046 0x5c71a95c
+ 0x07d458c5 0xfa490cac 0x19ad3653 0x38ebb812
+ 0x879f6091 0xa4b06da4 0x97d530ac 0x493cef7a
+ 0x34472438 0x2f7bc03c 0x7a0e971c 0x4de4c4da
+ 0x722567a1 0xeefaa9dd 0x0ff4289f 0x78ee158e
+ 0xb74dc660 0xe43d44cc 0x37fdf8ac 0xf0aa80cb
+ 0xc9bc302b 0x62bc2b14 0xe05400d1 0x50d9b3d1
+ 0xb2fa1a08 0x3319310e 0x1423ed01 0x9d21ffc8
+ 0x96b302f5 0x44e14bbe 0x48139d6f 0x00469f63
+ 0x1fc9e79a 0xe53dfe55 0x6e5fd22f 0xba9db817
+ 0xf06bd8fb 0x368e5fe3 0x57e1d023 0xbf2b7331
+ 0xe645dbb6 0xc3e9e1e4 0x33d992b5 0x71820083
+ 0x141a3f11 0x75bf460e 0xaf3940fe 0xba6a1b70
+ 0x1904207a 0xb9a59626 0x01c0e10a 0x3c799256
+ 0xe2f0a070 0xe49873c9 0x043f19a6 0xea15fa4c
+ 0x3914389c 0x5759106c 0xe8ef98ce 0xd48114b8
+ 0x998a8829 0xe2526434 0xc00f2cce 0x2077cbf7
+ 0xf44b9744 0x69693d18 0xb16a0880 0xf1fdd3f3
+ 0x32c3f731 0xa499472e 0x67dc721c 0x1d798259
+ 0x48d7a406 0xb8ccc13c 0x2ef181bf 0xb8ae2873
+ 0x47eded1d 0x29165bd0 0xd018f6a0 0x370fe96b
+ 0x9aeba42e 0xc070e6fb 0x7a65c9d1 0x4787b944
+ 0x873dd192 0x42c37903 0x12e9769a 0xe2678bab
+ 0xa6e3929b 0x265c037b 0xd7261fe0 0xbb6c295b
+ 0x9b833704 0xb2355808 0x5d56f79e 0x79f654a4
+ 0xcc125216 0x01908561 0x9b320df4 0x548c4f88
+ 0x7110e20e 0x0517f94d 0x03c2d0c8 0xba351956
+ 0x4275f6ed 0xe9c9d940 0xd680828e 0xef4d4fc8
+ 0xb0b32bd2 0xc6ccafd8 0xf696004a 0x4fdd7879
+ 0xfeb1fcb0 0x9385422b 0x3c2b9dd9 0x8cf18b07
+ 0x62748860 0x5bcb9e8c 0x899a2937 0xf9f501ae
+ 0x186eb5a0 0x959a3714 0xa400f6e3 0x5c27eab4
+ 0x50b42e84 0x51a7121d 0x94ea1f42 0x083edb1b
+ 0x9aa9ffcb 0x4d93db79 0x5a50e2cd 0xdad2b9aa
+ 0xdfc1993d 0xac0ef252 0x3ebea017 0xde8adcf4
+ 0xb83bb50e 0x8be07c3e 0x43e22441 0x2e4ffe0f
+ 0xacaea888 0xa96b1ae3 0x29b05f78 0xda38c661
+ 0x9e1c1c98 0x3be89982 0x686eeb2f 0x52ac0e93
+ 0xc13ef398 0xf6114090 0x72d74a13 0x0e4c5162
+ 0x412e4801 0x5664bb09 0xab8eff3e 0xb29a5ee1
+ 0xca4a0709 0x0c20eebe 0xbd266fc0 0x15ca28da
+ 0x80a96d8c 0xfef90527 0xaaa85e1a 0xcc457c17
+ 0x25dc38b8 0x8ce9769f 0xbf255314 0xc8400177
+ 0x089fa961 0xbd232721 0x53ca8254 0x5469aad2
+ 0x0bf328e3 0xfbc9cff3 0x9cbd2560 0x59083d00
+ 0x263b476c 0x2034b217 0x7b1b96df 0x71e2b5b5
+ 0x739b6488 0xf868f2ce 0xb4c2e558 0x2363c171
+ 0x66d12327 0x48055332 0x247b62c7 0xb9e86728
+ 0x71797ee9 0x9233b437 0xfdbab962 0x226ebe50
+ 0x3c646aae 0xccc66200 0xe2279855 0x54bd9796
+ 0xbc41d857 0x19b80e89 0x6d69a007 0x41e31450
+ 0x72688b6c 0xdb1d95f4 0xd3de621b 0xfae7e454
+ 0xc82d6c6e 0xd3a34aab 0x8d31bf7d 0x1e1baae7
+ 0xe554cea4 0xc1fe98b5 0x43e83432 0xb393a1f2
+ 0xff64dd99 0x0a798857 0x4d9508eb 0x6d5e520a
+ 0x5c028b0b 0x846461aa 0xd9d910ff 0xdc45a169
+ 0xfd6c7b05 0x39dfe286 0x48fea115 0xda5c22a3
+ 0x06df1f67 0x295c426b 0x2f57643a 0xab317e96
+ 0x5a97e35c 0xc35c99ea 0x616daed6 0x4a5a7e5b
+ 0x86db9179 0x2e31bebf 0x67c1bfd4 0xab70ad35
+ 0xc23d6e89 0xb86cd4af 0x96f15490 0xb4926f42
+ 0xd8eb2b04 0x36865b27 0x1bebc0a3 0xd320bb6a
+ 0xdb3d99ca 0x67f1eac7 0xf00cbfd9 0x88ff5de1
+ 0x9d6761b4 0x58c9665b 0xcf208f37 0x2e72850a
+ 0x75d6a311 0x1d9f6cbf 0x1ff2c8b7 0x0ac4974b
+ 0x9ffddb15 0x844da134 0x4385f83d 0xef3d5636
+ 0x1c46e418 0x282b5a69 0x33c19be1 0xbea4ca0c
+ 0x3430e6da 0x27bd1cbd 0x24f53db7 0xe7de5573
+ 0xb9df0cc8 0xd3608acf 0x3461d906 0xb98954e1
+ 0x4d17c0d3 0x6ff05d1f 0x4ffbd387 0xcc418845
+ 0x52691ea6 0x9fc82771 0xa0d4fe96 0xb246d371
+ 0x0c925598 0xd4f9c6e5 0x089c436d 0x462488b4
+ 0xc66bf983 0x80710b31 0xdcdd92ee 0x9b23344e
+ 0x893534fc 0x9b0958b2 0x2d972b53 0xc903891b
+ 0x5d3fa8f2 0xfad9f3da 0x025fceb2 0x0936f5c9
+ 0x22c60c28 0x022cbb55 0xbf64b03e 0xa2741a40
+ 0xc39839c1 0x689957f9 0x55016547 0x980be48c
+ 0x32f79347 0xc3b007c6 0x14b02b4d 0xaa7abdef
+ 0xbeef96bc 0xcac44a9e 0xd189581e 0x64c1678a
+ 0x842f7725 0x899ecd96 0xe6bd35af 0x9ff16743
+ 0xf9810444 0x937d2dcb 0xeef3745c 0x463d697d
+ 0xa9177296 0x922606ad 0xc589e4e6 0x7fce85f5
+ 0x0e282c9c 0x45772b2f 0x4f9e4ad1 0x1d8c18d3
+ 0xf6b7cecf 0x39f252a5 0x7a6517a9 0x43b531a7
+ 0xa1b70c15 0x4890149d 0xb77b41c6 0xc6273a81
+ 0x31fee2e3 0x5574b062 0x9030ac68 0x08be1c87
+ 0x7a28470c 0xb5d77506 0xbeb246aa 0x4ccfb5e2
+ 0x73cc0f3a 0x061ba338 0xb02c2910 0xd2cb7dc6
+ 0xb5fcb59c 0xfffb7494 0xcc1fb080 0x038da62a
+ 0x6f1e9c33 0x10c160b2 0xf92f9e46 0xe88e325c
+ 0x707a443c 0x4483717c 0x1bc3a65f 0x9cd36553
+ 0x0dce8fa5 0x6949cd99 0x27764ea5 0xf9aedd67
+ 0x3cf14fc5 0x4e7b2b8a 0x1648e477 0xe9ab5d58
+ 0x9a01ef8a 0xe4bb6451 0x4826c42e 0x429e43b9
+ 0x9ea26a2b 0x2a04324b 0x1b52a414 0x7b0e6263
+ 0xbdbaa603 0x6de2bd68 0x6e3f1ec1 0x58c33715
+ 0x125f33ef 0xb71d200f 0xd16aa410 0x2556e9e0
+ 0xc195b12b 0x8cc60255 0xae797629 0xabfc8c32
+ 0x3eb521a6 0x92e7c9c1 0xe2448157 0x9f6f8a7f
+ 0x731eb492 0x2712ae7d 0x89609926 0x0687a6a2
+ 0xe7f628c3 0x4f65157c 0x7d7b305d 0x841d3626
+ 0x391c386c 0x3e3a9d1f 0xabcd68c6 0xfd0cd231
+ 0x39c1e3db 0xfada45e3 0xd5b6d1aa 0x18fe646c
+ 0xf742a96d 0x74d26ac6 0x8467351c 0xafef9c1c
+ 0x7ff9d24f 0x51b28bf5 0x239ec2ac 0x648bd90e
+ 0x184f5241 0xd5173b0c 0x99f9e0e4 0x2ef7a3c2
+ 0x4631836f 0xe363f943 0x4daac20e 0x7e332266
+ 0x34474b72 0xfee7f6cd 0xa861b458 0x2b390bc5
+ 0xf33c2713 0x58bac7ab 0xfa560247 0x4444434a
+ 0xd183c11a 0x8b397b13 0x5f42ef20 0x5a7bb80d
+ 0x535492f8 0x1e3c479d 0x22af7d02 0x9ced1d00
+ 0x20509deb 0x287059b3 0xbf620a20 0xda7d4d23
+ 0xb628f464 0xb205b5de 0x3df7d96e 0x05a1d1d8
+ 0x68881dbe 0xb2f37cb8 0x3542778e 0x866b8e2e
+ 0x3d3c6243 0xfdbb75fd 0x398aa395 0x065b5e04
+ 0xbb8517b6 0xd9b51782 0x99bac363 0xf3166a18
+ 0x7c7fccca 0x1dc86d20 0xc7ca3c16 0xa328650f
+ 0x5ae266c7 0x893f5e21 0xf5b33e6d 0x42d75218
+ 0x7f70aec1 0xbdbf56a4 0xdca9dee3 0xaca87462
+ 0xab03ee81 0x9cb3170e 0xd047dc9a 0xf1a33dc2
+ 0x765ed8ef 0xbe7db712 0x8d24efc4 0x4f94db8f
+ 0x8e9054cd 0x5f130d0a 0x393884c3 0x9fa1aba2
+ 0x5d208022 0xff5dd2ab 0x10f2ff7b 0x031b14d9
+ 0xc42ecf87 0x9d8c51c5 0x93c53e6a 0xd950dc97
+ 0xca85f453 0x9e6167df 0x3d4b38e4 0x25334dc4
+ 0x7b2def4d 0xd88dd7ba 0xbc4c0164 0x1f8a45ab
+ 0xf2849ce8 0xb4afb52b 0x6994aa4f 0xa48811a6
+ 0xe59c8535 0x98e0459d 0x96baf624 0x49ef84f0
+ 0xc729f178 0x9690406e 0x91d494c3 0x7ad4b29d
+ 0x957735a3 0x44ff4c6c 0xa64673ba 0xf20e8b54
+ 0x62ae6437 0x3b8a767d 0x7187a2c8 0x5322dd0a
+ 0x2ed99b7e 0xb43e8e63 0x29abb7e7 0x41fc0edf
+ 0x62312c07 0xb310bbb5 0x8ebcab75 0xce246520
+ 0x38a3fcd5 0x2f9f0fb7 0xbc26a8b4 0xf1e90186
+ 0xb15c7de2 0x1178ab54 0xd5f76c38 0xe971da6d
+ 0x13556df7 0x61ce53a4 0x5b6c0704 0x2bae03c1
+ 0xe82fa850 0x8a6ab6fa 0x0ed05fc1 0x835927ac
+ 0x3849db78 0xcff4dfde 0x9804cd75 0x697f18a2
+ 0xbe604bef 0xc202738c 0xf2e8a4a5 0x8b6361d5
+ 0x0469300a 0xf89bf5c0 0xa9fdc209 0x2439fc79
+ 0xbda566aa 0x6b02ebf4 0x7daaeeca 0x5e845429
+ 0x79a52787 0x76c18921 0xf2157580 0x0e51c37a
+ 0x34f1e505 0xbef79b43 0x60f589c6 0x31d9e178
+ 0x66d77003 0xe2596de7 0x324531b5 0x9b08836b
+ 0x29d7b288 0xd66a8661 0xf99bf376 0x830d4e97
+ 0x43d19589 0x501f49ed 0x282a1103 0x6fc3f1e2
+ 0x17000117 0xd423646f 0xfd6d45d4 0x7c5eeb84
+ 0xc478e828 0xf8cbe08d 0x7cd41d18 0x74987bb3
+ 0x351c2305 0x703e9a90 0xda95a103 0x4675977b
+ 0x964c6719 0xc83f01a6 0xdf5816df 0x0711073d
+ 0xad788488 0xa2bef75c 0xd1bc3134 0x31e1ae80
+ 0xe47cd8dc 0xd6e997ac 0xbc64037b 0x6b693af3
+ 0x3e28d3f5 0xaa60b35a 0x6ddf3034 0x89cafc81
+ 0xeee00cf9 0x35298933 0x8b85e3ae 0x4e1ed6ad
+ 0x95c9a627 0x4cc27068 0x8c9a4667 0xab9984f2
+ 0x1be75381 0xea018e83 0xde3e9771 0xbd91f6b6
+ 0xc1ca440b 0x8384a0ce 0x531c3ee1 0x42d9a41c
+ 0x21cf18ec 0xba39f43f 0x9c6189e1 0x77134ca0
+ 0x1c6c9d89 0xea999a2b 0xdbdb0bb3 0x8f90e331
+ 0xbcac15df 0xa5e1ce4c 0x41872886 0xa134dc47
+ 0xe7b2e5fe 0xa60ea19b 0x0c242c64 0x1ee241cb
+ 0xe357a99e 0x4f169427 0xeeef270a 0x0a97b188
+ 0xe901a495 0xce68f434 0x87412b2b 0xb2797d07
+ 0x8453a00c 0xdf6a4506 0xb69b478a 0x760e3aeb
+ 0x6a450b2c 0xf29ce4d0 0x33b9b409 0x59dfb002
+ 0xa1885e8b 0x114c2cd6 0x4946c941 0x6aef1d0f
+ 0x09f2eb78 0x0230e56a 0x14fa9652 0x71ceac31
+ 0xf149957e 0x0c7fc978 0x3c4de046 0xcfaf111f
+ 0x8e806a58 0x90f589d7 0xadc9cfd5 0x76c98405
+ 0x45267b7a 0xf23080ed 0xfee4b22d 0x235c9d68
+ 0x61cddf25 0x94b24dbf 0x707b12de 0x039ddadd
+ 0x6d8ced8c 0x74a9aa61 0x55bd5d4b 0x0001267d
+ 0xc6bd2165 0xa8580393 0xa21380af 0x86f57fac
+ 0xdf225e98 0xed4a8bde 0x278ba930 0xdb0eb6f9
+ 0xd546baa4 0xa0d0eddf 0x3700d0ea 0x8623fbf0
+ 0xb5de4159 0xcd987abd 0xcdbb7d42 0xda51a7d7
+ 0xa2ed5b76 0x7fa8d049 0x0ff9cfb6 0xfe741c53
+ 0xe67ca66d 0xf87c80d6 0x0e338d5f 0x2816ab54
+ 0x9bb5111e 0x5908c471 0xc929d548 0x2e09a3b9
+ 0xcf996e71 0xb3feb32c 0xa6a3ded8 0xf1de159e
+ 0x8e7912c2 0x9117ea62 0x8a2bc677 0x62019360
+ 0x0a37c87a 0x68f7d20b 0xb20a6392 0x08dfd29e
+ 0xd1754a6f 0xf4e9b799 0xe8cb4097 0xea12996f
+ 0x4ee6b302 0x6b2222ed 0xc48f1def 0xae0ec530
+ 0x3f7dd4c3 0x9c0c89ff 0x10e5a030 0x3a7fe7d5
+ 0x591a1887 0xb896a6d4 0x5eebe287 0xcc6a2931
+ 0xf93a3d12 0xfd0c973a 0xd3ed2395 0x8856712e
+ 0x2dd3d153 0x71604f81 0x6d43dcae 0xfbd5a60a
+ 0xd3642cf8 0xcef67e72 0xf92679c5 0x5978a0df
+ 0x31e52d4c 0x2c99afd3 0xae5508e4 0xd80a2026
+ 0x9f8c2e26 0xca5678b0 0xd4457ed3 0x40eacefb
+ 0x30159f2e 0x787719fe 0x77bd38ae 0xc0c959b3
+ 0xa8fcdf83 0xeb2f35a0 0x12c3679f 0x0e6cdb49
+ 0xf4c2c1b2 0xec3cc30f 0x15393130 0x28666bfe
+ 0xb0280fb4 0x5e731016 0x87fc6fd6 0xd6ed815c
+ 0x5102dc55 0x01d1457f 0x42c20f03 0xc97c799f
+ 0x0898c8a8 0x236c74ab 0x59007c31 0x8671d1e6
+ 0x687d10c2 0x90596194 0x88737c04 0x6ba246ec
+ 0x9fd21a96 0xb31a0e22 0x06760d52 0x46376c4c
+ 0xd0377d10 0x27f327a6 0x7172371d 0x3278d768
+ 0xd5e4a4aa 0x9496b184 0xe1598e55 0x79b81601
+ 0x5e6504f7 0x65953db2 0x827e535b 0x2a9845b0
+ 0x0ebd585d 0x34fda4d3 0x9aa5f56d 0xc604a643
+ 0x04667d2e 0xdfaa3144 0x8b697070 0x1071b6e4
+ 0x59a62213 0x0aad9262 0xdd85a2c1 0xe78158c6
+ 0x5e597679 0xafc95247 0x8562ac76 0xbe724287
+ 0x95df26b1 0x631f95b8 0x4b273544 0xfe4c8205
+ 0xfcd0b2a3 0x6a648810 0xcd00fbc0 0x6d7ae7de
+ 0xc55dc711 0xd2c54140 0x7205328d 0x61149749
+ 0xa18ca6cb 0x465cd12e 0x4256c600 0x78e3994c
+ 0xa08f0d5e 0xeadfda4b 0x4144bef7 0xc2bbe8c8
+ 0xf9727a45 0x45aaff8c 0xdf55ff6a 0x1679e624
+ 0x08a0a4c9 0x3d850fe9 0x935371e3 0x4c8ee65a
+ 0x87489f22 0x922bc4d5 0x2a79234d 0xd3f4b9bc
+ 0x0428dc1e 0x0b56cf51 0x832be5e6 0xbebc05c6
+ 0x46a0229f 0xc096889e 0xc1eb7dbd 0x60583e8a
+ 0xbc916869 0x84f334dd 0xd1cd949a 0xd0b60e81
+ 0x14dc9282 0xc3260066 0x6bca5262 0xed65da4b
+ 0xf4afac17 0x20d3708e 0xd570d02a 0x0a5c4624
+ 0x458553e3 0x080670bb 0xaac9fe22 0x29635d29
+ 0x984543c4 0xaa46fab8 0x88f51422 0x7b0c922b
+ 0xe03f8571 0x253065be 0x7eae75ea 0xe0ad3531
+ 0x6e39a2d2 0x5e20398d 0x44c6eca8 0x5a99ce6c
+ 0x4bf0652a 0x1d87158f 0x5fa6ee5a 0x0d1ecef1
+ 0x9aeac19d 0x1291e54f 0x4ef5e8fe 0x201568c2
+ 0xac928887 0xdb213ab7 0xa5b23ca0 0x7aa36dc1
+ 0x9f459a01 0x6925051f 0x51166d69 0x17391074
+ 0x5f4dac0c 0x3c65c5ed 0x82410dd3 0x11dc9554
+ 0xc2ff2440 0xd145f7aa 0x88c580dd 0x2d665fe5
+ 0x8b459149 0xa6a3d63c 0x8119542c 0xe4ea4830
+ 0xc943ee11 0x11c81007 0x8b192b2b 0xe111fadf
+ 0xbf24f2bd 0x85688f72 0x395060e6 0x9a6183c5
+ 0x8f2c9397 0x7428bd10 0x81fbcc32 0x95e477cf
+ 0x6f7aca36 0xbfb729be 0x5692929c 0x55fec4fb
+ 0x2b7238f6 0x745c622d 0x7c306fc7 0x3aae5f89
+ 0x527ee3c7 0x124adeaa 0x3ef2a62a 0xf3d1f3a1
+ 0x1e29a164 0xf2fd7fed 0x779f38d6 0x9d781240
+ 0xb114b838 0x5acfbd0a 0x603db973 0xdb26d966
+ 0x2bb6d838 0x38808300 0x9968a93d 0x2d3b7a2a
+ 0x0b87310b 0xe1075e16 0xf99fbda9 0x26c80868
+ 0x4b3a0e16 0x489a041d 0x93fe522e 0x2f3d9f35
+ 0x65fcac62 0x784a79cd 0xf659ee00 0xc7115cee
+ 0xddb43dba 0xf7417c81 0x18bb0b76 0x4a65ed21
+ 0xd449cf4c 0xadef0ca2 0x8df488bf 0xa45ed893
+ 0x786074f0 0x63c8c85b 0x9ba06767 0xf91d6c4c
+ 0x8c296e0b 0x3e713400 0xf08a1a8a 0x3f85bcb0
+ 0x13a9a240 0x4af2097c 0x31e8c19d 0x8a5632ac
+ 0x4a7f3a01 0x27b33fbd 0x3eb57a1f 0xc41a9f9e
+ 0xb02e9d8b 0x3cd5c551 0x344459d0 0x82208b42
+ 0x7b5080a8 0x7297da72 0xcf099c27 0x7e9d8f08
+ 0xff89d997 0xcf4aadd2 0xbca31063 0x6e776ddc
+ 0x86887a48 0xd1e14c52 0x477a5c1e 0xad4c813f
+ 0xee8ee579 0xac0ef345 0xa2ca0189 0x9f3d2890
+ 0x551d307a 0xbe1186ff 0x47ec9093 0x282a217f
+ 0xb69a904f 0xc039cb02 0x6275b24a 0x198e63d7
+ 0x581315e8 0xe06273a1 0x83435257 0xd88f5344
+ 0xd0c09528 0xbcfd89ac 0xd10aeaac 0x7f40cafd
+ 0x6ee9d7e2 0x71c661c6 0xf43585a7 0xe77b33a6
+ 0x6459076f 0xfaa6bdb6 0xc094c451 0xda9581d5
+ 0xc4fb8bbc 0x279b815e 0x2ad06a46 0x85f16193
+ 0x157e2cd9 0x60603d40 0xbfebba5e 0x8f5602aa
+ 0xa99b67c9 0xc14940a5 0x63e5b0b8 0xdade3f40
+ 0xfea0e352 0xa838d4ca 0xfd49f7d4 0x411e92b6
+ 0xa59ecabf 0x56f5cd99 0x38464815 0x134d4834
+ 0xac5b045c 0x313225de 0x09f9d422 0xf13b59ba
+ 0x90c6e2b1 0x033cc601 0x05212579 0x50650085
+ 0x3e1ed885 0xfb55cf1a 0x514c188f 0x862d6542
+ 0x87b0a8ca 0x0dbbe2bf 0x1f062bd5 0xb9db5921
+ 0xb3956060 0xe1011253 0x02ba0715 0xb712d976
+ 0xa56effba 0xecfea4cd 0x998a8fa2 0xbac2040c
+ 0x78f810cd 0xf49cdded 0x1b1ecbf9 0xa39324e8
+ 0xc9c9d170 0xdbdf031d 0xffa22fd2 0x228fb0f7
+ 0xdeebbdcd 0x2ab87788 0x7733aad7 0xa0903ccb
+ 0xdfbe960c 0x4fb66a32 0xc4116a1a 0xf6f6fcb8
+ 0x34607f80 0x3fa5d765 0xeeb7d3ee 0x9e82916d
+ 0xec558818 0x57c1b40e 0xbcd7b5ee 0x41284e1a
+ 0xe4fcffa0 0xbe6994b4 0x081bc597 0xbfd2ae67
+ 0xdd3d45a3 0x8597efb1 0x1e32ed7f 0x916a2b59
+ 0xd9bfea8d 0x817c52c9 0x8e69978f 0x3260c8e1
+ 0x2e68361b 0x77121ca5 0x379afc8d 0x566f84df
+ 0xd671bed4 0x963ebea5 0x9e13a13e 0x149226b1
+ 0x54dc3e91 0x9d9d88f9 0xecf40a88 0xd11588d1
+ 0xdf1ce683 0x0a4c034a 0x0c0288e0 0x95d27196
+ 0xb70fcddd 0x390c6608 0x932c30fe 0x1421b40b
+ 0x3e6a8f12 0x720c37b4 0x131f84b0 0x9366cee0
+ 0xbeb1e54e 0xcb87807c 0x6eb511cf 0x51327e74
+ 0x9a14428e 0x7f85f990 0x32b49454 0x35e54147
+ 0x56485202 0x6098b209 0x47adf064 0x56e6b38c
+ 0x248bc21f 0xb4fb0248 0xb119ecd1 0x4adc92f9
+ 0x14121b5e 0x7960a2c6 0x5becea6b 0x4ada0b2f
+ 0x1392c419 0xc867fe0a 0x6d0a0ea3 0xb1693186
+ 0xd5f8c08f 0x5aef27b1 0x0a4cc1cc 0xa908727a
+ 0x479c6cee 0x8a2166ec 0x5004c1ae 0x5be28a85
+ 0x58345dc2 0x582fab3b 0xeb588d86 0x5ded5c7b
+ 0x62de5ee4 0xde399717 0x7eb71367 0x6711ca46
+ 0x25a067f1 0x4189d51d 0x8136cfa8 0x3fb2a63b
+ 0xa93bd63b 0x31ded695 0x138b4c19 0x7b3e3321
+ 0x00f85c16 0x99c9ad46 0x9c61c855 0xb590bd91
+ 0x9fe86d17 0xda40a5e2 0x8d6d5468 0x13390dee
+ 0xf9e04dfb 0xc1081395 0x2b9764a3 0x2002f0b5
+ 0xb8fb1a86 0x3a17ac03 0x63adfa9e 0x56070ed8
+ 0x70913109 0x506154ec 0xfc97e231 0x14e97084
+ 0x847acb88 0xdda65a5d 0x8852793f 0x3340d3a0
+ 0x178d6cb5 0xf88a3a72 0x2bd6cc4e 0x627bcc10
+ 0x2d84b6fd 0x8a4e0d9a 0x79e1656c 0xd5688a96
+ 0x339bdf6d 0x4cd371fb 0x0be9c919 0x3edbfa5c
+ 0x3b9ff9e8 0xc011e66b 0xeb07abe0 0xd957cf0b
+ 0x4b9b59ed 0x185df1d1 0x5b359154 0x0eafe888
+ 0x7a9ec4e4 0xad73fb84 0xbe680eed 0xab6bb5e3
+ 0x2fe7f672 0x12917f24 0xdf2f06bf 0xf2f15066
+ 0x653d7392 0x448f4958 0xc57b3616 0x7554c753
+ 0x477f344d 0x53cb815e 0x92432979 0x995f7c5b
+ 0xd444613d 0xbfc375a0 0xa558b193 0xb9a04fa7
+ 0x5dc44f73 0xd2794e11 0x67afd4db 0x2f33a486
+ 0x9f494f9b 0x4dbd615d 0x51467f59 0x4f8ade7d
+ 0x7d690d61 0xfc4e4cf0 0xd445fa4f 0x52a1963c
+ 0x976ba746 0x031ea65b 0x5c510fc7 0x6a6ecb39
+ 0x07341321 0xb2231470 0xa8c53448 0x398e6423
+ 0xf6ad9f7d 0xa0960bef 0x9d10e113 0xe492c051
+ 0x1fdbad33 0x5b5a5221 0x81e84600 0xc3960bd9
+ 0x670b29f0 0x6dcf1584 0x902b6b4d 0xd8d57f9e
+ 0x350a633a 0x60a76401 0x0ad8d075 0x819237de
+ 0x51a49f68 0x2e731581 0x36466063 0xbb6e0ae2
+ 0x842c2b84 0xd55e6c15 0x76db4240 0xd532b2c2
+ 0x88ee2b09 0x960820a1 0x12c128f9 0x50eb2d48
+ 0xd0899ebe 0x9aab2e87 0x431c5f0f 0xf0ad6572
+ 0x170d8286 0x3141f694 0xc599df60 0x88c369fe
+ 0xb185106f 0x19ddbb39 0x05abf400 0xa8c6e8af
+ 0x5c7c37c7 0x538e2704 0x7ff774e5 0x2a525d31
+ 0x5e86c8e1 0x6f1cab4d 0x9432754a 0xb31e7345
+ 0xda8c0ebe 0xde1e8f4e 0x22b8a5c7 0x2d43845c
+ 0xbc44ff6e 0x5a6a9f74 0x9245eb1c 0x05cf9997
+ 0xd9e54326 0x93c04441 0x89b64c83 0xd3c9502c
+ 0x1d77b35c 0x20c37f3a 0xf5ec242a 0x594235ad
+ 0x62445010 0xd43e4b0f 0x9945420e 0xe8808c53
+ 0xc4ec3486 0xccac8e69 0x85b742d9 0x05d14091
+ 0xd35044b1 0xe71d1900 0x721d137e 0xdf0b24d6
+ 0xc75b8cde 0xf7228766 0x2787c27a 0xf6810632
+ 0x4d326f1b 0x8ea69f7c 0x7013ae81 0xec071128
+ 0xa2ce8886 0x527c6e4b 0x7b792611 0x992426ce
+ 0xaa8bf49b 0xde77f138 0x675dcb46 0x81df02b8
+ 0xee38dbd7 0x82699815 0xe8e97881 0xc3c7dfbc
+ 0x080bdcfa 0x57e97143 0x728e27c8 0x773a7186
+ 0x617b8e48 0xe3bbdd6e 0x8aa36f10 0x39b5b9d3
+ 0x43949cbc 0x18ced620 0x4cbd3a25 0x7413db27
+ 0xd8f38237 0x60d8f30c 0x96174aa1 0x9d6e3762
+ 0x45e86e75 0x9302858d 0x02929f0c 0xcee92d8b
+ 0xe444d794 0x1850664b 0xa6f133c7 0xcdb7228c
+ 0x5f7e1457 0x2e906b98 0x3669d3b7 0x96152f85
+ 0x68683995 0xead5a65e 0xa3097397 0xbea543f4
+ 0xe7bdb225 0x42af47cb 0x75391ced 0xb23e26aa
+ 0x631443b4 0x9682298b 0x68b78e0c 0xa5b0c501
+ 0x30f14a74 0x11b5b8cc 0x124cc79d 0x0755ece8
+ 0x694730a1 0x8edba746 0xecb345bc 0x15e6c073
+ 0xb682ceaa 0xe9bbd0e5 0x035f0b8f 0xaa0df5e3
+ 0x14f09fad 0xc4716593 0xf5dad2b5 0x9e10b4da
+ 0x4386da92 0x7f990a4b 0x3eae9576 0xd00677d7
+ 0xc1d62609 0x5a01f3ce 0x3b155993 0xbc8a7f57
+ 0x4c7682f7 0x99c0bbf6 0x8ed9484d 0x802ac94b
+ 0xa67555b4 0x2004f6d6 0xe2082653 0xf44548f1
+ 0x09ac6801 0x6dca2a9a 0x6e4cbab5 0x815c7887
+ 0xbd79cff4 0xd88bbed5 0xb2f01ea0 0x159847ca
+ 0x947e16eb 0xaf80fc20 0xc7628ccd 0x7a8ae02d
+ 0xbf0ce15f 0x1290de82 0xe81e202e 0xe7d8a3b4
+ 0x8b905ca3 0x26627404 0x3ae0ac3b 0x0c6073da
+ 0xc12450b0 0xcb79a7f0 0x8bd5ea61 0xfe47b334
+ 0x7cfd9de8 0x74c89bb6 0x71f383ec 0x8661ad30
+ 0xb4b63123 0xebc613b5 0x15fff519 0x442bb4d9
+ 0xad59c517 0xc7ab8e33 0x0cbc7901 0x41199274
+ 0x45f306cf 0x3ad61c62 0x9e912bf6 0x44114ad6
+ 0x191d1ec2 0x2eccc397 0x905b1a54 0x8d8919c6
+ 0x4e87bac9 0xabd4a7a2 0x5b6b3993 0x0f6f18ee
+ 0xa7fe213f 0xd74bcde6 0x3d3f0482 0xb85a10e0
+ 0xa0e0b08e 0x5e9ecece 0xc2930a83 0x7595604d
+ 0x1cec8002 0x84b4c720 0x3033d9e3 0xc3cd9b62
+ 0x56ee9e9a 0x58aad2dc 0x535ca0b1 0xf5eef580
+ 0x280e12e4 0x1cf53a6b 0x4b63d5e5 0xfea73389
+ 0xe8aa9aac 0x29bdcb44 0xb408cc52 0xf1385801
+ 0x0de3b337 0xae8fd591 0x32f6469f 0x077d0b03
+ 0x5103a792 0xe6c861fe 0x5647e012 0x70ccc977
+ 0xcf32790e 0xf7fadf72 0x3770019e 0xb02dddda
+ 0xdda4f5e6 0x0b0d5e4b 0x26843a72 0x47ee4965
+ 0x1603077e 0xcc06f743 0x4d7748df 0x31c908ad
+ 0x3c19b991 0xb490ff50 0xacf9b2ba 0x37205591
+ 0x55db532c 0x75813338 0x5eb0a0c3 0x5f3e45e1
+ 0xd0d2ed2a 0x66886d7c 0x41e716e6 0xf3507079
+ 0xe734772e 0xe39dd270 0x4fcc1c4a 0xa957f121
+ 0x4ba2c853 0xf4570af9 0x52424fa8 0x95ca0993
+ 0x0f905db2 0xee96d160 0x85b6b8a2 0x8b1301b1
+ 0xecffef26 0xe1b87fb4 0x968bea1b 0xdad2c510
+ 0xd175726b 0x34a828d8 0x8310584b 0xdfca6d9a
+ 0x3b73628d 0x49fae2bc 0x55550fe1 0xa3a7df7f
+ 0x51210aea 0x6aa351cd 0x7b0f31f3 0xe1256629
+ 0x6669d296 0x50552e01 0xfc9593be 0xae90a4a3
+ 0x86225932 0x5fbe2f37 0x5befb997 0xd2f71acf
+ 0x2bc86954 0x60246751 0x727c9ac9 0x3ddb54ba
+ 0x80941a52 0x40a3a81c 0xca3000f4 0x9baf3d5e
+ 0x773bb476 0x023572b8 0x2e84af85 0xf666f7ba
+ 0x1743896b 0x073930d9 0x004acd2a 0x717d9896
+ 0x7d354494 0x999a492e 0x8eb4bbc3 0xf4b5d775
+ 0xc6e70e22 0xad2cfeca 0xa6cf04b1 0x8f9bc1f2
+ 0x09ba4743 0xc00425cb 0xfc02322d 0x5bc27d0e
+ 0xc77103ee 0xe12f5df9 0xa805e67e 0xc2b05c95
+ 0xb6cf2316 0x3ca44583 0x5fae6582 0x01129109
+ 0x2fb7b0ea 0x5b5a180a 0x9f94d616 0x90671f22
+ 0xd84c534e 0x14815deb 0x222b7be5 0xe4fb51ed
+ 0x73511682 0x752efee0 0x61ffb0c6 0x892412a4
+ 0xa20138e7 0x769f4a0c 0xc56a3237 0x72f5249d
+ 0xeb04b59d 0x6d286aba 0x53f9fe15 0xc0505c34
+ 0xc99cd600 0xdd3e61c8 0xaf3366e8 0x47ce1fe7
+ 0x068546a2 0x0bd4e6e9 0x0ff92967 0xc7e87eca
+ 0x65bfde25 0xe3692b7f 0xacbc4d7e 0xf0d81fa2
+ 0x2943a25b 0xce0feb3b 0x0b4d2f35 0x1ce4f67e
+ 0x297478ea 0xe4df25c4 0xc38fd905 0x7cc95c7e
+ 0xb430cdd7 0x1e3438da 0xf2ad2634 0x36e68548
+ 0x04b5db72 0x8792e32f 0xf54a6f45 0x2af52be7
+ 0x3c023453 0x2dd259c3 0xb2a684a1 0xd7c3c833
+ 0xfd471eb1 0x8fbf3928 0x4a5c71f2 0x4f2d58fa
+ 0xa024508e 0xb36d7589 0x6d553d5f 0x33181e8e
+ 0xc8b0fb4f 0x85ba3b03 0xbc209589 0xdb081c6f
+ 0x34d215c0 0x08be5c71 0xc1e0292e 0x76836c13
+ 0x2ddbaae1 0x5df4c244 0xec448d6c 0xf7c641b2
+ 0x2a5e53fd 0x66112ece 0x8da6d580 0x856de3d3
+ 0x6c1e473f 0xbfc60f19 0x2f144016 0xf6c55199
+ 0xe89642fd 0x6777f35a 0x5d1acb6b 0x6691b481
+ 0x528dd544 0x1411f2a2 0x2adcae8f 0x8c740190
+ 0xc6773d78 0xee996a7f 0x96d58502 0x72bd466b
+ 0x9cc4335f 0x0203bea8 0x1885d52f 0xdad7b494
+ 0x60b41e2c 0x3312c32b 0xbe2908fb 0xf69f2dd2
+ 0x484f658f 0xe48093d1 0xba75cd97 0x7e657376
+ 0xf1c92b0b 0x2be471eb 0x24f62fff 0xb99282ca
+ 0x3d7b5783 0x2513d204 0xea884d02 0x458f0cf1
+ 0x7e40f424 0x658a7a85 0x581b11ac 0x5bb5fc34
+ 0x1fcd272f 0xaa3972d6 0x9a1f8079 0xc59af67f
+ 0x7a827fc2 0xf472c0a1 0x84914900 0x3fd551c8
+ 0xa38a1f95 0x860a3b77 0xd00b08ad 0x08e5277d
+ 0x7a8c26ea 0x47b0a735 0xa1e99cd1 0xce1bc648
+ 0xbe1c41d4 0x66f6d2d4 0x4275938f 0x2fee7589
+ 0x707be4d1 0xaee4bd13 0x24c6345c 0xdbc54f29
+ 0x7efecbc4 0x0bf2230d 0xbb8cb923 0x27d2cdb2
+ 0x5e2a0541 0x35ab1727 0x98875039 0x35438620
+ 0xaa9c49ab 0x426114b9 0x84c40696 0x3cb66935
+ 0x431c4fd8 0x588f2dbb 0x092a0fcd 0x548185ae
+ 0xf23eb2b0 0x188b6f02 0xe9651fb2 0x1d0f74f0
+ 0xfc7f570b 0x180f1646 0x9f718a58 0x7401d5f7
+ 0x0aff98a9 0x4eaccf59 0xbca42e90 0x35d321db
+ 0x594b693c 0x818d9a17 0xbded7192 0xa9c1ea87
+ 0xd47e9a1d 0x9beea5ee 0x4e2fee03 0xc166ad28
+ 0xe55fc422 0x93a14122 0x010d35d4 0xe781c8cf
+ 0xc4aa6471 0xa8b96e7b 0x14dd565d 0x2dd9a026
+ 0x22d8075d 0x876a7c93 0x83694f2b 0x06c7eff1
+ 0x24acb7bb 0x2deb19c1 0xd4ba9956 0x2e806677
+ 0xba566fe0 0x81cd6103 0x246f9f68 0xe6113763
+ 0x804aeb1a 0x2173e433 0xc505dce2 0xf9319b55
+ 0x41fca4ff 0xf0714f4a 0x1a15e070 0x5db9c70b
+ 0xf34db1c8 0x183d533a 0x3d6c0f22 0x0f76ca0b
+ 0xd9039430 0x62ac91f6 0x2499efa5 0xf4ff76a5
+ 0x858aab83 0x9e986655 0x1cc8ff10 0xe8d4ce19
+ 0x0d8e2de3 0xa6cfcf48 0x181df14e 0x89a52eb4
+ 0x6816adb9 0xa2b66717 0x41b0fa96 0xfbe1edb7
+ 0xad668573 0x6d67820e 0x91cbf5ab 0xd1b9fc33
+ 0xeb331d5d 0xcf7628a3 0xfee9a9b8 0x66ab2d8a
+ 0xb672b6cd 0xad58e906 0xb4a39452 0x6f92f95f
+ 0x6cdb843a 0x56401c71 0x19f4aee9 0x57d76653
+ 0x5afa2e82 0x3ef7cdd8 0x296f5209 0xdecd3cdf
+ 0xc3951f94 0xe38326eb 0x25472f3c 0xbb5dce4c
+ 0x2ce8210c 0x9e5fc4aa 0x7f3fca3b 0xa5f17340
+ 0x44887cb4 0x8f5c6f26 0x55b54a21 0x988f1a27
+ 0x419be353 0xc535835b 0xfa904fc4 0x5de08b6a
+ 0xbcaeb6d9 0x705147a1 0xfb30755d 0x9fd7be17
+ 0x92724e90 0xbb3f29cf 0xc7ef74f8 0xfbc2c998
+ 0x71ad2c3c 0x87143833 0xa1187339 0xf660197f
+ 0xea84662b 0x67ea863b 0x70c34e51 0xcedb2bf6
+ 0x52cc9f7e 0x2ac9e77d 0x94eb7648 0xc8f6aaab
+ 0xef5186e7 0x3c4ceb87 0x2ca11ea4 0xd7c8540f
+ 0x4109e17a 0x45c3bd71 0x44554ebc 0x345ae1e6
+ 0xd8780f5a 0xc451138b 0x0bc2a7f4 0x6c412554
+ 0xa7fe4f95 0xe607cae1 0xda1d4ad4 0x6db5340f
+ 0xff64ebc4 0x55534be0 0x0bfc0c92 0x60601125
+ 0x95cb006b 0xe3be4649 0xa5e140f6 0x37fc9f93
+ 0xac38f0b9 0x0f6dad8b 0xe923c34a 0xb8ea4ad2
+ 0x6e654e52 0x2d08fc87 0x03cbb421 0xef78a443
+ 0x1b85fb58 0x7b3b36a9 0x18d7272f 0x28c34d93
+ 0x20383e57 0x27b58dd8 0xb551f954 0x55e1f411
+ 0xab483488 0x93e07e94 0x2e2a16fc 0x12d9e06a
+ 0x832c23c2 0x278cb7d5 0xb8e22e64 0x8394ef0e
+ 0x17ac0ceb 0x64931c52 0x077fe430 0x68002c2c
+ 0x27e18e68 0x45cc9e1f 0x4c49ec24 0x2980d740
+ 0x80a7c5c1 0x2b50eedb 0xbfd64ed9 0xf81983bd
+ 0xb678a219 0x1e5092b1 0x3dd6d628 0x19360275
+ 0x7de6641a 0xfa7cf7cb 0x98f62648 0xe688ae51
+ 0x018e7dc9 0x6a61f236 0x41f4b242 0xa495d0ef
+ 0xd4a94da6 0x106f1641 0x017cc5b7 0xe89f8bc0
+ 0x573153f1 0xc985e3ff 0xd0fdc851 0x7dc62089
+ 0xf8ea9ee2 0x9fe1ea26 0x8c54a7f1 0xcb8069c5
+ 0x54a86dbc 0xbf7a66e0 0x999c1285 0xaf2c2d4b
+ 0x0c6cf2b4 0xb4465271 0x846f28d6 0xeeded0f7
+ 0x6c43c6b0 0x703fdcbf 0x49c6db1a 0x78e69e7b
+ 0x542c298b 0x08b5b873 0xcf72235b 0xbdd9ae81
+ 0x69e1e6d3 0x5e9aaf66 0xece06ce0 0xcc525e97
+ 0x787f9a51 0x45121369 0x26147ba2 0xced126d6
+ 0x455777a9 0xb9064788 0x7ab26d13 0xb74a9aed
+ 0x82dd23f0 0x410eebbf 0x73cf78f7 0xf29953c7
+ 0x427b0421 0x2c6d40e1 0x546375ec 0xad8165ee
+ 0xb29484e0 0x96a2531e 0x46712333 0xebb63bf2
+ 0xa9823123 0x1b72caff 0x7947bef3 0x57051ad6
+ 0x3b936c87 0x80dacfc3 0x5ee40eac 0x0a229d01
+ 0x865767ff 0x8e12afa8 0x7b285d32 0x0ee31093
+ 0x3168bdd1 0xdd837dc4 0x58eacde3 0xc55084b3
+ 0x51ec771f 0x23006e9e 0x5c4c767b 0x908cd8ae
+ 0x722cadb0 0xcb9304b0 0xec60d811 0xcdae744e
+ 0x81cd4855 0x10ae6f5e 0xaefcea80 0x67f222bc
+ 0x30d0cc5b 0xbd1e2c25 0xd3b32426 0x43a2be34
+ 0xb002f12c 0xe9f73775 0xf5c9c2bf 0x739327c3
+ 0x2a7242e3 0x33bb27c4 0x2b7889c9 0xe342346a
+ 0x7acf80b8 0xda71648f 0xdb2cbd46 0xe16371a2
+ 0xede2cebc 0x7b589198 0x44e86d55 0x7bbffe83
+ 0xc83a3f65 0xcc901957 0x5ae5e6ca 0x23de3c09
+ 0x67aa277d 0xf1b63e69 0x85b99976 0x7a2ac4e7
+ 0x92b79fad 0x0d0a5277 0xddf4e562 0x46b66691
+ 0x6b1de610 0x263ca0b3 0xfb1e0f84 0x8f6fd83a
+ 0x6b3c2b45 0xe49ad81d 0x9885d8d4 0xf7746c4b
+ 0xfd84f3ab 0xc11a0bf4 0x4a828a3b 0x1e2e9b16
+ 0x1deba99a 0x18483669 0xb1e4f415 0x8ecfe51d
+ 0x3ecb9cc6 0x4e02175b 0x67e5c08f 0x6b5c6263
+ 0x8cebe442 0x8f3ff29f 0xb0813c4c 0x4bb7aaca
+ 0x1db39f19 0x9dd02910 0xe1f8a066 0xf7e56073
+ 0x6b86d18d 0xeb54eba8 0xeb0b8cab 0xeb7c9438
+ 0xe9a8c30e 0x7eb57257 0x53f8c8f8 0x4f9c89ef
+ 0x4443fc93 0x2813d51d 0xa58cf82f 0x75757120
+ 0xed4fee21 0x98eec7a9 0xeef67a47 0x3ae2111b
+ 0xbd391d55 0x67ca7ab7 0x404aff85 0x121f4671
+ 0xd8f6b365 0x36e7062e 0x215299f3 0xcf4fbef8
+ 0x1543e277 0xcb33df8a 0xda484268 0x9c494e61
+ 0x572d9b53 0x58abe627 0x7fe97f1f 0x028ca45b
+ 0x7c7dfacd 0xb51f1eaa 0x7e98a7ec 0xe832234c
+ 0x71deb341 0xc9e060f1 0xbe9f875c 0x354a853f
+ 0xf26b00ef 0xe6c87730 0x7eec122b 0xa9892426
+ 0x87918b08 0xc9946396 0x173115a1 0xf51ea146
+ 0x03b077ed 0x2a264d65 0xe01f4cc7 0x5e171457
+ 0xcbe5c3f7 0x95f6d140 0x326c8c47 0x9e6caae3
+ 0x18f5b4f6 0xdcd5c464 0x9eafb305 0x6e4c2aba
+ 0xc39392fb 0x57100051 0x2130483e 0xe08ba409
+ 0x7da42422 0xabafe0fb 0x9200f115 0x3e7322c0
+ 0x13e9fc90 0xe376444d 0xd68fa418 0x5583d5bc
+ 0xa852a3db 0x05197d2f 0x8345e9e2 0xc1f0982a
+ 0xebf67593 0x198eedd0 0xc8b5c671 0x85293c86
+ 0x0b50b9dc 0x31e2d510 0xb626cbd6 0xc83d16f1
+ 0x2c07b32e 0x4984ddf0 0xebb19417 0x817f99b3
+ 0xb4eafbe3 0xd0026855 0x6db93d14 0x009f298b
+ 0xd306be84 0x8abbe023 0x81b60efa 0x049be80a
+ 0x07401a52 0x4203bc93 0x0785562c 0xc01ab373
+ 0xd8da3195 0x28ecd4a4 0xfca10ada 0x17712048
+ 0x69553628 0xc7724f43 0x0dc923cd 0x172558d2
+ 0x752abeba 0x7bd7ffeb 0xc3ed6971 0xb0cf358b
+ 0x404d896b 0x4612dd1b 0xccaedd36 0x2638e06f
+ 0x928d3af3 0xc71eb9d9 0x023a73c3 0x8d103c49
+ 0x2d995e18 0xfa00c44e 0x44913889 0x0e876063
+ 0xb54f63b1 0x4d082825 0x89d834c5 0x0fe4a8d9
+ 0x0e85b58f 0x3f99f925 0x765883e5 0xbcc43dca
+ 0x4ee291f5 0x35b74dcf 0x027571f0 0xa0c5295a
+ 0x0c68069c 0xc7327b3c 0x4cc45fed 0x1f472e12
+ 0x2a63026b 0x4c4c17c1 0x9fa86708 0xe9c38a3c
+ 0xce8e9812 0x2b604fa5 0x38d5d1dc 0xe91846a5
+ 0x5747aed5 0x591f15ed 0x0fb619bb 0xd39f6bb5
+ 0xbc53e945 0xa02f3949 0x06b27e95 0xa23c46e7
+ 0x0d8362f8 0xfb6877fd 0x15c69e66 0x7b2933f5
+ 0x2bc45df5 0x1764196f 0xa8c55a88 0x37fded9b
+ 0xd6c3534c 0x36fe6a54 0x4badde31 0xd032c75a
+ 0xd8d2e57b 0x3c99cd0c 0x8d75e750 0x648d0106
+ 0x32a41039 0x254c1680 0x3b6fe699 0xcdabc95c
+ 0x46d47692 0xf4d969fe 0x84ba45b8 0x372f3232
+ 0xb3f9852c 0x924c3c28 0xf003b67b 0xee85c8b6
+ 0x8a2738ff 0xabca2de0 0x8da0f860 0xa9d95969
+ 0xedb3f8ee 0x554a358a 0x53528d45 0x31162b28
+ 0x0e50555e 0xcef1d0ae 0x5b805749 0x66bc69e1
+ 0xe368a0e2 0xed8c60c7 0xd2a2aa26 0x5e39e565
+ 0x397f03fd 0x07e64f11 0x9457fc30 0x9f265bdf
+ 0x19fcb18d 0x2fbd473b 0xf3b2ae8d 0xe86d9296
+ 0x1a317024 0xa27b86d4 0x6da73cab 0x914fb453
+ 0x3e5b9c14 0xf056ca1c 0x4e37c21b 0xc21bdc68
+ 0x8bd12ce3 0xada89078 0x8a0fc7f8 0x43892038
+ 0x18b3ead8 0x0311158a 0x6345ccfb 0x719030f1
+ 0x246dabe5 0xe1976ed3 0xc473da4e 0xf94d22cb
+ 0x9801bca4 0x4e4f1f9e 0xcd20b543 0x34d10800
+ 0xb62152d1 0x80b915a7 0x95c37fe9 0xebba8088
+ 0x87cd39ad 0x10f384ee 0xfd0e10ff 0x043ad9a0
+ 0x38ff5849 0x7e8f5a56 0x8b1de4c2 0x72c06d94
+ 0xcd6d4237 0xa8d5cac1 0xe1413995 0x76dd6ef5
+ 0x7d9d7bc4 0x5eb7b0bc 0x88b8af0f 0x46a2b10b
+ 0xb17d2429 0x95ec4595 0xae518994 0x3d7509f0
+ 0xe2aa249d 0x10740833 0x2b97c557 0x2c605939
+ 0x86f79340 0x1af2be26 0x540a70e9 0x1cbbeae6
+ 0x05a301f9 0xc88e12f1 0x1564fc42 0x68fb0e27
+ 0x2c7f4eb6 0x158883d5 0xd4dc1717 0x2cc658e5
+ 0x246c17f4 0x6a389e58 0x83c5343a 0x46db0cce
+ 0x4da840cb 0x97b918e5 0x285a067e 0xf243a6d9
+ 0xbc3af972 0x5b8edeb8 0xcd710e36 0x6ab486f4
+ 0x133fd0ab 0xd9e9a245 0x8779538c 0x3c0933f7
+ 0xc81841b1 0xaaaeea59 0x765f3fad 0xd8fbe536
+ 0x8176bd94 0x728bf97c 0x8e471350 0x513a44bf
+ 0x82353032 0xc20654ae 0x49ce3d85 0x64ee2518
+ 0xd5cfb23f 0xac189ee8 0xe1b9f468 0xb7a9ea8e
+ 0x877cf20d 0xc755983f 0xac51129a 0x7df719b3
+ 0x8a483f26 0xcfcaa3c8 0x5afa0ee5 0xa2c593aa
+ 0x4d2cdbe7 0xb5cd8283 0x7e4ff6a6 0x6e801a68
+ 0x980b13c1 0xe979630e 0x7f632d1f 0xbbf743b1
+ 0xcedab613 0x7677947c 0x734d3f1e 0x11ef770c
+ 0xf9da69c7 0x3b97ddd0 0x62b49df5 0x5a2acd51
+ 0x068cfa4b 0x198a348e 0xed809399 0x02b056e3
+ 0x5e9554c8 0x2512559d 0xb7b30621 0xe515c9c3
+ 0xf5648bd2 0xa31e6638 0xd5b42cae 0xb4b7bbce
+ 0xd2f350f0 0x98b99f9c 0xf7e24f3f 0xba8afae3
+ 0x657a798f 0x17ec9409 0x1c636dfb 0x7a3e3fe7
+ 0xa3eb6835 0x0a14b2b4 0x74a152fe 0x57fc6043
+ 0x3d17a5cb 0x31e650e0 0x356c3821 0xb38bdc0c
+ 0xf6b738ea 0xc412fbe5 0x39018b62 0xf1f14a7d
+ 0xb68bce4f 0xa4c5c887 0x2733400e 0xbd4e5111
+ 0xd41d010b 0x959850e7 0x426cc29b 0x79c53136
+ 0x281cd990 0xd0afa74e 0x9c74f6fe 0x59fcd65c
+ 0xfc580644 0xfa9a5fe5 0x597d59f5 0x5ce5a557
+ 0x75a46fa5 0x736b73ea 0x3e17ca48 0xfb87bbe5
+ 0xf28030c1 0x923a926e 0x2c175c37 0x798007e9
+ 0xae5599cd 0xaab93107 0x3001e588 0x7678c6c7
+ 0x153fd89d 0xd63c7bcb 0xd1960041 0x90c9e3f6
+ 0x45651ecf 0x0528e353 0x75581bda 0xf116c906
+ 0xc0051330 0xeb329e89 0xe6fecaae 0x2e45827d
+ 0xf3899797 0x0385fcde 0xe4d84770 0x0e7545c3
+ 0x5e873caf 0xc674aee3 0x62f2b5d6 0x84458ebf
+ 0x4c8fcc65 0x3db6dd6c 0x995d2eeb 0x25790fab
+ 0x581bf7c3 0x2ffca726 0x3dde038e 0x6cb21c71
+ 0xce236f54 0x21c1b5c9 0xd9bca960 0x77de5cb8
+ 0x3b836174 0x63055abd 0x698f1c45 0x92bdd9b8
+ 0xc0d92f66 0x35538d1a 0x2ac46829 0xc2f3e8b9
+ 0x733a7f24 0x7e21bf3e 0x8f67417a 0x058d5e78
+ 0x025f6fb8 0x71ac9975 0xeeca3bb2 0x422c52fb
+ 0x17b98771 0xb7ba7045 0xf57344d8 0x3aecb087
+ 0xcd245d35 0x69f94fac 0x72da3e1d 0x9f391828
+ 0x481a2454 0x73a39c2b 0xacbbec83 0x0cf4d2be
+ 0xc209b260 0x11f34b5f 0x3cf5159a 0xdefee9b5
+ 0xb900a60f 0x82f6341c 0x07b719f5 0xe2b1eef9
+ 0xeaa07132 0xd46a1746 0x7faad831 0x0ca7cf01
+ 0xe4e512c0 0x73663db9 0x0beeb604 0x5170a87b
+ 0x739f3a64 0x6527add0 0x6b05aad4 0xaf6a07ea
+ 0x9e5fc813 0xb80c957f 0x1509e086 0x1a652f9b
+ 0x83c4a31a 0x645479f3 0x271bdb57 0x5f04c0e4
+ 0x4bd8bd13 0x367ca8ad 0x1e1ada34 0x924e75a4
+ 0x135df414 0x8f326276 0xf5d23b38 0xd85902b3
+ 0xbd7a4ccf 0x12255ba2 0x09b164e5 0x1acdcaf5
+ 0xb753b78e 0x57ee136e 0x6ab95b37 0x2d3fe7bc
+ 0x368c8433 0x43c3d9fb 0x77a153ff 0xe835064e
+ 0xbfd8822e 0xc2d34f86 0x1c06b25e 0x32bdcb59
+ 0xb54691e1 0x665be085 0xa227ee6f 0x1e2a3563
+ 0x558fe4c9 0x4a11ebe6 0xd36046af 0x427329aa
+ 0x55155033 0x0c5ef912 0x9344a17f 0xb035f571
+ 0xf190b199 0x4daffefd 0x3b4ec3d9 0xfbb69438
+ 0x075eaedd 0x4dcd780b 0x82476d75 0x38a29a7b
+ 0xbd8b9199 0x28c97621 0x09f3bb4a 0x992b0120
+ 0x3ce53394 0xb81f6125 0xf24b8710 0xdb8c7e5d
+ 0xe66aa544 0x9e59db26 0x4bf601c1 0x6956438b
+ 0x7936284e 0x42c09dbc 0xb4286de2 0x3433fb38
+ 0xa65b462f 0xc453e362 0x38cf5031 0xcf2ddb81
+ 0x9a9b4d57 0xe5746cf8 0x15130f65 0xda1932a1
+ 0x00b830e2 0x250eef55 0xa066afb4 0xc1d32bdd
+ 0xb28c8daa 0xe60486ed 0x398f63d1 0xd8bf6630
+ 0xd784e9c3 0x0021aa08 0x34118453 0xb14561af
+ 0x41a6a25b 0x661e54b5 0xd919e480 0x2d006b11
+ 0xc58fc132 0x0f8c73c2 0x86b321e2 0x4ac8c451
+ 0xc5acfe6b 0x8a3ee820 0x96aafe6e 0x117fe9c5
+ 0xc53a77d7 0xe6289308 0x254d7010 0x10979262
+ 0xb0ca2fb3 0x9392e7f6 0xc3f7795b 0xdbc8e897
+ 0x66bc320c 0x46652a3b 0x51987bb6 0x0151620f
+ 0x479bd58b 0xb9831ae1 0x5e6758fa 0xe1db9a18
+ 0xe585362e 0xa214364f 0x79283b25 0xe41e5688
+ 0x449aff9d 0xa3748569 0x1ab77d53 0x423c1af7
+ 0x85a21770 0x717d72c9 0xc11a9d00 0x350c545a
+ 0xe7246cc8 0x591973dd 0x65c3c2c0 0xbb156877
+ 0x18b332ae 0x083b7792 0x7f5300ad 0xe2bc6462
+ 0x0ff80c64 0xe9cdffe3 0x81f5a179 0xc51b21e1
+ 0xba8cc80f 0x5528cce2 0x07af48a5 0x312e50a2
+ 0xb849b72b 0x6162eaba 0xb6d67046 0x8713a459
+ 0xefc571e2 0xaf1d17e8 0x7f5f4007 0xa6b689d8
+ 0x9524706a 0x3aebc3ce 0xdb8ade06 0x5af5b102
+ 0x7723648d 0x81a2fb99 0xc51abfaa 0x6276c2bc
+ 0x18f42359 0x4c2e0bb1 0x8a2e26fd 0x03ba8dde
+ 0x917479bc 0x4f23cc82 0x441501aa 0x47d16588
+ 0xe46bbb26 0x76cebde9 0x9d06c5ed 0x2fb19333
+ 0x74c314b3 0x6f70828e 0x1e747727 0x1c8b38b0
+ 0xad22a517 0xc2c306b3 0x9b0e8c1b 0x2a1b0cbf
+ 0x5ef93990 0xefd567a2 0x15d41c0a 0x3e759035
+ 0xf5bf6598 0x55ba183a 0x232bb2ee 0x7e2a518c
+ 0x2f55f023 0x29f9019f 0x4dcd1d87 0x66873fde
+ 0xa513b0d5 0xd2df839d 0x2e48a91a 0x88f5a4cd
+ 0xc1f41e63 0xe57c9470 0x2d54f4b7 0xadb6540b
+ 0xac93446a 0x0226acd8 0xa2852b58 0xe9b79d59
+ 0xc64035fc 0x0b1bcc74 0xbff993d4 0x31de54c2
+ 0xc34b2da3 0xd7500287 0x59cce868 0x4bfaf38f
+ 0xc3fdaff3 0xd1eeddb0 0x0579c161 0xeda22a64
+ 0x2a88d9a0 0x12b506c5 0xe496968e 0x55e6a7ee
+ 0x60fb7faf 0x96e9d3f9 0x59ff4cb6 0x2ff00e00
+ 0x8347f760 0x635a5b77 0x392dd6fc 0x8e633333
+ 0x5f951ca2 0xff656885 0x1c9d9178 0x27fdb652
+ 0x11c19001 0xb56c9db9 0x8f4d53ba 0xa14b6f68
+ 0x42e43f8c 0x29a84b0a 0x5dcc30c3 0x066c8304
+ 0xf049fdec 0xa9aeb741 0x47141e86 0x922e0d70
+ 0xa1e2af5d 0xa9ad9db3 0xcb0446ef 0xc097e87c
+ 0x929e5c1f 0x03cf9baa 0x19640d38 0x036b2ed2
+ 0x8a0468d5 0x6f38889e 0x9d836d46 0x6d460e63
+ 0x1a7e242a 0x81e1d569 0x26c0cc55 0xffaa2075
+ 0x2689857b 0x9c3123e1 0xde69b9ac 0x68678c56
+ 0x07c31945 0xbdcd09a8 0xb984128f 0x6b141f3f
+ 0x57e30d2e 0x77dbe7f2 0x4f43684e 0x28b0b495
+ 0x1f1b156b 0x03c1c0b5 0x24d5f20b 0x6677d692
+ 0xc68bba29 0xbace23ef 0xa0caea05 0x4a292b48
+ 0x54b28817 0x36711c31 0x8f43827b 0x9065cc31
+ 0x92ffc7dc 0xee4560da 0xeddf2c0a 0xf7e05169
+ 0xc8429620 0xe11ba6c6 0xec806b6b 0x0ad456bd
+ 0xcf3d955b 0xe064d178 0x7c81f9b0 0x369a2e98
+ 0xf946a8b3 0x26647955 0xb31e91be 0x22f79668
+ 0xcc8bcd27 0x33804fa0 0x054c3d3e 0xc65d1aa0
+ 0x8e8ebb9c 0x78e50c77 0x10a71e03 0x6f7eb5d7
+ 0x69fad4c0 0xe0c3d868 0xaaa27815 0xe787de22
+ 0xb28b0b72 0x140e140b 0x42350f96 0xb82dadb5
+ 0x63ed346b 0x5a53e8d5 0xd8e172db 0x15be3f66
+ 0x4efc8812 0x966a1085 0x8810f12a 0x5a9cc86e
+ 0x0f2101e1 0x4df822cb 0xe0e22c55 0x9b40ab87
+ 0xc185ea33 0x24da3227 0xbf6da297 0x7e85c299
+ 0x423d9723 0x82bf5a50 0x3f129df9 0xff71db6d
+ 0xdd9c61b7 0x6d61b223 0x5001f056 0x70def3cf
+ 0x9aa6b53f 0xa385409b 0x97a369b7 0x3aafcaa9
+ 0xc3ae08c3 0x74741a86 0xd08542bc 0xa8e6cad8
+ 0x4c9635be 0xabcebc1a 0x9cce5c40 0xded2f2c2
+ 0x71bb00df 0xb87228a6 0x29efc748 0x3723f6dd
+ 0xe772c299 0x1b1dfafd 0x8c13dd49 0x1779c8f3
+ 0x88743605 0x00eaa426 0x4295b019 0xd4227e8b
+ 0xe62da964 0x59c6c883 0xeda9b50e 0x0ab68434
+ 0x23f8dfc7 0xe52ca7e8 0x9fbc286b 0x80d2f140
+ 0x72b97700 0x15595da5 0xf8b17a11 0x35700095
+ 0x0748d3ef 0x048afd7f 0x1a79c6b7 0x22cfacda
+ 0xa64baaca 0xd7f134d4 0x22ec940a 0x8891592a
+ 0xa6a0ebfb 0x951ece3f 0x1bec1abd 0x18a9bc48
+ 0x6280d1b0 0xdf8f77df 0x3304a405 0x85dd1146
+ 0x5b9e51a2 0xa536471b 0xf2dd932c 0x59242994
+ 0x7ee5be81 0x28975f6b 0xf871ac4e 0xd68b0df4
+ 0xb6dd4ced 0xcf5c922a 0x79e744e9 0xd6aabebe
+ 0xd0a4eb03 0xe628ba02 0x2e640b6d 0xa3f74566
+ 0x3a87439b 0xb7620ec2 0xdf666f8c 0xdb402f56
+ 0xcb48744b 0x1e4c252c 0x0802b11c 0x307ef6d2
+ 0x7d6c35d6 0x094c0212 0x99a9505d 0xdde8e0b9
+ 0xd8a85e18 0x23d48407 0xe8fce481 0x57d2da6d
+ 0x189fb636 0x3bc4e436 0x64d1f5b3 0x873672e7
+ 0xeb0d163f 0x3e7699cb 0x77843424 0xb39cc2b8
+ 0x33b384fa 0x34c098b1 0x0dec103f 0x938175c3
+ 0x7a4fd9f5 0xe4fa138d 0x86e7945b 0xd6bc0b68
+ 0xa0384822 0x455c4e87 0xa30d7331 0xc55a986a
+ 0xa3fd77ba 0xf4ae89d2 0xf75c0de8 0xbcf4b02f
+ 0x1982c49b 0xa0895efe 0x4eb8b46a 0x8617cc9b
+ 0x7c77138f 0x4c734ec0 0xe80a006f 0xb42e0fd1
+ 0x612d5d62 0x6e3b28f7 0x128c5148 0xca9269c1
+ 0x54cf44b6 0x3ef8c71e 0x1902569e 0x47ac1243
+ 0xb59487c1 0x0a8bcd5c 0xe8376295 0xa185c2ed
+ 0xf48487a7 0xd2eb422c 0x60c8906b 0x85626bb5
+ 0x8aff9c01 0xeca98486 0x32642805 0x3dba00d1
+ 0x0f44b6e7 0x7f36d3e1 0x169159a5 0xc6f5f3d2
+ 0x70b2d883 0x30392544 0x89a1f11f 0xc4fe6666
+ 0xd7a644d1 0xc28c1925 0x3540c25d 0x83933376
+ 0x9564c63c 0xbc7e96bb 0xd9aed315 0xa627db55
+ 0x27b5dd12 0x9adf3a24 0xb8a31788 0xf1e1b75b
+ 0xb2d0f7c0 0xa11a109d 0x4bb6d538 0x65c11840
+ 0x69ea67d1 0xf39270bb 0x0b45559f 0x6237dad5
+ 0x6d584cc6 0xbbf3d720 0x3f06e546 0xfab204c5
+ 0xf60c2e78 0x2fd60875 0x414825d0 0x7de66f9c
+ 0x70296c29 0x3d3dc98b 0x4e780816 0xefedb2ab
+ 0xada68af4 0x1c0c4e2f 0xb1c5c088 0xddac785b
+ 0x006e46a2 0x91ea694b 0x23d17c88 0x9df9e192
+ 0xdacb38e3 0x6346671c 0x9c1063a7 0x52a0f4c5
+ 0xb7488fbc 0xe69b1d28 0x0b8be40f 0x7767cb3c
+ 0x4e53e5ea 0x88f93fd5 0xd289a3ae 0xd52b34d2
+ 0xc06a6abf 0x1f0d3393 0xfc697604 0xf8a9d142
+ 0x13456e9a 0x54fd7c2b 0x23e0d2c5 0xba20acb4
+ 0xb5d13f7e 0x51720fa1 0x7aa11a19 0xdb18b444
+ 0xd832d72b 0x82bd98c0 0xca345d75 0x8b53a7e1
+ 0xb78a9fc9 0x835c91b8 0xa721f269 0xb4228ada
+ 0x2a1332ef 0x9d2c3297 0x8ac605d5 0x101d0e3e
+ 0xc51da322 0xced12e70 0xfde53ead 0x1208f219
+ 0x0014ca96 0xddae88a9 0xaa157dff 0x3aa78eea
+ 0x98fee8f3 0xe6e0a663 0xe33427e7 0x9db0451c
+ 0xde9e1f4e 0xb1c81e9f 0x171ea5ee 0x289aa1bd
+ 0x3f02d9f0 0x1789641f 0x929c74e7 0xef4a720d
+ 0x75cecbd7 0x5d1bc327 0x9edb9707 0x93edf8b0
+ 0x906ddcb0 0x2d4ec3f8 0x2bb8019c 0x3a8fa6e0
+ 0xe9c95679 0x7938bfa2 0xd4377880 0x2b1fb187
+ 0x53105f1d 0x93e54541 0x15c293c0 0xc39f44d1
+ 0x4c022717 0x950d1bd6 0x809b4475 0x6fa53fa4
+ 0x574658ff 0xa047d562 0x1c991013 0x5f9908ae
+ 0xc31c56d6 0x53f51225 0x70d329c5 0x499fe938
+ 0xe3eba31a 0x3cf614df 0xe0565508 0xaa76d026
+ 0x68369afc 0x159a5063 0xfa9e8303 0x4989f72d
+ 0x697788fe 0xd44cf5e0 0xb787582f 0x9ae61831
+ 0xc13b900f 0x8682ad74 0xb8270369 0xff527834
+ 0x8075c909 0x4ab9fa91 0xfec8c247 0x2983dd9a
+ 0xaf5e88f7 0x31fa0dda 0x96a94e34 0x7cdb2fc7
+ 0x585d0f70 0x61959e38 0xb657af8b 0xe860a37c
+ 0x76efd5e7 0x75d4e4d0 0x09aad491 0x0f96d3d1
+ 0xc5362add 0x30db88ee 0x6505011c 0xed815b2f
+ 0xcd65a7be 0xff8c8933 0xf8e4dbae 0xb452c8b0
+ 0xba8c9650 0xfc4e4470 0xff434eff 0xeeff1c75
+ 0x3b572a54 0x6d299a57 0xa3f93ac8 0x81d7966f
+ 0xc3d0371f 0x45a67ec1 0x758b5c09 0xd6e9e0e0
+ 0x060ceb96 0xd9abe780 0x55aebdef 0xf8968395
+ 0xa7458357 0x40f928a3 0x839f1295 0x65c301da
+ 0xc29d0c27 0x12f440f1 0x501242b0 0x3d6901cc
+ 0x0f3763b1 0x9f8a13a2 0xf7d98cce 0x68bf2708
+ 0xbe8c6054 0x6a2887da 0xa89e2ab0 0xfddf5050
+ 0x7faa6323 0x45d441d7 0x5670f16f 0xc5f8ecc1
+ 0xfc055e8c 0xc9f823f0 0xf536c387 0x21cabfda
+ 0x1f48d7d8 0x42d8c548 0x0ae06ce7 0x40ee30ee
+ 0xb5f3c702 0xd15ccbe0 0xe1cc92a1 0x6432acb9
+ 0x269c6913 0xa1b410da 0x4c3dfa9f 0x6e188a15
+ 0x65fd9a6d 0x9ed8bc7a 0x3a56f184 0xe5235bf8
+ 0x13f0d45a 0x7c5e4c0b 0x7bee841c 0x05c8b28d
+ 0x1b073094 0x5bcf3dce 0x48b71861 0xdd507cfc
+ 0xc0a7ed57 0xb3d9d3a3 0x4a7bc06a 0x37cf37d5
+ 0x745b9217 0xc85943ce 0xd9d118bb 0xd199caa2
+ 0xa3cde3c2 0xb26acb43 0x3815bd9f 0x70b68e98
+ 0x350a0efe 0xb30f66d1 0xe0d6e822 0xc2133287
+ 0xa2488940 0x55dc3068 0xbcdacbe5 0xe650e03e
+ 0xcdc47780 0x886e5444 0xc4633856 0x3b5a9117
+ 0x862610ee 0x88f20b48 0x5c22e59a 0xf5b73c89
+ 0x8b2d1496 0xfdc285c1 0x6627f736 0x5cb4f02a
+ 0x9f2a3aed 0xd0d40bdc 0x6d860720 0x2c0cfd98
+ 0xf77e2507 0x7b5b71a2 0x43dddf53 0x8e1b9b95
+ 0x7bb26763 0xdd562c1e 0xb97f535e 0x0ff5a63d
+ 0x4b9143e5 0x03af7570 0x2a8cfddc 0xa641eca0
+ 0xa5e88d84 0x40bf55f9 0x43a44471 0x01a28153
+ 0x9a493986 0xb8640c31 0xba638a10 0x236594aa
+ 0x0964049e 0x6c580e70 0x9702093c 0x11717846
+ 0x8f84ee25 0x963bd0d4 0xee8aecbc 0xceb308c9
+ 0x7e87fefa 0xfe29eaf3 0x081bf223 0x39f50aee
+ 0x64426842 0x97a17f9e 0xb9be289e 0x388891bb
+ 0x4ff7d1e1 0x9ce9f261 0xa93271b8 0xe035f412
+ 0x2200e0b4 0x512b25b5 0x45ae8b23 0xd29ea962
+ 0x667f62e3 0xfabb6736 0x5b877b6d 0x053c7b61
+ 0x076cb3eb 0x601e232a 0x0e468161 0xed8adec0
+ 0x5f77e7b3 0x33cc6297 0xc012f67a 0x4e7eb479
+ 0x71c41e11 0xc022102d 0x968c4181 0xe3378a34
+ 0x921f1a7c 0x747b3223 0x2424eb3a 0x14a6099b
+ 0x2c21bfec 0xf931fc54 0x8834adce 0x8ea89281
+ 0x7149822b 0xf9064226 0x9035c603 0x5ae59126
+ 0x09a9bef5 0xb602bf8c 0xccc76158 0xe1462d73
+ 0x2fdad828 0x63b629af 0x73844cb8 0xb408c4ac
+ 0x94c1d64e 0x907b2a2e 0x9fc1b634 0x6afd654f
+ 0xa0edfdc0 0xbc29a7d6 0x767b1b0b 0x7138e98c
+ 0x352d8b21 0x0927d5ca 0x4d41ceb8 0x9fa9e4ff
+ 0x04756e49 0x62b06eed 0x8c0bce0e 0x4f6c8fb6
+ 0xcf5c7009 0xc367e6a0 0xb0bdb7fd 0x647be9e5
+ 0x6f996e46 0x197a8e3c 0x17799ba5 0x70b5aef9
+ 0xa41ce63d 0xc0d9086d 0xb71cb59a 0x453fe0a9
+ 0x68f36324 0x42165087 0x917f6c86 0x25cb02ea
+ 0x3a80eb14 0xf2026099 0x09f64835 0x2587641e
+ 0x0973460d 0x552774b0 0x20465def 0x4822a5ad
+ 0x992f6abb 0x954d1b87 0x3a6e15b0 0x279b5b30
+ 0x2151ddfa 0xccc18116 0x9720fdf4 0x2ed42fcd
+ 0x5b3c3664 0x5a55c3b1 0xfdd0416a 0xd5eed81e
+ 0x8a2e1433 0x24113038 0x4735a373 0xb3ff6425
+ 0xfcb08279 0x33293359 0x322b74c9 0x38c5a700
+ 0x4304badf 0x6eb9b90f 0x080ca3e1 0x43786a88
+ 0x0ffec938 0xfe4e5743 0x67e3c861 0x348ac552
+ 0x11414ac9 0xda0a9520 0x633f535f 0xff97a48f
+ 0x8fbea6c6 0xfbd2e2ab 0x677a91ab 0xecfdb8f9
+ 0x56b7cdfd 0x861106f3 0x1367b28e 0xac0ea350
+ 0x2957095e 0x0e15134d 0xd465f129 0x7e111986
+ 0x6903ffe5 0xe37ac087 0x6f13c15a 0x62fbaf84
+ 0x16bc67a0 0xe238771b 0x714ec75a 0xb09e2feb
+ 0xaf3ec6d3 0x8842008b 0xacc45f3a 0x1433cc4a
+ 0xebee23d6 0x13b9e003 0xf20a265d 0xc485064e
+ 0x0c72f0ad 0x6bc8bf06 0x74246c1c 0x6bf0bc64
+ 0xe03fc104 0x49581c87 0x35326bda 0xf617407f
+ 0x60d7d19c 0x1b94bb2b 0x8767c5f5 0xa8f373ad
+ 0x6c7ee825 0x6fb4a03c 0x5d1a75a8 0x86f425be
+ 0x7c60739f 0xce3a459a 0xa9e3c0fa 0xa0ff2952
+ 0xb8929242 0x520db900 0x0bc756cf 0xfb2df381
+ 0xd9616091 0x1685f62a 0x9580d893 0x2e09a90d
+ 0x60385df6 0x4763db61 0x005b1896 0x5e306c49
+ 0x13f53931 0x2785ab69 0x892b6765 0x8fbf4042
+ 0xe45495c8 0xf12880f6 0xc07df0b4 0xbd80dfd8
+ 0x677c7bc0 0x08aefbb1 0x415420af 0x1b4f7083
+ 0x0b8afd31 0x157a36b6 0x96f53d12 0xa85da83d
+ 0xb5276d89 0xe7c9f2e9 0x8fd0e291 0xad7d1fae
+ 0xda951bd1 0xb4b44ca3 0xebd72c28 0x57f90f7f
+ 0x677584b0 0x84e8d695 0x97fa0306 0xd21c4b77
+ 0xc52a0f4a 0xd9d74407 0x7211d537 0x53537228
+ 0x19397df4 0x71a91efe 0x74c01c0b 0x706877f3
+ 0x184f5d34 0x20dd060b 0x890fdaf0 0x52d19f60
+ 0x1217b122 0xc5615f70 0xaf9d2c8c 0xb272b296
+ 0x019449c8 0x3345644e 0x3c3b1e72 0xe4620518
+ 0x61f2150e 0x8a823141 0xe167e84a 0x114e05be
+ 0x2ebd17e7 0x1be2bb7a 0xb5b23ba3 0x5090f028
+ 0x5fc6aa04 0x2d1c5e65 0x9065b402 0xf0ec9ea2
+ 0xe872712a 0x420a4ddb 0x75b4cc28 0x065698ae
+ 0x0d7658f0 0xbfb57451 0x78d83c3c 0xa1929b6d
+ 0xe7189ecd 0x9f733a3b 0x2c3dbfbf 0x6a1751fb
+ 0x1ccd0a1d 0x015b9ab2 0x89ef1b81 0xa433137d
+ 0x6d1963fa 0xabc41008 0x292f7135 0x11230f69
+ 0xa3903eec 0xa10cbf4d 0x20393216 0xc8da597a
+ 0x99ca932c 0xf6e173e7 0x6b76f01b 0xa09e1ff8
+ 0x0318a1dc 0x49e27984 0xdd1b06d0 0xfb292259
+ 0x2d785d58 0x70aa6f16 0x446a6894 0x78f9e6fa
+ 0x6697bff4 0xb955fe3f 0x7d8c869d 0x64732d78
+ 0x0786c98d 0x8381fd3b 0xd6390e4e 0xc7993b9b
+ 0xe5e1f8c5 0xaafe569b 0x7d8a78a0 0xb89bd783
+ 0xf54c207b 0x2e939a1e 0xdf143293 0xae6ff8ae
+ 0xb2a91716 0x59968c88 0x39bf23b8 0xae6f4de8
+ 0x25036bd8 0x80aec9cf 0xf0ee7e3f 0x317b4da3
+ 0xf8fd7859 0x08df3ed8 0xa71e6b8b 0x3a3462fd
+ 0x25bc7455 0xb13fbb3d 0x9d2724cb 0xc7b31258
+ 0x29065213 0xb281d1e6 0x3106fb33 0xaa6c1ade
+ 0xb638c936 0x356ae429 0x13c86ee0 0xbce90444
+ 0xf9c0d88a 0x518c013b 0x62b04106 0x4ac7ee0b
+ 0x3c616332 0xf0c22f5b 0xfc27ee0d 0x4ce9b5c9
+ 0xc905c353 0x4e11e45d 0x20256223 0xcfea482b
+ 0x8af1d33a 0x6640b197 0x270691df 0x7475f179
+ 0xc1be0ff1 0xfc21a6dd 0x786b980e 0xc72ca8fc
+ 0xb767d852 0x7ac8af42 0x7d72c6b6 0x5a19fd11
+ 0x5716bd2e 0x82b53504 0x85b83ccf 0xf811ccce
+ 0x09f4fc3d 0x26d5ee64 0xeaeeebde 0xec395bd8
+ 0x63b1e856 0x72d766d9 0x48735ba3 0x05c17cec
+ 0x84ec9d2e 0x4799a35f 0x4db934c1 0x1a739a95
+ 0xcc76a3b1 0xec0380c6 0x9fe51ba6 0x3a50a27d
+ 0xf87acb98 0x341361c9 0xfacfcb38 0x5d4b6c17
+ 0xf895d893 0x5ddba6e1 0xde76e175 0xdd13201e
+ 0xf3ad93be 0x2f5b8221 0x59e89ac6 0x1a747325
+ 0x296066ba 0x4d85ed20 0x17622be7 0xa8a5a7bd
+ 0x2d4622c0 0x35bcbbf7 0x6adfc5f3 0x81df2b42
+ 0xfc506e18 0xb2abbd05 0x850204c1 0xdf349905
+ 0xfd16cf46 0x95a65c40 0xf522fd5f 0xc46bc0b2
+ 0x972d3bf7 0x63cd3d05 0x5c0cdba9 0x0a2b5665
+ 0x70b5d650 0x471c9665 0x5b46d2ca 0xe03dcfed
+ 0x88ad25ee 0x28b79b36 0xd4876196 0xff45ddb9
+ 0x3f6f97fb 0x84297dd7 0xf674b99b 0x53c88ca3
+ 0x120ea529 0xf2b960c1 0xc38b3d15 0xb51c0647
+ 0xa2730c34 0xd4165f60 0x9985dd8a 0x077643e9
+ 0xd59044ab 0x88957ef8 0x711688e1 0xb1037691
+ 0xfee7269a 0xf9d31f46 0xc77af041 0x3f37ffc5
+ 0xa4d46180 0x1bcf34b7 0xd3d0eaec 0xbfa88a90
+ 0x48263e38 0xed557ffb 0x1af3d3b2 0x0316948a
+ 0x4af71ae0 0x7517cbcd 0xe1b2d099 0xdc83d657
+ 0xa725bc70 0x355417cd 0x8ecdee8d 0x24007bfa
+ 0xe6849596 0x857cbf25 0xab6561de 0x4f5eefe6
+ 0xc4906bdc 0x6eaa8b85 0x56fa64f5 0xcaff294c
+ 0x17649e98 0x0a841bdc 0x9bf4f213 0x1b341d28
+ 0xdbe8cb6f 0xc39466e2 0x3bc747da 0x5649f344
+ 0x03cd04fd 0xfbe13795 0xbd77ede6 0x7021258b
+ 0x3ddb01d2 0xcae06294 0x9e078842 0x99f6e391
+ 0xafb9f4e0 0xbf598407 0xfff330f8 0xffb3b210
+ 0x818c3811 0xfb212c5a 0xddc8ffc9 0x395554cd
+ 0x1ae3fe4d 0x8d9222f1 0x26f8d43b 0xae69cfa5
+ 0xe4c894b3 0x67eb4bc0 0x652cfea7 0xfd4df537
+ 0xf5cc0cfd 0x6bf05b5a 0x27385c62 0xc836f0e7
+ 0x0c31c339 0x75906219 0xbb82f59d 0x3ad4d28b
+ 0xe482643b 0x527c4116 0x9da57e94 0x40a040b2
+ 0xc06cb4c2 0x3eaf28f6 0xc32fbf31 0xf539696c
+ 0x4941c01e 0x663106bc 0xeaeb376d 0xb9be9f1b
+ 0xc72e0c52 0x043a4216 0x306a80c3 0x4acc7adf
+ 0x770ec027 0xfeff9cc3 0xd3758d92 0xc2f4b4ab
+ 0xcdc5212e 0x7e8d4723 0x8bfa11ce 0x1820669d
+ 0x9f64641a 0xd0be018a 0x8155e867 0xd83a02f2
+ 0x3cb5f6fd 0xacde0504 0x6901ddcc 0xc07c6558
+ 0xf4e6e1ef 0xa00eeef1 0x700f082d 0xf3c0850b
+ 0x2a0847df 0x4c29c837 0x7362f81d 0xebde2f1c
+ 0x69ef6173 0x5f74b6b4 0x6c816252 0xb0594c53
+ 0x5aeeba10 0xe37de616 0x5bd89ef2 0x4d604d46
+ 0xf07b9ba6 0x590d4b3c 0x5eaed047 0xf2e80e52
+ 0x77d78870 0xadffbef4 0x82f2ad9a 0xc24df650
+ 0x4f9fee73 0x9b6e3248 0x40220a7a 0x66e18e7c
+ 0x4aa7303e 0xc4152aa7 0x7881cb37 0x94dbf10f
+ 0xfe390997 0x2ebcdf4f 0x31a1ba58 0x30a652a7
+ 0xc0a1e533 0x868c9169 0x5adacc98 0x65b64557
+ 0xb6a21b69 0x85c27fa7 0x8561bb37 0x7cbe2e5d
+ 0x4ac12213 0x2c820597 0xb5bed145 0x8393fe9a
+ 0xaba4bc10 0x1480dee4 0xc3651295 0x5ac05ae4
+ 0xea9223cb 0xe1683bff 0x25eabf57 0xc5f911f9
+ 0x69961525 0x21ee6e4a 0x36cfaa3f 0x58c44058
+ 0x654f8f59 0x63c179c2 0xbe0dc7cd 0x43edce6c
+ 0x75bec268 0x8b451b1b 0x65488a4f 0xf2ab82c6
+ 0x473dfd11 0x09c9e208 0xc92e032b 0x319c92cd
+ 0xb0016818 0x6cef2d44 0x9fc0d134 0xc375eb03
+ 0x3cbeb3c0 0x4e12c415 0xeaed2bcf 0x98489ec0
+ 0xd332bee8 0x8865b77c 0x986ae566 0x46ae627c
+ 0x43cf7d2c 0x4786a470 0xf8c23b0f 0x7f420546
+ 0x49947085 0xb5fa542a 0xfeb619b7 0x0062eb47
+ 0x964e7643 0xb4b20dc5 0xe6830b7e 0x42d7b4be
+ 0x367e45fc 0xf8a770e4 0x89381661 0x61dd19ae
+ 0xb16333f8 0xc22bd1f9 0x76f2f244 0xcf536bd0
+ 0x4b9d2004 0xfe5f8a48 0x64bafdf5 0x25eacc27
+ 0xc831c205 0x6e9d5c74 0x6700468b 0x72e451c4
+ 0x474d1e45 0x313fdd60 0xd8f23c79 0x052613d2
+ 0x8c1c6562 0x87b0988b 0x6da5d909 0xd286a27d
+ 0x369e1f5b 0x2eee77e9 0xd7942a63 0x83daa4a4
+ 0x0395eea1 0x75640f29 0xaf66cd73 0xe08f6de5
+ 0x5d4a2544 0x1845d47e 0x7447bb8f 0x91c82985
+ 0xd2df8d81 0x396cefd9 0xdb3b2ade 0x4c3dbd33
+ 0x9d3abe58 0xbcdeaa39 0xa904cd8c 0x87849f6c
+ 0x3827fbd4 0x00c17a56 0x9e1f3c93 0x36e83c68
+ 0xe803a822 0x537f11a6 0x8a6485dd 0x9ed17fad
+ 0x0ebde5e5 0xaa5e4856 0x49b58252 0x53619b36
+ 0x167e4702 0xca402b44 0xdecab152 0x1dfaa766
+ 0x1257140f 0x3069091b 0xd92374d1 0x3ab0597c
+ 0xb52bcc31 0x620e60d8 0xd83a5471 0x61006f3b
+ 0x629d6ad6 0x982149ef 0xcc96105e 0xfdd6f0ac
+ 0x3141869d 0xc5ea6866 0x9ab04e17 0xe46cb130
+ 0x3dcb70d7 0x5c8f384f 0x81e38fb3 0x1318faeb
+ 0x3e69c9c0 0x6fa70a9e 0x8b6d5450 0x26301b3e
+ 0x6df0df6e 0x3b50b066 0xc894e340 0x3ff53894
+ 0xd6fe09d2 0x69187a50 0x958df3c7 0xfade4e07
+ 0x5980b30d 0x4634b779 0x0dd4f80e 0xe1ea49e3
+ 0x55516c63 0x2d785418 0xbfdc1981 0x13467164
+ 0xc3d81d6e 0xda687d88 0xc0a15af1 0x572ebde2
+ 0xbfec27b9 0x2d40276e 0x72651cd5 0xc87b84df
+ 0x483543c9 0x9de39ef6 0xbd8b4606 0xeba1a3e2
+ 0x9b549679 0xa6c5918f 0x1ad8e96a 0x88f31d85
+ 0x29eb2208 0xee470626 0x0cb1aa35 0x0c8262da
+ 0x97dc5b4f 0xa1e06d7f 0x5818e64f 0xabbab4a6
+ 0x817c3816 0x7faff78f 0x5050c52a 0x7b8de34b
+ 0xf32f77bb 0x34ee341f 0x8d3a9e4d 0x39b1ada7
+ 0xef322bd2 0x29190d44 0x415bdfb8 0xd779ec97
+ 0xca058f42 0xd5912e76 0x96b1f11e 0x331f6fd3
+ 0x9fee7289 0x3fe204b4 0x1a629c6f 0xcbf9aff1
+ 0xff789191 0xa50a3890 0x7afe9809 0xfd9208da
+ 0x46d21823 0x74073593 0x23d4523a 0x10e8e98f
+ 0x566f17de 0x1df7aca2 0xad6237be 0xa48f877e
+ 0xb96513c5 0x539b4f7f 0x77e704d4 0x7812d61c
+ 0x81e3d573 0x8b530d0c 0x2bda27e1 0xbd2cae27
+ 0xf5c09ead 0x61b78bf9 0xcb933660 0xf8893a6a
+ 0xb45fc8b0 0xebde71f6 0x9fb14aa8 0x18950fd9
+ 0x6d8bb51f 0xf140c194 0x885f559f 0x10d049b9
+ 0xdd5ff1cd 0x3f589620 0x84f30dd3 0x70beec51
+ 0x75b70a1e 0xd3415405 0x096a9360 0x39c54abf
+ 0x83507ac0 0x39191f54 0xddb76cce 0x0054ba33
+ 0x6345d176 0x043fa87d 0x33b121ee 0x0e451b51
+ 0x1ee8412e 0x821ee12a 0x1aad0a1d 0xd49f63d8
+ 0x07ef3812 0x90fe7617 0xc2ad0712 0x68311c5e
+ 0x2dcd3471 0x928b6248 0xe20fcf7e 0x99e3c939
+ 0x9cc965dc 0xd4b9e274 0xf3fc93ed 0x80d127b5
+ 0x078c1604 0x2b65a809 0x4030853f 0x234febca
+ 0x9fa441f3 0x0c3b264c 0x53eac391 0x98cd202d
+ 0x7e50a035 0xbac1b949 0x47429a0d 0x62e0b0c5
+ 0xdaa182e0 0xd3bf57cf 0xce7cc318 0x6a07ae43
+ 0xf1127353 0x82156f15 0xd4e7a574 0xbc22b57c
+ 0xa3114d16 0xcdccd132 0xc47962bf 0x5ed0e4b6
+ 0x11c70012 0x4a50e501 0x80dbe1c9 0xe4d7bd1c
+ 0xe802a5fc 0xc6d127fa 0x50842812 0x5d9d4d93
+ 0xbdb3108e 0x41f7ff27 0x33478a4f 0x1c38e1d6
+ 0x7dc1bc3b 0x7b8f17b4 0x2115e253 0xbf8f1ac5
+ 0xd639ffa5 0x238876ed 0x7dba90b7 0xaa0d2c45
+ 0x3d3d383c 0x4bcefe30 0x99eeee70 0x22fd7f1b
+ 0x6ce141db 0xe8065fe0 0x4ac120da 0xe8abf231
+ 0xc353e26e 0x4d7d344e 0x1b704e29 0x9ce0bcb7
+ 0x9cdd3fe4 0xe5585f2d 0x2b5ae25e 0x820803e1
+ 0xb61f0734 0x1f088f07 0x91ba90db 0x89a64f71
+ 0x6c0bae11 0x777c2242 0x52f88f57 0x4e066af9
+ 0x3a306836 0xaba6d24b 0xa1d3848f 0x0409eef2
+ 0xab97e370 0xa6419863 0xd9c71cdd 0xc2cfcdec
+ 0x52c87221 0xe64b7ff1 0xb2cfb829 0xaf6a1164
+ 0x31f49fbb 0xc9b55773 0x1512b8fa 0xf52d1715
+ 0x4d443b40 0x3a0e15ff 0xfa810f9b 0xdf150287
+ 0x69d07a24 0x408cded6 0x8a1bde41 0x4d61714f
+ 0xbbcb8345 0x6bfb4c19 0x915fda61 0x771c9172
+ 0x5d11e873 0xf6ca0bb9 0xfbe5f5dc 0xa59cfeeb
+ 0x23fd2965 0x77af31b3 0x8bb691bd 0xc4131646
+ 0xc03178d4 0xf5bfbc1d 0x5e44cde8 0x373f8ac4
+ 0x89e0d0c5 0x60e45013 0x5f9d3eb6 0xb2694ef4
+ 0x5c90bd23 0x81b21d02 0x9ccbda7a 0x113837e1
+ 0x2e7a5eef 0xcc2b0c93 0x986d7017 0xc6d4341f
+ 0xed83411f 0xfb3be8ea 0x65df7285 0x43f71d3c
+ 0x98db6b47 0x356d3fb0 0xc28c0c3f 0x5bfa8b9c
+ 0xb7dc8574 0xf3e85821 0x5e618232 0x57eb8e09
+ 0xfa577d69 0x3256b9c0 0x23925882 0x049a62c2
+ 0x8bf9ea56 0xcf4a26ea 0x3ed441e6 0xa58b6e6a
+ 0x2c177862 0x3287e567 0xf23ca964 0x261c9b17
+ 0x22465daa 0x4ef9f195 0x046a867d 0xa38898ea
+ 0x912c0b81 0x2c54e834 0x4c7d8e9a 0x749b8caa
+ 0x44a0ddde 0xe3c28d2c 0x0e973992 0xf69f0a04
+ 0x12eedbeb 0x07d58a27 0x06335f41 0x5858009b
+ 0x02e0d44c 0x91b3f425 0x6f485a0f 0xcfbcfed0
+ 0x28ecae95 0x820c3d43 0x17563bd6 0x2eeed266
+ 0xefc66054 0x00cfb51f 0xc7725be0 0xda64401d
+ 0xaf62184b 0xc7c7e121 0xc2fcbccf 0x80bfc1ec
+ 0x7f881507 0xbf1d8cb7 0x762d74dc 0x8114836e
+ 0xb1f06f4e 0x6f601cfc 0xe180598c 0x78fdf809
+ 0x83a3c7f8 0x5b1836f9 0x6dba011d 0x00c8ae4b
+ 0x1835d8ae 0x5ed6e662 0x9c844738 0x2fb27fed
+ 0x0667707a 0xa9b346f5 0x9cebb524 0x924fc582
+ 0x606a13d1 0x16720fb9 0xf2ace147 0x2075637d
+ 0xcd1e83ed 0xb19b8945 0x96466650 0xccddef5e
+ 0xc32a83e1 0x12fb7523 0x401edbcc 0xcaa03bcd
+ 0x4d1a84f1 0xa5c725c3 0xd4707e6d 0x2ef4fa20
+ 0x7055c032 0xe1085516 0x7c18f940 0x1f82cb9d
+ 0x7bb59fe0 0x096736a8 0xb537886a 0x5abb9208
+ 0xcfcbc80c 0x3f5d2ec9 0x067dd2d6 0xacdb69b4
+ 0x76d00d90 0xeace3ae6 0x596c4c15 0xa5022191
+ 0xa3b9853a 0xdaad430e 0xb2b954d3 0x6e22758f
+ 0xb2970653 0x606ddc84 0x9c4e0b95 0xf5e75a19
+ 0xb499080b 0x8b42112d 0xb8108a0f 0x6bdca24e
+ 0xee8dfb1d 0x767b2f57 0xe37bced2 0xae936071
+ 0x66d2f8dc 0x7741efb5 0x5c77e0a7 0x865122a4
+ 0xd6e83d1e 0xcf928435 0x3de624e8 0x462696db
+ 0x10d1f807 0x541bb0d7 0x184e3d7b 0x5ac43ad4
+ 0xb3090fdf 0x4d3a3d94 0xcd924076 0xee2c0699
+ 0x17fdfa1b 0x03655b76 0x48d97db9 0xf1ee5304
+ 0x208bf840 0x8dd4e4bf 0x6b740615 0x22dc0f33
+ 0x9fda2f1c 0x7691c188 0xf7cf64f9 0x3a60d388
+ 0xeb1e7a76 0xe7788522 0xf0fb39ff 0x5e9cfc57
+ 0x76d58502 0xb432345e 0xeef3ff5d 0x380c0bba
+ 0xfab7de41 0x7d0479f1 0xa82a18c8 0x9bea9dda
+ 0x29daf1ba 0x0478713e 0x235875b2 0xb1e94931
+ 0xf725e488 0xccbb3665 0x1d1e12f8 0xe3169ac0
+ 0x0e353155 0xec0135af 0xb2f5bbb9 0xa1413c4a
+ 0x32dd6a50 0xa613ce43 0x34e8b451 0x90e2975e
+ 0xbd463ae6 0x530c5722 0x1e6882c5 0x375adec7
+ 0x1193cc50 0xa6d207e8 0x4d1d54eb 0xba27d393
+ 0x80e10ee4 0x79bb8587 0x49bd8647 0xea7617ad
+ 0x624ff2a2 0x71a1fd3a 0xb241b33d 0xf1ae8102
+ 0xf491156f 0x0f2ea561 0xa324bc38 0x2f7ee0b7
+ 0x00636490 0x25570a6e 0xefadb85e 0xa6d2d3a1
+ 0x157c3b64 0xd2ff1c1a 0x69ac4cbf 0x87d4fee8
+ 0x6aba8dd1 0x22d2a609 0xf8a2bbb9 0xbd2e4b14
+ 0x70b1ef68 0x27ba55cd 0xe9ce37ad 0x28d8ce39
+ 0xf87da8c4 0xd5f87821 0x7ecb7dca 0x85f3c622
+ 0x7d6cc927 0xf8475902 0x08c72487 0x14075f9b
+ 0xf38c8386 0x5589faee 0x6fb3277f 0xa33daafd
+ 0x463ee430 0x452c08ea 0x5a971195 0x8d58224e
+ 0x76d0bcf7 0xd477f886 0xb4afa33e 0x20db6f47
+ 0xd3f06a30 0x94a45d9a 0x17d13401 0xff77b1b5
+ 0x3f5b358f 0x695a48ce 0xfd6d6011 0x5d490878
+ 0x89e9b0a2 0xe5d579a0 0xa6b9d30d 0x689b78e3
+ 0xd54559ad 0xf4faa8da 0xb39c5d09 0x7d087d64
+ 0x6d61c287 0x8a57fce1 0x21e247d2 0x67c79473
+ 0x4e0d7780 0xa8a7b8bd 0xbb4bcc3d 0xd5e9398d
+ 0xb9520607 0x634867a1 0xe2499ffe 0x659217b9
+ 0x661b2857 0x653dc708 0x0c43a1d4 0x7fc3d14a
+ 0x2a9ea2b1 0x8ae5ea88 0x150f8219 0xcdce21d6
+ 0x942a487b 0x969bd34e 0x9e7f4407 0xe2a26c6b
+ 0x7129d6af 0x94869bbf 0xf65154a2 0x2ef48faf
+ 0x0602abd7 0x21755d3d 0xa4b8ae1f 0x37d4ced3
+ 0x29c5ae07 0xbb1196ae 0x658c8ff1 0x4cec0ccc
+ 0x604acb40 0xb1cd3d35 0xac4486bf 0xac3113d8
+ 0x45b82f3a 0x7d18f6b8 0x1f40801c 0x38c2afdc
+ 0x69435265 0xaf338c8f 0x37472b04 0x90f05195
+ 0xd94b6110 0x72e45ffb 0x0f985a7f 0xcaedf2da
+ 0x2f941a33 0xff093077 0x2ff5741d 0xf3cd640d
+ 0xfbea8b3b 0xe88d69f0 0x1868e3d2 0xde237ce5
+ 0x0e87e8a4 0xeab1ddf5 0xb402b367 0x623ac9ad
+ 0x0c3b6838 0xfeb50a00 0xe7b21c55 0x76a28adf
+ 0x14563da6 0x9e1999bc 0x163831cc 0x48187995
+ 0x041e1368 0x7b20c89b 0x3e8f237c 0xff90dff8
+ 0xaee1a97b 0x54665385 0x80577ab3 0xce8ce668
+ 0x3911cf3a 0x80b3354f 0x759f967e 0xa9c81de1
+ 0x361abb2f 0x3f413da0 0x74214313 0xb7a9e9fc
+ 0x340ca8b3 0x37172ad2 0xad3270ad 0x09be725d
+ 0xadc54991 0xdab7b984 0x0f13dae5 0x76268ed8
+ 0x59060e51 0x1f5c0188 0xb6b4c162 0xde7b2c61
+ 0x86bfb062 0x9e22d595 0xfc307f39 0x1630f78a
+ 0xdf479d05 0x52dbe41b 0xfc4dc8ea 0x208f1808
+ 0x32e07fd1 0x52c02977 0x8024fca0 0x801110b2
+ 0xa2c7b65b 0x32a59164 0x4242212c 0x47173b8f
+ 0xe14769aa 0xa60dea63 0xdfb10ed7 0xf2ae55fa
+ 0x152829f6 0xb48d4237 0xc9a6874a 0x96c2e600
+ 0xf6af04d5 0xa190d45a 0xe70fd3ef 0x44f23ab1
+ 0x3e855121 0xc0110062 0xd1f3edc7 0xba502f36
+ 0xa631d8e4 0x61e84d5c 0xff62a94e 0xb95ed76b
+ 0x59839a61 0xb85ea38b 0x2c52ce8c 0x299bcc6d
+ 0xa4093132 0xb7adee0d 0x2aa2e418 0xf3901449
+ 0x8bc8db20 0x9ed30a6d 0x079de39e 0x85c380d4
+ 0xf8ef66a3 0x3c4b3f4b 0x9bf5c780 0x32bd0dc6
+ 0xf3b65908 0x6cd47c06 0xf63419b0 0xe4e44829
+ 0x808b5e12 0xc9b0a33b 0x2147c554 0x352284bb
+ 0x7b94105c 0xe3bb1add 0x6bd5f31e 0xd5ebdebe
+ 0x56e01b27 0x0748c388 0x09281d79 0x2e68aecb
+ 0x469e3040 0x67aad95b 0xa7354ffc 0xfe80f193
+ 0x8dbf794e 0x3e15ffbd 0xb0eb2fc0 0x7ddf7747
+ 0x81b3ba19 0xb0a2fa5b 0xeaafe060 0x7c292897
+ 0xbada5f5a 0x6d3dfdf3 0x781d390f 0xf7e3f51b
+ 0xffd969f4 0x7e72612a 0xa3625a5a 0xbbf34741
+ 0x32680cd1 0xa79443f6 0x1caa178f 0x3f255b46
+ 0x64fa6137 0xf37f8333 0x38bc8f8f 0x974d2fb5
+ 0x85d49900 0xb6a5cb6f 0x5ad85aa3 0x0f5e6477
+ 0x44e86ace 0x8f21b385 0x68ad33e1 0xcbc88a7b
+ 0x1bf62264 0xcb53aa08 0xe6a953da 0x038224bb
+ 0x184f666c 0x8cebf64b 0x73d34e9e 0x7c87c559
+ 0xb130264f 0xc8094a11 0x6c8cb034 0xc4c408a9
+ 0x6e999fc5 0x60edfc21 0x9d4053d7 0x17f7c225
+ 0x161979cb 0x73cc61b5 0x89ea22b0 0x7887803a
+ 0x73859bb7 0x4b27c011 0x08e70c9b 0xb909a1c3
+ 0xb2bfea81 0xc5141b9e 0x3e0c43c7 0x12dc9fa0
+ 0x35701e3f 0xd2c4f6f2 0x98eae649 0x6c783fd2
+ 0x9ccf062e 0x1470ab42 0xdece3ad3 0xb8a2fa19
+ 0x9f5b8519 0xe3843a3e 0x1b9f3b79 0x51268bb8
+ 0x9eb0eeaf 0x49994b14 0xd2743466 0x6fb954ba
+ 0x4abc9b9a 0xc66fbebc 0xe2085c56 0xadedb2fb
+ 0x45722ebb 0xe4bb7d10 0xb4978709 0x226a4d7d
+ 0x242c08d4 0xee93fc4f 0x931b3c37 0xeb62e006
+ 0x82483dd7 0x216fbc42 0xd917981d 0x6087b346
+ 0x11a54983 0xef1e3307 0x1b588a7e 0x63fa27c4
+ 0xb8017cc7 0xb24a8cb7 0x7e879647 0xdc7da4b1
+ 0xf74d6835 0xee620649 0xae190349 0x3c3d53be
+ 0x1a4ace04 0x38002ea6 0xdc558ada 0xff3b1d52
+ 0xce99f397 0xc07cdd81 0xae913e80 0x4d367dd6
+ 0x13dc3349 0x8d33196a 0xbbf50e13 0x37f572db
+ 0x36735184 0x09c2d71c 0x14c5a677 0x76bdda40
+ 0xa48c2e0d 0x14e7df15 0x1727199f 0x795ca3d5
+ 0x925b5bc2 0xcb97d364 0xeba4db16 0x7cf6028f
+ 0x83755f53 0xf881fec6 0xde422b3d 0x1c085640
+ 0x4f23865e 0xaff88fcd 0x626ea59a 0xf5598008
+ 0x7b0ab489 0x39978fcb 0xa84191ab 0x7d2807ed
+ 0xf13f4343 0x890ce899 0xd6f637eb 0x7b20e016
+ 0x9909ebea 0x4bd59f10 0xbe7902c6 0x4ca3783c
+ 0x57d2588e 0x2179ecad 0x85c05d24 0xcb28ee97
+ 0x590771a7 0xe2132e7c 0xc640985a 0x4331a21e
+ 0x6be5ddfc 0x7ec3441a 0xdea4685c 0x596106da
+ 0x833b94a9 0xceb629ea 0x5a1375c2 0x41a23238
+ 0x8d55d148 0xfd27d828 0x57c933ce 0x21729557
+ 0xdcafe0e1 0x91b06e49 0xa6dd2635 0xcc3783e1
+ 0x20e50577 0x2568a488 0xb19e1425 0x1ba20828
+ 0x987bc2fc 0x62b33d70 0x1056e680 0x542b9214
+ 0x49391384 0x62d6170f 0x97a84c89 0xa9911d9a
+ 0xe0c98e8b 0xf6c81386 0xc7c46132 0x4a83d058
+ 0x4fcebfc8 0x12441c74 0x6c87ca14 0x87f7d3d9
+ 0x9cf008ba 0xa4f3735e 0x3506be84 0x3a6b6b3b
+ 0x7477725d 0xade4f1ec 0x592ae374 0x310b0e6a
+ 0x3e3ccb57 0xc4bfd2fb 0xcdbb318b 0x1299f706
+ 0xe8636a17 0x7efec28e 0xf7661b8f 0xb900cd60
+ 0xf222e768 0xabd23bb9 0xa1152084 0x2a26944c
+ 0x3d8747e7 0x49e17fe0 0xc19ae63e 0xa6b070c6
+ 0x81b07927 0x6e03984b 0xb117e26e 0xee1857ee
+ 0xe24c52f5 0x74bb61bb 0x9d7aed8d 0x4c010020
+ 0x1e3e3180 0x65287c0d 0x37481ec3 0x2995c17a
+ 0xdfedb8eb 0x45c5c59c 0x9c18a582 0x6d8ac7ed
+ 0x10425e79 0x18752f9f 0x1d8d3451 0xc7f2e2e4
+ 0x282111dc 0xe6fb7f7d 0x6dc210d0 0x50c6769b
+ 0x66e90a86 0x3257408c 0x828e3d50 0xe4b5033a
+ 0xf24da685 0xafe664ff 0x39dc5b71 0x96ccb04a
+ 0xbf3f04ee 0x5be42c4d 0x3f505e68 0x32c8c46a
+ 0xf1db2ca9 0xdca7094b 0xd39ac464 0x334c2403
+ 0x2a9a7716 0x67cf7b68 0x069e8449 0x2d809042
+ 0x35fe0f2f 0xca17bacf 0x1005128f 0x3b05def0
+ 0x07dede91 0xaf6c85b0 0x7e58e94d 0x053abdec
+ 0xef24c1c5 0xad242374 0x0ba1890c 0xd02ebd41
+ 0x0a46238a 0xd3e1c35f 0x769c6515 0x2a9808e1
+ 0x95ab0520 0xeb575cf2 0x79a17f8d 0x0c51a77d
+ 0xb38f3064 0x322097c8 0xc1b9197a 0x34473ead
+ 0x13e198eb 0x5634ba10 0x8955ce69 0x31d88b5f
+ 0x1e090166 0xed251efc 0xa7fbe0b8 0xfd4a7c35
+ 0xfa96ee0f 0xaa31f574 0x105e4865 0xb5b10240
+ 0x1fd08a0a 0x96199e4e 0xeff7c1c1 0x6ae9c539
+ 0xe592cc17 0xe2c202fb 0xad368437 0xb76c8b94
+ 0xbb330ea7 0x2b46e1c5 0x2dadc985 0x19fb2862
+ 0xec3d720c 0xf4fbafb6 0x44804949 0xe547ef56
+ 0xe2b5d0d7 0x82e45ad3 0xff5cc9c9 0xa34eaab3
+ 0x618f8530 0xb743c062 0xbe48e157 0xcf1df31c
+ 0x4eb314fe 0x84292218 0xacfa4098 0x2aaa1ad1
+ 0x35611959 0xf59510f4 0xb9d585be 0x434ca16b
+ 0x41b50b88 0xa8973b64 0xcf190fd2 0x59a7b2d6
+ 0xc4ed282d 0x50069edf 0x2c6a1c74 0x7264fc66
+ 0xc42e8715 0x866a54f0 0xcf850cc1 0x049fa76c
+ 0xdb540cdd 0x5e975b4c 0xf4851211 0xebca9bf3
+ 0x56ab93c7 0x6c3644e4 0xbbb3ce6b 0x9bd0886e
+ 0xd622d87e 0x29ff56fa 0x7fedeb3e 0x11ca822a
+ 0x964fd55a 0x64815d1c 0x5de299d1 0xc0344d87
+ 0xe6f03380 0x2b76d1ec 0xdac63777 0xfc82f6f7
+ 0xdc29bab6 0x3a345889 0x8e66f31f 0xa85c5b95
+ 0xc3590441 0x96cd06e3 0xbde2ff32 0x886e770a
+ 0x407078ec 0x6fb41a33 0xa2d809ff 0xae36137d
+ 0x6226694b 0xf69b19b9 0x8994ec81 0x27a845df
+ 0xf656a2d9 0x1468d119 0x2df7830e 0x307fea6b
+ 0xff39ec85 0x067328fa 0x1a2f5fc4 0x0eb1826f
+ 0xeccce43d 0x8eb43122 0xb4421608 0x857e02f5
+ 0x0e812ce3 0x6323b5b7 0x34ead2f8 0x4df21513
+ 0x8d9a0520 0xe7004fb6 0xf72e814f 0xf077cce3
+ 0x6388e042 0x7d748151 0xdfbcbcba 0x7d172571
+ 0x24990a40 0xdfd173f9 0x68cd2161 0x80f8ee00
+ 0xcb7bf35c 0x73c33c94 0xd8b7c28b 0x42415b96
+ 0x535e263f 0x7b5a4419 0xa869acdc 0x859832f6
+ 0x63b51b84 0xf0ce1fc2 0x4827d03f 0x8279c75e
+ 0x30e83aaf 0xc359670f 0x7373eafb 0xcd8a51cc
+ 0x3158dbf2 0x65d7ce0d 0x136a500d 0x6fd3cfcd
+ 0x852b3f5b 0x9c84fc67 0xcb3457bc 0xb207cd37
+ 0x2b9f3037 0x1b58a00d 0x30afbc1f 0x74d983d5
+ 0xb35a0640 0xf615013c 0x76280a97 0x8fbbed01
+ 0xf3ff8b82 0x9c8bf7c0 0xb517c986 0x8c34973a
+ 0x945590f9 0xae947cfc 0x9b973538 0xfb9d7dfb
+ 0x82884287 0xbff22c23 0x3d55dade 0x365c76d0
+ 0x62adf496 0xa48ef1fc 0x2723be5c 0x7ac930c1
+ 0x318ce996 0x120e51fb 0x969add52 0x3b296626
+ 0xc64c1c5a 0x7b016b62 0x76cbd18f 0xf405f9be
+ 0x46c5b3bc 0xa3ad6071 0x32cdcbc9 0x0a45c65e
+ 0x89f8db31 0x0406b13c 0xfc9a98e0 0xd8dff697
+ 0x275b05df 0x7314b4bd 0xf21edc9e 0x9e00e055
+ 0xfc9e094f 0x51893446 0xf7800e67 0xd561ef2d
+ 0x78d46bd4 0x19809124 0x342fbbc7 0xbebad398
+ 0x8146baf6 0xc138ec6d 0xfcda50dd 0xee9495b4
+ 0x0db40288 0xd5142c64 0x0c87d513 0x2c4eee1c
+ 0xac1f2369 0x6ba344e0 0x6c4c5ece 0xa8d9963d
+ 0x2c012ef6 0xaa8fead7 0x60fa4d1f 0xffe820f8
+ 0xa22a632e 0xc6bd0210 0x224e4f92 0x70534e1b
+ 0x5644bfd9 0xfdf6a54c 0xdc9658ed 0x2fe412a3
+ 0xa2089338 0x3e1d45c1 0xf834522c 0xb01e520f
+ 0x89d771a6 0xe66ce704 0x0a2c6557 0xcbf04071
+ 0xa835525a 0xba9cbc4e 0x39b3c3ef 0x322fa1f0
+ 0x14e96e98 0xbf48a7d0 0x5924713d 0xafe81627
+ 0x7dacc6be 0x20f04d86 0x27a86e2e 0x612f267a
+ 0x25e4b39d 0x02277be1 0x0befb95b 0x326a18d5
+ 0x454cb039 0x1912ec94 0x5913b530 0x640c81b0
+ 0xd8200108 0x70e8513b 0x4cc67352 0x4180dabd
+ 0xc13fea2f 0xb75d7e92 0x43e7fbd2 0x03970abe
+ 0x0192c51b 0x12175a67 0xfd0d1e94 0x5173ab22
+ 0x565f67d9 0xb7301dac 0x86647677 0x6579822e
+ 0x2fca90c9 0x9da0ab9a 0xe5b95852 0xb43ef479
+ 0xefde3dcc 0x340e0ce3 0xac979fcf 0x5458aec6
+ 0x63160461 0x5f921027 0xf820c99a 0x80f97b33
+ 0x7f3880c9 0x71338918 0x62000d9c 0x45329e41
+ 0xf505170c 0x47b3cd69 0xe95c797a 0x9b2952ad
+ 0xafd0d397 0x4c15bec6 0x226bf7e7 0x200cec22
+ 0x8fa00cf4 0x20b0c8ac 0xf7050b92 0xf72cf1d3
+ 0x2ebb18d2 0xbb8ae7ea 0xabb45dba 0x01b568e4
+ 0x793203b8 0x037d9eb5 0xca8cb1e5 0x9af6c43a
+ 0x16d143d4 0x0e9e3aa5 0x44c2efdd 0x54363e09
+ 0xe03f2faf 0xe14ce314 0xd7b99c5b 0x8b2b7de0
+ 0x2b6e3237 0xf4bab1e8 0xda4f5a7d 0x0ccfb320
+ 0x227f341d 0x140cb1ce 0xaa4c0e73 0xe2cf4984
+ 0x3bbb3256 0xda26cd97 0x02ec6207 0x7a16fcc5
+ 0x19a6e4b4 0x38c7e66d 0xc305d996 0x75c3dd71
+ 0xf194a65c 0xca3c29b6 0x6dfcb70f 0x9b740010
+ 0xda469aae 0xbd36870e 0x6af28ae4 0xe7c67bc0
+ 0xaf9035ca 0x036bb34c 0xfcc3b2ef 0xd2a7d218
+ 0xdd90b078 0x442e5baa 0xfed6c529 0x6bb624c4
+ 0xe82918fe 0x9bb882a9 0x69624c47 0x4250ab3d
+ 0x041061ce 0xb83149e2 0xabae7385 0xc5b6f878
+ 0x343bb149 0xa5bdad02 0xfa435cee 0xed9df83d
+ 0xdf030bb8 0x53c8a719 0xb8517b7f 0xba6089d6
+ 0xfc8500ab 0x44a26f98 0xdce8272d 0xfea017fb
+ 0x5b949a03 0xc4865cb8 0xca02bd68 0x04be3de0
+ 0x127d764f 0x0075fe7d 0x555862d8 0x0fdbb430
+ 0xcbe88e5e 0xdf8eea7d 0x5f252637 0xab6929bb
+ 0xfdf3bf28 0xaef26e0e 0x6f4a160a 0xf8ddb2a5
+ 0xb77486af 0x7ce7af50 0xd59ae204 0xe638ad8c
+ 0xb806581d 0xa131a882 0xee60c9e0 0x57bf2a73
+ 0x1d55c2ff 0x0677bc2e 0x98e2203d 0xa4da3b89
+ 0xd10df673 0x1890d381 0x44753e6a 0xd2374be4
+ 0xe1515c4f 0x31398576 0xaf29a94c 0xc833e871
+ 0x83114ae9 0xf1989533 0x3d6855ca 0x321bf2b9
+ 0xf03339ad 0xf119e6a0 0x08518f15 0x4bb2a2f3
+ 0xa1bc6a7d 0x4281b21b 0x6e449c55 0xf0a3a10e
+ 0x67713bb3 0x0971da72 0x56c40a76 0x40f962cd
+ 0x2b99cedb 0x515ef3ba 0x75b9941e 0x2dedb549
+ 0x40f64c89 0xca521276 0xf99ef855 0xcb871c5f
+ 0x5f8b0f1c 0xcec4e935 0x3181ef57 0x03f070d4
+ 0x3adf04a6 0xf368c0f3 0x0cdd9ece 0xb42575e5
+ 0xf3330c7c 0xddd7c228 0x1620149f 0x5e9c6ff5
+ 0x0bb443c2 0x39c16e77 0xb7914a40 0x0d6e41a6
+ 0x85b3aa01 0x8034fd49 0xf5cea432 0xa40aa8cb
+ 0x0457fbca 0x1edf2904 0xe2888d23 0xe7c5fb31
+ 0x144fdd01 0xd05b38ec 0xbcbdb172 0xe72e721b
+ 0x2dd4f673 0xf2b06bd6 0xe8744ed8 0x1f71445a
+ 0x06735a89 0xb90a30d9 0xa41c3576 0x4771da3b
+ 0xebb3be18 0x3063dc2c 0x6c37a2dd 0xd4e46133
+ 0x2f2229b6 0xd86d3a9b 0xdc6fe0ad 0x53e6ef27
+ 0x50610504 0xaa8ec2d3 0x1053e00b 0x1f7fb19d
+ 0x52dddd67 0x4087cb7e 0x79983df6 0x25b89a75
+ 0x0c273f72 0xeeb6038d 0x87912056 0x89d2c60d
+ 0x0f9a3f89 0x466e87aa 0x81d7fb0c 0x19c4a20b
+ 0x3a6d7f8e 0x7a3a853f 0xdb590879 0xa235d07f
+ 0x61af2785 0x3b3512e7 0x98553ffc 0x7fe687b9
+ 0x94857fa6 0x163e3e92 0xebc32498 0x27a7647c
+ 0x83199806 0xe4b57b69 0xbfbec239 0xfb9f96b4
+ 0x006d96ad 0x5ebb9c81 0x91d6fc3e 0x22c7d324
+ 0xd3867a5d 0xf3e3c0e5 0x9396ac42 0x3e4f877c
+ 0xd3713f68 0xaf65a501 0x12751ee6 0xb7657c74
+ 0xe8ab984a 0x20c7148c 0xcbe78866 0x7e26ae0e
+ 0x8f8dbe32 0x635c0335 0x827ec430 0x1eb65a86
+ 0x2d920987 0x99b8f206 0x51794ca5 0x98d23276
+ 0xa14ad870 0x01a25d21 0x6d9ded56 0x84a98da8
+ 0x5241feff 0xeb0bd44c 0x7ff0d5b2 0x4eafd901
+ 0xc4e5240e 0xd83a508b 0xda780274 0x2c9d31fd
+ 0x16a956e4 0x80ae7dd0 0x5e2996d0 0xe0f2c8db
+ 0x41f3b936 0x7097159a 0xdf8c2891 0x75d437b9
+ 0x33e6812e 0x028c0693 0x73ba98b3 0x286e2cde
+ 0x30dcc32f 0xfba1b8fe 0x0838f6db 0xe4600b0c
+ 0x71b37e93 0x8aa32674 0x60efe98e 0x5f2aa8f3
+ 0x4df96b2f 0x448ca812 0x08de8250 0x4e589a07
+ 0xb1a2b4a5 0x61cc2f70 0x0ab48797 0xb8fe2fbc
+ 0x41b6b009 0xd7f4f2c3 0xed49ddaf 0xaf41e8df
+ 0x16f3072d 0x3dbc5bfa 0x100b0ac9 0x975ad110
+ 0x5b8ba1c4 0xfb2cca87 0x5364fd70 0x657860e5
+ 0xdfb66039 0xb1bb5c7f 0x78ebed1f 0x5cd6d055
+ 0x783ae62a 0x770d974f 0x1ca3db3e 0xdc89476d
+ 0x0b92b39d 0x6edb3fc2 0x7d197db3 0x9c153321
+ 0xca82f11a 0x6ad3e144 0xc8919523 0xa904d663
+ 0xc6fdbeb4 0xf31202eb 0x6973e94b 0x999d0bb4
+ 0x1c00e7d5 0x3b7b3236 0x16fe019f 0xab063227
+ 0x55daad0f 0xe8d8ab3d 0x0120506c 0x5b33fad9
+ 0x2c5d9889 0xbc51eabb 0x7275a262 0x68c00c03
+ 0xabb720b5 0xad59c4eb 0xbc5ee111 0x13e8db52
+ 0xaa30b3a0 0x80c39f72 0x8e1e3556 0xd3b2ff26
+ 0x1152fd6e 0x68986c71 0x6eec49ee 0x22f1efcb
+ 0xf04877fe 0xad046796 0x2c0cfea6 0x856f41d7
+ 0x888f2cf2 0x210913c2 0x18b66f8b 0xd8f1e849
+ 0xffa3a144 0x2fbbe18e 0xdc2ee3ae 0xe4bd602b
+ 0x4a57bb4c 0x103bc8e0 0x8a28d26e 0x8d5420b8
+ 0x59fdd406 0xe00e081a 0x5fa22cef 0x7b27cff5
+ 0x9555bd01 0x7cb74723 0xffe1debe 0x6ce4be13
+ 0x7208420a 0x59dfb6d6 0x8a7a3727 0xb5fcc8a4
+ 0xc2c47307 0x32dfc132 0x58555a84 0x1626ed76
+ 0x1bc4930a 0x573ca725 0xdaf844e9 0x86412ed9
+ 0x56edcc86 0x7ce7d86a 0x3549ff0c 0xabb32f09
+ 0x142ae7ed 0x44a43c09 0x30f08a59 0x7d7ffd78
+ 0xfc45e227 0x54eeb32f 0xfbe758b1 0x7c9b1c98
+ 0xefefad06 0x0838c92e 0x9bd7a069 0xf6f71a42
+ 0x65a2e5c1 0xeb8186fb 0xbf3c93be 0x30f3720d
+ 0x4dcf7a73 0x5b1feac7 0x55ebeaa4 0xacbce709
+ 0x85b24a81 0xf8003552 0x92296135 0x9c2343e4
+ 0x04862757 0x24378a91 0xc2a37ec3 0xbecf299b
+ 0x7950df1e 0x9e02ba86 0x7cb3d764 0xbf332b0f
+ 0x305cb8ef 0xc96e973e 0xc4752d94 0x0d280865
+ 0x6dd06208 0xf7c0decc 0x9f62a7e4 0xa22b9e4d
+ 0x566ecc24 0xcd532672 0xe19697cf 0x31b5425d
+ 0xbab80fe0 0x23338ddd 0x26469603 0x2b9c07da
+ 0x86bd404a 0x1893e429 0xc84c9c31 0xb871978e
+ 0x2c8dac0b 0x3afdc81a 0x66de70a7 0x0c67fcc1
+ 0xb8dc0dea 0x537e7511 0xff031a24 0x7015e67c
+ 0x34c12ac7 0x885268c0 0x538071e9 0x7117a5e5
+ 0x5b9890a1 0x3a35a5b2 0xca0669bf 0xeb9be8ab
+ 0x0514816b 0x0d615a31 0x37bc09b3 0xb6ef53d4
+ 0xef635599 0x317ad54a 0x523537f4 0xa00a245e
+ 0x239cd535 0x64ab16e0 0x7529df8a 0xca7cfd72
+ 0xefa62c3d 0x8f3c7c78 0x8a9525a9 0x2449c3fe
+ 0x04b4654a 0x52405702 0x92740c4f 0x889c4c86
+ 0xbb433c1f 0xd35a81a1 0x09055603 0xa6630465
+ 0xbf0728ec 0x53657965 0xbb2e694a 0x7fcfaea0
+ 0x9f815c41 0xf2a9a2c3 0x1b32bd79 0x4ab37a04
+ 0x396510dd 0x0595d343 0xbe46c057 0xbc70707a
+ 0x479c2fe2 0x8772a36c 0xf6226f97 0x8f879773
+ 0x58d1bf88 0x346f90b8 0x5adf3ae9 0x366e21d6
+ 0xab951c42 0x5b441472 0x3586083b 0x6b09c693
+ 0xa543d9f6 0xa35f002d 0x7349c6e9 0xd0d9297e
+ 0x5ac3da84 0x1594a70d 0xe36cf8ab 0x52011943
+ 0x1133cb9e 0x31721c1a 0x689367f8 0xc36e0d34
+ 0xb40cd03d 0xcb4a6560 0x6fde32d1 0x3cc41337
+ 0x6edadb0f 0xeb94107f 0xbdce6c1c 0xb680fea9
+ 0xee5705ed 0xe8ccfd9a 0x4c2e25cf 0xaec446e5
+ 0xadedad15 0xac083684 0xc09c7576 0x18500d6d
+ 0xb35975d7 0xf79b4b3a 0xcc9bbf01 0x3e1c48d5
+ 0x950f8ed5 0x9754b7d8 0x37a3793e 0xdec7767c
+ 0xbbaf41e9 0x8c630cc4 0x4ba3442b 0x9fafa156
+ 0x69d7761a 0x4a77c503 0xd735e8c2 0xd503278b
+ 0xe58a4ebf 0x87b10dae 0x390a5e9a 0x14e29966
+ 0xcc713fb5 0x9ce6327a 0x6010165d 0x4cc1c54d
+ 0xbd12d6ba 0x775c23ad 0xddb84211 0x0f3a2878
+ 0x434f4580 0x34f88ea4 0x89321b73 0x1b8c7f98
+ 0x1f3e1e48 0xc4408ae0 0x5a654fe2 0xa676c04c
+ 0x070b59e9 0x9b94a087 0x7a5ca30e 0x7752a2f1
+ 0x1723f5bb 0x3b40c24e 0x83e91275 0x644863a7
+ 0x514305c6 0xf17497e4 0x31a29711 0x75df2066
+ 0xdb9dd12f 0xddefa292 0xf227d2af 0xee3984d3
+ 0x564af7a1 0x470204fd 0x9490c3c1 0x58ec98a3
+ 0x506d606f 0x6714b347 0xbf3b9bbc 0x3bd1fc29
+ 0x91a5c7f8 0x6adbe076 0x42910be8 0xa33f4e12
+ 0x5978d19c 0x1bda9fda 0x52358b20 0x2cb124c2
+ 0x8a9407b9 0x003dbd72 0x95775e44 0xd3cdb943
+ 0xd8944191 0xd34784c4 0x49355f80 0xe0e905a7
+ 0x16b19416 0xe9ad85ab 0xac510c84 0x8763b3bd
+ 0x86cc1dca 0xa0c0431f 0xef2cc448 0x7356ebdb
+ 0x4bbc2a4f 0x8c4b2d83 0xa454eb11 0xf2554402
+ 0xb2221af7 0xf39a006d 0x1f40db2e 0xcf1b4b24
+ 0xe6ada442 0x5715edf6 0xbd88c5fd 0xf8370676
+ 0x6374fa3c 0x21c43044 0xe09eba2e 0xd13121bc
+ 0x235f2e18 0xe920486c 0xd6d3ed96 0x3e65592a
+ 0x35b28b3e 0x968288f7 0xb1a8f263 0x2a095921
+ 0xd733dd90 0xc27f602a 0x57526980 0xbcaad755
+ 0xde77b9da 0x8b6f33c5 0xc6977d38 0xe0898599
+ 0x665dee18 0x2af9bdc8 0xa71446d1 0xac3733e3
+ 0xcd300da1 0x100af68b 0xe8ef9fc5 0xb328cd95
+ 0x595c7a2c 0xc33cbba8 0x45f779f9 0x84429560
+ 0x82c4b759 0x628472a0 0xa7aebca7 0x1f4d3017
+ 0x9dac2596 0xbb573467 0xd474a54a 0x7b0f53e6
+ 0xb931bc25 0xc3fd70d7 0xd7ec2eb1 0x2d537c85
+ 0xc718e6a0 0xf8e50b5a 0x4eca90d9 0x9d839c71
+ 0x23d47a3d 0xdff0d61c 0x6d04a0e8 0x0e166309
+ 0x2af6917d 0x0a1252de 0x7a62f303 0x5c2e9ecd
+ 0x7ac2223b 0xdce1ab0a 0x9e9cfecd 0x702a1549
+ 0xd2262e68 0x52c93a56 0xd45432ed 0xe43cb580
+ 0x2807a30f 0xc0aa2425 0x78ee782a 0x03ff6460
+ 0xd3e351ff 0xafbbf095 0xfe016746 0xfb3dde4a
+ 0xc0a78518 0x0f531fe1 0xec2b4f14 0xec05892f
+ 0x01a2db8d 0x76a8db65 0x95080291 0x68cd235e
+ 0xd6046324 0xc562bba3 0xe6b2eac7 0x9012954f
+ 0x7918aaa0 0x34c21d45 0x3235dfdc 0x6c3e5b04
+ 0x3aaf4137 0x8932ab1c 0x58b18c4a 0x2a81d2cc
+ 0xa70d05fa 0xbe0b315b 0xb3ebf1ef 0x5ffb7ac3
+ 0x887325e0 0x004a96c5 0x45dc30d7 0x38c52d24
+ 0xca444ba9 0x142402d7 0x4a437132 0x463f40f8
+ 0x5c40858b 0x90822d4e 0xc8256844 0xbcfb6faf
+ 0x357b0e86 0x5110fb28 0x114a531e 0xc322c375
+ 0x18cb1cd6 0xf0859c76 0x9a165fdc 0x4112bcae
+ 0xf7093213 0xe8b29412 0x1da7320a 0x7faba7c1
+ 0x57978831 0x45e74710 0x8ebc83d7 0x32116337
+ 0xdead9fcf 0x77c48252 0x18e3becd 0xae616db0
+ 0x8f5c4cbc 0xe7f7a56e 0x60e216e7 0xe2414c4b
+ 0xeadc1dab 0x81d54f1c 0x230a9758 0xa695cf15
+ 0xf40bc8d9 0xbdf2c94a 0xdf5986ca 0x3805965b
+ 0x4ba27c7d 0x4569d8db 0xd9fd79a0 0xf22f0afa
+ 0x16bb1d8f 0xc0759fe8 0x8c43e99a 0x75700859
+ 0x9ffe4ab8 0xa570f2d0 0x524e3a01 0x56dad32c
+ 0x85d55e45 0x85d881e9 0x3a93e5e6 0x89b03991
+ 0x0bf7cf97 0xbb2166fc 0x71db8270 0x38ba2fc7
+ 0x9921e2fb 0x8d590f34 0x6dc126c6 0x83bf3833
+ 0x4b610fc7 0x5ea14f5b 0xabc0b232 0x621b6371
+ 0xdbac1530 0xabded327 0xadc1bfe6 0x2c1700f3
+ 0xed5fd6fa 0xe589d956 0x4e313ea1 0xcd3880fb
+ 0x975aa904 0x4c69a30d 0xa1b36534 0xd9fbd174
+ 0x81160863 0xed25e4c7 0x04856f8b 0xbdbd0e25
+ 0xe77bbe49 0x58f747ea 0x1e152b06 0xc81f5552
+ 0x663870d2 0x5690f730 0xac123619 0x82f38298
+ 0xad13cb79 0x8b139198 0x8b990c26 0x46f43a42
+ 0x13295bf9 0x14692be0 0x5aad4b0c 0x0170eef2
+ 0x9e6d43b1 0x3f394d21 0xa9bb5969 0x2e55fc16
+ 0x571cc833 0x2d3b886a 0x3fbdd241 0xc2f692d0
+ 0x7934aeb4 0xb4758a91 0xec7840e1 0xcbeb4483
+ 0x49d89230 0x8acfcd21 0x78db849d 0xdb89bc3e
+ 0x23008191 0x0cf22895 0xa4f37634 0x880df3fd
+ 0x6b21779a 0xe1b21abc 0xe9ffecd3 0x6b03d356
+ 0x1dc13c44 0xd47e5606 0x39a45bac 0x2e0d0d43
+ 0x3f6804fb 0x39184454 0x519c8340 0x3aa1de30
+ 0x230bb743 0x672c5a77 0x1578491f 0x66ea9f3d
+ 0x91290f01 0x241bff3a 0x96ebf092 0x800e8a44
+ 0x386775e4 0x4044777e 0x32c90a90 0x091f1a68
+ 0x4c3cf321 0xff7c5bcb 0x6449fb26 0x1678b234
+ 0x9ca07a55 0x73bed56b 0xae871520 0x56607c8a
+ 0x3d891862 0x91465f3c 0xba0a008f 0xc12647ea
+ 0x3ed57a74 0x20511850 0x1dacfbbc 0x1be85a51
+ 0x7c4dc3a8 0x8bf69d64 0xcd12a3af 0x7f7a8947
+ 0xb782d3fc 0xd3baa39b 0x654a6f2c 0x4e8098b7
+ 0xeaa2a9dd 0x7b1444fc 0x1b17a8a3 0x5477c47b
+ 0x98e3989f 0xb165aad8 0x934b1a26 0x3c7396df
+ 0xa0df197e 0x88402f6b 0x633b4c8e 0x188368ed
+ 0xdd6ef1ec 0x10ca68c3 0xed9a9849 0x56ef27a2
+ 0x25746244 0x1b5d1e76 0xbfd8715c 0xd6c1c20e
+ 0xe5c5051f 0xcee2f685 0x3ad9bffb 0xf02b5544
+ 0xc783883c 0xb0c08788 0xc08d85f8 0xb654b840
+ 0x3801673c 0x5035928d 0x90072396 0xfc6be60a
+ 0xe1d91fff 0xd4cf7946 0xa989e61f 0x6eb27707
+ 0x7064ec46 0x66ed5e3c 0x7aaa6163 0x5a5215b0
+ 0x1250fe8e 0x98daeb89 0x06227be6 0x926fda4e
+ 0x1e5af2aa 0xcf54d342 0xb4f987d8 0xf9f691e8
+ 0xa196fec3 0xf10e03c5 0x712242d8 0x516d1dd9
+ 0x661ce323 0x299bea81 0x5da0a1f6 0xd4efe590
+ 0x233a872c 0xde7fe938 0xa8489405 0x80cf8506
+ 0xa14a30d0 0xfe0204af 0x8ec1eb33 0x45a33913
+ 0xe8f5f0a4 0x7ded8dc5 0x9bcbafd5 0xf8db53b2
+ 0xde7a9a19 0x2068398a 0x998c9e42 0xf83bb18f
+ 0x0abca1ed 0x6af92508 0x93e5d447 0x35a52d69
+ 0xee4d6b03 0x14b8f5ab 0x07e664e3 0xae5ebffa
+ 0x8a9ad0f8 0x9c61e029 0x623cc5c6 0xf53f8046
+ 0x299cbea5 0x329d6311 0x9d29e239 0x97254322
+ 0x1ab51d60 0x6a420e7f 0x9e839b09 0xfbfd0f9d
+ 0x71e79e4c 0x64db79aa 0x48312fc7 0x6aa6c163
+ 0x69f5a669 0x51897ab7 0x5be56db7 0xff28685d
+ 0x2bf568f7 0x2f397f8c 0xe2bd5c24 0x772d8c86
+ 0x72bbf518 0xa7e00c91 0x9ce87bef 0x9a87adf7
+ 0x98a234f4 0x98e6efad 0x6488536a 0xad7f3401
+ 0x1965ab49 0x15f073c4 0x1a40b820 0x8701f688
+ 0xaecfea30 0xf2710d99 0xf707183c 0xbabfa4e5
+ 0x3c656c1a 0xc7871ed1 0xb7e38fce 0xa17c51b7
+ 0xd136159a 0x500db2ac 0x6beadfcd 0x9e250948
+ 0xd48185e0 0xea424945 0x3fd0ad9f 0x692c55de
+ 0xb546a831 0x15ceca7d 0xb96f7585 0x329567c5
+ 0xc328daa8 0x795bed48 0x8d589ec1 0x59c5039d
+ 0x69b9df49 0xa3a9bca0 0x33f21d47 0xa5b4c884
+ 0x1524d082 0x04b8e6ed 0x2cfac981 0x8b2bf91f
+ 0xb65cab78 0xcaed7635 0xdf50f8d2 0x8d9894b2
+ 0x2c7dd4e1 0x2f0ba31a 0x8a2ad05a 0xf020143b
+ 0xd6443af4 0x43d99a7d 0x5932a8ab 0xf439abee
+ 0x358c39e0 0xc948bdd6 0xe0a23f1b 0x6a3f975d
+ 0xd0869563 0x2091634f 0x25a37a45 0xc98b748b
+ 0xb4c07888 0xadf3c21b 0x91aa6e90 0xd301e5b2
+ 0x831e9921 0x5cf2d88a 0x3d875085 0x3fd7e37b
+ 0xd80ee010 0xd61d0af9 0x300dcd8b 0x65fc3adc
+ 0xb62e5c17 0x570369ec 0x413f3135 0x4347b1b9
+ 0xa653d898 0xa374f9b2 0x5ea98269 0xb85bce61
+ 0x3c94ce20 0x671ce756 0xf8840f0f 0x870554a0
+ 0xb2aa3364 0xd4ee24bd 0x4c0a73d5 0x2b700d83
+ 0x8adaee09 0xfe9ec1b2 0x5d2a21ae 0x1e1d5cd3
+ 0x1ba3e0cc 0x5a940afa 0x2d4b46f3 0xaad74fa9
+ 0x1dbdb7a9 0x451f3977 0x4cba6d31 0x56fb678e
+ 0xfbfc193d 0x0c7973d1 0xaef4a731 0xfce12223
+ 0x11357778 0x83979d22 0x0194c5f5 0xce3dde5d
+ 0xeebd0bba 0xa0a07102 0x79539b0f 0x13bd2dbd
+ 0x6333c870 0x796b06ba 0x14470ee3 0x2780d6ea
+ 0x5dbc7ec2 0xd0c1948c 0xf82e5a52 0x929faae4
+ 0x53d79d6b 0xdec7f7e3 0xc0b80845 0xc8b63c35
+ 0x4ddb5449 0x7073c226 0xf207efd9 0x69b680ba
+ 0x22b7258e 0xd55168a0 0x9ff88d23 0xf80cf9e0
+ 0x95a95370 0x51bb4bdb 0xc743f83a 0xfc668525
+ 0x6246454f 0x1665241f 0x44216a86 0xce93a0a2
+ 0x6078e3a4 0xc6691a3d 0x238c4ddb 0xe3eb70f3
+ 0x6214f1da 0x6d86378e 0x0c904f40 0x5e813cf2
+ 0x27ad8a9e 0x27d81514 0xe2fd4749 0x8620e50f
+ 0x1316acc7 0xae68b637 0x148be177 0xf558c991
+ 0x8e25a2a4 0x0e5919df 0xd9f19ac7 0xc6a0c708
+ 0x042cfade 0x06770c05 0x5a76957e 0x587fd2f8
+ 0xb31370d5 0x828ed6cf 0x0f3b1a8e 0x1779a530
+ 0xd3b1d8a8 0x0d5aae00 0xa982cd22 0x7b82472b
+ 0x8056c1e1 0x226f6f6c 0x0fd80cd3 0x97d96da4
+ 0x61805e7a 0x84df2731 0x5c999636 0xf46741ae
+ 0x5bafac8a 0xf871d4d9 0xde6ad6b9 0xcab5859b
+ 0x77f78bcb 0x2e7a51f5 0x94e2c9d4 0x22d39537
+ 0x3b3d07ec 0xb5f392c0 0xbcd94eba 0xce1fb95d
+ 0xca716f56 0x5a8f7c2d 0xef9de54e 0x08845d4c
+ 0x767a59dc 0xfd170b05 0x05027d26 0x1f806f78
+ 0x5b66a678 0x3e137ea6 0x01e7fc4c 0x76df5d65
+ 0xe9cf9ef7 0x2af76225 0x2f42dcb3 0x28a8858f
+ 0x0e15b08a 0xd4e07b3c 0x02c4cfd6 0x8f2dae02
+ 0x973c6f32 0x5e9dec57 0x69c641c1 0x78bec8db
+ 0xbd5bc82f 0xad39bc31 0xcb10aa49 0x27ee22ab
+ 0x2dedabca 0x30789cce 0x2a215f15 0x05ea393f
+ 0x69757b87 0x787e3b1a 0x9c7b25e8 0x151ea785
+ 0x25c93b80 0x4bf5cbc3 0x73cca060 0x6c00be42
+ 0x967ef3a8 0x6293519e 0xa1007d65 0xa4ccff75
+ 0xc69c8843 0xf96b8b73 0xbf338ffe 0x2750acdc
+ 0x87fdbc7f 0xa0832263 0x90cb0912 0x54264748
+ 0x26c87710 0x143a9d62 0x37be9819 0x7d3b4fbd
+ 0x9af2eb14 0xc83b0d46 0xee1c4432 0xe156c2e6
+ 0x49d5f472 0x124f050b 0x7fe3af42 0x4aee49ef
+ 0x74188fab 0xca15c353 0xe774845a 0x04e7310c
+ 0xdd6dd6ea 0xb5a6d613 0xeb9b77b8 0xd5947bf7
+ 0x6ef9eafa 0x3aeb45f8 0x49351d7d 0xa072f018
+ 0x7483e5e6 0x6f13b68b 0xdebdf954 0x50b4385a
+ 0xbd5e9f33 0xfb744026 0xc1f830ec 0xac83bf60
+ 0x76a9ef51 0x32d18f5f 0x795f2e19 0x6f7fa556
+ 0x99c7aca1 0x69381821 0x8d44d1c9 0x948c584a
+ 0xd0be173b 0x4030e8d8 0x3651bef7 0x83248705
+ 0xbcb4dfaa 0x431de6ce 0xb2503d15 0x1169e47f
+ 0xd213aca1 0x745ae622 0x5b56bd12 0xad126322
+ 0x54704fa2 0x694f056a 0x49115d92 0x3d807e20
+ 0x47632e77 0x1311112b 0xbf06daad 0x95aa4cc3
+ 0x9aa92f52 0x65d57230 0x88f7aa75 0x54a57a2e
+ 0x713be92c 0xbb8b3684 0x9dfecc66 0x448d2c0e
+ 0x3f9883f8 0x9652fa29 0x68860bdf 0x011d897f
+ 0x4b0829bb 0x4cc674b8 0x01f13646 0x00a488ec
+ 0x65501a3e 0x88e128ec 0x827ec0ea 0x4b5175f3
+ 0xac5cccef 0x438201ce 0x79ecd144 0x469c28e0
+ 0xf91af7dc 0x97371a54 0xe29260ff 0x13a9436e
+ 0x311a94a4 0xa4da86b6 0xe18b73e9 0x8ed1854d
+ 0x057da825 0x34228358 0xb1063f97 0xeda2b117
+ 0xbc542204 0x7cc094d4 0x82c1f257 0x34d4ab20
+ 0x0e505a65 0xbb0f2cb4 0x8e5e4b64 0x67c2880d
+ 0x209583cf 0xdf65f51a 0x25eab3ed 0x4b2d2ff3
+ 0xbb137ce7 0x244be9a1 0x0a652ef9 0x3dd71282
+ 0xdc02f2a9 0x809f3ae4 0x17b30a32 0x9ce532b5
+ 0x7bde0397 0xb60616bb 0xffddcb18 0xf6f4be58
+ 0xcde163e8 0xd1ad7114 0x8cb41a81 0x6f02b845
+ 0x269439a9 0x70172077 0xb6f09684 0x28400ccb
+ 0x48aea720 0x2e1d720b 0x6b7799b6 0x3cf03de8
+ 0xb3ff42f2 0x3eb07288 0x90755be8 0xfb7b265c
+ 0x0a4fdd27 0x0efabd18 0xc043b53e 0x8e0a35cd
+ 0x57218045 0x66b0d97b 0x4641544f 0x889a0b79
+ 0xaca4b9ba 0xc226cded 0xf8089e7d 0x18416a78
+ 0x5085bf5a 0xa89f9cb1 0x588226a0 0xac3935c7
+ 0x68cb7d75 0x74853fb4 0x8ee36c87 0xc72986e8
+ 0x9d8aa967 0x509c1eb5 0x4d4ef31a 0xcc4f612c
+ 0x709b7b77 0x5c108a3c 0x8a654bce 0x8aaf712a
+ 0x398419f9 0x28cb7bdc 0xa90c4235 0x6c19408b
+ 0xe0ccda3e 0x33202fc4 0xebae0f73 0x4278c68e
+ 0x07273009 0x68931945 0xf9b50bb5 0xa43fc355
+ 0x5fc9877f 0xde15c6d9 0xf3f095f9 0xf1bc971d
+ 0x256ac91b 0xedbf0776 0x1f55cc83 0x3f422ff3
+ 0x2498d1ad 0xfa8eda95 0x527d9641 0x99901d61
+ 0x5c35e5ca 0xe8cffe68 0xe775e61f 0x21227b0f
+ 0x3af6636b 0xaf08f8fd 0x39ba8287 0x127d3209
+ 0x741bff23 0x52f5cc78 0x40e2f91a 0x51f0fa79
+ 0xa942e22e 0x3ae5bcf3 0xd9bef6cc 0x455dd4ed
+ 0x0b827356 0xecd8e59a 0xa80f1f2a 0xcce386f8
+ 0xcfeb2982 0x13dd110f 0x607275ec 0x0c766ef7
+ 0x3b4c1585 0x30cbbeb3 0x57b4ccf3 0xc063c086
+ 0x7cf5a420 0xf50bf1e0 0x7e2092fb 0x6ffe6057
+ 0xdbb47ae4 0x56a6d4c4 0xb47eb358 0x63d7b718
+ 0x3cd7369a 0x92fdff12 0xfd869092 0x878665f3
+ 0xff5a0256 0x42c2f259 0xf0cb21e1 0x658dcc4e
+ 0x80e9f85f 0x4c1fc304 0x5a8f1d47 0x1abc0020
+ 0xf0bb0522 0xf3294457 0xf5ea2f35 0x6681598a
+ 0x14733bcc 0x212c92a7 0xfbc293b9 0x81b49d81
+ 0x245d5926 0x9e58b86a 0xe1645ea9 0xeecb5059
+ 0xba81810b 0xc53dfb94 0x412de939 0xf3c1b5b3
+ 0x2e167708 0x3e74c972 0xfaf16b5c 0x57814119
+ 0xbad6c81a 0x6e2935dc 0xf7a1f5ad 0x25b5bd84
+ 0x9ddefb80 0xaa2b3a77 0xa9f91dee 0x9aaad6b9
+ 0xbba274b1 0xb08d295a 0x8d84ba2e 0xb5fa3475
+ 0xa8caefe4 0x09b2a662 0x8da4d199 0x194480ba
+ 0xe89bf8d4 0x11e77f26 0x18084e74 0x37f48f62
+ 0x7c3976fb 0x23b49e49 0xc3b5d5d6 0x25080932
+ 0xb4e708e7 0x01503dd8 0xf9396ffe 0x2d9b1d51
+ 0x94b14742 0xee6bc1a1 0xb5a2895c 0x1c914541
+ 0xbe5980d8 0x86ed8a24 0x3d52a7a6 0x4c77d74b
+ 0x8016911c 0x56b007fa 0xd1efce31 0x15326640
+ 0xf5c053dc 0x7012707e 0xf183699e 0x7969c341
+ 0x23b2103a 0x2fa21964 0xd549dab5 0x376dcd1c
+ 0xb327b470 0x22b045ab 0x4b00cec6 0x241b2bda
+ 0xf075633b 0x74d3fe57 0x661901c3 0x0fca71f6
+ 0xda0cc159 0x1367aaf6 0x835816a9 0xfc98b063
+ 0x7e9ca2df 0xbfe73c8e 0xa3834b1f 0x79614541
+ 0x854853c9 0x95492fae 0x27603fd4 0x55e1e93a
+ 0x25528bb3 0xd30bac22 0x1fecde8c 0x31002163
+ 0x2f01d7db 0x8596ff2e 0x20f80182 0xc324f92c
+ 0x1cd21542 0xbe094f03 0x9f43609f 0x50de10a4
+ 0xfff2f867 0x46b43556 0xaa8ee529 0x1856d8c2
+ 0x58656b90 0x3e7c2d81 0x8b4c6a74 0xf706c8f5
+ 0xc41e8962 0xea262591 0x29c2e013 0x4422b666
+ 0x86c7d6a4 0x5fa23c5c 0x32c2d31e 0xae72c75a
+ 0xa3dd046f 0xbc7c5f37 0xed94a3a5 0xd9a22859
+ 0x79d66f46 0xa6b4990c 0xfc49a056 0x74a1778b
+ 0x73811c97 0xd24440b1 0xc626124d 0x23ef8511
+ 0xa317d2b9 0xa5f9d7fa 0x326885b4 0x99e226c2
+ 0xea78b5d1 0x6b58cb66 0x8b5be497 0x48e964f0
+ 0x55ab4913 0x3301bf75 0x330e2743 0xd415a894
+ 0xf38ed952 0x00e6e660 0x55d26c36 0x55f12ded
+ 0x3846c0ab 0x63d58c09 0xfba15dd8 0x1e60bf12
+ 0x62f5a93a 0xb5986564 0xb98be31a 0x6f66a4e5
+ 0xdefdcda3 0x912fb317 0xf8c0488b 0xa4d941a4
+ 0xeaa5a8d2 0xb1f035cd 0x95f051e9 0xe29d05ce
+ 0x3e44b749 0x46fde8d0 0x39937696 0x224c3be8
+ 0x5a232a7a 0x0ca9041a 0x99fad21f 0x0303cfb9
+ 0x1a7643b7 0xd55d8c66 0x32060e6e 0xeda6ce0e
+ 0x219c81be 0xb5433840 0xfdf82993 0xac80ba38
+ 0x7772a04c 0x91f68bba 0xf42910df 0xad82db9e
+ 0xb35415ae 0x1d40f2c5 0x1fd01178 0x6d7eb7e5
+ 0xaaf2dffb 0x4779bf28 0xd36d0310 0xeb368a47
+ 0xb8ba4d9e 0x58fc0973 0xbd9ee703 0xbf969251
+ 0x1e35ae1a 0x447f8cb8 0x21757d93 0x1eb0dace
+ 0xc6f846a1 0xfb64ec19 0x494891b7 0xe4d35c15
+ 0xb9c50a38 0x89dd11fd 0x8bdc21f1 0x7343cf00
+ 0xc3bf71d8 0xd9a8af87 0xe5dc66ac 0x1c7810e5
+ 0xde98ce69 0xefd45cb3 0x6e32ddc2 0xfd6f4664
+ 0x3dad71c4 0xe2fb9131 0x2b950f11 0x2f189912
+ 0x0c7c01be 0x5f5dcf8b 0xf874aab2 0xe203451e
+ 0xb224fa47 0x579de04a 0x997ea108 0x5fc8d34e
+ 0x7bfb8a8f 0x6cb8ab68 0x7428234b 0xcfe16973
+ 0x3ca221fa 0x100e1072 0x93cd8af8 0x0abc2b73
+ 0x747b8f09 0x1427ec11 0x0d367b23 0x0ea4719a
+ 0x1ee649e5 0xd1bab2c6 0xb46c9dff 0xaeefbee1
+ 0x8de92617 0x7efb9ae9 0xb7542a1a 0x44a56df2
+ 0xb757b1d5 0x60ca058e 0xc67417f5 0x137cf58a
+ 0xb497b8a6 0x55affc90 0x6ad41636 0x47f53b8f
+ 0xfa8af101 0x4e4af0fe 0x5b526ee2 0xf7e1d851
+ 0xb2437be1 0x9d0d9600 0xd10b4e97 0xbd90a40b
+ 0x966e0f4b 0x2cc630e0 0x5dcd5377 0xe4fc80af
+ 0x6607c3e6 0xcc854f4d 0x65e70ef3 0x1aca994b
+ 0x556e06d7 0xb57db273 0x906eb1cb 0xe5542c5f
+ 0x45a0f2aa 0xa6066d4a 0xd11291f5 0xd9c392f9
+ 0x05ae1288 0x569395f3 0x743327b8 0x742b1c18
+ 0x795dff3f 0x00d635cf 0x0317a1bb 0x420a6ed4
+ 0x648b926b 0xc3c1333e 0xd5e904dd 0x479bcfdf
+ 0x8ae63fad 0xd71f204c 0x4c311f39 0x5cbdf76f
+ 0xe5bd4205 0x00721bab 0x9569c091 0xc4dd5f40
+ 0x739434c7 0xe6adb73e 0x34af4385 0x8627216c
+ 0x9d357195 0x9d2f5112 0xbe543ed5 0x0e1037f9
+ 0xddf7ac02 0x72ef5cb5 0xb8f6cbe6 0xdb1aa017
+ 0x5889b094 0x05d80d45 0x2ade1d37 0x6716f816
+ 0x94f6220a 0x53b4beae 0xeef5361d 0x17e7cb90
+ 0x10c536f4 0x01cc42c8 0x587b6f85 0x783261b6
+ 0x3e60d172 0x93d2a63a 0x20e44c63 0xa415cc75
+ 0x6de5620f 0xad7c5e97 0x8ad48c9e 0xe1fbfe36
+ 0x1385f1cc 0xbfc81bd0 0x7b8db259 0x00cc93e3
+ 0xe79afef4 0xb245cf74 0xf7cf840e 0xe4f75bb5
+ 0x6b5e5534 0x16919a9f 0x24933a7c 0x709a67a4
+ 0xb06cc7bc 0x27d00d60 0x23eec9c1 0x2557aad2
+ 0xd7b53016 0x6a626d84 0x837ac48b 0xfd58f0c4
+ 0x9f0d275e 0xf6ff3e6a 0x608ce8de 0x69a82582
+ 0xcb80c55e 0x0097ca1b 0x53a45277 0xc0d87cc9
+ 0xfbbb2867 0x048a0b96 0x567bb875 0xe42cc027
+ 0x1cfc40a7 0x6507709e 0x9e70a491 0x65ca4078
+ 0x91473cee 0x009c0bf5 0x648566e9 0x191c8cc7
+ 0x4fd72a58 0xea4823b5 0xa09ca42d 0xeba4fc85
+ 0x9af017a9 0xe18fa00b 0x57dabf57 0x4b8d6557
+ 0x76d9bbd0 0xfb4511d2 0x13624ca3 0x2662cab1
+ 0xd9cf4ed2 0xa0927b7f 0x0593ed03 0xb2ccd2b1
+ 0xb026f8d6 0x2393232f 0xaa7de1a6 0x212c2b41
+ 0x6f6a502b 0x960dd830 0x5e40123f 0xa772ce63
+ 0xa2b350fd 0x9be53f1f 0xb49ff483 0x6e7198d5
+ 0x184d5de4 0x8caede59 0x92a69f17 0x3944317e
+ 0x5b83e785 0xa2a1600f 0x88f4c890 0x7d0f0751
+ 0xa4dc4724 0x306c2422 0xa55778d6 0x3468cb7c
+ 0xdbc43d8f 0x97518c45 0x3786f4cf 0x59be6d38
+ 0x81328f07 0xc886c08c 0xe5f5a2c8 0x805cc450
+ 0x201025cf 0xcac77654 0xe03c5999 0x7f2fe9d8
+ 0x2d7cd63b 0xe37bda44 0x3fdafb55 0x1baadc8a
+ 0x04b9c4e8 0x05033691 0xf0542f66 0x076b9144
+ 0xa95b0460 0xffd59ee8 0x4adfad44 0x5c3d4ada
+ 0x85405a17 0x809bce8e 0xf76e4473 0xf2bbd4d4
+ 0x76bd3c17 0x197f08ae 0xfc72d944 0x61b871f5
+ 0x3cfd0867 0xd506fcf5 0x323b6c2f 0xe9a4e05a
+ 0x41559058 0x2497797d 0x8239ef53 0x90c9da08
+ 0x6fc6038c 0x4565e030 0x98dcf8bf 0x0d258c28
+ 0xd3b2a435 0xedc58062 0x9bf5fdf0 0x418a4f4f
+ 0x52493701 0x0f52bbae 0x4c1cad5f 0xeeabc56b
+ 0xcc26d83e 0xc8699144 0x711c8293 0xc94977ff
+ 0x64207548 0xaac1fc9f 0xb9ec2518 0xd42a581c
+ 0xc5d176b0 0x76148e4c 0x57e7c22e 0x50d79d68
+ 0x7261349b 0x01fc0a26 0x2e0741e0 0xd8990e91
+ 0x5ccdf76d 0xf253b0ae 0x0b4cefcc 0x87905632
+ 0x86c6bee4 0x34156b61 0x188af518 0xb8aa7c05
+ 0x51c6c308 0x99de423c 0x3e284f44 0x1352c866
+ 0xca90bb4a 0x561e0a54 0xbc48090f 0x87783530
+ 0x5ecafec3 0xaa11758d 0x02a3c95c 0x5140bf1c
+ 0xe710e834 0xcc792227 0x97c8fdf5 0x3d4ae80a
+ 0x174c270b 0x131bcc61 0x6a2d1ef0 0x858938c5
+ 0x7110b82a 0x98042869 0x658d6b34 0x2eeb4686
+ 0x0489e246 0x7c6c8fa1 0x1591b423 0x70cb970f
+ 0x63a77870 0xedf82598 0x6a59690b 0x22e9870d
+ 0xdecdd549 0x232340b7 0x603b48a1 0x181e7fea
+ 0xf62fbb42 0x44e88f9d 0x6b2dc3d2 0xc18b8c47
+ 0x648fb362 0x89c05984 0xe0e48711 0xbc36bb8c
+ 0x237b0266 0x38bf387d 0x975b0518 0x74fa5799
+ 0x8f49e13a 0xffe74abc 0x913b590f 0x93b0b2c2
+ 0x3eb3015a 0x38a0f94d 0xa62343d4 0x709b1921
+ 0x759458ac 0x5c9d5b02 0xafc56a30 0x29176dc6
+ 0x95640730 0xba946241 0x309fa854 0x2653120f
+ 0x6125e744 0x71594382 0x59ba63ab 0xbc820a96
+ 0x459d1b68 0x8addfde6 0xbd3960fe 0xcc128ee1
+ 0x5f1b4726 0x505e1816 0xe9f4eff4 0xc4a372df
+ 0x61d52ed7 0xb75d3184 0xf007e704 0xe80889b3
+ 0x4914100d 0xdc433905 0x507dc5fb 0x91e71741
+ 0xe8a8aaf2 0xa9a58028 0x8e452803 0x20d19046
+ 0x45d6804e 0xc5c6f4fc 0xeaaddc2c 0x34375983
+ 0x198ef17c 0x7383a724 0x1436c902 0x6cef7fe7
+ 0x7dcaba1e 0x55333649 0xaca12dd1 0x9f5ea721
+ 0xb524b004 0x13a3172c 0xc3074bc8 0x61a56a47
+ 0xc1ff249d 0xd012ad08 0x65dd207c 0xa8d38a54
+ 0xbf37ae04 0xed970086 0x03502e78 0x81faf743
+ 0x028dd6b5 0xafa8dcd4 0x84aff729 0x8079435f
+ 0x07433cf9 0x5acd7db7 0x63b5a865 0xedd0ecb4
+ 0x38198a9b 0x306ae22a 0x7ee63ba0 0x696b2fcc
+ 0x6e87ba2e 0x40a149eb 0x97bcac21 0x491e81be
+ 0x5862ec1e 0x7a37a598 0x8161e060 0xf0d2ef42
+ 0x0aae1b6c 0x9744329b 0xe8b428dd 0x7ecd2710
+ 0x28db6ee9 0x99cdae78 0xdb6438d4 0x99777322
+ 0xd99188a4 0x43c7af5f 0xb5194418 0x2ff77c3b
+ 0xdeabcecb 0x6a5a52c7 0x91f8ce20 0xc9d2c8c4
+ 0x855618c3 0x59479754 0x7f244182 0x688c271f
+ 0x38de9c9a 0x42fd5cd8 0xc9df931e 0x1791c2c2
+ 0x0006c6bf 0xefc0c89b 0x135f4fd7 0xd7ea17fa
+ 0xa76acedf 0xc4824dc7 0x5e74e2d8 0x784e00ed
+ 0x8c376c35 0xfd8915d6 0x63274627 0xfe4de86b
+ 0x057c780b 0xa3628ac8 0xb86fa094 0xa4180313
+ 0x98260bbf 0x31ffb6a9 0x346ada5a 0xf52cdb37
+ 0x990a0e04 0x1dd4f630 0xbc4b09ec 0x4f511d06
+ 0x827c673e 0xb16140e2 0xb4cb87a9 0x5aa641be
+ 0x3d3116ef 0x88e1130e 0xca5996f7 0x4913c5e4
+ 0xfef485d1 0x99899cf4 0xd2b8b8c4 0xbf605102
+ 0x9012aae5 0x24c2488c 0x98225b96 0xc6004100
+ 0xe9786694 0xdcf08ea1 0xe9a9698e 0x6d9985be
+ 0xf6c7bbc7 0x7913dcef 0x24c541f1 0x326c0aa4
+ 0xd6356e79 0x53260a76 0xa7927e05 0x16a67516
+ 0x2fab1dd6 0x68108bb8 0x7a184c86 0x5ed42c2c
+ 0x00d0b46b 0xcf5062cd 0xf06c2b38 0x2f1eb5f6
+ 0x72430b08 0x7faed127 0x8d52bc6b 0x0c01189b
+ 0x55926abc 0x5b43cb79 0xeb10fec6 0xfe3fe206
+ 0xfc43ab4b 0x33339a6f 0x65918b40 0xceae08ed
+ 0x23907eb6 0x8b50a149 0x3ee2d7cb 0x35a9c1bb
+ 0x33b9965b 0x13d0c07f 0x6e966e00 0xff6211f8
+ 0x1fcdcfb0 0xa45be5c4 0x6bb10242 0x51beb3a7
+ 0x5c5cbec5 0xff3eecd6 0x2f31ed96 0xb871733c
+ 0xa79abfd7 0x755ea2a3 0x5afd3104 0x632b74cf
+ 0xf5533208 0xeaa7858f 0xa489a246 0x8d3db27b
+ 0x80209a3d 0x6f821974 0x7a877499 0x698b0919
+ 0x8b522259 0x25b09456 0xb59c406c 0x214b6573
+ 0xf71ec38a 0x986e5402 0xea7c22de 0x474c0e97
+ 0x1c701f5d 0x572161c0 0xe6bb8f21 0xb9d37b66
+ 0x3bb33780 0x27c0b0fa 0xcd6c8ad6 0x0ccfbd2f
+ 0x87cb8197 0xf8062bbe 0x1c89176d 0xd6a8cf38
+ 0xfae92880 0x265d58f2 0x78416c5c 0x91a4c986
+ 0x09773b9b 0x151029e1 0xdf2c9056 0xc011b423
+ 0x38e01955 0xc9d3bbe5 0x3a1a8cc9 0x737e1832
+ 0x8056ab36 0x5397b84b 0xb5693b6d 0x0e04bc33
+ 0x55bd54ce 0x8f8afd54 0xf925eedc 0xd5735e1a
+ 0xfc83706d 0xd31afd37 0x60d53ed8 0x3921b0db
+ 0x27c52f2e 0x5eff5a29 0x1457267e 0xba02940f
+ 0xeb87265a 0xfba11a54 0x286b3d5f 0x62c8dfe7
+ 0x09acaaa2 0x7e324ca9 0xf88732b1 0x21519a6d
+ 0xda939cc8 0xdc7b7a3b 0x3cea28fa 0x1ebf4bbc
+ 0x481cbb29 0x4d6500b9 0x9d916185 0xc3c8abfb
+ 0xd918d34a 0x98e2e731 0xf171bc7a 0x7ed1767e
+ 0xb248576e 0x75b26cc0 0x32d29a34 0x4bbb60a8
+ 0x15353f33 0x0e3a0040 0xde8accb9 0x40958226
+ 0xad766a5a 0x1d5034d2 0x50e31058 0x020f0334
+ 0x2a5a36b6 0xe1bfb70a 0x02d3feea 0x64784369
+ 0xd26937c0 0x3d21e686 0xb509f055 0xdd080923
+ 0x22c6de8d 0x69ad6af8 0x66d5684d 0x39528761
+ 0x281d1c67 0x9f4847e6 0x52b5d5af 0x81e016af
+ 0x4401e179 0x8677e61b 0xdf2681ae 0x2fec63a6
+ 0xe1f26427 0xf2e91904 0x5ad56cbd 0x96c23a3a
+ 0xab858070 0xd8b56be7 0xd92ea61c 0xa922c734
+ 0x7a246e49 0xaa278bc8 0x7d8976f2 0x088f0c0f
+ 0xbbbd5d97 0xbd52d675 0x45c1d287 0xad02c87a
+ 0xe4e2b055 0x288c0b15 0x9176daee 0xb022bfac
+ 0xa23fc53f 0x5b019da2 0x602a8d94 0x2222c82b
+ 0x938677ec 0x09958df7 0x1d0f7daa 0x2dd8a9c6
+ 0xb3450f31 0x1df9e65e 0x8d3067bc 0x5249e896
+ 0xdb9f621c 0xe999d84f 0x784bb655 0x5e35eec1
+ 0xe689d839 0x304b033c 0x01082ace 0xec0f9627
+ 0x928ef406 0x3e5d7ba8 0x7b4c53d6 0x83735573
+ 0x5ead53f6 0x09c717b3 0xecf35a9b 0x3ed01fde
+ 0x1696aa1d 0xf7cb4817 0xe2fcd66d 0xee3ff786
+ 0xcab1b89c 0x13a03cce 0x1327498a 0x8960e308
+ 0x572a3588 0x01a84bba 0x15ed662e 0x7dc1e12a
+ 0xab2be262 0xa94f4d74 0xd2f1d04e 0x387d937f
+ 0xb47af6c6 0xe0d692e4 0x873c59a3 0xf60df864
+ 0x600719dc 0xf2dcf1c0 0x5d4b3b53 0x0536020f
+ 0x8744af7d 0x42b7647e 0x3c4fa6e2 0x27f85072
+ 0x859b6c71 0xc2da0dc6 0x96880d43 0x8ebfdcca
+ 0xf64fc35c 0xdc890edc 0x9ac62db3 0x03b24059
+ 0x5d4df402 0x9157910c 0x71d0c724 0x6ffb801d
+ 0x8138640c 0x58287f9c 0xcdfe7312 0x5d42ac32
+ 0x43ee41e3 0x601faba1 0x2d98880c 0x982ef6f6
+ 0x29fee027 0x6bf9c734 0xc6643eb3 0xf810f45c
+ 0x09e6598d 0xe922e9d3 0x9b9cd24e 0x13adbdf2
+ 0x87fafe2b 0x598153a0 0x07fe0627 0xdc9bbe63
+ 0x5fcd7a0e 0x344e9d97 0xaae1ccd7 0x12cc8785
+ 0x83bce154 0x81b6e4fd 0xecc54d13 0x78c16f81
+ 0x161274f6 0x9a84ab54 0xb0b68efa 0x8fc36d30
+ 0x44822756 0xf8b7c352 0xa3c8b5c9 0x4d79f22c
+ 0x92948fa5 0xbb1894cf 0x17cc9500 0xfba63222
+ 0xc09778f7 0x9dfcd0e8 0x33518208 0xbebb96e9
+ 0xffba3160 0x8c72e960 0x3f11d1ab 0xb4911fd0
+ 0x54bc5159 0xcaa29313 0xf7b6586a 0x0cc228d3
+ 0x936503c7 0xaa170b5e 0xd64fca4f 0x1881a6f2
+ 0x08e1c2bc 0x57b8a94c 0x2b9fd67c 0xc7879eae
+ 0x554a3c57 0x58ca2cb1 0x58fa905a 0x0c2f41a2
+ 0xf3844926 0x7d843474 0xb71234a7 0xafff1955
+ 0x8cd60a91 0xa2d462ac 0xe85b7897 0xfa94f137
+ 0xa52befd4 0x6f0ba1db 0x21381c00 0xbf231fca
+ 0x8691279c 0x29ac9a2a 0x1a5ef8f0 0x34ebb5bb
+ 0xbd3474f4 0x4610ce7a 0x4a48948a 0xecefa1ac
+ 0x2e0b10ef 0xfbaa21d4 0xf40d5dc4 0x2b3f5bbe
+ 0x1d360d61 0x58bd70b9 0x0a114fcd 0xf8355262
+ 0x52401115 0x25d59b5d 0x747079a6 0x23801f64
+ 0xfd0b0c18 0xc6e44236 0xd2744f37 0xa36fa13f
+ 0x3fd25df1 0xc6821c82 0x3a0ce1d9 0xb546ff49
+ 0x80c28886 0xabf85e5e 0x96910bf8 0x4f58ae33
+ 0xcfb853b1 0x591a9143 0xb8292dda 0x5b83a701
+ 0x35e18911 0x4d146860 0x040b53fb 0x8a5a4d4d
+ 0xb6117da3 0x9012f65e 0x169d8f3b 0x51ab1456
+ 0xc801485d 0x3bf357d9 0xd3c7e46e 0xd50963a3
+ 0xde44d541 0x10de078d 0xe07a9196 0x8c44ee32
+ 0xfbb01649 0x748edd37 0xa69ba2d0 0xfc525cb8
+ 0xd8a74e49 0xc892c44f 0xed0b50b9 0x1cf62b23
+ 0x2e881075 0x8f3a8b3c 0x24d8b09e 0x317548c7
+ 0xb3e14861 0xfeebf131 0xf2484505 0x870a469e
+ 0x59a7b206 0x7cf2f6fe 0x6d1f05ef 0x23b21d99
+ 0x29589811 0xc0736a54 0x61bcd0eb 0x0135ce68
+ 0x1729bde4 0x2dc96f91 0x41c77758 0x0d676649
+ 0x37337894 0x8adeffa5 0xe496f4e1 0xa557cd7f
+ 0xf568d996 0x57e1f297 0x92f70afa 0x781a2301
+ 0x790d71e3 0x4a7b35d0 0x6f9251e7 0x55a494fb
+ 0x76a6ba36 0x0e9f0126 0x046f22d1 0xea93ed50
+ 0xff76fd91 0x83ed0a6c 0x15bd11b7 0x935ced68
+ 0xdcc52119 0x960fcc2a 0xad91335d 0x349deaf9
+ 0x225b2929 0x65b7be98 0x0659a786 0xf65b2e2d
+ 0x08cbfa0f 0x7e8c3f4d 0x8a156726 0x36b5e58c
+ 0x989c069f 0x5459464d 0x9fc5aaf1 0x4dd86d29
+ 0x4d4ad07b 0x69c8c130 0x04e3142f 0xc95ea468
+ 0xeffb4afd 0x7a211bb7 0x952b8d10 0xbd102c4f
+ 0x67d7937c 0x83eb94d6 0x1ff1fdbe 0xb3bd615f
+ 0x08a071d2 0x50530418 0x21527174 0x93214577
+ 0xc097a66a 0x1dab8146 0xabb3482e 0x7e940eda
+ 0x0663abf8 0x050d47dc 0xa32d336e 0x4e4a887d
+ 0xdb987e01 0x8638c3a7 0x89b1b0a4 0x9f76d795
+ 0x7c46b627 0x8384bd8a 0xf77ed572 0xc9232bee
+ 0xbb45fd3b 0x12d1944c 0xb4954081 0xe771b6c8
+ 0xdfac1820 0x61dca1a7 0xec8a2940 0xd1bafc91
+ 0xf0bc4084 0x97c61ce8 0x7bc0ddf4 0xdf40b00d
+ 0xe4ad2946 0xedbabd85 0xa0c5ac70 0x0dc53e1d
+ 0xee5c96a1 0x77593635 0x7e9b23c9 0x8cee4341
+ 0x81b5a33d 0xb58c7ecd 0xc62e5f92 0xf9d39d7f
+ 0x122f4090 0xfee80c91 0x00fe09d7 0xb9afd944
+ 0x86b3b327 0x0523e8d4 0xdfbaeec4 0x596a0e2a
+ 0x97548a99 0x4774ee8d 0x8555a48b 0x73ea4142
+ 0xcb53fd5f 0x6dc88895 0x9d787f56 0x60966bb6
+ 0x403b9849 0xa1c13ab9 0xefd4e252 0xee8aed68
+ 0x66ba7d8b 0x64d4d61d 0x5f7eb39f 0x114c484a
+ 0x7713b3f0 0x8628805d 0x8a24e1a4 0x1139746c
+ 0x8a99de75 0xffefa8bd 0x9f9a938e 0xe93af749
+ 0x2eb9c43e 0x9e55664d 0x19ff5cb7 0x5782a442
+ 0xd800f3b5 0xa5bcb2d1 0xd6850316 0x3df8af93
+ 0x394ab2c3 0x6ef66c7e 0x556f73a3 0xa981f3ed
+ 0x20203c07 0x5d6a920f 0xe00a922b 0xf1903e75
+ 0xbf772696 0x21fc9a3d 0xe10229c9 0xe01ad2b7
+ 0x78f62dc6 0xfbadb04d 0x2957db23 0x8c94c107
+ 0x9ff3dcb5 0x26a3e680 0xe960b52a 0x4bbd0b87
+ 0x5abdd089 0x0dfc4286 0x829f59cf 0xe2247a40
+ 0x9d1cbccd 0x4e18275a 0xfc6a33fa 0x56af1cef
+ 0x46a5407c 0x90110c91 0x4015089a 0x00953ad7
+ 0x2c978a38 0x564c377c 0x6d6d8201 0x069e2756
+ 0x0c5fff64 0x9f9774c9 0x9609b2c8 0xe6abfd77
+ 0xa0580475 0x736144fe 0x05dc3c2d 0x6e5fc0a9
+ 0x50e0834e 0x8fbb47aa 0x90b68cdc 0x84c35ccd
+ 0xb81ee6d7 0xbfe0ce25 0x53fcf80c 0xce1cf77d
+ 0x1c275359 0x1d2b149b 0x56ebbe4b 0x4faa74dc
+ 0x07862ed0 0xdfb7fc08 0x558d371c 0xf2691a4f
+ 0x121bc61f 0x344111e9 0x3187fbe4 0x993d7413
+ 0xa8b52f7c 0x0cc39240 0x93b08b23 0x94266e6c
+ 0x9a268c2a 0x9734bce9 0xac998603 0xaa35a92b
+ 0xb784fe18 0xe6f629f1 0xc6ce9fa9 0x7e61683b
+ 0x35f930c1 0x52667303 0x41d8c050 0x2d99f78a
+ 0x3ab6d31e 0x9aab1c79 0x46c078e4 0x3f0f491b
+ 0x23d084b9 0xf22a8448 0x3dd9d718 0xc31e1563
+ 0x0ec2df74 0x1ad16767 0xfae2173c 0xb8752548
+ 0x07b8599d 0x35324a72 0xf2a68f0f 0xf8e2d671
+ 0xf442ff79 0x5c03bbd4 0x51f11325 0xe3f5183f
+ 0x9eeb69f5 0x890efeda 0x2a65b287 0xb4471c55
+ 0x8a45f5ac 0xe569267c 0xfeb1b0b5 0xd54913ac
+ 0xf2de26e4 0xd06f867b 0x29710c74 0x5fb1befc
+ 0x7025429e 0x58b8d19a 0x500f0cc3 0x65ecf67a
+ 0xfb628da6 0xe784c9bb 0x250e4bf8 0x99b9aecf
+ 0x5f4007c4 0x373a39bf 0x3b950adb 0x9a717036
+ 0x07d7a187 0x0abd3bd6 0x41370fa4 0xcf82b052
+ 0xfe5ec029 0xfb007bc0 0x63b29380 0x95b2de13
+ 0x566534df 0x25b6edbb 0xa942e41a 0xbee4d9d7
+ 0x70b6da90 0x91755dc0 0x612bd54b 0x9b40788e
+ 0x642cc160 0x9ec848fe 0x614e3528 0x15fc410e
+ 0xcc7f550a 0x7b3427ef 0xdb08937f 0x4b9afdf5
+ 0x6116eb2b 0xc0328047 0x62f0d812 0x0424e9f2
+ 0x0f893bd5 0x11476e2c 0xd26e12cd 0x6327ef0e
+ 0x404cfd09 0xbc4598a3 0x10b55cfc 0x1446ad32
+ 0x814c55de 0xf7713ff0 0x89eea612 0xfd425dd0
+ 0x003dda0d 0x702cb59d 0x145d1fb3 0x81303836
+ 0x2f3f3417 0xd6d1ea5d 0x4e301541 0x3d3f8667
+ 0x8d406f2a 0x1b8647c4 0x388dfa65 0x88dadf47
+ 0x6270baac 0xa34e0bab 0x429ed567 0x836c5e77
+ 0xc08e56e2 0xce6a4931 0x68437def 0x76ad3ce2
+ 0xec62349e 0x15429d20 0xc325196e 0x45a57f9f
+ 0x1a20c06c 0x9afa83aa 0x327e1a76 0x6d2fdc82
+ 0xd07ef3f0 0x177fe9ed 0x2bcff8a8 0xa65110df
+ 0xaf3001cb 0x5633a9de 0x1df68b9d 0x696baad4
+ 0xd0249ae9 0x02448e92 0x22bc4a0c 0x32ef7a1d
+ 0x6585b1bb 0xa66806a7 0xe0616052 0x5c722fae
+ 0xba0ab9cd 0xc8a38f10 0xbb3fe81e 0x32500744
+ 0xec813994 0x788c9807 0x2e81d444 0x88165de7
+ 0xd7540962 0x4346b654 0x6bc7cd93 0x99fec87d
+ 0x15b476cd 0x558d0c52 0x6abc5640 0x8b41a007
+ 0xc7606d9f 0xe04e693f 0x89fda724 0x5579a807
+ 0xdf33a9fc 0x1d3224c9 0xca72ab66 0x0dc9efdc
+ 0x1d498f9e 0xcffd4cc3 0x63f83770 0x1a6690f5
+ 0xa1f3af17 0x4ca7ec20 0xa8ea1e2f 0x9b784760
+ 0xd49d1927 0xb91c20f2 0x95c9202c 0xca8dad56
+ 0x5234d524 0x1856f6a6 0x2ee0b3f3 0xd7b20473
+ 0x091be698 0xcf478a0d 0xc6637ba2 0x5bb767b0
+ 0xecaab410 0xc91a19ce 0x85d25ccf 0xcc2da302
+ 0x324ee21a 0x22adbce7 0x3f2c722f 0x3f321405
+ 0x009945a4 0xc3a7d14c 0xedf6f3d1 0x81cd0bb3
+ 0x0a9b5eea 0xd041a2d7 0xa8e06a61 0x8997a4cd
+ 0xb2898ec7 0xe768b729 0x3430b9b8 0x644fb5ad
+ 0x7b90a2d5 0x48a72448 0x729dd522 0x7118735b
+ 0xb0d55182 0x4ac77348 0x441ec574 0xebab3eba
+ 0x11eecd9b 0x88b6612d 0xc5feae0e 0x92fcf02f
+ 0x4f05d5b9 0x7803aacc 0x5eb79723 0xe009b8d3
+ 0x70b544ab 0x97afb1c0 0x707a0282 0xae7c4c93
+ 0x2592575f 0x73cdcfeb 0xc948999a 0xaef3f9ad
+ 0xb3794bbd 0x4807380e 0x4eac29e3 0xaf939ae1
+ 0x80d59ac8 0x804c331c 0xcc090607 0xdc88a91d
+ 0x3b490db9 0x4f3c4eec 0x42df431b 0x56dfdcc1
+ 0xda724c79 0xd8c708a4 0x234c1b59 0x8275458a
+ 0x7b4981f0 0xc72ceac1 0x38e53c52 0x8fa414ff
+ 0x19da4809 0xb4d3ae44 0x740693d6 0x55e70140
+ 0xd21eb87c 0x906984fd 0x5702bdfc 0xd383d58f
+ 0x5fedeacc 0xd4396f05 0xf8a0b6f2 0xa357b9bf
+ 0x3a6a8576 0xa3c42ee8 0x442102c8 0x14a4bf79
+ 0x45de2ac8 0xd6754beb 0xd22d71de 0x10c6af1c
+ 0x90f4dc45 0x38e9702c 0xbaead6dc 0x2ad36a8d
+ 0xad64add2 0x99b62dc0 0x78c6829b 0xdfd7e096
+ 0x2dea8ea4 0x833ff4ef 0x61a6d864 0x8b2e19cd
+ 0x283ac076 0x8b6be036 0xab6c6080 0x8f542cb1
+ 0x314d4c84 0x0d9956fa 0xc47b5a2a 0x34b81491
+ 0x4df58d9b 0x4de1fb46 0xef7a6b6a 0x7da433ef
+ 0xd96082c2 0xd1a2adaf 0x14fc1556 0x86a72784
+ 0x2dfec1e2 0xac788574 0x69819abb 0x2922dba1
+ 0x8ab48f0c 0x9f03ca28 0x9270d2b4 0x7677f583
+ 0x27248cc7 0x92d8971e 0xbc385da7 0x14cc79fa
+ 0xc680780f 0x27848e1e 0x58d2b632 0x32790eae
+ 0x79e8d5ae 0x224d3f16 0x0b6d341c 0x224e9e91
+ 0x175e282f 0xb7c36625 0x705821a3 0x16e0bdc3
+ 0x387cdef1 0x8cdaf7ee 0x5007ca07 0x6a79a168
+ 0xa0db2776 0xfba26824 0x0e9bce6f 0xe600c368
+ 0x488f50c5 0x79739590 0x0ece49d2 0x03fc281e
+ 0xa2c8c717 0x721e90ab 0xc378799b 0x893c1a33
+ 0x13b0cd73 0x0c9081e6 0x16a9deef 0xb9e72955
+ 0x269e5482 0xad3993e0 0x2a10c681 0x7f285d76
+ 0xa395c5c4 0x911b2a1a 0x58431aae 0x0bfddfcd
+ 0xdb3559b4 0x7f49c8be 0x05039677 0x5d6e9b5e
+ 0xd9ceb3d8 0x5fd01959 0x6e8da61a 0xe246a2dd
+ 0x26a2bc6d 0xabff83b1 0x04b775b4 0xed358c56
+ 0x15f29b09 0x79fa65fa 0xb8f8702e 0xee0f1d0d
+ 0x5e724848 0x47bb200a 0x74d8a284 0x181c9830
+ 0xcf70a31b 0xf845947a 0x37a9ec63 0x4b9cf5f5
+ 0x003a3859 0xd9e303b2 0x4546be40 0x324955d0
+ 0x0a5e4ef4 0x439a4d22 0x99372ed4 0x2794c20c
+ 0x7636fa41 0x0a9b07f7 0x05b5ac3d 0xd5599050
+ 0x6f04fc49 0xe1320ba9 0x8c4e067d 0x879dfb21
+ 0x36465e7a 0x66f3ef7d 0x72d37f20 0x5cc376d0
+ 0x532df60c 0x62c1a06a 0xfd15736c 0x92620070
+ 0xb699cc1f 0xdcd068ed 0x5d8a98d3 0x6ce7f6cd
+ 0xf6c13820 0x87deb7de 0x4e906b97 0x2a745e57
+ 0xe69fee10 0x695a2cba 0x852cd7ef 0x99c0107a
+ 0x5111becd 0xcc323dc9 0x5692f080 0x46d6cdca
+ 0x2acf342e 0xbf8603e9 0x8ca56f5c 0xa72f08a3
+ 0xde60bd03 0x8bc19a08 0x2fa89646 0x44d0265c
+ 0x303da472 0xe491ff6e 0xad4b1072 0xeca3a968
+ 0xcee2577c 0x459f5af1 0x4d3c812e 0x16e94fff
+ 0xb0fb9735 0x01401110 0x242b3999 0x73c7d6e5
+ 0xd2e21b99 0x613e1800 0x9eaecb46 0xe6d4191a
+ 0xf698f877 0xd018765e 0x8f81c2cc 0x233b95f6
+ 0x849b3acb 0x8c010655 0xb5b623a0 0xbaa41efd
+ 0xf868cc38 0x253fc919 0x9f1fab25 0xda5dd9ad
+ 0xdd8e6b29 0x6bc3a557 0x1b50143d 0x8a7c04a9
+ 0x17631708 0x8167cd4e 0xa37b770c 0x67105ffb
+ 0xb78ac286 0x29c5726e 0x11416c47 0x4dc16db1
+ 0xa33efaf9 0x3b84dd88 0x570deef5 0x056a9806
+ 0x7976f125 0xc2942f06 0xd4c8c28d 0x9b65a893
+ 0x73995f09 0xa8548ee7 0x359ee61f 0x929fd628
+ 0x7a5439a2 0x5182fa81 0x62247ed8 0x5d22235e
+ 0x7aacd9cb 0x4f3cda1a 0x91311a37 0xe41d68dd
+ 0x325ac748 0xaefdd54e 0x1116e3f1 0xba749d52
+ 0x08b47631 0xbe4ab0ef 0x51ffa46b 0x52db617a
+ 0x5ade5675 0x0027005b 0xa3d99e68 0xfcfd766f
+ 0xd0824eec 0x115aef66 0x006601af 0xc1fe2c65
+ 0xa36712ed 0xb52b5a10 0xa36f677e 0x0a2fb9ea
+ 0xe1b458d2 0x6e444d72 0x13be25b4 0xb703ad95
+ 0x96792e2d 0x13580470 0x93d3b204 0x35504bfe
+ 0x720c794b 0x3d70be27 0x7655e2c5 0x6b1ae173
+ 0x8de22629 0xad32e01e 0x3d3b7907 0xd84e9995
+ 0x2e887e56 0x50be8126 0xf1a54d2a 0xbb1d6100
+ 0x08e4b765 0xaa3b33a4 0xdd09d122 0x82741701
+ 0xc1bc7d29 0x45fb5b56 0xc528a45c 0xf813f75b
+ 0x0b2ba18a 0x8da98ede 0xca7f418e 0xf3682a15
+ 0x1919fe33 0x65586c2f 0x7876cf1f 0x969c41e6
+ 0x46d07918 0x69c621d4 0x5fca0e46 0x72d277e0
+ 0x6c233976 0x9708f8d9 0xf6d28154 0xc9cc85f1
+ 0x6f357fd7 0x0424658e 0xb7020947 0x55a6448e
+ 0xc2e5f854 0x874ecbcb 0x17c24d79 0x707c78d4
+ 0x4502fbfc 0x65f1ca8c 0x2154f6ea 0x57fe2910
+ 0x7d89ac5d 0x1ce9a4c7 0x83e61a03 0xe6586a06
+ 0x53c7897d 0xd2cf9349 0x8eef31f7 0x52528d7e
+ 0x9a5fdb90 0xe1baaa8f 0x6f14a696 0x01909532
+ 0xf1f21d0a 0x74601127 0x11f490be 0xdeda6c6b
+ 0xcf85b10c 0x3562adfd 0x5504cac8 0xef8b56e3
+ 0x4b33b6d1 0xa5ebb84d 0xce401e47 0x9f6cb277
+ 0x72039e85 0x861ca68c 0x18950d6b 0x508d11bf
+ 0x349ad2af 0xf242e2f9 0x7eb42180 0x7533f825
+ 0x21a3340b 0x16e28330 0xd8571147 0xc84aebf0
+ 0xc23a975b 0xb0eea403 0x2232d224 0xf21e3160
+ 0xa1d6c39c 0x76c96409 0x9f5e2c75 0x222b72af
+ 0x059e8b47 0x388dce7b 0x39f5b246 0xd9668661
+ 0xe0a024e7 0x54edd260 0x0a270f3b 0xb6fbee78
+ 0x2c039b9e 0xaf1e444a 0xa39415a8 0xe3041193
+ 0xeeb26f2d 0x3b6ce988 0x58d74a71 0x608330b5
+ 0xd0eef205 0xc4267cd1 0xff03a1d9 0xea8ba1e0
+ 0xe4036ef6 0xa87f3028 0x90b33011 0x55242e67
+ 0xc35ee189 0x56097dd7 0x87c2b5e4 0x07a7a1ee
+ 0x641de89e 0x2f798154 0x491ed515 0x6e4ea602
+ 0x62fadd73 0x4a660586 0x047282f5 0x7955abc6
+ 0x4a1c1758 0x45d15417 0x6fdc9099 0xdc613b07
+ 0xed5c167d 0xe9822538 0xba3f8c49 0xa025d455
+ 0x4c0d0037 0xfd07db30 0x079cb572 0xaac6ba62
+ 0x9600e315 0x5a85c6b9 0xb71d5ef7 0x7f84ec38
+ 0x53bee874 0x6d9c8f80 0xf6163407 0x9239d31b
+ 0xc3794be3 0x431553e5 0xff083a87 0xbe687362
+ 0xb1b0e984 0xb3172474 0x7435823d 0xe49c98ca
+ 0x2799f77f 0x283f3ebb 0xfe0c0a0e 0x42dbce29
+ 0xe2daa570 0xf8f56b98 0xf653e89d 0x2da9466a
+ 0xe821b59b 0xcd8c1e26 0x914e9425 0xef01a32a
+ 0xe1ff4e1c 0x097363af 0xec455394 0x183506ce
+ 0x5d4e617a 0x3e96eaf6 0x337f4962 0x4809ebcc
+ 0xe7dcd960 0x0be6ea6a 0xba4f2fae 0x897c90ab
+ 0x5fb20c63 0x29584db3 0x71efe4a7 0x410d5462
+ 0x5852abd0 0x3282d97e 0x88c08da7 0x10517d90
+ 0x8203fac0 0x9198c071 0xb75e2350 0xd5dc6f2a
+ 0xfc66ae49 0xc264bbec 0x10c9a02d 0xcea6c4c5
+ 0x35860e57 0x9c2f6e98 0x84395132 0xa6b960ac
+ 0x2caf8028 0x8e1e5633 0xe1752db0 0xc3245b6f
+ 0xbc2cec8e 0xaa15b168 0xfab0ebf4 0xcbaf83ce
+ 0xbc52b077 0xacea8d81 0x82cea769 0xe581def1
+ 0x76ddee44 0xf17c7617 0x1a9b4ac3 0x39edff69
+ 0x9459de09 0x6d0ea754 0x6707ff35 0x98fee90b
+ 0xa139af94 0x59f6b1ec 0x39ef6a70 0x782074bd
+ 0x7e7d9e52 0x21db4c56 0x0e495ee2 0x184e9f7b
+ 0xb278874d 0x6e72b8d4 0xaa6f763d 0x49f8e47f
+ 0x08330d8a 0x02ffa0d1 0x1174cf44 0x7368cd37
+ 0x19bc4720 0xe31720c0 0x2fc34953 0xc2722687
+ 0xfa147a47 0x6906e465 0xcded8c2a 0x42385b71
+ 0x4fa5a5ff 0xed07e0ff 0x804f76f8 0x649f8898
+ 0xf4545a45 0xdca3db8b 0x8621d651 0x7bb87849
+ 0x157b14d0 0x776d7ab6 0x4226aec7 0x58c370f7
+ 0x49acf453 0x16e21652 0x541d581a 0x868f855f
+ 0x03c06a49 0xf38e6155 0x0cb111d3 0x14e6a36d
+ 0xfedd612d 0x1042b154 0x639b0d94 0xc63fb348
+ 0xbe6e66f1 0xd5d9df0b 0xa9e91f4d 0x1a19f11e
+ 0xc1cfc7ff 0x3aa16113 0xcea08dd0 0xa2aea243
+ 0xe42f951c 0x07a6db3a 0x67eb68e4 0x235e58cf
+ 0x17506a25 0x69bb3cfd 0x2bae86f4 0xa995a8fd
+ 0x20f480f0 0xa25ca74b 0xca1cdb25 0xf0aa2edb
+ 0xc61abd99 0x4a155ff6 0x6c083688 0x0633eb9a
+ 0x5f6223c1 0xfce26987 0x931de7c4 0xfb0561c3
+ 0xc52038fc 0x0571c227 0x75065594 0x676be0e0
+ 0xe9d9e47b 0x556ed5e2 0x1cc8e3aa 0x7c4ce1b4
+ 0x537eeb83 0x2c332e93 0xdf90cb6f 0x6da31edd
+ 0xcde77ab5 0xb9948b59 0x72198548 0x6d49e633
+ 0xea62555e 0x4419f41c 0x8e020cd4 0x3fcf5474
+ 0x6c5f1a5d 0x34314049 0xe5e9eb9c 0x968e6127
+ 0x239b603a 0x993e6c89 0xe7b67d41 0x3643087f
+ 0x02d8fd59 0x145502ab 0x98f4d610 0x0eb62bf5
+ 0xa2e02092 0xa21c9ec8 0x9bbdedc5 0x52922483
+ 0x19085100 0x7f7e4c15 0x21fb1ed1 0xd79abd7a
+ 0x1bf76b86 0x976e1175 0xff3d93db 0x9355b0ed
+ 0xcdd24eac 0x3856129c 0x8c143c8b 0x1b2aaa49
+ 0xcf0688c5 0xa0912255 0x1134f43f 0xf61e9271
+ 0x8c1eca82 0x297344df 0x467b61dd 0x3ac90cc9
+ 0x789018e9 0xc38a77da 0xff709ae9 0x72c9ceeb
+ 0x357f1b28 0x15f0aea7 0x551d246f 0xbd7cc82d
+ 0x672d4fb6 0xf858f87e 0x2b1eeeee 0x079689d9
+ 0x955925e7 0x00a10bed 0xdda0a02c 0x10a25c82
+ 0x56f68ec3 0x11fd65b9 0x0c4a65a2 0x376c4472
+ 0x0feb20ee 0x86daf4ce 0x9b278dd1 0xe5f364b3
+ 0x90cb0ef5 0x9f9d5fe5 0x91feabea 0xc46114e5
+ 0xf1c16e32 0x83945c8b 0x7f848eaf 0xa5026dc1
+ 0x3bec24e7 0x07bb910d 0xa752b3c2 0x0dcbdbfe
+ 0xc78c4784 0xcbc7c202 0xd5e695ba 0xa2d691ce
+ 0x828cab00 0xe1d64aa8 0xacf5d948 0x89b8861c
+ 0x31b3810c 0x6ad5cfdf 0xf221332b 0x22c87d65
+ 0x0a841b6b 0x16d99143 0xdd77e7eb 0xd21cfb06
+ 0xcd6a31b8 0x2dae353a 0x94d85b10 0x8eef3bd9
+ 0x8a76c301 0x8bdbf4e6 0x5a210641 0xd7420869
+ 0x630ad1a9 0x7b6b052b 0x3524464e 0xd846fd9b
+ 0xc0068471 0xfa3bbe8f 0xf084c8df 0x44226cf7
+ 0xebbccdc3 0xf0984e35 0xfb35f581 0xda93b2cb
+ 0x0aeee7b5 0x0dd32807 0x23c02205 0x3fb701f0
+ 0x1ac5bfda 0x3bcd2ce4 0x5d811747 0xf5541925
+ 0xb7375bcd 0xd882432c 0x1e478675 0x1ad173b5
+ 0x68fff417 0x38a91f66 0x3d659b0f 0xc8aee8c2
+ 0xd50d62fd 0x947a228a 0x601953eb 0x4d919f47
+ 0x2c19bd7c 0x9d35d641 0xfc265b57 0xb74799cb
+ 0x32f3ac32 0x5f595e1b 0x72a15736 0x7c077991
+ 0x102b2c91 0xb32f536e 0xccfe834e 0x98e4b690
+ 0x3f32d1f0 0x17fa31de 0x50422c3e 0x5d777366
+ 0xeb9329ad 0x8ac92be3 0x2d67d62b 0x05b2d142
+ 0xfb134580 0x1bd4fdee 0x193514ec 0xe299593b
+ 0x5a916adb 0xa3a91cd0 0x53b43410 0x761c29ce
+ 0x13033aa6 0x9999e69c 0x4a45d118 0x284f5624
+ 0x4c293a75 0x28b66b01 0x6cbe27f4 0x9bde5619
+ 0xb25856cf 0xd1ca33fe 0xe4c2b700 0x05ab2c66
+ 0x361d7e7d 0x665d674d 0xb395dfa6 0x45162269
+ 0xab8d300d 0x1f2f0747 0x9e1a9577 0x2c49b2f3
+ 0x6f96740f 0x319eed23 0xe6a57527 0x67142ac4
+ 0x8f53165c 0xb85c54ed 0x3d78dda5 0xc32be8a5
+ 0x1b3b0719 0xb23f7301 0x8420a33c 0x036cab5b
+ 0xb4e0d0f5 0x22839b64 0xe818330b 0x8a1763e1
+ 0x97696a37 0x249e23dd 0x0d7e1bf6 0x509196eb
+ 0xf6e50012 0xe5d893b6 0x48905c3b 0x05e02309
+ 0x29bc4aa2 0x73b784e8 0x8e4153d7 0x527167c2
+ 0x041549f3 0x4924dcda 0xbf93ca86 0xe28a1207
+ 0x9d327f71 0x6ca6c00c 0xf9137665 0xe8e5dfee
+ 0xa9fdcd1f 0x2349da0b 0x4c86ff7b 0x546afb66
+ 0x07b23458 0xe01ca83a 0xcf41d93f 0x4bd981a6
+ 0x3cff8d5d 0xd2fe6407 0xe1191895 0x400fe581
+ 0x5f74510b 0x2f4f7b7b 0xd557c281 0x085c8293
+ 0x251744b5 0x367b4095 0xebf6f48f 0xf2ea6d97
+ 0xfe0d42d3 0x02bc0fb9 0xb64f38af 0xb5118b87
+ 0x5a5b04a4 0x4642c640 0xb0500d33 0xf947778b
+ 0x23365f08 0x2f34d96b 0x596dc4be 0xd8a97b42
+ 0x9e44aaf1 0x91fe9485 0x76976934 0xb4e2b957
+ 0x3336893a 0x4e9fffe3 0xeb2a75b7 0x35b2291a
+ 0xd83e197e 0x26753fa7 0xf1993550 0x227a99ed
+ 0xe8b30fa8 0x499a81ea 0xa0274b8f 0x1e0675d8
+ 0x01eabc3d 0xade1ddb6 0x273caa5e 0x515ff12e
+ 0x5bd43352 0xe697fe31 0xb66b3eb0 0xe02fca0b
+ 0xc67fa56b 0x406219b1 0x85aec5ef 0x72fb6679
+ 0x9cddd44d 0x91360fe1 0x116a874b 0xd759aa07
+ 0x5330671e 0x55947d4f 0x90e8dfe1 0x9c5882f3
+ 0xf08d54ff 0xb6e2eb19 0xb7b48c7e 0xe9ad8310
+ 0x44af59b1 0xb2bda966 0xa61e1146 0x593928ff
+ 0xf0bc46b5 0x632bc665 0x14818224 0xb7456386
+ 0xb498b8ab 0x4a1bd6d9 0x09ed9613 0x912b4afc
+ 0x2cde21a9 0xccec290a 0x9798e5b5 0x3532a428
+ 0x825f9129 0x4ec5d6f2 0x6a2ab0a8 0x239e67b6
+ 0x6ef4fdca 0xde49fbbc 0xe55fbac9 0x857a746b
+ 0xa57e8eb4 0xc52d1177 0x76165b22 0x764df578
+ 0xedb92bb2 0xe5e91799 0xea70b3e9 0x5f101efe
+ 0xc60ccd93 0xa424ccc3 0x60f66951 0x9c6406f4
+ 0xb3613fc6 0x45015da7 0x6037f51f 0x198d616b
+ 0xf4885eb5 0x9e1f3710 0x37f96b58 0xd81ed7b3
+ 0x1dbcfded 0x2c698214 0x3d44dbf2 0xa4736f24
+ 0x280c900d 0x32a4179e 0xc91f58d0 0x78c9a829
+ 0x75274aea 0x1086ea93 0x6221c7bb 0x5ba660a5
+ 0xc351999e 0x9e395a65 0x676c627e 0x63d7c3ff
+ 0x3b3ef626 0xe50b46df 0xac546eda 0xd029a1e7
+ 0xbc2659c6 0xb3f04642 0x0a647b50 0x4261d62c
+ 0x037bd7ec 0x1c6392d2 0xb89895d6 0x4cda8c14
+ 0xa7cfdfe4 0xb290303a 0xe0547aa6 0xd2117ed4
+ 0xd729d316 0x1374dc2c 0x85568432 0x52902d7d
+ 0x90eae464 0xc9bb76a0 0x04efb64a 0x75ac68cf
+ 0xbd76dcc1 0x718fc088 0x23955173 0x09c73ecf
+ 0x255e4c62 0xea69bb72 0xa11a8d7c 0x9e34f5be
+ 0x679d4004 0x7ed467d7 0xfb39169e 0x0b183356
+ 0xe3ac01b2 0xa80039e3 0x02b6a1c2 0xfa90f1d9
+ 0xf3c3cfaf 0x963ce60b 0xedf9a86a 0xdeffa99f
+ 0x81eadecf 0x48e4387a 0x05cec096 0x0556b694
+ 0xab8e8147 0xe508f298 0x2e80ccb2 0xf42acc8d
+ 0x4f4bfe84 0xab58acbd 0xe16e1821 0xdca56a11
+ 0xa6019789 0x1fc8405e 0x60d70605 0xc6be366a
+ 0x5b581001 0x1b754680 0x50e79254 0xdb06bec7
+ 0x9abe763d 0x4d11e316 0x10855481 0xf0038cce
+ 0x848192d2 0x5275f364 0x1410439f 0xef4d0611
+ 0xd2855e7c 0xaf9a1ce5 0x9d04fb37 0xa91f0537
+ 0x6cd683d5 0xac4532ec 0x6dccb68c 0x5e6524f5
+ 0x01d8fbb2 0x4f0506c7 0x73088bb6 0xde4258da
+ 0x24987366 0x168e6004 0xb401ca58 0xe0e3ed90
+ 0x7f9cc276 0xa0d0df95 0x0b829a47 0xed0cb95d
+ 0x1b80e077 0xb66484f2 0x57ffce42 0x7d31d4ad
+ 0x4bd625de 0xdf03b660 0xf6d1a7ce 0x6f26aed2
+ 0x024e6c22 0x5a2ebf97 0x9ac2088a 0xdcf581b5
+ 0x31aa8d93 0x18b0e5f9 0x4d74be23 0xe2e47953
+ 0x492c8e75 0x84688df5 0xf477cf2f 0xb5c3ac43
+ 0x13391bb7 0x8e12b599 0x3b3debcb 0x05a7b474
+ 0x3a661679 0x60dd7249 0x9d4e79c2 0x2dd3abe7
+ 0x95bb7ab8 0xc6489109 0xb843b66b 0xef9bd35a
+ 0xac9534a3 0x4643e967 0xdbaea162 0xa2651aa3
+ 0xef077c6c 0xceaf4094 0x6a9873d3 0x1307f6ef
+ 0xc0f8ec89 0x31257a8f 0xa3ccffd6 0x954d07bd
+ 0xcad4f220 0x49491562 0xcd771af0 0xb52337d5
+ 0x56005903 0xfc8b8776 0x0bc5c5d9 0x77e6496e
+ 0x1c5ace1e 0x23214163 0xb16404ea 0xf21d7587
+ 0x3272b9c3 0x819d6967 0xf3935cda 0x5f75e7b7
+ 0xd47e0a45 0x3835711c 0x65c8b9f8 0xec9216e2
+ 0xca694b01 0xa09507fe 0x1321c7bf 0x09e884b3
+ 0xd47b9a71 0xb5d04a73 0x347b8e0a 0x8135bc67
+ 0xd203544f 0x5f0fb637 0x3b3b174c 0xf84c4e4f
+ 0x8c546829 0xec92ce65 0x211c2f94 0x0f15d175
+ 0x8a7a2eba 0xb2b3ea92 0x946f3cfa 0xd3af9721
+ 0x28420bce 0x0d1adbd5 0x76ab261a 0x8addf98d
+ 0xe0da2a84 0x96dce746 0x2a1c215d 0x69269465
+ 0xcdac281a 0xb02d391e 0x8668b6c8 0xc698d17f
+ 0x58fda8c6 0x5d670573 0xb6dd7500 0xc214e33f
+ 0xa799dba0 0x7f9af447 0x6e44fde8 0x99086eb9
+ 0x2f0c325c 0x7c3ae345 0xa53b3661 0xdd359b1e
+ 0xc4cdb7ea 0x24c92053 0x0676821e 0xdc768e80
+ 0x799e291a 0x4254efe9 0x245f1229 0x9fd3bc07
+ 0xf57dea56 0x2cae3b3b 0xc66828a7 0xbcf094dc
+ 0x946bc135 0xf3f4a5fa 0xbc6009ff 0x0315504d
+ 0x1d6383e0 0x9e3b6f27 0x0e0587a0 0x77f92fcb
+ 0xef643571 0xe9583f7f 0xaea0c615 0x18308730
+ 0xbf12e2bf 0x500e7e9a 0xa68193e9 0x037885bb
+ 0x7afa33be 0xa0215cc3 0x6f3b153f 0x0749bee8
+ 0xffde3598 0xc120bf6f 0xd87c6a94 0x39cf0ff7
+ 0x77e3b6eb 0xfc58b718 0x75cfaf83 0x0da3b0dd
+ 0x61bd6afc 0x13f73a6a 0x015315f3 0x8ab77ca8
+ 0xbd176c00 0xdbfb1163 0xafb556fc 0x586a8768
+ 0x87bb256e 0x080cf4c9 0xfc3672ff 0x82434519
+ 0x9ca08dc1 0xd91ef241 0xdb71c24c 0x247adc45
+ 0x88d6976e 0x3644c393 0x99160c08 0x86660664
+ 0x3e7c9c70 0x13bff68a 0x9d622be8 0xc27f7319
+ 0x38f7bee2 0xefe2cdbd 0xb862e5e3 0xca4afc28
+ 0x38615428 0xa4c218a7 0x3d5a0bbd 0x6846e206
+ 0xdc60775b 0x34a8a637 0x51bdc338 0x029c47b1
+ 0x12837e46 0x4cb03808 0x2c3302b4 0x6957523f
+ 0x74064563 0x4650749e 0xa0a699c2 0x2b6ee710
+ 0xb854168d 0xde2c5867 0x778225a1 0xc4c08262
+ 0x8dab98bb 0x86588df1 0x042b34bb 0x0c975ca4
+ 0xeecae2fd 0x899390e7 0x58a2cc81 0xa4663244
+ 0x4283bade 0x1df2caf1 0xad5195a4 0xc82ed5c0
+ 0x7a61742c 0x5f91acf6 0xece62844 0xc1e79126
+ 0x9c1c0da5 0xcc986bdb 0x78d7050a 0x7bc13829
+ 0x3d503e7a 0x7427d7b0 0x60a99dd8 0x69d18c4a
+ 0x1773ec06 0x82e68e3f 0x23efefa6 0x34abcc61
+ 0x5ffb24c9 0x550afd07 0x4d797854 0xc68d13bc
+ 0xde7239fa 0x71e6e110 0xaac81aa5 0x7cda2f9e
+ 0xc28662db 0x222d5fc0 0x59844c5a 0x5fb5444f
+ 0xc57a4f77 0xcf258bc7 0x81c98c21 0x1b07937f
+ 0x380c18d2 0xce92a236 0x597dc1e3 0x4c5e3600
+ 0x598f79ef 0xcc8d5785 0x739541b1 0xc97b533d
+ 0xbf3f15b8 0xa736552f 0x535468db 0xc416f758
+ 0x442e1f42 0xd983480c 0xfc62acba 0xe3259803
+ 0xd842885d 0x4de67800 0xe9739f17 0xccd6dbbf
+ 0x2693226d 0xb53440b9 0x6a2325be 0xa73db668
+ 0xc092fc17 0xfc3030a7 0x473182c3 0xe579f173
+ 0xb9826f21 0x1c003628 0x7a1c0849 0x07a91ae6
+ 0x1d374309 0x71137645 0xebeb0264 0xb4d0770b
+ 0x0b08efc2 0x0d41d275 0x2b4bd763 0x34befc76
+ 0xaf5969e6 0x8fae7eb3 0xd21ab29e 0xf311c198
+ 0x99ca6131 0x07b8727b 0x705d2272 0x4aba3e02
+ 0x6bcfa46a 0xcb410ff3 0x2218a46c 0x8fa79e4c
+ 0xe0a7fd8f 0xad866e32 0x19f3614c 0x51c5107b
+ 0x1d70682d 0xfae51d5b 0x92c8d209 0xf7e7f809
+ 0xf7f298ae 0x1ed98b1f 0x8d72320f 0x4ca62653
+ 0x555d761b 0x585b931d 0xea97f50b 0x4cd60527
+ 0xc11470aa 0x351ea162 0x6e02aa6d 0x13a2e29b
+ 0x26247856 0x53763351 0x73502e2b 0x0e72cf00
+ 0xfead8af9 0xea9fed5f 0x8e29593d 0x1dffa068
+ 0x35018a10 0x241b6929 0x8dd1ff6c 0xf7aafa9e
+ 0x799d49c5 0x1457a9f6 0x28bf4090 0xaafa7ba6
+ 0x7f96e432 0x98035b6b 0xa2bfa070 0xb47d9c1b
+ 0xd4f92138 0xe5c44f9d 0x817767e5 0xb5a851e1
+ 0x4abec330 0x4f3ee596 0x232f5407 0xff720a97
+ 0x4bcb73a3 0xb9e9defa 0x44ace459 0xacc87ec0
+ 0x6115e7ad 0x60c824d8 0xca2c910b 0x70b0a1dd
+ 0x09c5dbb5 0x53fff786 0x1f49e297 0x2deb0ff2
+ 0x4e7e1015 0x4a40fc18 0x7d2930af 0x641128e9
+ 0xb42c96d5 0xe0a63f2c 0xa3d5b009 0xa7683f57
+ 0xd1b15d72 0x5411bc6b 0xc5e3c6c4 0xa307e3dc
+ 0x8619f0e7 0x87f088e4 0x90bfa9da 0xcb88afe7
+ 0x41793feb 0xb36ad18b 0x09c23ea1 0x8732883e
+ 0x9f9557a1 0x22d6a9fa 0x0481d5ea 0xf857343d
+ 0xba41144d 0xa8b44d45 0x79752ae2 0x322edb6f
+ 0xec48bdc6 0xb28216de 0xca282e57 0x773e6396
+ 0xb99968ec 0xd105854e 0xf77089a4 0xea9521db
+ 0x39b5cbf4 0xaee60835 0x8e8326f5 0x457dbc19
+ 0x48c03f43 0x3aaa54b2 0x895b3606 0x82b8c9b7
+ 0xd7943204 0x83eb8600 0xe532c12d 0xc1171d60
+ 0x4ba2916c 0x2e785bc3 0x0dd98393 0xb8845390
+ 0x05fd2150 0x2211c618 0xb5c2e445 0xd7ed0c82
+ 0x0adf8dca 0x233af513 0x8503d749 0x488b1c15
+ 0x79dff5a7 0x42e58503 0xeedfd69e 0x88f15379
+ 0x1b7cd660 0xc9e9b279 0x14d20061 0x49c7aefd
+ 0x5e22c5aa 0xb63fdde0 0x9465f03f 0xdc58b321
+ 0x63a7289d 0x15f2288f 0xaf4532cc 0x4e4bbb69
+ 0x091cfeb1 0xb5be580e 0xbbec6fc2 0x0fd821bf
+ 0x0a547ce6 0xc2bcd84d 0x40a28139 0x7eeea0ca
+ 0xb2feea2b 0x4fd5e4f8 0x2ccf48dd 0xb7194b6c
+ 0xd22b9198 0x78ad936c 0x9460b1c8 0xdc17bbd8
+ 0x3f40823d 0x4b236d52 0x14f928cb 0xd007bc72
+ 0xd2f8b85d 0xb0d1d115 0x4c159971 0xda7580b5
+ 0xb1ead8af 0xb36b50e3 0x0bd46374 0x2ceb5dc5
+ 0xe1bb39d5 0x792e7cd4 0xc018c9a1 0xd800a972
+ 0x408ed808 0xbf4ca03a 0x8960e693 0x6e890423
+ 0x4551ec70 0x95cebd5b 0xcd80e621 0xeadf97f9
+ 0x7696783d 0xdf6e5acb 0xe9c07318 0x5c99b573
+ 0xb48f5ebd 0x45ac8391 0x4397286f 0x1384bfb5
+ 0x20956529 0xf3efad7e 0xbba89728 0x81e2ffdf
+ 0xfe7267a2 0xba5a0b2c 0xea564265 0x2eab215f
+ 0x0585687a 0x8b321898 0x018932fa 0x79b1eebb
+ 0xdf5e0adc 0x83b2599e 0x69de903a 0x0042d857
+ 0x64621f39 0x916e6620 0x7edc8eff 0x0e30efa0
+ 0x89e1712a 0xe2956107 0x613114e2 0xc507bf0c
+ 0x18c57a2c 0x73c7d51e 0x73ed48d0 0x0134e2f5
+ 0x9e7fc4df 0x9d23249e 0xd664b664 0xea0e92b1
+ 0x62751e9e 0xa5253078 0x13b29a93 0x607f0ed6
+ 0x6399eca1 0xad627487 0x8674256e 0x07a72d0c
+ 0x64d888f2 0xb186a4fb 0x53c28502 0x3e1a820f
+ 0x0e2e283d 0x29cc46d4 0x044debd0 0x264258d8
+ 0xf2df4d96 0x381fe77f 0xb34e0bb9 0xa680fce4
+ 0xf3965166 0xf66aa965 0xfa01274e 0x173a27c3
+ 0x9372c2e2 0xaf379123 0x1d7795b5 0xd0cbea27
+ 0xac2aa4dc 0xaf75cd15 0x08aafbd7 0xe1eb3ad9
+ 0x73f2efba 0x7e1f8cfc 0x4fc216ce 0xc0b058df
+ 0x47984d31 0xdbba78d6 0xf4322222 0x2d1332ae
+ 0x1e389863 0xda868594 0x9009bcf3 0x3e3bfd37
+ 0xf5c8d23e 0x659ed8f0 0xaf40d5ed 0x79334c6a
+ 0x8a5fe638 0x43794c1e 0xfb797e56 0x0cfdf9ab
+ 0xb9cb56e8 0x4521d561 0xb9225208 0xe640f78e
+ 0x1228af34 0xde8b9a8e 0x068d9ab7 0x83e3b7ab
+ 0xda2594b3 0x5788c4fb 0x482757d3 0xd2dc8c42
+ 0xc2b20dd2 0x056d07d1 0xe2547141 0x1ffc298a
+ 0xc3a87b06 0x41e29745 0x097beee1 0x79900e95
+ 0x7b1adecd 0xb2e72144 0x4e26e17b 0x85cc1a4c
+ 0x9950fce5 0xd6d98df9 0x93794074 0x824d14d2
+ 0x4f0647a5 0x946ebf66 0xf7573917 0xbd8de17c
+ 0x87b3e0f0 0x2d7244aa 0xc7e3a076 0x15b1cc40
+ 0xbd4da30d 0x72d94da2 0x59f4bb70 0x11171bd1
+ 0x7fb5b60e 0xb5c57746 0x9bc50e57 0x3f451f05
+ 0xb94e5d7c 0x1a8f3f35 0x161962d3 0xdb989b4c
+ 0x677fe3cd 0x11c0d3dd 0xf44e1845 0x4f0e923c
+ 0xc9747ce4 0xd3e3b8f7 0xcca06709 0x22364a45
+ 0xc451d651 0x61175a92 0x37c80223 0xce26776a
+ 0xd84465a2 0x6f650d82 0x3c0c44c6 0x4cce06a4
+ 0x9419dbd8 0x3790ad96 0x92931a8c 0xbee8a011
+ 0xc6e6e935 0x90ded61f 0x2c600834 0x288d7aa7
+ 0x29525b86 0xbc356cb2 0xe7990035 0x93a41510
+ 0xeb1ae6f3 0xcfaebe12 0x986b8751 0xe5c12e29
+ 0x97a81f41 0x0486ad01 0xe72ed202 0xb113d7f6
+ 0x474b2b6b 0x84117dca 0x253fa634 0xd82a74ea
+ 0x638cc440 0xa7f37501 0x6fee7b98 0x11c8d721
+ 0xb546c6a8 0xb9614144 0x11f332f7 0x74cbd864
+ 0xeebb972b 0x7fcfe0d0 0xc3bc74b8 0xf77b951b
+ 0x48ebcc35 0x4e14d72f 0x7b953ae1 0xfbbb9ce2
+ 0x42c55f78 0xb6d380ed 0x49c3d722 0x872ba533
+ 0xb8e493c7 0x7ebb8ac1 0xd72cf5bb 0x008276de
+ 0xac42547f 0x36d30ad9 0x73c4e5a5 0xd42a79c6
+ 0xd7fc1c97 0xc1e39393 0x9d93c834 0x504deadf
+ 0x507017d7 0x5e7f8596 0x64dff308 0xa1ffa86c
+ 0x406863fb 0xc696762f 0x8346ab74 0xbbb26ac0
+ 0x040e22b7 0xb9bd6bc1 0xb5a9662a 0x313baf09
+ 0xc88a5d73 0xf89b101e 0x2df99e8c 0x66f9143d
+ 0x6a15e728 0xd073efc9 0x2550f1e5 0xe6d2e0e7
+ 0x201603c0 0xbedee383 0xb90eeba5 0x3c6d3689
+ 0x6c221cc7 0x5e42e7e3 0x16773ca3 0xa903f046
+ 0xa359c206 0x21aa9ce7 0xecc3c52f 0xfdd397dc
+ 0xff0aa1aa 0x86a9241a 0x23dca3ca 0x7aa7964f
+ 0xce44f45e 0x787ce819 0x102182f2 0x648daae7
+ 0xfe8cef54 0xe5a2fa46 0x7858e946 0xe0f78cd8
+ 0xc03dcc41 0xaa9eeda2 0xdec6ff3b 0x82503cad
+ 0xe3c69ab1 0x636ecaaa 0x2842ccec 0x8281e787
+ 0xc9457836 0xaaeb2b64 0x58433aa0 0xa8e90fdb
+ 0xf4878f15 0xa4509d31 0x349d3d9e 0xdb41cd52
+ 0xfcacc1dd 0x028cf8e6 0xe4063eed 0x4374291c
+ 0x0a7b5823 0x5dc812a6 0xc559676e 0x1cccb0c0
+ 0x8b5054ae 0x2c668113 0xe6ea95d8 0xebc32c6d
+ 0x7c7e8e52 0x563f5e56 0x7b6ba1d1 0xbc768499
+ 0x44d1b27b 0x11da187c 0xc150a0ae 0x8d549c27
+ 0xef479ebd 0x1bec041a 0x2d724c70 0x4f6fff05
+ 0xccc70e9a 0xcdf3f224 0xde13a03d 0x286faf62
+ 0x0422a7ee 0xa1dce95a 0xa052c652 0x24ef7f65
+ 0xc3d56751 0x062ca4b6 0x9c3a424b 0x4c6b8a5d
+ 0x9b0760a3 0x454eb5a1 0x89d719c6 0x5d7c30b5
+ 0x1875f304 0x76ccdecc 0x7f7b6f2d 0x91392a06
+ 0xa4dadd23 0x3f89b22d 0xe5670c1e 0x69e5fab5
+ 0x8d7d676a 0xca764743 0xee377c21 0x962ef23e
+ 0x3c9776ca 0xcf94e1f1 0x90b70a30 0x82331925
+ 0xac501a5d 0x9c9e78c4 0x709b0db6 0x427e02d7
+ 0xf1b04309 0xa9f6f0f4 0x08ff5d7f 0x78a97bbf
+ 0xab003329 0x62c425e7 0xc444a6bd 0x91d672d6
+ 0x694e119d 0x0caf0d23 0xd25b4687 0x220d1657
+ 0xf7ba3375 0x288606d7 0x843cf7da 0x57885fa7
+ 0xedb17314 0x6b72199f 0x60781834 0x2af5db9b
+ 0x30580a07 0x8624fbf0 0x7e0cd294 0x47352010
+ 0x10a3b651 0x6f339211 0xc1eae963 0x35be0698
+ 0x59ba2497 0x59b522b9 0x3f2f1d3e 0xca39fbda
+ 0x8e75f2a9 0x0548e490 0x9f33e02c 0x6adecfdb
+ 0xc5503669 0x4d5db11a 0x67e838e3 0xe9b880aa
+ 0xfd649783 0xc138c050 0xd7aeaa11 0x966cc90a
+ 0xaee0e03f 0x274a604f 0x8f9aa296 0x814516e7
+ 0x6e196fc7 0xb73e1c2f 0x0d12e4f4 0x9ac2a2d5
+ 0x8c7c9604 0x2697ef9b 0x1e29342f 0x31e4e835
+ 0x24c641d9 0x11caf5ab 0x3f2e207b 0xbc84be68
+ 0x053d130f 0xd9c47984 0xe876ad21 0x313d7941
+ 0x4fbd8b5f 0x55da59db 0xad5f7256 0x72aad15d
+ 0xa0dd11c2 0x2edb36b6 0xe2394a24 0xd1d3e21a
+ 0x1bc12b51 0x3f90e0c8 0x1e931f28 0x228d3807
+ 0x148253ba 0x0c92fa37 0x68cea9b5 0x8fa72940
+ 0x8e168b8e 0x7917c0ba 0xca35e962 0xa24501ea
+ 0xc88a581e 0xf7eec60e 0x44a2c310 0x3b6fe6b7
+ 0x7157e3ef 0xc7336d28 0x94e1c1fe 0x53cae8a4
+ 0xfa702348 0x377220d5 0xaf64d7df 0xd36c486b
+ 0x4cc02674 0xfb4e74d8 0x5f444b3b 0xff8918bf
+ 0xad443e0f 0xfb1e69e2 0x58a35eef 0x52be618a
+ 0xbc32b508 0xd4bfd717 0x12c20777 0x9fac22cb
+ 0xf527f00d 0xc4036217 0x076a0000 0x3e050a72
+ 0x24d5bd98 0xb3df2dcf 0xb6577a1a 0x20db8dbf
+ 0x81d84f2b 0x2b23bc93 0x04f5aba4 0xb89a7879
+ 0x26037e61 0x8bf4c947 0x2c2f00db 0x4770fdaa
+ 0x03517beb 0x7c0aed15 0x9b1c508d 0xd03887fa
+ 0x612c327f 0x75630859 0xee089ebc 0x054363de
+ 0xe1170da6 0xa6fbad45 0xbe5fd481 0x7170ce4a
+ 0x982705f2 0x2f28fce4 0x4828396d 0x946e3227
+ 0x4707b6a3 0x40b3b489 0x38e44d67 0x9baf7701
+ 0xb5514d53 0x6a03ea96 0xa7edeb18 0x318592be
+ 0x8077c7e2 0x54bb983e 0xba06f777 0x78ac3dae
+ 0x162292fc 0x5f5a64de 0x8447342c 0xae366b1f
+ 0xd40cda5f 0xa00c4331 0xc9f89e9a 0x614bfd85
+ 0x13f4d895 0x351d65da 0x2dcc6c65 0xb932fef4
+ 0xd979267a 0x369a3a48 0x3d69186f 0xbd36dedc
+ 0x6531794b 0x5994888c 0x9c810184 0x86078fa0
+ 0x019116c4 0x27c94578 0xa0f4b9a2 0x624564b5
+ 0x5eaa49cf 0x6bb1af65 0xef20f1b5 0xc4e51d80
+ 0xa4253cb9 0x0613e005 0x6a48efb6 0x6572d581
+ 0x80e998c0 0x03d1497b 0xef167ec5 0x9778e1e4
+ 0xcc81e16b 0xa690c40c 0x20e4afdd 0x85a7f7a6
+ 0x036f2764 0x9899bbf0 0xb7d5ad3f 0xcea2c566
+ 0xabad02af 0xb2d06c67 0x9c8d5a47 0x35c8381e
+ 0xd620a859 0x37e6a29f 0x95158030 0x0f209e29
+ 0x47ea5ef6 0xa4848559 0x3aff1ebf 0xe252e609
+ 0x159bc4b0 0x30c2354c 0x6051bc9b 0x867842e1
+ 0x16f60895 0xb62cee9c 0xa1afdd0a 0xeb91a8fa
+ 0x4c711ddf 0x595d88cb 0x2b3144df 0x2dd6f0ee
+ 0x1a5d54bd 0xa97fdee2 0x9acc0191 0x97b317c6
+ 0x8801e044 0x008e6462 0x8bf44ec4 0xcde58a45
+ 0xdc4b8ffa 0x4b99ce7e 0x98a86ccd 0x201461da
+ 0x98b35c96 0xb01a44b5 0xb2873eac 0x100f0d31
+ 0x8a4c4856 0x3bca7b1d 0x6692c4d5 0xd1b52a79
+ 0xd0a0dccf 0xef954a6d 0xee084a14 0xf9e290ca
+ 0x554125a6 0x4fe7363a 0x6582a536 0x91f95b1a
+ 0x79b9a1b5 0x337b3623 0x4534e2c8 0xf9baf5e1
+ 0x3bcf71d5 0x157a8e77 0x3c42836a 0x19d9e549
+ 0x7b90ef15 0x3f556612 0x68b02db5 0x9a9261dc
+ 0xc87ad241 0xa4783fc9 0x0b9e52e7 0x18f3a671
+ 0x9c753a17 0xbb263021 0x7b79489c 0xd26d5901
+ 0xda6aa081 0x6c9ec91d 0x7f51e8eb 0x63d8e990
+ 0xeabd63cb 0x51a2b689 0xeec71240 0x6fd61a3f
+ 0xb8bef531 0x5c579f62 0x42cda99e 0x32829716
+ 0x587fe9bc 0xe2787a90 0x3caa6374 0xc6b05b3a
+ 0x033b091e 0x4227df55 0x00f2ccf3 0xf8ba50be
+ 0x5b3cbff8 0x2dec92d3 0xcd92b997 0x3aae0eea
+ 0x58265341 0xb140c1bf 0x896bd107 0x8e134f1e
+ 0xa2ab412a 0x692d37b1 0x3feb282c 0xe33378c4
+ 0xb1825514 0xbb463933 0xbe4973af 0x4beec156
+ 0xb3806b53 0x30544c35 0xb3d801b8 0x735a5103
+ 0x9a44d96a 0xe36ce6ef 0x99ffd1d8 0x9887ffde
+ 0xf36cb2a8 0xd778276f 0x16212ca2 0xac7507a1
+ 0x1d37f935 0x0b3dd0b8 0xc9fbf313 0xdebbf9c9
+ 0xbcb3ce18 0xc7b56762 0x326f0143 0xf670a4ad
+ 0x39260fe6 0x523d5f26 0x2e2f3dc8 0x311a4065
+ 0xddb07fdd 0x9c6e378c 0xaa812c40 0xb76a6682
+ 0x798adc3f 0x0eb85bf6 0x085f1f36 0x9d787e48
+ 0x5af6ad55 0x078882fa 0x286e6aad 0x0fbbd33e
+ 0xa3a83587 0xd8dede42 0x8e0bc57f 0x830da747
+ 0xe6a39721 0x5f17385b 0x130a11c7 0xf7ebf4a6
+ 0x01c47595 0x0b1cd209 0x6e3fa03e 0x1c165752
+ 0xe6d733a4 0xd5115cb4 0xd26bd353 0x633dc916
+ 0xad32ae98 0xaf360cc0 0xcc433c3e 0xee2db5f1
+ 0xbc52cb9b 0xd57d9343 0x1aea1757 0x305678ab
+ 0xb706fe92 0x79be3615 0x9f826438 0xd8451944
+ 0xde387b02 0xd1a7ab99 0x7e90bc25 0x3083cb16
+ 0xb7457bce 0x5f3a5bac 0x4de880d2 0x799c1684
+ 0x05957d56 0xe11f9a26 0x7489984d 0xc383c690
+ 0x20e67701 0x67d91f20 0xe0bf8925 0x21207184
+ 0x6151e242 0xe9b70cb3 0x9506a913 0x4a67bf59
+ 0xd7274edc 0x5f33bb0d 0xc73eba6e 0xc90ffb29
+ 0x2ac578c9 0x69b8a02a 0x79f0f3ed 0x25172463
+ 0x343866c3 0x62ac94e1 0x868e8ef8 0xa2735dd7
+ 0xb578b263 0x36eaf066 0x6cc058fb 0xa68329d5
+ 0x6d56bad6 0xfe13ed4f 0xbc13f247 0x4ea42e00
+ 0x03abe771 0xe0cfdff2 0x02b946f6 0x3e28b51c
+ 0x00d1a074 0x630d047d 0x3774bde0 0xd54d848f
+ 0x519df7c8 0x2f795cdd 0x2be0979a 0xffc9336f
+ 0x865b9fe4 0x989ef40e 0xe8e1937f 0x70c73c37
+ 0xd47ce2c1 0x84747455 0xd29ffe8f 0x7d5f7e59
+ 0x54503948 0x33a43626 0xcb21bfaf 0x372754eb
+ 0xf4e9fef0 0x7ef72486 0xea5981f7 0x6f460236
+ 0xe562a5d5 0x50529138 0xe6a53b06 0x39b362e8
+ 0x84899918 0xb9748fb3 0x8263ef83 0x5c6a28e4
+ 0x081cc763 0x5635c0bd 0xf45de0a9 0xf676e138
+ 0x70358031 0x0c96d004 0x9c7a26bd 0x621f7620
+ 0x0f5f2d5d 0x4b884b34 0xe97c5049 0xc3dc680a
+ 0xabd96144 0x581eb22a 0x9a21e4c9 0xa65945a9
+ 0x3cb2eb06 0x198dfbcc 0xeed765e4 0xa79433b5
+ 0x1eab8e7c 0xaf0caa85 0x1f64e75d 0xe5ac6d33
+ 0x566cb0bc 0x99a1dd23 0x07488351 0x20420ef8
+ 0xee4c584f 0x4b16ec16 0x9c22d1b6 0x0677a344
+ 0xd675b2e6 0x3699da5d 0xfcd9c9a9 0xaf39754d
+ 0xc20e780f 0x6a313594 0xad4d8e05 0x0b745217
+ 0x1caeeaea 0x8d33c5dd 0xb5134401 0x25897152
+ 0xabc5620c 0x5c6a6e2f 0x7f9bfcc6 0x4e23c064
+ 0x915851ee 0x10cde250 0xd43ce4a3 0x77e3d669
+ 0x83c5acd0 0xd556601c 0xb4b9b0d1 0x5fc0197d
+ 0x6fe1b764 0x98736a2e 0x8f9c5d6c 0x5a3c73a0
+ 0xbb9223e9 0x477fb96c 0x76e212d4 0x852c7448
+ 0xe3df0ebd 0xd26e786d 0x5adf03f2 0x43a19194
+ 0x39e95e1e 0x312c2c01 0xf28f5bb9 0xad9b066a
+ 0x50c6804c 0xb3cb2412 0x27736125 0x2d75b115
+ 0x878b9808 0xcee5e550 0xd3b21a84 0x7f73c6f6
+ 0xf31048f8 0x9c27baf7 0xcbe28ae5 0xf16f55e8
+ 0xff1d883a 0xb917dee3 0xd84bcba9 0x99d9bc06
+ 0xd3254c6e 0x913fb216 0x33bae4b3 0x3ab2b856
+ 0xe40edf7a 0x3f8e9842 0x6dcb2c20 0xb08a42bb
+ 0xf82b32bc 0xd6e65b9a 0x8280902a 0x13bde0c4
+ 0x5749ee1d 0xe09a44f9 0xa1ed7a47 0x92325cb1
+ 0xba37e230 0x08bf455b 0xf7a8e6b1 0xf999b250
+ 0x279eb5f6 0xae471b0d 0xe3ddc073 0x99a4a6d4
+ 0x6f0c9b2e 0xea2ec118 0x6930dd92 0x76f731fd
+ 0x3ced82b8 0xac77a11c 0xf6d40ae3 0x9709b288
+ 0x066bee60 0x366e4442 0xc682e70b 0xcf3f5ee6
+ 0xeb669330 0xb2bfec9f 0xd9d02229 0xe506c12c
+ 0x5c499813 0x1acd8364 0x5dea0305 0x11b8cdcb
+ 0xae9d46f8 0xe92f7cff 0xe47da028 0xa96b7996
+ 0x3c24981c 0x8218d0dc 0xcdc423f8 0x5783ec85
+ 0x71031f87 0x75f91d5b 0x7dbd9347 0x89320bd3
+ 0x44ea6e5b 0xf52fed47 0x8cfba940 0xc568ba2c
+ 0x32e64a48 0x467f2af2 0xe1c81736 0xd677c3c4
+ 0xb691033f 0xf05f91ae 0x3ab34af4 0xb7f77aa8
+ 0xec235606 0x2dd4f5d9 0x51918489 0xed4ccd82
+ 0x7388c7e8 0x1b4c953d 0xa4dbc23d 0x47f6896e
+ 0x5df966e6 0x51077388 0xdc110c3d 0xd784b6d1
+ 0x16a759c6 0x23e10e0e 0x1ff60d5b 0xc8a0b014
+ 0x23b0bac1 0x99a220ef 0x53af8b8c 0x07ac467d
+ 0xc906cc36 0x3f94abe0 0x175fd4ec 0x18d9644f
+ 0xad6ea521 0xb6c70a07 0x32f6af52 0x9f62ad48
+ 0xe1f3d447 0x407b2768 0x1e081391 0x29a24dca
+ 0x92d3b535 0x2a445762 0x066c94fa 0x6da4b159
+ 0xbcb3c6e3 0x67127ece 0x75cb186a 0x31c96430
+ 0xa8bdacd8 0x8e73d453 0xcd809a5c 0x6e651761
+ 0x6b594127 0xff12aab7 0x91d08ff8 0x86080248
+ 0x52107544 0x80894884 0x05e57b3f 0x80cab344
+ 0xfe8e16fa 0xf65fe16e 0xe2265c3e 0xe2cbb1d6
+ 0x7330dbd6 0x2c9535e6 0x6a1e434c 0xf575b138
+ 0x7a6f4b59 0x24fb8bf5 0x62502c89 0x92e0442b
+ 0x5c77ab13 0x1d83ce27 0xfa7e3916 0x5eb18873
+ 0xcc314bbb 0x9d641295 0x7fff5b4f 0x10cf0507
+ 0x4bdf7795 0x77536166 0x6746a004 0x4886b845
+ 0x5aa46f6d 0xe30d9ba2 0xef7f14e7 0xdca44530
+ 0x0516615d 0x43927969 0xc80235f7 0xd8473012
+ 0x8b4b2e12 0x841ec702 0xfa110fbe 0xcad703e9
+ 0x5df65ee2 0x947b7c2c 0x7cac7cfb 0x3282a0b5
+ 0x5c67da3b 0x71459bfd 0x91b055db 0xc951eeed
+ 0xde06eeda 0xaaea5aca 0x08d9226d 0x1e0c0b50
+ 0x44ae07b8 0xf037265d 0x823100f8 0xa642e2e5
+ 0x7f54061d 0xa0026339 0xbd969e25 0x51eb6051
+ 0xb7b2b522 0x7e3a0bd7 0xd8116971 0x3e973442
+ 0x8cdc35f3 0x0d108320 0x7a2f92dc 0x2c94b7a4
+ 0x6ab06326 0x50b9b16c 0x9bb91308 0xacd38150
+ 0x05922ec7 0x9f48a633 0x8e72317b 0x41b59d8c
+ 0xc6cdfe4c 0x2f628aac 0x3874bd08 0xb4e572ad
+ 0x7649260e 0x71b6aaf9 0x39dab510 0x858f965e
+ 0x322ba132 0x58c33983 0x25f5a5c5 0x45131737
+ 0xc9efed2a 0x43dcdc7a 0xb8176559 0x62a26ac4
+ 0x1ee7c5b1 0xc0f02a9b 0x26dd7616 0x8d0c377c
+ 0x9c5c57c6 0x06edf20c 0x22ad4eaf 0x5bddddc4
+ 0x7e221c25 0xbbec97e9 0xf82338e3 0xbb5c5916
+ 0x65885430 0x962077de 0xe52142ec 0x4c10a5a6
+ 0xcbf19d91 0x825cb043 0x21b49df1 0x1407f2c4
+ 0xa3cc17b2 0x796ed4ad 0x1859e928 0xeb9f55d2
+ 0x2f5fb606 0x4ef1bf74 0xa00279f9 0xc9fa2517
+ 0x925d9a77 0x164beb20 0xc4c52a47 0x3cd6b3f3
+ 0x607d07d0 0x1791803c 0xe82123a4 0xe2409ff9
+ 0xbcafaa43 0xd4809fe4 0x0ff22683 0x7ef4d5f9
+ 0xf67098f2 0x215173e0 0xe84b651d 0xfff97430
+ 0x9117caa5 0x9701e965 0xfb41af2b 0x2de0b345
+ 0x863219cd 0x57dbfb08 0x5ed9878f 0xda9848c8
+ 0xbd6a3e2a 0x78cee879 0x65a9ae31 0xd265ab5d
+ 0x4d8d0a94 0x53fe3477 0x163a9807 0xe6ee333d
+ 0x230ec18a 0x805befb4 0x28c735f3 0xfcea12a8
+ 0xdfb36088 0x6d71eeda 0x526509a0 0x97c07aa7
+ 0x505217dd 0x471bddf6 0x861c2251 0x1d4de90c
+ 0xe9b9c550 0x4741fb3f 0x67d594e5 0x0f134eea
+ 0x122daaee 0xab9a4171 0xf3675a04 0x68226f18
+ 0xdfeb2219 0x2d558e8d 0x3520077b 0xbd89e17e
+ 0x55ee30f2 0xe89bb5dd 0x5cd339a2 0x23671683
+ 0x6ae7fef5 0xff85343c 0x24592a20 0xaf79aa20
+ 0xa32c6711 0x2fe7d13a 0x3f582a56 0x575b9049
+ 0xd117d4a2 0xfe150bcd 0xd3598397 0x3df2fab3
+ 0x1259b6fe 0x7f9137d9 0x6911f18d 0xafeeeb77
+ 0x1c9c05ec 0xef1c1316 0xdc90bc14 0x3f084ebb
+ 0x197022a5 0xc723baef 0x8d956a3a 0x98b49ce9
+ 0x368f3198 0xa9542710 0x0d9b0fc8 0xe8940414
+ 0x0e4a345f 0x93d03091 0xb91a177c 0x166de3e9
+ 0x0497a17f 0x3b179d21 0x145bb508 0x59dcefdc
+ 0x6c00b488 0x48c5b25a 0x11ac5ff2 0x791caabe
+ 0x2a69fdb6 0xd4e828bb 0x495a2e26 0xafdbfbb9
+ 0x44a9c4de 0x203ebc65 0x41783cd5 0x5eec8a1a
+ 0x1b0107a4 0x8ee93772 0xa5342616 0xd1aeb1a2
+ 0xeb11eea0 0xa2db8d0e 0xd887bf86 0x2328668b
+ 0x6f047abb 0x1a016056 0x02792c95 0x743580e9
+ 0xf597f3d6 0x48169911 0x0fe7e92a 0x0d7bdd58
+ 0xf7a6dc2b 0xa928427c 0x52ad1483 0xaf181b83
+ 0x129dc832 0xf771c658 0x9fb4882e 0x491bfd60
+ 0x756e61cd 0xad7191fe 0x1ba10ed9 0x3cf91d75
+ 0xe635f99b 0x8182d8bf 0x2567117a 0x7a9c16c6
+ 0x79f4ec31 0xa0422381 0x75a6ee79 0x17fcc09c
+ 0x093dac9f 0x5d86884a 0x47294d64 0x9bbbbbb7
+ 0x8188504d 0x499bde9d 0xac5f4d4b 0x230012a6
+ 0x06e74e6b 0x9a2af42f 0x28786631 0xd9db3613
+ 0x6212a02b 0xff9c9169 0x0f7d0549 0x32cb119a
+ 0xdd8d4303 0x9798bff1 0xd72ff905 0xca5365a3
+ 0x3cb9f375 0xfe61bc4b 0xccd0f915 0x94151776
+ 0x64166df4 0xeefd90a6 0x3a0089cb 0xc4efaca4
+ 0xa64cbd96 0xbc4b834c 0x4b8be091 0x72f322fe
+ 0x35e67029 0x4030ed4c 0xe0cd63a3 0xda35976a
+ 0x94fbc08c 0xd6d3429b 0x6ac3087d 0x57e3eb54
+ 0xeba813a4 0x9bd06f05 0x2d2f860f 0x4901e70c
+ 0x226802f5 0xcc8d0940 0xa8825eb5 0x1ab23757
+ 0xe842caff 0x77123976 0x647068e2 0xc75de8be
+ 0x0bf388a2 0x4f501ebe 0xc64118fc 0xc1cbaabb
+ 0x98c9810d 0x0b4f63e4 0x641e2360 0x168bb3c8
+ 0xa1cede7b 0x5fe0d436 0xa93a4cf8 0xf7b75424
+ 0xf4725a08 0xe0532c1e 0xfe83bc98 0x3a43d6e0
+ 0xbebecec8 0x81bd1a51 0x5525ecd7 0x384d8d37
+ 0xed6ef639 0x5efe6032 0x6937ce1f 0xb3ee8dbd
+ 0xa0aa97df 0xd62d6fd7 0x5acc6d6f 0xef19f5b1
+ 0x3ad0d109 0x3660bbd1 0xfbf8d7e7 0x210ab474
+ 0xd9cde94d 0x4cb35844 0xb287c427 0x6087b156
+ 0xc04b25c1 0x78722325 0xe5937d3b 0x2477d2bf
+ 0x859237aa 0xd29b1567 0xc4b6c1ec 0xb325f9d3
+ 0xb59d3b11 0x54449fb8 0xba28f795 0xc72e0157
+ 0xa306042a 0x974e4bf8 0x835a665c 0x4b54f87b
+ 0x25b9f700 0x2176126c 0x868ad962 0xf5478e50
+ 0xa82f2f84 0x1ef6e4af 0xbfaf0c9b 0xea6acebe
+ 0x55965550 0x0d1a325d 0x9b786f43 0xa3a55c13
+ 0x758e4290 0x0e156cd6 0xec3fa531 0x73464f29
+ 0x1639e8bf 0x051d786b 0x303c214a 0x80c09001
+ 0x71f5ec60 0xb5322364 0x91ea1fc2 0xb461fe47
+ 0x596fbd60 0x73671c45 0x7301b951 0xb9c9605c
+ 0x1b04f497 0xfbef823b 0xc621a97b 0xe55e1d29
+ 0x6984e8b5 0xefce9254 0x544f7540 0xdcd81ef6
+ 0xa20e4ad6 0xc80fb804 0xb96d8a3b 0x3d04128e
+ 0xdcbd0f39 0xb5d4bca3 0x7720d158 0x6da9a045
+ 0x273c430e 0xece0eb38 0x672e817a 0xc0d79da7
+ 0x75c37954 0x58c753de 0xcbcbad35 0x786e6c7e
+ 0xe260b5d1 0xc404468d 0x57cfae75 0x39b497a8
+ 0x1bae57a2 0x52c7508e 0x89b127b9 0x03736bf1
+ 0xd0af6722 0x10b7cad0 0xb2fec538 0xae1bee3b
+ 0xb4fcc9f5 0xc7a89d3b 0xdde3aa84 0xef24259d
+ 0x5adacacb 0xd7f953d6 0x0be41a0c 0x83d6fbb0
+ 0x6967528e 0xb46394d6 0xf63ebf82 0xd2b3f03e
+ 0x7b86862f 0x57786dba 0xeb06cbba 0x7e989a81
+ 0xb9ebccbc 0xb74fffd4 0xbec943d2 0xb9a375c3
+ 0xd3344f7a 0x26c60798 0x49016082 0x551f17e0
+ 0x0f4bee9d 0x614303cd 0xcad6bd8c 0x5c3bbeaf
+ 0x86f4d83d 0xfc4445db 0x0f1a79e5 0xb9f0ce8c
+ 0xdc4152af 0x6e8fc82f 0xf2ccad51 0x8b0b7cc3
+ 0xa2aa307b 0xa520ea29 0x0292bc09 0x534ffc75
+ 0x1b398c80 0x5eca089e 0xc7aff269 0x0059f0b9
+ 0x541aa484 0x99943f2a 0xfc1f579e 0x85da714d
+ 0xd7092c5f 0x0a167a5d 0x898726b8 0x47ffe115
+ 0x8990821e 0xc08ff8a0 0x0e1a2986 0x339ff1d0
+ 0xedd4aaeb 0x9350e602 0x6569e126 0x5859aafd
+ 0x5b0cb2c6 0x147cfa35 0x0d905917 0xf2233208
+ 0xb36ef680 0x841b48d9 0x1c6a0f0d 0x8227247e
+ 0xac9bbb04 0xff8bbb90 0x6fcea1ea 0x7dfbb3aa
+ 0xa464bac7 0x88633a36 0x674b0362 0x74223977
+ 0x139a8d87 0x1d8a5826 0xaa254054 0xeff8db68
+ 0x664d29b7 0x5f1ac3eb 0xddcba2bf 0x0e73df53
+ 0x08ffe947 0xbf3f1da8 0x46f1d718 0x5ab11692
+ 0xf190a0b8 0x9d0e9717 0x86757018 0x97827999
+ 0x573d0b1d 0x7bf3969b 0x3172eab5 0xc5dd90bd
+ 0x413d1445 0xc9612206 0x43ecc87c 0x4d0af8fb
+ 0xad744b83 0x8f007f86 0x44551cd7 0xaf820402
+ 0x6b9a3cd7 0xed4a0a59 0xd4eb0493 0x1bde6215
+ 0xa693b3fc 0x22e4fe0d 0x057a211e 0x9973169c
+ 0x086516f4 0xe1e6ba26 0xb4ad5a0e 0xbf3cf264
+ 0xa40e61f0 0x12eef468 0x7be11464 0x6acb81cf
+ 0xa04787f7 0xdbe5ac75 0xcad096a8 0x185cf673
+ 0x6e0ea343 0xe84a1467 0xef3f00eb 0xef177b01
+ 0x46dd87bc 0x34309420 0x0821d1d1 0x39000215
+ 0x685f4c0e 0xb80c1c87 0x9756d5ff 0xbbcaf5b0
+ 0xde2d1453 0x4c9f69d1 0x56196e6b 0xef81e9a5
+ 0xfc22f7ce 0xca61a7a6 0x4bf15020 0xfa080406
+ 0xd0b837a6 0x7bcb8577 0xfedf367c 0xfcf81696
+ 0x014ed3e6 0xf3353212 0xc062d44a 0xd813a68f
+ 0xd5d7a1db 0x8c45c94e 0xc5b90467 0x6f74385b
+ 0x7130a2d3 0x708b9489 0xdbbb7ce7 0xfc90865c
+ 0x653c5bd4 0xac3cd1e2 0xe27bb6d9 0xd41e4d6a
+ 0xae016134 0x87b7b2c9 0xd994b3e9 0x71e42004
+ 0xb845d3af 0x592dbebb 0x620899c0 0x8d3b090d
+ 0x9d0e6a42 0xce95d950 0x4b7117d0 0x4e32208e
+ 0x379df4c7 0x73c8403d 0x9c035976 0x9fa4ab3f
+ 0x0e4abd10 0xea5abdc0 0xc74b08f5 0x8ad84f2f
+ 0xe6ea941f 0xedd37fd7 0x8800959d 0x4eaf1dd9
+ 0xc03f8601 0x3f05cec7 0xa7dc9585 0xfc497aa7
+ 0x5ab6ec8d 0xf920b15a 0x0528a3a0 0xb03478f9
+ 0xf58d945c 0xf6d56911 0x9d6b8f61 0x62eced7e
+ 0x8c387967 0xb9c3664c 0x703321a1 0xb0779fb6
+ 0x0a5ca536 0x216262ca 0x8471e2dc 0x456035c2
+ 0x1f9a3f80 0x62f7b45b 0xe0fb6e10 0xd817b0a1
+ 0xb04007a7 0x8a2a3997 0xc13b2ff7 0xac042c3c
+ 0x0af1158f 0xb080446d 0x22561f86 0x3c449de0
+ 0xbe156e20 0x7745c38a 0x19cadbff 0xcf505afc
+ 0xc2f94af9 0x720e8b00 0x1d740186 0xc411e6a7
+ 0x16f99b0a 0x0b949e35 0xbc306cf9 0x67f417b4
+ 0xce3e2635 0xd8f3a3fa 0x4b6fd9e6 0x63cfad21
+ 0xaaf1456d 0x6c520541 0xca2dcac8 0xab62863d
+ 0x150a0ae3 0xa9e92a07 0x85e51d1f 0x327253e7
+ 0xa0d5d35e 0x331b43ce 0x207a336a 0x3407a0b3
+ 0x975a2429 0x95d42c04 0x9ff5ef17 0xfefb14c7
+ 0xa3d8f8ac 0x6a112cd8 0x2d276889 0x5f2f6ef9
+ 0x611636e3 0xecc81a74 0x4d482888 0xa46a478d
+ 0x7de65d9d 0x921e2a1f 0x48cca90f 0x64013e1f
+ 0x45aa6b87 0x5da46878 0x39a21b74 0xa72250de
+ 0xebbaa970 0xef8d31f9 0x59a9e1e2 0xd3403b97
+ 0x1780ddca 0x731fa40f 0x6c2ba0fe 0x4f053afb
+ 0x2cf0e873 0xb6a733a8 0xc2a2e53e 0xd2241962
+ 0xcb981a05 0x4af04278 0x053d4e34 0x63d071b8
+ 0x731b063a 0xeed8b331 0x05221e90 0x6705a444
+ 0x2c504d6d 0x231c42ec 0x8debbfaa 0x07829ed7
+ 0x50ee8337 0x17ed0270 0x4a04c200 0xf5e650bd
+ 0x5bbe5f66 0x72d412d3 0x40253020 0xa949f29d
+ >;
pos = <CONFIG_VGA_BIOS_ADDR>;
};
#endif
+#ifdef CONFIG_HAVE_VBT
+ intel-vbt {
+ filename = CONFIG_VBT_FILE;
+ pos = <CONFIG_VBT_ADDR>;
+ };
+#endif
#ifdef CONFIG_HAVE_REFCODE
intel-refcode {
pos = <CONFIG_X86_REFCODE_ADDR>;
--- /dev/null
+/*
+ * Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#ifndef __FSP_CONFIGS_H__
+#define __FSP_CONFIGS_H__
+
+#ifndef __ASSEMBLY__
+struct fsp_config_data {
+ struct fsp_cfg_common common;
+ struct upd_region fsp_upd;
+};
+
+struct fspinit_rtbuf {
+ struct common_buf common; /* FSP common runtime data structure */
+};
+#endif
+
+/* FSP user configuration settings */
+
+#define MRC_INIT_TSEG_SIZE_1MB 1
+#define MRC_INIT_TSEG_SIZE_2MB 2
+#define MRC_INIT_TSEG_SIZE_4MB 4
+#define MRC_INIT_TSEG_SIZE_8MB 8
+
+#define MRC_INIT_MMIO_SIZE_1024MB 0x400
+#define MRC_INIT_MMIO_SIZE_1536MB 0x600
+#define MRC_INIT_MMIO_SIZE_2048MB 0x800
+
+#define IGD_DVMT50_PRE_ALLOC_32MB 0x01
+#define IGD_DVMT50_PRE_ALLOC_64MB 0x02
+#define IGD_DVMT50_PRE_ALLOC_96MB 0x03
+#define IGD_DVMT50_PRE_ALLOC_128MB 0x04
+#define IGD_DVMT50_PRE_ALLOC_160MB 0x05
+#define IGD_DVMT50_PRE_ALLOC_192MB 0x06
+#define IGD_DVMT50_PRE_ALLOC_224MB 0x07
+#define IGD_DVMT50_PRE_ALLOC_256MB 0x08
+#define IGD_DVMT50_PRE_ALLOC_288MB 0x09
+#define IGD_DVMT50_PRE_ALLOC_320MB 0x0a
+#define IGD_DVMT50_PRE_ALLOC_352MB 0x0b
+#define IGD_DVMT50_PRE_ALLOC_384MB 0x0c
+#define IGD_DVMT50_PRE_ALLOC_416MB 0x0d
+#define IGD_DVMT50_PRE_ALLOC_448MB 0x0e
+#define IGD_DVMT50_PRE_ALLOC_480MB 0x0f
+#define IGD_DVMT50_PRE_ALLOC_512MB 0x10
+
+#define APERTURE_SIZE_128MB 1
+#define APERTURE_SIZE_256MB 2
+#define APERTURE_SIZE_512MB 3
+
+#define GTT_SIZE_1MB 1
+#define GTT_SIZE_2MB 2
+
+#define DRAM_TYPE_DDR3 0
+#define DRAM_TYPE_LPDDR3 1
+
+#define SDCARD_MODE_DISABLED 0
+#define SDCARD_MODE_PCI 1
+#define SDCARD_MODE_ACPI 2
+
+#define LPE_MODE_DISABLED 0
+#define LPE_MODE_PCI 1
+#define LPE_MODE_ACPI 2
+
+#define CHV_SVID_CONFIG_0 0
+#define CHV_SVID_CONFIG_1 1
+#define CHV_SVID_CONFIG_2 2
+#define CHV_SVID_CONFIG_3 3
+
+#define EMMC_MODE_DISABLED 0
+#define EMMC_MODE_PCI 1
+#define EMMC_MODE_ACPI 2
+
+#define SATA_SPEED_GEN1 1
+#define SATA_SPEED_GEN2 2
+#define SATA_SPEED_GEN3 3
+
+#define ISP_PCI_DEV_CONFIG_1 1
+#define ISP_PCI_DEV_CONFIG_2 2
+#define ISP_PCI_DEV_CONFIG_3 3
+
+#define PNP_SETTING_DISABLED 0
+#define PNP_SETTING_POWER 1
+#define PNP_SETTING_PERF 2
+#define PNP_SETTING_POWER_AND_PERF 3
+
+#endif /* __FSP_CONFIGS_H__ */
--- /dev/null
+/*
+ * Copyright (C) 2015, Intel Corporation
+ * Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+ *
+ * SPDX-License-Identifier: Intel
+ */
+
+#ifndef __FSP_VPD_H__
+#define __FSP_VPD_H__
+
+struct __packed memory_upd {
+ u64 signature; /* Offset 0x0020 */
+ u8 revision; /* Offset 0x0028 */
+ u8 unused2[7]; /* Offset 0x0029 */
+ u16 mrc_init_tseg_size; /* Offset 0x0030 */
+ u16 mrc_init_mmio_size; /* Offset 0x0032 */
+ u8 mrc_init_spd_addr1; /* Offset 0x0034 */
+ u8 mrc_init_spd_addr2; /* Offset 0x0035 */
+ u8 mem_ch0_config; /* Offset 0x0036 */
+ u8 mem_ch1_config; /* Offset 0x0037 */
+ u32 memory_spd_ptr; /* Offset 0x0038 */
+ u8 igd_dvmt50_pre_alloc; /* Offset 0x003c */
+ u8 aperture_size; /* Offset 0x003d */
+ u8 gtt_size; /* Offset 0x003e */
+ u8 legacy_seg_decode; /* Offset 0x003f */
+ u8 enable_dvfs; /* Offset 0x0040 */
+ u8 memory_type; /* Offset 0x0041 */
+ u8 enable_ca_mirror; /* Offset 0x0042 */
+ u8 reserved[189]; /* Offset 0x0043 */
+};
+
+struct __packed azalia_verb_table_header {
+ u32 vendor_device_id;
+ u16 sub_system_id;
+ u8 revision_id;
+ u8 front_panel_support;
+ u16 number_of_rear_jacks;
+ u16 number_of_front_jacks;
+};
+
+struct __packed azalia_verb_table {
+ struct azalia_verb_table_header header;
+ u32 *data;
+};
+
+struct __packed azalia_config {
+ u8 pme_enable:1;
+ u8 docking_supported:1;
+ u8 docking_attached:1;
+ u8 hdmi_codec_enable:1;
+ u8 azalia_v_ci_enable:1;
+ u8 reserved:3;
+ u8 verb_table_num;
+ struct azalia_verb_table *verb_table;
+ u16 reset_wait_timer_ms;
+};
+
+struct gpio_family {
+ u32 confg;
+ u32 confg_changes;
+ u32 misc;
+ u32 mmio_addr;
+ wchar_t *name;
+};
+
+struct gpio_pad {
+ u32 confg0;
+ u32 confg0_changes;
+ u32 confg1;
+ u32 confg1_changes;
+ u32 community;
+ u32 mmio_addr;
+ wchar_t *name;
+ u32 misc;
+};
+
+struct __packed silicon_upd {
+ u64 signature; /* Offset 0x0100 */
+ u8 revision; /* Offset 0x0108 */
+ u8 unused3[7]; /* Offset 0x0109 */
+ u8 sdcard_mode; /* Offset 0x0110 */
+ u8 enable_hsuart0; /* Offset 0x0111 */
+ u8 enable_hsuart1; /* Offset 0x0112 */
+ u8 enable_azalia; /* Offset 0x0113 */
+ struct azalia_config *azalia_cfg_ptr; /* Offset 0x0114 */
+ u8 enable_sata; /* Offset 0x0118 */
+ u8 enable_xhci; /* Offset 0x0119 */
+ u8 lpe_mode; /* Offset 0x011a */
+ u8 enable_dma0; /* Offset 0x011b */
+ u8 enable_dma1; /* Offset 0x011c */
+ u8 enable_i2c0; /* Offset 0x011d */
+ u8 enable_i2c1; /* Offset 0x011e */
+ u8 enable_i2c2; /* Offset 0x011f */
+ u8 enable_i2c3; /* Offset 0x0120 */
+ u8 enable_i2c4; /* Offset 0x0121 */
+ u8 enable_i2c5; /* Offset 0x0122 */
+ u8 enable_i2c6; /* Offset 0x0123 */
+ u32 graphics_config_ptr; /* Offset 0x0124 */
+ struct gpio_family *gpio_familiy_ptr; /* Offset 0x0128 */
+ struct gpio_pad *gpio_pad_ptr; /* Offset 0x012c */
+ u8 disable_punit_pwr_config; /* Offset 0x0130 */
+ u8 chv_svid_config; /* Offset 0x0131 */
+ u8 disable_dptf; /* Offset 0x0132 */
+ u8 emmc_mode; /* Offset 0x0133 */
+ u8 usb3_clk_ssc; /* Offset 0x0134 */
+ u8 disp_clk_ssc; /* Offset 0x0135 */
+ u8 sata_clk_ssc; /* Offset 0x0136 */
+ u8 usb2_port0_pe_txi_set; /* Offset 0x0137 */
+ u8 usb2_port0_txi_set; /* Offset 0x0138 */
+ u8 usb2_port0_tx_emphasis_en; /* Offset 0x0139 */
+ u8 usb2_port0_tx_pe_half; /* Offset 0x013a */
+ u8 usb2_port1_pe_txi_set; /* Offset 0x013b */
+ u8 usb2_port1_txi_set; /* Offset 0x013c */
+ u8 usb2_port1_tx_emphasis_en; /* Offset 0x013d */
+ u8 usb2_port1_tx_pe_half; /* Offset 0x013e */
+ u8 usb2_port2_pe_txi_set; /* Offset 0x013f */
+ u8 usb2_port2_txi_set; /* Offset 0x0140 */
+ u8 usb2_port2_tx_emphasis_en; /* Offset 0x0141 */
+ u8 usb2_port2_tx_pe_half; /* Offset 0x0142 */
+ u8 usb2_port3_pe_txi_set; /* Offset 0x0143 */
+ u8 usb2_port3_txi_set; /* Offset 0x0144 */
+ u8 usb2_port3_tx_emphasis_en; /* Offset 0x0145 */
+ u8 usb2_port3_tx_pe_half; /* Offset 0x0146 */
+ u8 usb2_port4_pe_txi_set; /* Offset 0x0147 */
+ u8 usb2_port4_txi_set; /* Offset 0x0148 */
+ u8 usb2_port4_tx_emphasis_en; /* Offset 0x0149 */
+ u8 usb2_port4_tx_pe_half; /* Offset 0x014a */
+ u8 usb3_lane0_ow2tap_gen2_deemph3p5; /* Offset 0x014b */
+ u8 usb3_lane1_ow2tap_gen2_deemph3p5; /* Offset 0x014c */
+ u8 usb3_lane2_ow2tap_gen2_deemph3p5; /* Offset 0x014d */
+ u8 usb3_lane3_ow2tap_gen2_deemph3p5; /* Offset 0x014e */
+ u8 sata_speed; /* Offset 0x014f */
+ u8 usb_ssic_port; /* Offset 0x0150 */
+ u8 usb_hsic_port; /* Offset 0x0151 */
+ u8 pcie_rootport_speed; /* Offset 0x0152 */
+ u8 enable_ssic; /* Offset 0x0153 */
+ u32 logo_ptr; /* Offset 0x0154 */
+ u32 logo_size; /* Offset 0x0158 */
+ u8 rtc_lock; /* Offset 0x015c */
+ u8 pmic_i2c_bus; /* Offset 0x015d */
+ u8 enable_isp; /* Offset 0x015e */
+ u8 isp_pci_dev_config; /* Offset 0x015f */
+ u8 turbo_mode; /* Offset 0x0160 */
+ u8 pnp_settings; /* Offset 0x0161 */
+ u8 sd_detect_chk; /* Offset 0x0162 */
+ u8 reserved[411]; /* Offset 0x0163 */
+};
+
+#define MEMORY_UPD_ID 0x244450554d454d24 /* '$MEMUPD$' */
+#define SILICON_UPD_ID 0x244450555f495324 /* '$SI_UPD$' */
+
+struct __packed upd_region {
+ u64 signature; /* Offset 0x0000 */
+ u8 revision; /* Offset 0x0008 */
+ u8 unused0[7]; /* Offset 0x0009 */
+ u32 memory_upd_offset; /* Offset 0x0010 */
+ u32 silicon_upd_offset; /* Offset 0x0014 */
+ u64 unused1; /* Offset 0x0018 */
+ struct memory_upd memory_upd; /* Offset 0x0020 */
+ struct silicon_upd silicon_upd; /* Offset 0x0100 */
+ u16 terminator; /* Offset 0x02fe */
+};
+
+#define VPD_IMAGE_ID 0x2450534657534224 /* '$BSWFSP$' */
+
+struct __packed vpd_region {
+ u64 sign; /* Offset 0x0000 */
+ u32 img_rev; /* Offset 0x0008 */
+ u32 upd_offset; /* Offset 0x000c */
+};
+
+#endif /* __FSP_VPD_H__ */
--- /dev/null
+/*
+ * Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ *
+ * From coreboot src/soc/intel/braswell/include/soc/gpio.h
+ */
+
+#ifndef _BRASWELL_GPIO_H_
+#define _BRASWELL_GPIO_H_
+
+#include <asm/arch/iomap.h>
+
+enum mode_list {
+ M0,
+ M1,
+ M2,
+ M3,
+ M4,
+ M5,
+ M6,
+ M7,
+ M8,
+ M9,
+ M10,
+ M11,
+ M12,
+ M13,
+};
+
+enum int_select {
+ L0,
+ L1,
+ L2,
+ L3,
+ L4,
+ L5,
+ L6,
+ L7,
+ L8,
+ L9,
+ L10,
+ L11,
+ L12,
+ L13,
+ L14,
+ L15,
+};
+
+enum gpio_en {
+ NATIVE = 0xff,
+ GPIO = 0, /* Native, no need to set PAD_VALUE */
+ GPO = 1, /* GPO, output only in PAD_VALUE */
+ GPI = 2, /* GPI, input only in PAD_VALUE */
+ HI_Z = 3,
+ NA_GPO = 0,
+};
+
+enum gpio_state {
+ LOW,
+ HIGH,
+};
+
+enum en_dis {
+ DISABLE, /* Disable */
+ ENABLE, /* Enable */
+};
+
+enum int_type {
+ INT_DIS,
+ TRIG_EDGE_LOW,
+ TRIG_EDGE_HIGH,
+ TRIG_EDGE_BOTH,
+ TRIG_LEVEL,
+};
+
+enum mask {
+ MASKABLE,
+ NON_MASKABLE,
+};
+
+enum glitch_cfg {
+ GLITCH_DISABLE,
+ EN_EDGE_DETECT,
+ EN_RX_DATA,
+ EN_EDGE_RX_DATA,
+};
+
+enum inv_rx_tx {
+ NO_INVERSION = 0,
+ INV_RX_ENABLE = 1,
+ INV_TX_ENABLE = 2,
+ INV_RX_TX_ENABLE = 3,
+ INV_RX_DATA = 4,
+ INV_TX_DATA = 8,
+};
+
+enum voltage {
+ VOLT_3_3, /* Working on 3.3 Volts */
+ VOLT_1_8, /* Working on 1.8 Volts */
+};
+
+enum hs_mode {
+ DISABLE_HS, /* Disable high speed mode */
+ ENABLE_HS, /* Enable high speed mode */
+};
+
+enum odt_up_dn {
+ PULL_UP, /* On Die Termination Up */
+ PULL_DOWN, /* On Die Termination Down */
+};
+
+enum odt_en {
+ DISABLE_OD, /* On Die Termination Disable */
+ ENABLE_OD, /* On Die Termination Enable */
+};
+
+enum pull_type {
+ P_NONE = 0, /* Pull None */
+ P_20K_L = 1, /* Pull Down 20K */
+ P_5K_L = 2, /* Pull Down 5K */
+ P_1K_L = 4, /* Pull Down 1K */
+ P_20K_H = 9, /* Pull Up 20K */
+ P_5K_H = 10, /* Pull Up 5K */
+ P_1K_H = 12 /* Pull Up 1K */
+};
+
+enum bit {
+ ONE_BIT = 1,
+ TWO_BIT = 3,
+ THREE_BIT = 7,
+ FOUR_BIT = 15,
+ FIVE_BIT = 31,
+ SIX_BIT = 63,
+ SEVEN_BIT = 127,
+ EIGHT_BIT = 255
+};
+
+enum gpe_config {
+ GPE,
+ SMI,
+ SCI,
+};
+
+enum community {
+ SOUTHWEST = 0x0000,
+ NORTH = 0x8000,
+ EAST = 0x10000,
+ SOUTHEAST = 0x18000,
+ VIRTUAL = 0x20000,
+};
+
+#define NA 0xff
+#define TERMINATOR 0xffffffff
+
+#define GPIO_FAMILY_CONF(family_name, park_mode, hysctl, vp18_mode, hs_mode, \
+ odt_up_dn, odt_en, curr_src_str, rcomp, family_no, community_offset) { \
+ .confg = ((((park_mode) != NA) ? park_mode << 26 : 0) | \
+ (((hysctl) != NA) ? hysctl << 24 : 0) | \
+ (((vp18_mode) != NA) ? vp18_mode << 21 : 0) | \
+ (((hs_mode) != NA) ? hs_mode << 19 : 0) | \
+ (((odt_up_dn) != NA) ? odt_up_dn << 18 : 0) | \
+ (((odt_en) != NA) ? odt_en << 17 : 0) | \
+ (curr_src_str)), \
+ .confg_changes = ((((park_mode) != NA) ? ONE_BIT << 26 : 0) | \
+ (((hysctl) != NA) ? TWO_BIT << 24 : 0) | \
+ (((vp18_mode) != NA) ? ONE_BIT << 21 : 0) | \
+ (((hs_mode) != NA) ? ONE_BIT << 19 : 0) | \
+ (((odt_up_dn) != NA) ? ONE_BIT << 18 : 0) | \
+ (((odt_en) != NA) ? ONE_BIT << 17 : 0) | \
+ (THREE_BIT)), \
+ .misc = ((rcomp == ENABLE) ? 1 : 0) , \
+ .mmio_addr = (community_offset == TERMINATOR) ? TERMINATOR : \
+ ((family_no != NA) ? (IO_BASE_ADDRESS + community_offset +\
+ (0x80 * family_no) + 0x1080) : 0) , \
+ .name = 0 \
+}
+
+#define GPIO_PAD_CONF(pad_name, mode_select, mode, gpio_config, gpio_state, \
+ gpio_light_mode, int_type, int_sel, term, open_drain, current_source,\
+ int_mask, glitch, inv_rx_tx, wake_mask, wake_mask_bit, gpe, \
+ mmio_offset, community_offset) { \
+ .confg0 = ((((int_sel) != NA) ? (int_sel << 28) : 0) | \
+ (((glitch) != NA) ? (glitch << 26) : 0) | \
+ (((term) != NA) ? (term << 20) : 0) | \
+ (((mode_select) == GPIO) ? ((mode << 16) | (1 << 15)) : \
+ ((mode << 16))) | \
+ (((gpio_config) != NA) ? (gpio_config << 8) : 0) | \
+ (((gpio_light_mode) != NA) ? (gpio_light_mode << 7) : 0) | \
+ (((gpio_state) == HIGH) ? 2 : 0)), \
+ .confg0_changes = ((((int_sel) != NA) ? (FOUR_BIT << 28) : 0) | \
+ (((glitch) != NA) ? (TWO_BIT << 26) : 0) | \
+ (((term) != NA) ? (FOUR_BIT << 20) : 0) | \
+ (FIVE_BIT << 15) | \
+ (((gpio_config) != NA) ? (THREE_BIT << 8) : 0) | \
+ (((gpio_light_mode) != NA) ? (ONE_BIT << 7) : 0) | \
+ (((gpio_state) != NA) ? ONE_BIT << 1 : 0)), \
+ .confg1 = ((((current_source) != NA) ? (current_source << 27) : 0) | \
+ (((inv_rx_tx) != NA) ? inv_rx_tx << 4 : 0) | \
+ (((open_drain) != NA) ? open_drain << 3 : 0) | \
+ (((int_type) != NA) ? int_type : 0)), \
+ .confg1_changes = ((((current_source) != NA) ? (ONE_BIT << 27) : 0) | \
+ (((inv_rx_tx) != NA) ? FOUR_BIT << 4 : 0) | \
+ (((open_drain) != NA) ? ONE_BIT << 3 : 0) | \
+ (((int_type) != NA) ? THREE_BIT : 0)), \
+ .community = community_offset, \
+ .mmio_addr = (community_offset == TERMINATOR) ? TERMINATOR : \
+ ((mmio_offset != NA) ? (IO_BASE_ADDRESS + \
+ community_offset + mmio_offset) : 0), \
+ .name = 0, \
+ .misc = ((((gpe) != NA) ? (gpe << 0) : 0) | \
+ (((wake_mask) != NA) ? (wake_mask << 2) : 0) | \
+ (((int_mask) != NA) ? (int_mask << 3) : 0)) | \
+ (((wake_mask_bit) != NA) ? (wake_mask_bit << 4) : (NA << 4)) \
+}
+
+#endif /* _BRASWELL_GPIO_H_ */
--- /dev/null
+/*
+ * Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#ifndef _BRASWELL_IOMAP_H_
+#define _BRASWELL_IOMAP_H_
+
+/* Memory Mapped IO bases */
+
+/* Power Management Controller */
+#define PMC_BASE_ADDRESS 0xfed03000
+#define PMC_BASE_SIZE 0x400
+
+/* Power Management Unit */
+#define PUNIT_BASE_ADDRESS 0xfed05000
+#define PUNIT_BASE_SIZE 0x800
+
+/* Intel Legacy Block */
+#define ILB_BASE_ADDRESS 0xfed08000
+#define ILB_BASE_SIZE 0x400
+
+/* SPI Bus */
+#define SPI_BASE_ADDRESS 0xfed01000
+#define SPI_BASE_SIZE 0x400
+
+/* Root Complex Base Address */
+#define RCBA_BASE_ADDRESS 0xfed1c000
+#define RCBA_BASE_SIZE 0x400
+
+/* IO Memory */
+#define IO_BASE_ADDRESS 0xfed80000
+#define IO_BASE_SIZE 0x4000
+
+/* MODPHY */
+#define MPHY_BASE_ADDRESS 0xfef00000
+#define MPHY_BASE_SIZE 0x100000
+
+/* IO Port bases */
+
+#define ACPI_BASE_ADDRESS 0x400
+#define ACPI_BASE_SIZE 0x80
+
+#define GPIO_BASE_ADDRESS 0x500
+#define GPIO_BASE_SIZE 0x100
+
+#define SMBUS_BASE_ADDRESS 0xefa0
+
+#endif /* _BRASWELL_IOMAP_H_ */
#ifndef __ASM_X86_DMA_MAPPING_H
#define __ASM_X86_DMA_MAPPING_H
-#define dma_mapping_error(x, y) 0
+#include <linux/dma-direction.h>
-enum dma_data_direction {
- DMA_BIDIRECTIONAL = 0,
- DMA_TO_DEVICE = 1,
- DMA_FROM_DEVICE = 2,
-};
+#define dma_mapping_error(x, y) 0
static inline void *dma_alloc_coherent(size_t len, unsigned long *handle)
{
u32 stack_top;
u32 boot_mode; /* Current system boot mode */
void *upd_data; /* User platform configuraiton data region */
- u32 reserved[7]; /* Reserved */
+ u32 tolum_size; /* Top of low usable memory size (FSP 1.1) */
+ u32 reserved[6]; /* Reserved */
};
enum fsp_phase {
/* GUID specific data goes here */
};
+enum pixel_format {
+ pixel_rgbx_8bpc, /* RGB 8 bit per color */
+ pixel_bgrx_8bpc, /* BGR 8 bit per color */
+ pixel_bitmask,
+};
+
+struct __packed hob_graphics_info {
+ phys_addr_t fb_base; /* framebuffer base address */
+ u32 fb_size; /* framebuffer size */
+ u32 version;
+ u32 width;
+ u32 height;
+ enum pixel_format pixel_format;
+ u32 red_mask;
+ u32 green_mask;
+ u32 blue_mask;
+ u32 reserved_mask;
+ u32 pixels_per_scanline;
+};
+
/**
* get_next_hob() - return a pointer to the next HOB in the HOB list
*
{ 0x82, 0xb9, 0x56, 0xa5, 0xf3, 0xe6, 0x2a, 0x07 } \
}
+/* The following GUIDs are newly introduced in FSP spec 1.1 */
+
+#define FSP_HOB_RESOURCE_OWNER_BOOTLOADER_TOLUM_GUID \
+ { \
+ 0x73ff4f56, 0xaa8e, 0x4451, \
+ { 0xb3, 0x16, 0x36, 0x35, 0x36, 0x67, 0xad, 0x44 } \
+ }
+
+#define FSP_GRAPHICS_INFO_HOB_GUID \
+ { \
+ 0x39f62cce, 0x6825, 0x4669, \
+ { 0xbb, 0x56, 0x54, 0x1a, 0xba, 0x75, 0x3a, 0x07 } \
+ }
+
#endif
u32 fsp_tempram_init; /* tempram_init offset */
u32 fsp_init; /* fsp_init offset */
u32 fsp_notify; /* fsp_notify offset */
- u32 reserved2;
+ u32 fsp_mem_init; /* fsp_mem_init offset */
+ u32 fsp_tempram_exit; /* fsp_tempram_exit offset */
+ u32 fsp_silicon_init; /* fsp_silicon_init offset */
};
+#define FSP_HEADER_REVISION_1 1
+#define FSP_HEADER_REVISION_2 2
+
+#define FSP_ATTR_GRAPHICS_SUPPORT (1 << 0)
+
#endif
*/
void *fsp_get_bootloader_tmp_mem(const void *hob_list, u32 *len);
+/**
+ * This function retrieves graphics information.
+ *
+ * @hob_list: A HOB list pointer.
+ * @len: A pointer to the graphics info HOB length.
+ * If the HOB is located, the length will be updated.
+ *
+ * @retval NULL: Failed to find the graphics info HOB.
+ * @retval others: A pointer to struct hob_graphics_info.
+ */
+void *fsp_get_graphics_info(const void *hob_list, u32 *len);
+
/**
* This function overrides the default configurations of FSP.
*
uint8_t x86_mask;
uint32_t x86_device;
uint64_t tsc_base; /* Initial value returned by rdtsc() */
+ unsigned long clock_rate; /* Clock rate of timer in Hz */
void *new_fdt; /* Relocated FDT */
uint32_t bist; /* Built-in self test value */
enum pei_boot_mode_t pei_boot_mode;
obj-y += fsp_car.o
obj-y += fsp_common.o
obj-y += fsp_dram.o
+obj-$(CONFIG_VIDEO_FSP) += fsp_graphics.o
obj-y += fsp_support.o
for (i = 0; i < sizeof(hdr->sign); i++)
printf("%c", *sign++);
printf(", size %d, rev %d\n", hdr->hdr_len, hdr->hdr_rev);
- printf("Image : rev %d.%d, id ",
- (hdr->img_rev >> 8) & 0xff, hdr->img_rev & 0xff);
+ printf("Image : rev ");
+ if (hdr->hdr_rev == FSP_HEADER_REVISION_1) {
+ printf("%d.%d",
+ (hdr->img_rev >> 8) & 0xff, hdr->img_rev & 0xff);
+ } else {
+ printf("%d.%d.%d.%d",
+ (hdr->img_rev >> 24) & 0xff, (hdr->img_rev >> 16) & 0xff,
+ (hdr->img_rev >> 8) & 0xff, hdr->img_rev & 0xff);
+ }
+ printf(", id ");
for (i = 0; i < ARRAY_SIZE(hdr->img_id); i++)
printf("%c", hdr->img_id[i]);
printf(", addr 0x%08x, size %d\n", img_addr, hdr->img_size);
+ if (hdr->hdr_rev == FSP_HEADER_REVISION_2) {
+ printf("GFX :%ssupported\n",
+ hdr->img_attr & FSP_ATTR_GRAPHICS_SUPPORT ? " " : " un");
+ }
printf("VPD : addr 0x%08x, size %d\n",
hdr->cfg_region_off + img_addr, hdr->cfg_region_size);
printf("\nNumber of APIs Supported : %d\n", hdr->api_num);
printf("\tTempRamInit : 0x%08x\n", hdr->fsp_tempram_init + img_addr);
printf("\tFspInit : 0x%08x\n", hdr->fsp_init + img_addr);
printf("\tFspNotify : 0x%08x\n", hdr->fsp_notify + img_addr);
+ if (hdr->hdr_rev == FSP_HEADER_REVISION_2) {
+ printf("\tMemoryInit : 0x%08x\n",
+ hdr->fsp_mem_init + img_addr);
+ printf("\tTempRamExit : 0x%08x\n",
+ hdr->fsp_tempram_exit + img_addr);
+ printf("\tSiliconInit : 0x%08x\n",
+ hdr->fsp_silicon_init + img_addr);
+ }
return 0;
}
--- /dev/null
+/*
+ * Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
+#include <dm.h>
+#include <vbe.h>
+#include <video.h>
+#include <asm/fsp/fsp_support.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+struct pixel {
+ u8 pos;
+ u8 size;
+};
+
+static const struct fsp_framebuffer {
+ struct pixel red;
+ struct pixel green;
+ struct pixel blue;
+ struct pixel rsvd;
+} fsp_framebuffer_format_map[] = {
+ [pixel_rgbx_8bpc] = { {0, 8}, {8, 8}, {16, 8}, {24, 8} },
+ [pixel_bgrx_8bpc] = { {16, 8}, {8, 8}, {0, 8}, {24, 8} },
+};
+
+static int save_vesa_mode(struct vesa_mode_info *vesa)
+{
+ const struct hob_graphics_info *ginfo;
+ const struct fsp_framebuffer *fbinfo;
+
+ ginfo = fsp_get_graphics_info(gd->arch.hob_list, NULL);
+
+ /*
+ * If there is no graphics info structure, bail out and keep
+ * running on the serial console.
+ */
+ if (!ginfo) {
+ debug("FSP graphics hand-off block not found\n");
+ return -ENXIO;
+ }
+
+ vesa->x_resolution = ginfo->width;
+ vesa->y_resolution = ginfo->height;
+ vesa->bits_per_pixel = 32;
+ vesa->bytes_per_scanline = ginfo->pixels_per_scanline * 4;
+ vesa->phys_base_ptr = ginfo->fb_base;
+
+ if (ginfo->pixel_format >= pixel_bitmask) {
+ debug("FSP set unknown framebuffer format: %d\n",
+ ginfo->pixel_format);
+ return -EINVAL;
+ }
+ fbinfo = &fsp_framebuffer_format_map[ginfo->pixel_format];
+ vesa->red_mask_size = fbinfo->red.size;
+ vesa->red_mask_pos = fbinfo->red.pos;
+ vesa->green_mask_size = fbinfo->green.size;
+ vesa->green_mask_pos = fbinfo->green.pos;
+ vesa->blue_mask_size = fbinfo->blue.size;
+ vesa->blue_mask_pos = fbinfo->blue.pos;
+ vesa->reserved_mask_size = fbinfo->rsvd.size;
+ vesa->reserved_mask_pos = fbinfo->rsvd.pos;
+
+ return 0;
+}
+
+static int fsp_video_probe(struct udevice *dev)
+{
+ struct video_uc_platdata *plat = dev_get_uclass_platdata(dev);
+ struct video_priv *uc_priv = dev_get_uclass_priv(dev);
+ struct vesa_mode_info *vesa = &mode_info.vesa;
+ int ret;
+
+ printf("Video: ");
+
+ /* Initialize vesa_mode_info structure */
+ ret = save_vesa_mode(vesa);
+ if (ret)
+ goto err;
+
+ /*
+ * The framebuffer base address in the FSP graphics info HOB reflects
+ * the value assigned by the FSP. After PCI enumeration the framebuffer
+ * base address may be relocated. Let's get the updated one from device.
+ *
+ * For IGD, it seems to be always on BAR2.
+ */
+ vesa->phys_base_ptr = dm_pci_read_bar32(dev, 2);
+
+ ret = vbe_setup_video_priv(vesa, uc_priv, plat);
+ if (ret)
+ goto err;
+
+ printf("%dx%dx%d\n", uc_priv->xsize, uc_priv->ysize,
+ vesa->bits_per_pixel);
+
+ return 0;
+
+err:
+ printf("No video mode configured in FSP!\n");
+ return ret;
+}
+
+static const struct udevice_id fsp_video_ids[] = {
+ { .compatible = "fsp-fb" },
+ { }
+};
+
+U_BOOT_DRIVER(fsp_video) = {
+ .name = "fsp_video",
+ .id = UCLASS_VIDEO,
+ .of_match = fsp_video_ids,
+ .probe = fsp_video_probe,
+};
+
+static struct pci_device_id fsp_video_supported[] = {
+ { PCI_DEVICE_CLASS(PCI_CLASS_DISPLAY_VGA << 8, 0xffff00) },
+ { },
+};
+
+U_BOOT_PCI_DEVICE(fsp_video, fsp_video_supported);
return fsp_get_guid_hob_data(hob_list, len, (struct efi_guid *)&guid);
}
+
+void *fsp_get_graphics_info(const void *hob_list, u32 *len)
+{
+ const struct efi_guid guid = FSP_GRAPHICS_INFO_HOB_GUID;
+
+ return fsp_get_guid_hob_data(hob_list, len, (struct efi_guid *)&guid);
+}
* SPDX-License-Identifier: GPL-2.0+
*/
+#include <asm/mach-types.h>
#include <common.h>
#if defined(CONFIG_FTMAC100) && !defined(CONFIG_DM_ETH)
#include <netdev.h>
--- /dev/null
+if TARGET_VYASA_RK3288
+
+config SYS_BOARD
+ default "vyasa-rk3288"
+
+config SYS_VENDOR
+ default "amarula"
+
+config SYS_CONFIG_NAME
+ default "vyasa-rk3288"
+
+endif
--- /dev/null
+VYASA RK3288
+M: Jagan Teki <jagan@amarulasolutions.com>
+S: Maintained
+F: board/amarula/vyasa-rk3288
+F: include/configs/vyasa-rk3288.h
+F: configs/vyasa-rk3288_defconfig
--- /dev/null
+#
+# Copyright (C) 2017 Amarula Solutions
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += vyasa-rk3288.o
--- /dev/null
+/*
+ * Copyright (C) 2017 Amarula Solutions
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
at91_set_pio_pullup(AT91_PIO_PORTD, 7, 1);
at91_set_pio_pullup(AT91_PIO_PORTD, 8, 1);
-#ifdef CONFIG_SYS_USE_MMC
+#ifdef CONFIG_SD_BOOT
at91_mci_hw_init();
-#elif CONFIG_SYS_USE_NANDFLASH
+#elif CONFIG_NAND_BOOT
at91sam9m10g45ek_nand_hw_init();
#endif
}
void at91_spl_board_init(void)
{
-#ifdef CONFIG_SYS_USE_MMC
+#ifdef CONFIG_SD_BOOT
at91_mci_hw_init();
-#elif CONFIG_SYS_USE_NANDFLASH
+#elif CONFIG_NAND_BOOT
at91sam9n12ek_nand_hw_init();
-#elif CONFIG_SYS_USE_SPIFLASH
+#elif CONFIG_SPI_BOOT
at91_spi0_hw_init(1 << 4);
#endif
}
void at91_spl_board_init(void)
{
-#ifdef CONFIG_SYS_USE_MMC
+#ifdef CONFIG_SD_BOOT
at91_mci_hw_init();
-#elif CONFIG_SYS_USE_NANDFLASH
+#elif CONFIG_NAND_BOOT
at91sam9x5ek_nand_hw_init();
#endif
}
--- /dev/null
+#
+# Copyright (C) 2017 Microchip
+# Wenyou Yang <wenyou.yang@microchip.com>
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += board.o
+ifndef CONFIG_SPL_BUILD
+obj-$(CONFIG_I2C_EEPROM) += mac_eeprom.o
+obj-$(CONFIG_DM_VIDEO) += video_display.o
+endif
--- /dev/null
+/*
+ * Copyright (C) 2017 Microchip
+ * Wenyou Yang <wenyou.yang@microchip.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
+
+void dummy(void)
+{
+}
--- /dev/null
+/*
+ * Copyright (C) 2017 Microchip
+ * Wenyou Yang <wenyou.yang@microchip.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
+#include <dm.h>
+#include <i2c_eeprom.h>
+#include <netdev.h>
+
+int at91_set_ethaddr(int offset)
+{
+ const int ETH_ADDR_LEN = 6;
+ unsigned char ethaddr[ETH_ADDR_LEN];
+ const char *ETHADDR_NAME = "ethaddr";
+ struct udevice *dev;
+ int ret;
+
+ if (env_get(ETHADDR_NAME))
+ return 0;
+
+ ret = uclass_first_device_err(UCLASS_I2C_EEPROM, &dev);
+ if (ret)
+ return ret;
+
+ ret = i2c_eeprom_read(dev, offset, ethaddr, 6);
+ if (ret)
+ return ret;
+
+ if (is_valid_ethaddr(ethaddr))
+ eth_env_set_enetaddr(ETHADDR_NAME, ethaddr);
+
+ return 0;
+}
--- /dev/null
+/*
+ * Copyright (C) 2017 Microchip
+ * Wenyou Yang <wenyou.yang@microchip.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
+#include <atmel_lcd.h>
+#include <dm.h>
+#include <nand.h>
+#include <version.h>
+#include <video.h>
+#include <video_console.h>
+#include <asm/io.h>
+#include <asm/arch/clk.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int at91_video_show_board_info(void)
+{
+ ulong dram_size, nand_size;
+ int i;
+ u32 len = 0;
+ char buf[255];
+ char *corp = "2017 Microchip Technology Inc.\n";
+ char temp[32];
+ struct udevice *dev, *con;
+ const char *s;
+ vidinfo_t logo_info;
+ int ret;
+
+ len += sprintf(&buf[len], "%s\n", U_BOOT_VERSION);
+ memcpy(&buf[len], corp, strlen(corp));
+ len += strlen(corp);
+ len += sprintf(&buf[len], "%s CPU at %s MHz\n", get_cpu_name(),
+ strmhz(temp, get_cpu_clk_rate()));
+
+ dram_size = 0;
+ for (i = 0; i < CONFIG_NR_DRAM_BANKS; i++)
+ dram_size += gd->bd->bi_dram[i].size;
+
+ nand_size = 0;
+#ifdef CONFIG_NAND_ATMEL
+ for (i = 0; i < CONFIG_SYS_MAX_NAND_DEVICE; i++)
+ nand_size += nand_info[i]->size;
+#endif
+
+ len += sprintf(&buf[len], "%ld MB SDRAM, %ld MB NAND\n",
+ dram_size >> 20, nand_size >> 20);
+
+ ret = uclass_get_device(UCLASS_VIDEO, 0, &dev);
+ if (ret)
+ return ret;
+
+ microchip_logo_info(&logo_info);
+ ret = video_bmp_display(dev, logo_info.logo_addr,
+ logo_info.logo_x_offset,
+ logo_info.logo_y_offset, false);
+ if (ret)
+ return ret;
+
+ ret = uclass_get_device(UCLASS_VIDEO_CONSOLE, 0, &con);
+ if (ret)
+ return ret;
+
+ vidconsole_position_cursor(con, 0, logo_info.logo_height);
+ for (s = buf, i = 0; i < len; s++, i++)
+ vidconsole_put_char(con, *s);
+
+ return 0;
+}
--- /dev/null
+if TARGET_SAMA5D27_SOM1_EK
+
+config SYS_BOARD
+ default "sama5d27_som1_ek"
+
+config SYS_VENDOR
+ default "atmel"
+
+config SYS_SOC
+ default "at91"
+
+config SYS_CONFIG_NAME
+ default "sama5d27_som1_ek"
+
+endif
--- /dev/null
+SAMA5D27 SOM1 EK BOARD
+M: Wenyou Yang <wenyou.yang@microchip.com>
+S: Maintained
+F: board/atmel/sama5d27_som1_ek/
+F: include/configs/sama5d27_som1_ek.h
+F: configs/sama5d27_som1_ek_mmc_defconfig
--- /dev/null
+#
+# Copyright (C) 2017 Microchip Corporation
+# Wenyou Yang <wenyou.yang@microchip.com>
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += sama5d27_som1_ek.o
--- /dev/null
+/*
+ * Copyright (C) 2017 Microchip Corporation
+ * Wenyou.Yang <wenyou.yang@microchip.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
+#include <debug_uart.h>
+#include <asm/io.h>
+#include <asm/arch/at91_common.h>
+#include <asm/arch/atmel_pio4.h>
+#include <asm/arch/atmel_mpddrc.h>
+#include <asm/arch/atmel_sdhci.h>
+#include <asm/arch/clk.h>
+#include <asm/arch/gpio.h>
+#include <asm/arch/sama5d2.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+static void board_usb_hw_init(void)
+{
+ atmel_pio4_set_pio_output(AT91_PIO_PORTB, 10, 1);
+}
+
+#ifdef CONFIG_BOARD_LATE_INIT
+int board_late_init(void)
+{
+#ifdef CONFIG_DM_VIDEO
+ at91_video_show_board_info();
+#endif
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_DEBUG_UART_BOARD_INIT
+static void board_uart1_hw_init(void)
+{
+ atmel_pio4_set_a_periph(AT91_PIO_PORTD, 2, 1); /* URXD1 */
+ atmel_pio4_set_a_periph(AT91_PIO_PORTD, 3, 0); /* UTXD1 */
+
+ at91_periph_clk_enable(ATMEL_ID_UART1);
+}
+
+void board_debug_uart_init(void)
+{
+ board_uart1_hw_init();
+}
+#endif
+
+#ifdef CONFIG_BOARD_EARLY_INIT_F
+int board_early_init_f(void)
+{
+#ifdef CONFIG_DEBUG_UART
+ debug_uart_init();
+#endif
+
+ return 0;
+}
+#endif
+
+int board_init(void)
+{
+ /* address of boot parameters */
+ gd->bd->bi_boot_params = CONFIG_SYS_SDRAM_BASE + 0x100;
+
+#ifdef CONFIG_CMD_USB
+ board_usb_hw_init();
+#endif
+
+ return 0;
+}
+
+int dram_init(void)
+{
+ gd->ram_size = get_ram_size((void *)CONFIG_SYS_SDRAM_BASE,
+ CONFIG_SYS_SDRAM_SIZE);
+ return 0;
+}
+
+#define MAC24AA_MAC_OFFSET 0xfa
+
+#ifdef CONFIG_MISC_INIT_R
+int misc_init_r(void)
+{
+#ifdef CONFIG_I2C_EEPROM
+ at91_set_ethaddr(MAC24AA_MAC_OFFSET);
+#endif
+ return 0;
+}
+#endif
+
+/* SPL */
+#ifdef CONFIG_SPL_BUILD
+void spl_board_init(void)
+{
+}
+
+static void ddrc_conf(struct atmel_mpddrc_config *ddrc)
+{
+ ddrc->md = (ATMEL_MPDDRC_MD_DBW_16_BITS | ATMEL_MPDDRC_MD_DDR2_SDRAM);
+
+ ddrc->cr = (ATMEL_MPDDRC_CR_NC_COL_10 |
+ ATMEL_MPDDRC_CR_NR_ROW_13 |
+ ATMEL_MPDDRC_CR_CAS_DDR_CAS3 |
+ ATMEL_MPDDRC_CR_DIC_DS |
+ ATMEL_MPDDRC_CR_ZQ_LONG |
+ ATMEL_MPDDRC_CR_NB_8BANKS |
+ ATMEL_MPDDRC_CR_DECOD_INTERLEAVED |
+ ATMEL_MPDDRC_CR_UNAL_SUPPORTED);
+
+ ddrc->rtr = 0x511;
+
+ ddrc->tpr0 = ((7 << ATMEL_MPDDRC_TPR0_TRAS_OFFSET) |
+ (3 << ATMEL_MPDDRC_TPR0_TRCD_OFFSET) |
+ (3 << ATMEL_MPDDRC_TPR0_TWR_OFFSET) |
+ (9 << ATMEL_MPDDRC_TPR0_TRC_OFFSET) |
+ (3 << ATMEL_MPDDRC_TPR0_TRP_OFFSET) |
+ (4 << ATMEL_MPDDRC_TPR0_TRRD_OFFSET) |
+ (4 << ATMEL_MPDDRC_TPR0_TWTR_OFFSET) |
+ (2 << ATMEL_MPDDRC_TPR0_TMRD_OFFSET));
+
+ ddrc->tpr1 = ((22 << ATMEL_MPDDRC_TPR1_TRFC_OFFSET) |
+ (23 << ATMEL_MPDDRC_TPR1_TXSNR_OFFSET) |
+ (200 << ATMEL_MPDDRC_TPR1_TXSRD_OFFSET) |
+ (3 << ATMEL_MPDDRC_TPR1_TXP_OFFSET));
+
+ ddrc->tpr2 = ((2 << ATMEL_MPDDRC_TPR2_TXARD_OFFSET) |
+ (8 << ATMEL_MPDDRC_TPR2_TXARDS_OFFSET) |
+ (4 << ATMEL_MPDDRC_TPR2_TRPA_OFFSET) |
+ (4 << ATMEL_MPDDRC_TPR2_TRTP_OFFSET) |
+ (8 << ATMEL_MPDDRC_TPR2_TFAW_OFFSET));
+}
+
+void mem_init(void)
+{
+ struct at91_pmc *pmc = (struct at91_pmc *)ATMEL_BASE_PMC;
+ struct atmel_mpddr *mpddrc = (struct atmel_mpddr *)ATMEL_BASE_MPDDRC;
+ struct atmel_mpddrc_config ddrc_config;
+ u32 reg;
+
+ ddrc_conf(&ddrc_config);
+
+ at91_periph_clk_enable(ATMEL_ID_MPDDRC);
+ writel(AT91_PMC_DDR, &pmc->scer);
+
+ reg = readl(&mpddrc->io_calibr);
+ reg &= ~ATMEL_MPDDRC_IO_CALIBR_RDIV;
+ reg |= ATMEL_MPDDRC_IO_CALIBR_DDR3_RZQ_55;
+ reg &= ~ATMEL_MPDDRC_IO_CALIBR_TZQIO;
+ reg |= ATMEL_MPDDRC_IO_CALIBR_TZQIO_(101);
+ writel(reg, &mpddrc->io_calibr);
+
+ writel(ATMEL_MPDDRC_RD_DATA_PATH_SHIFT_ONE_CYCLE,
+ &mpddrc->rd_data_path);
+
+ ddr3_init(ATMEL_BASE_MPDDRC, ATMEL_BASE_DDRCS, &ddrc_config);
+
+ writel(0x3, &mpddrc->cal_mr4);
+ writel(64, &mpddrc->tim_cal);
+}
+
+void at91_pmc_init(void)
+{
+ u32 tmp;
+
+ /*
+ * while coming from the ROM code, we run on PLLA @ 492 MHz / 164 MHz
+ * so we need to slow down and configure MCKR accordingly.
+ * This is why we have a special flavor of the switching function.
+ */
+ tmp = AT91_PMC_MCKR_PLLADIV_2 |
+ AT91_PMC_MCKR_MDIV_3 |
+ AT91_PMC_MCKR_CSS_MAIN;
+ at91_mck_init_down(tmp);
+
+ tmp = AT91_PMC_PLLAR_29 |
+ AT91_PMC_PLLXR_PLLCOUNT(0x3f) |
+ AT91_PMC_PLLXR_MUL(40) |
+ AT91_PMC_PLLXR_DIV(1);
+ at91_plla_init(tmp);
+
+ tmp = AT91_PMC_MCKR_H32MXDIV |
+ AT91_PMC_MCKR_PLLADIV_2 |
+ AT91_PMC_MCKR_MDIV_3 |
+ AT91_PMC_MCKR_CSS_PLLA;
+ at91_mck_init(tmp);
+}
+#endif
#ifdef CONFIG_SPL_BUILD
void spl_board_init(void)
{
-#ifdef CONFIG_SYS_USE_SERIALFLASH
+#ifdef CONFIG_SPI_BOOT
board_spi0_hw_init();
#endif
-#ifdef CONFIG_SYS_USE_NANDFLASH
+#ifdef CONFIG_NAND_BOOT
board_nand_hw_init();
#endif
}
#include <common.h>
#include <atmel_hlcdc.h>
#include <debug_uart.h>
-#include <dm.h>
-#include <i2c.h>
#include <lcd.h>
#include <version.h>
#include <asm/io.h>
return 0;
}
-#ifdef CONFIG_CMD_I2C
-static int set_ethaddr_from_eeprom(void)
-{
- const int ETH_ADDR_LEN = 6;
- unsigned char ethaddr[ETH_ADDR_LEN];
- const char *ETHADDR_NAME = "ethaddr";
- struct udevice *bus, *dev;
-
- if (env_get(ETHADDR_NAME))
- return 0;
-
- if (uclass_get_device_by_seq(UCLASS_I2C, 1, &bus)) {
- printf("Cannot find I2C bus 1\n");
- return -1;
- }
-
- if (dm_i2c_probe(bus, AT24MAC_ADDR, 0, &dev)) {
- printf("Failed to probe I2C chip\n");
- return -1;
- }
-
- if (dm_i2c_read(dev, AT24MAC_REG, ethaddr, ETH_ADDR_LEN)) {
- printf("Failed to read ethernet address from EEPROM\n");
- return -1;
- }
-
- if (!is_valid_ethaddr(ethaddr)) {
- printf("The ethernet address read from EEPROM is not valid!\n");
- return -1;
- }
-
- return eth_env_set_enetaddr(ETHADDR_NAME, ethaddr);
-}
-#else
-static int set_ethaddr_from_eeprom(void)
-{
- return 0;
-}
-#endif
+#define AT24MAC_MAC_OFFSET 0x9a
#ifdef CONFIG_MISC_INIT_R
int misc_init_r(void)
{
- set_ethaddr_from_eeprom();
+#ifdef CONFIG_I2C_EEPROM
+ at91_set_ethaddr(AT24MAC_MAC_OFFSET);
+#endif
return 0;
}
struct at91_pmc *pmc = (struct at91_pmc *)ATMEL_BASE_PMC;
u32 tmp;
+ /*
+ * while coming from the ROM code, we run on PLLA @ 492 MHz / 164 MHz
+ * so we need to slow down and configure MCKR accordingly.
+ * This is why we have a special flavor of the switching function.
+ */
+ tmp = AT91_PMC_MCKR_PLLADIV_2 |
+ AT91_PMC_MCKR_MDIV_3 |
+ AT91_PMC_MCKR_CSS_MAIN;
+ at91_mck_init_down(tmp);
+
tmp = AT91_PMC_PLLAR_29 |
AT91_PMC_PLLXR_PLLCOUNT(0x3f) |
AT91_PMC_PLLXR_MUL(82) |
#ifdef CONFIG_SPL_BUILD
void spl_board_init(void)
{
-#ifdef CONFIG_SYS_USE_MMC
+#ifdef CONFIG_SD_BOOT
#ifdef CONFIG_GENERIC_ATMEL_MCI
sama5d3_xplained_mci0_hw_init();
#endif
-#elif CONFIG_SYS_USE_NANDFLASH
+#elif CONFIG_NAND_BOOT
sama5d3_xplained_nand_hw_init();
#endif
}
#ifdef CONFIG_SPL_BUILD
void spl_board_init(void)
{
-#if CONFIG_SYS_USE_NANDFLASH
+#if CONFIG_NAND_BOOT
sama5d3xek_nand_hw_init();
#endif
}
}
#endif
+#define AT24MAC_MAC_OFFSET 0x9a
+
+#ifdef CONFIG_MISC_INIT_R
+int misc_init_r(void)
+{
+#ifdef CONFIG_I2C_EEPROM
+ at91_set_ethaddr(AT24MAC_MAC_OFFSET);
+#endif
+ return 0;
+}
+#endif
+
int board_init(void)
{
/* adress of boot parameters */
#ifdef CONFIG_SPL_BUILD
void spl_board_init(void)
{
-#if CONFIG_SYS_USE_NANDFLASH
+#if CONFIG_NAND_BOOT
sama5d4_xplained_nand_hw_init();
#endif
}
#ifdef CONFIG_SPL_BUILD
void spl_board_init(void)
{
-#if CONFIG_SYS_USE_NANDFLASH
+#if CONFIG_NAND_BOOT
sama5d4ek_nand_hw_init();
#endif
}
/* configure MMDC for SDRAM width/size and per-model calibration */
ot1200_spl_dram_init();
-
- /* Clear the BSS. */
- memset(__bss_start, 0, __bss_end - __bss_start);
-
- /* load/boot image from boot device */
- board_init_r(NULL, 0);
}
/* Serial console */
static const struct pad_conf_entry cl_som_am57x_padconf_console[] = {
- {UART3_RXD, (FSC | IEN | PDIS | PTU | M0)}, /* UART3_RXD */
- {UART3_TXD, (FSC | IEN | PDIS | PTU | M0)}, /* UART3_TXD */
+ {UART3_RXD, (M0 | PIN_INPUT_PULLUP | SLEWCONTROL)}, /* UART3_RXD */
+ {UART3_TXD, (M0 | PIN_INPUT_PULLUP | SLEWCONTROL)}, /* UART3_TXD */
};
/* PMIC I2C */
static const struct pad_conf_entry cl_som_am57x_padconf_pmic[] = {
- {MCASP1_ACLKR, (IEN | PEN | M10)}, /* MCASP1_ACLKR.I2C4_SDA */
- {MCASP1_FSR, (IEN | PEN | M10)}, /* MCASP1_FSR.I2C4_SCL */
+ {MCASP1_ACLKR, (M10 | PIN_INPUT)}, /* MCASP1_ACLKR.I2C4_SDA */
+ {MCASP1_FSR, (M10 | PIN_INPUT)}, /* MCASP1_FSR.I2C4_SCL */
};
/* Green GPIO led */
static const struct pad_conf_entry cl_som_am57x_padconf_green_led[] = {
- {GPMC_A15, (IDIS | PDIS | PTD | M14)}, /* GPMC_A15.GPIO2_5 */
+ {GPMC_A15, (M14 | PIN_OUTPUT_PULLDOWN)}, /* GPMC_A15.GPIO2_5 */
};
/* MMC/SD Card */
static const struct pad_conf_entry cl_som_am57x_padconf_sd_card[] = {
- {MMC1_CLK, (IEN | PDIS | PTU | M0) }, /* MMC1_CLK */
- {MMC1_CMD, (IEN | PDIS | PTU | M0) }, /* MMC1_CMD */
- {MMC1_DAT0, (IEN | PDIS | PTU | M0) }, /* MMC1_DAT0 */
- {MMC1_DAT1, (IEN | PDIS | PTU | M0) }, /* MMC1_DAT1 */
- {MMC1_DAT2, (IEN | PDIS | PTU | M0) }, /* MMC1_DAT2 */
- {MMC1_DAT3, (IEN | PDIS | PTU | M0) }, /* MMC1_DAT3 */
- {MMC1_SDCD, (IEN | PEN | M14)}, /* MMC1_SDCD */
- {MMC1_SDWP, (IEN | PEN | M14)}, /* MMC1_SDWP */
+ {MMC1_CLK, (M0 | PIN_INPUT_PULLUP)}, /* MMC1_CLK */
+ {MMC1_CMD, (M0 | PIN_INPUT_PULLUP)}, /* MMC1_CMD */
+ {MMC1_DAT0, (M0 | PIN_INPUT_PULLUP)}, /* MMC1_DAT0 */
+ {MMC1_DAT1, (M0 | PIN_INPUT_PULLUP)}, /* MMC1_DAT1 */
+ {MMC1_DAT2, (M0 | PIN_INPUT_PULLUP)}, /* MMC1_DAT2 */
+ {MMC1_DAT3, (M0 | PIN_INPUT_PULLUP)}, /* MMC1_DAT3 */
+ {MMC1_SDCD, (M14 | PIN_INPUT) }, /* MMC1_SDCD */
+ {MMC1_SDWP, (M14 | PIN_INPUT) }, /* MMC1_SDWP */
};
/* WiFi - must be in the safe mode on boot */
static const struct pad_conf_entry cl_som_am57x_padconf_wifi[] = {
- {UART1_CTSN, (IEN | M15)}, /* UART1_CTSN */
- {UART1_RTSN, (IEN | M15)}, /* UART1_RTSN */
- {UART2_RXD, (IEN | M15)}, /* UART2_RXD */
- {UART2_TXD, (IEN | M15)}, /* UART2_TXD */
- {UART2_CTSN, (IEN | M15)}, /* UART2_CTSN */
- {UART2_RTSN, (IEN | M15)}, /* UART2_RTSN */
+ {UART1_CTSN, (M15 | PIN_INPUT_PULLDOWN)}, /* UART1_CTSN */
+ {UART1_RTSN, (M15 | PIN_INPUT_PULLDOWN)}, /* UART1_RTSN */
+ {UART2_RXD, (M15 | PIN_INPUT_PULLDOWN)}, /* UART2_RXD */
+ {UART2_TXD, (M15 | PIN_INPUT_PULLDOWN)}, /* UART2_TXD */
+ {UART2_CTSN, (M15 | PIN_INPUT_PULLDOWN)}, /* UART2_CTSN */
+ {UART2_RTSN, (M15 | PIN_INPUT_PULLDOWN)}, /* UART2_RTSN */
};
/* QSPI */
static const struct pad_conf_entry cl_som_am57x_padconf_qspi[] = {
- {GPMC_A13, (IEN | PEN | M1)}, /* GPMC_A13.QSPI1_RTCLK */
- {GPMC_A18, (IEN | PEN | M1)}, /* GPMC_A18.QSPI1_SCLK */
- {GPMC_A16, (IEN | PEN | M1)}, /* GPMC_A16.QSPI1_D0 */
- {GPMC_A17, (IEN | PEN | M1)}, /* GPMC_A17.QSPI1_D1 */
- {GPMC_CS2, (IEN | PDIS | PTU | M1)}, /* GPMC_CS2.QSPI1_CS0 */
+ {GPMC_A13, (M1 | PIN_INPUT) }, /* GPMC_A13.QSPI1_RTCLK */
+ {GPMC_A18, (M1 | PIN_INPUT) }, /* GPMC_A18.QSPI1_SCLK */
+ {GPMC_A16, (M1 | PIN_INPUT) }, /* GPMC_A16.QSPI1_D0 */
+ {GPMC_A17, (M1 | PIN_INPUT) }, /* GPMC_A17.QSPI1_D1 */
+ {GPMC_CS2, (M1 | PIN_INPUT_PULLUP)}, /* GPMC_CS2.QSPI1_CS0 */
};
/* GPIO Expander I2C */
static const struct pad_conf_entry cl_som_am57x_padconf_i2c_gpio[] = {
- {MCASP1_AXR0, (IEN | PEN | M10)}, /* MCASP1_AXR0.I2C5_SDA */
- {MCASP1_AXR1, (IEN | PEN | M10)}, /* MCASP1_AXR1.I2C5_SCL */
+ {MCASP1_AXR0, (M10 | PIN_INPUT)}, /* MCASP1_AXR0.I2C5_SDA */
+ {MCASP1_AXR1, (M10 | PIN_INPUT)}, /* MCASP1_AXR1.I2C5_SCL */
};
/* eMMC internal storage */
static const struct pad_conf_entry cl_som_am57x_padconf_emmc[] = {
- {GPMC_A19, (IEN | PDIS | PTU | M1)}, /* GPMC_A19.MMC2_DAT4 */
- {GPMC_A20, (IEN | PDIS | PTU | M1)}, /* GPMC_A20.MMC2_DAT5 */
- {GPMC_A21, (IEN | PDIS | PTU | M1)}, /* GPMC_A21.MMC2_DAT6 */
- {GPMC_A22, (IEN | PDIS | PTU | M1)}, /* GPMC_A22.MMC2_DAT7 */
- {GPMC_A23, (IEN | PDIS | PTU | M1)}, /* GPMC_A23.MMC2_CLK */
- {GPMC_A24, (IEN | PDIS | PTU | M1)}, /* GPMC_A24.MMC2_DAT0 */
- {GPMC_A25, (IEN | PDIS | PTU | M1)}, /* GPMC_A25.MMC2_DAT1 */
- {GPMC_A26, (IEN | PDIS | PTU | M1)}, /* GPMC_A26.MMC2_DAT2 */
- {GPMC_A27, (IEN | PDIS | PTU | M1)}, /* GPMC_A27.MMC2_DAT3 */
- {GPMC_CS1, (IEN | PDIS | PTU | M1)}, /* GPMC_CS1.MMC2_CMD */
+ {GPMC_A19, (M1 | PIN_INPUT_PULLUP)}, /* GPMC_A19.MMC2_DAT4 */
+ {GPMC_A20, (M1 | PIN_INPUT_PULLUP)}, /* GPMC_A20.MMC2_DAT5 */
+ {GPMC_A21, (M1 | PIN_INPUT_PULLUP)}, /* GPMC_A21.MMC2_DAT6 */
+ {GPMC_A22, (M1 | PIN_INPUT_PULLUP)}, /* GPMC_A22.MMC2_DAT7 */
+ {GPMC_A23, (M1 | PIN_INPUT_PULLUP)}, /* GPMC_A23.MMC2_CLK */
+ {GPMC_A24, (M1 | PIN_INPUT_PULLUP)}, /* GPMC_A24.MMC2_DAT0 */
+ {GPMC_A25, (M1 | PIN_INPUT_PULLUP)}, /* GPMC_A25.MMC2_DAT1 */
+ {GPMC_A26, (M1 | PIN_INPUT_PULLUP)}, /* GPMC_A26.MMC2_DAT2 */
+ {GPMC_A27, (M1 | PIN_INPUT_PULLUP)}, /* GPMC_A27.MMC2_DAT3 */
+ {GPMC_CS1, (M1 | PIN_INPUT_PULLUP)}, /* GPMC_CS1.MMC2_CMD */
};
/* usb1_drvvbus */
static const struct pad_conf_entry cl_som_am57x_padconf_usb[] = {
- {USB1_DRVVBUS, (M0 | FSC) }, /* USB1_DRVVBUS.USB1_DRVVBUS */
+ /* USB1_DRVVBUS.USB1_DRVVBUS */
+ {USB1_DRVVBUS, (M0 | PIN_OUTPUT_PULLDOWN | SLEWCONTROL) },
};
/* Ethernet */
static const struct pad_conf_entry cl_som_am57x_padconf_ethernet[] = {
/* MDIO bus */
- {VIN2A_D10, (PDIS | PTU | M3) }, /* VIN2A_D10.MDIO_MCLK */
- {VIN2A_D11, (IEN | PDIS | PTU | M3) }, /* VIN2A_D11.MDIO_D */
+ {VIN2A_D10, (M3 | PIN_OUTPUT_PULLUP) }, /* VIN2A_D10.MDIO_MCLK */
+ {VIN2A_D11, (M3 | PIN_INPUT_PULLUP) }, /* VIN2A_D11.MDIO_D */
/* EMAC Slave 1 at addr 0x1 - Default interface */
- {VIN2A_D12, (IDIS | PEN | M3) }, /* VIN2A_D12.RGMII1_TXC */
- {VIN2A_D13, (IDIS | PEN | M3) }, /* VIN2A_D13.RGMII1_TXCTL */
- {VIN2A_D14, (IDIS | PEN | M3) }, /* VIN2A_D14.RGMII1_TXD3 */
- {VIN2A_D15, (IDIS | PEN | M3) }, /* VIN2A_D15.RGMII1_TXD2 */
- {VIN2A_D16, (IDIS | PEN | M3) }, /* VIN2A_D16.RGMII1_TXD1 */
- {VIN2A_D17, (IDIS | PEN | M3) }, /* VIN2A_D17.RGMII1_TXD0 */
- {VIN2A_D18, (IEN | PDIS | PTD | M3) }, /* VIN2A_D18.RGMII1_RXC */
- {VIN2A_D19, (IEN | PDIS | PTD | M3) }, /* VIN2A_D19.RGMII1_RXCTL */
- {VIN2A_D20, (IEN | PDIS | PTD | M3) }, /* VIN2A_D20.RGMII1_RXD3 */
- {VIN2A_D21, (IEN | PDIS | PTD | M3) }, /* VIN2A_D21.RGMII1_RXD2 */
- {VIN2A_D22, (IEN | PDIS | PTD | M3) }, /* VIN2A_D22.RGMII1_RXD1 */
- {VIN2A_D23, (IEN | PDIS | PTD | M3) }, /* VIN2A_D23.RGMII1_RXD0 */
+ {VIN2A_D12, (M3 | PIN_OUTPUT) }, /* VIN2A_D12.RGMII1_TXC */
+ {VIN2A_D13, (M3 | PIN_OUTPUT) }, /* VIN2A_D13.RGMII1_TXCTL */
+ {VIN2A_D14, (M3 | PIN_OUTPUT) }, /* VIN2A_D14.RGMII1_TXD3 */
+ {VIN2A_D15, (M3 | PIN_OUTPUT) }, /* VIN2A_D15.RGMII1_TXD2 */
+ {VIN2A_D16, (M3 | PIN_OUTPUT) }, /* VIN2A_D16.RGMII1_TXD1 */
+ {VIN2A_D17, (M3 | PIN_OUTPUT) }, /* VIN2A_D17.RGMII1_TXD0 */
+ {VIN2A_D18, (M3 | PIN_INPUT_PULLDOWN) }, /* VIN2A_D18.RGMII1_RXC */
+ {VIN2A_D19, (M3 | PIN_INPUT_PULLDOWN) }, /* VIN2A_D19.RGMII1_RXCTL */
+ {VIN2A_D20, (M3 | PIN_INPUT_PULLDOWN) }, /* VIN2A_D20.RGMII1_RXD3 */
+ {VIN2A_D21, (M3 | PIN_INPUT_PULLDOWN) }, /* VIN2A_D21.RGMII1_RXD2 */
+ {VIN2A_D22, (M3 | PIN_INPUT_PULLDOWN) }, /* VIN2A_D22.RGMII1_RXD1 */
+ {VIN2A_D23, (M3 | PIN_INPUT_PULLDOWN) }, /* VIN2A_D23.RGMII1_RXD0 */
/* Eth PHY1 reset GPIOs*/
- {VIN2A_CLK0, (IDIS | PDIS | PTD | M14)}, /* VIN2A_CLK0.GPIO3_28 */
+ {VIN2A_CLK0, (M14 | PIN_OUTPUT_PULLDOWN)}, /* VIN2A_CLK0.GPIO3_28 */
};
#define SET_MUX(mux_array) do_set_mux32((*ctrl)->control_padconf_core_base, \
puts("!!!ERROR!!! DRAM detection failed!!!\n");
hang();
}
-
- memset(__bss_start, 0, __bss_end - __bss_start);
- board_init_r(NULL, 0);
}
void board_boot_order(u32 *spl_boot_list)
config SYS_CONFIG_NAME
default "da850evm"
+menuconfig DA850_MAC
+ bool "Use MAC Address"
+ default y
+
+if DA850_MAC
+config MAC_ADDR_IN_SPIFLASH
+ bool "MAC address in SPI Flash"
+ default y
+ help
+ The OMAP-L138 and AM1808 SoM are programmed with
+ their MAC address in SPI Flash from the factory
+ Enable this option to read the MAC from SPI Flash
+
+config MAC_ADDR_IN_EEPROM
+ bool "MAC address in EEPROM"
+ help
+ The DA850 EVM comes with SoM are programmed with
+ their MAC address in SPI Flash from the factory,
+ but the kit has an optional expansion board with
+ EEPROM available. Enable this option to read the
+ MAC from the EEPROM
+
+endif
+
endif
if TARGET_OMAPL138_LCDK
config SYS_CONFIG_NAME
default "omapl138_lcdk"
-source "board/ti/common/Kconfig"
-
endif
+
+source "board/ti/common/Kconfig"
-DA8XXEVM BOARD
-M: Nick Thompson <nick.thompson@gefanuc.com>
-S: Maintained
-F: board/davinci/da8xxevm/
-F: include/configs/da830evm.h
-F: configs/da830evm_defconfig
-
DA850_AM18XXEVM BOARD
-M: Sudhakar Rajashekhara <sudhakar.raj@ti.com>
+M: Adam Ford <aford173@gmail.com>
S: Maintained
+F: board/davinci/da8xxevm/
F: include/configs/da850evm.h
F: configs/da850_am18xxevm_defconfig
F: configs/da850evm_defconfig
enetaddr_found = eth_env_get_enetaddr("ethaddr", env_enetaddr);
+#endif
+
#ifdef CONFIG_MAC_ADDR_IN_SPIFLASH
int spi_mac_read;
uchar buff[6];
"with the MAC address in the environment\n");
printf("Default using MAC address from environment\n");
}
-#endif
+
+#elif defined(CONFIG_MAC_ADDR_IN_EEPROM)
uint8_t enetaddr[8];
int eeprom_mac_read;
/* DDR initialization */
spl_dram_init();
-
- /* Clear the BSS. */
- memset(__bss_start, 0, __bss_end - __bss_start);
-
- /* load/boot image from boot device */
- board_init_r(NULL, 0);
}
int board_init(void)
{
- struct ccsr_cci400 *cci = (struct ccsr_cci400 *)CONFIG_SYS_CCI400_ADDR;
+ struct ccsr_cci400 *cci = (struct ccsr_cci400 *)(CONFIG_SYS_IMMR +
+ CONFIG_SYS_CCI400_OFFSET);
+
/*
* Set CCI-400 control override register to enable barrier
* transaction
int board_init(void)
{
- struct ccsr_cci400 *cci = (struct ccsr_cci400 *)
- CONFIG_SYS_CCI400_ADDR;
+ struct ccsr_cci400 *cci = (struct ccsr_cci400 *)(CONFIG_SYS_IMMR +
+ CONFIG_SYS_CCI400_OFFSET);
/* Set CCI-400 control override register to enable barrier
* transaction */
int board_init(void)
{
- struct ccsr_cci400 *cci = (struct ccsr_cci400 *)CONFIG_SYS_CCI400_ADDR;
+ struct ccsr_cci400 *cci = (struct ccsr_cci400 *)(CONFIG_SYS_IMMR +
+ CONFIG_SYS_CCI400_OFFSET);
/*
* Set CCI-400 control override register to enable barrier
* transaction
#ifdef CONFIG_SPL_BUILD
void board_init_f(ulong dummy)
{
- struct ccsr_cci400 *cci = (struct ccsr_cci400 *)CONFIG_SYS_CCI400_ADDR;
+ struct ccsr_cci400 *cci = (struct ccsr_cci400 *)(CONFIG_SYS_IMMR +
+ CONFIG_SYS_CCI400_OFFSET);
unsigned int major;
#ifdef CONFIG_NAND_BOOT
int board_init(void)
{
- struct ccsr_cci400 *cci = (struct ccsr_cci400 *)CONFIG_SYS_CCI400_ADDR;
+ struct ccsr_cci400 *cci = (struct ccsr_cci400 *)(CONFIG_SYS_IMMR +
+ CONFIG_SYS_CCI400_OFFSET);
unsigned int major;
#ifdef CONFIG_SYS_FSL_ERRATUM_A010315
#if defined(CONFIG_DEEP_SLEEP)
void board_sleep_prepare(void)
{
- struct ccsr_cci400 __iomem *cci = (void *)CONFIG_SYS_CCI400_ADDR;
+ struct ccsr_cci400 __iomem *cci = (void *)(CONFIG_SYS_IMMR +
+ CONFIG_SYS_CCI400_OFFSET);
unsigned int major;
major = get_soc_major_rev();
--- /dev/null
+if TARGET_LS1088AQDS
+
+config SYS_BOARD
+ default "ls1088a"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls1088aqds"
+
+endif
+
+if TARGET_LS1088ARDB
+
+config SYS_BOARD
+ default "ls1088a"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls1088ardb"
+
+endif
--- /dev/null
+LS1088ARDB BOARD
+M: Prabhakar Kushwaha <prabhakar.kushwaha@nxp.com>
+M: Ashish Kumar <Ashish.Kumar@nxp.com>
+S: Maintained
+F: board/freescale/ls1088a/
+F: include/configs/ls1088ardb.h
+F: configs/ls1088ardb_qspi_defconfig
+
+LS1088AQDS BOARD
+M: Prabhakar Kushwaha <prabhakar.kushwaha@nxp.com>
+M: Ashish Kumar <Ashish.Kumar@nxp.com>
+S: Maintained
+F: board/freescale/ls1088a/
+F: include/configs/ls1088aqds.h
+F: configs/ls1088aqds_qspi_defconfig
--- /dev/null
+#
+# Copyright 2017 NXP
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += ls1088a.o
+obj-$(CONFIG_TARGET_LS1088ARDB) += eth_ls1088ardb.o
+obj-$(CONFIG_TARGET_LS1088AQDS) += eth_ls1088aqds.o
+obj-y += ddr.o
--- /dev/null
+Overview
+--------
+The LS1088A Reference Design (RDB) is a high-performance computing,
+evaluation, and development platform that supports ARM SoC LS1088A and its
+derivatives.
+
+
+LS1088A SoC Overview
+--------------------------------------
+Please refer arch/arm/cpu/armv8/fsl-layerscape/doc/README.soc
+
+RDB Default Switch Settings (1: ON; 0: OFF)
+-------------------------------------------
+
+For QSPI Boot
+SW1 0011 0001
+SW2 x100 0000
+SW3 1111 0010
+SW4 1001 0011
+SW5 1111 0000
+
+For SD Boot
+SW1 0010 0000
+SW2 0100 0000
+SW3 1111 0010
+SW4 1001 0011
+SW5 1111 0000
+
+For eMMC Boot
+SW1 0010 0000
+SW2 1100 0000
+SW3 1111 0010
+SW4 1001 0011
+SW5 1111 0000
+
+Alternately you can use this command to switch from QSPI to SD
+
+=> i2c mw 66 0x60 0x20; i2c mw 66 10 10;i2c mw 66 10 21
+
+ LS1088ARDB board Overview
+ -------------------------
+ - SERDES Connections, 16 lanes supporting:
+ - PCI Express - 3.0
+ - SATA 3.0
+ - XFI
+ - QSGMII
+ - DDR Controller
+ - One ports of 72-bits (8-bits ECC, 64-bits DATA) DDR4. Each port supports four
+ chip-selects on one DIMM connector. Support is up to 2133MT/s, Although MAX default
+ with FSL refernce software is 2100MT/s
+ - 2 QSPI-NOR Spansion(S25FS512SDSMFI011) flash of size 64MB
+ - IFC/Local Bus
+ - One 2 GB NAND flash with ECC support, not as boot source
+ - CPLD of size 2K
+ - USB 3.0
+ - Two high speed USB 3.0 ports
+ - First USB 3.0 port configured as Host with Type-A connector
+ - Second USB 3.0 port configured as OTG with micro-AB connector
+ - SDHC/eMMC
+ - SDHC slot and onboard eMMC are muxed together
+ - 4 I2C controllers
+ - Two SATA onboard connectors
+ - 2 UART
+ - JTAG support
+ - QSPI emulator support
+ - TDM riser support
+
+QDS Default Switch Settings (1: ON; 0: OFF)
+-------------------------------------------
+
+For 16b IFC-NOR
+SW1 0001 0010
+SW2 x110 1111
+
+For QSPI Boot
+SW1 0011 0001
+SW2 0110 1111
+
+For SD Boot
+SW1 0010 0000
+SW2 0110 1111
+
+For eMMC Boot
+SW1 0010 0000
+SW2 1110 1111
+
+For I2C (ext. addr.)
+SW1 0010 0100
+SW2 1110 1111
+
+SW3 to SW12 are identical for all boot source
+
+SW3 0010 0100
+SW4 0010 0000
+SW5 1110 0111
+SW6 1110 1000
+SW7 0001 1101
+SW8 0000 1101
+SW9 1100 1010
+SW10 1110 1000
+SW11 1111 0100
+SW12 1111 1111
+
+ LS1088AQDS board Overview
+ -------------------------
+ - SERDES Connections, 16 lanes supporting:
+ - PCI Express - 3.0
+ - SATA 3.0
+ - 2 XFI
+ - QSGMII, SGMII with help for Riser card
+ - 2 RGMII
+ - 5 slot for Riser card or PCIe NIC
+ - DDR Controller
+ - One ports of 72-bits (8-bits ECC, 64-bits DATA) DDR4. Each port supports four
+ chip-selects on one DIMM connector. Support is up to 2133MT/s, Although MAX default
+ with FSL refernce software is 2100MT/s
+ - 2 QSPI-NOR Spansion(S25FS512SDSMFI011) flash of size 64MB
+ - IFC/Local Bus
+ - One 2 GB NAND flash with ECC support, not as boot source
+ - CPLD of size 2K
+ - USB 3.0
+ - Two high speed USB 3.0 ports
+ - First USB 3.0 port configured as Host with Type-A connector
+ - Second USB 3.0 port configured as OTG with micro-AB connector
+ - SDHC/eMMC
+ - SDHC/eMMC slot via adaptor
+ - 4 I2C controllers
+ - Two SATA onboard connectors
+ - 2 UART
+ - JTAG support
+ - DSPI
+ - PROMJET support
+ - QSPI emulator support
+ - TDM riser support
+
+QSPI flash memory map valid for both QDS and RDB
+ Image Flash Offset
+ RCW+PBI 0x00000000
+ Boot firmware (U-Boot) 0x00100000
+ Boot firmware Environment 0x00300000
+ PPA firmware 0x00400000
+ DPAA2 MC 0x00A00000
+ DPAA2 DPL 0x00D00000
+ DPAA2 DPC 0x00E00000
+ Kernel.itb 0x01000000
--- /dev/null
+/*
+ * Copyright 2017 NXP
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <asm/arch/soc.h>
+#include <asm/arch/clock.h>
+#include "ddr.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+ const struct board_specific_parameters *pbsp, *pbsp_highest = NULL;
+ ulong ddr_freq;
+
+ if (ctrl_num > 1) {
+ printf("Not supported controller number %d\n", ctrl_num);
+ return;
+ }
+ if (!pdimm->n_ranks)
+ return;
+
+ /*
+ * we use identical timing for all slots. If needed, change the code
+ * to pbsp = rdimms[ctrl_num] or pbsp = udimms[ctrl_num];
+ */
+ pbsp = udimms[0];
+
+ /* Get clk_adjust, wrlvl_start, wrlvl_ctl, according to the board ddr
+ * freqency and n_banks specified in board_specific_parameters table.
+ */
+ ddr_freq = get_ddr_freq(0) / 1000000;
+ while (pbsp->datarate_mhz_high) {
+ if (pbsp->n_ranks == pdimm->n_ranks) {
+ if (ddr_freq <= pbsp->datarate_mhz_high) {
+ popts->clk_adjust = pbsp->clk_adjust;
+ popts->wrlvl_start = pbsp->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ goto found;
+ }
+ pbsp_highest = pbsp;
+ }
+ pbsp++;
+ }
+
+ if (pbsp_highest) {
+ printf("Error: board specific timing not found for %lu MT/s\n",
+ ddr_freq);
+ printf("Trying to use the highest speed (%u) parameters\n",
+ pbsp_highest->datarate_mhz_high);
+ popts->clk_adjust = pbsp_highest->clk_adjust;
+ popts->wrlvl_start = pbsp_highest->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ } else {
+ panic("DIMM is not supported by this board");
+ }
+found:
+ debug("Found timing match: n_ranks %d, data rate %d, rank_gb %d\n"
+ "\tclk_adjust %d, wrlvl_start %d, wrlvl_ctrl_2 0x%x, wrlvl_ctrl_3 0x%x\n",
+ pbsp->n_ranks, pbsp->datarate_mhz_high, pbsp->rank_gb,
+ pbsp->clk_adjust, pbsp->wrlvl_start, pbsp->wrlvl_ctl_2,
+ pbsp->wrlvl_ctl_3);
+
+
+
+ popts->half_strength_driver_enable = 0;
+ /*
+ * Write leveling override
+ */
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0xf;
+
+
+ /* Enable ZQ calibration */
+ popts->zq_en = 1;
+
+ /* Enable DDR hashing */
+ popts->addr_hash = 1;
+
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN | DDR_CDR1_ODT(DDR_CDR_ODT_60ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_60ohm) |
+ DDR_CDR2_VREF_TRAIN_EN | DDR_CDR2_VREF_RANGE_2;
+}
+
+
+int fsl_initdram(void)
+{
+ puts("Initializing DDR....using SPD\n");
+
+ gd->ram_size = fsl_ddr_sdram();
+
+ return 0;
+}
--- /dev/null
+/*
+ * Copyright 2017 NXP
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#ifndef __LS1088A_DDR_H__
+#define __LS1088A_DDR_H__
+struct board_specific_parameters {
+ u32 n_ranks;
+ u32 datarate_mhz_high;
+ u32 rank_gb;
+ u32 clk_adjust;
+ u32 wrlvl_start;
+ u32 wrlvl_ctl_2;
+ u32 wrlvl_ctl_3;
+};
+
+/*
+ * These tables contain all valid speeds we want to override with board
+ * specific parameters. datarate_mhz_high values need to be in ascending order
+ * for each n_ranks group.
+ */
+
+static const struct board_specific_parameters udimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3
+ */
+#if defined(CONFIG_TARGET_LS1088ARDB)
+
+ {2, 1666, 0, 8, 8, 0x090A0B0E, 0x0F10110D,},
+ {2, 1900, 0, 4, 7, 0x09090B0D, 0x0E10120B,},
+ {2, 2300, 0, 8, 9, 0x0A0C0E11, 0x1214160F,},
+ {}
+#elif defined(CONFIG_TARGET_LS1088AQDS)
+ {2, 1666, 0, 8, 8, 0x0A0A0C0E, 0x0F10110C,},
+ {2, 1900, 0, 4, 7, 0x09090B0D, 0x0E10120B,},
+ {2, 2300, 0, 4, 9, 0x0A0C0D11, 0x1214150E,},
+ {}
+
+#endif
+};
+
+static const struct board_specific_parameters *udimms[] = {
+ udimm0,
+};
+#endif
--- /dev/null
+/*
+ * Copyright 2017 NXP
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
+#include <netdev.h>
+#include <asm/io.h>
+#include <asm/arch/fsl_serdes.h>
+#include <hwconfig.h>
+#include <fsl_mdio.h>
+#include <malloc.h>
+#include <fm_eth.h>
+#include <i2c.h>
+#include <miiphy.h>
+#include <fsl-mc/ldpaa_wriop.h>
+
+#include "../common/qixis.h"
+
+#include "ls1088a_qixis.h"
+
+#define MC_BOOT_ENV_VAR "mcinitcmd"
+
+#ifdef CONFIG_FSL_MC_ENET
+
+#define SFP_TX 0
+
+ /* - In LS1088A A there are only 16 SERDES lanes, spread across 2 SERDES banks.
+ * Bank 1 -> Lanes A, B, C, D,
+ * Bank 2 -> Lanes A,B, C, D,
+ */
+
+ /* Mapping of 8 SERDES lanes to LS1088A QDS board slots. A value of '0' here
+ * means that the mapping must be determined dynamically, or that the lane
+ * maps to something other than a board slot.
+ */
+
+static u8 lane_to_slot_fsm1[] = {
+ 0, 0, 0, 0, 0, 0, 0, 0
+};
+
+/* On the Vitesse VSC8234XHG SGMII riser card there are 4 SGMII PHYs
+ * housed.
+ */
+
+static int xqsgii_riser_phy_addr[] = {
+ XQSGMII_CARD_PHY1_PORT0_ADDR,
+ XQSGMII_CARD_PHY2_PORT0_ADDR,
+ XQSGMII_CARD_PHY3_PORT0_ADDR,
+ XQSGMII_CARD_PHY4_PORT0_ADDR,
+ XQSGMII_CARD_PHY3_PORT2_ADDR,
+ XQSGMII_CARD_PHY1_PORT2_ADDR,
+ XQSGMII_CARD_PHY4_PORT2_ADDR,
+ XQSGMII_CARD_PHY2_PORT2_ADDR,
+};
+
+static int sgmii_riser_phy_addr[] = {
+ SGMII_CARD_PORT1_PHY_ADDR,
+ SGMII_CARD_PORT2_PHY_ADDR,
+ SGMII_CARD_PORT3_PHY_ADDR,
+ SGMII_CARD_PORT4_PHY_ADDR,
+};
+
+/* Slot2 does not have EMI connections */
+#define EMI_NONE 0xFF
+#define EMI1_RGMII1 0
+#define EMI1_RGMII2 1
+#define EMI1_SLOT1 2
+
+static const char * const mdio_names[] = {
+ "LS1088A_QDS_MDIO0",
+ "LS1088A_QDS_MDIO1",
+ "LS1088A_QDS_MDIO2",
+ DEFAULT_WRIOP_MDIO2_NAME,
+};
+
+struct ls1088a_qds_mdio {
+ u8 muxval;
+ struct mii_dev *realbus;
+};
+
+static void sgmii_configure_repeater(int dpmac)
+{
+ struct mii_dev *bus;
+ uint8_t a = 0xf;
+ int i, j, ret;
+ unsigned short value;
+ const char *dev = "LS1088A_QDS_MDIO2";
+ int i2c_addr[] = {0x58, 0x59, 0x5a, 0x5b};
+ int i2c_phy_addr = 0;
+ int phy_addr = 0;
+
+ uint8_t ch_a_eq[] = {0x1, 0x2, 0x3, 0x7};
+ uint8_t ch_a_ctl2[] = {0x81, 0x82, 0x83, 0x84};
+ uint8_t ch_b_eq[] = {0x1, 0x2, 0x3, 0x7};
+ uint8_t ch_b_ctl2[] = {0x81, 0x82, 0x83, 0x84};
+
+ /* Set I2c to Slot 1 */
+ i2c_write(0x77, 0, 0, &a, 1);
+
+ switch (dpmac) {
+ case 1:
+ i2c_phy_addr = i2c_addr[1];
+ phy_addr = 4;
+ break;
+ case 2:
+ i2c_phy_addr = i2c_addr[0];
+ phy_addr = 0;
+ break;
+ case 3:
+ i2c_phy_addr = i2c_addr[3];
+ phy_addr = 0xc;
+ break;
+ case 7:
+ i2c_phy_addr = i2c_addr[2];
+ phy_addr = 8;
+ break;
+ }
+
+ /* Check the PHY status */
+ ret = miiphy_set_current_dev(dev);
+ if (ret > 0)
+ goto error;
+
+ bus = mdio_get_current_dev();
+ debug("Reading from bus %s\n", bus->name);
+
+ ret = miiphy_write(dev, phy_addr, 0x1f, 3);
+ if (ret > 0)
+ goto error;
+
+ mdelay(10);
+ ret = miiphy_read(dev, phy_addr, 0x11, &value);
+ if (ret > 0)
+ goto error;
+
+ mdelay(10);
+
+ if ((value & 0xfff) == 0x401) {
+ miiphy_write(dev, phy_addr, 0x1f, 0);
+ printf("DPMAC %d:PHY is ..... Configured\n", dpmac);
+ return;
+ }
+
+ for (i = 0; i < 4; i++) {
+ for (j = 0; j < 4; j++) {
+ a = 0x18;
+ i2c_write(i2c_phy_addr, 6, 1, &a, 1);
+ a = 0x38;
+ i2c_write(i2c_phy_addr, 4, 1, &a, 1);
+ a = 0x4;
+ i2c_write(i2c_phy_addr, 8, 1, &a, 1);
+
+ i2c_write(i2c_phy_addr, 0xf, 1,
+ &ch_a_eq[i], 1);
+ i2c_write(i2c_phy_addr, 0x11, 1,
+ &ch_a_ctl2[j], 1);
+
+ i2c_write(i2c_phy_addr, 0x16, 1,
+ &ch_b_eq[i], 1);
+ i2c_write(i2c_phy_addr, 0x18, 1,
+ &ch_b_ctl2[j], 1);
+
+ a = 0x14;
+ i2c_write(i2c_phy_addr, 0x23, 1, &a, 1);
+ a = 0xb5;
+ i2c_write(i2c_phy_addr, 0x2d, 1, &a, 1);
+ a = 0x20;
+ i2c_write(i2c_phy_addr, 4, 1, &a, 1);
+ mdelay(100);
+ ret = miiphy_read(dev, phy_addr, 0x11, &value);
+ if (ret > 0)
+ goto error;
+
+ mdelay(100);
+ ret = miiphy_read(dev, phy_addr, 0x11, &value);
+ if (ret > 0)
+ goto error;
+
+ if ((value & 0xfff) == 0x401) {
+ printf("DPMAC %d :PHY is configured ",
+ dpmac);
+ printf("after setting repeater 0x%x\n",
+ value);
+ i = 5;
+ j = 5;
+ } else {
+ printf("DPMAC %d :PHY is failed to ",
+ dpmac);
+ printf("configure the repeater 0x%x\n", value);
+ }
+ }
+ }
+ miiphy_write(dev, phy_addr, 0x1f, 0);
+error:
+ if (ret)
+ printf("DPMAC %d ..... FAILED to configure PHY\n", dpmac);
+ return;
+}
+
+static void qsgmii_configure_repeater(int dpmac)
+{
+ uint8_t a = 0xf;
+ int i, j;
+ int i2c_phy_addr = 0;
+ int phy_addr = 0;
+ int i2c_addr[] = {0x58, 0x59, 0x5a, 0x5b};
+
+ uint8_t ch_a_eq[] = {0x1, 0x2, 0x3, 0x7};
+ uint8_t ch_a_ctl2[] = {0x81, 0x82, 0x83, 0x84};
+ uint8_t ch_b_eq[] = {0x1, 0x2, 0x3, 0x7};
+ uint8_t ch_b_ctl2[] = {0x81, 0x82, 0x83, 0x84};
+
+ const char *dev = mdio_names[EMI1_SLOT1];
+ int ret = 0;
+ unsigned short value;
+
+ /* Set I2c to Slot 1 */
+ i2c_write(0x77, 0, 0, &a, 1);
+
+ switch (dpmac) {
+ case 7:
+ case 8:
+ case 9:
+ case 10:
+ i2c_phy_addr = i2c_addr[2];
+ phy_addr = 8;
+ break;
+
+ case 3:
+ case 4:
+ case 5:
+ case 6:
+ i2c_phy_addr = i2c_addr[3];
+ phy_addr = 0xc;
+ break;
+ }
+
+ /* Check the PHY status */
+ ret = miiphy_set_current_dev(dev);
+ ret = miiphy_write(dev, phy_addr, 0x1f, 3);
+ mdelay(10);
+ ret = miiphy_read(dev, phy_addr, 0x11, &value);
+ mdelay(10);
+ ret = miiphy_read(dev, phy_addr, 0x11, &value);
+ mdelay(10);
+ if ((value & 0xf) == 0xf) {
+ miiphy_write(dev, phy_addr, 0x1f, 0);
+ printf("DPMAC %d :PHY is ..... Configured\n", dpmac);
+ return;
+ }
+
+ for (i = 0; i < 4; i++) {
+ for (j = 0; j < 4; j++) {
+ a = 0x18;
+ i2c_write(i2c_phy_addr, 6, 1, &a, 1);
+ a = 0x38;
+ i2c_write(i2c_phy_addr, 4, 1, &a, 1);
+ a = 0x4;
+ i2c_write(i2c_phy_addr, 8, 1, &a, 1);
+
+ i2c_write(i2c_phy_addr, 0xf, 1, &ch_a_eq[i], 1);
+ i2c_write(i2c_phy_addr, 0x11, 1, &ch_a_ctl2[j], 1);
+
+ i2c_write(i2c_phy_addr, 0x16, 1, &ch_b_eq[i], 1);
+ i2c_write(i2c_phy_addr, 0x18, 1, &ch_b_ctl2[j], 1);
+
+ a = 0x14;
+ i2c_write(i2c_phy_addr, 0x23, 1, &a, 1);
+ a = 0xb5;
+ i2c_write(i2c_phy_addr, 0x2d, 1, &a, 1);
+ a = 0x20;
+ i2c_write(i2c_phy_addr, 4, 1, &a, 1);
+ mdelay(100);
+ ret = miiphy_read(dev, phy_addr, 0x11, &value);
+ if (ret > 0)
+ goto error;
+ mdelay(1);
+ ret = miiphy_read(dev, phy_addr, 0x11, &value);
+ if (ret > 0)
+ goto error;
+ mdelay(10);
+ if ((value & 0xf) == 0xf) {
+ miiphy_write(dev, phy_addr, 0x1f, 0);
+ printf("DPMAC %d :PHY is ..... Configured\n",
+ dpmac);
+ return;
+ }
+ }
+ }
+error:
+ printf("DPMAC %d :PHY ..... FAILED to configure PHY\n", dpmac);
+ return;
+}
+
+static const char *ls1088a_qds_mdio_name_for_muxval(u8 muxval)
+{
+ return mdio_names[muxval];
+}
+
+struct mii_dev *mii_dev_for_muxval(u8 muxval)
+{
+ struct mii_dev *bus;
+ const char *name = ls1088a_qds_mdio_name_for_muxval(muxval);
+
+ if (!name) {
+ printf("No bus for muxval %x\n", muxval);
+ return NULL;
+ }
+
+ bus = miiphy_get_dev_by_name(name);
+
+ if (!bus) {
+ printf("No bus by name %s\n", name);
+ return NULL;
+ }
+
+ return bus;
+}
+
+static void ls1088a_qds_enable_SFP_TX(u8 muxval)
+{
+ u8 brdcfg9;
+
+ brdcfg9 = QIXIS_READ(brdcfg[9]);
+ brdcfg9 &= ~BRDCFG9_SFPTX_MASK;
+ brdcfg9 |= (muxval << BRDCFG9_SFPTX_SHIFT);
+ QIXIS_WRITE(brdcfg[9], brdcfg9);
+}
+
+static void ls1088a_qds_mux_mdio(u8 muxval)
+{
+ u8 brdcfg4;
+
+ if (muxval <= 5) {
+ brdcfg4 = QIXIS_READ(brdcfg[4]);
+ brdcfg4 &= ~BRDCFG4_EMISEL_MASK;
+ brdcfg4 |= (muxval << BRDCFG4_EMISEL_SHIFT);
+ QIXIS_WRITE(brdcfg[4], brdcfg4);
+ }
+}
+
+static int ls1088a_qds_mdio_read(struct mii_dev *bus, int addr,
+ int devad, int regnum)
+{
+ struct ls1088a_qds_mdio *priv = bus->priv;
+
+ ls1088a_qds_mux_mdio(priv->muxval);
+
+ return priv->realbus->read(priv->realbus, addr, devad, regnum);
+}
+
+static int ls1088a_qds_mdio_write(struct mii_dev *bus, int addr, int devad,
+ int regnum, u16 value)
+{
+ struct ls1088a_qds_mdio *priv = bus->priv;
+
+ ls1088a_qds_mux_mdio(priv->muxval);
+
+ return priv->realbus->write(priv->realbus, addr, devad, regnum, value);
+}
+
+static int ls1088a_qds_mdio_reset(struct mii_dev *bus)
+{
+ struct ls1088a_qds_mdio *priv = bus->priv;
+
+ return priv->realbus->reset(priv->realbus);
+}
+
+static int ls1088a_qds_mdio_init(char *realbusname, u8 muxval)
+{
+ struct ls1088a_qds_mdio *pmdio;
+ struct mii_dev *bus = mdio_alloc();
+
+ if (!bus) {
+ printf("Failed to allocate ls1088a_qds MDIO bus\n");
+ return -1;
+ }
+
+ pmdio = malloc(sizeof(*pmdio));
+ if (!pmdio) {
+ printf("Failed to allocate ls1088a_qds private data\n");
+ free(bus);
+ return -1;
+ }
+
+ bus->read = ls1088a_qds_mdio_read;
+ bus->write = ls1088a_qds_mdio_write;
+ bus->reset = ls1088a_qds_mdio_reset;
+ sprintf(bus->name, ls1088a_qds_mdio_name_for_muxval(muxval));
+
+ pmdio->realbus = miiphy_get_dev_by_name(realbusname);
+
+ if (!pmdio->realbus) {
+ printf("No bus with name %s\n", realbusname);
+ free(bus);
+ free(pmdio);
+ return -1;
+ }
+
+ pmdio->muxval = muxval;
+ bus->priv = pmdio;
+
+ return mdio_register(bus);
+}
+
+/*
+ * Initialize the dpmac_info array.
+ *
+ */
+static void initialize_dpmac_to_slot(void)
+{
+ struct ccsr_gur __iomem *gur = (void *)CONFIG_SYS_FSL_GUTS_ADDR;
+ u32 serdes1_prtcl, cfg;
+
+ cfg = in_le32(&gur->rcwsr[FSL_CHASSIS3_SRDS1_REGSR - 1]) &
+ FSL_CHASSIS3_SRDS1_PRTCL_MASK;
+ cfg >>= FSL_CHASSIS3_SRDS1_PRTCL_SHIFT;
+ serdes1_prtcl = serdes_get_number(FSL_SRDS_1, cfg);
+
+ switch (serdes1_prtcl) {
+ case 0x12:
+ printf("qds: WRIOP: Supported SerDes1 Protocol 0x%02x\n",
+ serdes1_prtcl);
+ lane_to_slot_fsm1[0] = EMI1_SLOT1 - 1;
+ lane_to_slot_fsm1[1] = EMI1_SLOT1 - 1;
+ lane_to_slot_fsm1[2] = EMI1_SLOT1 - 1;
+ lane_to_slot_fsm1[3] = EMI1_SLOT1 - 1;
+ break;
+ case 0x15:
+ case 0x1D:
+ printf("qds: WRIOP: Supported SerDes1 Protocol 0x%02x\n",
+ serdes1_prtcl);
+ lane_to_slot_fsm1[0] = EMI1_SLOT1 - 1;
+ lane_to_slot_fsm1[1] = EMI1_SLOT1 - 1;
+ lane_to_slot_fsm1[2] = EMI_NONE;
+ lane_to_slot_fsm1[3] = EMI_NONE;
+ break;
+ case 0x1E:
+ printf("qds: WRIOP: Supported SerDes1 Protocol 0x%02x\n",
+ serdes1_prtcl);
+ lane_to_slot_fsm1[0] = EMI1_SLOT1 - 1;
+ lane_to_slot_fsm1[1] = EMI1_SLOT1 - 1;
+ lane_to_slot_fsm1[2] = EMI1_SLOT1 - 1;
+ lane_to_slot_fsm1[3] = EMI_NONE;
+ break;
+ case 0x3A:
+ printf("qds: WRIOP: Supported SerDes1 Protocol 0x%02x\n",
+ serdes1_prtcl);
+ lane_to_slot_fsm1[0] = EMI1_SLOT1 - 1;
+ lane_to_slot_fsm1[1] = EMI_NONE;
+ lane_to_slot_fsm1[2] = EMI1_SLOT1 - 1;
+ lane_to_slot_fsm1[3] = EMI1_SLOT1 - 1;
+ break;
+
+ default:
+ printf("%s qds: WRIOP: Unsupported SerDes1 Protocol 0x%02x\n",
+ __func__, serdes1_prtcl);
+ break;
+ }
+}
+
+void ls1088a_handle_phy_interface_sgmii(int dpmac_id)
+{
+ struct mii_dev *bus;
+ struct ccsr_gur __iomem *gur = (void *)CONFIG_SYS_FSL_GUTS_ADDR;
+ u32 serdes1_prtcl, cfg;
+
+ cfg = in_le32(&gur->rcwsr[FSL_CHASSIS3_SRDS1_REGSR - 1]) &
+ FSL_CHASSIS3_SRDS1_PRTCL_MASK;
+ cfg >>= FSL_CHASSIS3_SRDS1_PRTCL_SHIFT;
+ serdes1_prtcl = serdes_get_number(FSL_SRDS_1, cfg);
+
+ int *riser_phy_addr;
+ char *env_hwconfig = env_get("hwconfig");
+
+ if (hwconfig_f("xqsgmii", env_hwconfig))
+ riser_phy_addr = &xqsgii_riser_phy_addr[0];
+ else
+ riser_phy_addr = &sgmii_riser_phy_addr[0];
+
+ switch (serdes1_prtcl) {
+ case 0x12:
+ case 0x15:
+ case 0x1E:
+ case 0x3A:
+ switch (dpmac_id) {
+ case 1:
+ wriop_set_phy_address(dpmac_id, riser_phy_addr[1]);
+ break;
+ case 2:
+ wriop_set_phy_address(dpmac_id, riser_phy_addr[0]);
+ break;
+ case 3:
+ wriop_set_phy_address(dpmac_id, riser_phy_addr[3]);
+ break;
+ case 7:
+ wriop_set_phy_address(dpmac_id, riser_phy_addr[2]);
+ break;
+ default:
+ printf("WRIOP: Wrong DPMAC%d set to SGMII", dpmac_id);
+ break;
+ }
+ break;
+ default:
+ printf("%s qds: WRIOP: Unsupported SerDes1 Protocol 0x%02x\n",
+ __func__, serdes1_prtcl);
+ return;
+ }
+ dpmac_info[dpmac_id].board_mux = EMI1_SLOT1;
+ bus = mii_dev_for_muxval(EMI1_SLOT1);
+ wriop_set_mdio(dpmac_id, bus);
+}
+
+void ls1088a_handle_phy_interface_qsgmii(int dpmac_id)
+{
+ struct mii_dev *bus;
+ struct ccsr_gur __iomem *gur = (void *)CONFIG_SYS_FSL_GUTS_ADDR;
+ u32 serdes1_prtcl, cfg;
+
+ cfg = in_le32(&gur->rcwsr[FSL_CHASSIS3_SRDS1_REGSR - 1]) &
+ FSL_CHASSIS3_SRDS1_PRTCL_MASK;
+ cfg >>= FSL_CHASSIS3_SRDS1_PRTCL_SHIFT;
+ serdes1_prtcl = serdes_get_number(FSL_SRDS_1, cfg);
+
+ switch (serdes1_prtcl) {
+ case 0x1D:
+ case 0x1E:
+ switch (dpmac_id) {
+ case 3:
+ case 4:
+ case 5:
+ case 6:
+ wriop_set_phy_address(dpmac_id, dpmac_id + 9);
+ break;
+ case 7:
+ case 8:
+ case 9:
+ case 10:
+ wriop_set_phy_address(dpmac_id, dpmac_id + 1);
+ break;
+ }
+
+ dpmac_info[dpmac_id].board_mux = EMI1_SLOT1;
+ bus = mii_dev_for_muxval(EMI1_SLOT1);
+ wriop_set_mdio(dpmac_id, bus);
+ break;
+ default:
+ printf("qds: WRIOP: Unsupported SerDes Protocol 0x%02x\n",
+ serdes1_prtcl);
+ break;
+ }
+}
+
+void ls1088a_handle_phy_interface_xsgmii(int i)
+{
+ struct ccsr_gur __iomem *gur = (void *)CONFIG_SYS_FSL_GUTS_ADDR;
+ u32 serdes1_prtcl, cfg;
+
+ cfg = in_le32(&gur->rcwsr[FSL_CHASSIS3_SRDS1_REGSR - 1]) &
+ FSL_CHASSIS3_SRDS1_PRTCL_MASK;
+ cfg >>= FSL_CHASSIS3_SRDS1_PRTCL_SHIFT;
+ serdes1_prtcl = serdes_get_number(FSL_SRDS_1, cfg);
+
+ switch (serdes1_prtcl) {
+ case 0x15:
+ case 0x1D:
+ case 0x1E:
+ wriop_set_phy_address(i, i + 26);
+ ls1088a_qds_enable_SFP_TX(SFP_TX);
+ break;
+ default:
+ printf("qds: WRIOP: Unsupported SerDes Protocol 0x%02x\n",
+ serdes1_prtcl);
+ break;
+ }
+}
+
+static void ls1088a_handle_phy_interface_rgmii(int dpmac_id)
+{
+ struct ccsr_gur __iomem *gur = (void *)CONFIG_SYS_FSL_GUTS_ADDR;
+ u32 serdes1_prtcl, cfg;
+ struct mii_dev *bus;
+
+ cfg = in_le32(&gur->rcwsr[FSL_CHASSIS3_SRDS1_REGSR - 1]) &
+ FSL_CHASSIS3_SRDS1_PRTCL_MASK;
+ cfg >>= FSL_CHASSIS3_SRDS1_PRTCL_SHIFT;
+ serdes1_prtcl = serdes_get_number(FSL_SRDS_1, cfg);
+
+ switch (dpmac_id) {
+ case 4:
+ wriop_set_phy_address(dpmac_id, RGMII_PHY1_ADDR);
+ dpmac_info[dpmac_id].board_mux = EMI1_RGMII1;
+ bus = mii_dev_for_muxval(EMI1_RGMII1);
+ wriop_set_mdio(dpmac_id, bus);
+ break;
+ case 5:
+ wriop_set_phy_address(dpmac_id, RGMII_PHY2_ADDR);
+ dpmac_info[dpmac_id].board_mux = EMI1_RGMII2;
+ bus = mii_dev_for_muxval(EMI1_RGMII2);
+ wriop_set_mdio(dpmac_id, bus);
+ break;
+ default:
+ printf("qds: WRIOP: Unsupported RGMII SerDes Protocol 0x%02x\n",
+ serdes1_prtcl);
+ break;
+ }
+}
+#endif
+
+int board_eth_init(bd_t *bis)
+{
+ int error = 0, i;
+ char *mc_boot_env_var;
+#ifdef CONFIG_FSL_MC_ENET
+ struct memac_mdio_info *memac_mdio0_info;
+ char *env_hwconfig = env_get("hwconfig");
+
+ initialize_dpmac_to_slot();
+
+ memac_mdio0_info = (struct memac_mdio_info *)malloc(
+ sizeof(struct memac_mdio_info));
+ memac_mdio0_info->regs =
+ (struct memac_mdio_controller *)
+ CONFIG_SYS_FSL_WRIOP1_MDIO1;
+ memac_mdio0_info->name = DEFAULT_WRIOP_MDIO1_NAME;
+
+ /* Register the real MDIO1 bus */
+ fm_memac_mdio_init(bis, memac_mdio0_info);
+ /* Register the muxing front-ends to the MDIO buses */
+ ls1088a_qds_mdio_init(DEFAULT_WRIOP_MDIO1_NAME, EMI1_RGMII1);
+ ls1088a_qds_mdio_init(DEFAULT_WRIOP_MDIO1_NAME, EMI1_RGMII2);
+ ls1088a_qds_mdio_init(DEFAULT_WRIOP_MDIO1_NAME, EMI1_SLOT1);
+
+ for (i = WRIOP1_DPMAC1; i < NUM_WRIOP_PORTS; i++) {
+ switch (wriop_get_enet_if(i)) {
+ case PHY_INTERFACE_MODE_RGMII:
+ ls1088a_handle_phy_interface_rgmii(i);
+ break;
+ case PHY_INTERFACE_MODE_QSGMII:
+ ls1088a_handle_phy_interface_qsgmii(i);
+ break;
+ case PHY_INTERFACE_MODE_SGMII:
+ ls1088a_handle_phy_interface_sgmii(i);
+ break;
+ case PHY_INTERFACE_MODE_XGMII:
+ ls1088a_handle_phy_interface_xsgmii(i);
+ break;
+ default:
+ break;
+
+ if (i == 16)
+ i = NUM_WRIOP_PORTS;
+ }
+ }
+
+ mc_boot_env_var = env_get(MC_BOOT_ENV_VAR);
+ if (mc_boot_env_var)
+ run_command_list(mc_boot_env_var, -1, 0);
+ error = cpu_eth_init(bis);
+
+ if (hwconfig_f("xqsgmii", env_hwconfig)) {
+ for (i = WRIOP1_DPMAC1; i < NUM_WRIOP_PORTS; i++) {
+ switch (wriop_get_enet_if(i)) {
+ case PHY_INTERFACE_MODE_QSGMII:
+ qsgmii_configure_repeater(i);
+ break;
+ case PHY_INTERFACE_MODE_SGMII:
+ sgmii_configure_repeater(i);
+ break;
+ default:
+ break;
+ }
+
+ if (i == 16)
+ i = NUM_WRIOP_PORTS;
+ }
+ }
+#endif
+ error = pci_eth_init(bis);
+ return error;
+}
--- /dev/null
+/*
+ * Copyright 2017 NXP
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
+#include <command.h>
+#include <netdev.h>
+#include <malloc.h>
+#include <fsl_mdio.h>
+#include <miiphy.h>
+#include <phy.h>
+#include <fm_eth.h>
+#include <asm/io.h>
+#include <exports.h>
+#include <asm/arch/fsl_serdes.h>
+#include <fsl-mc/ldpaa_wriop.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define MC_BOOT_ENV_VAR "mcinitcmd"
+int board_eth_init(bd_t *bis)
+{
+#if defined(CONFIG_FSL_MC_ENET)
+ char *mc_boot_env_var;
+ int i, interface;
+ struct memac_mdio_info mdio_info;
+ struct mii_dev *dev;
+ struct ccsr_gur *gur = (void *)(CONFIG_SYS_FSL_GUTS_ADDR);
+ struct memac_mdio_controller *reg;
+ u32 srds_s1, cfg;
+
+ cfg = in_le32(&gur->rcwsr[FSL_CHASSIS3_SRDS1_REGSR - 1]) &
+ FSL_CHASSIS3_SRDS1_PRTCL_MASK;
+ cfg >>= FSL_CHASSIS3_SRDS1_PRTCL_SHIFT;
+
+ srds_s1 = serdes_get_number(FSL_SRDS_1, cfg);
+
+ reg = (struct memac_mdio_controller *)CONFIG_SYS_FSL_WRIOP1_MDIO1;
+ mdio_info.regs = reg;
+ mdio_info.name = DEFAULT_WRIOP_MDIO1_NAME;
+
+ /* Register the EMI 1 */
+ fm_memac_mdio_init(bis, &mdio_info);
+
+ reg = (struct memac_mdio_controller *)CONFIG_SYS_FSL_WRIOP1_MDIO2;
+ mdio_info.regs = reg;
+ mdio_info.name = DEFAULT_WRIOP_MDIO2_NAME;
+
+ /* Register the EMI 2 */
+ fm_memac_mdio_init(bis, &mdio_info);
+
+ switch (srds_s1) {
+ case 0x1D:
+ /*
+ * XFI does not need a PHY to work, but to avoid U-boot use
+ * default PHY address which is zero to a MAC when it found
+ * a MAC has no PHY address, we give a PHY address to XFI
+ * MAC error.
+ */
+ wriop_set_phy_address(WRIOP1_DPMAC1, 0x0a);
+ wriop_set_phy_address(WRIOP1_DPMAC2, AQ_PHY_ADDR1);
+ wriop_set_phy_address(WRIOP1_DPMAC3, QSGMII1_PORT1_PHY_ADDR);
+ wriop_set_phy_address(WRIOP1_DPMAC4, QSGMII1_PORT2_PHY_ADDR);
+ wriop_set_phy_address(WRIOP1_DPMAC5, QSGMII1_PORT3_PHY_ADDR);
+ wriop_set_phy_address(WRIOP1_DPMAC6, QSGMII1_PORT4_PHY_ADDR);
+ wriop_set_phy_address(WRIOP1_DPMAC7, QSGMII2_PORT1_PHY_ADDR);
+ wriop_set_phy_address(WRIOP1_DPMAC8, QSGMII2_PORT2_PHY_ADDR);
+ wriop_set_phy_address(WRIOP1_DPMAC9, QSGMII2_PORT3_PHY_ADDR);
+ wriop_set_phy_address(WRIOP1_DPMAC10, QSGMII2_PORT4_PHY_ADDR);
+
+ break;
+ default:
+ printf("SerDes1 protocol 0x%x is not supported on LS1088ARDB\n",
+ srds_s1);
+ break;
+ }
+
+ for (i = WRIOP1_DPMAC3; i <= WRIOP1_DPMAC10; i++) {
+ interface = wriop_get_enet_if(i);
+ switch (interface) {
+ case PHY_INTERFACE_MODE_QSGMII:
+ dev = miiphy_get_dev_by_name(DEFAULT_WRIOP_MDIO1_NAME);
+ wriop_set_mdio(i, dev);
+ break;
+ default:
+ break;
+ }
+ }
+
+ dev = miiphy_get_dev_by_name(DEFAULT_WRIOP_MDIO2_NAME);
+ wriop_set_mdio(WRIOP1_DPMAC2, dev);
+
+ mc_boot_env_var = env_get(MC_BOOT_ENV_VAR);
+ if (mc_boot_env_var)
+ run_command_list(mc_boot_env_var, -1, 0);
+ cpu_eth_init(bis);
+#endif /* CONFIG_FMAN_ENET */
+
+ return pci_eth_init(bis);
+}
--- /dev/null
+/*
+ * Copyright 2017 NXP
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+#include <common.h>
+#include <i2c.h>
+#include <malloc.h>
+#include <errno.h>
+#include <netdev.h>
+#include <fsl_ifc.h>
+#include <fsl_ddr.h>
+#include <fsl_sec.h>
+#include <asm/io.h>
+#include <fdt_support.h>
+#include <libfdt.h>
+#include <fsl-mc/fsl_mc.h>
+#include <environment.h>
+#include <asm/arch-fsl-layerscape/soc.h>
+#include <asm/arch/ppa.h>
+
+#include "../common/qixis.h"
+#include "ls1088a_qixis.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+unsigned long long get_qixis_addr(void)
+{
+ unsigned long long addr;
+
+ if (gd->flags & GD_FLG_RELOC)
+ addr = QIXIS_BASE_PHYS;
+ else
+ addr = QIXIS_BASE_PHYS_EARLY;
+
+ /*
+ * IFC address under 256MB is mapped to 0x30000000, any address above
+ * is mapped to 0x5_10000000 up to 4GB.
+ */
+ addr = addr > 0x10000000 ? addr + 0x500000000ULL : addr + 0x30000000;
+
+ return addr;
+}
+
+int checkboard(void)
+{
+ char buf[64];
+ u8 sw;
+ static const char *const freq[] = {"100", "125", "156.25",
+ "100 separate SSCG"};
+ int clock;
+
+#ifdef CONFIG_TARGET_LS1088AQDS
+ printf("Board: LS1088A-QDS, ");
+#else
+ printf("Board: LS1088A-RDB, ");
+#endif
+
+ sw = QIXIS_READ(arch);
+ printf("Board Arch: V%d, ", sw >> 4);
+
+#ifdef CONFIG_TARGET_LS1088AQDS
+ printf("Board version: %c, boot from ", (sw & 0xf) + 'A' - 1);
+#else
+ printf("Board version: %c, boot from ", (sw & 0xf) + 'A');
+#endif
+
+ memset((u8 *)buf, 0x00, ARRAY_SIZE(buf));
+
+ sw = QIXIS_READ(brdcfg[0]);
+ sw = (sw & QIXIS_LBMAP_MASK) >> QIXIS_LBMAP_SHIFT;
+
+#ifdef CONFIG_SD_BOOT
+ puts("SD card\n");
+#endif
+ switch (sw) {
+#ifdef CONFIG_TARGET_LS1088AQDS
+ case 0:
+ case 1:
+ case 2:
+ case 3:
+ case 4:
+ case 5:
+ case 6:
+ case 7:
+ printf("vBank: %d\n", sw);
+ break;
+ case 8:
+ puts("PromJet\n");
+ break;
+ case 15:
+ puts("IFCCard\n");
+ break;
+ case 14:
+#else
+ case 0:
+#endif
+ puts("QSPI:");
+ sw = QIXIS_READ(brdcfg[0]);
+ sw = (sw & QIXIS_QMAP_MASK) >> QIXIS_QMAP_SHIFT;
+ if (sw == 0 || sw == 4)
+ puts("0\n");
+ else if (sw == 1)
+ puts("1\n");
+ else
+ puts("EMU\n");
+ break;
+
+ default:
+ printf("invalid setting of SW%u\n", QIXIS_LBMAP_SWITCH);
+ break;
+ }
+
+#ifdef CONFIG_TARGET_LS1088AQDS
+ printf("FPGA: v%d (%s), build %d",
+ (int)QIXIS_READ(scver), qixis_read_tag(buf),
+ (int)qixis_read_minor());
+ /* the timestamp string contains "\n" at the end */
+ printf(" on %s", qixis_read_time(buf));
+#else
+ printf("CPLD: v%d.%d\n", QIXIS_READ(scver), QIXIS_READ(tagdata));
+#endif
+
+ /*
+ * Display the actual SERDES reference clocks as configured by the
+ * dip switches on the board. Note that the SWx registers could
+ * technically be set to force the reference clocks to match the
+ * values that the SERDES expects (or vice versa). For now, however,
+ * we just display both values and hope the user notices when they
+ * don't match.
+ */
+ puts("SERDES1 Reference : ");
+ sw = QIXIS_READ(brdcfg[2]);
+ clock = (sw >> 6) & 3;
+ printf("Clock1 = %sMHz ", freq[clock]);
+ clock = (sw >> 4) & 3;
+ printf("Clock2 = %sMHz", freq[clock]);
+
+ puts("\nSERDES2 Reference : ");
+ clock = (sw >> 2) & 3;
+ printf("Clock1 = %sMHz ", freq[clock]);
+ clock = (sw >> 0) & 3;
+ printf("Clock2 = %sMHz\n", freq[clock]);
+
+ return 0;
+}
+
+bool if_board_diff_clk(void)
+{
+#ifdef CONFIG_TARGET_LS1088AQDS
+ u8 diff_conf = QIXIS_READ(brdcfg[11]);
+ return diff_conf & 0x40;
+#else
+ u8 diff_conf = QIXIS_READ(dutcfg[11]);
+ return diff_conf & 0x80;
+#endif
+}
+
+unsigned long get_board_sys_clk(void)
+{
+ u8 sysclk_conf = QIXIS_READ(brdcfg[1]);
+
+ switch (sysclk_conf & 0x0f) {
+ case QIXIS_SYSCLK_83:
+ return 83333333;
+ case QIXIS_SYSCLK_100:
+ return 100000000;
+ case QIXIS_SYSCLK_125:
+ return 125000000;
+ case QIXIS_SYSCLK_133:
+ return 133333333;
+ case QIXIS_SYSCLK_150:
+ return 150000000;
+ case QIXIS_SYSCLK_160:
+ return 160000000;
+ case QIXIS_SYSCLK_166:
+ return 166666666;
+ }
+
+ return 66666666;
+}
+
+unsigned long get_board_ddr_clk(void)
+{
+ u8 ddrclk_conf = QIXIS_READ(brdcfg[1]);
+
+ if (if_board_diff_clk())
+ return get_board_sys_clk();
+ switch ((ddrclk_conf & 0x30) >> 4) {
+ case QIXIS_DDRCLK_100:
+ return 100000000;
+ case QIXIS_DDRCLK_125:
+ return 125000000;
+ case QIXIS_DDRCLK_133:
+ return 133333333;
+ }
+
+ return 66666666;
+}
+
+int select_i2c_ch_pca9547(u8 ch)
+{
+ int ret;
+
+ ret = i2c_write(I2C_MUX_PCA_ADDR_PRI, 0, 1, &ch, 1);
+ if (ret) {
+ puts("PCA: failed to select proper channel\n");
+ return ret;
+ }
+
+ return 0;
+}
+
+void board_retimer_init(void)
+{
+ u8 reg;
+
+ /* Retimer is connected to I2C1_CH5 */
+ select_i2c_ch_pca9547(I2C_MUX_CH5);
+
+ /* Access to Control/Shared register */
+ reg = 0x0;
+ i2c_write(I2C_RETIMER_ADDR, 0xff, 1, ®, 1);
+
+ /* Read device revision and ID */
+ i2c_read(I2C_RETIMER_ADDR, 1, 1, ®, 1);
+ debug("Retimer version id = 0x%x\n", reg);
+
+ /* Enable Broadcast. All writes target all channel register sets */
+ reg = 0x0c;
+ i2c_write(I2C_RETIMER_ADDR, 0xff, 1, ®, 1);
+
+ /* Reset Channel Registers */
+ i2c_read(I2C_RETIMER_ADDR, 0, 1, ®, 1);
+ reg |= 0x4;
+ i2c_write(I2C_RETIMER_ADDR, 0, 1, ®, 1);
+
+ /* Set data rate as 10.3125 Gbps */
+ reg = 0x90;
+ i2c_write(I2C_RETIMER_ADDR, 0x60, 1, ®, 1);
+ reg = 0xb3;
+ i2c_write(I2C_RETIMER_ADDR, 0x61, 1, ®, 1);
+ reg = 0x90;
+ i2c_write(I2C_RETIMER_ADDR, 0x62, 1, ®, 1);
+ reg = 0xb3;
+ i2c_write(I2C_RETIMER_ADDR, 0x63, 1, ®, 1);
+ reg = 0xcd;
+ i2c_write(I2C_RETIMER_ADDR, 0x64, 1, ®, 1);
+
+ /* Select VCO Divider to full rate (000) */
+ i2c_read(I2C_RETIMER_ADDR, 0x2F, 1, ®, 1);
+ reg &= 0x0f;
+ reg |= 0x70;
+ i2c_write(I2C_RETIMER_ADDR, 0x2F, 1, ®, 1);
+
+#ifdef CONFIG_TARGET_LS1088AQDS
+ /* Retimer is connected to I2C1_CH5 */
+ select_i2c_ch_pca9547(I2C_MUX_CH5);
+
+ /* Access to Control/Shared register */
+ reg = 0x0;
+ i2c_write(I2C_RETIMER_ADDR2, 0xff, 1, ®, 1);
+
+ /* Read device revision and ID */
+ i2c_read(I2C_RETIMER_ADDR2, 1, 1, ®, 1);
+ debug("Retimer version id = 0x%x\n", reg);
+
+ /* Enable Broadcast. All writes target all channel register sets */
+ reg = 0x0c;
+ i2c_write(I2C_RETIMER_ADDR2, 0xff, 1, ®, 1);
+
+ /* Reset Channel Registers */
+ i2c_read(I2C_RETIMER_ADDR2, 0, 1, ®, 1);
+ reg |= 0x4;
+ i2c_write(I2C_RETIMER_ADDR2, 0, 1, ®, 1);
+
+ /* Set data rate as 10.3125 Gbps */
+ reg = 0x90;
+ i2c_write(I2C_RETIMER_ADDR2, 0x60, 1, ®, 1);
+ reg = 0xb3;
+ i2c_write(I2C_RETIMER_ADDR2, 0x61, 1, ®, 1);
+ reg = 0x90;
+ i2c_write(I2C_RETIMER_ADDR2, 0x62, 1, ®, 1);
+ reg = 0xb3;
+ i2c_write(I2C_RETIMER_ADDR2, 0x63, 1, ®, 1);
+ reg = 0xcd;
+ i2c_write(I2C_RETIMER_ADDR2, 0x64, 1, ®, 1);
+
+ /* Select VCO Divider to full rate (000) */
+ i2c_read(I2C_RETIMER_ADDR2, 0x2F, 1, ®, 1);
+ reg &= 0x0f;
+ reg |= 0x70;
+ i2c_write(I2C_RETIMER_ADDR2, 0x2F, 1, ®, 1);
+#endif
+ /*return the default channel*/
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT);
+}
+
+int board_init(void)
+{
+ init_final_memctl_regs();
+#if defined(CONFIG_TARGET_LS1088ARDB) && defined(CONFIG_FSL_MC_ENET)
+ u32 __iomem *irq_ccsr = (u32 __iomem *)ISC_BASE;
+#endif
+
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT);
+ board_retimer_init();
+
+#ifdef CONFIG_ENV_IS_NOWHERE
+ gd->env_addr = (ulong)&default_environment[0];
+#endif
+
+#if defined(CONFIG_TARGET_LS1088ARDB) && defined(CONFIG_FSL_MC_ENET)
+ /* invert AQR105 IRQ pins polarity */
+ out_le32(irq_ccsr + IRQCR_OFFSET / 4, AQR105_IRQ_MASK);
+#endif
+
+#ifdef CONFIG_FSL_LS_PPA
+ ppa_init();
+#endif
+ return 0;
+}
+
+int board_early_init_f(void)
+{
+ fsl_lsch3_early_init_f();
+ return 0;
+}
+
+void detail_board_ddr_info(void)
+{
+ puts("\nDDR ");
+ print_size(gd->bd->bi_dram[0].size + gd->bd->bi_dram[1].size, "");
+ print_ddr_info(0);
+}
+
+#if defined(CONFIG_ARCH_MISC_INIT)
+int arch_misc_init(void)
+{
+#ifdef CONFIG_FSL_CAAM
+ sec_init();
+#endif
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_FSL_MC_ENET
+void fdt_fixup_board_enet(void *fdt)
+{
+ int offset;
+
+ offset = fdt_path_offset(fdt, "/fsl-mc");
+
+ if (offset < 0)
+ offset = fdt_path_offset(fdt, "/fsl,dprc@0");
+
+ if (offset < 0) {
+ printf("%s: ERROR: fsl-mc node not found in device tree (error %d)\n",
+ __func__, offset);
+ return;
+ }
+
+ if (get_mc_boot_status() == 0)
+ fdt_status_okay(fdt, offset);
+ else
+ fdt_status_fail(fdt, offset);
+}
+#endif
+
+#ifdef CONFIG_OF_BOARD_SETUP
+int ft_board_setup(void *blob, bd_t *bd)
+{
+ int err, i;
+ u64 base[CONFIG_NR_DRAM_BANKS];
+ u64 size[CONFIG_NR_DRAM_BANKS];
+
+ ft_cpu_setup(blob, bd);
+
+ /* fixup DT for the two GPP DDR banks */
+ for (i = 0; i < CONFIG_NR_DRAM_BANKS; i++) {
+ base[i] = gd->bd->bi_dram[i].start;
+ size[i] = gd->bd->bi_dram[i].size;
+ }
+
+#ifdef CONFIG_RESV_RAM
+ /* reduce size if reserved memory is within this bank */
+ if (gd->arch.resv_ram >= base[0] &&
+ gd->arch.resv_ram < base[0] + size[0])
+ size[0] = gd->arch.resv_ram - base[0];
+ else if (gd->arch.resv_ram >= base[1] &&
+ gd->arch.resv_ram < base[1] + size[1])
+ size[1] = gd->arch.resv_ram - base[1];
+#endif
+
+ fdt_fixup_memory_banks(blob, base, size, CONFIG_NR_DRAM_BANKS);
+
+#ifdef CONFIG_FSL_MC_ENET
+ fdt_fixup_board_enet(blob);
+ err = fsl_mc_ldpaa_exit(bd);
+ if (err)
+ return err;
+#endif
+
+ return 0;
+}
+#endif
--- /dev/null
+/*
+ * Copyright 2017 NXP
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#ifndef __LS1088AQDS_QIXIS_H__
+#define __LS1088AQDS_QIXIS_H__
+
+/* Definitions of QIXIS Registers for LS1088AQDS */
+
+/* SYSCLK */
+#define QIXIS_SYSCLK_66 0x0
+#define QIXIS_SYSCLK_83 0x1
+#define QIXIS_SYSCLK_100 0x2
+#define QIXIS_SYSCLK_125 0x3
+#define QIXIS_SYSCLK_133 0x4
+#define QIXIS_SYSCLK_150 0x5
+#define QIXIS_SYSCLK_160 0x6
+#define QIXIS_SYSCLK_166 0x7
+
+/* DDRCLK */
+#define QIXIS_DDRCLK_66 0x0
+#define QIXIS_DDRCLK_100 0x1
+#define QIXIS_DDRCLK_125 0x2
+#define QIXIS_DDRCLK_133 0x3
+
+/* BRDCFG2 - SD clock*/
+#define QIXIS_SDCLK1_100 0x0
+#define QIXIS_SDCLK1_125 0x1
+#define QIXIS_SDCLK1_165 0x2
+#define QIXIS_SDCLK1_100_SP 0x3
+
+#define BRDCFG4_EMISEL_MASK 0xE0
+#define BRDCFG4_EMISEL_SHIFT 5
+#define BRDCFG9_SFPTX_MASK 0x10
+#define BRDCFG9_SFPTX_SHIFT 4
+
+#endif
#endif
select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT);
rtc_enable_32khz_output();
+#ifdef CONFIG_FSL_CAAM
+ sec_init();
+#endif
#ifdef CONFIG_FSL_LS_PPA
ppa_init();
#endif
-#ifdef CONFIG_FSL_CAAM
- sec_init();
-#endif
-
return 0;
}
M: Saksham Jain <saksham.jain@nxp.freescale.com>
S: Maintained
F: configs/ls2080ardb_SECURE_BOOT_defconfig
+
+LS2088A_QSPI_SECURE_BOOT BOARD
+M: Udit Agarwal <udit.agarwal@nxp.com>
+S: Maintained
+F: configs/ls2088ardb_qspi_SECURE_BOOT_defconfig
#ifdef CONFIG_FSL_QIXIS
QIXIS_WRITE(rst_ctl, QIXIS_RST_CTL_RESET_EN);
#endif
+
+#ifdef CONFIG_FSL_CAAM
+ sec_init();
+#endif
#ifdef CONFIG_FSL_LS_PPA
ppa_init();
#endif
(IOMUXC_GPR_GPR1_GPR_ENET1_TX_CLK_SEL_MASK |
IOMUXC_GPR_GPR1_GPR_ENET1_CLK_DIR_MASK), 0);
- return set_clk_enet(ENET_125MHz);
+ return set_clk_enet(ENET_125MHZ);
}
spl_dram_init(8 << ventana_info.sdram_width,
16 << ventana_info.sdram_size,
board_model);
-
- /* Clear the BSS. */
- memset(__bss_start, 0, __bss_end - __bss_start);
}
void board_boot_order(u32 *spl_boot_list)
# SPDX-License-Identifier: GPL-2.0+
#
-obj-y := bx50v3.o
+obj-y := bx50v3.o vpd_reader.o
#include <asm/arch/sys_proto.h>
#include <i2c.h>
#include <pwm.h>
+#include <stdlib.h>
+#include "vpd_reader.h"
DECLARE_GLOBAL_DATA_PTR;
+#ifndef CONFIG_SYS_I2C_EEPROM_ADDR
+# define CONFIG_SYS_I2C_EEPROM_ADDR 0x50
+# define CONFIG_SYS_I2C_EEPROM_ADDR_LEN 1
+#endif
+
+#ifndef CONFIG_SYS_I2C_EEPROM_BUS
+#define CONFIG_SYS_I2C_EEPROM_BUS 2
+#endif
+
#define NC_PAD_CTRL (PAD_CTL_PUS_100K_UP | \
PAD_CTL_SPEED_MED | PAD_CTL_DSE_40ohm | \
PAD_CTL_HYS)
return 1;
}
+#define VPD_TYPE_INVALID 0x00
+#define VPD_BLOCK_NETWORK 0x20
+#define VPD_BLOCK_HWID 0x44
+#define VPD_PRODUCT_B850 1
+#define VPD_PRODUCT_B650 2
+#define VPD_PRODUCT_B450 3
+
+struct vpd_cache {
+ uint8_t product_id;
+ uint8_t macbits;
+ unsigned char mac1[6];
+};
+
+/*
+ * Extracts MAC and product information from the VPD.
+ */
+static int vpd_callback(
+ void *userdata,
+ uint8_t id,
+ uint8_t version,
+ uint8_t type,
+ size_t size,
+ uint8_t const *data)
+{
+ struct vpd_cache *vpd = (struct vpd_cache *)userdata;
+
+ if ( id == VPD_BLOCK_HWID
+ && version == 1
+ && type != VPD_TYPE_INVALID
+ && size >= 1) {
+ vpd->product_id = data[0];
+
+ } else if ( id == VPD_BLOCK_NETWORK
+ && version == 1
+ && type != VPD_TYPE_INVALID
+ && size >= 6) {
+ vpd->macbits |= 1;
+ memcpy(vpd->mac1, data, 6);
+ }
+
+ return 0;
+}
+
+static void set_eth0_mac_address(unsigned char * mac)
+{
+ uint32_t *ENET_TCR = (uint32_t*)0x21880c4;
+ uint32_t *ENET_PALR = (uint32_t*)0x21880e4;
+ uint32_t *ENET_PAUR = (uint32_t*)0x21880e8;
+
+ *ENET_TCR |= 0x100; /* ADDINS */
+ *ENET_PALR |= (mac[0] << 24) | (mac[1] << 16) | (mac[2] << 8) | mac[3];
+ *ENET_PAUR |= (mac[4] << 24) | (mac[5] << 16);
+}
+
+static void process_vpd(struct vpd_cache *vpd)
+{
+ if ( vpd->product_id == VPD_PRODUCT_B850
+ || vpd->product_id == VPD_PRODUCT_B650
+ || vpd->product_id == VPD_PRODUCT_B450) {
+ if (vpd->macbits & 1) {
+ set_eth0_mac_address(vpd->mac1);
+ }
+ }
+}
+
+static int read_vpd(uint eeprom_bus)
+{
+ struct vpd_cache vpd;
+ int res;
+ int size = 1024;
+ uint8_t *data;
+ unsigned int current_i2c_bus = i2c_get_bus_num();
+
+ res = i2c_set_bus_num(eeprom_bus);
+ if (res < 0)
+ return res;
+
+ data = (uint8_t *)malloc(size);
+ if (!data)
+ return -ENOMEM;
+
+ res = i2c_read(CONFIG_SYS_I2C_EEPROM_ADDR, 0,
+ CONFIG_SYS_I2C_EEPROM_ADDR_LEN, data, size);
+
+ if (res == 0) {
+ memset(&vpd, 0, sizeof(vpd));
+ vpd_reader(size, data, &vpd, vpd_callback);
+ process_vpd(&vpd);
+ }
+
+ free(data);
+
+ i2c_set_bus_num(current_i2c_bus);
+ return res;
+}
+
int board_eth_init(bd_t *bis)
{
setup_iomux_enet();
setup_i2c(2, CONFIG_SYS_I2C_SPEED, 0x7f, &i2c_pad_info2);
setup_i2c(3, CONFIG_SYS_I2C_SPEED, 0x7f, &i2c_pad_info3);
+ read_vpd(CONFIG_SYS_I2C_EEPROM_BUS);
+
return 0;
}
--- /dev/null
+/*
+ * Copyright 2016 General Electric Company
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include "vpd_reader.h"
+
+#include <linux/bch.h>
+#include <stdlib.h>
+
+
+/* BCH configuration */
+
+const struct {
+ int header_ecc_capability_bits;
+ int data_ecc_capability_bits;
+ unsigned int prim_poly;
+ struct {
+ int min;
+ int max;
+ } galois_field_order;
+} bch_configuration = {
+ .header_ecc_capability_bits = 4,
+ .data_ecc_capability_bits = 16,
+ .prim_poly = 0,
+ .galois_field_order = {
+ .min = 5,
+ .max = 15,
+ },
+};
+
+static int calculate_galois_field_order(size_t source_length)
+{
+ int gfo = bch_configuration.galois_field_order.min;
+
+ for (; gfo < bch_configuration.galois_field_order.max &&
+ ((((1 << gfo) - 1) - ((int)source_length * 8)) < 0);
+ gfo++) {
+ }
+
+ if (gfo == bch_configuration.galois_field_order.max) {
+ return -1;
+ }
+
+ return gfo + 1;
+}
+
+static int verify_bch(int ecc_bits, unsigned int prim_poly,
+ uint8_t * data, size_t data_length,
+ const uint8_t * ecc, size_t ecc_length)
+{
+ int gfo = calculate_galois_field_order(data_length);
+ if (gfo < 0) {
+ return -1;
+ }
+
+ struct bch_control * bch = init_bch(gfo, ecc_bits, prim_poly);
+ if (!bch) {
+ return -1;
+ }
+
+ if (bch->ecc_bytes != ecc_length) {
+ free_bch(bch);
+ return -1;
+ }
+
+ unsigned * errloc = (unsigned *)calloc(data_length, sizeof(unsigned));
+ int errors = decode_bch(
+ bch, data, data_length, ecc, NULL, NULL, errloc);
+ free_bch(bch);
+ if (errors < 0) {
+ free(errloc);
+ return -1;
+ }
+
+ if (errors > 0) {
+ for (int n = 0; n < errors; n++) {
+ if (errloc[n] >= 8 * data_length) {
+ /* n-th error located in ecc (no need for data correction) */
+ } else {
+ /* n-th error located in data */
+ data[errloc[n] / 8] ^= 1 << (errloc[n] % 8);
+ }
+ }
+ }
+
+ free(errloc);
+ return 0;
+}
+
+
+static const int ID = 0;
+static const int LEN = 1;
+static const int VER = 2;
+static const int TYP = 3;
+static const int BLOCK_SIZE = 4;
+
+static const uint8_t HEADER_BLOCK_ID = 0x00;
+static const uint8_t HEADER_BLOCK_LEN = 18;
+static const uint32_t HEADER_BLOCK_MAGIC = 0xca53ca53;
+static const size_t HEADER_BLOCK_VERIFY_LEN = 14;
+static const size_t HEADER_BLOCK_ECC_OFF = 14;
+static const size_t HEADER_BLOCK_ECC_LEN = 4;
+
+static const uint8_t ECC_BLOCK_ID = 0xFF;
+
+int vpd_reader(
+ size_t size,
+ uint8_t * data,
+ void * userdata,
+ int (*fn)(
+ void * userdata,
+ uint8_t id,
+ uint8_t version,
+ uint8_t type,
+ size_t size,
+ uint8_t const * data))
+{
+ if ( size < HEADER_BLOCK_LEN
+ || data == NULL
+ || fn == NULL) {
+ return -EINVAL;
+ }
+
+ /*
+ * +--------------------+--------------------+--//--+--------------------+
+ * | header block | data block | ... | ecc block |
+ * +--------------------+--------------------+--//--+--------------------+
+ * : : :
+ * +------+-------+-----+ +------+-------------+
+ * | id | magic | ecc | | ... | ecc |
+ * | len | off | | +------+-------------+
+ * | ver | size | | :
+ * | type | | | :
+ * +------+-------+-----+ :
+ * : : : :
+ * <----- [1] ----> <----------- [2] ----------->
+ *
+ * Repair (if necessary) the contents of header block [1] by using a
+ * 4 byte ECC located at the end of the header block. A successful
+ * return value means that we can trust the header.
+ */
+ int ret = verify_bch(
+ bch_configuration.header_ecc_capability_bits,
+ bch_configuration.prim_poly,
+ data,
+ HEADER_BLOCK_VERIFY_LEN,
+ &data[HEADER_BLOCK_ECC_OFF],
+ HEADER_BLOCK_ECC_LEN);
+ if (ret < 0) {
+ return ret;
+ }
+
+ /* Validate header block { id, length, version, type }. */
+ if ( data[ID] != HEADER_BLOCK_ID
+ || data[LEN] != HEADER_BLOCK_LEN
+ || data[VER] != 0
+ || data[TYP] != 0
+ || ntohl(*(uint32_t *)(&data[4])) != HEADER_BLOCK_MAGIC) {
+ return -EINVAL;
+ }
+
+ uint32_t offset = ntohl(*(uint32_t *)(&data[8]));
+ uint16_t size_bits = ntohs(*(uint16_t *)(&data[12]));
+
+ /* Check that ECC header fits. */
+ if (offset + 3 >= size) {
+ return -EINVAL;
+ }
+
+ /* Validate ECC block. */
+ uint8_t * ecc = &data[offset];
+ if ( ecc[ID] != ECC_BLOCK_ID
+ || ecc[LEN] < BLOCK_SIZE
+ || ecc[LEN] + offset > size
+ || ecc[LEN] - BLOCK_SIZE != size_bits / 8
+ || ecc[VER] != 1
+ || ecc[TYP] != 1) {
+ return -EINVAL;
+ }
+
+ /*
+ * Use the header block to locate the ECC block and verify the data
+ * blocks [2] against the ecc block ECC.
+ */
+ ret = verify_bch(
+ bch_configuration.data_ecc_capability_bits,
+ bch_configuration.prim_poly,
+ &data[data[LEN]],
+ offset - data[LEN],
+ &data[offset + BLOCK_SIZE],
+ ecc[LEN] - BLOCK_SIZE);
+ if (ret < 0) {
+ return ret;
+ }
+
+ /* Stop after ECC. Ignore possible zero padding. */
+ size = offset;
+
+ for (;;) {
+ /* Move to next block. */
+ size -= data[LEN];
+ data += data[LEN];
+
+ if (size == 0) {
+ /* Finished iterating through blocks. */
+ return 0;
+ }
+
+ if ( size < BLOCK_SIZE
+ || data[LEN] < BLOCK_SIZE) {
+ /* Not enough data for a header, or short header. */
+ return -EINVAL;
+ }
+
+ ret = fn(
+ userdata,
+ data[ID],
+ data[VER],
+ data[TYP],
+ data[LEN] - BLOCK_SIZE,
+ &data[BLOCK_SIZE]);
+ if (ret) {
+ return ret;
+ }
+ }
+}
--- /dev/null
+/*
+ * Copyright 2016 General Electric Company
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include "common.h"
+
+/*
+ * Read VPD from given data, verify content, and call callback
+ * for each vital product data block.
+ *
+ * Returns Non-zero on error. Negative numbers encode errno.
+ */
+int vpd_reader(
+ size_t size,
+ uint8_t * data,
+ void * userdata,
+ int (*fn)(
+ void * userdata,
+ uint8_t id,
+ uint8_t version,
+ uint8_t type,
+ size_t size,
+ uint8_t const * data));
4GB memory, HDMI/DP/VGA display, HD audio, SATA, USB2, USB3, SD, eMMC,
PCIe and some other sensor interfaces.
+config TARGET_CHERRYHILL
+ bool "Cherry Hill"
+ help
+ This is the Intel Cherry Hill Customer Reference Board. It is in a
+ mini-ITX form factor containing the Intel Braswell SoC, which has
+ a 64-bit quad-core, single-thread, Intel Atom processor, along with
+ serial console, 10/100/1000 Ethernet, SD-Card, USB 2/3, SATA, PCIe,
+ some GPIOs, one HDMI and two DP video out.
+
config TARGET_COUGARCANYON2
bool "Cougar Canyon 2"
help
endchoice
source "board/intel/bayleybay/Kconfig"
+source "board/intel/cherryhill/Kconfig"
source "board/intel/cougarcanyon2/Kconfig"
source "board/intel/crownbay/Kconfig"
source "board/intel/edison/Kconfig"
--- /dev/null
+if TARGET_CHERRYHILL
+
+config SYS_BOARD
+ default "cherryhill"
+
+config SYS_VENDOR
+ default "intel"
+
+config SYS_SOC
+ default "braswell"
+
+config SYS_CONFIG_NAME
+ default "cherryhill"
+
+config SYS_TEXT_BASE
+ default 0xffe00000
+
+config BOARD_SPECIFIC_OPTIONS # dummy
+ def_bool y
+ select X86_RESET_VECTOR
+ select INTEL_BRASWELL
+ select BOARD_ROMSIZE_KB_8192
+ select SPI_FLASH_MACRONIX
+
+endif
--- /dev/null
+INTEL CHERRYHILL BOARD
+M: Bin Meng <bmeng.cn@gmail.com>
+S: Maintained
+F: board/intel/cherryhill/
+F: include/configs/cherryhill.h
+F: configs/cherryhill_defconfig
--- /dev/null
+#
+# Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += cherryhill.o start.o
--- /dev/null
+/*
+ * Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
+#include <asm/arch/gpio.h>
+#include <asm/fsp/fsp_support.h>
+
+static const struct gpio_family gpio_family[] = {
+ GPIO_FAMILY_CONF("SOUTHEAST_2_hshvfamily_2x3_rcomp_7_0", NA, 0,
+ VOLT_1_8, NA, NA, NA, 0, ENABLE, 2, SOUTHEAST),
+
+ /* end of the table */
+ GPIO_FAMILY_CONF("GPIO FAMILY TABLE END", NA, 0,
+ VOLT_1_8, NA, NA, NA, 0, DISABLE, 0, TERMINATOR),
+};
+
+static const struct gpio_pad gpio_pad[] = {
+ GPIO_PAD_CONF("N37: CX_PRDY_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 29, NA, 0x4c38, NORTH),
+ GPIO_PAD_CONF("N35: CX_PRDY_B_2", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 27, NA, 0x4c28, NORTH),
+ GPIO_PAD_CONF("N39: CX_PREQ_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 20, NA, 0x4858, NORTH),
+ GPIO_PAD_CONF("N48: GP_CAMERASB00", GPIO, M1, GPO, LOW,
+ NA, NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 37, NA, 0x5018, NORTH),
+ GPIO_PAD_CONF("N53: GP_CAMERASB01", GPIO, M1, GPO, LOW,
+ NA, NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 42, NA, 0x5040, NORTH),
+ GPIO_PAD_CONF("N46: GP_CAMERASB02", GPIO, M1, GPO, LOW,
+ NA, NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 35, NA, 0x5008, NORTH),
+ GPIO_PAD_CONF("N51: GP_CAMERASB03", GPIO, M1, GPO, LOW,
+ NA, NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 40, NA, 0x5030, NORTH),
+ GPIO_PAD_CONF("N56: GP_CAMERASB04", GPIO, M1, GPO, LOW,
+ NA, NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 45, NA, 0x5058, NORTH),
+ GPIO_PAD_CONF("N45: GP_CAMERASB05", GPIO, M1, GPO, LOW,
+ NA, NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 34, NA, 0x5000, NORTH),
+ GPIO_PAD_CONF("N49: GP_CAMERASB06", GPIO, M1, GPO, LOW,
+ NA, NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 38, NA, 0x5020, NORTH),
+ GPIO_PAD_CONF("N54: GP_CAMERASB07", GPIO, M1, GPO, LOW,
+ NA, NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 43, NA, 0x5048, NORTH),
+ GPIO_PAD_CONF("N47: GP_CAMERASB08", GPIO, M1, GPO, LOW,
+ NA, NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 36, NA, 0x5010, NORTH),
+ GPIO_PAD_CONF("N52: GP_CAMERASB09", GPIO, M1, GPO, LOW,
+ NA, NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 41, NA, 0x5038, NORTH),
+ GPIO_PAD_CONF("N50: GP_CAMERASB10", GPIO, M1, GPO, LOW,
+ NA, NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 39, NA, 0x5028, NORTH),
+ GPIO_PAD_CONF("N55: GP_CAMERASB11", GPIO, M1, GPO, LOW,
+ NA, NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 44, NA, 0x5050, NORTH),
+ GPIO_PAD_CONF("N00: GPIO_DFX0", NATIVE, M5, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 0, NA, 0x4400, NORTH),
+ GPIO_PAD_CONF("N03: GPIO_DFX1", NATIVE, M5, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 3, NA, 0x4418, NORTH),
+ GPIO_PAD_CONF("N07: GPIO_DFX2", NATIVE, M5, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 2, NA, 0x4438, NORTH),
+ GPIO_PAD_CONF("N01: GPIO_DFX3", NATIVE, M5, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, INV_TX_ENABLE,
+ NA, 1, NA, 0x4408, NORTH),
+ GPIO_PAD_CONF("N05: GPIO_DFX4", GPIO, M1, GPO, HIGH, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 5, NA, 0x4428, NORTH),
+ GPIO_PAD_CONF("N04: GPIO_DFX5", GPIO, M1, GPO, HIGH, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 4, NA, 0x4420, NORTH),
+ GPIO_PAD_CONF("N08: GPIO_DFX6", NATIVE, M8, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 8, NA, 0x4440, NORTH),
+ GPIO_PAD_CONF("N02: GPIO_DFX7", GPIO, M1, GPO, LOW, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 2, NA, 0x4410, NORTH),
+ GPIO_PAD_CONF("N15: GPIO_SUS0", GPIO, M1, GPI, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 9 , NA, 0x4800, NORTH),
+ GPIO_PAD_CONF("N19: GPIO_SUS1", GPIO, M1, GPI, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 13, NA, 0x4820, NORTH),
+ GPIO_PAD_CONF("N24: GPIO_SUS2", GPIO, M1, GPI, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 18, NA, 0x4848, NORTH),
+ GPIO_PAD_CONF("N17: GPIO_SUS3", NATIVE, M6, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 11, NA, 0x4810, NORTH),
+ GPIO_PAD_CONF("N22: GPIO_SUS4", GPIO, M1, GPO, HIGH, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 16, NA, 0x4838, NORTH),
+ GPIO_PAD_CONF("N20: GPIO_SUS5", GPIO, M1, GPO, HIGH, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 14, NA, 0x4828, NORTH),
+ GPIO_PAD_CONF("N25: GPIO_SUS6", GPIO, M1, GPI, NA, NA,
+ TRIG_EDGE_LOW, L9, NA, NA, NA, NON_MASKABLE,
+ EN_EDGE_RX_DATA, NO_INVERSION,
+ NA, 19, SCI, 0x4850, NORTH),
+ GPIO_PAD_CONF("N18: GPIO_SUS7", GPIO, M1, GPI, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 12, SMI, 0x4818, NORTH),
+ GPIO_PAD_CONF("N71: HV_DDI0_DDC_SCL", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 57, NA, 0x5458, NORTH),
+ GPIO_PAD_CONF("N66: HV_DDI0_DDC_SDA", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 52, NA, 0x5430, NORTH),
+ GPIO_PAD_CONF("N61: HV_DDI0_HPD", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, INV_TX_ENABLE,
+ NA, 47, NA, 0x5408, NORTH),
+ GPIO_PAD_CONF("N64: HV_DDI1_HPD", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, INV_TX_ENABLE,
+ NA, 50, NA, 0x5420, NORTH),
+ GPIO_PAD_CONF("N67: HV_DDI2_DDC_SCL", NATIVE, M3, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 53, NA, 0x5438, NORTH),
+ GPIO_PAD_CONF("N62: HV_DDI2_DDC_SDA", NATIVE, M3, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 48, NA, 0x5410, NORTH),
+ GPIO_PAD_CONF("N68: HV_DDI2_HPD", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, INV_TX_ENABLE,
+ NA, 54, NA, 0x5440, NORTH),
+ GPIO_PAD_CONF("N65: PANEL0_BKLTCTL", GPIO, M1, GPI, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 51, NA, 0x5428, NORTH),
+ GPIO_PAD_CONF("N60: PANEL0_BKLTEN", GPIO, M1, GPI, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 46, NA, 0x5400, NORTH),
+ GPIO_PAD_CONF("N72: PANEL0_VDDEN", GPIO, M1, GPI, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 58, NA, 0x5460, NORTH),
+ GPIO_PAD_CONF("N63: PANEL1_BKLTCTL", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 49, NA, 0x5418, NORTH),
+ GPIO_PAD_CONF("N70: PANEL1_BKLTEN", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 56, NA, 0x5450, NORTH),
+ GPIO_PAD_CONF("N69: PANEL1_VDDEN", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 55, NA, 0x5448, NORTH),
+ GPIO_PAD_CONF("N32: PROCHOT_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 24, NA, 0x4c10, NORTH),
+ GPIO_PAD_CONF("N16: SEC_GPIO_SUS10", GPIO, M1, GPI, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 10, NA, 0x4808, NORTH),
+ GPIO_PAD_CONF("N21: SEC_GPIO_SUS11", GPIO, M1, GPI, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 15, NA, 0x4830, NORTH),
+ GPIO_PAD_CONF("N23: SEC_GPIO_SUS8", GPIO, M1, GPI, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 17, NA, 0x4840, NORTH),
+ GPIO_PAD_CONF("N27: SEC_GPIO_SUS9", GPIO, M1, GPI, LOW, NA,
+ TRIG_LEVEL, L15, NA, NA, NA, NON_MASKABLE,
+ EN_RX_DATA, INV_RX_DATA,
+ NA, 21, SCI, 0x4860, NORTH),
+ GPIO_PAD_CONF("N31: TCK", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 23, NA, 0x4c08, NORTH),
+ GPIO_PAD_CONF("N41: TDI", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 33, NA, 0x4c58, NORTH),
+ GPIO_PAD_CONF("N39: TDO", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 31, NA, 0x4c48, NORTH),
+ GPIO_PAD_CONF("N36: TDO_2", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 28, NA, 0x4c30, NORTH),
+ GPIO_PAD_CONF("N34: TMS", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 26, NA, 0x4c20, NORTH),
+ GPIO_PAD_CONF("N30: TRST_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 22, NA, 0x4c00, NORTH),
+
+ GPIO_PAD_CONF("E21: MF_ISH_GPIO_0", GPIO, M1, GPI, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 18, NA, 0x4830, EAST),
+ GPIO_PAD_CONF("E18: MF_ISH_GPIO_1", GPIO, M1, GPI, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 15, NA, 0x4818, EAST),
+ GPIO_PAD_CONF("E24: MF_ISH_GPIO_2", GPIO, M1, GPI, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 21, NA, 0x4848, EAST),
+ GPIO_PAD_CONF("E15: MF_ISH_GPIO_3", GPIO, M1, GPI, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 12, NA, 0x4800, EAST),
+ GPIO_PAD_CONF("E22: MF_ISH_GPIO_4", GPIO, M1, GPI, NA, NA,
+ NA, L0, NA, NA, NA, NON_MASKABLE, NA, NO_INVERSION,
+ NA, 19, NA, 0x4838, EAST),
+ GPIO_PAD_CONF("E19: MF_ISH_GPIO_5", GPIO, M1, GPO, HIGH, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 16, NA, 0x4820, EAST),
+ GPIO_PAD_CONF("E25: MF_ISH_GPIO_6", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 22, NA, 0x4850, EAST),
+ GPIO_PAD_CONF("E16: MF_ISH_GPIO_7", GPIO, M1, GPO, HIGH, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 13, NA, 0x4808, EAST),
+ GPIO_PAD_CONF("E23: MF_ISH_GPIO_8", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 20, NA, 0x4840, EAST),
+ GPIO_PAD_CONF("E20: MF_ISH_GPIO_9", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 17, NA, 0x4828, EAST),
+ GPIO_PAD_CONF("E26: MF_ISH_I2C1_SDA", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 23, NA, 0x4858, EAST),
+ GPIO_PAD_CONF("E17: MF_ISH_I2C1_SCL", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 14, NA, 0x4810, EAST),
+ GPIO_PAD_CONF("E04: PMU_AC_PRESENT", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 4, NA, 0x4420, EAST),
+ GPIO_PAD_CONF("E01: PMU_BATLOW_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 1, NA, 0x4408, EAST),
+ GPIO_PAD_CONF("E05: PMU_PLTRST_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 5, NA, 0x4428, EAST),
+ GPIO_PAD_CONF("E07: PMU_SLP_LAN_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 7, NA, 0x4438, EAST),
+ GPIO_PAD_CONF("E03: PMU_SLP_S0IX_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 3, NA, 0x4418, EAST),
+ GPIO_PAD_CONF("E00: PMU_SLP_S3_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 0, NA, 0x4400, EAST),
+ GPIO_PAD_CONF("E09: PMU_SLP_S4_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 9, NA, 0x4448, EAST),
+ GPIO_PAD_CONF("E06: PMU_SUSCLK", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 6, NA, 0x4430, EAST),
+ GPIO_PAD_CONF("E10: PMU_WAKE_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_1K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 10, NA, 0x4450, EAST),
+ GPIO_PAD_CONF("E11: PMU_WAKE_LAN_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 11, NA, 0x4458, EAST),
+ GPIO_PAD_CONF("E02: SUS_STAT_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 2, NA, 0x4410, EAST),
+
+ GPIO_PAD_CONF("SE16: SDMMC1_CLK", NATIVE, M1, NA, NA, HIGH,
+ NA, NA, P_20K_L, NA, NA, NA, NA, NO_INVERSION,
+ NA, 9, NA, 0x4808, SOUTHEAST),
+ GPIO_PAD_CONF("SE23: SDMMC1_CMD", NATIVE, M1, NA, NA, HIGH,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 16, NA, 0x4840, SOUTHEAST),
+ GPIO_PAD_CONF("SE17: SDMMC1_D0", NATIVE, M1, NA, NA, HIGH,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 10, NA, 0x4810, SOUTHEAST),
+ GPIO_PAD_CONF("SE24: SDMMC1_D1", NATIVE, M1, NA, NA, HIGH,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 17, NA, 0x4848, SOUTHEAST),
+ GPIO_PAD_CONF("SE20: SDMMC1_D2", NATIVE, M1, NA, NA, HIGH,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 13, NA, 0x4828, SOUTHEAST),
+ GPIO_PAD_CONF("SE26: SDMMC1_D3_CD_B", NATIVE, M1, NA, NA, HIGH,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 19, NA, 0x4858, SOUTHEAST),
+ GPIO_PAD_CONF("SE67: MMC1_D4_SD_WE", NATIVE, M1, NA, NA, HIGH,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 41, NA, 0x5438, SOUTHEAST),
+ GPIO_PAD_CONF("SE65: MMC1_D5", NATIVE, M1, NA, NA, HIGH,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 39, NA, 0x5428, SOUTHEAST),
+ GPIO_PAD_CONF("SE63: MMC1_D6", NATIVE, M1, NA, NA, HIGH,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 37, NA, 0x5418, SOUTHEAST),
+ GPIO_PAD_CONF("SE68: MMC1_D7", NATIVE, M1, NA, NA, HIGH,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 42, NA, 0x5440, SOUTHEAST),
+ GPIO_PAD_CONF("SE69: MMC1_RCLK", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 43, NA, 0x5448, SOUTHEAST),
+ GPIO_PAD_CONF("SE77: GPIO_ALERT", GPIO, M1, GPI, NA, NA,
+ TRIG_LEVEL, L2, NA, NA, NA, NON_MASKABLE,
+ EN_RX_DATA, INV_RX_DATA,
+ NA, 46, NA, 0x5810, SOUTHEAST),
+ GPIO_PAD_CONF("SE79: ILB_SERIRQ", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 48, NA, 0x5820, SOUTHEAST),
+ GPIO_PAD_CONF("SE51: MF_LPC_CLKOUT0", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_NONE, NA, NA, NA, NA, NO_INVERSION,
+ NA, 32, NA, 0x5030, SOUTHEAST),
+ GPIO_PAD_CONF("SE49: MF_LPC_CLKOUT1", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 30, NA, 0x5020, SOUTHEAST),
+ GPIO_PAD_CONF("SE47: MF_LPC_AD0", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 28, NA, 0x5010, SOUTHEAST),
+ GPIO_PAD_CONF("SE52: MF_LPC_AD1", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 33, NA, 0x5038, SOUTHEAST),
+ GPIO_PAD_CONF("SE45: MF_LPC_AD2", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 26, NA, 0x5000, SOUTHEAST),
+ GPIO_PAD_CONF("SE50: MF_LPC_AD3", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 31, NA, 0x5028, SOUTHEAST),
+ GPIO_PAD_CONF("SE46: LPC_CLKRUNB", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 27, NA, 0x5008, SOUTHEAST),
+ GPIO_PAD_CONF("SE48: LPC_FRAMEB", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 29, NA, 0x5018, SOUTHEAST),
+ GPIO_PAD_CONF("SE00: MF_PLT_CLK0", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 0, NA, 0x4400, SOUTHEAST),
+ GPIO_PAD_CONF("SE02: MF_PLT_CLK1", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 1, NA, 0x4410, SOUTHEAST),
+ GPIO_PAD_CONF("SE07: MF_PLT_CLK2", GPIO, M1, GPI, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 7, NA, 0x4438, SOUTHEAST),
+ GPIO_PAD_CONF("SE04: MF_PLT_CLK3", GPIO, M1, GPI, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 4, NA, 0x4420, SOUTHEAST),
+ GPIO_PAD_CONF("SE03: MF_PLT_CLK4", GPIO, M1, GPO, LOW, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 3, NA, 0x4418, SOUTHEAST),
+ GPIO_PAD_CONF("SE06: MF_PLT_CLK5", GPIO, M3, GPO, LOW, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 6, NA, 0x4430, SOUTHEAST),
+ GPIO_PAD_CONF("SE83: SUSPWRDNACK", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 52, NA, 0x5840, SOUTHEAST),
+ GPIO_PAD_CONF("SE05: PWM0", GPIO, M1, GPO, LOW, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 5, NA, 0x4428, SOUTHEAST),
+ GPIO_PAD_CONF("SE01: PWM1", GPIO, M1, GPO, HIGH, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 1, NA, 0x4408, SOUTHEAST),
+ GPIO_PAD_CONF("SE85: SDMMC3_1P8_EN", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 54, NA, 0x5850, SOUTHEAST),
+ GPIO_PAD_CONF("SE81: SDMMC3_CD_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 50, NA, 0x5830, SOUTHEAST),
+ GPIO_PAD_CONF("SE31: SDMMC3_CLK", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 21, NA, 0x4c08, SOUTHEAST),
+ GPIO_PAD_CONF("SE34: SDMMC3_CMD", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 24, NA, 0x4c20, SOUTHEAST),
+ GPIO_PAD_CONF("SE35: SDMMC3_D0", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 25, NA, 0x4c28, SOUTHEAST),
+ GPIO_PAD_CONF("SE30: SDMMC3_D1", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 20, NA, 0x4c00, SOUTHEAST),
+ GPIO_PAD_CONF("SE33: SDMMC3_D2", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 23, NA, 0x4c18, SOUTHEAST),
+ GPIO_PAD_CONF("SE32: SDMMC3_D3", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 22, NA, 0x4c10, SOUTHEAST),
+ GPIO_PAD_CONF("SE78: SDMMC3_PWR_EN_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_L, NA, NA, NA, NA, NO_INVERSION,
+ NA, 47, NA, 0x5818, SOUTHEAST),
+ GPIO_PAD_CONF("SE19: SDMMC2_CLK", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 12, NA, 0x4820, SOUTHEAST),
+ GPIO_PAD_CONF("SE22: SDMMC2_CMD", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 15, NA, 0x4838, SOUTHEAST),
+ GPIO_PAD_CONF("SE25: SDMMC2_D0", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 18, NA, 0x4850, SOUTHEAST),
+ GPIO_PAD_CONF("SE18: SDMMC2_D1", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 11, NA, 0x4818, SOUTHEAST),
+ GPIO_PAD_CONF("SE21: SDMMC2_D2", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 14, NA, 0x4830, SOUTHEAST),
+ GPIO_PAD_CONF("SE15: SDMMC2_D3_CD_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 8, NA, 0x4800, SOUTHEAST),
+ GPIO_PAD_CONF("SE62: SPI1_CLK", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 36, NA, 0x5410, SOUTHEAST),
+ GPIO_PAD_CONF("SE61: SPI1_CS0_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 35, NA, 0x5408, SOUTHEAST),
+ GPIO_PAD_CONF("SE66: SPI1_CS1_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 40, NA, 0x5430, SOUTHEAST),
+ GPIO_PAD_CONF("SE60: SPI1_MISO", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 34, NA, 0x5400, SOUTHEAST),
+ GPIO_PAD_CONF("SE64: SPI1_MOSI", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 38, NA, 0x5420, SOUTHEAST),
+ GPIO_PAD_CONF("SE80: USB_OC0_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 49, NA, 0x5828, SOUTHEAST),
+ GPIO_PAD_CONF("SE75: USB_OC1_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 44, NA, 0x5800, SOUTHEAST),
+ GPIO_PAD_CONF("SW02: FST_SPI_CLK", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 2, NA, 0x4410, SOUTHWEST),
+ GPIO_PAD_CONF("SW06: FST_SPI_CS0_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 6, NA, 0x4430, SOUTHWEST),
+ GPIO_PAD_CONF("SW04: FST_SPI_CS1_B", GPIO, M1, GPO, HIGH, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 4, NA, 0x4420, SOUTHWEST),
+ GPIO_PAD_CONF("SW07: FST_SPI_CS2_B", GPIO, M1, GPO, LOW, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 7, NA, 0x4438, SOUTHWEST),
+ GPIO_PAD_CONF("SW01: FST_SPI_D0", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 1, NA, 0x4408, SOUTHWEST),
+ GPIO_PAD_CONF("SW05: FST_SPI_D1", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 5, NA, 0x4428, SOUTHWEST),
+ GPIO_PAD_CONF("SW00: FST_SPI_D2", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 0, NA, 0x4400, SOUTHWEST),
+ GPIO_PAD_CONF("SW03: FST_SPI_D3", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 3, NA, 0x4418, SOUTHWEST),
+ GPIO_PAD_CONF("SW30: MF_HDA_CLK", NATIVE, M2, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 16, NA, 0x4c00, SOUTHWEST),
+ GPIO_PAD_CONF("SW37: MF_HDA_DOCKENB", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 23, NA, 0x4c38, SOUTHWEST),
+ GPIO_PAD_CONF("SW34: MF_HDA_DOCKRSTB", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 20, NA, 0x4c20, SOUTHWEST),
+ GPIO_PAD_CONF("SW31: MF_HDA_RSTB", NATIVE, M2, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 17, NA, 0x4c08, SOUTHWEST),
+ GPIO_PAD_CONF("SW32: MF_HDA_SDI0", NATIVE, M2, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 18, NA, 0x4c10, SOUTHWEST),
+ GPIO_PAD_CONF("SW36: MF_HDA_SDI1", NATIVE, M2, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 22, NA, 0x4c30, SOUTHWEST),
+ GPIO_PAD_CONF("SW33: MF_HDA_SDO", NATIVE, M2, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 19, NA, 0x4c18, SOUTHWEST),
+ GPIO_PAD_CONF("SW35: MF_HDA_SYNC", NATIVE, M2, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 21, NA, 0x4c28, SOUTHWEST),
+ GPIO_PAD_CONF("SW18: UART1_CTS_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 11, NA, 0x4818, SOUTHWEST),
+ GPIO_PAD_CONF("SW15: UART1_RTS_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 8, NA, 0x4800, SOUTHWEST),
+ GPIO_PAD_CONF("SW16: UART1_RXD", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 9, NA, 0x4808, SOUTHWEST),
+ GPIO_PAD_CONF("SW20: UART1_TXD", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 13, NA, 0x4828, SOUTHWEST),
+ GPIO_PAD_CONF("SW22: UART2_CTS_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_NONE, NA, NA, NA, NA, NO_INVERSION,
+ NA, 15, NA, 0x4838, SOUTHWEST),
+ GPIO_PAD_CONF("SW19: UART2_RTS_B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 12, NA, 0x4820, SOUTHWEST),
+ GPIO_PAD_CONF("SW17: UART2_RXD", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_NONE, NA, NA, NA, NA, NO_INVERSION,
+ NA, 10, NA, 0x4810, SOUTHWEST),
+ GPIO_PAD_CONF("SW21: UART2_TXD", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 14, NA, 0x4830, SOUTHWEST),
+ GPIO_PAD_CONF("SW50: I2C4_SCL", NATIVE, M3, NA, NA, NA,
+ NA, NA, P_1K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 29, NA, 0x5028, SOUTHWEST),
+ GPIO_PAD_CONF("SW46: I2C4_SDA", NATIVE, M3, NA, NA, NA,
+ NA, NA, P_1K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 25, NA, 0x5008, SOUTHWEST),
+ GPIO_PAD_CONF("SW49: I2C_NFC_SDA", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, INV_TX_ENABLE,
+ NA, 28, NA, 0x5020, SOUTHWEST),
+ GPIO_PAD_CONF("SW52: I2C_NFC_SCL", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, INV_TX_ENABLE,
+ NA, 31, NA, 0x5038, SOUTHWEST),
+ GPIO_PAD_CONF("SW77: GP_SSP_2_CLK", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 50, NA, 0x5c10, SOUTHWEST),
+ GPIO_PAD_CONF("SW81: GP_SSP_2_FS", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 54, NA, 0x5c30, SOUTHWEST),
+ GPIO_PAD_CONF("SW79: GP_SSP_2_RXD", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 52, NA, 0x5c20, SOUTHWEST),
+ GPIO_PAD_CONF("SW82: GP_SSP_2_TXD", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, INV_TX_ENABLE,
+ NA, 55, NA, 0x5C38, SOUTHWEST),
+ GPIO_PAD_CONF("SW90: PCIE_CLKREQ0B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 48, NA, 0x5c00, SOUTHWEST),
+ GPIO_PAD_CONF("SW91: PCIE_CLKREQ1B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 49, NA, 0x5c08, SOUTHWEST),
+ GPIO_PAD_CONF("SW93: PCIE_CLKREQ2B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 51, NA, 0x5c18, SOUTHWEST),
+ GPIO_PAD_CONF("SW95: PCIE_CLKREQ3B", NATIVE, M2, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 53, NA, 0x5c28, SOUTHWEST),
+ GPIO_PAD_CONF("SW75: SATA_GP0", GPIO, M1, GPO, HIGH, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 40, NA, 0x5800, SOUTHWEST),
+ GPIO_PAD_CONF("SW76: SATA_GP1", GPIO, M1, GPI, HIGH, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 41, NA, 0x5808, SOUTHWEST),
+ GPIO_PAD_CONF("SW78: SATA_GP2", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, ENABLE, NA, NA, NA, NO_INVERSION,
+ NA, 43, NA, 0x5818, SOUTHWEST),
+ GPIO_PAD_CONF("SW80: SATA_GP3", GPIO, M2, GPI, LOW, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 45, NA, 0x5828, SOUTHWEST),
+ GPIO_PAD_CONF("SW77: SATA_LEDN", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, ENABLE, NA, NA, NA, NO_INVERSION,
+ NA, 42, NA, 0x5810, SOUTHWEST),
+ GPIO_PAD_CONF("SW79: MF_SMB_ALERTB", NATIVE, M1, NA, NA,
+ NA, NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 44, NA, 0x5820, SOUTHWEST),
+ GPIO_PAD_CONF("SW81: MF_SMB_CLK", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 46, NA, 0x5830, SOUTHWEST),
+ GPIO_PAD_CONF("SW82: MF_SMB_DATA", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NO_INVERSION,
+ NA, 47, NA, 0x5838, SOUTHWEST),
+ GPIO_PAD_CONF("SW90: PCIE_CLKREQ0B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NA,
+ NA, 48, NA, 0x5c00, SOUTHWEST),
+ GPIO_PAD_CONF("SW91: PCIE_CLKREQ1B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NA,
+ NA, 49, NA, 0x5c08, SOUTHWEST),
+ GPIO_PAD_CONF("SW93: PCIE_CLKREQ2B", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NA,
+ NA, 51, NA, 0x5c18, SOUTHWEST),
+ GPIO_PAD_CONF("SW95: PCIE_CLKREQ3B", NATIVE, M2, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NA,
+ NA, 53, NA, 0x5c28, SOUTHWEST),
+ GPIO_PAD_CONF("SW75: SATA_GP0", GPIO, M1, GPO, HIGH, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA,
+ NA, 40, NA, 0x5800, SOUTHWEST),
+ GPIO_PAD_CONF("SW76: SATA_GP1", GPIO, M1, GPI, HIGH, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA,
+ NA, 41, NA, 0x5808, SOUTHWEST),
+ GPIO_PAD_CONF("SW78: SATA_GP2", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, ENABLE, NA, NA, NA, NA,
+ NA, 43, NA, 0x5818, SOUTHWEST),
+ GPIO_PAD_CONF("SW80: SATA_GP3", GPIO, M2, GPI, LOW, NA,
+ NA, NA, NA, NA, NA, NA, NA, NA,
+ NA, 45, NA, 0x5828, SOUTHWEST),
+ GPIO_PAD_CONF("SW77: SATA_LEDN", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, ENABLE, NA, NA, NA, NA,
+ NA, 42, NA, 0x5810, SOUTHWEST),
+ GPIO_PAD_CONF("SW79: MF_SMB_ALERTB", NATIVE, M1, NA, NA,
+ NA, NA, NA, P_20K_H, NA, NA, NA, NA, NA,
+ NA, 44, NA, 0x5820, SOUTHWEST),
+ GPIO_PAD_CONF("SW81: MF_SMB_CLK", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NA,
+ NA, 46, NA, 0x5830, SOUTHWEST),
+ GPIO_PAD_CONF("SW82: MF_SMB_DATA", NATIVE, M1, NA, NA, NA,
+ NA, NA, P_20K_H, NA, NA, NA, NA, NA,
+ NA, 47, NA, 0x5838, SOUTHWEST),
+
+ /* end of the table */
+ GPIO_PAD_CONF("GPIO PAD TABLE END", NATIVE, M1, NA, NA, NA,
+ NA, NA, NA, NA, NA, NA, NA, NO_INVERSION,
+ NA, 0, NA, 0, TERMINATOR),
+};
+
+void update_fsp_gpio_configs(const struct gpio_family **family,
+ const struct gpio_pad **pad)
+{
+ *family = gpio_family;
+ *pad = gpio_pad;
+}
--- /dev/null
+/*
+ * Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+.globl early_board_init
+early_board_init:
+ jmp early_board_init_ret
udelay(100);
mmdc_do_write_level_calibration(&novena_ddr_info);
mmdc_do_dqs_calibration(&novena_ddr_info);
-
- /* Clear the BSS. */
- memset(__bss_start, 0, __bss_end - __bss_start);
-
- /* load/boot image from boot device */
- board_init_r(NULL, 0);
}
/* DDR initialization */
spl_dram_init();
-
- /* Clear the BSS. */
- memset(__bss_start, 0, __bss_end - __bss_start);
-
- /* load/boot image from boot device */
- board_init_r(NULL, 0);
}
#endif
config SYS_CONFIG_NAME
default "am3517_evm"
+source "board/ti/common/Kconfig"
+
endif
#include <linux/usb/gadget.h>
#include <linux/usb/musb.h>
#include "omap3logic.h"
+#ifdef CONFIG_USB_EHCI_HCD
+#include <usb.h>
+#include <asm/ehci-omap.h>
+#endif
DECLARE_GLOBAL_DATA_PTR;
};
#endif
+#if defined(CONFIG_USB_EHCI_HCD) && !defined(CONFIG_SPL_BUILD)
+/* Call usb_stop() before starting the kernel */
+void show_boot_progress(int val)
+{
+ if (val == BOOTSTAGE_ID_RUN_OS)
+ usb_stop();
+}
+
+static struct omap_usbhs_board_data usbhs_bdata = {
+ .port_mode[0] = OMAP_EHCI_PORT_MODE_PHY,
+ .port_mode[1] = OMAP_EHCI_PORT_MODE_PHY,
+ .port_mode[2] = OMAP_USBHS_PORT_MODE_UNUSED
+};
+
+int ehci_hcd_init(int index, enum usb_init_type init,
+ struct ehci_hccr **hccr, struct ehci_hcor **hcor)
+{
+ return omap_ehci_hcd_init(index, &usbhs_bdata, hccr, hcor);
+}
+
+int ehci_hcd_stop(int index)
+{
+ return omap_ehci_hcd_stop();
+}
+
+#endif /* CONFIG_USB_EHCI_HCD */
+
/*
* Routine: misc_init_r
CONFIG_SANDBOX_BIG_ENDIAN should be defined when running on big-endian
machines.
+By default sandbox builds and runs on 64-bit hosts. If you are going to build
+and run sandbox on a 32-bit host, select CONFIG_SANDBOX_32BIT.
+
Note that standalone/API support is not available at present.
make sandbox_defconfig all NO_SDL=1
./u-boot
- If you are building on a 32-bit machine you may get errors from __ffs.h
- about shifting more than the machine word size. Edit the config file
- include/configs/sandbox.h and change CONFIG_SANDBOX_BITS_PER_LONG to 32.
-
U-Boot will start on your computer, showing a sandbox emulation of the serial
console:
$> sudo mkfs.vfat -n EFI -v ${lodev}p1
$> sudo mkfs.ext4 -L ROOT -v ${lodev}p2
+or utilize the device described in test/py/make_test_disk.py:
+
+ #!/usr/bin/python
+ import make_test_disk
+ make_test_disk.makeDisk()
Writing Sandbox Drivers
-----------------------
* Machine selection -
* Machine val1, val2
* -------------------------
+ * HB2 x x
* HB rev 3.x x 0
* CBi 0 1
* HB 1 1
return true;
}
+static bool is_hummingboard2(void)
+{
+ int val1;
+
+ SETUP_IOMUX_PADS(hb_cbi_sense);
+
+ gpio_direction_input(IMX_GPIO_NR(2, 8));
+
+ val1 = gpio_get_value(IMX_GPIO_NR(2, 8));
+
+ /*
+ * Machine selection -
+ * Machine val1
+ * -------------------
+ * HB2 0
+ * HB rev 3.x x
+ * CBi x
+ * HB x
+ */
+
+ if (val1 == 0)
+ return true;
+ else
+ return false;
+}
+
int checkboard(void)
{
- if (is_hummingboard())
+ if (is_hummingboard2())
+ puts("Board: MX6 Hummingboard2\n");
+ else if (is_hummingboard())
puts("Board: MX6 Hummingboard\n");
else
puts("Board: MX6 Cubox-i\n");
int board_late_init(void)
{
#ifdef CONFIG_ENV_VARS_UBOOT_RUNTIME_CONFIG
- if (is_hummingboard())
+ if (is_hummingboard2())
+ env_set("board_name", "HUMMINGBOARD2");
+ else if (is_hummingboard())
env_set("board_name", "HUMMINGBOARD");
else
env_set("board_name", "CUBOXI");
Put pico board into normal boot mode.
Power up the board and the new updated U-Boot should boot from eMMC.
+
+Building U-Boot to boot with NXP 4.1 kernel:
+
+The NXP 4.1 kernel boots only in secure boot mode on mx7.
+
+Follow the next steps to enable secure boot:
+
+$ make mrproper
+$ make pico-imx7d_defconfig
+$ make menuconfig
+ -> ARM architecture
+ -> [*] Enable support for booting in non-secure mode
+ -> [*] Boot in secure mode by default
+ -> Exit
+$ make
+
+Flash u-boot.imx using the imx_usb_loader tool.
(IOMUXC_GPR_GPR1_GPR_ENET1_TX_CLK_SEL_MASK |
IOMUXC_GPR_GPR1_GPR_ENET1_CLK_DIR_MASK), 0);
- return set_clk_enet(ENET_125MHz);
+ return set_clk_enet(ENET_125MHZ);
}
int board_phy_config(struct phy_device *phydev)
> make CROSS_COMPILE=aarch64-unknown-elf- ARCH=arm u-boot.itb
-Write to a SD-card
-==================
+Flash the image
+===============
+
+Copy the SPL to offset 32k and the FIT image containing the payloads
+(U-Boot proper, ATF, devicetree) to offset 256k card.
+
+SD-Card
+-------
> dd if=spl-3368.img of=/dev/sdb seek=64
> dd if=u-boot.itb of=/dev/sdb seek=512
+eMMC
+----
+
+rkdeveloptool allows to flash the on-board eMMC via the USB OTG interface with
+help of the Rockchip loader binary.
+
+ > git clone https://github.com/rockchip-linux/rkdeveloptool
+ > cd rkdeveloptool
+ > autoreconf -i && && ./configure && make
+ > git clone https://github.com/rockchip-linux/rkbin.git
+ > ./rkdeveloptool db rkbin/rk33/rk3368_loader_v2.00.256.bin
+ > ./rkdeveloptool wl 64 ../spl.img
+ > ./rkdeveloptool wl 512 ../u-boot.itb
+
If everything went according to plan, you should see the following
output on UART0:
Package the image
=================
- > tools/mkimage -n rk3399 -T rksd -d spl/u-boot-spl.bin spl.img
- > make CROSS_COMPILE=aarch64-linux-gnu- u-boot.itb
+Creating a SPL image for SD-Card/eMMC
+ > tools/mkimage -n rk3399 -T rksd -d spl/u-boot-spl.bin spl_mmc.img
+Creating a SPL image for SPI-NOR
+ > tools/mkimage -n rk3399 -T rkspi -d spl/u-boot-spl.bin spl_nor.img
+Create the FIT image containing U-Boot proper, ATF, M0 Firmware, devicetree
+ > make CROSS_COMPILE=aarch64-linux-gnu- u-boot.itb
Flash the image
===============
-Copy the SPL to offset 32k and the FIT image containing the payloads
-(U-Boot proper, ATF, M0 Firmware, devicetree) to offset 256k on a SD
-card.
+Copy the SPL to offset 32k for SD/eMMC, offset 0 for NOR-Flash and the FIT
+image to offset 256k card.
- > dd if=spl.img of=/dev/sdb seek=64
+SD-Card
+-------
+
+ > dd if=spl_mmc.img of=/dev/sdb seek=64
> dd if=u-boot.itb of=/dev/sdb seek=512
-After powering up the board (with the inserted SD card), you should see
-a U-Boot console on UART0 (115200n8).
+eMMC
+----
+
+rkdeveloptool allows to flash the on-board eMMC via the USB OTG interface with
+help of the Rockchip loader binary.
+
+ > git clone https://github.com/rockchip-linux/rkdeveloptool
+ > cd rkdeveloptool
+ > autoreconf -i && ./configure && make
+ > git clone https://github.com/rockchip-linux/rkbin.git
+ > ./rkdeveloptool db rkbin/rk33/rk3399_loader_v1.08.106.bin
+ > ./rkdeveloptool wl 64 ../spl_mmc.img
+ > ./rkdeveloptool wl 512 ../u-boot.itb
+
+NOR-Flash
+---------
+
+Writing the SPI NOR Flash requires a running U-Boot. For the sake of simplicity
+we assume you have a SD-Card with a partition containing the required files
+ready.
+
+ > load mmc 1:1 ${kernel_addr_r} spl_nor.img
+ > sf probe
+ > sf erase 0 +$filesize
+ > sf write $kernel_addr_r 0 ${filesize}
+ > load mmc 1:1 ${kernel_addr_r} u-boot.itb
+ > sf erase 0x40000 +$filesize
+ > sf write $kernel_addr_r 0x40000 ${filesize}
+
+
+Reboot the system and you should see a U-Boot console on UART0 (115200n8).
u8 low[cpuid_length/2], high[cpuid_length/2];
char cpuid_str[cpuid_length * 2 + 1];
u64 serialno;
- char serialno_str[16];
+ char serialno_str[17];
/* retrieve the device */
ret = uclass_get_device_by_driver(UCLASS_MISC,
0x0
};
+static const struct emif_regs am571x_emif1_ddr3_666mhz_emif_regs = {
+ .sdram_config_init = 0x61863332,
+ .sdram_config = 0x61863332,
+ .sdram_config2 = 0x08000000,
+ .ref_ctrl = 0x0000514d,
+ .ref_ctrl_final = 0x0000144a,
+ .sdram_tim1 = 0xd333887c,
+ .sdram_tim2 = 0x40b37fe3,
+ .sdram_tim3 = 0x409f8ada,
+ .read_idle_ctrl = 0x00050000,
+ .zq_config = 0x5007190b,
+ .temp_alert_config = 0x00000000,
+ .emif_ddr_phy_ctlr_1_init = 0x0024400f,
+ .emif_ddr_phy_ctlr_1 = 0x0e24400f,
+ .emif_ddr_ext_phy_ctrl_1 = 0x10040100,
+ .emif_ddr_ext_phy_ctrl_2 = 0x00910091,
+ .emif_ddr_ext_phy_ctrl_3 = 0x00950095,
+ .emif_ddr_ext_phy_ctrl_4 = 0x009b009b,
+ .emif_ddr_ext_phy_ctrl_5 = 0x009e009e,
+ .emif_rd_wr_lvl_rmp_win = 0x00000000,
+ .emif_rd_wr_lvl_rmp_ctl = 0x80000000,
+ .emif_rd_wr_lvl_ctl = 0x00000000,
+ .emif_rd_wr_exec_thresh = 0x00000305
+};
+
void emif_get_reg_dump(u32 emif_nr, const struct emif_regs **regs)
{
switch (emif_nr) {
case 1:
- *regs = &beagle_x15_emif1_ddr3_532mhz_emif_regs;
+ if (board_is_am571x_idk())
+ *regs = &am571x_emif1_ddr3_666mhz_emif_regs;
+ else
+ *regs = &beagle_x15_emif1_ddr3_532mhz_emif_regs;
break;
case 2:
*regs = &beagle_x15_emif2_ddr3_532mhz_emif_regs;
void hw_data_init(void)
{
*prcm = &dra7xx_prcm;
- *dplls_data = &dra7xx_dplls;
+ if (is_dra72x())
+ *dplls_data = &dra72x_dplls;
+ else
+ *dplls_data = &dra7xx_dplls;
*ctrl = &dra7xx_ctrl;
}
if (board_is_x15_revb1()) {
if (!strcmp(name, "am57xx-beagle-x15-revb1"))
return 0;
+ } else if (board_is_x15_revc()) {
+ if (!strcmp(name, "am57xx-beagle-x15-revc"))
+ return 0;
} else if (!strcmp(name, "am57xx-beagle-x15")) {
return 0;
}
#include "mux_data.h"
#include "../common/board_detect.h"
+#define board_is_dra76x_evm() board_ti_is("DRA76/7x")
#define board_is_dra74x_evm() board_ti_is("5777xCPU")
#define board_is_dra72x_evm() board_ti_is("DRA72x-T")
#define board_is_dra71x_evm() board_ti_is("DRA79x,D")
.emif_rd_wr_exec_thresh = 0x00000305
};
+const struct emif_regs emif_1_regs_ddr3_666_mhz_1cs_dra76 = {
+ .sdram_config_init = 0x61862B32,
+ .sdram_config = 0x61862B32,
+ .sdram_config2 = 0x00000000,
+ .ref_ctrl = 0x0000514C,
+ .ref_ctrl_final = 0x0000144A,
+ .sdram_tim1 = 0xD113783C,
+ .sdram_tim2 = 0x30B47FE3,
+ .sdram_tim3 = 0x409F8AD8,
+ .read_idle_ctrl = 0x00050000,
+ .zq_config = 0x5007190B,
+ .temp_alert_config = 0x00000000,
+ .emif_ddr_phy_ctlr_1_init = 0x0824400D,
+ .emif_ddr_phy_ctlr_1 = 0x0E24400D,
+ .emif_ddr_ext_phy_ctrl_1 = 0x04040100,
+ .emif_ddr_ext_phy_ctrl_2 = 0x006B009F,
+ .emif_ddr_ext_phy_ctrl_3 = 0x006B00A2,
+ .emif_ddr_ext_phy_ctrl_4 = 0x006B00A8,
+ .emif_ddr_ext_phy_ctrl_5 = 0x006B00A8,
+ .emif_rd_wr_lvl_rmp_win = 0x00000000,
+ .emif_rd_wr_lvl_rmp_ctl = 0x80000000,
+ .emif_rd_wr_lvl_ctl = 0x00000000,
+ .emif_rd_wr_exec_thresh = 0x00000305
+};
+
+const struct emif_regs emif_2_regs_ddr3_666_mhz_1cs_dra76 = {
+ .sdram_config_init = 0x61862B32,
+ .sdram_config = 0x61862B32,
+ .sdram_config2 = 0x00000000,
+ .ref_ctrl = 0x0000514C,
+ .ref_ctrl_final = 0x0000144A,
+ .sdram_tim1 = 0xD113781C,
+ .sdram_tim2 = 0x30B47FE3,
+ .sdram_tim3 = 0x409F8AD8,
+ .read_idle_ctrl = 0x00050000,
+ .zq_config = 0x5007190B,
+ .temp_alert_config = 0x00000000,
+ .emif_ddr_phy_ctlr_1_init = 0x0824400D,
+ .emif_ddr_phy_ctlr_1 = 0x0E24400D,
+ .emif_ddr_ext_phy_ctrl_1 = 0x04040100,
+ .emif_ddr_ext_phy_ctrl_2 = 0x006B009F,
+ .emif_ddr_ext_phy_ctrl_3 = 0x006B00A2,
+ .emif_ddr_ext_phy_ctrl_4 = 0x006B00A8,
+ .emif_ddr_ext_phy_ctrl_5 = 0x006B00A8,
+ .emif_rd_wr_lvl_rmp_win = 0x00000000,
+ .emif_rd_wr_lvl_rmp_ctl = 0x80000000,
+ .emif_rd_wr_lvl_ctl = 0x00000000,
+ .emif_rd_wr_exec_thresh = 0x00000305
+};
+
void emif_get_reg_dump(u32 emif_nr, const struct emif_regs **regs)
{
u64 ram_size;
break;
}
break;
+ case DRA762_ES1_0:
+ if (emif_nr == 1)
+ *regs = &emif_1_regs_ddr3_666_mhz_1cs_dra76;
+ else
+ *regs = &emif_2_regs_ddr3_666_mhz_1cs_dra76;
+ break;
case DRA722_ES1_0:
case DRA722_ES2_0:
+ case DRA722_ES2_1:
if (ram_size < CONFIG_MAX_MEM_MAPPED)
*regs = &emif_1_regs_ddr3_666_mhz_1cs_dra_es1;
else
ram_size = board_ti_get_emif_size();
switch (omap_revision()) {
+ case DRA762_ES1_0:
case DRA752_ES1_0:
case DRA752_ES1_1:
case DRA752_ES2_0:
break;
case DRA722_ES1_0:
case DRA722_ES2_0:
+ case DRA722_ES2_1:
default:
if (ram_size < CONFIG_MAX_MEM_MAPPED)
*dmm_lisa_regs = &lisa_map_2G_x_2;
.iva.abb_tx_done_mask = OMAP_ABB_IVA_TXDONE_MASK,
};
+struct vcores_data dra76x_volts = {
+ .mpu.value[OPP_NOM] = VDD_MPU_DRA7_NOM,
+ .mpu.efuse.reg[OPP_NOM] = STD_FUSE_OPP_VMIN_MPU_NOM,
+ .mpu.efuse.reg_bits = DRA752_EFUSE_REGBITS,
+ .mpu.addr = LP87565_REG_ADDR_BUCK01,
+ .mpu.pmic = &lp87565,
+ .mpu.abb_tx_done_mask = OMAP_ABB_MPU_TXDONE_MASK,
+
+ .eve.value[OPP_NOM] = VDD_EVE_DRA7_NOM,
+ .eve.value[OPP_OD] = VDD_EVE_DRA7_OD,
+ .eve.value[OPP_HIGH] = VDD_EVE_DRA7_HIGH,
+ .eve.efuse.reg[OPP_NOM] = STD_FUSE_OPP_VMIN_DSPEVE_NOM,
+ .eve.efuse.reg[OPP_OD] = STD_FUSE_OPP_VMIN_DSPEVE_OD,
+ .eve.efuse.reg[OPP_HIGH] = STD_FUSE_OPP_VMIN_DSPEVE_HIGH,
+ .eve.efuse.reg_bits = DRA752_EFUSE_REGBITS,
+ .eve.addr = TPS65917_REG_ADDR_SMPS1,
+ .eve.pmic = &tps659038,
+ .eve.abb_tx_done_mask = OMAP_ABB_EVE_TXDONE_MASK,
+
+ .gpu.value[OPP_NOM] = VDD_GPU_DRA7_NOM,
+ .gpu.value[OPP_OD] = VDD_GPU_DRA7_OD,
+ .gpu.value[OPP_HIGH] = VDD_GPU_DRA7_HIGH,
+ .gpu.efuse.reg[OPP_NOM] = STD_FUSE_OPP_VMIN_GPU_NOM,
+ .gpu.efuse.reg[OPP_OD] = STD_FUSE_OPP_VMIN_GPU_OD,
+ .gpu.efuse.reg[OPP_HIGH] = STD_FUSE_OPP_VMIN_GPU_HIGH,
+ .gpu.efuse.reg_bits = DRA752_EFUSE_REGBITS,
+ .gpu.addr = LP87565_REG_ADDR_BUCK23,
+ .gpu.pmic = &lp87565,
+ .gpu.abb_tx_done_mask = OMAP_ABB_GPU_TXDONE_MASK,
+
+ .core.value[OPP_NOM] = VDD_CORE_DRA7_NOM,
+ .core.efuse.reg[OPP_NOM] = STD_FUSE_OPP_VMIN_CORE_NOM,
+ .core.efuse.reg_bits = DRA752_EFUSE_REGBITS,
+ .core.addr = TPS65917_REG_ADDR_SMPS3,
+ .core.pmic = &tps659038,
+
+ .iva.value[OPP_NOM] = VDD_IVA_DRA7_NOM,
+ .iva.value[OPP_OD] = VDD_IVA_DRA7_OD,
+ .iva.value[OPP_HIGH] = VDD_IVA_DRA7_HIGH,
+ .iva.efuse.reg[OPP_NOM] = STD_FUSE_OPP_VMIN_IVA_NOM,
+ .iva.efuse.reg[OPP_OD] = STD_FUSE_OPP_VMIN_IVA_OD,
+ .iva.efuse.reg[OPP_HIGH] = STD_FUSE_OPP_VMIN_IVA_HIGH,
+ .iva.efuse.reg_bits = DRA752_EFUSE_REGBITS,
+ .iva.addr = TPS65917_REG_ADDR_SMPS4,
+ .iva.pmic = &tps659038,
+ .iva.abb_tx_done_mask = OMAP_ABB_IVA_TXDONE_MASK,
+};
+
struct vcores_data dra722_volts = {
.mpu.value[OPP_NOM] = VDD_MPU_DRA7_NOM,
.mpu.efuse.reg[OPP_NOM] = STD_FUSE_OPP_VMIN_MPU_NOM,
name = "dra71x";
else
name = "dra72x";
+ } else if (is_dra76x()) {
+ name = "dra76x";
} else {
name = "dra7xx";
}
bname = "DRA72x EVM";
} else if (board_is_dra71x_evm()) {
bname = "DRA71x EVM";
+ } else if (board_is_dra76x_evm()) {
+ bname = "DRA76x EVM";
} else {
/* If EEPROM is not populated */
if (is_dra72x())
*omap_vcores = &dra722_volts;
} else if (board_is_dra71x_evm()) {
*omap_vcores = &dra718_volts;
+ } else if (board_is_dra76x_evm()) {
+ *omap_vcores = &dra76x_volts;
} else {
/* If EEPROM is not populated */
if (is_dra72x())
switch (omap_revision()) {
case DRA722_ES1_0:
case DRA722_ES2_0:
+ case DRA722_ES2_1:
pads = dra72x_core_padconf_array_common;
npads = ARRAY_SIZE(dra72x_core_padconf_array_common);
if (board_is_dra71x_evm()) {
iodelay = dra742_es1_1_iodelay_cfg_array;
niodelays = ARRAY_SIZE(dra742_es1_1_iodelay_cfg_array);
break;
+ case DRA762_ES1_0:
+ pads = dra76x_core_padconf_array;
+ npads = ARRAY_SIZE(dra76x_core_padconf_array);
+ iodelay = dra76x_es1_0_iodelay_cfg_array;
+ niodelays = ARRAY_SIZE(dra76x_es1_0_iodelay_cfg_array);
+ break;
default:
case DRA752_ES2_0:
pads = dra74x_core_padconf_array;
omap_mmc_init(1, 0, 0, -1, -1);
return 0;
}
+
+void board_mmc_poweron_ldo(uint voltage)
+{
+ if (board_is_dra71x_evm()) {
+ if (voltage == LDO_VOLT_3V0)
+ voltage = 0x19;
+ else if (voltage == LDO_VOLT_1V8)
+ voltage = 0xa;
+ lp873x_mmc1_poweron_ldo(voltage);
+ } else if (board_is_dra76x_evm()) {
+ palmas_mmc1_poweron_ldo(LDO4_VOLTAGE, LDO4_CTRL, voltage);
+ } else {
+ palmas_mmc1_poweron_ldo(LDO1_VOLTAGE, LDO1_CTRL, voltage);
+ }
+}
#endif
#ifdef CONFIG_USB_DWC3
if (omap_hw_init_context() == OMAP_INIT_CONTEXT_UBOOT_AFTER_SPL)
return;
- /* Do not enable VTT for DRA722 */
- if (is_dra72x())
+ /* Do not enable VTT for DRA722 or DRA76x */
+ if (is_dra72x() || is_dra76x())
return;
/*
} else if (!strcmp(name, "dra72-evm")) {
return 0;
}
- } else if (!is_dra72x() && !strcmp(name, "dra7-evm")) {
+ } else if (is_dra76x() && !strcmp(name, "dra76-evm")) {
+ return 0;
+ } else if (!is_dra72x() && !is_dra76x() && !strcmp(name, "dra7-evm")) {
return 0;
}
{WAKEUP2, (M14)}, /* Wakeup2.gpio1_2 */
};
+const struct pad_conf_entry dra76x_core_padconf_array[] = {
+ {GPMC_AD0, (M3 | PIN_INPUT | MANUAL_MODE)}, /* gpmc_ad0.vout3_d0 */
+ {GPMC_AD1, (M3 | PIN_INPUT | MANUAL_MODE)}, /* gpmc_ad1.vout3_d1 */
+ {GPMC_AD2, (M3 | PIN_INPUT | MANUAL_MODE)}, /* gpmc_ad2.vout3_d2 */
+ {GPMC_AD3, (M3 | PIN_INPUT | MANUAL_MODE)}, /* gpmc_ad3.vout3_d3 */
+ {GPMC_AD4, (M3 | PIN_INPUT | MANUAL_MODE)}, /* gpmc_ad4.vout3_d4 */
+ {GPMC_AD5, (M3 | PIN_INPUT | MANUAL_MODE)}, /* gpmc_ad5.vout3_d5 */
+ {GPMC_AD6, (M3 | PIN_INPUT | MANUAL_MODE)}, /* gpmc_ad6.vout3_d6 */
+ {GPMC_AD7, (M3 | PIN_INPUT | MANUAL_MODE)}, /* gpmc_ad7.vout3_d7 */
+ {GPMC_AD8, (M3 | PIN_INPUT | MANUAL_MODE)}, /* gpmc_ad8.vout3_d8 */
+ {GPMC_AD9, (M3 | PIN_INPUT | MANUAL_MODE)}, /* gpmc_ad9.vout3_d9 */
+ {GPMC_AD10, (M3 | PIN_INPUT | MANUAL_MODE)}, /* gpmc_ad10.vout3_d10 */
+ {GPMC_AD11, (M3 | PIN_INPUT | MANUAL_MODE)}, /* gpmc_ad11.vout3_d11 */
+ {GPMC_AD12, (M3 | PIN_INPUT | MANUAL_MODE)}, /* gpmc_ad12.vout3_d12 */
+ {GPMC_AD13, (M3 | PIN_INPUT | MANUAL_MODE)}, /* gpmc_ad13.vout3_d13 */
+ {GPMC_AD14, (M3 | PIN_INPUT | MANUAL_MODE)}, /* gpmc_ad14.vout3_d14 */
+ {GPMC_AD15, (M3 | PIN_INPUT | MANUAL_MODE)}, /* gpmc_ad15.vout3_d15 */
+ {GPMC_A0, (M3 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a0.vout3_d16 */
+ {GPMC_A1, (M3 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a1.vout3_d17 */
+ {GPMC_A2, (M3 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a2.vout3_d18 */
+ {GPMC_A3, (M3 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a3.vout3_d19 */
+ {GPMC_A4, (M3 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a4.vout3_d20 */
+ {GPMC_A5, (M3 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a5.vout3_d21 */
+ {GPMC_A6, (M3 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a6.vout3_d22 */
+ {GPMC_A7, (M3 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a7.vout3_d23 */
+ {GPMC_A8, (M3 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a8.vout3_hsync */
+ {GPMC_A9, (M3 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a9.vout3_vsync */
+ {GPMC_A10, (M3 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a10.vout3_de */
+ {GPMC_A11, (M14 | PIN_INPUT_PULLUP)}, /* gpmc_a11.gpio2_1 */
+ {GPMC_A12, (M14 | PIN_INPUT_PULLUP)}, /* gpmc_a12.gpio2_2 */
+ {GPMC_A13, (M1 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a13.qspi1_rtclk */
+ {GPMC_A14, (M1 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a14.qspi1_d3 */
+ {GPMC_A15, (M1 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a15.qspi1_d2 */
+ {GPMC_A16, (M1 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a16.qspi1_d0 */
+ {GPMC_A17, (M1 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a17.qspi1_d1 */
+ {GPMC_A18, (M1 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* gpmc_a18.qspi1_sclk */
+ {GPMC_A19, (M1 | PIN_INPUT_PULLDOWN)}, /* gpmc_a19.mmc2_dat4 */
+ {GPMC_A20, (M1 | PIN_INPUT_PULLDOWN)}, /* gpmc_a20.mmc2_dat5 */
+ {GPMC_A21, (M1 | PIN_INPUT_PULLDOWN)}, /* gpmc_a21.mmc2_dat6 */
+ {GPMC_A22, (M1 | PIN_INPUT_PULLDOWN)}, /* gpmc_a22.mmc2_dat7 */
+ {GPMC_A23, (M1 | PIN_INPUT_PULLDOWN)}, /* gpmc_a23.mmc2_clk */
+ {GPMC_A24, (M1 | PIN_INPUT_PULLDOWN)}, /* gpmc_a24.mmc2_dat0 */
+ {GPMC_A25, (M1 | PIN_INPUT_PULLDOWN)}, /* gpmc_a25.mmc2_dat1 */
+ {GPMC_A26, (M1 | PIN_INPUT_PULLDOWN)}, /* gpmc_a26.mmc2_dat2 */
+ {GPMC_A27, (M1 | PIN_INPUT_PULLDOWN)}, /* gpmc_a27.mmc2_dat3 */
+ {GPMC_CS1, (M1 | PIN_INPUT_PULLUP)}, /* gpmc_cs1.mmc2_cmd */
+ {GPMC_CS0, (M0 | PIN_INPUT_PULLUP)}, /* gpmc_cs0.gpmc_cs0 */
+ {GPMC_CS2, (M1 | PIN_INPUT_PULLUP | MANUAL_MODE)}, /* gpmc_cs2.qspi1_cs0 */
+ {GPMC_CS3, (M3 | PIN_INPUT_PULLUP | MANUAL_MODE)}, /* gpmc_cs3.vout3_clk */
+ {GPMC_ADVN_ALE, (M0 | PIN_INPUT_PULLUP)}, /* gpmc_advn_ale.gpmc_advn_ale */
+ {GPMC_OEN_REN, (M0 | PIN_INPUT_PULLUP)}, /* gpmc_oen_ren.gpmc_oen_ren */
+ {GPMC_WEN, (M0 | PIN_INPUT_PULLUP)}, /* gpmc_wen.gpmc_wen */
+ {GPMC_BEN0, (M0 | PIN_INPUT_PULLUP)}, /* gpmc_ben0.gpmc_ben0 */
+ {GPMC_WAIT0, (M0 | PIN_INPUT_PULLUP | SLEWCONTROL)}, /* gpmc_wait0.gpmc_wait0 */
+ {VIN1A_FLD0, (M14 | PIN_INPUT_PULLUP)}, /* vin1a_fld0.gpio3_1 */
+ {VIN2A_CLK0, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vin2a_clk0.vin2a_clk0 */
+ {VIN2A_DE0, (M15 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vin2a_de0.Driveroff */
+ {VIN2A_FLD0, (M14 | PIN_INPUT_PULLDOWN)}, /* vin2a_fld0.gpio3_30 */
+ {VIN2A_HSYNC0, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vin2a_hsync0.vin2a_hsync0 */
+ {VIN2A_VSYNC0, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vin2a_vsync0.vin2a_vsync0 */
+ {VIN2A_D0, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vin2a_d0.vin2a_d0 */
+ {VIN2A_D1, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vin2a_d1.vin2a_d1 */
+ {VIN2A_D2, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vin2a_d2.vin2a_d2 */
+ {VIN2A_D3, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vin2a_d3.vin2a_d3 */
+ {VIN2A_D4, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vin2a_d4.vin2a_d4 */
+ {VIN2A_D5, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vin2a_d5.vin2a_d5 */
+ {VIN2A_D6, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vin2a_d6.vin2a_d6 */
+ {VIN2A_D7, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vin2a_d7.vin2a_d7 */
+ {VIN2A_D8, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vin2a_d8.vin2a_d8 */
+ {VIN2A_D9, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vin2a_d9.vin2a_d9 */
+ {VIN2A_D10, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vin2a_d10.vin2a_d10 */
+ {VIN2A_D11, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vin2a_d11.vin2a_d11 */
+ {VIN2A_D12, (M3 | PIN_INPUT | MANUAL_MODE)}, /* vin2a_d12.rgmii1_txc */
+ {VIN2A_D13, (M3 | PIN_INPUT | MANUAL_MODE)}, /* vin2a_d13.rgmii1_txctl */
+ {VIN2A_D14, (M3 | PIN_INPUT | MANUAL_MODE)}, /* vin2a_d14.rgmii1_txd3 */
+ {VIN2A_D15, (M3 | PIN_INPUT | MANUAL_MODE)}, /* vin2a_d15.rgmii1_txd2 */
+ {VIN2A_D16, (M3 | PIN_INPUT | MANUAL_MODE)}, /* vin2a_d16.rgmii1_txd1 */
+ {VIN2A_D17, (M3 | PIN_INPUT | MANUAL_MODE)}, /* vin2a_d17.rgmii1_txd0 */
+ {VIN2A_D18, (M3 | PIN_INPUT | MANUAL_MODE)}, /* vin2a_d18.rgmii1_rxc */
+ {VIN2A_D19, (M3 | PIN_INPUT | MANUAL_MODE)}, /* vin2a_d19.rgmii1_rxctl */
+ {VIN2A_D20, (M3 | PIN_INPUT | MANUAL_MODE)}, /* vin2a_d20.rgmii1_rxd3 */
+ {VIN2A_D21, (M3 | PIN_INPUT | MANUAL_MODE)}, /* vin2a_d21.rgmii1_rxd2 */
+ {VIN2A_D22, (M3 | PIN_INPUT | MANUAL_MODE)}, /* vin2a_d22.rgmii1_rxd1 */
+ {VIN2A_D23, (M3 | PIN_INPUT | MANUAL_MODE)}, /* vin2a_d23.rgmii1_rxd0 */
+ {VOUT1_CLK, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_clk.vout1_clk */
+ {VOUT1_DE, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_de.vout1_de */
+ {VOUT1_FLD, (M14 | PIN_INPUT_PULLUP)}, /* vout1_fld.gpio4_21 */
+ {VOUT1_HSYNC, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_hsync.vout1_hsync */
+ {VOUT1_VSYNC, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_vsync.vout1_vsync */
+ {VOUT1_D0, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d0.vout1_d0 */
+ {VOUT1_D1, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d1.vout1_d1 */
+ {VOUT1_D2, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d2.vout1_d2 */
+ {VOUT1_D3, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d3.vout1_d3 */
+ {VOUT1_D4, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d4.vout1_d4 */
+ {VOUT1_D5, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d5.vout1_d5 */
+ {VOUT1_D6, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d6.vout1_d6 */
+ {VOUT1_D7, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d7.vout1_d7 */
+ {VOUT1_D8, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d8.vout1_d8 */
+ {VOUT1_D9, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d9.vout1_d9 */
+ {VOUT1_D10, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d10.vout1_d10 */
+ {VOUT1_D11, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d11.vout1_d11 */
+ {VOUT1_D12, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d12.vout1_d12 */
+ {VOUT1_D13, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d13.vout1_d13 */
+ {VOUT1_D14, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d14.vout1_d14 */
+ {VOUT1_D15, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d15.vout1_d15 */
+ {VOUT1_D16, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d16.vout1_d16 */
+ {VOUT1_D17, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d17.vout1_d17 */
+ {VOUT1_D18, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d18.vout1_d18 */
+ {VOUT1_D19, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d19.vout1_d19 */
+ {VOUT1_D20, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d20.vout1_d20 */
+ {VOUT1_D21, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d21.vout1_d21 */
+ {VOUT1_D22, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d22.vout1_d22 */
+ {VOUT1_D23, (M0 | PIN_INPUT_PULLDOWN | MANUAL_MODE)}, /* vout1_d23.vout1_d23 */
+ {MDIO_MCLK, (M0 | PIN_INPUT_PULLUP | SLEWCONTROL)}, /* mdio_mclk.mdio_mclk */
+ {MDIO_D, (M0 | PIN_INPUT_PULLUP | SLEWCONTROL)}, /* mdio_d.mdio_d */
+ {RGMII0_TXC, (M0 | PIN_INPUT | MANUAL_MODE)}, /* rgmii0_txc.rgmii0_txc */
+ {RGMII0_TXCTL, (M0 | PIN_INPUT | MANUAL_MODE)}, /* rgmii0_txctl.rgmii0_txctl */
+ {RGMII0_TXD3, (M0 | PIN_INPUT | MANUAL_MODE)}, /* rgmii0_txd3.rgmii0_txd3 */
+ {RGMII0_TXD2, (M0 | PIN_INPUT | MANUAL_MODE)}, /* rgmii0_txd2.rgmii0_txd2 */
+ {RGMII0_TXD1, (M0 | PIN_INPUT | MANUAL_MODE)}, /* rgmii0_txd1.rgmii0_txd1 */
+ {RGMII0_TXD0, (M0 | PIN_INPUT | MANUAL_MODE)}, /* rgmii0_txd0.rgmii0_txd0 */
+ {RGMII0_RXC, (M0 | PIN_INPUT | MANUAL_MODE)}, /* rgmii0_rxc.rgmii0_rxc */
+ {RGMII0_RXCTL, (M0 | PIN_INPUT | MANUAL_MODE)}, /* rgmii0_rxctl.rgmii0_rxctl */
+ {RGMII0_RXD3, (M0 | PIN_INPUT | MANUAL_MODE)}, /* rgmii0_rxd3.rgmii0_rxd3 */
+ {RGMII0_RXD2, (M0 | PIN_INPUT | MANUAL_MODE)}, /* rgmii0_rxd2.rgmii0_rxd2 */
+ {RGMII0_RXD1, (M0 | PIN_INPUT | MANUAL_MODE)}, /* rgmii0_rxd1.rgmii0_rxd1 */
+ {RGMII0_RXD0, (M0 | PIN_INPUT | MANUAL_MODE)}, /* rgmii0_rxd0.rgmii0_rxd0 */
+ {USB1_DRVVBUS, (M0 | PIN_INPUT_SLEW)}, /* usb1_drvvbus.usb1_drvvbus */
+ {USB2_DRVVBUS, (M0 | PIN_INPUT_SLEW)}, /* usb2_drvvbus.usb2_drvvbus */
+ {GPIO6_14, (M9 | PIN_INPUT_PULLUP)}, /* gpio6_14.i2c3_sda */
+ {GPIO6_15, (M9 | PIN_INPUT_PULLUP)}, /* gpio6_15.i2c3_scl */
+ {GPIO6_16, (M0 | PIN_INPUT_PULLUP)}, /* gpio6_16.gpio6_16 */
+ {XREF_CLK2, (M5 | PIN_INPUT_PULLDOWN)}, /* xref_clk2.atl_clk2 */
+ {MCASP1_ACLKX, (M14 | 0x00070000)}, /* mcasp1_aclkx.gpio7_31 */
+ {MCASP1_FSX, (M14 | PIN_INPUT | SLEWCONTROL)}, /* mcasp1_fsx.gpio7_30 */
+ {MCASP1_AXR0, (M10 | PIN_INPUT_PULLUP | SLEWCONTROL)}, /* mcasp1_axr0.i2c5_sda */
+ {MCASP1_AXR1, (M10 | 0x000f0000)}, /* mcasp1_axr1.i2c5_scl */
+ {MCASP1_AXR2, (M14 | PIN_INPUT_PULLDOWN)}, /* mcasp1_axr2.gpio5_4 */
+ {MCASP1_AXR3, (M14 | PIN_INPUT_PULLDOWN)}, /* mcasp1_axr3.gpio5_5 */
+ {MCASP1_AXR4, (M14 | PIN_INPUT_PULLDOWN)}, /* mcasp1_axr4.gpio5_6 */
+ {MCASP1_AXR5, (M14 | PIN_INPUT_PULLDOWN)}, /* mcasp1_axr5.gpio5_7 */
+ {MCASP1_AXR6, (M14 | PIN_INPUT_PULLDOWN)}, /* mcasp1_axr6.gpio5_8 */
+ {MCASP1_AXR7, (M14 | PIN_INPUT_PULLDOWN)}, /* mcasp1_axr7.gpio5_9 */
+ {MCASP1_AXR12, (M1 | PIN_INPUT_SLEW | VIRTUAL_MODE10)}, /* mcasp1_axr12.mcasp7_axr0 */
+ {MCASP1_AXR13, (M1 | PIN_INPUT_SLEW)}, /* mcasp1_axr13.mcasp7_axr1 */
+ {MCASP1_AXR14, (M1 | PIN_INPUT_SLEW | VIRTUAL_MODE10)}, /* mcasp1_axr14.mcasp7_aclkx */
+ {MCASP1_AXR15, (M1 | PIN_INPUT_SLEW | VIRTUAL_MODE10)}, /* mcasp1_axr15.mcasp7_fsx */
+ {MCASP2_ACLKR, (M15 | PIN_INPUT_PULLUP)}, /* mcasp2_aclkr.Driveroff */
+ {MCASP3_ACLKX, (M0 | PIN_INPUT_PULLDOWN)}, /* mcasp3_aclkx.mcasp3_aclkx */
+ {MCASP3_FSX, (M0 | PIN_INPUT_SLEW)}, /* mcasp3_fsx.mcasp3_fsx */
+ {MCASP3_AXR0, (M0 | PIN_INPUT_SLEW)}, /* mcasp3_axr0.mcasp3_axr0 */
+ {MCASP3_AXR1, (M0 | PIN_INPUT_SLEW | VIRTUAL_MODE6)}, /* mcasp3_axr1.mcasp3_axr1 */
+ {MMC1_CLK, (M0 | PIN_INPUT_PULLUP)}, /* mmc1_clk.mmc1_clk */
+ {MMC1_CMD, (M0 | PIN_INPUT_PULLUP)}, /* mmc1_cmd.mmc1_cmd */
+ {MMC1_DAT0, (M0 | PIN_INPUT_PULLUP)}, /* mmc1_dat0.mmc1_dat0 */
+ {MMC1_DAT1, (M0 | PIN_INPUT_PULLUP)}, /* mmc1_dat1.mmc1_dat1 */
+ {MMC1_DAT2, (M0 | PIN_INPUT_PULLUP)}, /* mmc1_dat2.mmc1_dat2 */
+ {MMC1_DAT3, (M0 | PIN_INPUT_PULLUP)}, /* mmc1_dat3.mmc1_dat3 */
+ {MMC1_SDCD, (M0 | PIN_INPUT_PULLUP | SLEWCONTROL)}, /* mmc1_sdcd.mmc1_sdcd */
+ {MMC1_SDWP, (M14 | PIN_INPUT_SLEW)}, /* mmc1_sdwp.gpio6_28 */
+ {SPI1_SCLK, (M0 | PIN_INPUT_PULLDOWN)}, /* spi1_sclk.spi1_sclk */
+ {SPI1_D1, (M0 | PIN_INPUT_PULLDOWN)}, /* spi1_d1.spi1_d1 */
+ {SPI1_D0, (M0 | PIN_INPUT_PULLDOWN)}, /* spi1_d0.spi1_d0 */
+ {SPI1_CS0, (M0 | PIN_INPUT_PULLUP)}, /* spi1_cs0.spi1_cs0 */
+ {SPI1_CS2, (M6 | 0x000f0000)}, /* spi1_cs2.hdmi1_hpd */
+ {SPI1_CS3, (M6 | 0x000f0000)}, /* spi1_cs3.hdmi1_cec */
+ {SPI2_SCLK, (M1 | PIN_INPUT_PULLDOWN)}, /* spi2_sclk.uart3_rxd */
+ {SPI2_D1, (M1 | PIN_INPUT_SLEW)}, /* spi2_d1.uart3_txd */
+ {SPI2_D0, (M1 | PIN_INPUT_SLEW)}, /* spi2_d0.uart3_ctsn */
+ {SPI2_CS0, (M1 | PIN_INPUT_PULLUP | SLEWCONTROL)}, /* spi2_cs0.uart3_rtsn */
+ {DCAN1_TX, (M0 | PIN_INPUT_PULLUP | SLEWCONTROL)}, /* dcan1_tx.dcan1_tx */
+ {DCAN1_RX, (M0 | PIN_INPUT_PULLUP | SLEWCONTROL)}, /* dcan1_rx.dcan1_rx */
+ {UART1_RXD, (M0 | PIN_INPUT_PULLUP | SLEWCONTROL)}, /* uart1_rxd.uart1_rxd */
+ {UART1_TXD, (M0 | PIN_INPUT_PULLUP | SLEWCONTROL)}, /* uart1_txd.uart1_txd */
+ {UART1_CTSN, (M3 | PIN_INPUT_PULLUP)}, /* uart1_ctsn.mmc4_clk */
+ {UART1_RTSN, (M3 | PIN_INPUT_PULLUP)}, /* uart1_rtsn.mmc4_cmd */
+ {UART2_RXD, (M3 | PIN_INPUT_PULLUP)}, /* N/A.mmc4_dat0 */
+ {UART2_TXD, (M3 | PIN_INPUT_PULLUP)}, /* uart2_txd.mmc4_dat1 */
+ {UART2_CTSN, (M3 | PIN_INPUT_PULLUP)}, /* uart2_ctsn.mmc4_dat2 */
+ {UART2_RTSN, (M3 | PIN_INPUT_PULLUP)}, /* uart2_rtsn.mmc4_dat3 */
+ {I2C2_SDA, (M1 | PIN_INPUT_PULLUP)}, /* i2c2_sda.hdmi1_ddc_scl */
+ {I2C2_SCL, (M1 | PIN_INPUT_PULLUP)}, /* i2c2_scl.hdmi1_ddc_sda */
+ {WAKEUP0, (M14 | PIN_OUTPUT)}, /* N/A.gpio1_0 */
+ {WAKEUP1, (M14 | PIN_OUTPUT)}, /* N/A.gpio1_1 */
+ {WAKEUP2, (M1 | PIN_OUTPUT)}, /* N/A.sys_nirq2 */
+ {WAKEUP3, (M1 | PIN_OUTPUT)}, /* N/A.sys_nirq1 */
+};
+
#ifdef CONFIG_IODELAY_RECALIBRATION
const struct iodelay_cfg_entry dra742_es1_1_iodelay_cfg_array[] = {
{0x06F0, 480, 0}, /* CFG_RGMII0_RXC_IN */
{0x0188, 590, 0}, /* CFG_GPMC_A18_OUT */
{0x0374, 0, 0}, /* CFG_GPMC_CS2_OUT */
};
+
+const struct iodelay_cfg_entry dra76x_es1_0_iodelay_cfg_array[] = {
+ {0x011C, 787, 0}, /* CFG_GPMC_A0_OUT */
+ {0x0128, 1181, 0}, /* CFG_GPMC_A10_OUT */
+ {0x0144, 0, 0}, /* CFG_GPMC_A13_IN */
+ {0x0150, 2149, 1052}, /* CFG_GPMC_A14_IN */
+ {0x015C, 2121, 997}, /* CFG_GPMC_A15_IN */
+ {0x0168, 2159, 1134}, /* CFG_GPMC_A16_IN */
+ {0x0170, 0, 0}, /* CFG_GPMC_A16_OUT */
+ {0x0174, 2135, 1085}, /* CFG_GPMC_A17_IN */
+ {0x0188, 0, 0}, /* CFG_GPMC_A18_OUT */
+ {0x01A0, 592, 0}, /* CFG_GPMC_A1_OUT */
+ {0x020C, 641, 0}, /* CFG_GPMC_A2_OUT */
+ {0x0218, 1481, 0}, /* CFG_GPMC_A3_OUT */
+ {0x0224, 1775, 0}, /* CFG_GPMC_A4_OUT */
+ {0x0230, 785, 0}, /* CFG_GPMC_A5_OUT */
+ {0x023C, 848, 0}, /* CFG_GPMC_A6_OUT */
+ {0x0248, 851, 0}, /* CFG_GPMC_A7_OUT */
+ {0x0254, 1783, 0}, /* CFG_GPMC_A8_OUT */
+ {0x0260, 951, 0}, /* CFG_GPMC_A9_OUT */
+ {0x026C, 1091, 0}, /* CFG_GPMC_AD0_OUT */
+ {0x0278, 1027, 0}, /* CFG_GPMC_AD10_OUT */
+ {0x0284, 824, 0}, /* CFG_GPMC_AD11_OUT */
+ {0x0290, 1196, 0}, /* CFG_GPMC_AD12_OUT */
+ {0x029C, 754, 0}, /* CFG_GPMC_AD13_OUT */
+ {0x02A8, 665, 0}, /* CFG_GPMC_AD14_OUT */
+ {0x02B4, 1027, 0}, /* CFG_GPMC_AD15_OUT */
+ {0x02C0, 937, 0}, /* CFG_GPMC_AD1_OUT */
+ {0x02CC, 1168, 0}, /* CFG_GPMC_AD2_OUT */
+ {0x02D8, 872, 0}, /* CFG_GPMC_AD3_OUT */
+ {0x02E4, 1092, 0}, /* CFG_GPMC_AD4_OUT */
+ {0x02F0, 576, 0}, /* CFG_GPMC_AD5_OUT */
+ {0x02FC, 1113, 0}, /* CFG_GPMC_AD6_OUT */
+ {0x0308, 943, 0}, /* CFG_GPMC_AD7_OUT */
+ {0x0314, 0, 0}, /* CFG_GPMC_AD8_OUT */
+ {0x0320, 0, 0}, /* CFG_GPMC_AD9_OUT */
+ {0x0374, 0, 0}, /* CFG_GPMC_CS2_OUT */
+ {0x0380, 1801, 948}, /* CFG_GPMC_CS3_OUT */
+ {0x06F0, 451, 0}, /* CFG_RGMII0_RXC_IN */
+ {0x06FC, 127, 1571}, /* CFG_RGMII0_RXCTL_IN */
+ {0x0708, 165, 1178}, /* CFG_RGMII0_RXD0_IN */
+ {0x0714, 136, 1302}, /* CFG_RGMII0_RXD1_IN */
+ {0x0720, 0, 1520}, /* CFG_RGMII0_RXD2_IN */
+ {0x072C, 28, 1690}, /* CFG_RGMII0_RXD3_IN */
+ {0x0740, 121, 0}, /* CFG_RGMII0_TXC_OUT */
+ {0x074C, 60, 0}, /* CFG_RGMII0_TXCTL_OUT */
+ {0x0758, 153, 0}, /* CFG_RGMII0_TXD0_OUT */
+ {0x0764, 35, 0}, /* CFG_RGMII0_TXD1_OUT */
+ {0x0770, 0, 0}, /* CFG_RGMII0_TXD2_OUT */
+ {0x077C, 172, 0}, /* CFG_RGMII0_TXD3_OUT */
+ {0x0A38, 0, 0}, /* CFG_VIN2A_CLK0_IN */
+ {0x0A44, 2180, 0}, /* CFG_VIN2A_D0_IN */
+ {0x0A50, 2297, 110}, /* CFG_VIN2A_D10_IN */
+ {0x0A5C, 1938, 0}, /* CFG_VIN2A_D11_IN */
+ {0x0A70, 147, 0}, /* CFG_VIN2A_D12_OUT */
+ {0x0A7C, 110, 0}, /* CFG_VIN2A_D13_OUT */
+ {0x0A88, 18, 0}, /* CFG_VIN2A_D14_OUT */
+ {0x0A94, 82, 0}, /* CFG_VIN2A_D15_OUT */
+ {0x0AA0, 33, 0}, /* CFG_VIN2A_D16_OUT */
+ {0x0AAC, 0, 0}, /* CFG_VIN2A_D17_OUT */
+ {0x0AB0, 417, 0}, /* CFG_VIN2A_D18_IN */
+ {0x0ABC, 156, 843}, /* CFG_VIN2A_D19_IN */
+ {0x0AC8, 2326, 309}, /* CFG_VIN2A_D1_IN */
+ {0x0AD4, 223, 1413}, /* CFG_VIN2A_D20_IN */
+ {0x0AE0, 169, 1415}, /* CFG_VIN2A_D21_IN */
+ {0x0AEC, 43, 1150}, /* CFG_VIN2A_D22_IN */
+ {0x0AF8, 0, 1210}, /* CFG_VIN2A_D23_IN */
+ {0x0B04, 2057, 0}, /* CFG_VIN2A_D2_IN */
+ {0x0B10, 2440, 257}, /* CFG_VIN2A_D3_IN */
+ {0x0B1C, 2142, 0}, /* CFG_VIN2A_D4_IN */
+ {0x0B28, 2455, 252}, /* CFG_VIN2A_D5_IN */
+ {0x0B34, 1883, 0}, /* CFG_VIN2A_D6_IN */
+ {0x0B40, 2229, 0}, /* CFG_VIN2A_D7_IN */
+ {0x0B4C, 2250, 151}, /* CFG_VIN2A_D8_IN */
+ {0x0B58, 2279, 27}, /* CFG_VIN2A_D9_IN */
+ {0x0B7C, 2233, 0}, /* CFG_VIN2A_HSYNC0_IN */
+ {0x0B88, 1936, 0}, /* CFG_VIN2A_VSYNC0_IN */
+ {0x0B9C, 1281, 497}, /* CFG_VOUT1_CLK_OUT */
+ {0x0BA8, 379, 0}, /* CFG_VOUT1_D0_OUT */
+ {0x0BB4, 441, 0}, /* CFG_VOUT1_D10_OUT */
+ {0x0BC0, 461, 0}, /* CFG_VOUT1_D11_OUT */
+ {0x0BCC, 1189, 0}, /* CFG_VOUT1_D12_OUT */
+ {0x0BD8, 312, 0}, /* CFG_VOUT1_D13_OUT */
+ {0x0BE4, 298, 0}, /* CFG_VOUT1_D14_OUT */
+ {0x0BF0, 284, 0}, /* CFG_VOUT1_D15_OUT */
+ {0x0BFC, 152, 0}, /* CFG_VOUT1_D16_OUT */
+ {0x0C08, 216, 0}, /* CFG_VOUT1_D17_OUT */
+ {0x0C14, 408, 0}, /* CFG_VOUT1_D18_OUT */
+ {0x0C20, 519, 0}, /* CFG_VOUT1_D19_OUT */
+ {0x0C2C, 475, 0}, /* CFG_VOUT1_D1_OUT */
+ {0x0C38, 316, 0}, /* CFG_VOUT1_D20_OUT */
+ {0x0C44, 59, 0}, /* CFG_VOUT1_D21_OUT */
+ {0x0C50, 221, 0}, /* CFG_VOUT1_D22_OUT */
+ {0x0C5C, 96, 0}, /* CFG_VOUT1_D23_OUT */
+ {0x0C68, 264, 0}, /* CFG_VOUT1_D2_OUT */
+ {0x0C74, 421, 0}, /* CFG_VOUT1_D3_OUT */
+ {0x0C80, 1257, 0}, /* CFG_VOUT1_D4_OUT */
+ {0x0C8C, 432, 0}, /* CFG_VOUT1_D5_OUT */
+ {0x0C98, 436, 0}, /* CFG_VOUT1_D6_OUT */
+ {0x0CA4, 440, 0}, /* CFG_VOUT1_D7_OUT */
+ {0x0CB0, 81, 100}, /* CFG_VOUT1_D8_OUT */
+ {0x0CBC, 471, 0}, /* CFG_VOUT1_D9_OUT */
+ {0x0CC8, 0, 0}, /* CFG_VOUT1_DE_OUT */
+ {0x0CE0, 0, 0}, /* CFG_VOUT1_HSYNC_OUT */
+ {0x0CEC, 815, 0}, /* CFG_VOUT1_VSYNC_OUT */
+};
#endif
#endif /* _MUX_DATA_DRA7XX_H_ */
#include <asm/arch/mmc_host_def.h>
#include <fdtdec.h>
#include <i2c.h>
+#include <remoteproc.h>
#include "mux-k2g.h"
#include "../common/board_detect.h"
return sizeof(eth_priv_cfg) / sizeof(struct eth_priv_t);
}
#endif
+
+#ifdef CONFIG_TI_SECURE_DEVICE
+void board_pmmc_image_process(ulong pmmc_image, size_t pmmc_size)
+{
+ int id = getenv_ulong("dev_pmmc", 10, 0);
+ int ret;
+
+ if (!rproc_is_initialized())
+ rproc_init();
+
+ ret = rproc_load(id, pmmc_image, pmmc_size);
+ printf("Load Remote Processor %d with data@addr=0x%08lx %u bytes:%s\n",
+ id, pmmc_image, pmmc_size, ret ? " Failed!" : " Success!");
+
+ if (!ret)
+ rproc_start(id);
+}
+
+U_BOOT_FIT_LOADABLE_HANDLER(IH_TYPE_PMMC, board_pmmc_image_process);
+#endif
#include <dm/platform_data/serial_mxc.h>
#include <dm/platdata.h>
#include <fsl_esdhc.h>
-#include <g_dnl.h>
#include <i2c.h>
#include <imx_thermal.h>
#include <linux/errno.h>
{
}
-#ifdef CONFIG_SPL_USB_GADGET_SUPPORT
-int g_dnl_bind_fixup(struct usb_device_descriptor *dev, const char *name)
-{
- unsigned short usb_pid;
-
- usb_pid = TORADEX_USB_PRODUCT_NUM_OFFSET + 0xfff;
- put_unaligned(usb_pid, &dev->idProduct);
-
- return 0;
-}
-#endif
-
#endif
static struct mxc_serial_platdata mxc_serial_plat = {
#include <dm/platform_data/serial_mxc.h>
#include <dm/platdata.h>
#include <fsl_esdhc.h>
-#include <g_dnl.h>
#include <i2c.h>
#include <imx_thermal.h>
#include <linux/errno.h>
{
}
-#ifdef CONFIG_SPL_USB_GADGET_SUPPORT
-int g_dnl_bind_fixup(struct usb_device_descriptor *dev, const char *name)
-{
- unsigned short usb_pid;
-
- usb_pid = TORADEX_USB_PRODUCT_NUM_OFFSET + 0xfff;
- put_unaligned(usb_pid, &dev->idProduct);
-
- return 0;
-}
-#endif
-
#endif
static struct mxc_serial_platdata mxc_serial_plat = {
IOMUXC_GPR_GPR1_GPR_ENET1_TX_CLK_SEL_MASK);
#endif
- return set_clk_enet(ENET_50MHz);
+ return set_clk_enet(ENET_50MHZ);
}
int board_phy_config(struct phy_device *phydev)
ret = -EIO;
goto out;
}
- /* Flush cache after read */
- flush_cache((ulong)(unsigned char *)config_block, 512);
} else {
/* Just writing one 512 byte block */
if (blk_dwrite(mmc_get_blk_desc(mmc), blk_start, 1,
/* DDR initialization */
spl_dram_init();
-
- /* Clear the BSS. */
- memset(__bss_start, 0, __bss_end - __bss_start);
-
- /* load/boot image from boot device */
- board_init_r(NULL, 0);
}
#endif
/* DDR initialization */
spl_dram_init();
-
- /* Clear the BSS. */
- memset(__bss_start, 0, __bss_end - __bss_start);
-
- /* load/boot image from boot device */
- board_init_r(NULL, 0);
}
#endif
ulong cnt = simple_strtoul(argv[4], NULL, 16);
ulong n;
- printf("\n%s read: device %d block # %lld, count %ld ... ",
- if_name, *cur_devnump, (unsigned long long)blk,
- cnt);
+ printf("\n%s read: device %d block # "LBAFU", count %lu ... ",
+ if_name, *cur_devnump, blk, cnt);
n = blk_read_devnum(if_type, *cur_devnump, blk, cnt,
(ulong *)addr);
ulong cnt = simple_strtoul(argv[4], NULL, 16);
ulong n;
- printf("\n%s write: device %d block # %lld, count %ld ... ",
- if_name, *cur_devnump, (unsigned long long)blk,
- cnt);
+ printf("\n%s write: device %d block # "LBAFU", count %lu ... ",
+ if_name, *cur_devnump, blk, cnt);
n = blk_write_devnum(if_type, *cur_devnump, blk, cnt,
(ulong *)addr);
if (!fdt_valid(&blob))
return CMD_RET_FAILURE;
- ret = fdt_overlay_apply(working_fdt, blob);
- if (ret) {
- printf("fdt_overlay_apply(): %s\n", fdt_strerror(ret));
+ /* apply method prints messages on error */
+ ret = fdt_overlay_apply_verbose(working_fdt, blob);
+ if (ret)
return CMD_RET_FAILURE;
- }
}
#endif
/* resize the fdt */
curr_device, blk, cnt);
n = blk_dread(mmc_get_blk_desc(mmc), blk, cnt, addr);
- /* flush cache after read */
- flush_cache((ulong)addr, cnt * 512); /* FIXME */
printf("%d blocks read: %s\n", n, (n == cnt) ? "OK" : "ERROR");
return (n == cnt) ? CMD_RET_SUCCESS : CMD_RET_FAILURE;
c = find_cmd_tbl(argv[1], &cmd_spl_export_sub[0],
ARRAY_SIZE(cmd_spl_export_sub));
- if ((c) && ((int)c->cmd <= SPL_EXPORT_LAST)) {
+ if ((c) && ((long)c->cmd <= SPL_EXPORT_LAST)) {
argc -= 2;
argv += 2;
- if (call_bootm(argc, argv, subcmd_list[(int)c->cmd]))
+ if (call_bootm(argc, argv, subcmd_list[(long)c->cmd]))
return -1;
- switch ((int)c->cmd) {
+ switch ((long)c->cmd) {
#ifdef CONFIG_OF_LIBFDT
case SPL_EXPORT_FDT:
printf("Argument image is now in RAM: 0x%p\n",
c = find_cmd_tbl(argv[1], &cmd_spl_sub[0], ARRAY_SIZE(cmd_spl_sub));
if (c) {
- cmd = (int)c->cmd;
+ cmd = (long)c->cmd;
switch (cmd) {
case SPL_EXPORT:
argc--;
unsigned long long tmp;
struct ubi_volume *vol;
loff_t offp = 0;
+ size_t len_read;
vol = ubi_find_volume(volume);
if (vol == NULL)
tmp = offp;
off = do_div(tmp, vol->usable_leb_size);
lnum = tmp;
+ len_read = size;
do {
if (off + len >= vol->usable_leb_size)
len = vol->usable_leb_size - off;
len = size > tbuf_size ? tbuf_size : size;
} while (size);
+ if (!size)
+ env_set_hex("filesize", len_read);
+
free(tbuf);
return err;
}
29,916,167 26,005,792 bootm_start
30,361,327 445,160 start_kernel
-config BOOTSTAGE_USER_COUNT
- int "Number of boot ID numbers available for user use"
- default 20
- help
- This is the number of available user bootstage records.
- Each time you call bootstage_mark(BOOTSTAGE_ID_ALLOC, ...)
- a new ID will be allocated from this stash. If you exceed
- the limit, recording will stop.
-
config BOOTSTAGE_RECORD_COUNT
int "Number of boot stage records to store"
default 30
This is the size of the bootstage record list and is the maximum
number of bootstage records that can be recorded.
+config SPL_BOOTSTAGE_RECORD_COUNT
+ int "Number of boot stage records to store for SPL"
+ default 5
+ help
+ This is the size of the bootstage record list and is the maximum
+ number of bootstage records that can be recorded.
+
config BOOTSTAGE_FDT
bool "Store boot timing information in the OS device tree"
depends on BOOTSTAGE
endif # !CONFIG_SPL_BUILD
-obj-$(CONFIG_$(SPL_)BOOTSTAGE) += bootstage.o
+obj-$(CONFIG_$(SPL_TPL_)BOOTSTAGE) += bootstage.o
ifdef CONFIG_SPL_BUILD
obj-$(CONFIG_SPL_DFU_SUPPORT) += dfu.o
* UART if available.
*/
gd->flags &= ~GD_FLG_SERIAL_READY;
+#ifdef CONFIG_TIMER
+ gd->timer = NULL;
+#endif
/*
* U-Boot has been copied into SDRAM, the BSS has been cleared etc.
DECLARE_GLOBAL_DATA_PTR;
enum {
- RECORD_COUNT = CONFIG_BOOTSTAGE_RECORD_COUNT,
+ RECORD_COUNT = CONFIG_VAL(BOOTSTAGE_RECORD_COUNT),
};
struct bootstage_record {
}
if (data->rec_count > RECORD_COUNT)
printf("Overflowed internal boot id table by %d entries\n"
- "- please increase CONFIG_BOOTSTAGE_RECORD_COUNT\n",
+ "Please increase CONFIG_(SPL_)BOOTSTAGE_RECORD_COUNT\n",
data->rec_count - RECORD_COUNT);
puts("\nAccumulated time:\n");
if (data->rec_count + hdr->count > RECORD_COUNT) {
debug("%s: Bootstage has %d records, we have space for %d\n"
- "- please increase CONFIG_BOOTSTAGE_USER_COUNT\n",
+ "Please increase CONFIG_(SPL_)BOOTSTAGE_RECORD_COUNT\n",
__func__, hdr->count, RECORD_COUNT - data->rec_count);
return -ENOSPC;
}
}
return toff;
}
+
+#ifdef CONFIG_OF_LIBFDT_OVERLAY
+/**
+ * fdt_overlay_apply_verbose - Apply an overlay with verbose error reporting
+ *
+ * @fdt: ptr to device tree
+ * @fdto: ptr to device tree overlay
+ *
+ * Convenience function to apply an overlay and display helpful messages
+ * in the case of an error
+ */
+int fdt_overlay_apply_verbose(void *fdt, void *fdto)
+{
+ int err;
+ bool has_symbols;
+
+ err = fdt_path_offset(fdt, "/__symbols__");
+ has_symbols = err >= 0;
+
+ err = fdt_overlay_apply(fdt, fdto);
+ if (err < 0) {
+ printf("failed on fdt_overlay_apply(): %s\n",
+ fdt_strerror(err));
+ if (!has_symbols) {
+ printf("base fdt does did not have a /__symbols__ node\n");
+ printf("make sure you've compiled with -@\n");
+ }
+ }
+ return err;
+}
+#endif
if (fit_check_format(buf)) {
ulong load, len;
- fdt_noffset = fit_image_load(images,
+ fdt_noffset = boot_get_fdt_fit(images,
fdt_addr, &fit_uname_fdt,
&fit_uname_config,
- arch, IH_TYPE_FLATDT,
- BOOTSTAGE_ID_FIT_FDT_START,
- FIT_LOAD_OPTIONAL, &load, &len);
+ arch, &load, &len);
images->fit_hdr_fdt = map_sysmem(fdt_addr, 0);
images->fit_uname_fdt = fit_uname_fdt;
images->fit_noffset_fdt = fdt_noffset;
fdt_addr = load;
+
break;
} else
#endif
#include <errno.h>
#include <mapmem.h>
#include <asm/io.h>
+#include <malloc.h>
DECLARE_GLOBAL_DATA_PTR;
#endif /* !USE_HOSTCC*/
printf("0x%08lx\n", load);
}
+ /* optional load address for FDT */
+ if (type == IH_TYPE_FLATDT && !fit_image_get_load(fit, image_noffset, &load))
+ printf("%s Load Address: 0x%08lx\n", p, load);
+
if ((type == IH_TYPE_KERNEL) || (type == IH_TYPE_STANDALONE) ||
(type == IH_TYPE_RAMDISK)) {
ret = fit_image_get_entry(fit, image_noffset, &entry);
{
int noffset, confs_noffset;
int len;
+ const char *s;
+ char *conf_uname_copy = NULL;
confs_noffset = fdt_path_offset(fit, FIT_CONFS_PATH);
if (confs_noffset < 0) {
debug("Found default configuration: '%s'\n", conf_uname);
}
+ s = strchr(conf_uname, '#');
+ if (s) {
+ len = s - conf_uname;
+ conf_uname_copy = malloc(len + 1);
+ if (!conf_uname_copy) {
+ debug("Can't allocate uname copy: '%s'\n",
+ conf_uname);
+ return -ENOMEM;
+ }
+ memcpy(conf_uname_copy, conf_uname, len);
+ conf_uname_copy[len] = '\0';
+ conf_uname = conf_uname_copy;
+ }
+
noffset = fdt_subnode_offset(fit, confs_noffset, conf_uname);
if (noffset < 0) {
debug("Can't get node offset for configuration unit name: '%s' (%s)\n",
conf_uname, fdt_strerror(noffset));
}
+ if (conf_uname_copy)
+ free(conf_uname_copy);
+
return noffset;
}
-int fit_conf_get_prop_node(const void *fit, int noffset,
+int fit_conf_get_prop_node_count(const void *fit, int noffset,
const char *prop_name)
{
- char *uname;
+ return fdt_stringlist_count(fit, noffset, prop_name);
+}
+
+int fit_conf_get_prop_node_index(const void *fit, int noffset,
+ const char *prop_name, int index)
+{
+ const char *uname;
int len;
/* get kernel image unit name from configuration kernel property */
- uname = (char *)fdt_getprop(fit, noffset, prop_name, &len);
+ uname = fdt_stringlist_get(fit, noffset, prop_name, index, &len);
if (uname == NULL)
return len;
return fit_image_get_node(fit, uname);
}
+int fit_conf_get_prop_node(const void *fit, int noffset,
+ const char *prop_name)
+{
+ return fit_conf_get_prop_node_index(fit, noffset, prop_name, 0);
+}
+
/**
* fit_conf_print - prints out the FIT configuration details
* @fit: pointer to the FIT format image header
char *desc;
const char *uname;
int ret;
- int loadables_index;
+ int fdt_index, loadables_index;
/* Mandatory properties */
ret = fit_get_desc(fit, noffset, &desc);
if (uname)
printf("%s Init Ramdisk: %s\n", p, uname);
- uname = fdt_getprop(fit, noffset, FIT_FDT_PROP, NULL);
- if (uname)
- printf("%s FDT: %s\n", p, uname);
+ for (fdt_index = 0;
+ uname = fdt_stringlist_get(fit, noffset, FIT_FDT_PROP,
+ fdt_index, NULL), uname;
+ fdt_index++) {
+
+ if (fdt_index == 0)
+ printf("%s FDT: ", p);
+ else
+ printf("%s ", p);
+ printf("%s\n", uname);
+ }
uname = fdt_getprop(fit, noffset, FIT_FPGA_PROP, NULL);
if (uname)
int cfg_noffset, noffset;
const char *fit_uname;
const char *fit_uname_config;
+ const char *fit_base_uname_config;
const void *fit;
const void *buf;
size_t size;
fit = map_sysmem(addr, 0);
fit_uname = fit_unamep ? *fit_unamep : NULL;
fit_uname_config = fit_uname_configp ? *fit_uname_configp : NULL;
+ fit_base_uname_config = NULL;
prop_name = fit_get_image_type_property(image_type);
printf("## Loading %s from FIT Image at %08lx ...\n", prop_name, addr);
BOOTSTAGE_SUB_NO_UNIT_NAME);
return -ENOENT;
}
- fit_uname_config = fdt_get_name(fit, cfg_noffset, NULL);
- printf(" Using '%s' configuration\n", fit_uname_config);
+ fit_base_uname_config = fdt_get_name(fit, cfg_noffset, NULL);
+ printf(" Using '%s' configuration\n", fit_base_uname_config);
if (image_type == IH_TYPE_KERNEL) {
/* Remember (and possibly verify) this config */
- images->fit_uname_cfg = fit_uname_config;
+ images->fit_uname_cfg = fit_base_uname_config;
if (IMAGE_ENABLE_VERIFY && images->verify) {
puts(" Verifying Hash Integrity ... ");
if (fit_config_verify(fit, cfg_noffset)) {
if (fit_unamep)
*fit_unamep = (char *)fit_uname;
if (fit_uname_configp)
- *fit_uname_configp = (char *)fit_uname_config;
+ *fit_uname_configp = (char *)(fit_uname_config ? :
+ fit_base_uname_config);
return noffset;
}
return ret;
}
+
+#ifndef USE_HOSTCC
+int boot_get_fdt_fit(bootm_headers_t *images, ulong addr,
+ const char **fit_unamep, const char **fit_uname_configp,
+ int arch, ulong *datap, ulong *lenp)
+{
+ int fdt_noffset, cfg_noffset, count;
+ const void *fit;
+ const char *fit_uname = NULL;
+ const char *fit_uname_config = NULL;
+ char *fit_uname_config_copy = NULL;
+ char *next_config = NULL;
+ ulong load, len;
+#ifdef CONFIG_OF_LIBFDT_OVERLAY
+ ulong image_start, image_end;
+ ulong ovload, ovlen;
+ const char *uconfig;
+ const char *uname;
+ void *base, *ov;
+ int i, err, noffset, ov_noffset;
+#endif
+
+ fit_uname = fit_unamep ? *fit_unamep : NULL;
+
+ if (fit_uname_configp && *fit_uname_configp) {
+ fit_uname_config_copy = strdup(*fit_uname_configp);
+ if (!fit_uname_config_copy)
+ return -ENOMEM;
+
+ next_config = strchr(fit_uname_config_copy, '#');
+ if (next_config)
+ *next_config++ = '\0';
+ if (next_config - 1 > fit_uname_config_copy)
+ fit_uname_config = fit_uname_config_copy;
+ }
+
+ fdt_noffset = fit_image_load(images,
+ addr, &fit_uname, &fit_uname_config,
+ arch, IH_TYPE_FLATDT,
+ BOOTSTAGE_ID_FIT_FDT_START,
+ FIT_LOAD_OPTIONAL, &load, &len);
+
+ if (fdt_noffset < 0)
+ goto out;
+
+ debug("fit_uname=%s, fit_uname_config=%s\n",
+ fit_uname ? fit_uname : "<NULL>",
+ fit_uname_config ? fit_uname_config : "<NULL>");
+
+ fit = map_sysmem(addr, 0);
+
+ cfg_noffset = fit_conf_get_node(fit, fit_uname_config);
+
+ /* single blob, or error just return as well */
+ count = fit_conf_get_prop_node_count(fit, cfg_noffset, FIT_FDT_PROP);
+ if (count <= 1 && !next_config)
+ goto out;
+
+ /* we need to apply overlays */
+
+#ifdef CONFIG_OF_LIBFDT_OVERLAY
+ image_start = addr;
+ image_end = addr + fit_get_size(fit);
+ /* verify that relocation took place by load address not being in fit */
+ if (load >= image_start && load < image_end) {
+ /* check is simplified; fit load checks for overlaps */
+ printf("Overlayed FDT requires relocation\n");
+ fdt_noffset = -EBADF;
+ goto out;
+ }
+
+ base = map_sysmem(load, len);
+
+ /* apply extra configs in FIT first, followed by args */
+ for (i = 1; ; i++) {
+ if (i < count) {
+ noffset = fit_conf_get_prop_node_index(fit, cfg_noffset,
+ FIT_FDT_PROP, i);
+ uname = fit_get_name(fit, noffset, NULL);
+ uconfig = NULL;
+ } else {
+ if (!next_config)
+ break;
+ uconfig = next_config;
+ next_config = strchr(next_config, '#');
+ if (next_config)
+ *next_config++ = '\0';
+ uname = NULL;
+ }
+
+ debug("%d: using uname=%s uconfig=%s\n", i, uname, uconfig);
+
+ ov_noffset = fit_image_load(images,
+ addr, &uname, &uconfig,
+ arch, IH_TYPE_FLATDT,
+ BOOTSTAGE_ID_FIT_FDT_START,
+ FIT_LOAD_REQUIRED, &ovload, &ovlen);
+ if (ov_noffset < 0) {
+ printf("load of %s failed\n", uname);
+ continue;
+ }
+ debug("%s loaded at 0x%08lx len=0x%08lx\n",
+ uname, ovload, ovlen);
+ ov = map_sysmem(ovload, ovlen);
+
+ base = map_sysmem(load, len + ovlen);
+ err = fdt_open_into(base, base, len + ovlen);
+ if (err < 0) {
+ printf("failed on fdt_open_into\n");
+ fdt_noffset = err;
+ goto out;
+ }
+ /* the verbose method prints out messages on error */
+ err = fdt_overlay_apply_verbose(base, ov);
+ if (err < 0) {
+ fdt_noffset = err;
+ goto out;
+ }
+ fdt_pack(base);
+ len = fdt_totalsize(base);
+ }
+#else
+ printf("config with overlays but CONFIG_OF_LIBFDT_OVERLAY not set\n");
+ fdt_noffset = -EBADF;
+#endif
+
+out:
+ if (datap)
+ *datap = load;
+ if (lenp)
+ *lenp = len;
+ if (fit_unamep)
+ *fit_unamep = fit_uname;
+ if (fit_uname_configp)
+ *fit_uname_configp = fit_uname_config;
+
+ if (fit_uname_config_copy)
+ free(fit_uname_config_copy);
+ return fdt_noffset;
+}
+#endif
{ IH_TYPE_FPGA, "fpga", "FPGA Image" },
{ IH_TYPE_TEE, "tee", "Trusted Execution Environment Image",},
{ IH_TYPE_FIRMWARE_IVT, "firmware_ivt", "Firmware with HABv4 IVT" },
+ { IH_TYPE_PMMC, "pmmc", "TI Power Management Micro-Controller Firmware",},
{ -1, "", "", },
};
spl_image->load_addr, spl_image->size);
#else
/* LEGACY image not supported */
- debug("Legacy boot image support not enabled, proceeding to other boot methods");
+ debug("Legacy boot image support not enabled, proceeding to other boot methods\n");
return -EINVAL;
#endif
} else {
spl_set_header_raw_uboot(spl_image);
#else
/* RAW image not supported, proceed to other boot methods. */
- debug("Raw boot image support not enabled, proceeding to other boot methods");
+ debug("Raw boot image support not enabled, proceeding to other boot methods\n");
return -EINVAL;
#endif
}
#include <libfdt.h>
#include <spl.h>
+#ifndef CONFIG_SYS_BOOTM_LEN
+#define CONFIG_SYS_BOOTM_LEN (64 << 20)
+#endif
+
/**
* spl_fit_get_image_node(): By using the matching configuration subnode,
* retrieve the name of an image, specified by a property name and an index
void *fit, ulong base_offset, int node,
struct spl_image_info *image_info)
{
- ulong offset;
+ int offset;
size_t length;
+ int len;
ulong load_addr, load_ptr;
void *src;
ulong overhead;
int nr_sectors;
int align_len = ARCH_DMA_MINALIGN - 1;
+ uint8_t image_comp = -1, type = -1;
+ const void *data;
+
+ if (IS_ENABLED(CONFIG_SPL_OS_BOOT) && IS_ENABLED(CONFIG_SPL_GZIP)) {
+ if (fit_image_get_comp(fit, node, &image_comp))
+ puts("Cannot get image compression format.\n");
+ else
+ debug("%s ", genimg_get_comp_name(image_comp));
+
+ if (fit_image_get_type(fit, node, &type))
+ puts("Cannot get image type.\n");
+ else
+ debug("%s ", genimg_get_type_name(type));
+ }
- offset = fdt_getprop_u32(fit, node, "data-offset");
- if (offset == FDT_ERROR)
- return -ENOENT;
- offset += base_offset;
- length = fdt_getprop_u32(fit, node, "data-size");
- if (length == FDT_ERROR)
- return -ENOENT;
- load_addr = fdt_getprop_u32(fit, node, "load");
- if (load_addr == FDT_ERROR && image_info)
+ if (fit_image_get_load(fit, node, &load_addr))
load_addr = image_info->load_addr;
- load_ptr = (load_addr + align_len) & ~align_len;
-
- overhead = get_aligned_image_overhead(info, offset);
- nr_sectors = get_aligned_image_size(info, length, offset);
- if (info->read(info, sector + get_aligned_image_offset(info, offset),
- nr_sectors, (void*)load_ptr) != nr_sectors)
- return -EIO;
- debug("image: dst=%lx, offset=%lx, size=%lx\n", load_ptr, offset,
- (unsigned long)length);
+ if (!fit_image_get_data_offset(fit, node, &offset)) {
+ /* External data */
+ offset += base_offset;
+ if (fit_image_get_data_size(fit, node, &len))
+ return -ENOENT;
+
+ load_ptr = (load_addr + align_len) & ~align_len;
+ length = len;
+
+ overhead = get_aligned_image_overhead(info, offset);
+ nr_sectors = get_aligned_image_size(info, length, offset);
+
+ if (info->read(info,
+ sector + get_aligned_image_offset(info, offset),
+ nr_sectors, (void *)load_ptr) != nr_sectors)
+ return -EIO;
+
+ debug("External data: dst=%lx, offset=%x, size=%lx\n",
+ load_ptr, offset, (unsigned long)length);
+ src = (void *)load_ptr + overhead;
+ } else {
+ /* Embedded data */
+ if (fit_image_get_data(fit, node, &data, &length)) {
+ puts("Cannot get image data/size\n");
+ return -ENOENT;
+ }
+ debug("Embedded data: dst=%lx, size=%lx\n", load_addr,
+ (unsigned long)length);
+ src = (void *)data;
+ }
- src = (void *)load_ptr + overhead;
#ifdef CONFIG_SPL_FIT_IMAGE_POST_PROCESS
board_fit_image_post_process(&src, &length);
#endif
- memcpy((void*)load_addr, src, length);
+ if (IS_ENABLED(CONFIG_SPL_OS_BOOT) &&
+ IS_ENABLED(CONFIG_SPL_GZIP) &&
+ image_comp == IH_COMP_GZIP &&
+ type == IH_TYPE_KERNEL) {
+ if (gunzip((void *)load_addr, CONFIG_SYS_BOOTM_LEN,
+ src, &length)) {
+ puts("Uncompressing error\n");
+ return -EIO;
+ }
+ } else {
+ memcpy((void *)load_addr, src, length);
+ }
if (image_info) {
image_info->load_addr = load_addr;
ulong size;
unsigned long count;
struct spl_image_info image_info;
- int node, images, ret;
+ bool boot_os = false;
+ int node = -1;
+ int images, ret;
int base_offset, align_len = ARCH_DMA_MINALIGN - 1;
int index = 0;
/*
- * Figure out where the external images start. This is the base for the
- * data-offset properties in each image.
+ * For FIT with external data, figure out where the external images
+ * start. This is the base for the data-offset properties in each
+ * image.
*/
size = fdt_totalsize(fit);
size = (size + 3) & ~3;
*
* In fact the FIT has its own load address, but we assume it cannot
* be before CONFIG_SYS_TEXT_BASE.
+ *
+ * For FIT with data embedded, data is loaded as part of FIT image.
+ * For FIT with external data, data is not loaded in this step.
*/
fit = (void *)((CONFIG_SYS_TEXT_BASE - size - info->bl_len -
align_len) & ~align_len);
return -1;
}
+#ifdef CONFIG_SPL_OS_BOOT
+ /* Find OS image first */
+ node = spl_fit_get_image_node(fit, images, FIT_KERNEL_PROP, 0);
+ if (node < 0)
+ debug("No kernel image.\n");
+ else
+ boot_os = true;
+#endif
/* find the U-Boot image */
- node = spl_fit_get_image_node(fit, images, "firmware", 0);
+ if (node < 0)
+ node = spl_fit_get_image_node(fit, images, "firmware", 0);
if (node < 0) {
debug("could not find firmware image, trying loadables...\n");
node = spl_fit_get_image_node(fit, images, "loadables", 0);
if (ret)
return ret;
+#ifdef CONFIG_SPL_OS_BOOT
+ if (!fit_image_get_os(fit, node, &spl_image->os))
+ debug("Image OS is %s\n", genimg_get_os_name(spl_image->os));
+#else
spl_image->os = IH_OS_U_BOOT;
+#endif
- /* Figure out which device tree the board wants to use */
- node = spl_fit_get_image_node(fit, images, FIT_FDT_PROP, 0);
- if (node < 0) {
- debug("%s: cannot find FDT node\n", __func__);
- return node;
- }
+ if (!boot_os) {
+ /* Figure out which device tree the board wants to use */
+ node = spl_fit_get_image_node(fit, images, FIT_FDT_PROP, 0);
+ if (node < 0) {
+ debug("%s: cannot find FDT node\n", __func__);
+ return node;
+ }
- /*
- * Read the device tree and place it after the image.
- * Align the destination address to ARCH_DMA_MINALIGN.
- */
- image_info.load_addr = spl_image->load_addr + spl_image->size;
- ret = spl_load_fit_image(info, sector, fit, base_offset, node,
- &image_info);
- if (ret < 0)
- return ret;
+ /*
+ * Read the device tree and place it after the image.
+ * Align the destination address to ARCH_DMA_MINALIGN.
+ */
+ image_info.load_addr = spl_image->load_addr + spl_image->size;
+ ret = spl_load_fit_image(info, sector, fit, base_offset, node,
+ &image_info);
+ if (ret < 0)
+ return ret;
+ }
/* Now check if there are more images for us to load */
for (; ; index++) {
CONFIG_BOOTDELAY=3
CONFIG_SYS_PROMPT="NDS32 # "
CONFIG_CMD_MMC=y
+CONFIG_CMD_SF=y
+CONFIG_CMD_SF_TEST=y
# CONFIG_CMD_SETEXPR is not set
CONFIG_CMD_DHCP=y
CONFIG_CMD_PING=y
CONFIG_CMD_EXT2=y
CONFIG_CMD_FAT=y
CONFIG_OF_CONTROL=y
-CONFIG_ENV_IS_IN_FLASH=y
+CONFIG_ENV_IS_IN_SPI_FLASH=y
CONFIG_NET_RANDOM_ETHADDR=y
CONFIG_DM=y
+CONFIG_CLK=y
CONFIG_MMC=y
CONFIG_MTD=y
CONFIG_MTD_NOR_FLASH=y
CONFIG_CFI_FLASH=y
+CONFIG_DM_SPI_FLASH=y
+CONFIG_SPI_FLASH=y
+CONFIG_SPI_FLASH_MACRONIX=y
CONFIG_DM_ETH=y
CONFIG_FTMAC100=y
CONFIG_BAUDRATE=38400
CONFIG_DM_SERIAL=y
CONFIG_SYS_NS16550=y
+CONFIG_DM_SPI=y
+CONFIG_NDS_AE3XX_SPI=y
CONFIG_TIMER=y
CONFIG_AE3XX_TIMER=y
CONFIG_SYS_TEXT_BASE=0x80100000
# CONFIG_SPL_GPIO_SUPPORT is not set
CONFIG_TARGET_AM3517_CRANE=y
+CONFIG_EMIF4=y
CONFIG_BOOTDELAY=10
CONFIG_SPL=y
# CONFIG_SPL_EXT_SUPPORT is not set
# CONFIG_SYS_THUMB_BUILD is not set
CONFIG_ARCH_OMAP2PLUS=y
CONFIG_SYS_TEXT_BASE=0x80100000
+CONFIG_TI_COMMON_CMD_OPTIONS=y
# CONFIG_SPL_GPIO_SUPPORT is not set
CONFIG_TARGET_AM3517_EVM=y
+CONFIG_EMIF4=y
CONFIG_BOOTDELAY=10
CONFIG_VERSION_VARIABLE=y
CONFIG_SPL=y
CONFIG_SPL_MTD_SUPPORT=y
CONFIG_HUSH_PARSER=y
CONFIG_SYS_PROMPT="AM3517_EVM # "
-CONFIG_CMD_BOOTZ=y
# CONFIG_CMD_IMI is not set
# CONFIG_CMD_IMLS is not set
-CONFIG_CMD_ASKENV=y
+# CONFIG_CMD_EEPROM is not set
# CONFIG_CMD_FLASH is not set
# CONFIG_CMD_FPGA is not set
-CONFIG_CMD_GPIO=y
-CONFIG_CMD_I2C=y
-CONFIG_CMD_MMC=y
+# CONFIG_CMD_GPT is not set
CONFIG_CMD_NAND=y
-CONFIG_CMD_PART=y
-CONFIG_CMD_USB=y
+# CONFIG_CMD_SPI is not set
# CONFIG_CMD_SETEXPR is not set
-CONFIG_CMD_DHCP=y
-CONFIG_CMD_PING=y
+# CONFIG_CMD_MII is not set
CONFIG_CMD_CACHE=y
-CONFIG_CMD_EXT2=y
-CONFIG_CMD_EXT4=y
-CONFIG_CMD_EXT4_WRITE=y
-CONFIG_CMD_FAT=y
-CONFIG_CMD_FS_GENERIC=y
+# CONFIG_CMD_TIME is not set
CONFIG_CMD_UBI=y
CONFIG_SPL_PARTITION_UUIDS=y
CONFIG_ENV_IS_IN_NAND=y
CONFIG_USB=y
CONFIG_USB_MUSB_HOST=y
CONFIG_USB_STORAGE=y
+# CONFIG_FAT_WRITE is not set
CONFIG_BCH=y
CONFIG_OF_LIBFDT=y
CONFIG_ISO_PARTITION=y
CONFIG_OF_CONTROL=y
CONFIG_SPL_OF_CONTROL=y
-CONFIG_OF_LIST="am57xx-beagle-x15 am57xx-beagle-x15-revb1 am572x-idk am571x-idk"
+CONFIG_OF_LIST="am57xx-beagle-x15 am57xx-beagle-x15-revb1 am57xx-beagle-x15-revc am572x-idk am571x-idk"
CONFIG_ENV_IS_IN_MMC=y
CONFIG_DM=y
CONFIG_SPL_DM=y
CONFIG_ISO_PARTITION=y
CONFIG_OF_CONTROL=y
CONFIG_SPL_OF_CONTROL=y
-CONFIG_OF_LIST="am57xx-beagle-x15 am57xx-beagle-x15-revb1 am572x-idk am571x-idk"
+CONFIG_OF_LIST="am57xx-beagle-x15 am57xx-beagle-x15-revb1 am57xx-beagle-x15-revc am572x-idk am571x-idk"
CONFIG_ENV_IS_IN_MMC=y
CONFIG_DM=y
CONFIG_SPL_DM=y
CONFIG_SYS_MALLOC_F_LEN=0x2000
CONFIG_DEFAULT_DEVICE_TREE="at91sam9m10g45ek"
CONFIG_DEBUG_UART=y
-CONFIG_SYS_EXTRA_OPTIONS="AT91SAM9M10G45,SYS_USE_MMC"
+CONFIG_SD_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 mtdparts=atmel_nand:8M(bootstrap/uboot/kernel)ro,-(rootfs) root=/dev/mmcblk0p2 rw rootwait"
CONFIG_SYS_MALLOC_F_LEN=0x2000
CONFIG_DEFAULT_DEVICE_TREE="at91sam9m10g45ek"
CONFIG_DEBUG_UART=y
-CONFIG_SYS_EXTRA_OPTIONS="AT91SAM9M10G45,SYS_USE_NANDFLASH"
+CONFIG_NAND_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk mtdparts=atmel_nand:256k(bootstrap)ro,512k(uboot)ro,256k(env),256k(env_redundant),256k(spare),512k(dtb),6M(kernel)ro,-(rootfs) root=/dev/mtdblock7 rw rootfstype=jffs2"
CONFIG_SYS_MALLOC_F_LEN=0x2000
CONFIG_DEFAULT_DEVICE_TREE="at91sam9n12ek"
CONFIG_DEBUG_UART=y
-CONFIG_SYS_EXTRA_OPTIONS="AT91SAM9N12,SYS_USE_MMC"
+CONFIG_SD_BOOT=y
CONFIG_BOOTDELAY=3
# CONFIG_CONSOLE_MUX is not set
CONFIG_SYS_CONSOLE_IS_IN_ENV=y
CONFIG_SYS_MALLOC_F_LEN=0x2000
CONFIG_DEFAULT_DEVICE_TREE="at91sam9n12ek"
CONFIG_DEBUG_UART=y
-CONFIG_SYS_EXTRA_OPTIONS="AT91SAM9N12,SYS_USE_NANDFLASH"
+CONFIG_NAND_BOOT=y
CONFIG_BOOTDELAY=3
# CONFIG_CONSOLE_MUX is not set
CONFIG_SYS_CONSOLE_IS_IN_ENV=y
CONFIG_SYS_MALLOC_F_LEN=0x2000
CONFIG_DEFAULT_DEVICE_TREE="at91sam9n12ek"
CONFIG_DEBUG_UART=y
-CONFIG_SYS_EXTRA_OPTIONS="AT91SAM9N12,SYS_USE_SPIFLASH"
+CONFIG_SPI_BOOT=y
CONFIG_BOOTDELAY=3
# CONFIG_CONSOLE_MUX is not set
CONFIG_SYS_CONSOLE_IS_IN_ENV=y
CONFIG_SYS_MALLOC_F_LEN=0x2000
CONFIG_DEFAULT_DEVICE_TREE="at91sam9g35ek"
CONFIG_DEBUG_UART=y
-CONFIG_SYS_EXTRA_OPTIONS="AT91SAM9X5,SYS_USE_DATAFLASH"
+CONFIG_SYS_EXTRA_OPTIONS="SYS_USE_DATAFLASH"
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk mtdparts=atmel_nand:256k(bootstrap)ro,512k(uboot)ro,256k(env),256k(env_redundant),256k(spare),512k(dtb),6M(kernel)ro,-(rootfs) rootfstype=ubifs ubi.mtd=7 root=ubi0:rootfs rw"
CONFIG_SYS_MALLOC_F_LEN=0x2000
CONFIG_DEFAULT_DEVICE_TREE="at91sam9g35ek"
CONFIG_DEBUG_UART=y
-CONFIG_SYS_EXTRA_OPTIONS="AT91SAM9X5,SYS_USE_MMC"
+CONFIG_SD_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="mem=128M console=ttyS0,115200 mtdparts=atmel_nand:8M(bootstrap/uboot/kernel)ro,-(rootfs) root=/dev/mmcblk0p2 rw rootfstype=ext4 rootwait"
CONFIG_SYS_MALLOC_F_LEN=0x2000
CONFIG_DEFAULT_DEVICE_TREE="at91sam9g35ek"
CONFIG_DEBUG_UART=y
-CONFIG_SYS_EXTRA_OPTIONS="AT91SAM9X5,SYS_USE_NANDFLASH"
+CONFIG_NAND_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk mtdparts=atmel_nand:256k(bootstrap)ro,512k(uboot)ro,256k(env),256k(env_redundant),256k(spare),512k(dtb),6M(kernel)ro,-(rootfs) rootfstype=ubifs ubi.mtd=7 root=ubi0:rootfs rw"
CONFIG_SYS_MALLOC_F_LEN=0x2000
CONFIG_DEFAULT_DEVICE_TREE="at91sam9g35ek"
CONFIG_DEBUG_UART=y
-CONFIG_SYS_EXTRA_OPTIONS="AT91SAM9X5,SYS_USE_SPIFLASH"
+CONFIG_SPI_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk mtdparts=atmel_nand:256k(bootstrap)ro,512k(uboot)ro,256k(env),256k(env_redundant),256k(spare),512k(dtb),6M(kernel)ro,-(rootfs) rootfstype=ubifs ubi.mtd=7 root=ubi0:rootfs rw"
--- /dev/null
+CONFIG_X86=y
+CONFIG_VENDOR_INTEL=y
+CONFIG_DEFAULT_DEVICE_TREE="cherryhill"
+CONFIG_TARGET_CHERRYHILL=y
+CONFIG_DEBUG_UART=y
+CONFIG_SMP=y
+CONFIG_GENERATE_MP_TABLE=y
+CONFIG_SYS_CONSOLE_INFO_QUIET=y
+CONFIG_HUSH_PARSER=y
+CONFIG_CMD_CPU=y
+# CONFIG_CMD_IMLS is not set
+# CONFIG_CMD_FLASH is not set
+CONFIG_CMD_MMC=y
+CONFIG_CMD_SF=y
+CONFIG_CMD_SPI=y
+CONFIG_CMD_USB=y
+# CONFIG_CMD_SETEXPR is not set
+CONFIG_CMD_DHCP=y
+# CONFIG_CMD_NFS is not set
+CONFIG_CMD_PING=y
+CONFIG_CMD_TIME=y
+CONFIG_CMD_EXT2=y
+CONFIG_CMD_EXT4=y
+CONFIG_CMD_EXT4_WRITE=y
+CONFIG_CMD_FAT=y
+CONFIG_CMD_FS_GENERIC=y
+CONFIG_ISO_PARTITION=y
+CONFIG_EFI_PARTITION=y
+CONFIG_REGMAP=y
+CONFIG_SYSCON=y
+CONFIG_CPU=y
+CONFIG_RTL8169=y
+CONFIG_DEBUG_UART_BASE=0x3f8
+CONFIG_DEBUG_UART_CLOCK=1843200
+CONFIG_USB_STORAGE=y
+CONFIG_USB_KEYBOARD=y
CONFIG_DEBUG_UART_BOARD_INIT=y
CONFIG_SYS_NS16550=y
CONFIG_SPL_TIMER=y
+CONFIG_TIMER_EARLY=y
CONFIG_TPM_TIS_LPC=y
CONFIG_USB_STORAGE=y
CONFIG_USB_KEYBOARD=y
CONFIG_DEBUG_UART_CLOCK=1843200
CONFIG_DEBUG_UART_BOARD_INIT=y
CONFIG_SYS_NS16550=y
+CONFIG_TIMER_EARLY=y
CONFIG_TPM_TIS_LPC=y
CONFIG_USB_STORAGE=y
CONFIG_USB_KEYBOARD=y
CONFIG_ARCH_OMAP2PLUS=y
CONFIG_SYS_TEXT_BASE=0x80008000
CONFIG_TARGET_CM_T3517=y
+CONFIG_EMIF4=y
CONFIG_BOOTDELAY=3
# CONFIG_CONSOLE_MUX is not set
CONFIG_SYS_CONSOLE_IS_IN_ENV=y
CONFIG_ARM=y
CONFIG_ARCH_DAVINCI=y
CONFIG_TARGET_DA850EVM=y
+CONFIG_TI_COMMON_CMD_OPTIONS=y
+CONFIG_MAC_ADDR_IN_EEPROM=y
CONFIG_SPL_LIBCOMMON_SUPPORT=y
CONFIG_SPL_LIBGENERIC_SUPPORT=y
CONFIG_SPL_SERIAL_SUPPORT=y
CONFIG_SPL_SPI_FLASH_SUPPORT=y
CONFIG_SPL_SPI_SUPPORT=y
-CONFIG_SYS_EXTRA_OPTIONS="DA850_AM18X_EVM,MAC_ADDR_IN_EEPROM,SYS_I2C_EEPROM_ADDR_LEN=2,SYS_I2C_EEPROM_ADDR=0x50"
+CONFIG_SYS_EXTRA_OPTIONS="DA850_AM18X_EVM,SYS_I2C_EEPROM_ADDR_LEN=2,SYS_I2C_EEPROM_ADDR=0x50"
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="mem=32M console=ttyS2,115200n8 root=/dev/mtdblock2 rw noinitrd ip=dhcp"
CONFIG_SPL=y
CONFIG_SPL_BOARD_INIT=y
CONFIG_HUSH_PARSER=y
+# CONFIG_CMD_BOOTZ is not set
# CONFIG_CMD_IMLS is not set
-CONFIG_CMD_ASKENV=y
CONFIG_CRC32_VERIFY=y
+# CONFIG_CMD_EEPROM is not set
# CONFIG_CMD_FLASH is not set
-CONFIG_CMD_MMC=y
-CONFIG_CMD_SF=y
-CONFIG_CMD_SPI=y
+# CONFIG_CMD_GPIO is not set
+# CONFIG_CMD_GPT is not set
+# CONFIG_CMD_I2C is not set
+# CONFIG_CMD_PART is not set
# CONFIG_CMD_SETEXPR is not set
-CONFIG_CMD_DHCP=y
-CONFIG_CMD_MII=y
-CONFIG_CMD_PING=y
-CONFIG_CMD_EXT2=y
-CONFIG_CMD_FAT=y
+# CONFIG_CMD_TIME is not set
+# CONFIG_CMD_EXT4 is not set
+# CONFIG_CMD_FS_GENERIC is not set
CONFIG_CMD_DIAG=y
CONFIG_ENV_IS_IN_SPI_FLASH=y
CONFIG_SPI_FLASH=y
CONFIG_SPI_FLASH_STMICRO=y
CONFIG_SPI_FLASH_WINBOND=y
CONFIG_SYS_NS16550=y
+# CONFIG_FAT_WRITE is not set
CONFIG_OF_LIBFDT=y
CONFIG_ARM=y
CONFIG_ARCH_DAVINCI=y
CONFIG_TARGET_DA850EVM=y
+CONFIG_TI_COMMON_CMD_OPTIONS=y
CONFIG_SPL_LIBCOMMON_SUPPORT=y
CONFIG_SPL_LIBGENERIC_SUPPORT=y
CONFIG_SPL_SERIAL_SUPPORT=y
CONFIG_SPL_SPI_FLASH_SUPPORT=y
CONFIG_SPL_SPI_SUPPORT=y
-CONFIG_SYS_EXTRA_OPTIONS="MAC_ADDR_IN_SPIFLASH"
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="mem=32M console=ttyS2,115200n8 root=/dev/mtdblock2 rw noinitrd ip=dhcp"
CONFIG_SPL_BOARD_INIT=y
CONFIG_HUSH_PARSER=y
CONFIG_SYS_PROMPT="U-Boot > "
-CONFIG_CMD_BOOTZ=y
# CONFIG_CMD_IMLS is not set
-CONFIG_CMD_ASKENV=y
CONFIG_CRC32_VERIFY=y
+# CONFIG_CMD_EEPROM is not set
# CONFIG_CMD_FLASH is not set
-CONFIG_CMD_MMC=y
-CONFIG_CMD_SF=y
-CONFIG_CMD_SPI=y
+# CONFIG_CMD_GPIO is not set
+# CONFIG_CMD_GPT is not set
+# CONFIG_CMD_I2C is not set
+# CONFIG_CMD_PART is not set
# CONFIG_CMD_SETEXPR is not set
-CONFIG_CMD_DHCP=y
-CONFIG_CMD_MII=y
-CONFIG_CMD_PING=y
-CONFIG_CMD_EXT2=y
-CONFIG_CMD_FAT=y
+# CONFIG_CMD_TIME is not set
+# CONFIG_CMD_EXT4 is not set
+# CONFIG_CMD_FS_GENERIC is not set
CONFIG_CMD_DIAG=y
CONFIG_ENV_IS_IN_SPI_FLASH=y
CONFIG_SPI_FLASH=y
CONFIG_SPI_FLASH_STMICRO=y
CONFIG_SPI_FLASH_WINBOND=y
CONFIG_SYS_NS16550=y
+# CONFIG_FAT_WRITE is not set
CONFIG_OF_LIBFDT=y
CONFIG_ARM=y
CONFIG_ARCH_DAVINCI=y
CONFIG_TARGET_DA850EVM=y
-CONFIG_SYS_EXTRA_OPTIONS="MAC_ADDR_IN_SPIFLASH,USE_NOR,DIRECT_NOR_BOOT"
+CONFIG_TI_COMMON_CMD_OPTIONS=y
+CONFIG_SYS_EXTRA_OPTIONS="USE_NOR,DIRECT_NOR_BOOT"
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="mem=32M console=ttyS2,115200n8 root=/dev/mtdblock2 rw noinitrd ip=dhcp"
CONFIG_BOARD_EARLY_INIT_F=y
CONFIG_HUSH_PARSER=y
CONFIG_SYS_PROMPT="U-Boot > "
-CONFIG_CMD_ASKENV=y
+# CONFIG_CMD_BOOTZ is not set
CONFIG_CRC32_VERIFY=y
-CONFIG_CMD_SF=y
+# CONFIG_CMD_EEPROM is not set
+# CONFIG_CMD_GPIO is not set
+# CONFIG_CMD_GPT is not set
+# CONFIG_CMD_I2C is not set
+# CONFIG_CMD_MMC is not set
+# CONFIG_CMD_PART is not set
+# CONFIG_CMD_SPI is not set
# CONFIG_CMD_SETEXPR is not set
-CONFIG_CMD_DHCP=y
-CONFIG_CMD_MII=y
-CONFIG_CMD_PING=y
+# CONFIG_CMD_TIME is not set
+# CONFIG_CMD_EXT2 is not set
+# CONFIG_CMD_EXT4 is not set
+# CONFIG_CMD_FAT is not set
+# CONFIG_CMD_FS_GENERIC is not set
CONFIG_CMD_DIAG=y
CONFIG_ENV_IS_IN_FLASH=y
# CONFIG_MMC is not set
CONFIG_ISO_PARTITION=y
CONFIG_OF_CONTROL=y
CONFIG_SPL_OF_CONTROL=y
-CONFIG_OF_LIST="dra7-evm dra72-evm dra72-evm-revc dra71-evm"
+CONFIG_OF_LIST="dra7-evm dra72-evm dra72-evm-revc dra71-evm dra76-evm"
CONFIG_ENV_IS_IN_MMC=y
CONFIG_DM=y
CONFIG_SPL_DM=y
CONFIG_ISO_PARTITION=y
CONFIG_OF_CONTROL=y
CONFIG_SPL_OF_CONTROL=y
-CONFIG_OF_LIST="dra7-evm dra72-evm dra72-evm-revc dra71-evm"
+CONFIG_OF_LIST="dra7-evm dra72-evm dra72-evm-revc dra71-evm dra76-evm"
CONFIG_ENV_IS_IN_MMC=y
CONFIG_DM=y
CONFIG_SPL_DM=y
CONFIG_ARCH_OMAP2PLUS=y
CONFIG_SYS_TEXT_BASE=0x80008000
CONFIG_TARGET_ECO5PK=y
+CONFIG_EMIF4=y
CONFIG_BOOTDELAY=10
CONFIG_SPL=y
# CONFIG_SPL_EXT_SUPPORT is not set
CONFIG_DEFAULT_DEVICE_TREE="rv1108-evb"
CONFIG_DEBUG_UART=y
# CONFIG_DISPLAY_CPUINFO is not set
+CONFIG_FASTBOOT=y
+CONFIG_USB_FUNCTION_FASTBOOT=y
+CONFIG_CMD_FASTBOOT=y
+CONFIG_FASTBOOT_BUF_ADDR=0x62000000
+CONFIG_FASTBOOT_BUF_SIZE=0x08000000
+CONFIG_FASTBOOT_FLASH=y
+CONFIG_FASTBOOT_FLASH_MMC_DEV=1
# CONFIG_CMD_IMLS is not set
CONFIG_CMD_SF=y
+CONFIG_CMD_USB=y
# CONFIG_CMD_SETEXPR is not set
CONFIG_CMD_CACHE=y
CONFIG_CMD_TIME=y
CONFIG_GMAC_ROCKCHIP=y
CONFIG_PINCTRL=y
CONFIG_PINCTRL_ROCKCHIP_RV1108=y
+CONFIG_DM_REGULATOR_FIXED=y
CONFIG_BAUDRATE=1500000
# CONFIG_SPL_SERIAL_PRESENT is not set
CONFIG_DEBUG_UART_BASE=0x10210000
CONFIG_DEBUG_UART_SHIFT=2
CONFIG_SYSRESET=y
CONFIG_USB=y
+CONFIG_USB_EHCI_HCD=y
+CONFIG_USB_EHCI_GENERIC=y
+CONFIG_USB_OHCI_HCD=y
+CONFIG_USB_OHCI_GENERIC=y
+CONFIG_USB_DWC2=y
+CONFIG_USB_STORAGE=y
+CONFIG_USB_GADGET=y
+CONFIG_USB_GADGET_DWC2_OTG=y
+CONFIG_USB_GADGET_DOWNLOAD=y
+CONFIG_G_DNL_MANUFACTURER="Rockchip"
+CONFIG_G_DNL_VENDOR_NUM=0x2207
+CONFIG_G_DNL_PRODUCT_NUM=0x110a
CONFIG_ERRNO_STR=y
CONFIG_FIT_VERBOSE=y
CONFIG_SPL_LOAD_FIT=y
CONFIG_SPL_FIT_SOURCE="board/theobroma-systems/lion_rk3368/fit_spl_atf.its"
+CONFIG_BOOTSTAGE=y
+CONFIG_SPL_BOOTSTAGE=y
+CONFIG_BOOTSTAGE_REPORT=y
+CONFIG_BOOTSTAGE_FDT=y
+CONFIG_ENV_IS_IN_MMC=y
# CONFIG_DISPLAY_CPUINFO is not set
CONFIG_ARCH_EARLY_INIT_R=y
CONFIG_SPL=y
CONFIG_CMD_GPIO=y
CONFIG_CMD_MMC=y
CONFIG_CMD_SF=y
+CONFIG_CMD_BOOTSTAGE=y
CONFIG_CMD_REGULATOR=y
CONFIG_CMD_MTDPARTS=y
CONFIG_SPL_OF_CONTROL=y
CONFIG_TPL_OF_CONTROL=y
+CONFIG_OF_LIVE=y
CONFIG_OF_SPL_REMOVE_PROPS="pinctrl-0 pinctrl-names interrupt-parent"
CONFIG_TPL_OF_PLATDATA=y
CONFIG_ENV_IS_IN_MMC=y
--- /dev/null
+CONFIG_ARM=y
+CONFIG_TARGET_LS1088AQDS=y
+# CONFIG_SYS_MALLOC_F is not set
+CONFIG_DM_SPI=y
+CONFIG_DM_SPI_FLASH=y
+CONFIG_DEFAULT_DEVICE_TREE="fsl-ls1088a-qds"
+CONFIG_FIT=y
+CONFIG_FIT_VERBOSE=y
+CONFIG_OF_BOARD_SETUP=y
+CONFIG_OF_STDOUT_VIA_ALIAS=y
+CONFIG_SYS_EXTRA_OPTIONS="SYS_FSL_DDR4, QSPI_BOOT"
+CONFIG_HUSH_PARSER=y
+CONFIG_CMD_MMC=y
+CONFIG_CMD_SF=y
+CONFIG_CMD_I2C=y
+# CONFIG_CMD_SETEXPR is not set
+CONFIG_CMD_DHCP=y
+CONFIG_CMD_PING=y
+CONFIG_OF_CONTROL=y
+CONFIG_NET_RANDOM_ETHADDR=y
+CONFIG_DM=y
+CONFIG_SPI_FLASH=y
+CONFIG_NETDEVICES=y
+CONFIG_E1000=y
+CONFIG_PCI=y
+CONFIG_DM_PCI=y
+CONFIG_DM_PCI_COMPAT=y
+CONFIG_PCIE_LAYERSCAPE=y
+CONFIG_SYS_NS16550=y
+CONFIG_FSL_DSPI=y
+CONFIG_EFI_LOADER_BOUNCE_BUFFER=y
+# CONFIG_DISPLAY_BOARDINFO is not set
+CONFIG_FSL_LS_PPA=y
--- /dev/null
+CONFIG_ARM=y
+CONFIG_TARGET_LS1088ARDB=y
+# CONFIG_SYS_MALLOC_F is not set
+CONFIG_DM_SPI=y
+CONFIG_DM_SPI_FLASH=y
+CONFIG_DEFAULT_DEVICE_TREE="fsl-ls1088a-rdb"
+CONFIG_FIT=y
+CONFIG_FIT_VERBOSE=y
+CONFIG_OF_BOARD_SETUP=y
+CONFIG_OF_STDOUT_VIA_ALIAS=y
+CONFIG_SYS_EXTRA_OPTIONS="SYS_FSL_DDR4, QSPI_BOOT"
+CONFIG_HUSH_PARSER=y
+CONFIG_CMD_MMC=y
+CONFIG_CMD_SF=y
+CONFIG_CMD_I2C=y
+# CONFIG_CMD_SETEXPR is not set
+CONFIG_CMD_DHCP=y
+CONFIG_CMD_PING=y
+CONFIG_OF_CONTROL=y
+CONFIG_NET_RANDOM_ETHADDR=y
+CONFIG_DM=y
+CONFIG_SPI_FLASH=y
+CONFIG_NETDEVICES=y
+CONFIG_E1000=y
+CONFIG_PCI=y
+CONFIG_DM_PCI=y
+CONFIG_DM_PCI_COMPAT=y
+CONFIG_PCIE_LAYERSCAPE=y
+CONFIG_SYS_NS16550=y
+CONFIG_FSL_DSPI=y
+CONFIG_EFI_LOADER_BOUNCE_BUFFER=y
+# CONFIG_DISPLAY_BOARDINFO is not set
+CONFIG_FSL_LS_PPA=y
--- /dev/null
+CONFIG_ARM=y
+CONFIG_TARGET_LS2080ARDB=y
+CONFIG_FSL_LS_PPA=y
+CONFIG_QSPI_AHB_INIT=y
+CONFIG_DEFAULT_DEVICE_TREE="fsl-ls2088a-rdb-qspi"
+# CONFIG_SYS_MALLOC_F is not set
+CONFIG_FIT_VERBOSE=y
+CONFIG_OF_BOARD_SETUP=y
+CONFIG_OF_STDOUT_VIA_ALIAS=y
+CONFIG_QSPI_BOOT=y
+CONFIG_ENV_IS_IN_SPI_FLASH=y
+CONFIG_BOOTDELAY=10
+# CONFIG_CMD_IMLS is not set
+CONFIG_CMD_GREPENV=y
+CONFIG_CMD_GPT=y
+CONFIG_CMD_MMC=y
+CONFIG_CMD_SF=y
+CONFIG_CMD_I2C=y
+CONFIG_CMD_USB=y
+# CONFIG_CMD_SETEXPR is not set
+CONFIG_CMD_CACHE=y
+CONFIG_OF_CONTROL=y
+CONFIG_NET_RANDOM_ETHADDR=y
+CONFIG_DM=y
+CONFIG_FSL_CAAM=y
+CONFIG_DM_SPI_FLASH=y
+CONFIG_PHYLIB=y
+CONFIG_NETDEVICES=y
+CONFIG_PHY_GIGE=y
+CONFIG_E1000=y
+CONFIG_PCI=y
+CONFIG_DM_PCI=y
+CONFIG_DM_PCI_COMPAT=y
+CONFIG_PCIE_LAYERSCAPE=y
+CONFIG_SYS_NS16550=y
+CONFIG_DM_SPI=y
+CONFIG_FSL_DSPI=y
+CONFIG_FSL_QSPI=y
+CONFIG_USB=y
+CONFIG_DM_USB=y
+CONFIG_USB_XHCI_HCD=y
+CONFIG_USB_XHCI_DWC3=y
+CONFIG_USB_STORAGE=y
+CONFIG_EFI_LOADER_BOUNCE_BUFFER=y
+CONFIG_DISTRO_DEFAULTS=y
+CONFIG_SECURE_BOOT=y
+CONFIG_RSA=y
+CONFIG_RSA_SOFTWARE_EXP=y
CONFIG_SPL_SPI_FLASH_SUPPORT=y
CONFIG_SPL_SPI_SUPPORT=y
CONFIG_FIT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D4"
+CONFIG_SYS_EXTRA_OPTIONS=""
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS3,115200"
CONFIG_SYS_TEXT_BASE=0x80008000
# CONFIG_SPL_GPIO_SUPPORT is not set
CONFIG_TARGET_MCX=y
+CONFIG_EMIF4=y
CONFIG_VIDEO=y
CONFIG_BOOTDELAY=3
# CONFIG_CONSOLE_MUX is not set
CONFIG_ARCH_OMAP2PLUS=y
CONFIG_SYS_TEXT_BASE=0x80008000
CONFIG_TARGET_MT_VENTOUX=y
+CONFIG_EMIF4=y
CONFIG_VIDEO=y
CONFIG_BOOTDELAY=10
# CONFIG_CONSOLE_MUX is not set
CONFIG_SPL_EXT_SUPPORT=y
CONFIG_SPL_I2C_SUPPORT=y
CONFIG_SPL_OS_BOOT=y
+CONFIG_SPL_USB_HOST_SUPPORT=y
+CONFIG_SPL_USB_GADGET_SUPPORT=y
+CONFIG_SPL_USB_SDP_SUPPORT=y
CONFIG_HUSH_PARSER=y
CONFIG_CMD_BOOTZ=y
# CONFIG_CMD_IMLS is not set
CONFIG_CMD_PCI=y
CONFIG_CMD_SF=y
CONFIG_CMD_USB=y
+CONFIG_CMD_USB_SDP=y
CONFIG_CMD_DHCP=y
CONFIG_CMD_MII=y
CONFIG_CMD_PING=y
# CONFIG_CMD_FPGA is not set
CONFIG_CMD_NAND=y
CONFIG_CMD_NAND_LOCK_UNLOCK=y
-# CONFIG_CMD_USB is not set
CONFIG_CMD_CACHE=y
CONFIG_CMD_UBI=y
CONFIG_ISO_PARTITION=y
CONFIG_SYS_NS16550=y
CONFIG_OMAP3_SPI=y
CONFIG_USB=y
+CONFIG_USB_EHCI_HCD=y
CONFIG_USB_MUSB_GADGET=y
+CONFIG_USB_STORAGE=y
CONFIG_USB_GADGET=y
CONFIG_USB_GADGET_DOWNLOAD=y
CONFIG_G_DNL_MANUFACTURER="TI"
CONFIG_CMD_PMIC=y
CONFIG_CMD_REGULATOR=y
CONFIG_SPL_OF_CONTROL=y
+CONFIG_OF_LIVE=y
CONFIG_OF_SPL_REMOVE_PROPS="pinctrl-0 pinctrl-names interrupt-parent assigned-clocks assigned-clock-rates assigned-clock-parents"
CONFIG_ENV_IS_IN_MMC=y
CONFIG_REGMAP=y
--- /dev/null
+CONFIG_ARM=y
+CONFIG_ARCH_AT91=y
+CONFIG_TARGET_SAMA5D27_SOM1_EK=y
+CONFIG_SPL_GPIO_SUPPORT=y
+CONFIG_SPL_LIBCOMMON_SUPPORT=y
+CONFIG_SPL_LIBGENERIC_SUPPORT=y
+CONFIG_SYS_MALLOC_F_LEN=0x2000
+CONFIG_SPL_MMC_SUPPORT=y
+CONFIG_SPL_SERIAL_SUPPORT=y
+CONFIG_SPL_DRIVERS_MISC_SUPPORT=y
+CONFIG_SPL_LIBDISK_SUPPORT=y
+CONFIG_SPL_FAT_SUPPORT=y
+CONFIG_DEFAULT_DEVICE_TREE="at91-sama5d27_som1_ek"
+CONFIG_DEBUG_UART=y
+CONFIG_FIT=y
+CONFIG_SYS_EXTRA_OPTIONS="SAMA5D2"
+CONFIG_SD_BOOT=y
+CONFIG_BOOTDELAY=3
+# CONFIG_DISPLAY_BOARDINFO is not set
+CONFIG_SPL=y
+CONFIG_SPL_SEPARATE_BSS=y
+CONFIG_HUSH_PARSER=y
+CONFIG_CMD_BOOTZ=y
+# CONFIG_CMD_IMI is not set
+# CONFIG_CMD_IMLS is not set
+# CONFIG_CMD_FLASH is not set
+# CONFIG_CMD_FPGA is not set
+CONFIG_CMD_I2C=y
+# CONFIG_CMD_LOADS is not set
+CONFIG_CMD_MMC=y
+CONFIG_CMD_SF=y
+CONFIG_CMD_USB=y
+CONFIG_CMD_DHCP=y
+CONFIG_CMD_PING=y
+CONFIG_CMD_EXT4=y
+CONFIG_CMD_FAT=y
+CONFIG_OF_CONTROL=y
+CONFIG_SPL_OF_CONTROL=y
+CONFIG_OF_SPL_REMOVE_PROPS="interrupts interrupt-parent dmas dma-names"
+CONFIG_ENV_IS_IN_FAT=y
+CONFIG_DM=y
+CONFIG_SPL_DM=y
+CONFIG_SPL_DM_SEQ_ALIAS=y
+CONFIG_CLK=y
+CONFIG_SPL_CLK=y
+CONFIG_CLK_AT91=y
+CONFIG_AT91_UTMI=y
+CONFIG_AT91_H32MX=y
+CONFIG_AT91_GENERIC_CLK=y
+CONFIG_DM_GPIO=y
+CONFIG_ATMEL_PIO4=y
+CONFIG_DM_I2C=y
+CONFIG_SYS_I2C_AT91=y
+CONFIG_I2C_EEPROM=y
+CONFIG_DM_MMC=y
+CONFIG_MMC_SDHCI=y
+CONFIG_MMC_SDHCI_ATMEL=y
+CONFIG_DM_SPI_FLASH=y
+CONFIG_SPI_FLASH=y
+CONFIG_SPI_FLASH_ATMEL=y
+CONFIG_SPI_FLASH_MACRONIX=y
+CONFIG_SPI_FLASH_STMICRO=y
+CONFIG_SPI_FLASH_SST=y
+CONFIG_DM_ETH=y
+CONFIG_MACB=y
+CONFIG_PINCTRL=y
+CONFIG_SPL_PINCTRL=y
+CONFIG_PINCTRL_AT91PIO4=y
+CONFIG_DM_SERIAL=y
+CONFIG_DEBUG_UART_ATMEL=y
+CONFIG_DEBUG_UART_BASE=0xf8020000
+CONFIG_DEBUG_UART_CLOCK=82000000
+CONFIG_DEBUG_UART_BOARD_INIT=y
+CONFIG_DEBUG_UART_ANNOUNCE=y
+CONFIG_ATMEL_USART=y
+CONFIG_DM_SPI=y
+CONFIG_ATMEL_SPI=y
+CONFIG_TIMER=y
+CONFIG_SPL_TIMER=y
+CONFIG_ATMEL_PIT_TIMER=y
+CONFIG_USB=y
+CONFIG_DM_USB=y
+CONFIG_USB_EHCI_HCD=y
+CONFIG_USB_STORAGE=y
+CONFIG_USB_GADGET=y
+CONFIG_USB_GADGET_ATMEL_USBA=y
+CONFIG_DM_VIDEO=y
+CONFIG_ATMEL_HLCD=y
CONFIG_SPL_LIBGENERIC_SUPPORT=y
CONFIG_SPL_SERIAL_SUPPORT=y
CONFIG_SPL_NAND_SUPPORT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D2,SYS_USE_NANDFLASH"
+CONFIG_NAND_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,57600 earlyprintk mtdparts=atmel_nand:6M(bootstrap)ro, 6M(kernel)ro,-(rootfs) rootfstype=ubifs ubi.mtd=2 root=ubi0:rootfs"
CONFIG_SPL_SERIAL_SUPPORT=y
CONFIG_SPL_SPI_FLASH_SUPPORT=y
CONFIG_SPL_SPI_SUPPORT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D2,SYS_USE_SERIALFLASH"
+CONFIG_SPI_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,57600 earlyprintk mtdparts=atmel_nand:6M(bootstrap)ro, 6M(kernel)ro,-(rootfs) rootfstype=ubifs ubi.mtd=2 root=ubi0:rootfs"
CONFIG_DEBUG_UART=y
CONFIG_FIT=y
CONFIG_SYS_EXTRA_OPTIONS="SAMA5D2,SYS_USE_MMC"
+CONFIG_SD_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk root=/dev/mmcblk1p2 rw rootwait"
CONFIG_ATMEL_PIO4=y
CONFIG_DM_I2C=y
CONFIG_SYS_I2C_AT91=y
+CONFIG_I2C_EEPROM=y
CONFIG_DM_MMC=y
CONFIG_MMC_SDHCI=y
CONFIG_MMC_SDHCI_ATMEL=y
CONFIG_DEFAULT_DEVICE_TREE="at91-sama5d2_xplained"
CONFIG_DEBUG_UART=y
CONFIG_FIT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D2,SYS_USE_SERIALFLASH"
+CONFIG_SPI_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk mtdparts=atmel_nand:256k(bootstrap)ro,512k(uboot)ro,256K(env),256k(env_redundant),256k(spare),512k(dtb),6M(kernel)ro,-(rootfs) rootfstype=ubifs ubi.mtd=7 root=ubi0:rootfs"
CONFIG_ATMEL_PIO4=y
CONFIG_DM_I2C=y
CONFIG_SYS_I2C_AT91=y
+CONFIG_I2C_EEPROM=y
CONFIG_DM_MMC=y
CONFIG_MMC_SDHCI=y
CONFIG_MMC_SDHCI_ATMEL=y
CONFIG_DEFAULT_DEVICE_TREE="sama5d36ek_cmp"
CONFIG_DEBUG_UART=y
CONFIG_FIT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D3,SYS_USE_MMC"
+CONFIG_SD_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk root=/dev/mmcblk0p2 rw rootwait"
CONFIG_DEFAULT_DEVICE_TREE="sama5d36ek_cmp"
CONFIG_DEBUG_UART=y
CONFIG_FIT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D3,SYS_USE_NANDFLASH"
+CONFIG_NAND_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk mtdparts=atmel_nand:256k(bootstrap)ro,512k(uboot)ro,256K(env),256k(env_redundant),256k(spare),512k(dtb),6M(kernel)ro,-(rootfs) rootfstype=ubifs ubi.mtd=7 root=ubi0:rootfs"
CONFIG_DEFAULT_DEVICE_TREE="sama5d36ek_cmp"
CONFIG_DEBUG_UART=y
CONFIG_FIT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D3,SYS_USE_SERIALFLASH"
+CONFIG_SPI_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk mtdparts=atmel_nand:256k(bootstrap)ro,512k(uboot)ro,256K(env),256k(env_redundant),256k(spare),512k(dtb),6M(kernel)ro,-(rootfs) rootfstype=ubifs ubi.mtd=7 root=ubi0:rootfs"
CONFIG_DEFAULT_DEVICE_TREE="at91-sama5d3_xplained"
CONFIG_DEBUG_UART=y
CONFIG_FIT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D3,SYS_USE_MMC"
+CONFIG_SD_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk root=/dev/mmcblk0p2 rw rootwait"
CONFIG_DEFAULT_DEVICE_TREE="at91-sama5d3_xplained"
CONFIG_DEBUG_UART=y
CONFIG_FIT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D3,SYS_USE_NANDFLASH"
+CONFIG_NAND_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk mtdparts=atmel_nand:256k(bootstrap)ro,512k(uboot)ro,256K(env),256k(env_redundant),256k(spare),512k(dtb),6M(kernel)ro,-(rootfs) rootfstype=ubifs ubi.mtd=7 root=ubi0:rootfs"
CONFIG_DEFAULT_DEVICE_TREE="sama5d36ek"
CONFIG_DEBUG_UART=y
CONFIG_FIT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D3,SYS_USE_MMC"
+CONFIG_SD_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk root=/dev/mmcblk0p2 rw rootwait"
CONFIG_DEFAULT_DEVICE_TREE="sama5d36ek"
CONFIG_DEBUG_UART=y
CONFIG_FIT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D3,SYS_USE_NANDFLASH"
+CONFIG_NAND_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk mtdparts=atmel_nand:256k(bootstrap)ro,512k(uboot)ro,256K(env),256k(env_redundant),256k(spare),512k(dtb),6M(kernel)ro,-(rootfs) rootfstype=ubifs ubi.mtd=7 root=ubi0:rootfs"
CONFIG_DEFAULT_DEVICE_TREE="sama5d36ek"
CONFIG_DEBUG_UART=y
CONFIG_FIT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D3,SYS_USE_SERIALFLASH"
+CONFIG_SPI_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk mtdparts=atmel_nand:256k(bootstrap)ro,512k(uboot)ro,256K(env),256k(env_redundant),256k(spare),512k(dtb),6M(kernel)ro,-(rootfs) rootfstype=ubifs ubi.mtd=7 root=ubi0:rootfs"
CONFIG_DEFAULT_DEVICE_TREE="at91-sama5d4_xplained"
CONFIG_DEBUG_UART=y
CONFIG_FIT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D4,SYS_USE_MMC"
+CONFIG_SD_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk root=/dev/mmcblk0p2 rw rootwait"
CONFIG_AT91_H32MX=y
CONFIG_DM_GPIO=y
CONFIG_AT91_GPIO=y
+CONFIG_DM_I2C=y
+CONFIG_SYS_I2C_AT91=y
+CONFIG_I2C_EEPROM=y
CONFIG_DM_MMC=y
CONFIG_GENERIC_ATMEL_MCI=y
CONFIG_DM_SPI_FLASH=y
CONFIG_DEFAULT_DEVICE_TREE="at91-sama5d4_xplained"
CONFIG_DEBUG_UART=y
CONFIG_FIT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D4,SYS_USE_NANDFLASH"
+CONFIG_NAND_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk mtdparts=atmel_nand:256k(bootstrap)ro,512k(uboot)ro,256K(env),256k(env_redundant),256k(spare),512k(dtb),6M(kernel)ro,-(rootfs) rootfstype=ubifs ubi.mtd=7 root=ubi0:rootfs"
CONFIG_AT91_H32MX=y
CONFIG_DM_GPIO=y
CONFIG_AT91_GPIO=y
+CONFIG_DM_I2C=y
+CONFIG_SYS_I2C_AT91=y
+CONFIG_I2C_EEPROM=y
CONFIG_DM_MMC=y
CONFIG_GENERIC_ATMEL_MCI=y
CONFIG_DM_SPI_FLASH=y
CONFIG_DEFAULT_DEVICE_TREE="at91-sama5d4_xplained"
CONFIG_DEBUG_UART=y
CONFIG_FIT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D4,SYS_USE_SERIALFLASH"
+CONFIG_SPI_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk mtdparts=atmel_nand:256k(bootstrap)ro,512k(uboot)ro,256K(env),256k(env_redundant),256k(spare),512k(dtb),6M(kernel)ro,-(rootfs) rootfstype=ubifs ubi.mtd=7 root=ubi0:rootfs"
CONFIG_AT91_H32MX=y
CONFIG_DM_GPIO=y
CONFIG_AT91_GPIO=y
+CONFIG_DM_I2C=y
+CONFIG_SYS_I2C_AT91=y
+CONFIG_I2C_EEPROM=y
CONFIG_DM_MMC=y
CONFIG_GENERIC_ATMEL_MCI=y
CONFIG_DM_SPI_FLASH=y
CONFIG_DEFAULT_DEVICE_TREE="at91-sama5d4ek"
CONFIG_DEBUG_UART=y
CONFIG_FIT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D4,SYS_USE_MMC"
+CONFIG_SD_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk root=/dev/mmcblk0p2 rw rootwait"
CONFIG_DEFAULT_DEVICE_TREE="at91-sama5d4ek"
CONFIG_DEBUG_UART=y
CONFIG_FIT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D4,SYS_USE_NANDFLASH"
+CONFIG_NAND_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk mtdparts=atmel_nand:256k(bootstrap)ro,512k(uboot)ro,256K(env),256k(env_redundant),256k(spare),512k(dtb),6M(kernel)ro,-(rootfs) rootfstype=ubifs ubi.mtd=7 root=ubi0:rootfs"
CONFIG_DEFAULT_DEVICE_TREE="at91-sama5d4ek"
CONFIG_DEBUG_UART=y
CONFIG_FIT=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D4,SYS_USE_SERIALFLASH"
+CONFIG_SPI_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk mtdparts=atmel_nand:256k(bootstrap)ro,512k(uboot)ro,256K(env),256k(env_redundant),256k(spare),512k(dtb),6M(kernel)ro,-(rootfs) rootfstype=ubifs ubi.mtd=7 root=ubi0:rootfs"
CONFIG_FIT_VERBOSE=y
CONFIG_BOOTSTAGE=y
CONFIG_BOOTSTAGE_REPORT=y
-CONFIG_BOOTSTAGE_USER_COUNT=32
CONFIG_BOOTSTAGE_FDT=y
CONFIG_BOOTSTAGE_STASH=y
CONFIG_BOOTSTAGE_STASH_ADDR=0x0
CONFIG_CMD_DEMO=y
CONFIG_CMD_GPIO=y
CONFIG_CMD_GPT=y
+CONFIG_CMD_GPT_RENAME=y
CONFIG_CMD_IDE=y
CONFIG_CMD_I2C=y
CONFIG_CMD_PCI=y
CONFIG_TPM=y
CONFIG_LZ4=y
CONFIG_ERRNO_STR=y
+CONFIG_OF_LIBFDT_OVERLAY=y
CONFIG_UNIT_TEST=y
CONFIG_UT_TIME=y
CONFIG_UT_DM=y
CONFIG_UT_ENV=y
+CONFIG_UT_OVERLAY=y
CONFIG_FIT_VERBOSE=y
CONFIG_BOOTSTAGE=y
CONFIG_BOOTSTAGE_REPORT=y
-CONFIG_BOOTSTAGE_USER_COUNT=32
CONFIG_BOOTSTAGE_FDT=y
CONFIG_BOOTSTAGE_STASH=y
CONFIG_BOOTSTAGE_STASH_ADDR=0x0
CONFIG_FIT_VERBOSE=y
CONFIG_BOOTSTAGE=y
CONFIG_BOOTSTAGE_REPORT=y
-CONFIG_BOOTSTAGE_USER_COUNT=32
CONFIG_BOOTSTAGE_FDT=y
CONFIG_BOOTSTAGE_STASH=y
CONFIG_BOOTSTAGE_STASH_ADDR=0x0
CONFIG_SPL_LOAD_FIT=y
CONFIG_BOOTSTAGE=y
CONFIG_BOOTSTAGE_REPORT=y
-CONFIG_BOOTSTAGE_USER_COUNT=32
CONFIG_BOOTSTAGE_FDT=y
CONFIG_BOOTSTAGE_STASH=y
CONFIG_BOOTSTAGE_STASH_ADDR=0x0
CONFIG_ARCH_ROCKCHIP=y
CONFIG_SYS_MALLOC_F_LEN=0x1000
CONFIG_ROCKCHIP_RK3368=y
+CONFIG_TARGET_SHEEP=y
CONFIG_DEFAULT_DEVICE_TREE="rk3368-sheep"
CONFIG_DEBUG_UART=y
CONFIG_ANDROID_BOOT_IMAGE=y
CONFIG_MMC_DW=y
CONFIG_MMC_DW_ROCKCHIP=y
CONFIG_PINCTRL=y
+CONFIG_PINCTRL_ROCKCHIP_RK3368=y
CONFIG_RAM=y
CONFIG_DEBUG_UART_BASE=0xFF1b0000
CONFIG_DEBUG_UART_CLOCK=24000000
CONFIG_ARCH_OMAP2PLUS=y
CONFIG_SYS_TEXT_BASE=0x80008000
CONFIG_TARGET_TWISTER=y
+CONFIG_EMIF4=y
CONFIG_BOOTDELAY=10
CONFIG_SPL=y
# CONFIG_SPL_EXT_SUPPORT is not set
+++ /dev/null
-CONFIG_ARM=y
-CONFIG_ARCH_UNIPHIER=y
-CONFIG_SYS_TEXT_BASE=0x84000000
-CONFIG_SYS_MALLOC_F_LEN=0x2000
-CONFIG_SPL_MMC_SUPPORT=y
-CONFIG_SPL_SERIAL_SUPPORT=y
-CONFIG_SPL_NAND_SUPPORT=y
-CONFIG_MICRO_SUPPORT_CARD=y
-CONFIG_DEFAULT_DEVICE_TREE="uniphier-pro4-ref"
-# CONFIG_ARCH_FIXUP_FDT_MEMORY is not set
-CONFIG_SPL=y
-CONFIG_SPL_NOR_SUPPORT=y
-CONFIG_HUSH_PARSER=y
-CONFIG_CMD_CONFIG=y
-CONFIG_CMD_BOOTZ=y
-# CONFIG_CMD_XIMG is not set
-# CONFIG_CMD_ENV_EXISTS is not set
-# CONFIG_CMD_FPGA is not set
-CONFIG_CMD_GPIO=y
-CONFIG_CMD_GPT=y
-CONFIG_CMD_I2C=y
-CONFIG_CMD_MMC=y
-CONFIG_CMD_USB=y
-CONFIG_CMD_TFTPPUT=y
-CONFIG_CMD_PING=y
-CONFIG_CMD_CACHE=y
-CONFIG_CMD_TIME=y
-# CONFIG_CMD_MISC is not set
-CONFIG_CMD_FAT=y
-CONFIG_CMD_FS_GENERIC=y
-# CONFIG_SPL_DOS_PARTITION is not set
-# CONFIG_SPL_EFI_PARTITION is not set
-CONFIG_NET_RANDOM_ETHADDR=y
-CONFIG_GPIO_UNIPHIER=y
-CONFIG_MISC=y
-CONFIG_I2C_EEPROM=y
-CONFIG_SYS_EEPROM_PAGE_WRITE_DELAY_MS=10
-CONFIG_MMC_UNIPHIER=y
-CONFIG_NAND=y
-CONFIG_NAND_DENALI=y
-CONFIG_NAND_DENALI_DT=y
-CONFIG_SYS_NAND_DENALI_64BIT=y
-CONFIG_NAND_DENALI_SPARE_AREA_SKIP_BYTES=8
-CONFIG_SPL_NAND_DENALI=y
-CONFIG_USB=y
-CONFIG_USB_XHCI_HCD=y
-CONFIG_USB_EHCI_HCD=y
-CONFIG_USB_EHCI_GENERIC=y
-CONFIG_USB_STORAGE=y
+++ /dev/null
-CONFIG_ARM=y
-CONFIG_ARCH_UNIPHIER=y
-CONFIG_SYS_TEXT_BASE=0x84000000
-CONFIG_SYS_MALLOC_F_LEN=0x2000
-CONFIG_SPL_MMC_SUPPORT=y
-CONFIG_SPL_SERIAL_SUPPORT=y
-CONFIG_SPL_NAND_SUPPORT=y
-CONFIG_ARCH_UNIPHIER_PRO5_PXS2_LD6B=y
-CONFIG_MICRO_SUPPORT_CARD=y
-CONFIG_DEFAULT_DEVICE_TREE="uniphier-pxs2-vodka"
-# CONFIG_ARCH_FIXUP_FDT_MEMORY is not set
-CONFIG_SPL=y
-CONFIG_SPL_NOR_SUPPORT=y
-CONFIG_HUSH_PARSER=y
-CONFIG_CMD_CONFIG=y
-CONFIG_CMD_BOOTZ=y
-# CONFIG_CMD_XIMG is not set
-# CONFIG_CMD_ENV_EXISTS is not set
-# CONFIG_CMD_FPGA is not set
-CONFIG_CMD_GPIO=y
-CONFIG_CMD_GPT=y
-CONFIG_CMD_I2C=y
-CONFIG_CMD_MMC=y
-CONFIG_CMD_USB=y
-CONFIG_CMD_TFTPPUT=y
-CONFIG_CMD_PING=y
-CONFIG_CMD_CACHE=y
-CONFIG_CMD_TIME=y
-# CONFIG_CMD_MISC is not set
-CONFIG_CMD_FAT=y
-CONFIG_CMD_FS_GENERIC=y
-# CONFIG_SPL_DOS_PARTITION is not set
-# CONFIG_SPL_EFI_PARTITION is not set
-CONFIG_NET_RANDOM_ETHADDR=y
-CONFIG_GPIO_UNIPHIER=y
-CONFIG_MISC=y
-CONFIG_I2C_EEPROM=y
-CONFIG_SYS_EEPROM_PAGE_WRITE_DELAY_MS=10
-CONFIG_MMC_UNIPHIER=y
-CONFIG_NAND=y
-CONFIG_NAND_DENALI=y
-CONFIG_NAND_DENALI_DT=y
-CONFIG_SYS_NAND_DENALI_64BIT=y
-CONFIG_NAND_DENALI_SPARE_AREA_SKIP_BYTES=8
-CONFIG_SPL_NAND_DENALI=y
-CONFIG_USB=y
-CONFIG_USB_XHCI_HCD=y
-CONFIG_USB_STORAGE=y
--- /dev/null
+CONFIG_ARM=y
+CONFIG_ARCH_UNIPHIER=y
+CONFIG_SYS_TEXT_BASE=0x84000000
+CONFIG_SYS_MALLOC_F_LEN=0x2000
+CONFIG_SPL_MMC_SUPPORT=y
+CONFIG_SPL_SERIAL_SUPPORT=y
+CONFIG_SPL_NAND_SUPPORT=y
+CONFIG_ARCH_UNIPHIER_V7_MULTI=y
+CONFIG_MICRO_SUPPORT_CARD=y
+CONFIG_DEFAULT_DEVICE_TREE="uniphier-pxs2-vodka"
+# CONFIG_ARCH_FIXUP_FDT_MEMORY is not set
+CONFIG_SPL=y
+CONFIG_SPL_NOR_SUPPORT=y
+CONFIG_HUSH_PARSER=y
+CONFIG_CMD_CONFIG=y
+CONFIG_CMD_BOOTZ=y
+# CONFIG_CMD_XIMG is not set
+# CONFIG_CMD_ENV_EXISTS is not set
+# CONFIG_CMD_FPGA is not set
+CONFIG_CMD_GPIO=y
+CONFIG_CMD_GPT=y
+CONFIG_CMD_I2C=y
+CONFIG_CMD_MMC=y
+CONFIG_CMD_USB=y
+CONFIG_CMD_TFTPPUT=y
+CONFIG_CMD_PING=y
+CONFIG_CMD_CACHE=y
+CONFIG_CMD_TIME=y
+# CONFIG_CMD_MISC is not set
+CONFIG_CMD_FAT=y
+CONFIG_CMD_FS_GENERIC=y
+# CONFIG_SPL_DOS_PARTITION is not set
+# CONFIG_SPL_EFI_PARTITION is not set
+CONFIG_NET_RANDOM_ETHADDR=y
+CONFIG_GPIO_UNIPHIER=y
+CONFIG_MISC=y
+CONFIG_I2C_EEPROM=y
+CONFIG_SYS_EEPROM_PAGE_WRITE_DELAY_MS=10
+CONFIG_MMC_UNIPHIER=y
+CONFIG_NAND=y
+CONFIG_NAND_DENALI=y
+CONFIG_NAND_DENALI_DT=y
+CONFIG_SYS_NAND_DENALI_64BIT=y
+CONFIG_NAND_DENALI_SPARE_AREA_SKIP_BYTES=8
+CONFIG_SPL_NAND_DENALI=y
+CONFIG_USB=y
+CONFIG_USB_XHCI_HCD=y
+CONFIG_USB_EHCI_HCD=y
+CONFIG_USB_EHCI_GENERIC=y
+CONFIG_USB_STORAGE=y
CONFIG_ARM=y
CONFIG_ARCH_AT91=y
CONFIG_TARGET_VINCO=y
-CONFIG_SYS_EXTRA_OPTIONS="SAMA5D4,SYS_USE_SERIALFLASH"
+CONFIG_SPI_BOOT=y
CONFIG_BOOTDELAY=3
CONFIG_USE_BOOTARGS=y
CONFIG_BOOTARGS="console=ttyS0,115200 earlyprintk rw root=/dev/mmcblk0p2 rootfstype=ext4 rootwait quiet lpj=1990656"
--- /dev/null
+CONFIG_ARM=y
+CONFIG_ARCH_ROCKCHIP=y
+CONFIG_SYS_MALLOC_F_LEN=0x2000
+CONFIG_ROCKCHIP_RK3288=y
+CONFIG_TARGET_VYASA_RK3288=y
+CONFIG_SPL_STACK_R_ADDR=0x80000
+CONFIG_DEFAULT_DEVICE_TREE="rk3288-vyasa"
+CONFIG_DEBUG_UART=y
+CONFIG_ENV_IS_IN_MMC=y
+CONFIG_SILENT_CONSOLE=y
+# CONFIG_DISPLAY_CPUINFO is not set
+CONFIG_SPL_STACK_R=y
+CONFIG_SPL_STACK_R_MALLOC_SIMPLE_LEN=0x2000
+# CONFIG_CMD_IMLS is not set
+CONFIG_CMD_GPT=y
+CONFIG_CMD_MMC=y
+CONFIG_CMD_I2C=y
+CONFIG_CMD_GPIO=y
+# CONFIG_CMD_SETEXPR is not set
+CONFIG_CMD_CACHE=y
+CONFIG_CMD_TIME=y
+CONFIG_CMD_PMIC=y
+CONFIG_CMD_REGULATOR=y
+# CONFIG_SPL_DOS_PARTITION is not set
+# CONFIG_SPL_ISO_PARTITION is not set
+# CONFIG_SPL_EFI_PARTITION is not set
+CONFIG_SPL_PARTITION_UUIDS=y
+CONFIG_SPL_OF_CONTROL=y
+CONFIG_OF_SPL_REMOVE_PROPS="pinctrl-0 pinctrl-names clock-names interrupt-parent assigned-clocks assigned-clock-rates assigned-clock-parents"
+CONFIG_REGMAP=y
+CONFIG_SPL_REGMAP=y
+CONFIG_SYSCON=y
+CONFIG_SPL_SYSCON=y
+# CONFIG_SPL_SIMPLE_BUS is not set
+CONFIG_CLK=y
+CONFIG_SPL_CLK=y
+CONFIG_ROCKCHIP_GPIO=y
+CONFIG_SYS_I2C_ROCKCHIP=y
+CONFIG_LED=y
+CONFIG_LED_GPIO=y
+CONFIG_MMC_DW=y
+CONFIG_MMC_DW_ROCKCHIP=y
+CONFIG_PINCTRL=y
+CONFIG_SPL_PINCTRL=y
+# CONFIG_SPL_PINCTRL_FULL is not set
+CONFIG_PINCTRL_ROCKCHIP_RK3288=y
+CONFIG_DM_PMIC=y
+# CONFIG_SPL_PMIC_CHILDREN is not set
+CONFIG_PMIC_RK8XX=y
+CONFIG_REGULATOR_RK8XX=y
+CONFIG_DM_REGULATOR_FIXED=y
+CONFIG_PWM_ROCKCHIP=y
+CONFIG_RAM=y
+CONFIG_SPL_RAM=y
+CONFIG_DEBUG_UART_BASE=0xff690000
+CONFIG_DEBUG_UART_CLOCK=24000000
+CONFIG_DEBUG_UART_SHIFT=2
+CONFIG_SYS_NS16550=y
+CONFIG_SYSRESET=y
+CONFIG_CONSOLE_SCROLL_LINES=10
+CONFIG_USE_TINY_PRINTF=y
+CONFIG_CMD_DHRYSTONE=y
+CONFIG_ERRNO_STR=y
return -1;
}
+int part_get_info_whole_disk(struct blk_desc *dev_desc, disk_partition_t *info)
+{
+ info->start = 0;
+ info->size = dev_desc->lba;
+ info->blksz = dev_desc->blksz;
+ info->bootable = 0;
+ strcpy((char *)info->type, BOOT_PART_TYPE);
+ strcpy((char *)info->name, "Whole Disk");
+#if CONFIG_IS_ENABLED(PARTITION_UUIDS)
+ info->uuid[0] = 0;
+#endif
+#ifdef CONFIG_PARTITION_TYPE_GUID
+ info->type_guid[0] = 0;
+#endif
+
+ return 0;
+}
+
int blk_get_device_by_str(const char *ifname, const char *dev_hwpart_str,
struct blk_desc **dev_desc)
{
(*dev_desc)->log2blksz = LOG2((*dev_desc)->blksz);
- info->start = 0;
- info->size = (*dev_desc)->lba;
- info->blksz = (*dev_desc)->blksz;
- info->bootable = 0;
- strcpy((char *)info->type, BOOT_PART_TYPE);
- strcpy((char *)info->name, "Whole Disk");
-#if CONFIG_IS_ENABLED(PARTITION_UUIDS)
- info->uuid[0] = 0;
-#endif
-#ifdef CONFIG_PARTITION_TYPE_GUID
- info->type_guid[0] = 0;
-#endif
+ part_get_info_whole_disk(*dev_desc, info);
ret = 0;
goto cleanup;
--- /dev/null
+U-Boot FDT Overlay usage
+=============================================
+
+Overlays Syntax
+---------------
+
+Overlays require slightly different syntax compared to traditional overlays.
+Please refer to dt-object-internal.txt in the dtc sources for information
+regarding the internal format of overlays:
+https://git.kernel.org/pub/scm/utils/dtc/dtc.git/tree/Documentation/dt-object-internal.txt
+
+Building Overlays
+-----------------
+
+In a nutshell overlays provides a means to manipulate a symbol a previous dtb
+or overlay has defined. It requires both the base and all the overlays
+to be compiled with the -@ command line switch so that symbol information is
+included.
+
+Note support for -@ option can only be found in dtc version 1.4.4 or newer.
+Only version 4.14 or higher of the Linux kernel includes a built in version
+of dtc that meets this requirement.
+
+Building an overlay follows the same process as building a traditional dtb.
+
+For example:
+
+base.dts
+--------
+
+ /dts-v1/;
+ / {
+ foo: foonode {
+ foo-property;
+ };
+ };
+
+ $ dtc -@ -I dts -O dtb -o base.dtb base.dts
+
+bar.dts
+-------
+
+ /dts-v1/;
+ /plugin/;
+ / {
+ fragment@1 {
+ target = <&foo>;
+ __overlay__ {
+ overlay-1-property;
+ bar: barnode {
+ bar-property;
+ };
+ };
+ };
+ };
+
+ $ dtc -@ -I dts -O dtb -o bar.dtb bar.dts
+
+Ways to Utilize Overlays in U-boot
+----------------------------------
+
+There are two ways to apply overlays in U-boot.
+1. Include and define overlays within a FIT image and have overlays
+ automatically applied.
+
+2. Manually load and apply overlays
+
+The remainder of this document will discuss using overlays via the manual
+approach. For information on using overlays as part of a FIT image please see:
+doc/uImage.FIT/overlay-fdt-boot.txt
+
+Manually Loading and Applying Overlays
+--------------------------------------
+
+1. Figure out where to place both the base device tree blob and the
+overlay. Make sure you have enough space to grow the base tree without
+overlapping anything.
+
+=> setenv fdtaddr 0x87f00000
+=> setenv fdtovaddr 0x87fc0000
+
+2. Load the base blob and overlay blobs
+
+=> load ${devtype} ${bootpart} ${fdtaddr} ${bootdir}/base.dtb
+=> load ${devtype} ${bootpart} ${fdtovaddr} ${bootdir}/overlay.dtb
+
+3. Set it as the working fdt tree.
+
+=> fdtaddr $fdtaddr
+
+4. Grow it enough so it can 'fit' all the applied overlays
+
+=> fdt resize 8192
+
+5. You are now ready to apply the overlay.
+
+=> fdt apply $fdtovaddr
+
+6. Boot system like you would do with a traditional dtb.
+
+For bootm:
+
+=> bootm ${kerneladdr} - ${fdtaddr}
+
+For bootz:
+
+=> bootz ${kerneladdr} - ${fdtaddr}
+
+Please note that in case of an error, both the base and overlays are going
+to be invalidated, so keep copies to avoid reloading.
+
+Pantelis Antoniou
+pantelis.antoniou@konsulko.com
+11/7/2017
32bit SoC boards:
- Board | <defconfig> | <device-tree>
----------------|------------------------------|------------------------------
-LD4 reference | uniphier_ld4_sld8_defconfig | uniphier-ld4-ref (default)
-sld8 reference | uniphier_ld4_sld8_defconfig | uniphier-sld8-def
-Pro4 reference | uniphier_pro4_defconfig | uniphier-pro4-ref (default)
-Pro4 Ace | uniphier_pro4_defconfig | uniphier-pro4-ace
-Pro4 Sanji | uniphier_pro4_defconfig | uniphier-pro4-sanji
-Pro5 4KBOX | uniphier_pxs2_ld6b_defconfig | uniphier-pro5-4kbox
-PXs2 Gentil | uniphier_pxs2_ld6b_defconfig | uniphier-pxs2-gentil
-PXs2 Vodka | uniphier_pxs2_ld6b_defconfig | uniphier-pxs2-vodka (default)
-LD6b reference | uniphier_pxs2_ld6b_defconfig | uniphier-ld6b-ref
+ Board | <defconfig> | <device-tree>
+---------------|-----------------------------|------------------------------
+LD4 reference | uniphier_ld4_sld8_defconfig | uniphier-ld4-ref (default)
+sld8 reference | uniphier_ld4_sld8_defconfig | uniphier-sld8-def
+Pro4 reference | uniphier_v7_defconfig | uniphier-pro4-ref
+Pro4 Ace | uniphier_v7_defconfig | uniphier-pro4-ace
+Pro4 Sanji | uniphier_v7_defconfig | uniphier-pro4-sanji
+Pro5 4KBOX | uniphier_v7_defconfig | uniphier-pro5-4kbox
+PXs2 Gentil | uniphier_v7_defconfig | uniphier-pxs2-gentil
+PXs2 Vodka | uniphier_v7_defconfig | uniphier-pxs2-vodka (default)
+LD6b reference | uniphier_v7_defconfig | uniphier-ld6b-ref
64bit SoC boards:
LD11 Global | uniphier_v8_defconfig | uniphier-ld11-global
LD20 reference | uniphier_v8_defconfig | uniphier-ld20-ref (default)
LD20 Global | uniphier_v8_defconfig | uniphier-ld20-global
+PXs3 reference | uniphier_v8_defconfig | uniphier-pxs3-ref
For example, to compile the source for PXs2 Vodka board, run the following:
- $ make uniphier_pxs2_ld6b_defconfig
+ $ make uniphier_v7_defconfig
$ make CROSS_COMPILE=arm-linux-gnueabihf- DEVICE_TREE=uniphier-pxs2-vodka
The device tree marked as (default) can be omitted. `uniphier-pxs2-vodka` is
-the default device tree for the configuration `uniphier_pxs2_ld6b_defconfig`,
-so the following gives the same result.
+the default device tree for the configuration `uniphier_v7_defconfig`, so the
+following gives the same result.
- $ make uniphier_pxs2_ld6b_defconfig
+ $ make uniphier_v7_defconfig
$ make CROSS_COMPILE=arm-linux-gnueabihf-
--
Masahiro Yamada <yamada.masahiro@socionext.com>
-Jul. 2017
+Sep. 2017
are supported:
- Bayley Bay CRB
+ - Cherry Hill CRB
- Congatec QEVAL 2.0 & conga-QA3/E3845
- Cougar Canyon 2 CRB
- Crown Bay CRB
---
+Intel Cherry Hill specific instructions for bare mode:
+
+This uses Intel FSP for Braswell platform. Download it from Intel FSP website,
+put the .fd file to the board directory and rename it to fsp.bin.
+
+Extract descriptor.bin and me.bin from the original BIOS on the board using
+ifdtool and put them to the board directory as well.
+
+Note the FSP package for Braswell does not ship a traditional legacy VGA BIOS
+image for the integrated graphics device. Instead a new binary called Video
+BIOS Table (VBT) is shipped. Put it to the board directory and rename it to
+vbt.bin if you want graphics support in U-Boot.
+
+Now you can build U-Boot and obtain u-boot.rom
+
+$ make cherryhill_defconfig
+$ make all
+
+An important note for programming u-boot.rom to the on-board SPI flash is that
+you need make sure the SPI flash's 'quad enable' bit in its status register
+matches the settings in the descriptor.bin, otherwise the board won't boot.
+
+For the on-board SPI flash MX25U6435F, this can be done by writing 0x40 to the
+status register by DediProg in: Config > Modify Status Register > Write Status
+Register(s) > Register1 Value(Hex). This is is a one-time change. Once set, it
+persists in SPI flash part regardless of the u-boot.rom image burned.
+
+---
+
Intel Galileo instructions for bare mode:
Only one binary blob is needed for Remote Management Unit (RMU) within Intel
--- /dev/null
+# List of addresses picked up by patman/get_maintainer.pl that are known to
+# bounce. Addresses are listed one per line and need to match the author
+# information recorded in git.
bool cap_sd_highspeed;
fdt32_t card_detect_delay;
fdt32_t clock_freq_min_max[2];
- struct phandle_2_cell clocks[4];
+ struct phandle_1_arg clocks[4];
bool disable_wp;
fdt32_t fifo_depth;
fdt32_t interrupts[3];
New uImage:
8. bootm <addr1>
9. bootm [<addr1>]:<subimg1>
-10. bootm [<addr1>]#<conf>
+10. bootm [<addr1>]#<conf>[#<extra-conf[#...]]
11. bootm [<addr1>]:<subimg1> [<addr2>]:<subimg2>
12. bootm [<addr1>]:<subimg1> [<addr2>]:<subimg2> [<addr3>]:<subimg3>
13. bootm [<addr1>]:<subimg1> [<addr2>]:<subimg2> <addr3>
- new uImage configuration specification
<addr>#<configuration unit_name>
+- new uImage configuration specification with extra configuration components
+<addr>#<configuration unit_name>[#<extra configuration unit_name>[#..]]
+
+The extra configuration currently is supported only for additional device tree
+overlays to apply on the base device tree supplied by the first configuration
+unit.
Examples:
- boot configuration "cfg@1" from a new uImage located at 200000:
bootm 200000#cfg@1
+- boot configuration "cfg@1" with extra "cfg@2" from a new uImage located
+ at 200000:
+bootm 200000#cfg@1#cfg@2
+
- boot "kernel@1" from a new uImage at 200000 with initrd "ramdisk@2" found in
some other new uImage stored at address 800000:
bootm 200000:kernel@1 800000:ramdisk@2
* (Bogus) example FIT image description file demonstrating the usage
* of multiple images loaded by the SPL.
* Several binaries will be loaded at their respective load addresses.
+ *
+ * For booting U-Boot, "firmware" is searched first. If not found, "loadables"
+ * is used to identify images to be loaded into memory. If falcon boot is
+ * enabled, "kernel" is searched first. If not found, it falls back to the
+ * same flow as booting U-Boot. Changing image type will result skipping
+ * specific image.
+ *
* Finally the one image specifying an entry point will be entered by the SPL.
*/
--- /dev/null
+U-Boot FDT Overlay FIT usage
+============================
+
+Introduction
+------------
+In many cases it is desirable to have a single FIT image support a multitude
+of similar boards and their expansion options. The same kernel on DT enabled
+platforms can support this easily enough by providing a DT blob upon boot
+that matches the desired configuration.
+
+This document focuses on specifically using overlays as part of a FIT image.
+General information regarding overlays including its syntax and building it
+can be found in doc/README.fdt-overlays
+
+Configuration without overlays
+------------------------------
+
+Take a hypothetical board named 'foo' where there are different supported
+revisions, reva and revb. Assume that both board revisions can use add a bar
+add-on board, while only the revb board can use a baz add-on board.
+
+Without using overlays the configuration would be as follows for every case.
+
+ /dts-v1/;
+ / {
+ images {
+ kernel@1 {
+ data = /incbin/("./zImage");
+ type = "kernel";
+ arch = "arm";
+ os = "linux";
+ load = <0x82000000>;
+ entry = <0x82000000>;
+ };
+ fdt@1 {
+ data = /incbin/("./foo-reva.dtb");
+ type = "flat_dt";
+ arch = "arm";
+ };
+ fdt@2 {
+ data = /incbin/("./foo-revb.dtb");
+ type = "flat_dt";
+ arch = "arm";
+ };
+ fdt@3 {
+ data = /incbin/("./foo-reva-bar.dtb");
+ type = "flat_dt";
+ arch = "arm";
+ };
+ fdt@4 {
+ data = /incbin/("./foo-revb-bar.dtb");
+ type = "flat_dt";
+ arch = "arm";
+ };
+ fdt@5 {
+ data = /incbin/("./foo-revb-baz.dtb");
+ type = "flat_dt";
+ arch = "arm";
+ };
+ fdt@6 {
+ data = /incbin/("./foo-revb-bar-baz.dtb");
+ type = "flat_dt";
+ arch = "arm";
+ };
+ };
+
+ configurations {
+ default = "foo-reva.dtb;
+ foo-reva.dtb {
+ kernel = "kernel@1";
+ fdt = "fdt@1";
+ };
+ foo-revb.dtb {
+ kernel = "kernel@1";
+ fdt = "fdt@2";
+ };
+ foo-reva-bar.dtb {
+ kernel = "kernel@1";
+ fdt = "fdt@3";
+ };
+ foo-revb-bar.dtb {
+ kernel = "kernel@1";
+ fdt = "fdt@4";
+ };
+ foo-revb-baz.dtb {
+ kernel = "kernel@1";
+ fdt = "fdt@5";
+ };
+ foo-revb-bar-baz.dtb {
+ kernel = "kernel@1";
+ fdt = "fdt@6";
+ };
+ };
+ };
+
+Note the blob needs to be compiled for each case and the combinatorial explosion of
+configurations. A typical device tree blob is in the low hunderds of kbytes so a
+multitude of configuration grows the image quite a bit.
+
+Booting this image is done by using
+
+ # bootm <addr>#<config>
+
+Where config is one of:
+ foo-reva.dtb, foo-revb.dtb, foo-reva-bar.dtb, foo-revb-bar.dtb,
+ foo-revb-baz.dtb, foo-revb-bar-baz.dtb
+
+This selects the DTB to use when booting.
+
+Configuration using overlays
+----------------------------
+
+Device tree overlays can be applied to a base DT and result in the same blob
+being passed to the booting kernel. This saves on space and avoid the combinatorial
+explosion problem.
+
+ /dts-v1/;
+ / {
+ images {
+ kernel@1 {
+ data = /incbin/("./zImage");
+ type = "kernel";
+ arch = "arm";
+ os = "linux";
+ load = <0x82000000>;
+ entry = <0x82000000>;
+ };
+ fdt@1 {
+ data = /incbin/("./foo.dtb");
+ type = "flat_dt";
+ arch = "arm";
+ load = <0x87f00000>;
+ };
+ fdt@2 {
+ data = /incbin/("./reva.dtbo");
+ type = "flat_dt";
+ arch = "arm";
+ load = <0x87fc0000>;
+ };
+ fdt@3 {
+ data = /incbin/("./revb.dtbo");
+ type = "flat_dt";
+ arch = "arm";
+ load = <0x87fc0000>;
+ };
+ fdt@4 {
+ data = /incbin/("./bar.dtbo");
+ type = "flat_dt";
+ arch = "arm";
+ load = <0x87fc0000>;
+ };
+ fdt@5 {
+ data = /incbin/("./baz.dtbo");
+ type = "flat_dt";
+ arch = "arm";
+ load = <0x87fc0000>;
+ };
+ };
+
+ configurations {
+ default = "foo-reva.dtb;
+ foo-reva.dtb {
+ kernel = "kernel@1";
+ fdt = "fdt@1", "fdt@2";
+ };
+ foo-revb.dtb {
+ kernel = "kernel@1";
+ fdt = "fdt@1", "fdt@3";
+ };
+ foo-reva-bar.dtb {
+ kernel = "kernel@1";
+ fdt = "fdt@1", "fdt@2", "fdt@4";
+ };
+ foo-revb-bar.dtb {
+ kernel = "kernel@1";
+ fdt = "fdt@1", "fdt@3", "fdt@4";
+ };
+ foo-revb-baz.dtb {
+ kernel = "kernel@1";
+ fdt = "fdt@1", "fdt@3", "fdt@5";
+ };
+ foo-revb-bar-baz.dtb {
+ kernel = "kernel@1";
+ fdt = "fdt@1", "fdt@3", "fdt@4", "fdt@5";
+ };
+ bar {
+ fdt = "fdt@4";
+ };
+ baz {
+ fdt = "fdt@5";
+ };
+ };
+ };
+
+Booting this image is exactly the same as the non-overlay example.
+u-boot will retrieve the base blob and apply the overlays in sequence as
+they are declared in the configuration.
+
+Note the minimum amount of different DT blobs, as well as the requirement for
+the DT blobs to have a load address; the overlay application requires the blobs
+to be writeable.
+
+Configuration using overlays and feature selection
+--------------------------------------------------
+
+Although the configuration in the previous section works is a bit inflexible
+since it requires all possible configuration options to be laid out before
+hand in the FIT image. For the add-on boards the extra config selection method
+might make sense.
+
+Note the two bar & baz configuration nodes. To boot a reva board with
+the bar add-on board enabled simply use:
+
+ # bootm <addr>#foo-reva.dtb#bar
+
+While booting a revb with bar and baz is as follows:
+
+ # bootm <addr>#foo-revb.dtb#bar#baz
+
+The limitation for a feature selection configuration node is that a single
+fdt option is currently supported.
+
+Pantelis Antoniou
+pantelis.antoniou@konsulko.com
+12/6/2017
|- description = "configuration description"
|- kernel = "kernel sub-node unit name"
|- ramdisk = "ramdisk sub-node unit name"
- |- fdt = "fdt sub-node unit-name"
+ |- fdt = "fdt sub-node unit-name" [, "fdt overlay sub-node unit-name", ...]
|- fpga = "fpga sub-node unit-name"
|- loadables = "loadables sub-node unit-name"
- ramdisk : Unit name of the corresponding ramdisk image (component image
node of a "ramdisk" type).
- fdt : Unit name of the corresponding fdt blob (component image node of a
- "fdt type").
+ "fdt type"). Additional fdt overlay nodes can be supplied which signify
+ that the resulting device tree blob is generated by the first base fdt
+ blob with all subsequent overlays applied.
- setup : Unit name of the corresponding setup binary (used for booting
an x86 kernel). This contains the setup.bin file built by the kernel.
- fpga : Unit name of the corresponding fpga bitstream blob
defines an absolute position or address as the offset. This is helpful when
booting U-Boot proper before performing relocation.
+Normal kernel FIT image has data embedded within FIT structure. U-Boot image
+for SPL boot has external data. Existence of 'data-offset' can be used to
+identify which format is used.
+
9) Examples
-----------
#include <command.h>
#include <pci.h>
#include <asm/processor.h>
+#include <linux/dma-direction.h>
#include <linux/errno.h>
#include <asm/io.h>
#include <malloc.h>
#endif
};
-enum dma_data_direction {
- DMA_BIDIRECTIONAL = 0,
- DMA_TO_DEVICE = 1,
- DMA_FROM_DEVICE = 2,
- DMA_NONE = 3,
-};
-
struct ata_link {
struct ata_port *ap;
int pmp;
if (IS_ERR_VALUE(n))
return n;
- /* flush cache after read */
- flush_cache((ulong)buffer, blkcnt * desc->blksz);
-
return n;
}
int blk_create_device(struct udevice *parent, const char *drv_name,
const char *name, int if_type, int devnum, int blksz,
- lbaint_t size, struct udevice **devp)
+ lbaint_t lba, struct udevice **devp)
{
struct blk_desc *desc;
struct udevice *dev;
desc = dev_get_uclass_platdata(dev);
desc->if_type = if_type;
desc->blksz = blksz;
- desc->lba = size / blksz;
+ desc->lba = lba;
desc->part_type = PART_TYPE_UNKNOWN;
desc->bdev = dev;
desc->devnum = devnum;
int blk_create_devicef(struct udevice *parent, const char *drv_name,
const char *name, int if_type, int devnum, int blksz,
- lbaint_t size, struct udevice **devp)
+ lbaint_t lba, struct udevice **devp)
{
char dev_name[30], *str;
int ret;
return -ENOMEM;
ret = blk_create_device(parent, drv_name, str, if_type, devnum,
- blksz, size, devp);
+ blksz, lba, devp);
if (ret) {
free(str);
return ret;
if (IS_ERR_VALUE(n))
return n;
- /* flush cache after read */
- flush_cache((ulong)buffer, blkcnt * desc->blksz);
-
return n;
}
}
ret = blk_create_device(gd->dm_root, "sandbox_host_blk", str,
IF_TYPE_HOST, devnum, 512,
- os_lseek(fd, 0, OS_SEEK_END), &dev);
+ os_lseek(fd, 0, OS_SEEK_END) / 512, &dev);
if (ret)
goto err_file;
ret = device_probe(dev);
(struct davinci_rtc *)CONFIG_SYS_BOOTCOUNT_ADDR;
/*
- * write RTC kick register to enable write
- * for RTC Scratch registers. Scratch0 and 1 are
- * used for bootcount values.
+ * write RTC kick registers to enable write
+ * for RTC Scratch registers. Scratch register 2 is
+ * used for bootcount value.
*/
writel(RTC_KICK0R_WE, ®->kick0r);
writel(RTC_KICK1R_WE, ®->kick1r);
config SPL_CLK
bool "Enable clock support in SPL"
- depends on CLK && SPL_DM
+ depends on CLK && SPL && SPL_DM
help
The clock subsystem adds a small amount of overhead to the image.
If this is acceptable and you have a need to use clock drivers in
config AT91_UTMI
bool "Support UTMI PLL Clock"
- depends on CLK_AT91
+ depends on CLK_AT91 && SPL_DM
+ select REGMAP
+ select SPL_REGMAP
+ select SYSCON
+ select SPL_SYSCON
help
This option is used to enable the AT91 UTMI PLL clock
driver. It is the clock provider of USB, and UPLLCK is the
#include <common.h>
#include <clk-uclass.h>
#include <dm.h>
+#include <syscon.h>
#include <linux/io.h>
#include <mach/at91_pmc.h>
+#include <mach/sama5_sfr.h>
#include "pmc.h"
DECLARE_GLOBAL_DATA_PTR;
-#define UTMI_FIXED_MUL 40
+/*
+ * The purpose of this clock is to generate a 480 MHz signal. A different
+ * rate can't be configured.
+ */
+#define UTMI_RATE 480000000
static int utmi_clk_enable(struct clk *clk)
{
struct pmc_platdata *plat = dev_get_platdata(clk->dev);
struct at91_pmc *pmc = plat->reg_base;
+ struct clk clk_dev;
+ ulong clk_rate;
+ u32 utmi_ref_clk_freq;
u32 tmp;
+ int err;
if (readl(&pmc->sr) & AT91_PMC_LOCKU)
return 0;
+ /*
+ * If mainck rate is different from 12 MHz, we have to configure the
+ * FREQ field of the SFR_UTMICKTRIM register to generate properly
+ * the utmi clock.
+ */
+ err = clk_get_by_index(clk->dev, 0, &clk_dev);
+ if (err)
+ return -EINVAL;
+
+ clk_rate = clk_get_rate(&clk_dev);
+ switch (clk_rate) {
+ case 12000000:
+ utmi_ref_clk_freq = 0;
+ break;
+ case 16000000:
+ utmi_ref_clk_freq = 1;
+ break;
+ case 24000000:
+ utmi_ref_clk_freq = 2;
+ break;
+ /*
+ * Not supported on SAMA5D2 but it's not an issue since MAINCK
+ * maximum value is 24 MHz.
+ */
+ case 48000000:
+ utmi_ref_clk_freq = 3;
+ break;
+ default:
+ printf("UTMICK: unsupported mainck rate\n");
+ return -EINVAL;
+ }
+
+ if (plat->regmap_sfr) {
+ err = regmap_read(plat->regmap_sfr, AT91_SFR_UTMICKTRIM, &tmp);
+ if (err)
+ return -EINVAL;
+
+ tmp &= ~AT91_UTMICKTRIM_FREQ;
+ tmp |= utmi_ref_clk_freq;
+ err = regmap_write(plat->regmap_sfr, AT91_SFR_UTMICKTRIM, tmp);
+ if (err)
+ return -EINVAL;
+ } else if (utmi_ref_clk_freq) {
+ printf("UTMICK: sfr node required\n");
+ return -EINVAL;
+ }
+
tmp = readl(&pmc->uckr);
tmp |= AT91_PMC_UPLLEN |
AT91_PMC_UPLLCOUNT |
static ulong utmi_clk_get_rate(struct clk *clk)
{
- return gd->arch.main_clk_rate_hz * UTMI_FIXED_MUL;
+ /* UTMI clk rate is fixed. */
+ return UTMI_RATE;
}
static struct clk_ops utmi_clk_ops = {
.get_rate = utmi_clk_get_rate,
};
+static int utmi_clk_ofdata_to_platdata(struct udevice *dev)
+{
+ struct pmc_platdata *plat = dev_get_platdata(dev);
+ struct udevice *syscon;
+
+ uclass_get_device_by_phandle(UCLASS_SYSCON, dev,
+ "regmap-sfr", &syscon);
+
+ if (syscon)
+ plat->regmap_sfr = syscon_get_regmap(syscon);
+
+ return 0;
+}
+
static int utmi_clk_probe(struct udevice *dev)
{
return at91_pmc_core_probe(dev);
.id = UCLASS_CLK,
.of_match = utmi_clk_match,
.probe = utmi_clk_probe,
+ .ofdata_to_platdata = utmi_clk_ofdata_to_platdata,
.platdata_auto_alloc_size = sizeof(struct pmc_platdata),
.ops = &utmi_clk_ops,
};
#ifndef __AT91_PMC_H__
#define __AT91_PMC_H__
+#include <regmap.h>
+
struct pmc_platdata {
struct at91_pmc *reg_base;
+ struct regmap *regmap_sfr;
};
int at91_pmc_core_probe(struct udevice *dev);
#if CONFIG_IS_ENABLED(OF_CONTROL)
# if CONFIG_IS_ENABLED(OF_PLATDATA)
int clk_get_by_index_platdata(struct udevice *dev, int index,
- struct phandle_2_cell *cells, struct clk *clk)
+ struct phandle_1_arg *cells, struct clk *clk)
{
int ret;
ret = uclass_get_device(UCLASS_CLK, 0, &clk->dev);
if (ret)
return ret;
- clk->id = cells[0].id;
+ clk->id = cells[0].arg[0];
return 0;
}
#if CONFIG_IS_ENABLED(OF_PLATDATA)
struct rk3368_clk_plat *plat = dev_get_platdata(dev);
- priv->cru = map_sysmem(plat->dtd.reg[1], plat->dtd.reg[3]);
+ priv->cru = map_sysmem(plat->dtd.reg[0], plat->dtd.reg[1]);
#endif
#if IS_ENABLED(CONFIG_SPL_BUILD) || IS_ENABLED(CONFIG_TPL_BUILD)
rkclk_init(priv->cru);
#if !CONFIG_IS_ENABLED(OF_PLATDATA)
struct rk3368_clk_priv *priv = dev_get_priv(dev);
- priv->cru = (struct rk3368_cru *)devfdt_get_addr(dev);
+ priv->cru = dev_read_addr_ptr(dev);
#endif
return 0;
return ret;
}
+static int rk3399_clk_enable(struct clk *clk)
+{
+ switch (clk->id) {
+ case HCLK_HOST0:
+ case HCLK_HOST0_ARB:
+ case HCLK_HOST1:
+ case HCLK_HOST1_ARB:
+ return 0;
+ }
+
+ debug("%s: unsupported clk %ld\n", __func__, clk->id);
+ return -ENOENT;
+}
+
static struct clk_ops rk3399_clk_ops = {
.get_rate = rk3399_clk_get_rate,
.set_rate = rk3399_clk_set_rate,
+ .enable = rk3399_clk_enable,
};
static int rk3399_clk_probe(struct udevice *dev)
#if CONFIG_IS_ENABLED(OF_PLATDATA)
struct rk3399_clk_plat *plat = dev_get_platdata(dev);
- priv->cru = map_sysmem(plat->dtd.reg[1], plat->dtd.reg[3]);
+ priv->cru = map_sysmem(plat->dtd.reg[0], plat->dtd.reg[1]);
#endif
rkclk_init(priv->cru);
#endif
#if !CONFIG_IS_ENABLED(OF_PLATDATA)
struct rk3399_clk_priv *priv = dev_get_priv(dev);
- priv->cru = (struct rk3399_cru *)devfdt_get_addr(dev);
+ priv->cru = dev_read_addr_ptr(dev);
#endif
return 0;
}
#if CONFIG_IS_ENABLED(OF_PLATDATA)
struct rk3399_pmuclk_plat *plat = dev_get_platdata(dev);
- priv->pmucru = map_sysmem(plat->dtd.reg[1], plat->dtd.reg[3]);
+ priv->pmucru = map_sysmem(plat->dtd.reg[0], plat->dtd.reg[1]);
#endif
#ifndef CONFIG_SPL_BUILD
#if !CONFIG_IS_ENABLED(OF_PLATDATA)
struct rk3399_pmuclk_priv *priv = dev_get_priv(dev);
- priv->pmucru = (struct rk3399_pmucru *)devfdt_get_addr(dev);
+ priv->pmucru = dev_read_addr_ptr(dev);
#endif
return 0;
}
{
int i, is_last;
struct udevice *child;
- char class_name[12];
/* print the first 11 characters to not break the tree-format. */
- strlcpy(class_name, dev->uclass->uc_drv->name, sizeof(class_name));
- printf(" %-11s [ %c ] ", class_name,
- dev->flags & DM_FLAG_ACTIVATED ? '+' : ' ');
+ printf(" %-10.10s [ %c ] %-10.10s ", dev->uclass->uc_drv->name,
+ dev->flags & DM_FLAG_ACTIVATED ? '+' : ' ', dev->driver->name);
for (i = depth; i >= 0; i--) {
is_last = (last_flag >> i) & 1;
root = dm_root();
if (root) {
- printf(" Class Probed Name\n");
+ printf(" Class Probed Driver Name\n");
printf("----------------------------------------\n");
show_devices(root, -1, 0);
}
if (!ofnode_valid(timings))
return -EINVAL;
- for (i = 0, node = ofnode_first_subnode(timings);
- ofnode_valid(node) && i != index;
- node = ofnode_first_subnode(node))
- i++;
+ i = 0;
+ ofnode_for_each_subnode(node, timings) {
+ if (i++ == index)
+ break;
+ }
if (!ofnode_valid(node))
return -EINVAL;
return dev_read_addr_index(dev, 0);
}
+void *dev_read_addr_ptr(struct udevice *dev)
+{
+ fdt_addr_t addr = dev_read_addr(dev);
+
+ return (addr == FDT_ADDR_T_NONE) ? NULL : (void *)addr;
+}
+
fdt_addr_t dev_read_addr_size(struct udevice *dev, const char *property,
fdt_size_t *sizep)
{
}
#if CONFIG_IS_ENABLED(OF_PLATDATA)
-int regmap_init_mem_platdata(struct udevice *dev, u32 *reg, int count,
+int regmap_init_mem_platdata(struct udevice *dev, fdt_val_t *reg, int count,
struct regmap **mapp)
{
struct regmap_range *range;
#endif
return dm_scan_fdt_node(gd->dm_root, blob, 0, pre_reloc_only);
}
+#else
+static int dm_scan_fdt_node(struct udevice *parent, const void *blob,
+ int offset, bool pre_reloc_only)
+{
+ return 0;
+}
#endif
+int dm_extended_scan_fdt(const void *blob, bool pre_reloc_only)
+{
+ int node, ret;
+
+ ret = dm_scan_fdt(gd->fdt_blob, pre_reloc_only);
+ if (ret) {
+ debug("dm_scan_fdt() failed: %d\n", ret);
+ return ret;
+ }
+
+ /* bind fixed-clock */
+ node = ofnode_to_offset(ofnode_path("/clocks"));
+ /* if no DT "clocks" node, no need to go further */
+ if (node < 0)
+ return ret;
+
+ ret = dm_scan_fdt_node(gd->dm_root, gd->fdt_blob, node,
+ pre_reloc_only);
+ if (ret)
+ debug("dm_scan_fdt_node() failed: %d\n", ret);
+
+ return ret;
+}
+
__weak int dm_scan_other(bool pre_reloc_only)
{
return 0;
}
if (CONFIG_IS_ENABLED(OF_CONTROL) && !CONFIG_IS_ENABLED(OF_PLATDATA)) {
- ret = dm_scan_fdt(gd->fdt_blob, pre_reloc_only);
+ ret = dm_extended_scan_fdt(gd->fdt_blob, pre_reloc_only);
if (ret) {
- debug("dm_scan_fdt() failed: %d\n", ret);
+ debug("dm_extended_scan_dt() failed: %d\n", ret);
return ret;
}
}
void remove_unused_controllers(fsl_ddr_info_t *info)
{
-#ifdef CONFIG_FSL_LSCH3
+#ifdef CONFIG_SYS_FSL_HAS_CCN504
int i;
u64 nodeid;
void *hnf_sam_ctrl = (void *)(CCI_HN_F_0_BASE + CCN_HN_F_SAM_CTL);
char *end;
int ret;
- /* This only supports RK3288 at present */
- priv->regs = (struct rockchip_gpio_regs *)devfdt_get_addr(dev);
+ priv->regs = dev_read_addr_ptr(dev);
ret = uclass_first_device_err(UCLASS_PINCTRL, &priv->pinctrl);
if (ret)
return ret;
/*
* Copyright (C) 2015 - 2016 Xilinx, Inc.
+ * Copyright (C) 2017 National Instruments Corp
* Written by Michal Simek
*
* SPDX-License-Identifier: GPL-2.0+
#include <dm.h>
#include <errno.h>
#include <i2c.h>
-#include <asm/gpio.h>
+
+#include <asm-generic/gpio.h>
DECLARE_GLOBAL_DATA_PTR;
struct pca954x_priv {
u32 addr; /* I2C mux address */
u32 width; /* I2C mux width - number of busses */
+ struct gpio_desc gpio_mux_reset;
};
static const struct chip_desc chips[] = {
return 0;
}
+static int pca954x_probe(struct udevice *dev)
+{
+ if (IS_ENABLED(CONFIG_DM_GPIO)) {
+ struct pca954x_priv *priv = dev_get_priv(dev);
+ int err;
+
+ err = gpio_request_by_name(dev, "reset-gpios", 0,
+ &priv->gpio_mux_reset, GPIOD_IS_OUT);
+
+ /* it's optional so only bail if we get a real error */
+ if (err && (err != -ENOENT))
+ return err;
+
+ /* dm will take care of polarity */
+ if (dm_gpio_is_valid(&priv->gpio_mux_reset))
+ dm_gpio_set_value(&priv->gpio_mux_reset, 0);
+ }
+
+ return 0;
+}
+
+static int pca954x_remove(struct udevice *dev)
+{
+ if (IS_ENABLED(CONFIG_DM_GPIO)) {
+ struct pca954x_priv *priv = dev_get_priv(dev);
+
+ if (dm_gpio_is_valid(&priv->gpio_mux_reset))
+ dm_gpio_free(dev, &priv->gpio_mux_reset);
+ }
+
+ return 0;
+}
+
U_BOOT_DRIVER(pca954x) = {
.name = "pca954x",
.id = UCLASS_I2C_MUX,
.of_match = pca954x_ids,
+ .probe = pca954x_probe,
+ .remove = pca954x_remove,
.ops = &pca954x_ops,
.ofdata_to_platdata = pca954x_ofdata_to_platdata,
.priv_auto_alloc_size = sizeof(struct pca954x_priv),
{
struct rk_i2c *priv = dev_get_priv(bus);
- priv->regs = (void *)devfdt_get_addr(bus);
+ priv->regs = dev_read_addr_ptr(bus);
return 0;
}
help
Enable a generic driver for EEPROMs attached via I2C.
+
+config SPL_I2C_EEPROM
+ bool "Enable driver for generic I2C-attached EEPROMs for SPL"
+ depends on MISC && SPL && SPL_DM
+ help
+ This option is an SPL-variant of the I2C_EEPROM option.
+ See the help of I2C_EEPROM for details.
+
if I2C_EEPROM
config SYS_I2C_EEPROM_ADDR
endif
obj-$(CONFIG_FSL_IIM) += fsl_iim.o
obj-$(CONFIG_LED_STATUS_GPIO) += gpio_led.o
-obj-$(CONFIG_I2C_EEPROM) += i2c_eeprom.o
+obj-$(CONFIG_$(SPL_)I2C_EEPROM) += i2c_eeprom.o
obj-$(CONFIG_FSL_MC9SDZ60) += mc9sdz60.o
obj-$(CONFIG_MXC_OCOTP) += mxc_ocotp.o
obj-$(CONFIG_MXS_OCOTP) += mxs_ocotp.o
config->flash_erase_value = ofnode_read_s32_default(flash_node,
"erase-value", -1);
- for (node = ofnode_first_subnode(flash_node); ofnode_valid(node);
- node = ofnode_next_subnode(node)) {
+ ofnode_for_each_subnode(node, flash_node) {
const char *name = ofnode_get_name(node);
enum ec_flash_region region;
static const struct udevice_id i2c_eeprom_std_ids[] = {
{ .compatible = "i2c-eeprom", .data = 0 },
+ { .compatible = "microchip,24aa02e48", .data = 3 },
{ .compatible = "atmel,24c01a", .data = 3 },
{ .compatible = "atmel,24c02", .data = 3 },
{ .compatible = "atmel,24c04", .data = 4 },
{ .compatible = "atmel,24c08a", .data = 4 },
{ .compatible = "atmel,24c16a", .data = 4 },
+ { .compatible = "atmel,24mac402", .data = 4 },
{ .compatible = "atmel,24c32", .data = 5 },
{ .compatible = "atmel,24c64", .data = 5 },
{ .compatible = "atmel,24c128", .data = 6 },
{
struct rockchip_efuse_platdata *plat = dev_get_platdata(dev);
- plat->base = (void *)dev_read_addr(dev);
+ plat->base = dev_read_addr_ptr(dev);
return 0;
}
struct dwmci_host *host = &priv->host;
host->name = dev->name;
- host->ioaddr = (void *)devfdt_get_addr(dev);
+ host->ioaddr = dev_read_addr_ptr(dev);
host->buswidth = dev_read_u32_default(dev, "bus-width", 4);
host->get_mmc_clk = rockchip_dwmmc_get_mmc_clk;
host->priv = dev;
#include <common.h>
#include <dm.h>
#include <dt-structs.h>
-#include <fdtdec.h>
#include <libfdt.h>
#include <malloc.h>
#include <mapmem.h>
struct dtd_rockchip_rk3399_sdhci_5_1 *dtplat = &plat->dtplat;
host->name = dev->name;
- host->ioaddr = map_sysmem(dtplat->reg[1], dtplat->reg[3]);
+ host->ioaddr = map_sysmem(dtplat->reg[0], dtplat->reg[1]);
max_frequency = dtplat->max_frequency;
ret = clk_get_by_index_platdata(dev, 0, dtplat->clocks, &clk);
#else
struct sdhci_host *host = dev_get_priv(dev);
host->name = dev->name;
- host->ioaddr = devfdt_get_addr_ptr(dev);
+ host->ioaddr = dev_read_addr_ptr(dev);
#endif
return 0;
#include <mmc.h>
#include <dm.h>
#include <linux/compat.h>
+#include <linux/dma-direction.h>
#include <linux/io.h>
#include <linux/sizes.h>
#include <asm/unaligned.h>
-#include <asm/dma-mapping.h>
DECLARE_GLOBAL_DATA_PTR;
#include <malloc.h>
#include <nand.h>
#include <linux/errno.h>
-#include <asm/io.h>
+#include <linux/io.h>
#include "denali.h"
*/
static void detect_max_banks(struct denali_nand_info *denali)
{
- uint32_t features = readl(denali->flash_reg + FEATURES);
- /*
- * Read the revision register, so we can calculate the max_banks
- * properly: the encoding changed from rev 5.0 to 5.1
- */
- u32 revision = MAKE_COMPARABLE_REVISION(
- readl(denali->flash_reg + REVISION));
- if (revision < REVISION_5_1)
- denali->max_banks = 2 << (features & FEATURES__N_BANKS);
- else
- denali->max_banks = 1 << (features & FEATURES__N_BANKS);
+ uint32_t features = ioread32(denali->flash_reg + FEATURES);
+
+ denali->max_banks = 1 << (features & FEATURES__N_BANKS);
+
+ /* the encoding changed from rev 5.0 to 5.1 */
+ if (denali->revision < 0x0501)
+ denali->max_banks <<= 1;
}
static void detect_partition_feature(struct denali_nand_info *denali)
/* Initialization code to bring the device up to a known good state */
static void denali_hw_init(struct denali_nand_info *denali)
{
+ /*
+ * The REVISION register may not be reliable. Platforms are allowed to
+ * override it.
+ */
+ if (!denali->revision)
+ denali->revision = swab16(ioread32(denali->flash_reg + REVISION));
+
/*
* tell driver how many bit controller will skip before writing
* ECC code in OOB. This is normally used for bad block marker
#define REVISION 0x370
#define REVISION__VALUE 0xffff
-#define MAKE_COMPARABLE_REVISION(x) swab16((x) & REVISION__VALUE)
-#define REVISION_5_1 0x00000501
#define ONFI_DEVICE_FEATURES 0x380
#define ONFI_DEVICE_FEATURES__VALUE 0x003f
uint32_t blksperchip;
uint32_t bbtskipbytes;
uint32_t max_banks;
+ unsigned int revision;
+ unsigned int caps;
};
+#define DENALI_CAP_HW_ECC_FIXUP BIT(0)
+#define DENALI_CAP_DMA_64BIT BIT(1)
+
int denali_init(struct denali_nand_info *denali);
#endif /* __DENALI_H__ */
#include "denali.h"
+struct denali_dt_data {
+ unsigned int revision;
+ unsigned int caps;
+};
+
+static const struct denali_dt_data denali_socfpga_data = {
+ .caps = DENALI_CAP_HW_ECC_FIXUP,
+};
+
+static const struct denali_dt_data denali_uniphier_v5a_data = {
+ .caps = DENALI_CAP_HW_ECC_FIXUP |
+ DENALI_CAP_DMA_64BIT,
+};
+
+static const struct denali_dt_data denali_uniphier_v5b_data = {
+ .revision = 0x0501,
+ .caps = DENALI_CAP_HW_ECC_FIXUP |
+ DENALI_CAP_DMA_64BIT,
+};
+
static const struct udevice_id denali_nand_dt_ids[] = {
{
.compatible = "altr,socfpga-denali-nand",
+ .data = (unsigned long)&denali_socfpga_data,
},
{
.compatible = "socionext,uniphier-denali-nand-v5a",
+ .data = (unsigned long)&denali_uniphier_v5a_data,
},
{
.compatible = "socionext,uniphier-denali-nand-v5b",
+ .data = (unsigned long)&denali_uniphier_v5b_data,
},
{ /* sentinel */ }
};
static int denali_dt_probe(struct udevice *dev)
{
struct denali_nand_info *denali = dev_get_priv(dev);
+ const struct denali_dt_data *data;
struct resource res;
int ret;
+ data = (void *)dev_get_driver_data(dev);
+ if (data) {
+ denali->revision = data->revision;
+ denali->caps = data->caps;
+ }
+
ret = dev_read_resource_byname(dev, "denali_reg", &res);
if (ret)
return ret;
{"mx25l51235f", INFO(0xc2201a, 0x0, 64 * 1024, 1024, RD_FULL | WR_QPP) },
{"mx25u6435f", INFO(0xc22537, 0x0, 64 * 1024, 128, RD_FULL | WR_QPP) },
{"mx25l12855e", INFO(0xc22618, 0x0, 64 * 1024, 256, RD_FULL | WR_QPP) },
+ {"mx25u1635e", INFO(0xc22535, 0x0, 64 * 1024, 32, SECT_4K) },
{"mx66u51235f", INFO(0xc2253a, 0x0, 64 * 1024, 1024, RD_FULL | WR_QPP) },
{"mx66l1g45g", INFO(0xc2201b, 0x0, 64 * 1024, 2048, RD_FULL | WR_QPP) },
#endif
#endif
struct eth_pdata *pdata = &dw_pdata->eth_pdata;
const char *phy_mode;
- const fdt32_t *cell;
#ifdef CONFIG_DM_GPIO
int reset_flags = GPIOD_IS_OUT;
#endif
int ret = 0;
- pdata->iobase = devfdt_get_addr(dev);
+ pdata->iobase = dev_read_addr(dev);
pdata->phy_interface = -1;
- phy_mode = fdt_getprop(gd->fdt_blob, dev_of_offset(dev), "phy-mode",
- NULL);
+ phy_mode = dev_read_string(dev, "phy-mode");
if (phy_mode)
pdata->phy_interface = phy_get_interface_by_name(phy_mode);
if (pdata->phy_interface == -1) {
return -EINVAL;
}
- pdata->max_speed = 0;
- cell = fdt_getprop(gd->fdt_blob, dev_of_offset(dev), "max-speed", NULL);
- if (cell)
- pdata->max_speed = fdt32_to_cpu(*cell);
+ pdata->max_speed = dev_read_u32_default(dev, "max-speed", 0);
#ifdef CONFIG_DM_GPIO
if (dev_read_bool(dev, "snps,reset-active-low"))
mmc_init(mmc);
(void)mmc->block_dev.block_read(&mmc->block_dev, blk, cnt,
addr);
- /* flush cache after read */
- flush_cache((ulong)addr, cnt * 512);
}
#elif defined(CONFIG_SYS_QE_FMAN_FW_IN_REMOTE)
void *addr = (void *)CONFIG_SYS_FMAN_FW_ADDR;
return mc_dpl_applied;
}
-/**
+/*
* Return the MC address of private DRAM block.
+ * As per MC design document, MC initial base address
+ * should be least significant 512MB address of MC private
+ * memory, i.e. address should point to end address masked
+ * with 512MB offset in private DRAM block.
*/
u64 mc_get_dram_addr(void)
{
- return gd->arch.resv_ram;
+ size_t mc_ram_size = mc_get_dram_block_size();
+
+ return (gd->arch.resv_ram + mc_ram_size - 1) &
+ MC_RAM_BASE_ADDR_ALIGNMENT_MASK;
}
/**
writel (FTMAC100_MACCR_SW_RST, &ftmac100->maccr);
while (readl (&ftmac100->maccr) & FTMAC100_MACCR_SW_RST)
- ;
+ mdelay(1);
+ /*
+ * When soft reset complete, write mac address immediately maybe fail somehow
+ * Wait for a while can avoid this problem
+ */
+ mdelay(1);
}
/*
struct ftmac100_rxdes *rxdes = priv->rxdes;
unsigned int maccr;
int i;
-
debug ("%s()\n", __func__);
ftmac100_reset(priv);
unsigned short rxlen;
curr_des = &priv->rxdes[priv->rx_index];
-
if (curr_des->rxdes0 & FTMAC100_RXDES0_RXDMA_OWN)
return 0;
}
rxlen = FTMAC100_RXDES0_RFL (curr_des->rxdes0);
-
+ invalidate_dcache_range(curr_des->rxdes2,curr_des->rxdes2+rxlen);
debug ("%s(): RX buffer %d, %x received\n",
__func__, priv->rx_index, rxlen);
/* initiate a transmit sequence */
+ flush_dcache_range((u32)packet,(u32)packet+length);
curr_des->txdes2 = (unsigned int)packet; /* TXBUF_BADR */
curr_des->txdes1 &= FTMAC100_TXDES1_EDOTR;
obj-y += ldpaa_wriop.o
obj-y += ldpaa_eth.o
obj-$(CONFIG_ARCH_LS2080A) += ls2080a.o
+obj-$(CONFIG_ARCH_LS1088A) += ls1088a.o
}
}
+void wriop_init_dpmac_enet_if(int dpmac_id, phy_interface_t enet_if)
+{
+ dpmac_info[dpmac_id].enabled = 1;
+ dpmac_info[dpmac_id].id = dpmac_id;
+ dpmac_info[dpmac_id].phy_addr = -1;
+ dpmac_info[dpmac_id].enet_if = enet_if;
+}
+
+
/*TODO what it do */
static int wriop_dpmac_to_index(int dpmac_id)
{
--- /dev/null
+/*
+ * Copyright 2017 NXP
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+#include <common.h>
+#include <phy.h>
+#include <fsl-mc/ldpaa_wriop.h>
+#include <asm/io.h>
+#include <asm/arch/fsl_serdes.h>
+#include <asm/arch/soc.h>
+
+u32 dpmac_to_devdisr[] = {
+ [WRIOP1_DPMAC1] = FSL_CHASSIS3_DEVDISR2_DPMAC1,
+ [WRIOP1_DPMAC2] = FSL_CHASSIS3_DEVDISR2_DPMAC2,
+ [WRIOP1_DPMAC3] = FSL_CHASSIS3_DEVDISR2_DPMAC3,
+ [WRIOP1_DPMAC4] = FSL_CHASSIS3_DEVDISR2_DPMAC4,
+ [WRIOP1_DPMAC5] = FSL_CHASSIS3_DEVDISR2_DPMAC5,
+ [WRIOP1_DPMAC6] = FSL_CHASSIS3_DEVDISR2_DPMAC6,
+ [WRIOP1_DPMAC7] = FSL_CHASSIS3_DEVDISR2_DPMAC7,
+ [WRIOP1_DPMAC8] = FSL_CHASSIS3_DEVDISR2_DPMAC8,
+ [WRIOP1_DPMAC9] = FSL_CHASSIS3_DEVDISR2_DPMAC9,
+ [WRIOP1_DPMAC10] = FSL_CHASSIS3_DEVDISR2_DPMAC10,
+};
+
+static int is_device_disabled(int dpmac_id)
+{
+ struct ccsr_gur __iomem *gur = (void *)CONFIG_SYS_FSL_GUTS_ADDR;
+ u32 devdisr2 = in_le32(&gur->devdisr2);
+
+ return dpmac_to_devdisr[dpmac_id] & devdisr2;
+}
+
+void wriop_dpmac_disable(int dpmac_id)
+{
+ struct ccsr_gur __iomem *gur = (void *)CONFIG_SYS_FSL_GUTS_ADDR;
+
+ setbits_le32(&gur->devdisr2, dpmac_to_devdisr[dpmac_id]);
+}
+
+void wriop_dpmac_enable(int dpmac_id)
+{
+ struct ccsr_gur __iomem *gur = (void *)CONFIG_SYS_FSL_GUTS_ADDR;
+
+ clrbits_le32(&gur->devdisr2, dpmac_to_devdisr[dpmac_id]);
+}
+
+phy_interface_t wriop_dpmac_enet_if(int dpmac_id, int lane_prtcl)
+{
+ enum srds_prtcl;
+
+ if (is_device_disabled(dpmac_id + 1))
+ return PHY_INTERFACE_MODE_NONE;
+
+ switch (lane_prtcl) {
+ case SGMII1:
+ case SGMII2:
+ case SGMII3:
+ case SGMII7:
+ return PHY_INTERFACE_MODE_SGMII;
+ }
+
+ if (lane_prtcl >= XFI1 && lane_prtcl <= XFI2)
+ return PHY_INTERFACE_MODE_XGMII;
+
+ if (lane_prtcl >= QSGMII_A && lane_prtcl <= QSGMII_B)
+ return PHY_INTERFACE_MODE_QSGMII;
+
+ return PHY_INTERFACE_MODE_NONE;
+}
+
+void wriop_init_dpmac_qsgmii(int sd, int lane_prtcl)
+{
+ switch (lane_prtcl) {
+ case QSGMII_A:
+ wriop_init_dpmac(sd, 3, (int)lane_prtcl);
+ wriop_init_dpmac(sd, 4, (int)lane_prtcl);
+ wriop_init_dpmac(sd, 5, (int)lane_prtcl);
+ wriop_init_dpmac(sd, 6, (int)lane_prtcl);
+ break;
+ case QSGMII_B:
+ wriop_init_dpmac(sd, 7, (int)lane_prtcl);
+ wriop_init_dpmac(sd, 8, (int)lane_prtcl);
+ wriop_init_dpmac(sd, 9, (int)lane_prtcl);
+ wriop_init_dpmac(sd, 10, (int)lane_prtcl);
+ break;
+ }
+}
+
+#ifdef CONFIG_SYS_FSL_HAS_RGMII
+void fsl_rgmii_init(void)
+{
+ struct ccsr_gur __iomem *gur = (void *)(CONFIG_SYS_FSL_GUTS_ADDR);
+ u32 ec;
+
+#ifdef CONFIG_SYS_FSL_EC1
+ ec = gur_in32(&gur->rcwsr[FSL_CHASSIS3_EC1_REGSR - 1])
+ & FSL_CHASSIS3_RCWSR25_EC1_PRTCL_MASK;
+ ec >>= FSL_CHASSIS3_RCWSR25_EC1_PRTCL_SHIFT;
+
+ if (!ec)
+ wriop_init_dpmac_enet_if(4, PHY_INTERFACE_MODE_RGMII);
+#endif
+
+#ifdef CONFIG_SYS_FSL_EC2
+ ec = gur_in32(&gur->rcwsr[FSL_CHASSIS3_EC2_REGSR - 1])
+ & FSL_CHASSIS3_RCWSR25_EC2_PRTCL_MASK;
+ ec >>= FSL_CHASSIS3_RCWSR25_EC2_PRTCL_SHIFT;
+
+ if (!ec)
+ wriop_init_dpmac_enet_if(5, PHY_INTERFACE_MODE_RGMII);
+#endif
+}
+#endif
mmc_init(mmc);
(void)mmc->block_dev.block_read(&mmc->block_dev, blk, cnt,
addr);
- /* flush cache after read */
- flush_cache((ulong)addr, cnt * 512);
}
#endif
* (C) Copyright 2017 Adaptrum, Inc.
* Written by Alexandru Gagniuc <alex.g@adaptrum.com> for Adaptrum, Inc.
*/
+
#include <config.h>
#include <common.h>
#include <dm.h>
#include <errno.h>
-#include <fdtdec.h>
#include <micrel.h>
#include <phy.h>
return -EOPNOTSUPP;
for (i = 0; i < ofcfg->grpsz; i++) {
- val[i] = fdtdec_get_uint(gd->fdt_blob, dev_of_offset(dev),
- ofcfg->grp[i].name, -1);
+ val[i] = dev_read_u32_default(dev, ofcfg->grp[i].name, ~0);
offset = ofcfg->grp[i].off;
if (val[i] == -1) {
/* Default register value for KSZ9021 */
#include <common.h>
#include <dm.h>
#include <dm/pinctrl.h>
+#include <asm/hardware.h>
#include <linux/io.h>
#include <linux/err.h>
#include <mach/at91_pio.h>
u32 cell[3];
int ret;
- ret = fdtdec_get_int_array(gd->fdt_blob, dev_of_offset(periph),
- "interrupts", cell, ARRAY_SIZE(cell));
+ ret = dev_read_u32_array(periph, "interrupts", cell, ARRAY_SIZE(cell));
if (ret < 0)
return -EINVAL;
}
#endif
-int palmas_mmc1_poweron_ldo(uint voltage)
+int palmas_mmc1_poweron_ldo(uint ldo_volt, uint ldo_ctrl, uint voltage)
{
u8 val = 0;
#if defined(CONFIG_DRA7XX)
int ret;
- /*
- * Currently valid for the dra7xx_evm board:
- * Set TPS659038 LDO1 to 3.0 V or 1.8V
- */
- ret = palmas_i2c_write_u8(TPS65903X_CHIP_P1, LDO1_VOLTAGE, voltage);
+
+ ret = palmas_i2c_write_u8(TPS65903X_CHIP_P1, ldo_volt, voltage);
if (ret) {
printf("tps65903x: could not set LDO1 voltage.\n");
return ret;
}
/* TURN ON LDO1 */
val = RSC_MODE_SLEEP | RSC_MODE_ACTIVE;
- ret = palmas_i2c_write_u8(TPS65903X_CHIP_P1, LDO1_CTRL, val);
+ ret = palmas_i2c_write_u8(TPS65903X_CHIP_P1, ldo_ctrl, val);
if (ret) {
printf("tps65903x: could not turn on LDO1.\n");
return ret;
debug("%s for '%s' at node offset: %d\n", __func__, pmic->name,
dev_of_offset(pmic));
- for (node = ofnode_first_subnode(parent);
- ofnode_valid(node);
- node = ofnode_next_subnode(node)) {
+ ofnode_for_each_subnode(node, parent) {
node_name = ofnode_get_name(node);
debug("* Found child node: '%s'\n", node_name);
#include <common.h>
#include <dm.h>
#include <errno.h>
-#include <fdtdec.h>
-#include <libfdt.h>
#include <power/rk8xx_pmic.h>
#include <power/pmic.h>
mmc_init(mmc);
(void)mmc->block_dev.block_read(&mmc->block_dev, blk, cnt,
addr);
- /* flush cache after read */
- flush_cache((ulong)addr, cnt * 512);
}
#endif
- u_qe_upload_firmware(addr);
- out_be32(&qe_immr->iram.iready, QE_IRAM_READY);
+ if (!u_qe_upload_firmware(addr))
+ out_be32(&qe_immr->iram.iready, QE_IRAM_READY);
#ifdef CONFIG_SYS_QE_FMAN_FW_IN_MMC
free(addr);
#endif
{
struct rk3368_sdram_params *plat = dev_get_platdata(dev);
struct dtd_rockchip_rk3368_dmc *of_plat = &plat->of_plat;
- int ret;
plat->ddr_freq = of_plat->rockchip_ddr_frequency;
plat->ddr_speed_bin = of_plat->rockchip_ddr_speed_bin;
plat->memory_schedule = of_plat->rockchip_memory_schedule;
- ret = regmap_init_mem_platdata(dev, of_plat->reg,
- ARRAY_SIZE(of_plat->reg) / 2,
- &plat->map);
- if (ret)
- return ret;
-
return 0;
}
#endif
debug("%s: pmugrf=%p\n", __func__, priv->pmugrf);
#ifdef CONFIG_TPL_BUILD
- pctl = regmap_get_range(plat->map, 0);
- ddrphy = regmap_get_range(plat->map, 1);
+ pctl = (struct rk3368_ddr_pctl *)plat->of_plat.reg[0];
+ ddrphy = (struct rk3368_ddrphy *)plat->of_plat.reg[2];
msch = syscon_get_first_range(ROCKCHIP_SYSCON_MSCH);
grf = syscon_get_first_range(ROCKCHIP_SYSCON_GRF);
*/
snprintf(str, sizeof(str), "id%dlun%d", id, lun);
ret = blk_create_devicef(dev, "scsi_blk", str, IF_TYPE_SCSI, -1,
- bd.blksz, bd.blksz * bd.lba, &bdev);
+ bd.blksz, bd.lba, &bdev);
if (ret) {
debug("Can't create device\n");
return ret;
If you have a machine based on a Motorola IMX CPU you
can enable its onboard serial port by enabling this option.
+config NULLDEV_SERIAL
+ bool "Null serial device"
+ help
+ Select this to enable null serial device support. A null serial
+ device merely acts as a placeholder for a serial device and does
+ nothing for all it's operation.
+
config PIC32_SERIAL
bool "Support for Microchip PIC32 on-chip UART"
depends on DM_SERIAL && MACH_PIC32
obj-$(CONFIG_MSM_SERIAL) += serial_msm.o
obj-$(CONFIG_MVEBU_A3700_UART) += serial_mvebu_a3700.o
obj-$(CONFIG_MPC8XX_CONS) += serial_mpc8xx.o
+obj-$(CONFIG_NULLDEV_SERIAL) += serial_nulldev.o
ifndef CONFIG_SPL_BUILD
obj-$(CONFIG_USB_TTY) += usbtty.o
--- /dev/null
+/*
+ * Copyright (c) 2015 National Instruments
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
+#include <dm.h>
+#include <serial.h>
+
+static int nulldev_serial_setbrg(struct udevice *dev, int baudrate)
+{
+ return 0;
+}
+
+static int nulldev_serial_getc(struct udevice *dev)
+{
+ return -EAGAIN;
+}
+
+static int nulldev_serial_input(struct udevice *dev)
+{
+ return 0;
+}
+
+static int nulldev_serial_putc(struct udevice *dev, const char ch)
+{
+ return 0;
+}
+
+static const struct udevice_id nulldev_serial_ids[] = {
+ { .compatible = "nulldev-serial" },
+ { }
+};
+
+
+const struct dm_serial_ops nulldev_serial_ops = {
+ .putc = nulldev_serial_putc,
+ .getc = nulldev_serial_getc,
+ .setbrg = nulldev_serial_setbrg,
+};
+
+U_BOOT_DRIVER(serial_nulldev) = {
+ .name = "serial_nulldev",
+ .id = UCLASS_SERIAL,
+ .of_match = nulldev_serial_ids,
+ .ops = &nulldev_serial_ops,
+};
used to access the SPI NOR flash on platforms embedding this
Freescale IP core.
+config NDS_AE3XX_SPI
+ bool "Andestech AE3XX SPI driver"
+ help
+ Enable the Andestech AE3XX SPI driver. This driver can be
+ used to access the SPI flash on platforms embedding this
+ Andestech IP core.
+
config TI_QSPI
bool "TI QSPI driver"
help
obj-$(CONFIG_MVEBU_A3700_SPI) += mvebu_a3700_spi.o
obj-$(CONFIG_MXC_SPI) += mxc_spi.o
obj-$(CONFIG_MXS_SPI) += mxs_spi.o
+obj-$(CONFIG_NDS_AE3XX_SPI) += nds_ae3xx_spi.o
obj-$(CONFIG_OMAP3_SPI) += omap3_spi.o
obj-$(CONFIG_PIC32_SPI) += pic32_spi.o
obj-$(CONFIG_ROCKCHIP_SPI) += rk_spi.o
--- /dev/null
+/*
+ * NDS SPI controller driver.
+ *
+ * Copyright 2017 Andes Technology, Inc.
+ * Author: Rick Chen (rick@andestech.com)
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <clk.h>
+#include <common.h>
+#include <malloc.h>
+#include <spi.h>
+#include <asm/io.h>
+#include <dm.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define MAX_TRANSFER_LEN 512
+#define CHUNK_SIZE 1
+#define SPI_TIMEOUT 0x100000
+#define SPI0_BUS 0
+#define SPI1_BUS 1
+#define SPI0_BASE 0xf0b00000
+#define SPI1_BASE 0xf0f00000
+#define NSPI_MAX_CS_NUM 1
+
+struct ae3xx_spi_regs {
+ u32 rev;
+ u32 reserve1[3];
+ u32 format; /* 0x10 */
+#define DATA_LENGTH(x) ((x-1)<<8)
+ u32 pio;
+ u32 reserve2[2];
+ u32 tctrl; /* 0x20 */
+#define TRAMODE_OFFSET 24
+#define TRAMODE_MASK (0x0F<<TRAMODE_OFFSET)
+#define TRAMODE_WR_SYNC (0<<TRAMODE_OFFSET)
+#define TRAMODE_WO (1<<TRAMODE_OFFSET)
+#define TRAMODE_RO (2<<TRAMODE_OFFSET)
+#define TRAMODE_WR (3<<TRAMODE_OFFSET)
+#define TRAMODE_RW (4<<TRAMODE_OFFSET)
+#define TRAMODE_WDR (5<<TRAMODE_OFFSET)
+#define TRAMODE_RDW (6<<TRAMODE_OFFSET)
+#define TRAMODE_NONE (7<<TRAMODE_OFFSET)
+#define TRAMODE_DW (8<<TRAMODE_OFFSET)
+#define TRAMODE_DR (9<<TRAMODE_OFFSET)
+#define WCNT_OFFSET 12
+#define WCNT_MASK (0x1FF<<WCNT_OFFSET)
+#define RCNT_OFFSET 0
+#define RCNT_MASK (0x1FF<<RCNT_OFFSET)
+ u32 cmd;
+ u32 addr;
+ u32 data;
+ u32 ctrl; /* 0x30 */
+#define TXFTH_OFFSET 16
+#define RXFTH_OFFSET 8
+#define TXDMAEN (1<<4)
+#define RXDMAEN (1<<3)
+#define TXFRST (1<<2)
+#define RXFRST (1<<1)
+#define SPIRST (1<<0)
+ u32 status;
+#define TXFFL (1<<23)
+#define TXEPTY (1<<22)
+#define TXFVE_MASK (0x1F<<16)
+#define RXFEM (1<<14)
+#define RXFVE_OFFSET (8)
+#define RXFVE_MASK (0x1F<<RXFVE_OFFSET)
+#define SPIBSY (1<<0)
+ u32 inten;
+ u32 intsta;
+ u32 timing; /* 0x40 */
+#define SCLK_DIV_MASK 0xFF
+};
+
+struct nds_spi_slave {
+#ifndef CONFIG_DM_SPI
+ struct spi_slave slave;
+#endif
+ volatile struct ae3xx_spi_regs *regs;
+ int to;
+ unsigned int freq;
+ ulong clock;
+ unsigned int mode;
+ u8 num_cs;
+ unsigned int mtiming;
+ size_t cmd_len;
+ u8 cmd_buf[16];
+ size_t data_len;
+ size_t tran_len;
+ u8 *din;
+ u8 *dout;
+ unsigned int max_transfer_length;
+};
+
+static int __ae3xx_spi_set_speed(struct nds_spi_slave *ns)
+{
+ u32 tm;
+ u8 div;
+ tm = ns->regs->timing;
+ tm &= ~SCLK_DIV_MASK;
+
+ if(ns->freq >= ns->clock)
+ div =0xff;
+ else{
+ for (div = 0; div < 0xff; div++) {
+ if (ns->freq >= ns->clock / (2 * (div + 1)))
+ break;
+ }
+ }
+
+ tm |= div;
+ ns->regs->timing = tm;
+
+ return 0;
+
+}
+
+static int __ae3xx_spi_claim_bus(struct nds_spi_slave *ns)
+{
+ unsigned int format=0;
+ ns->regs->ctrl |= (TXFRST|RXFRST|SPIRST);
+ while((ns->regs->ctrl &(TXFRST|RXFRST|SPIRST))&&(ns->to--))
+ if(!ns->to)
+ return -EINVAL;
+
+ ns->cmd_len = 0;
+ format = ns->mode|DATA_LENGTH(8);
+ ns->regs->format = format;
+ __ae3xx_spi_set_speed(ns);
+
+ return 0;
+}
+
+static int __ae3xx_spi_release_bus(struct nds_spi_slave *ns)
+{
+ /* do nothing */
+ return 0;
+}
+
+static int __ae3xx_spi_start(struct nds_spi_slave *ns)
+{
+ int i,olen=0;
+ int tc = ns->regs->tctrl;
+
+ tc &= ~(WCNT_MASK|RCNT_MASK|TRAMODE_MASK);
+ if ((ns->din)&&(ns->cmd_len))
+ tc |= TRAMODE_WR;
+ else if (ns->din)
+ tc |= TRAMODE_RO;
+ else
+ tc |= TRAMODE_WO;
+
+ if(ns->dout)
+ olen = ns->tran_len;
+ tc |= (ns->cmd_len+olen-1) << WCNT_OFFSET;
+
+ if(ns->din)
+ tc |= (ns->tran_len-1) << RCNT_OFFSET;
+
+ ns->regs->tctrl = tc;
+ ns->regs->cmd = 1;
+
+ for (i=0;i<ns->cmd_len;i++)
+ ns->regs->data = ns->cmd_buf[i];
+
+ return 0;
+}
+
+static int __ae3xx_spi_stop(struct nds_spi_slave *ns)
+{
+ ns->regs->timing = ns->mtiming;
+ while ((ns->regs->status & SPIBSY)&&(ns->to--))
+ if (!ns->to)
+ return -EINVAL;
+
+ return 0;
+}
+
+static void __nspi_espi_tx(struct nds_spi_slave *ns, const void *dout)
+{
+ ns->regs->data = *(u8 *)dout;
+}
+
+static int __nspi_espi_rx(struct nds_spi_slave *ns, void *din, unsigned int bytes)
+{
+ *(u8 *)din = ns->regs->data;
+ return bytes;
+}
+
+
+static int __ae3xx_spi_xfer(struct nds_spi_slave *ns,
+ unsigned int bitlen, const void *data_out, void *data_in,
+ unsigned long flags)
+{
+ unsigned int event, rx_bytes;
+ const void *dout = NULL;
+ void *din = NULL;
+ int num_blks, num_chunks, max_tran_len, tran_len;
+ int num_bytes;
+ u8 *cmd_buf = ns->cmd_buf;
+ size_t cmd_len = ns->cmd_len;
+ size_t data_len = bitlen / 8;
+ int rf_cnt;
+ int ret = 0;
+
+ max_tran_len = ns->max_transfer_length;
+ switch (flags) {
+ case SPI_XFER_BEGIN:
+ cmd_len = ns->cmd_len = data_len;
+ memcpy(cmd_buf, data_out, cmd_len);
+ return 0;
+
+ case 0:
+ case SPI_XFER_END:
+ if (bitlen == 0) {
+ return 0;
+ }
+ ns->data_len = data_len;
+ ns->din = (u8 *)data_in;
+ ns->dout = (u8 *)data_out;
+ break;
+
+ case SPI_XFER_BEGIN | SPI_XFER_END:
+ ns->data_len = 0;
+ ns->din = 0;
+ ns->dout = 0;
+ cmd_len = ns->cmd_len = data_len;
+ memcpy(cmd_buf, data_out, cmd_len);
+ data_out = 0;
+ data_len = 0;
+ __ae3xx_spi_start(ns);
+ break;
+ }
+ debug("spi_xfer: data_out %08X(%p) data_in %08X(%p) data_len %u\n",
+ *(uint *)data_out, data_out, *(uint *)data_in, data_in, data_len);
+ num_chunks = DIV_ROUND_UP(data_len, max_tran_len);
+ din = data_in;
+ dout = data_out;
+ while (num_chunks--) {
+ tran_len = min(data_len, (size_t)max_tran_len);
+ ns->tran_len = tran_len;
+ num_blks = DIV_ROUND_UP(tran_len , CHUNK_SIZE);
+ num_bytes = (tran_len) % CHUNK_SIZE;
+ if(num_bytes == 0)
+ num_bytes = CHUNK_SIZE;
+ __ae3xx_spi_start(ns);
+
+ while (num_blks) {
+ event = in_le32(&ns->regs->status);
+ if ((event & TXEPTY) && (data_out)) {
+ __nspi_espi_tx(ns, dout);
+ num_blks -= CHUNK_SIZE;
+ dout += CHUNK_SIZE;
+ }
+
+ if ((event & RXFVE_MASK) && (data_in)) {
+ rf_cnt = ((event & RXFVE_MASK)>> RXFVE_OFFSET);
+ if (rf_cnt >= CHUNK_SIZE)
+ rx_bytes = CHUNK_SIZE;
+ else if (num_blks == 1 && rf_cnt == num_bytes)
+ rx_bytes = num_bytes;
+ else
+ continue;
+
+ if (__nspi_espi_rx(ns, din, rx_bytes) == rx_bytes) {
+ num_blks -= CHUNK_SIZE;
+ din = (unsigned char *)din + rx_bytes;
+ }
+ }
+ }
+
+ data_len -= tran_len;
+ if(data_len)
+ {
+ ns->cmd_buf[1] += ((tran_len>>16)&0xff);
+ ns->cmd_buf[2] += ((tran_len>>8)&0xff);
+ ns->cmd_buf[3] += ((tran_len)&0xff);
+ ns->data_len = data_len;
+ }
+ ret = __ae3xx_spi_stop(ns);
+ }
+ ret = __ae3xx_spi_stop(ns);
+
+ return ret;
+}
+
+#ifndef CONFIG_DM_SPI
+#define to_nds_spi_slave(s) container_of(s, struct nds_spi_slave, slave)
+struct spi_slave *spi_setup_slave(unsigned int bus, unsigned int cs,
+ unsigned int max_hz, unsigned int mode)
+{
+ struct nds_spi_slave *ns;
+
+ if (!spi_cs_is_valid(bus, cs))
+ return NULL;
+
+ ns = spi_alloc_slave(struct nds_spi_slave, bus, cs);
+
+ switch (bus) {
+ case SPI0_BUS:
+ ns->regs = (struct ae3xx_spi_regs *)SPI0_BASE;
+ break;
+
+ case SPI1_BUS:
+ ns->regs = (struct ae3xx_spi_regs *)SPI1_BASE;
+ break;
+
+ default:
+ return NULL;
+ }
+
+ ns->freq= max_hz;
+ ns->mode = mode;
+ ns->to = SPI_TIMEOUT;
+ ns->max_transfer_length = MAX_TRANSFER_LEN;
+ ns->slave.max_write_size = MAX_TRANSFER_LEN;
+ if (!ns)
+ return NULL;
+
+ return &ns->slave;
+}
+
+void spi_free_slave(struct spi_slave *slave)
+{
+ struct nds_spi_slave *ns = to_nds_spi_slave(slave);
+ free(ns);
+}
+
+void spi_init(void)
+{
+ /* do nothing */
+}
+
+int spi_claim_bus(struct spi_slave *slave)
+{
+ struct nds_spi_slave *ns = to_nds_spi_slave(slave);
+ return __ae3xx_spi_claim_bus(ns);
+}
+
+void spi_release_bus(struct spi_slave *slave)
+{
+ struct nds_spi_slave *ns = to_nds_spi_slave(slave);
+ __ae3xx_spi_release_bus(ns);
+}
+
+int spi_xfer(struct spi_slave *slave, unsigned int bitlen, const void *data_out,
+ void *data_in, unsigned long flags)
+{
+ struct nds_spi_slave *ns = to_nds_spi_slave(slave);
+ return __ae3xx_spi_xfer(ns, bitlen, data_out, data_in, flags);
+}
+
+int spi_cs_is_valid(unsigned int bus, unsigned int cs)
+{
+ return bus == 0 && cs < NSPI_MAX_CS_NUM;
+}
+
+void spi_cs_activate(struct spi_slave *slave)
+{
+ struct nds_spi_slave *ns = to_nds_spi_slave(slave);
+ __ae3xx_spi_start(ns);
+}
+
+void spi_cs_deactivate(struct spi_slave *slave)
+{
+ struct nds_spi_slave *ns = to_nds_spi_slave(slave);
+ __ae3xx_spi_stop(ns);
+}
+#else
+static int ae3xx_spi_set_speed(struct udevice *bus, uint max_hz)
+{
+ struct nds_spi_slave *ns = dev_get_priv(bus);
+
+ debug("%s speed %u\n", __func__, max_hz);
+
+ ns->freq = max_hz;
+ __ae3xx_spi_set_speed(ns);
+
+ return 0;
+}
+
+static int ae3xx_spi_set_mode(struct udevice *bus, uint mode)
+{
+ struct nds_spi_slave *ns = dev_get_priv(bus);
+
+ debug("%s mode %u\n", __func__, mode);
+ ns->mode = mode;
+
+ return 0;
+}
+
+static int ae3xx_spi_claim_bus(struct udevice *dev)
+{
+ struct dm_spi_slave_platdata *slave_plat =
+ dev_get_parent_platdata(dev);
+ struct udevice *bus = dev->parent;
+ struct nds_spi_slave *ns = dev_get_priv(bus);
+
+ if (slave_plat->cs >= ns->num_cs) {
+ printf("Invalid SPI chipselect\n");
+ return -EINVAL;
+ }
+
+ return __ae3xx_spi_claim_bus(ns);
+}
+
+static int ae3xx_spi_release_bus(struct udevice *dev)
+{
+ struct nds_spi_slave *ns = dev_get_priv(dev->parent);
+
+ return __ae3xx_spi_release_bus(ns);
+}
+
+static int ae3xx_spi_xfer(struct udevice *dev, unsigned int bitlen,
+ const void *dout, void *din,
+ unsigned long flags)
+{
+ struct udevice *bus = dev->parent;
+ struct nds_spi_slave *ns = dev_get_priv(bus);
+
+ return __ae3xx_spi_xfer(ns, bitlen, dout, din, flags);
+}
+
+static int ae3xx_spi_get_clk(struct udevice *bus)
+{
+ struct nds_spi_slave *ns = dev_get_priv(bus);
+ struct clk clk;
+ ulong clk_rate;
+ int ret;
+
+ ret = clk_get_by_index(bus, 0, &clk);
+ if (ret)
+ return -EINVAL;
+
+ clk_rate = clk_get_rate(&clk);
+ if (!clk_rate)
+ return -EINVAL;
+
+ ns->clock = clk_rate;
+ clk_free(&clk);
+
+ return 0;
+}
+
+static int ae3xx_spi_probe(struct udevice *bus)
+{
+ struct nds_spi_slave *ns = dev_get_priv(bus);
+
+ ns->to = SPI_TIMEOUT;
+ ns->max_transfer_length = MAX_TRANSFER_LEN;
+ ns->mtiming = ns->regs->timing;
+ ae3xx_spi_get_clk(bus);
+
+ return 0;
+}
+
+static int ae3xx_ofdata_to_platadata(struct udevice *bus)
+{
+ struct nds_spi_slave *ns = dev_get_priv(bus);
+ const void *blob = gd->fdt_blob;
+ int node = dev_of_offset(bus);
+
+ ns->regs = map_physmem(devfdt_get_addr(bus),
+ sizeof(struct ae3xx_spi_regs),
+ MAP_NOCACHE);
+ if (!ns->regs) {
+ printf("%s: could not map device address\n", __func__);
+ return -EINVAL;
+ }
+ ns->num_cs = fdtdec_get_int(blob, node, "num-cs", 4);
+
+ return 0;
+}
+
+static const struct dm_spi_ops ae3xx_spi_ops = {
+ .claim_bus = ae3xx_spi_claim_bus,
+ .release_bus = ae3xx_spi_release_bus,
+ .xfer = ae3xx_spi_xfer,
+ .set_speed = ae3xx_spi_set_speed,
+ .set_mode = ae3xx_spi_set_mode,
+};
+
+static const struct udevice_id ae3xx_spi_ids[] = {
+ { .compatible = "andestech,atcspi200" },
+ { }
+};
+
+U_BOOT_DRIVER(ae3xx_spi) = {
+ .name = "ae3xx_spi",
+ .id = UCLASS_SPI,
+ .of_match = ae3xx_spi_ids,
+ .ops = &ae3xx_spi_ops,
+ .ofdata_to_platdata = ae3xx_ofdata_to_platadata,
+ .priv_auto_alloc_size = sizeof(struct nds_spi_slave),
+ .probe = ae3xx_spi_probe,
+};
+#endif
struct rockchip_spi_priv *priv = dev_get_priv(bus);
int ret;
- plat->base = devfdt_get_addr(bus);
+ plat->base = dev_read_addr(bus);
ret = clk_get_by_index(bus, 0, &priv->clk);
if (ret < 0) {
obj-$(CONFIG_ROCKCHIP_RK3036) += sysreset_rk3036.o
endif
obj-$(CONFIG_ROCKCHIP_RK3188) += sysreset_rk3188.o
+obj-$(CONFIG_ROCKCHIP_RK322X) += sysreset_rk322x.o
obj-$(CONFIG_ROCKCHIP_RK3288) += sysreset_rk3288.o
obj-$(CONFIG_ROCKCHIP_RK3328) += sysreset_rk3328.o
obj-$(CONFIG_ROCKCHIP_RK3368) += sysreset_rk3368.o
#include <common.h>
#include <dm.h>
+#include <dm/ofnode.h>
#include <mapmem.h>
#include <asm/arch/timer.h>
#include <dt-structs.h>
struct rk_timer *timer;
};
-static int rockchip_timer_get_count(struct udevice *dev, u64 *count)
+static inline int64_t rockchip_timer_get_curr_value(struct rk_timer *timer)
{
- struct rockchip_timer_priv *priv = dev_get_priv(dev);
uint64_t timebase_h, timebase_l;
uint64_t cntr;
- timebase_l = readl(&priv->timer->timer_curr_value0);
- timebase_h = readl(&priv->timer->timer_curr_value1);
+ timebase_l = readl(&timer->timer_curr_value0);
+ timebase_h = readl(&timer->timer_curr_value1);
- /* timers are down-counting */
cntr = timebase_h << 32 | timebase_l;
+ return cntr;
+}
+
+#if CONFIG_IS_ENABLED(BOOTSTAGE)
+ulong timer_get_boot_us(void)
+{
+ uint64_t ticks = 0;
+ uint32_t rate;
+ uint64_t us;
+ int ret;
+
+ ret = dm_timer_init();
+
+ if (!ret) {
+ /* The timer is available */
+ rate = timer_get_rate(gd->timer);
+ timer_get_count(gd->timer, &ticks);
+#if !CONFIG_IS_ENABLED(OF_PLATDATA)
+ } else if (ret == -EAGAIN) {
+ /* We have been called so early that the DM is not ready,... */
+ ofnode node = offset_to_ofnode(-1);
+ struct rk_timer *timer = NULL;
+
+ /*
+ * ... so we try to access the raw timer, if it is specified
+ * via the tick-timer property in /chosen.
+ */
+ node = ofnode_get_chosen_node("tick-timer");
+ if (!ofnode_valid(node)) {
+ debug("%s: no /chosen/tick-timer\n", __func__);
+ return 0;
+ }
+
+ timer = (struct rk_timer *)ofnode_get_addr(node);
+
+ /* This timer is down-counting */
+ ticks = ~0uLL - rockchip_timer_get_curr_value(timer);
+ if (ofnode_read_u32(node, "clock-frequency", &rate)) {
+ debug("%s: could not read clock-frequency\n", __func__);
+ return 0;
+ }
+#endif
+ } else {
+ return 0;
+ }
+
+ us = (ticks * 1000) / rate;
+ return us;
+}
+#endif
+
+static int rockchip_timer_get_count(struct udevice *dev, u64 *count)
+{
+ struct rockchip_timer_priv *priv = dev_get_priv(dev);
+ uint64_t cntr = rockchip_timer_get_curr_value(priv->timer);
+
+ /* timers are down-counting */
*count = ~0ull - cntr;
return 0;
}
#if !CONFIG_IS_ENABLED(OF_PLATDATA)
struct rockchip_timer_priv *priv = dev_get_priv(dev);
- priv->timer = (struct rk_timer *)devfdt_get_addr(dev);
+ priv->timer = dev_read_addr_ptr(dev);
+ if (!priv->timer)
+ return -ENOENT;
#endif
return 0;
const uint32_t reload_val_l = reload_val & 0xffffffff;
const uint32_t reload_val_h = reload_val >> 32;
+ /* don't reinit, if the timer is already running and set up */
+ if ((readl(&priv->timer->timer_ctrl_reg) & 1) == 1 &&
+ (readl(&priv->timer->timer_load_count0) == reload_val_l) &&
+ (readl(&priv->timer->timer_load_count1) == reload_val_h))
+ return 0;
+
/* disable timer and reset all control */
writel(0, &priv->timer->timer_ctrl_reg);
/* write reload value */
struct rockchip_timer_priv *priv = dev_get_priv(dev);
struct rockchip_timer_plat *plat = dev_get_platdata(dev);
- priv->timer = map_sysmem(plat->dtd.reg[1], plat->dtd.reg[3]);
+ priv->timer = map_sysmem(plat->dtd.reg[0], plat->dtd.reg[1]);
uc_priv->clock_rate = plat->dtd.clock_frequency;
#endif
#include <dm.h>
#include <dm/lists.h>
#include <dm/device-internal.h>
+#include <dm/root.h>
#include <clk.h>
#include <errno.h>
#include <timer.h>
if (IS_ERR_VALUE(ret))
return ret;
uc_priv->clock_rate = ret;
- } else
- uc_priv->clock_rate = fdtdec_get_int(gd->fdt_blob,
- dev_of_offset(dev), "clock-frequency", 0);
+ } else {
+ uc_priv->clock_rate =
+ dev_read_u32_default(dev, "clock-frequency", 0);
+ }
#endif
return 0;
int notrace dm_timer_init(void)
{
- __maybe_unused const void *blob = gd->fdt_blob;
struct udevice *dev = NULL;
- int node = -ENOENT;
+ __maybe_unused ofnode node;
int ret;
if (gd->timer)
return 0;
+ /*
+ * Directly access gd->dm_root to suppress error messages, if the
+ * virtual root driver does not yet exist.
+ */
+ if (gd->dm_root == NULL)
+ return -EAGAIN;
+
#if !CONFIG_IS_ENABLED(OF_PLATDATA)
/* Check for a chosen timer to be used for tick */
- node = fdtdec_get_chosen_node(blob, "tick-timer");
+ node = ofnode_get_chosen_node("tick-timer");
+
+ if (ofnode_valid(node) &&
+ uclass_get_device_by_ofnode(UCLASS_TIMER, node, &dev)) {
+ /*
+ * If the timer is not marked to be bound before
+ * relocation, bind it anyway.
+ */
+ if (!lists_bind_fdt(dm_root(), node, &dev)) {
+ ret = device_probe(dev);
+ if (ret)
+ return ret;
+ }
+ }
#endif
- if (node < 0) {
- /* No chosen timer, trying first available timer */
+
+ if (!dev) {
+ /* Fall back to the first available timer */
ret = uclass_first_device_err(UCLASS_TIMER, &dev);
if (ret)
return ret;
- } else {
- if (uclass_get_device_by_of_offset(UCLASS_TIMER, node, &dev)) {
- /*
- * If the timer is not marked to be bound before
- * relocation, bind it anyway.
- */
- if (node > 0 &&
- !lists_bind_fdt(gd->dm_root, offset_to_ofnode(node),
- &dev)) {
- ret = device_probe(dev);
- if (ret)
- return ret;
- }
- }
}
if (dev) {
#include <asm/msr.h>
#include <asm/u-boot-x86.h>
-#define MAX_NUM_FREQS 8
+#define MAX_NUM_FREQS 9
DECLARE_GLOBAL_DATA_PTR;
static struct freq_desc freq_desc_tables[] = {
/* PNW */
- { 6, 0x27, 0, { 0, 0, 0, 0, 0, 99840, 0, 83200 } },
+ { 6, 0x27, 0, { 0, 0, 0, 0, 0, 99840, 0, 83200, 0 } },
/* CLV+ */
- { 6, 0x35, 0, { 0, 133200, 0, 0, 0, 99840, 0, 83200 } },
+ { 6, 0x35, 0, { 0, 133200, 0, 0, 0, 99840, 0, 83200, 0 } },
/* TNG - Intel Atom processor Z3400 series */
- { 6, 0x4a, 1, { 0, 100000, 133300, 0, 0, 0, 0, 0 } },
+ { 6, 0x4a, 1, { 0, 100000, 133300, 0, 0, 0, 0, 0, 0 } },
/* VLV2 - Intel Atom processor E3000, Z3600, Z3700 series */
- { 6, 0x37, 1, { 83300, 100000, 133300, 116700, 80000, 0, 0, 0 } },
+ { 6, 0x37, 1, { 83300, 100000, 133300, 116700, 80000, 0, 0, 0, 0 } },
/* ANN - Intel Atom processor Z3500 series */
- { 6, 0x5a, 1, { 83300, 100000, 133300, 100000, 0, 0, 0, 0 } },
+ { 6, 0x5a, 1, { 83300, 100000, 133300, 100000, 0, 0, 0, 0, 0 } },
+ /* AMT - Intel Atom processor X7-Z8000 and X5-Z8000 series */
+ { 6, 0x4c, 1, { 83300, 100000, 133300, 116700,
+ 80000, 93300, 90000, 88900, 87500 } },
/* Ivybridge */
- { 6, 0x3a, 2, { 0, 0, 0, 0, 0, 0, 0, 0 } },
+ { 6, 0x3a, 2, { 0, 0, 0, 0, 0, 0, 0, 0, 0 } },
};
static int match_cpu(u8 family, u8 model)
return 0;
}
-static int tsc_timer_probe(struct udevice *dev)
+static void tsc_timer_ensure_setup(void)
{
- struct timer_dev_priv *uc_priv = dev_get_uclass_priv(dev);
-
+ if (gd->arch.tsc_base)
+ return;
gd->arch.tsc_base = rdtsc();
/*
* If there is no clock frequency specified in the device tree,
* calibrate it by ourselves.
*/
- if (!uc_priv->clock_rate) {
+ if (!gd->arch.clock_rate) {
unsigned long fast_calibrate;
fast_calibrate = cpu_mhz_from_msr();
panic("TSC frequency is ZERO");
}
- uc_priv->clock_rate = fast_calibrate * 1000000;
+ gd->arch.clock_rate = fast_calibrate * 1000000;
}
+}
+
+static int tsc_timer_probe(struct udevice *dev)
+{
+ struct timer_dev_priv *uc_priv = dev_get_uclass_priv(dev);
+
+ tsc_timer_ensure_setup();
+ uc_priv->clock_rate = gd->arch.clock_rate;
return 0;
}
+unsigned long notrace timer_early_get_rate(void)
+{
+ tsc_timer_ensure_setup();
+
+ return gd->arch.clock_rate;
+}
+
+u64 notrace timer_early_get_count(void)
+{
+ return rdtsc() - gd->arch.tsc_base;
+}
+
static const struct timer_ops tsc_timer_ops = {
.get_count = tsc_timer_get_count,
};
#include <linux/errno.h>
#include <asm/arch/imx-regs.h>
#include <asm/arch/crm_regs.h>
+#include <asm/arch/sys_proto.h>
#include <div64.h>
#include "ipu.h"
#include "ipu_regs.h"
#define IPU_SW_RST_TOUT_USEC (10000)
+#define IPUV3_CLK_MX51 133000000
+#define IPUV3_CLK_MX53 200000000
+#define IPUV3_CLK_MX6Q 264000000
+#define IPUV3_CLK_MX6DL 198000000
+
void clk_enable(struct clk *clk)
{
if (clk) {
static struct clk ipu_clk = {
.name = "ipu_clk",
- .rate = CONFIG_IPUV3_CLK,
#if defined(CONFIG_MX51) || defined(CONFIG_MX53)
.enable_reg = (u32 *)(CCM_BASE_ADDR +
offsetof(struct mxc_ccm_reg, CCGR5)),
g_pixel_clk[1] = &pixel_clk[1];
g_ipu_clk = &ipu_clk;
+#if defined(CONFIG_MX51)
+ g_ipu_clk->rate = IPUV3_CLK_MX51;
+#elif defined(CONFIG_MX53)
+ g_ipu_clk->rate = IPUV3_CLK_MX53;
+#else
+ g_ipu_clk->rate = is_mx6sdl() ? IPUV3_CLK_MX6DL : IPUV3_CLK_MX6Q;
+#endif
debug("ipu_clk = %u\n", clk_get_rate(g_ipu_clk));
g_ldb_clk = &ldb_clk;
debug("ldb_clk = %u\n", clk_get_rate(g_ldb_clk));
EXT_COBJ-y += lib/string.o
EXT_COBJ-y += lib/time.o
EXT_COBJ-y += lib/vsprintf.o
+EXT_COBJ-y += lib/charset.o
+EXT_COBJ-$(CONFIG_LIB_UUID) += lib/uuid.o
EXT_SOBJ-$(CONFIG_PPC) += arch/powerpc/lib/ppcstring.o
ifeq ($(ARCH),arm)
EXT_SOBJ-$(CONFIG_USE_ARCH_MEMSET) += arch/arm/lib/memset.o
{
syscall(API_DISPLAY_CLEAR, NULL);
}
+
+__weak void *memcpy(void *dest, const void *src, size_t size)
+{
+ unsigned char *dptr = dest;
+ const unsigned char *ptr = src;
+ const unsigned char *end = src + size;
+
+ while (ptr < end)
+ *dptr++ = *ptr++;
+
+ return dest;
+}
obj-$(CONFIG_FS_FAT) := fat.o
obj-$(CONFIG_FAT_WRITE):= fat_write.o
-
-ifndef CONFIG_SPL_BUILD
-obj-$(CONFIG_FS_FAT) += file.o
-endif
#include <config.h>
#include <exports.h>
#include <fat.h>
+#include <fs.h>
#include <asm/byteorder.h>
#include <part.h>
#include <malloc.h>
#endif
/*
- * Convert a string to lowercase.
+ * Convert a string to lowercase. Converts at most 'len' characters,
+ * 'len' may be larger than the length of 'str' if 'str' is NULL
+ * terminated.
*/
-static void downcase(char *str)
+static void downcase(char *str, size_t len)
{
- while (*str != '\0') {
+ while (*str != '\0' && len--) {
*str = tolower(*str);
str++;
}
return fat_set_blk_dev(dev_desc, &info);
}
-/*
- * Get the first occurence of a directory delimiter ('/' or '\') in a string.
- * Return index into string if found, -1 otherwise.
- */
-static int dirdelim(char *str)
-{
- char *start = str;
-
- while (*str != '\0') {
- if (ISDIRDELIM(*str))
- return str - start;
- str++;
- }
- return -1;
-}
-
/*
* Extract zero terminated short name from a directory entry.
*/
ptr = s_name;
while (*ptr && *ptr != ' ')
ptr++;
+ if (dirent->lcase & CASE_LOWER_BASE)
+ downcase(s_name, (unsigned)(ptr - s_name));
if (dirent->ext[0] && dirent->ext[0] != ' ') {
- *ptr = '.';
- ptr++;
+ *ptr++ = '.';
memcpy(ptr, dirent->ext, 3);
+ if (dirent->lcase & CASE_LOWER_EXT)
+ downcase(ptr, 3);
ptr[3] = '\0';
while (*ptr && *ptr != ' ')
ptr++;
*s_name = '\0';
else if (*s_name == aRING)
*s_name = DELETED_FLAG;
- downcase(s_name);
}
static int flush_dirty_fat_buffer(fsdata *mydata);
int ret;
if (clustnum > 0) {
- startsect = mydata->data_begin +
- clustnum * mydata->clust_size;
+ startsect = clust_to_sect(mydata, clustnum);
} else {
startsect = mydata->rootdir_sect;
}
return 0;
}
-/*
- * Extract the full long filename starting at 'retdent' (which is really
- * a slot) into 'l_name'. If successful also copy the real directory entry
- * into 'retdent'
- * Return 0 on success, -1 otherwise.
- */
-static int
-get_vfatname(fsdata *mydata, int curclust, __u8 *cluster,
- dir_entry *retdent, char *l_name)
-{
- dir_entry *realdent;
- dir_slot *slotptr = (dir_slot *)retdent;
- __u8 *buflimit = cluster + mydata->sect_size * ((curclust == 0) ?
- PREFETCH_BLOCKS :
- mydata->clust_size);
- __u8 counter = (slotptr->id & ~LAST_LONG_ENTRY_MASK) & 0xff;
- int idx = 0;
-
- if (counter > VFAT_MAXSEQ) {
- debug("Error: VFAT name is too long\n");
- return -1;
- }
-
- while ((__u8 *)slotptr < buflimit) {
- if (counter == 0)
- break;
- if (((slotptr->id & ~LAST_LONG_ENTRY_MASK) & 0xff) != counter)
- return -1;
- slotptr++;
- counter--;
- }
-
- if ((__u8 *)slotptr >= buflimit) {
- dir_slot *slotptr2;
-
- if (curclust == 0)
- return -1;
- curclust = get_fatent(mydata, curclust);
- if (CHECK_CLUST(curclust, mydata->fatsize)) {
- debug("curclust: 0x%x\n", curclust);
- printf("Invalid FAT entry\n");
- return -1;
- }
-
- if (get_cluster(mydata, curclust, get_contents_vfatname_block,
- mydata->clust_size * mydata->sect_size) != 0) {
- debug("Error: reading directory block\n");
- return -1;
- }
-
- slotptr2 = (dir_slot *)get_contents_vfatname_block;
- while (counter > 0) {
- if (((slotptr2->id & ~LAST_LONG_ENTRY_MASK)
- & 0xff) != counter)
- return -1;
- slotptr2++;
- counter--;
- }
-
- /* Save the real directory entry */
- realdent = (dir_entry *)slotptr2;
- while ((__u8 *)slotptr2 > get_contents_vfatname_block) {
- slotptr2--;
- slot2str(slotptr2, l_name, &idx);
- }
- } else {
- /* Save the real directory entry */
- realdent = (dir_entry *)slotptr;
- }
-
- do {
- slotptr--;
- if (slot2str(slotptr, l_name, &idx))
- break;
- } while (!(slotptr->id & LAST_LONG_ENTRY_MASK));
-
- l_name[idx] = '\0';
- if (*l_name == DELETED_FLAG)
- *l_name = '\0';
- else if (*l_name == aRING)
- *l_name = DELETED_FLAG;
- downcase(l_name);
-
- /* Return the real directory entry */
- memcpy(retdent, realdent, sizeof(dir_entry));
-
- return 0;
-}
-
/* Calculate short name checksum */
static __u8 mkcksum(const char name[8], const char ext[3])
{
}
/*
- * Get the directory entry associated with 'filename' from the directory
- * starting at 'startsect'
+ * TODO these should go away once fat_write is reworked to use the
+ * directory iterator
*/
__u8 get_dentfromdir_block[MAX_CLUSTSIZE]
__aligned(ARCH_DMA_MINALIGN);
-
-static dir_entry *get_dentfromdir(fsdata *mydata, int startsect,
- char *filename, dir_entry *retdent,
- int dols)
-{
- __u16 prevcksum = 0xffff;
- __u32 curclust = START(retdent);
- int files = 0, dirs = 0;
-
- debug("get_dentfromdir: %s\n", filename);
-
- while (1) {
- dir_entry *dentptr;
-
- int i;
-
- if (get_cluster(mydata, curclust, get_dentfromdir_block,
- mydata->clust_size * mydata->sect_size) != 0) {
- debug("Error: reading directory block\n");
- return NULL;
- }
-
- dentptr = (dir_entry *)get_dentfromdir_block;
-
- for (i = 0; i < DIRENTSPERCLUST; i++) {
- char s_name[14], l_name[VFAT_MAXLEN_BYTES];
-
- l_name[0] = '\0';
- if (dentptr->name[0] == DELETED_FLAG) {
- dentptr++;
- continue;
- }
- if ((dentptr->attr & ATTR_VOLUME)) {
- if (vfat_enabled &&
- (dentptr->attr & ATTR_VFAT) == ATTR_VFAT &&
- (dentptr->name[0] & LAST_LONG_ENTRY_MASK)) {
- prevcksum = ((dir_slot *)dentptr)->alias_checksum;
- get_vfatname(mydata, curclust,
- get_dentfromdir_block,
- dentptr, l_name);
- if (dols) {
- int isdir;
- char dirc;
- int doit = 0;
-
- isdir = (dentptr->attr & ATTR_DIR);
-
- if (isdir) {
- dirs++;
- dirc = '/';
- doit = 1;
- } else {
- dirc = ' ';
- if (l_name[0] != 0) {
- files++;
- doit = 1;
- }
- }
- if (doit) {
- if (dirc == ' ') {
- printf(" %8u %s%c\n",
- FAT2CPU32(dentptr->size),
- l_name,
- dirc);
- } else {
- printf(" %s%c\n",
- l_name,
- dirc);
- }
- }
- dentptr++;
- continue;
- }
- debug("vfatname: |%s|\n", l_name);
- } else {
- /* Volume label or VFAT entry */
- dentptr++;
- continue;
- }
- }
- if (dentptr->name[0] == 0) {
- if (dols) {
- printf("\n%d file(s), %d dir(s)\n\n",
- files, dirs);
- }
- debug("Dentname == NULL - %d\n", i);
- return NULL;
- }
- if (vfat_enabled) {
- __u8 csum = mkcksum(dentptr->name, dentptr->ext);
- if (dols && csum == prevcksum) {
- prevcksum = 0xffff;
- dentptr++;
- continue;
- }
- }
-
- get_name(dentptr, s_name);
- if (dols) {
- int isdir = (dentptr->attr & ATTR_DIR);
- char dirc;
- int doit = 0;
-
- if (isdir) {
- dirs++;
- dirc = '/';
- doit = 1;
- } else {
- dirc = ' ';
- if (s_name[0] != 0) {
- files++;
- doit = 1;
- }
- }
-
- if (doit) {
- if (dirc == ' ') {
- printf(" %8u %s%c\n",
- FAT2CPU32(dentptr->size),
- s_name, dirc);
- } else {
- printf(" %s%c\n",
- s_name, dirc);
- }
- }
-
- dentptr++;
- continue;
- }
-
- if (strcmp(filename, s_name)
- && strcmp(filename, l_name)) {
- debug("Mismatch: |%s|%s|\n", s_name, l_name);
- dentptr++;
- continue;
- }
-
- memcpy(retdent, dentptr, sizeof(dir_entry));
-
- debug("DentName: %s", s_name);
- debug(", start: 0x%x", START(dentptr));
- debug(", size: 0x%x %s\n",
- FAT2CPU32(dentptr->size),
- (dentptr->attr & ATTR_DIR) ? "(DIR)" : "");
-
- return retdent;
- }
-
- curclust = get_fatent(mydata, curclust);
- if (CHECK_CLUST(curclust, mydata->fatsize)) {
- debug("curclust: 0x%x\n", curclust);
- printf("Invalid FAT entry\n");
- return NULL;
- }
- }
-
- return NULL;
-}
+__u8 do_fat_read_at_block[MAX_CLUSTSIZE]
+ __aligned(ARCH_DMA_MINALIGN);
/*
* Read boot sector and volume info from a FAT filesystem
return ret;
}
-__u8 do_fat_read_at_block[MAX_CLUSTSIZE]
- __aligned(ARCH_DMA_MINALIGN);
-
-int do_fat_read_at(const char *filename, loff_t pos, void *buffer,
- loff_t maxsize, int dols, int dogetsize, loff_t *size)
+static int get_fs_info(fsdata *mydata)
{
- char fnamecopy[2048];
boot_sector bs;
volume_info volinfo;
- fsdata datablock;
- fsdata *mydata = &datablock;
- dir_entry *dentptr = NULL;
- __u16 prevcksum = 0xffff;
- char *subname = "";
- __u32 cursect;
- int idx, isdir = 0;
- int files = 0, dirs = 0;
- int ret = -1;
- int firsttime;
- __u32 root_cluster = 0;
- __u32 read_blk;
- int rootdir_size = 0;
- int buffer_blk_cnt;
- int do_read;
- __u8 *dir_ptr;
-
- if (read_bootsectandvi(&bs, &volinfo, &mydata->fatsize)) {
+ int ret;
+
+ ret = read_bootsectandvi(&bs, &volinfo, &mydata->fatsize);
+ if (ret) {
debug("Error: reading boot sector\n");
- return -1;
+ return ret;
}
if (mydata->fatsize == 32) {
- root_cluster = bs.root_cluster;
mydata->fatlength = bs.fat32_length;
} else {
mydata->fatlength = bs.fat_length;
mydata->fat_sect = bs.reserved;
- cursect = mydata->rootdir_sect
- = mydata->fat_sect + mydata->fatlength * bs.fats;
+ mydata->rootdir_sect = mydata->fat_sect + mydata->fatlength * bs.fats;
mydata->sect_size = (bs.sector_size[1] << 8) + bs.sector_size[0];
mydata->clust_size = bs.cluster_size;
if (mydata->fatsize == 32) {
mydata->data_begin = mydata->rootdir_sect -
(mydata->clust_size * 2);
+ mydata->root_cluster = bs.root_cluster;
} else {
- rootdir_size = ((bs.dir_entries[1] * (int)256 +
- bs.dir_entries[0]) *
- sizeof(dir_entry)) /
- mydata->sect_size;
+ mydata->rootdir_size = ((bs.dir_entries[1] * (int)256 +
+ bs.dir_entries[0]) *
+ sizeof(dir_entry)) /
+ mydata->sect_size;
mydata->data_begin = mydata->rootdir_sect +
- rootdir_size -
+ mydata->rootdir_size -
(mydata->clust_size * 2);
+ mydata->root_cluster =
+ sect_to_clust(mydata, mydata->rootdir_sect);
}
mydata->fatbufnum = -1;
mydata->fatsize, mydata->fat_sect, mydata->fatlength);
debug("Rootdir begins at cluster: %d, sector: %d, offset: %x\n"
"Data begins at: %d\n",
- root_cluster,
+ mydata->root_cluster,
mydata->rootdir_sect,
mydata->rootdir_sect * mydata->sect_size, mydata->data_begin);
debug("Sector size: %d, cluster size: %d\n", mydata->sect_size,
mydata->clust_size);
- /* "cwd" is always the root... */
- while (ISDIRDELIM(*filename))
- filename++;
+ return 0;
+}
- /* Make a copy of the filename and convert it to lowercase */
- strcpy(fnamecopy, filename);
- downcase(fnamecopy);
-root_reparse:
- if (*fnamecopy == '\0') {
- if (!dols)
- goto exit;
+/*
+ * Directory iterator, to simplify filesystem traversal
+ *
+ * Implements an iterator pattern to traverse directory tables,
+ * transparently handling directory tables split across multiple
+ * clusters, and the difference between FAT12/FAT16 root directory
+ * (contiguous) and subdirectories + FAT32 root (chained).
+ *
+ * Rough usage:
+ *
+ * for (fat_itr_root(&itr, fsdata); fat_itr_next(&itr); ) {
+ * // to traverse down to a subdirectory pointed to by
+ * // current iterator position:
+ * fat_itr_child(&itr, &itr);
+ * }
+ *
+ * For more complete example, see fat_itr_resolve()
+ */
- dols = LS_ROOT;
- } else if ((idx = dirdelim(fnamecopy)) >= 0) {
- isdir = 1;
- fnamecopy[idx] = '\0';
- subname = fnamecopy + idx + 1;
-
- /* Handle multiple delimiters */
- while (ISDIRDELIM(*subname))
- subname++;
- } else if (dols) {
- isdir = 1;
- }
+typedef struct {
+ fsdata *fsdata; /* filesystem parameters */
+ unsigned clust; /* current cluster */
+ int last_cluster; /* set once we've read last cluster */
+ int is_root; /* is iterator at root directory */
+ int remaining; /* remaining dent's in current cluster */
- buffer_blk_cnt = 0;
- firsttime = 1;
- while (1) {
- int i;
+ /* current iterator position values: */
+ dir_entry *dent; /* current directory entry */
+ char l_name[VFAT_MAXLEN_BYTES]; /* long (vfat) name */
+ char s_name[14]; /* short 8.3 name */
+ char *name; /* l_name if there is one, else s_name */
- if (mydata->fatsize == 32 || firsttime) {
- dir_ptr = do_fat_read_at_block;
- firsttime = 0;
- } else {
- /**
- * FAT16 sector buffer modification:
- * Each loop, the second buffered block is moved to
- * the buffer begin, and two next sectors are read
- * next to the previously moved one. So the sector
- * buffer keeps always 3 sectors for fat16.
- * And the current sector is the buffer second sector
- * beside the "firsttime" read, when it is the first one.
- *
- * PREFETCH_BLOCKS is 2 for FAT16 == loop[0:1]
- * n = computed root dir sector
- * loop | cursect-1 | cursect | cursect+1 |
- * 0 | sector n+0 | sector n+1 | none |
- * 1 | none | sector n+0 | sector n+1 |
- * 0 | sector n+1 | sector n+2 | sector n+3 |
- * 1 | sector n+3 | ...
- */
- dir_ptr = (do_fat_read_at_block + mydata->sect_size);
- memcpy(do_fat_read_at_block, dir_ptr, mydata->sect_size);
- }
+ /* storage for current cluster in memory: */
+ u8 block[MAX_CLUSTSIZE] __aligned(ARCH_DMA_MINALIGN);
+} fat_itr;
- do_read = 1;
+static int fat_itr_isdir(fat_itr *itr);
- if (mydata->fatsize == 32 && buffer_blk_cnt)
- do_read = 0;
+/**
+ * fat_itr_root() - initialize an iterator to start at the root
+ * directory
+ *
+ * @itr: iterator to initialize
+ * @fsdata: filesystem data for the partition
+ * @return 0 on success, else -errno
+ */
+static int fat_itr_root(fat_itr *itr, fsdata *fsdata)
+{
+ if (get_fs_info(fsdata))
+ return -ENXIO;
- if (do_read) {
- read_blk = (mydata->fatsize == 32) ?
- mydata->clust_size : PREFETCH_BLOCKS;
+ itr->fsdata = fsdata;
+ itr->clust = fsdata->root_cluster;
+ itr->dent = NULL;
+ itr->remaining = 0;
+ itr->last_cluster = 0;
+ itr->is_root = 1;
- debug("FAT read(sect=%d, cnt:%d), clust_size=%d, DIRENTSPERBLOCK=%zd\n",
- cursect, read_blk, mydata->clust_size, DIRENTSPERBLOCK);
+ return 0;
+}
- if (disk_read(cursect, read_blk, dir_ptr) < 0) {
- debug("Error: reading rootdir block\n");
- goto exit;
- }
+/**
+ * fat_itr_child() - initialize an iterator to descend into a sub-
+ * directory
+ *
+ * Initializes 'itr' to iterate the contents of the directory at
+ * the current cursor position of 'parent'. It is an error to
+ * call this if the current cursor of 'parent' is pointing at a
+ * regular file.
+ *
+ * Note that 'itr' and 'parent' can be the same pointer if you do
+ * not need to preserve 'parent' after this call, which is useful
+ * for traversing directory structure to resolve a file/directory.
+ *
+ * @itr: iterator to initialize
+ * @parent: the iterator pointing at a directory entry in the
+ * parent directory of the directory to iterate
+ */
+static void fat_itr_child(fat_itr *itr, fat_itr *parent)
+{
+ fsdata *mydata = parent->fsdata; /* for silly macros */
+ unsigned clustnum = START(parent->dent);
- dentptr = (dir_entry *)dir_ptr;
- }
+ assert(fat_itr_isdir(parent));
- for (i = 0; i < DIRENTSPERBLOCK; i++) {
- char s_name[14], l_name[VFAT_MAXLEN_BYTES];
- __u8 csum;
+ itr->fsdata = parent->fsdata;
+ if (clustnum > 0) {
+ itr->clust = clustnum;
+ } else {
+ itr->clust = parent->fsdata->root_cluster;
+ }
+ itr->dent = NULL;
+ itr->remaining = 0;
+ itr->last_cluster = 0;
+ itr->is_root = 0;
+}
- l_name[0] = '\0';
- if (dentptr->name[0] == DELETED_FLAG) {
- dentptr++;
- continue;
- }
+static void *next_cluster(fat_itr *itr)
+{
+ fsdata *mydata = itr->fsdata; /* for silly macros */
+ int ret;
+ u32 sect;
+
+ /* have we reached the end? */
+ if (itr->last_cluster)
+ return NULL;
+
+ sect = clust_to_sect(itr->fsdata, itr->clust);
+
+ debug("FAT read(sect=%d), clust_size=%d, DIRENTSPERBLOCK=%zd\n",
+ sect, itr->fsdata->clust_size, DIRENTSPERBLOCK);
+
+ /*
+ * NOTE: do_fat_read_at() had complicated logic to deal w/
+ * vfat names that span multiple clusters in the fat16 case,
+ * which get_dentfromdir() probably also needed (and was
+ * missing). And not entirely sure what fat32 didn't have
+ * the same issue.. We solve that by only caring about one
+ * dent at a time and iteratively constructing the vfat long
+ * name.
+ */
+ ret = disk_read(sect, itr->fsdata->clust_size,
+ itr->block);
+ if (ret < 0) {
+ debug("Error: reading block\n");
+ return NULL;
+ }
- if (vfat_enabled)
- csum = mkcksum(dentptr->name, dentptr->ext);
-
- if (dentptr->attr & ATTR_VOLUME) {
- if (vfat_enabled &&
- (dentptr->attr & ATTR_VFAT) == ATTR_VFAT &&
- (dentptr->name[0] & LAST_LONG_ENTRY_MASK)) {
- prevcksum =
- ((dir_slot *)dentptr)->alias_checksum;
-
- get_vfatname(mydata,
- root_cluster,
- dir_ptr,
- dentptr, l_name);
-
- if (dols == LS_ROOT) {
- char dirc;
- int doit = 0;
- int isdir =
- (dentptr->attr & ATTR_DIR);
-
- if (isdir) {
- dirs++;
- dirc = '/';
- doit = 1;
- } else {
- dirc = ' ';
- if (l_name[0] != 0) {
- files++;
- doit = 1;
- }
- }
- if (doit) {
- if (dirc == ' ') {
- printf(" %8u %s%c\n",
- FAT2CPU32(dentptr->size),
- l_name,
- dirc);
- } else {
- printf(" %s%c\n",
- l_name,
- dirc);
- }
- }
- dentptr++;
- continue;
- }
- debug("Rootvfatname: |%s|\n",
- l_name);
- } else {
- /* Volume label or VFAT entry */
- dentptr++;
- continue;
- }
- } else if (dentptr->name[0] == 0) {
- debug("RootDentname == NULL - %d\n", i);
- if (dols == LS_ROOT) {
- printf("\n%d file(s), %d dir(s)\n\n",
- files, dirs);
- ret = 0;
- }
- goto exit;
- }
- else if (vfat_enabled &&
- dols == LS_ROOT && csum == prevcksum) {
- prevcksum = 0xffff;
- dentptr++;
- continue;
- }
+ if (itr->is_root && itr->fsdata->fatsize != 32) {
+ itr->clust++;
+ sect = clust_to_sect(itr->fsdata, itr->clust);
+ if (sect - itr->fsdata->rootdir_sect >=
+ itr->fsdata->rootdir_size) {
+ debug("cursect: 0x%x\n", itr->clust);
+ itr->last_cluster = 1;
+ }
+ } else {
+ itr->clust = get_fatent(itr->fsdata, itr->clust);
+ if (CHECK_CLUST(itr->clust, itr->fsdata->fatsize)) {
+ debug("cursect: 0x%x\n", itr->clust);
+ itr->last_cluster = 1;
+ }
+ }
- get_name(dentptr, s_name);
-
- if (dols == LS_ROOT) {
- int isdir = (dentptr->attr & ATTR_DIR);
- char dirc;
- int doit = 0;
-
- if (isdir) {
- dirc = '/';
- if (s_name[0] != 0) {
- dirs++;
- doit = 1;
- }
- } else {
- dirc = ' ';
- if (s_name[0] != 0) {
- files++;
- doit = 1;
- }
- }
- if (doit) {
- if (dirc == ' ') {
- printf(" %8u %s%c\n",
- FAT2CPU32(dentptr->size),
- s_name, dirc);
- } else {
- printf(" %s%c\n",
- s_name, dirc);
- }
- }
- dentptr++;
- continue;
- }
+ return itr->block;
+}
- if (strcmp(fnamecopy, s_name)
- && strcmp(fnamecopy, l_name)) {
- debug("RootMismatch: |%s|%s|\n", s_name,
- l_name);
- dentptr++;
- continue;
- }
+static dir_entry *next_dent(fat_itr *itr)
+{
+ if (itr->remaining == 0) {
+ struct dir_entry *dent = next_cluster(itr);
+ unsigned nbytes = itr->fsdata->sect_size *
+ itr->fsdata->clust_size;
- if (isdir && !(dentptr->attr & ATTR_DIR))
- goto exit;
+ /* have we reached the last cluster? */
+ if (!dent)
+ return NULL;
- debug("RootName: %s", s_name);
- debug(", start: 0x%x", START(dentptr));
- debug(", size: 0x%x %s\n",
- FAT2CPU32(dentptr->size),
- isdir ? "(DIR)" : "");
+ itr->remaining = nbytes / sizeof(dir_entry) - 1;
+ itr->dent = dent;
+ } else {
+ itr->remaining--;
+ itr->dent++;
+ }
- goto rootdir_done; /* We got a match */
- }
- debug("END LOOP: buffer_blk_cnt=%d clust_size=%d\n", buffer_blk_cnt,
- mydata->clust_size);
+ /* have we reached the last valid entry? */
+ if (itr->dent->name[0] == 0)
+ return NULL;
- /*
- * On FAT32 we must fetch the FAT entries for the next
- * root directory clusters when a cluster has been
- * completely processed.
- */
- ++buffer_blk_cnt;
- int rootdir_end = 0;
- if (mydata->fatsize == 32) {
- if (buffer_blk_cnt == mydata->clust_size) {
- int nxtsect = 0;
- int nxt_clust = 0;
+ return itr->dent;
+}
+
+static dir_entry *extract_vfat_name(fat_itr *itr)
+{
+ struct dir_entry *dent = itr->dent;
+ int seqn = itr->dent->name[0] & ~LAST_LONG_ENTRY_MASK;
+ u8 chksum, alias_checksum = ((dir_slot *)dent)->alias_checksum;
+ int n = 0;
- nxt_clust = get_fatent(mydata, root_cluster);
- rootdir_end = CHECK_CLUST(nxt_clust, 32);
+ while (seqn--) {
+ char buf[13];
+ int idx = 0;
- nxtsect = mydata->data_begin +
- (nxt_clust * mydata->clust_size);
+ slot2str((dir_slot *)dent, buf, &idx);
- root_cluster = nxt_clust;
+ /* shift accumulated long-name up and copy new part in: */
+ memmove(itr->l_name + idx, itr->l_name, n);
+ memcpy(itr->l_name, buf, idx);
+ n += idx;
- cursect = nxtsect;
- buffer_blk_cnt = 0;
- }
- } else {
- if (buffer_blk_cnt == PREFETCH_BLOCKS)
- buffer_blk_cnt = 0;
+ dent = next_dent(itr);
+ if (!dent)
+ return NULL;
+ }
- rootdir_end = (++cursect - mydata->rootdir_sect >=
- rootdir_size);
- }
+ itr->l_name[n] = '\0';
- /* If end of rootdir reached */
- if (rootdir_end) {
- if (dols == LS_ROOT) {
- printf("\n%d file(s), %d dir(s)\n\n",
- files, dirs);
- *size = 0;
- }
- goto exit;
- }
+ chksum = mkcksum(dent->name, dent->ext);
+
+ /* checksum mismatch could mean deleted file, etc.. skip it: */
+ if (chksum != alias_checksum) {
+ debug("** chksum=%x, alias_checksum=%x, l_name=%s, s_name=%8s.%3s\n",
+ chksum, alias_checksum, itr->l_name, dent->name, dent->ext);
+ return NULL;
}
-rootdir_done:
- firsttime = 1;
+ return dent;
+}
+
+/**
+ * fat_itr_next() - step to the next entry in a directory
+ *
+ * Must be called once on a new iterator before the cursor is valid.
+ *
+ * @itr: the iterator to iterate
+ * @return boolean, 1 if success or 0 if no more entries in the
+ * current directory
+ */
+static int fat_itr_next(fat_itr *itr)
+{
+ dir_entry *dent;
- while (isdir) {
- int startsect = mydata->data_begin
- + START(dentptr) * mydata->clust_size;
- dir_entry dent;
- char *nextname = NULL;
+ itr->name = NULL;
- dent = *dentptr;
- dentptr = &dent;
+ while (1) {
+ dent = next_dent(itr);
+ if (!dent)
+ return 0;
- idx = dirdelim(subname);
+ if (dent->name[0] == DELETED_FLAG ||
+ dent->name[0] == aRING)
+ continue;
- if (idx >= 0) {
- subname[idx] = '\0';
- nextname = subname + idx + 1;
- /* Handle multiple delimiters */
- while (ISDIRDELIM(*nextname))
- nextname++;
- if (dols && *nextname == '\0')
- firsttime = 0;
- } else {
- if (dols && firsttime) {
- firsttime = 0;
+ if (dent->attr & ATTR_VOLUME) {
+ if (vfat_enabled &&
+ (dent->attr & ATTR_VFAT) == ATTR_VFAT &&
+ (dent->name[0] & LAST_LONG_ENTRY_MASK)) {
+ dent = extract_vfat_name(itr);
+ if (!dent)
+ continue;
+ itr->name = itr->l_name;
+ break;
} else {
- isdir = 0;
+ /* Volume label or VFAT entry, skip */
+ continue;
}
}
- if (get_dentfromdir(mydata, startsect, subname, dentptr,
- isdir ? 0 : dols) == NULL) {
- if (dols && !isdir)
- *size = 0;
- goto exit;
- }
+ break;
+ }
- if (isdir && !(dentptr->attr & ATTR_DIR))
- goto exit;
+ get_name(dent, itr->s_name);
+ if (!itr->name)
+ itr->name = itr->s_name;
- /*
- * If we are looking for a directory, and found a directory
- * type entry, and the entry is for the root directory (as
- * denoted by a cluster number of 0), jump back to the start
- * of the function, since at least on FAT12/16, the root dir
- * lives in a hard-coded location and needs special handling
- * to parse, rather than simply following the cluster linked
- * list in the FAT, like other directories.
- */
- if (isdir && (dentptr->attr & ATTR_DIR) && !START(dentptr)) {
- /*
- * Modify the filename to remove the prefix that gets
- * back to the root directory, so the initial root dir
- * parsing code can continue from where we are without
- * confusion.
- */
- strcpy(fnamecopy, nextname ?: "");
- /*
- * Set up state the same way as the function does when
- * first started. This is required for the root dir
- * parsing code operates in its expected environment.
- */
- subname = "";
- cursect = mydata->rootdir_sect;
- isdir = 0;
- goto root_reparse;
- }
+ return 1;
+}
- if (idx >= 0)
- subname = nextname;
- }
+/**
+ * fat_itr_isdir() - is current cursor position pointing to a directory
+ *
+ * @itr: the iterator
+ * @return true if cursor is at a directory
+ */
+static int fat_itr_isdir(fat_itr *itr)
+{
+ return !!(itr->dent->attr & ATTR_DIR);
+}
- if (dogetsize) {
- *size = FAT2CPU32(dentptr->size);
- ret = 0;
- } else {
- ret = get_contents(mydata, dentptr, pos, buffer, maxsize, size);
- }
- debug("Size: %u, got: %llu\n", FAT2CPU32(dentptr->size), *size);
+/*
+ * Helpers:
+ */
-exit:
- free(mydata->fatbuf);
- return ret;
-}
+#define TYPE_FILE 0x1
+#define TYPE_DIR 0x2
+#define TYPE_ANY (TYPE_FILE | TYPE_DIR)
-int do_fat_read(const char *filename, void *buffer, loff_t maxsize, int dols,
- loff_t *actread)
+/**
+ * fat_itr_resolve() - traverse directory structure to resolve the
+ * requested path.
+ *
+ * Traverse directory structure to the requested path. If the specified
+ * path is to a directory, this will descend into the directory and
+ * leave it iterator at the start of the directory. If the path is to a
+ * file, it will leave the iterator in the parent directory with current
+ * cursor at file's entry in the directory.
+ *
+ * @itr: iterator initialized to root
+ * @path: the requested path
+ * @type: bitmask of allowable file types
+ * @return 0 on success or -errno
+ */
+static int fat_itr_resolve(fat_itr *itr, const char *path, unsigned type)
{
- return do_fat_read_at(filename, 0, buffer, maxsize, dols, 0, actread);
+ const char *next;
+
+ /* chomp any extra leading slashes: */
+ while (path[0] && ISDIRDELIM(path[0]))
+ path++;
+
+ /* are we at the end? */
+ if (strlen(path) == 0) {
+ if (!(type & TYPE_DIR))
+ return -ENOENT;
+ return 0;
+ }
+
+ /* find length of next path entry: */
+ next = path;
+ while (next[0] && !ISDIRDELIM(next[0]))
+ next++;
+
+ while (fat_itr_next(itr)) {
+ int match = 0;
+ unsigned n = max(strlen(itr->name), (size_t)(next - path));
+
+ /* check both long and short name: */
+ if (!strncasecmp(path, itr->name, n))
+ match = 1;
+ else if (itr->name != itr->s_name &&
+ !strncasecmp(path, itr->s_name, n))
+ match = 1;
+
+ if (!match)
+ continue;
+
+ if (fat_itr_isdir(itr)) {
+ /* recurse into directory: */
+ fat_itr_child(itr, itr);
+ return fat_itr_resolve(itr, next, type);
+ } else if (next[0]) {
+ /*
+ * If next is not empty then we have a case
+ * like: /path/to/realfile/nonsense
+ */
+ debug("bad trailing path: %s\n", next);
+ return -ENOENT;
+ } else if (!(type & TYPE_FILE)) {
+ return -ENOTDIR;
+ } else {
+ return 0;
+ }
+ }
+
+ return -ENOENT;
}
int file_fat_detectfs(void)
return 0;
}
-int file_fat_ls(const char *dir)
-{
- loff_t size;
-
- return do_fat_read(dir, NULL, 0, LS_YES, &size);
-}
-
int fat_exists(const char *filename)
{
+ fsdata fsdata;
+ fat_itr itrblock, *itr = &itrblock;
int ret;
- loff_t size;
- ret = do_fat_read_at(filename, 0, NULL, 0, LS_NO, 1, &size);
+ ret = fat_itr_root(itr, &fsdata);
+ if (ret)
+ return 0;
+
+ ret = fat_itr_resolve(itr, filename, TYPE_ANY);
+ free(fsdata.fatbuf);
return ret == 0;
}
int fat_size(const char *filename, loff_t *size)
{
- return do_fat_read_at(filename, 0, NULL, 0, LS_NO, 1, size);
+ fsdata fsdata;
+ fat_itr itrblock, *itr = &itrblock;
+ int ret;
+
+ ret = fat_itr_root(itr, &fsdata);
+ if (ret)
+ return ret;
+
+ ret = fat_itr_resolve(itr, filename, TYPE_FILE);
+ if (ret) {
+ /*
+ * Directories don't have size, but fs_size() is not
+ * expected to fail if passed a directory path:
+ */
+ free(fsdata.fatbuf);
+ fat_itr_root(itr, &fsdata);
+ if (!fat_itr_resolve(itr, filename, TYPE_DIR)) {
+ *size = 0;
+ ret = 0;
+ }
+ goto out;
+ }
+
+ *size = FAT2CPU32(itr->dent->size);
+out:
+ free(fsdata.fatbuf);
+ return ret;
}
int file_fat_read_at(const char *filename, loff_t pos, void *buffer,
loff_t maxsize, loff_t *actread)
{
+ fsdata fsdata;
+ fat_itr itrblock, *itr = &itrblock;
+ int ret;
+
+ ret = fat_itr_root(itr, &fsdata);
+ if (ret)
+ return ret;
+
+ ret = fat_itr_resolve(itr, filename, TYPE_FILE);
+ if (ret)
+ goto out;
+
printf("reading %s\n", filename);
- return do_fat_read_at(filename, pos, buffer, maxsize, LS_NO, 0,
- actread);
+ ret = get_contents(&fsdata, itr->dent, pos, buffer, maxsize, actread);
+
+out:
+ free(fsdata.fatbuf);
+ return ret;
}
int file_fat_read(const char *filename, void *buffer, int maxsize)
return ret;
}
+typedef struct {
+ struct fs_dir_stream parent;
+ struct fs_dirent dirent;
+ fsdata fsdata;
+ fat_itr itr;
+} fat_dir;
+
+int fat_opendir(const char *filename, struct fs_dir_stream **dirsp)
+{
+ fat_dir *dir = calloc(1, sizeof(*dir));
+ int ret;
+
+ if (!dir)
+ return -ENOMEM;
+
+ ret = fat_itr_root(&dir->itr, &dir->fsdata);
+ if (ret)
+ goto fail;
+
+ ret = fat_itr_resolve(&dir->itr, filename, TYPE_DIR);
+ if (ret)
+ goto fail;
+
+ *dirsp = (struct fs_dir_stream *)dir;
+ return 0;
+
+fail:
+ free(dir->fsdata.fatbuf);
+ free(dir);
+ return ret;
+}
+
+int fat_readdir(struct fs_dir_stream *dirs, struct fs_dirent **dentp)
+{
+ fat_dir *dir = (fat_dir *)dirs;
+ struct fs_dirent *dent = &dir->dirent;
+
+ if (!fat_itr_next(&dir->itr))
+ return -ENOENT;
+
+ memset(dent, 0, sizeof(*dent));
+ strcpy(dent->name, dir->itr.name);
+
+ if (fat_itr_isdir(&dir->itr)) {
+ dent->type = FS_DT_DIR;
+ } else {
+ dent->type = FS_DT_REG;
+ dent->size = FAT2CPU32(dir->itr.dent->size);
+ }
+
+ *dentp = dent;
+
+ return 0;
+}
+
+void fat_closedir(struct fs_dir_stream *dirs)
+{
+ fat_dir *dir = (fat_dir *)dirs;
+ free(dir->fsdata.fatbuf);
+ free(dir);
+}
+
void fat_close(void)
{
}
*l_name = '\0';
else if (*l_name == aRING)
*l_name = DELETED_FLAG;
- downcase(l_name);
+ downcase(l_name, INT_MAX);
/* Return the real directory entry */
*retdent = realdent;
int ret;
if (clustnum > 0)
- startsect = mydata->data_begin +
- clustnum * mydata->clust_size;
+ startsect = clust_to_sect(mydata, clustnum);
else
startsect = mydata->rootdir_sect;
__u32 startsect, sect_num, offset;
if (clustnum > 0) {
- startsect = mydata->data_begin +
- clustnum * mydata->clust_size;
+ startsect = clust_to_sect(mydata, clustnum);
} else {
startsect = mydata->rootdir_sect;
}
static dir_entry *find_directory_entry(fsdata *mydata, int startsect,
char *filename, dir_entry *retdent, __u32 start)
{
- __u32 curclust = (startsect - mydata->data_begin) / mydata->clust_size;
+ __u32 curclust = sect_to_clust(mydata, startsect);
debug("get_dentfromdir: %s\n", filename);
memcpy(l_filename, filename, name_len);
l_filename[name_len] = 0; /* terminate the string */
- downcase(l_filename);
+ downcase(l_filename, INT_MAX);
startsect = mydata->rootdir_sect;
retdent = find_directory_entry(mydata, startsect,
+++ /dev/null
-/*
- * file.c
- *
- * Mini "VFS" by Marcus Sundberg
- *
- * 2002-07-28 - rjones@nexus-tech.net - ported to ppcboot v1.1.6
- * 2003-03-10 - kharris@nexus-tech.net - ported to uboot
- *
- * SPDX-License-Identifier: GPL-2.0+
- */
-
-#include <common.h>
-#include <config.h>
-#include <malloc.h>
-#include <fat.h>
-#include <linux/stat.h>
-#include <linux/time.h>
-
-/* Supported filesystems */
-static const struct filesystem filesystems[] = {
- { file_fat_detectfs, file_fat_ls, file_fat_read, "FAT" },
-};
-#define NUM_FILESYS (sizeof(filesystems)/sizeof(struct filesystem))
-
-/* The filesystem which was last detected */
-static int current_filesystem = FSTYPE_NONE;
-
-/* The current working directory */
-#define CWD_LEN 511
-char file_cwd[CWD_LEN+1] = "/";
-
-const char *
-file_getfsname(int idx)
-{
- if (idx < 0 || idx >= NUM_FILESYS)
- return NULL;
-
- return filesystems[idx].name;
-}
-
-static void
-pathcpy(char *dest, const char *src)
-{
- char *origdest = dest;
-
- do {
- if (dest-file_cwd >= CWD_LEN) {
- *dest = '\0';
- return;
- }
- *(dest) = *(src);
- if (*src == '\0') {
- if (dest-- != origdest && ISDIRDELIM(*dest)) {
- *dest = '\0';
- }
- return;
- }
- ++dest;
-
- if (ISDIRDELIM(*src))
- while (ISDIRDELIM(*src)) src++;
- else
- src++;
- } while (1);
-}
-
-int
-file_cd(const char *path)
-{
- if (ISDIRDELIM(*path)) {
- while (ISDIRDELIM(*path)) path++;
- strncpy(file_cwd+1, path, CWD_LEN-1);
- } else {
- const char *origpath = path;
- char *tmpstr = file_cwd;
- int back = 0;
-
- while (*tmpstr != '\0') tmpstr++;
- do {
- tmpstr--;
- } while (ISDIRDELIM(*tmpstr));
-
- while (*path == '.') {
- path++;
- while (*path == '.') {
- path++;
- back++;
- }
- if (*path != '\0' && !ISDIRDELIM(*path)) {
- path = origpath;
- back = 0;
- break;
- }
- while (ISDIRDELIM(*path)) path++;
- origpath = path;
- }
-
- while (back--) {
- /* Strip off path component */
- while (!ISDIRDELIM(*tmpstr)) {
- tmpstr--;
- }
- if (tmpstr == file_cwd) {
- /* Incremented again right after the loop. */
- tmpstr--;
- break;
- }
- /* Skip delimiters */
- while (ISDIRDELIM(*tmpstr)) tmpstr--;
- }
- tmpstr++;
- if (*path == '\0') {
- if (tmpstr == file_cwd) {
- *tmpstr = '/';
- tmpstr++;
- }
- *tmpstr = '\0';
- return 0;
- }
- *tmpstr = '/';
- pathcpy(tmpstr+1, path);
- }
-
- return 0;
-}
-
-int
-file_detectfs(void)
-{
- int i;
-
- current_filesystem = FSTYPE_NONE;
-
- for (i = 0; i < NUM_FILESYS; i++) {
- if (filesystems[i].detect() == 0) {
- strcpy(file_cwd, "/");
- current_filesystem = i;
- break;
- }
- }
-
- return current_filesystem;
-}
-
-int
-file_ls(const char *dir)
-{
- char fullpath[1024];
- const char *arg;
-
- if (current_filesystem == FSTYPE_NONE) {
- printf("Can't list files without a filesystem!\n");
- return -1;
- }
-
- if (ISDIRDELIM(*dir)) {
- arg = dir;
- } else {
- sprintf(fullpath, "%s/%s", file_cwd, dir);
- arg = fullpath;
- }
- return filesystems[current_filesystem].ls(arg);
-}
-
-int file_read(const char *filename, void *buffer, int maxsize)
-{
- char fullpath[1024];
- const char *arg;
-
- if (current_filesystem == FSTYPE_NONE) {
- printf("Can't load file without a filesystem!\n");
- return -1;
- }
-
- if (ISDIRDELIM(*filename)) {
- arg = filename;
- } else {
- sprintf(fullpath, "%s/%s", file_cwd, filename);
- arg = fullpath;
- }
-
- return filesystems[current_filesystem].read(arg, buffer, maxsize);
-}
DECLARE_GLOBAL_DATA_PTR;
static struct blk_desc *fs_dev_desc;
+static int fs_dev_part;
static disk_partition_t fs_partition;
static int fs_type = FS_TYPE_ANY;
return -1;
}
+/* generic implementation of ls in terms of opendir/readdir/closedir */
+__maybe_unused
+static int fs_ls_generic(const char *dirname)
+{
+ struct fs_dir_stream *dirs;
+ struct fs_dirent *dent;
+ int nfiles = 0, ndirs = 0;
+
+ dirs = fs_opendir(dirname);
+ if (!dirs)
+ return -errno;
+
+ while ((dent = fs_readdir(dirs))) {
+ if (dent->type == FS_DT_DIR) {
+ printf(" %s/\n", dent->name);
+ ndirs++;
+ } else {
+ printf(" %8lld %s\n", dent->size, dent->name);
+ nfiles++;
+ }
+ }
+
+ fs_closedir(dirs);
+
+ printf("\n%d file(s), %d dir(s)\n\n", nfiles, ndirs);
+
+ return 0;
+}
+
static inline int fs_exists_unsupported(const char *filename)
{
return 0;
return -1;
}
+static inline int fs_opendir_unsupported(const char *filename,
+ struct fs_dir_stream **dirs)
+{
+ return -EACCES;
+}
+
struct fstype_info {
int fstype;
char *name;
loff_t len, loff_t *actwrite);
void (*close)(void);
int (*uuid)(char *uuid_str);
+ /*
+ * Open a directory stream. On success return 0 and directory
+ * stream pointer via 'dirsp'. On error, return -errno. See
+ * fs_opendir().
+ */
+ int (*opendir)(const char *filename, struct fs_dir_stream **dirsp);
+ /*
+ * Read next entry from directory stream. On success return 0
+ * and directory entry pointer via 'dentp'. On error return
+ * -errno. See fs_readdir().
+ */
+ int (*readdir)(struct fs_dir_stream *dirs, struct fs_dirent **dentp);
+ /* see fs_closedir() */
+ void (*closedir)(struct fs_dir_stream *dirs);
};
static struct fstype_info fstypes[] = {
.null_dev_desc_ok = false,
.probe = fat_set_blk_dev,
.close = fat_close,
- .ls = file_fat_ls,
+ .ls = fs_ls_generic,
.exists = fat_exists,
.size = fat_size,
.read = fat_read_file,
.write = fs_write_unsupported,
#endif
.uuid = fs_uuid_unsupported,
+ .opendir = fat_opendir,
+ .readdir = fat_readdir,
+ .closedir = fat_closedir,
},
#endif
#ifdef CONFIG_FS_EXT4
.write = fs_write_unsupported,
#endif
.uuid = ext4fs_uuid,
+ .opendir = fs_opendir_unsupported,
},
#endif
#ifdef CONFIG_SANDBOX
.read = fs_read_sandbox,
.write = fs_write_sandbox,
.uuid = fs_uuid_unsupported,
+ .opendir = fs_opendir_unsupported,
},
#endif
#ifdef CONFIG_CMD_UBIFS
.read = ubifs_read,
.write = fs_write_unsupported,
.uuid = fs_uuid_unsupported,
+ .opendir = fs_opendir_unsupported,
},
#endif
{
.read = fs_read_unsupported,
.write = fs_write_unsupported,
.uuid = fs_uuid_unsupported,
+ .opendir = fs_opendir_unsupported,
},
};
if (!fs_dev_desc && !info->null_dev_desc_ok)
continue;
+ if (!info->probe(fs_dev_desc, &fs_partition)) {
+ fs_type = info->fstype;
+ fs_dev_part = part;
+ return 0;
+ }
+ }
+
+ return -1;
+}
+
+/* set current blk device w/ blk_desc + partition # */
+int fs_set_blk_dev_with_part(struct blk_desc *desc, int part)
+{
+ struct fstype_info *info;
+ int ret, i;
+
+ if (part >= 1)
+ ret = part_get_info(desc, part, &fs_partition);
+ else
+ ret = part_get_info_whole_disk(desc, &fs_partition);
+ if (ret)
+ return ret;
+ fs_dev_desc = desc;
+
+ for (i = 0, info = fstypes; i < ARRAY_SIZE(fstypes); i++, info++) {
if (!info->probe(fs_dev_desc, &fs_partition)) {
fs_type = info->fstype;
return 0;
return ret;
}
+struct fs_dir_stream *fs_opendir(const char *filename)
+{
+ struct fstype_info *info = fs_get_info(fs_type);
+ struct fs_dir_stream *dirs = NULL;
+ int ret;
+
+ ret = info->opendir(filename, &dirs);
+ fs_close();
+ if (ret) {
+ errno = -ret;
+ return NULL;
+ }
+
+ dirs->desc = fs_dev_desc;
+ dirs->part = fs_dev_part;
+
+ return dirs;
+}
+
+struct fs_dirent *fs_readdir(struct fs_dir_stream *dirs)
+{
+ struct fstype_info *info;
+ struct fs_dirent *dirent;
+ int ret;
+
+ fs_set_blk_dev_with_part(dirs->desc, dirs->part);
+ info = fs_get_info(fs_type);
+
+ ret = info->readdir(dirs, &dirent);
+ fs_close();
+ if (ret) {
+ errno = -ret;
+ return NULL;
+ }
+
+ return dirent;
+}
+
+void fs_closedir(struct fs_dir_stream *dirs)
+{
+ struct fstype_info *info;
+
+ if (!dirs)
+ return;
+
+ fs_set_blk_dev_with_part(dirs->desc, dirs->part);
+ info = fs_get_info(fs_type);
+
+ info->closedir(dirs);
+ fs_close();
+}
+
+
int do_size(cmd_tbl_t *cmdtp, int flag, int argc, char * const argv[],
int fstype)
{
u_long vl_lower_margin; /* Time from picture to sync */
u_long mmio; /* Memory mapped registers */
+
+ u_int logo_width;
+ u_int logo_height;
+ int logo_x_offset;
+ int logo_y_offset;
+ u_long logo_addr;
} vidinfo_t;
+void atmel_logo_info(vidinfo_t *info);
+void microchip_logo_info(vidinfo_t *info);
+
#endif
* @devnum: Device number, specific to the interface type, or -1 to
* allocate the next available number
* @blksz: Block size of the device in bytes (typically 512)
- * @size: Total size of the device in bytes
+ * @lba: Total number of blocks of the device
* @devp: the new device (which has not been probed)
*/
int blk_create_device(struct udevice *parent, const char *drv_name,
const char *name, int if_type, int devnum, int blksz,
- lbaint_t size, struct udevice **devp);
+ lbaint_t lba, struct udevice **devp);
/**
* blk_create_devicef() - Create a new named block device
* @devnum: Device number, specific to the interface type, or -1 to
* allocate the next available number
* @blksz: Block size of the device in bytes (typically 512)
- * @size: Total size of the device in bytes
+ * @lba: Total number of blocks of the device
* @devp: the new device (which has not been probed)
*/
int blk_create_devicef(struct udevice *parent, const char *drv_name,
const char *name, int if_type, int devnum, int blksz,
- lbaint_t size, struct udevice **devp);
+ lbaint_t lba, struct udevice **devp);
/**
* blk_prepare_device() - Prepare a block device for use
#ifndef _BOOTSTAGE_H
#define _BOOTSTAGE_H
-/* Define this for host tools */
-#ifndef CONFIG_BOOTSTAGE_USER_COUNT
-#define CONFIG_BOOTSTAGE_USER_COUNT 20
-#endif
-
/* Flags for each bootstage record */
enum bootstage_flags {
BOOTSTAGEF_ERROR = 1 << 0, /* Error record */
/* a few spare for the user, from here */
BOOTSTAGE_ID_USER,
- BOOTSTAGE_ID_COUNT = BOOTSTAGE_ID_USER + CONFIG_BOOTSTAGE_USER_COUNT,
BOOTSTAGE_ID_ALLOC,
};
--- /dev/null
+/*
+ * charset conversion utils
+ *
+ * Copyright (c) 2017 Rob Clark
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#ifndef __CHARSET_H_
+#define __CHARSET_H_
+
+#define MAX_UTF8_PER_UTF16 4
+
+/**
+ * utf16_strlen() - Get the length of an utf16 string
+ *
+ * Returns the number of 16 bit characters in an utf16 string, not
+ * including the terminating NULL character.
+ *
+ * @in the string to measure
+ * @return the string length
+ */
+size_t utf16_strlen(const uint16_t *in);
+
+/**
+ * utf16_strnlen() - Get the length of a fixed-size utf16 string.
+ *
+ * Returns the number of 16 bit characters in an utf16 string,
+ * not including the terminating NULL character, but at most
+ * 'count' number of characters. In doing this, utf16_strnlen()
+ * looks at only the first 'count' characters.
+ *
+ * @in the string to measure
+ * @count the maximum number of characters to count
+ * @return the string length, up to a maximum of 'count'
+ */
+size_t utf16_strnlen(const uint16_t *in, size_t count);
+
+/**
+ * utf16_strcpy() - UTF16 equivalent of strcpy()
+ */
+uint16_t *utf16_strcpy(uint16_t *dest, const uint16_t *src);
+
+/**
+ * utf16_strdup() - UTF16 equivalent of strdup()
+ */
+uint16_t *utf16_strdup(const uint16_t *s);
+
+/**
+ * utf16_to_utf8() - Convert an utf16 string to utf8
+ *
+ * Converts 'size' characters of the utf16 string 'src' to utf8
+ * written to the 'dest' buffer.
+ *
+ * NOTE that a single utf16 character can generate up to 4 utf8
+ * characters. See MAX_UTF8_PER_UTF16.
+ *
+ * @dest the destination buffer to write the utf8 characters
+ * @src the source utf16 string
+ * @size the number of utf16 characters to convert
+ * @return the pointer to the first unwritten byte in 'dest'
+ */
+uint8_t *utf16_to_utf8(uint8_t *dest, const uint16_t *src, size_t size);
+
+#endif /* __CHARSET_H_ */
};
#if CONFIG_IS_ENABLED(OF_CONTROL) && CONFIG_IS_ENABLED(CLK)
-struct phandle_2_cell;
+struct phandle_1_arg;
int clk_get_by_index_platdata(struct udevice *dev, int index,
- struct phandle_2_cell *cells, struct clk *clk);
+ struct phandle_1_arg *cells, struct clk *clk);
/**
* clock_get_by_index - Get/request a clock by integer index.
#if (CONFIG_IS_ENABLED(PARTITION_UUIDS) || \
CONFIG_IS_ENABLED(EFI_PARTITION) || \
+ CONFIG_IS_ENABLED(EFI_LOADER) || \
defined(CONFIG_RANDOM_UUID) || \
defined(CONFIG_CMD_UUID) || \
defined(CONFIG_BOOTP_PXE)) && \
#define CONFIG_CMDLINE_EDITING
#define CONFIG_PANIC_HANG
-#define CONFIG_SYS_ICACHE_OFF
-#define CONFIG_SYS_DCACHE_OFF
+#define CONFIG_ARCH_MAP_SYSMEM
#define CONFIG_BOOTP_SEND_HOSTNAME
#define CONFIG_BOOTP_SERVERIP
/* max number of sectors on one chip */
#define CONFIG_FLASH_SECTOR_SIZE (0x10000*2)
-#define CONFIG_ENV_SECT_SIZE CONFIG_FLASH_SECTOR_SIZE
#define CONFIG_SYS_MAX_FLASH_SECT 512
/* environments */
-#define CONFIG_ENV_ADDR (CONFIG_SYS_MONITOR_BASE + 0x140000)
+#define CONFIG_ENV_SPI_BUS 0
+#define CONFIG_ENV_SPI_CS 0
+#define CONFIG_ENV_SPI_MAX_HZ 50000000
+#define CONFIG_ENV_SPI_MODE 0
+#define CONFIG_ENV_SECT_SIZE 0x1000
+#define CONFIG_ENV_OFFSET 0x140000
#define CONFIG_ENV_SIZE 8192
#define CONFIG_ENV_OVERWRITE
+
+/* SPI FLASH */
+#define CONFIG_SF_DEFAULT_BUS 0
+#define CONFIG_SF_DEFAULT_CS 0
+#define CONFIG_SF_DEFAULT_SPEED 1000000
+#define CONFIG_SF_DEFAULT_MODE 0
+
/*
* For booting Linux, the board info and command line data
* have to be in the first 16 MB of memory, since this is
#define CONFIG_CMDLINE_EDITING
-#define CONFIG_SYS_ICACHE_OFF
-#define CONFIG_SYS_DCACHE_OFF
+#define CONFIG_ARCH_MAP_SYSMEM
#define CONFIG_BOOTP_SEND_HOSTNAME
#define CONFIG_BOOTP_SERVERIP
#define CONFIG_BMP_16BPP
#define CONFIG_VIDEO_LOGO
#define CONFIG_VIDEO_BMP_LOGO
-#define CONFIG_IPUV3_CLK 260000000
#define CONFIG_IMX_HDMI
#define CONFIG_IMX_VIDEO_SKIP
#endif
/*
* High Level Configuration Options
*/
-#define CONFIG_EMIF4 /* The chip has EMIF4 controller */
#include <asm/arch/cpu.h> /* get chip and board defs */
#include <asm/arch/omap.h>
#define CONFIG_SYS_MONITOR_BASE CONFIG_SYS_FLASH_BASE
#define CONFIG_NAND_OMAP_GPMC
-#define SMNAND_ENV_OFFSET 0x260000 /* environment starts here */
#define CONFIG_SYS_ENV_SECT_SIZE (128 << 10) /* 128 KiB sector */
-#define CONFIG_ENV_OFFSET SMNAND_ENV_OFFSET
-#define CONFIG_ENV_ADDR SMNAND_ENV_OFFSET
+#define CONFIG_ENV_OFFSET 0x260000
+#define CONFIG_ENV_ADDR 0x260000
/*-----------------------------------------------------------------------
* CFI FLASH driver setup
#define CONFIG_NR_DRAM_BANKS 2 /* CS1 may or may not be populated */
-#define CONFIG_EMIF4 /* The chip has EMIF4 controller */
-
/*
* 1MB into the SDRAM to allow for SPL's bss at the beginning of SDRAM
* 64 bytes before this address should be set aside for u-boot.img's
#define CONFIG_SYS_SPL_MALLOC_START 0x80208000
#define CONFIG_SYS_SPL_MALLOC_SIZE 0x100000
-#include <asm/arch/cpu.h> /* get chip and board defs */
-#include <asm/arch/omap.h>
+#include <configs/ti_omap3_common.h>
+#undef CONFIG_SDRC /* Disable SDRC since we have EMIF4 */
#define CONFIG_MISC_INIT_R
-#define CONFIG_CMDLINE_TAG /* enable passing of ATAGs */
-#define CONFIG_SETUP_MEMORY_TAGS
-#define CONFIG_INITRD_TAG
#define CONFIG_REVISION_TAG
-/* Clock Defines */
-#define V_OSCK 26000000 /* Clock output from T2 */
-#define V_SCLK (V_OSCK >> 1)
-
-/* Size of malloc() pool */
-#define CONFIG_SYS_MALLOC_LEN (16 << 20)
-
/* Hardware drivers */
/* NS16550 Configuration */
-#define V_NS16550_CLK 48000000 /* 48MHz (APLL96/2) */
#define CONFIG_SYS_NS16550_SERIAL
#define CONFIG_SYS_NS16550_REG_SIZE (-4)
-#define CONFIG_SYS_NS16550_CLK V_NS16550_CLK
/* select serial console configuration */
#define CONFIG_CONS_INDEX 3
#define CONFIG_SYS_NS16550_COM3 OMAP34XX_UART3
#define CONFIG_SERIAL3 3 /* UART3 on AM3517 EVM */
+
/* allow to overwrite serial and ethaddr */
#define CONFIG_ENV_OVERWRITE
-#define CONFIG_SYS_BAUDRATE_TABLE {4800, 9600, 19200, 38400, 57600,\
- 115200}
/*
* USB configuration
/* Board NAND Info. */
#ifdef CONFIG_NAND
-#define CONFIG_NAND_OMAP_GPMC
#define CONFIG_NAND_OMAP_GPMC_PREFETCH
#define CONFIG_SYS_NAND_ADDR NAND_BASE /* physical address */
/* to access nand */
-#define CONFIG_SYS_NAND_BASE NAND_BASE /* physical address */
- /* to access */
- /* nand at CS0 */
-#define CONFIG_SYS_MAX_NAND_DEVICE 1 /* Max number of */
- /* NAND devices */
#define CONFIG_SYS_NAND_BUSWIDTH_16BIT
#define CONFIG_SYS_NAND_5_ADDR_CYCLE
#define CONFIG_SYS_NAND_PAGE_COUNT 64
/* We set the max number of command args high to avoid HUSH bugs. */
#define CONFIG_SYS_MAXARGS 64
-/* Console I/O Buffer Size */
-#define CONFIG_SYS_CBSIZE 512
+/* Print Buffer Size */
+#define CONFIG_SYS_PBSIZE (CONFIG_SYS_CBSIZE \
+ + sizeof(CONFIG_SYS_PROMPT) + 16)
+/* Boot Argument Buffer Size */
+#define CONFIG_SYS_BARGSIZE CONFIG_SYS_CBSIZE
/* memtest works on */
#define CONFIG_SYS_MEMTEST_START (OMAP34XX_SDRC_CS0)
#define CONFIG_SYS_MEMTEST_END (OMAP34XX_SDRC_CS0 + \
0x01F00000) /* 31MB */
-#define CONFIG_SYS_LOAD_ADDR (OMAP34XX_SDRC_CS0) /* default load */
- /* address */
-
-/*
- * AM3517 has 12 GP timers, they can be driven by the system clock
- * (12/13/16.8/19.2/38.4MHz) or by 32KHz clock. We use 13MHz (V_SCLK).
- * This rate is divided by a local divisor.
- */
-#define CONFIG_SYS_TIMERBASE OMAP34XX_GPT2
-#define CONFIG_SYS_PTV 2 /* Divisor: 2^(PTV+1) => 8 */
-
/* Physical Memory Map */
-#define PHYS_SDRAM_1 OMAP34XX_SDRC_CS0
-#define PHYS_SDRAM_2 OMAP34XX_SDRC_CS1
#define CONFIG_SYS_CS0_SIZE (256 * 1024 * 1024)
-#define CONFIG_SYS_SDRAM_BASE PHYS_SDRAM_1
#define CONFIG_SYS_INIT_RAM_ADDR 0x4020f800
#define CONFIG_SYS_INIT_RAM_SIZE 0x800
-#define CONFIG_SYS_INIT_SP_ADDR (CONFIG_SYS_INIT_RAM_ADDR + \
- CONFIG_SYS_INIT_RAM_SIZE - \
- GENERATED_GBL_DATA_SIZE)
/* FLASH and environment organization */
#define CONFIG_SYS_ENV_SECT_SIZE (128 << 10) /* 128 KiB */
#define CONFIG_ENV_SIZE CONFIG_SYS_ENV_SECT_SIZE
-#define SMNAND_ENV_OFFSET 0x260000 /* environment starts here */
-#define CONFIG_ENV_OFFSET SMNAND_ENV_OFFSET
-#define CONFIG_ENV_ADDR SMNAND_ENV_OFFSET
+#define CONFIG_ENV_OFFSET 0x260000
+#define CONFIG_ENV_ADDR 0x260000
/* Defines for SPL */
#define CONFIG_SPL_FRAMEWORK
-#define CONFIG_SPL_NAND_SIMPLE
+#undef CONFIG_SPL_TEXT_BASE
#define CONFIG_SPL_TEXT_BASE 0x40200000
#define CONFIG_SPL_MAX_SIZE (SRAM_SCRATCH_SPACE_ADDR - \
CONFIG_SPL_TEXT_BASE)
+#undef CONFIG_SPL_BSS_START_ADDR
#define CONFIG_SPL_BSS_START_ADDR 0x80000000
#define CONFIG_SPL_BSS_MAX_SIZE 0x80000 /* 512 KB */
#define CONFIG_BMP_16BPP
#define CONFIG_VIDEO_LOGO
#define CONFIG_VIDEO_BMP_LOGO
-#define CONFIG_IPUV3_CLK 260000000
#define CONFIG_CONSOLE_MUX
#define CONFIG_IMX_HDMI
#define CONFIG_IMX_VIDEO_SKIP
#define CONFIG_BMP_16BPP
#define CONFIG_VIDEO_LOGO
#define CONFIG_VIDEO_BMP_LOGO
-#define CONFIG_IPUV3_CLK 198000000
#define CONFIG_IMX_VIDEO_SKIP
#define CONFIG_PWM_IMX
#ifndef __AT91_SAMA5_COMMON_H
#define __AT91_SAMA5_COMMON_H
-#include <asm/hardware.h>
-
#define CONFIG_SYS_TEXT_BASE 0x26f00000
/* ARM asynchronous clock */
* Command line configuration.
*/
-#ifdef CONFIG_SYS_USE_MMC
+#ifdef CONFIG_SD_BOOT
#ifdef CONFIG_ENV_IS_IN_MMC
/* Use raw reserved sectors to save environment */
#else
-#ifdef CONFIG_SYS_USE_NANDFLASH
+#ifdef CONFIG_NAND_BOOT
/* u-boot env in nand flash */
#define CONFIG_ENV_OFFSET 0xc0000
#define CONFIG_ENV_OFFSET_REDUND 0x100000
#define CONFIG_BOOTCOMMAND "nand read 0x21000000 0x180000 0x80000;" \
"nand read 0x22000000 0x200000 0x600000;" \
"bootz 0x22000000 - 0x21000000"
-#elif CONFIG_SYS_USE_SERIALFLASH
+#elif CONFIG_SPI_BOOT
/* u-boot env in serial flash, by default is bus 0 and cs 0 */
#define CONFIG_ENV_OFFSET 0x6000
#define CONFIG_ENV_SIZE 0x2000
#ifndef __CONFIG_H
#define __CONFIG_H
-#include <asm/hardware.h>
-
#define CONFIG_SYS_TEXT_BASE 0x73f00000
#define CONFIG_ATMEL_LEGACY /* required until (g)pio is fixed */
/* SDRAM */
#define CONFIG_NR_DRAM_BANKS 1
-#define CONFIG_SYS_SDRAM_BASE ATMEL_BASE_CS6
+#define CONFIG_SYS_SDRAM_BASE 0x70000000
#define CONFIG_SYS_SDRAM_SIZE 0x08000000
#define CONFIG_SYS_INIT_SP_ADDR \
#define CONFIG_SYS_MEMTEST_START CONFIG_SYS_SDRAM_BASE
#define CONFIG_SYS_MEMTEST_END 0x23e00000
-#ifdef CONFIG_SYS_USE_NANDFLASH
+#ifdef CONFIG_NAND_BOOT
/* bootstrap + u-boot + env in nandflash */
#define CONFIG_ENV_OFFSET 0x120000
#define CONFIG_ENV_OFFSET_REDUND 0x100000
#define CONFIG_BOOTCOMMAND \
"nand read 0x70000000 0x200000 0x300000;" \
"bootm 0x70000000"
-#elif CONFIG_SYS_USE_MMC
+#elif CONFIG_SD_BOOT
/* bootstrap + u-boot + env + linux in mmc */
#define CONFIG_ENV_SIZE 0x4000
#define CONFIG_SYS_MONITOR_LEN 0x80000
-#ifdef CONFIG_SYS_USE_MMC
+#ifdef CONFIG_SD_BOOT
#define CONFIG_SPL_BSS_START_ADDR 0x70000000
#define CONFIG_SPL_BSS_MAX_SIZE 0x00080000
#define CONFIG_SYS_MMCSD_FS_BOOT_PARTITION 1
#define CONFIG_SPL_FS_LOAD_PAYLOAD_NAME "u-boot.img"
-#elif CONFIG_SYS_USE_NANDFLASH
+#elif CONFIG_NAND_BOOT
#define CONFIG_SPL_NAND_DRIVERS
#define CONFIG_SPL_NAND_BASE
#define CONFIG_SPL_NAND_ECC
#ifndef __AT91SAM9N12_CONFIG_H_
#define __AT91SAM9N12_CONFIG_H_
-/*
- * SoC must be defined first, before hardware.h is included.
- * In this case SoC is defined in boards.cfg.
- */
-#include <asm/hardware.h>
-
#define CONFIG_SYS_TEXT_BASE 0x26f00000
/* ARM asynchronous clock */
* that address while providing maximum stack area below.
*/
# define CONFIG_SYS_INIT_SP_ADDR \
- (ATMEL_BASE_SRAM + 16 * 1024 - GENERATED_GBL_DATA_SIZE)
+ (0x00300000 + 16 * 1024 - GENERATED_GBL_DATA_SIZE)
/* DataFlash */
#ifdef CONFIG_CMD_SF
#define CONFIG_SYS_USB_OHCI_MAX_ROOT_PORTS 1
#endif
-#ifdef CONFIG_SYS_USE_SPIFLASH
+#ifdef CONFIG_SPI_BOOT
/* bootstrap + u-boot + env + linux in dataflash on CS0 */
#define CONFIG_ENV_OFFSET 0x5000
"sf probe 0; sf read 0x22000000 0x100000 0x300000; " \
"bootm 0x22000000"
-#elif defined(CONFIG_SYS_USE_NANDFLASH)
+#elif defined(CONFIG_NAND_BOOT)
/* bootstrap + u-boot + env + linux in nandflash */
#define CONFIG_ENV_OFFSET 0x120000
"nand read 0x22000000 0x200000 0x400000;" \
"bootm 0x22000000 - 0x21000000"
-#else /* CONFIG_SYS_USE_MMC */
+#else /* CONFIG_SD_BOOT */
/* bootstrap + u-boot + env + linux in mmc */
#define CONFIG_SYS_MCKR 0x1301
#define CONFIG_SYS_MCKR_CSS 0x1302
-#ifdef CONFIG_SYS_USE_MMC
+#ifdef CONFIG_SD_BOOT
#define CONFIG_SYS_MMCSD_FS_BOOT_PARTITION 1
#define CONFIG_SPL_FS_LOAD_PAYLOAD_NAME "u-boot.img"
#elif CONFIG_SYS_USE_NANDFLASH
+#elif CONFIG_SPI_BOOT
+#define CONFIG_SPL_SPI_LOAD
+#define CONFIG_SYS_SPI_U_BOOT_OFFS 0x8400
+
+#elif CONFIG_NAND_BOOT
#define CONFIG_SPL_NAND_DRIVERS
#define CONFIG_SPL_NAND_BASE
+#endif
#define CONFIG_SYS_NAND_U_BOOT_OFFS 0x40000
#define CONFIG_SYS_NAND_5_ADDR_CYCLE
#define CONFIG_SYS_NAND_PAGE_SIZE 0x800
#define CONFIG_SYS_NAND_BAD_BLOCK_POS 0x0
#define CONFIG_SPL_GENERATE_ATMEL_PMECC_HEADER
-#elif CONFIG_SYS_USE_SPIFLASH
-#define CONFIG_SPL_SPI_LOAD
-#define CONFIG_SYS_SPI_U_BOOT_OFFS 0x8400
-
-#endif
-
#endif
#ifndef __CONFIG_H__
#define __CONFIG_H__
-#include <asm/hardware.h>
-
#define CONFIG_SYS_TEXT_BASE 0x26f00000
/* ARM asynchronous clock */
#define CONFIG_SYS_AT91_SLOW_CLOCK 32768
#define CONFIG_SYS_AT91_MAIN_CLOCK 12000000 /* 12 MHz crystal */
-#define CONFIG_AT91SAM9X5EK
-
#define CONFIG_CMDLINE_TAG /* enable passing of ATAGs */
#define CONFIG_SETUP_MEMORY_TAGS
#define CONFIG_INITRD_TAG
#define CONFIG_SYS_MEMTEST_START CONFIG_SYS_SDRAM_BASE
#define CONFIG_SYS_MEMTEST_END 0x26e00000
-#ifdef CONFIG_SYS_USE_NANDFLASH
+#ifdef CONFIG_NAND_BOOT
/* bootstrap + u-boot + env + linux in nandflash */
#define CONFIG_ENV_OFFSET 0x120000
#define CONFIG_ENV_OFFSET_REDUND 0x100000
#define CONFIG_BOOTCOMMAND "nand read " \
"0x22000000 0x200000 0x300000; " \
"bootm 0x22000000"
-#elif defined(CONFIG_SYS_USE_SPIFLASH)
+#elif defined(CONFIG_SPI_BOOT)
/* bootstrap + u-boot + env + linux in spi flash */
#define CONFIG_ENV_OFFSET 0x5000
#define CONFIG_ENV_SIZE 0x3000
#define CONFIG_BOOTCOMMAND "sf probe 0; " \
"sf read 0x22000000 0x84000 0x294000; " \
"bootm 0x22000000"
-#else /* CONFIG_SYS_USE_MMC */
+#else /* CONFIG_SD_BOOT */
/* bootstrap + u-boot + env + linux in mmc */
#define CONFIG_ENV_SIZE 0x4000
#endif
#define CONFIG_SYS_MCKR 0x1301
#define CONFIG_SYS_MCKR_CSS 0x1302
-#ifdef CONFIG_SYS_USE_MMC
+#ifdef CONFIG_SD_BOOT
#define CONFIG_SYS_MMCSD_FS_BOOT_PARTITION 1
#define CONFIG_SPL_FS_LOAD_PAYLOAD_NAME "u-boot.img"
-#elif CONFIG_SYS_USE_NANDFLASH
+#elif CONFIG_SPI_BOOT
+#define CONFIG_SPL_SPI_LOAD
+#define CONFIG_SYS_SPI_U_BOOT_OFFS 0x8400
+
+#elif CONFIG_NAND_BOOT
#define CONFIG_SPL_NAND_DRIVERS
#define CONFIG_SPL_NAND_BASE
+#endif
#define CONFIG_SYS_NAND_U_BOOT_OFFS 0x40000
#define CONFIG_SYS_NAND_5_ADDR_CYCLE
#define CONFIG_SYS_NAND_PAGE_SIZE 0x800
#define CONFIG_SYS_NAND_BAD_BLOCK_POS 0x0
#define CONFIG_SPL_GENERATE_ATMEL_PMECC_HEADER
-#elif CONFIG_SYS_USE_SPIFLASH
-#define CONFIG_SPL_SPI_LOAD
-#define CONFIG_SYS_SPI_U_BOOT_OFFS 0x8400
-
-#endif
-
#endif
#define CONFIG_BMP_16BPP
#define CONFIG_VIDEO_LOGO
#define CONFIG_VIDEO_BMP_LOGO
-#ifdef CONFIG_MX6DL
-#define CONFIG_IPUV3_CLK 198000000
-#else
-#define CONFIG_IPUV3_CLK 264000000
-#endif
#define CONFIG_IMX_HDMI
/* SATA */
--- /dev/null
+/*
+ * Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#ifndef __CONFIG_H
+#define __CONFIG_H
+
+#include <configs/x86-common.h>
+
+#define CONFIG_SYS_MONITOR_LEN (2 << 20)
+
+#define CONFIG_STD_DEVICES_SETTINGS "stdin=usbkbd,serial\0" \
+ "stdout=vidconsole,serial\0" \
+ "stderr=vidconsole,serial\0"
+
+/* Environment configuration */
+#define CONFIG_ENV_SECT_SIZE 0x10000
+#define CONFIG_ENV_OFFSET 0x005f0000
+
+#endif /* __CONFIG_H */
/* Display */
#define CONFIG_VIDEO_IPUV3
-#define CONFIG_IPUV3_CLK 260000000
#define CONFIG_IMX_HDMI
#define CONFIG_SPLASH_SCREEN
*/
#define CONFIG_CM_T3X /* working with CM-T35 and CM-T3730 */
-#define CONFIG_SDRC /* The chip has SDRC controller */
-
#include <asm/arch/cpu.h> /* get chip and board defs */
#include <asm/arch/omap.h>
#define CONFIG_SYS_MONITOR_BASE CONFIG_SYS_FLASH_BASE
#define CONFIG_SYS_MONITOR_LEN (256 << 10) /* Reserve 2 sectors */
-#define SMNAND_ENV_OFFSET 0x260000 /* environment starts here */
-#define CONFIG_ENV_OFFSET SMNAND_ENV_OFFSET
-#define CONFIG_ENV_ADDR SMNAND_ENV_OFFSET
+#define CONFIG_ENV_OFFSET 0x260000
+#define CONFIG_ENV_ADDR 0x260000
#if defined(CONFIG_CMD_NET)
#define CONFIG_SMC911X
* to be on the safe side once the default is changed.
*/
-#define CONFIG_EMIF4 /* The chip has EMIF4 controller */
-
#include <asm/arch/cpu.h> /* get chip and board defs */
#include <asm/arch/omap.h>
#define CONFIG_SYS_MONITOR_BASE CONFIG_SYS_FLASH_BASE
#define CONFIG_SYS_MONITOR_LEN (256 << 10) /* Reserve 2 sectors */
-#define SMNAND_ENV_OFFSET 0x260000 /* environment starts here */
-#define CONFIG_ENV_OFFSET SMNAND_ENV_OFFSET
-#define CONFIG_ENV_ADDR SMNAND_ENV_OFFSET
+#define CONFIG_ENV_OFFSET 0x260000
+#define CONFIG_ENV_ADDR 0x260000
#if defined(CONFIG_CMD_NET)
#define CONFIG_DRIVER_TI_EMAC
#define CONFIG_BMP_16BPP
#define CONFIG_VIDEO_LOGO
#define CONFIG_VIDEO_BMP_LOGO
-#define CONFIG_IPUV3_CLK 260000000
#define CONFIG_CONSOLE_MUX
#define CONFIG_IMX_HDMI
#define CONFIG_IMX_VIDEO_SKIP
0x01000000) /* 16MB */
/* NAND and environment organization */
-#define SMNAND_ENV_OFFSET 0x260000 /* environment starts here */
-#define CONFIG_ENV_OFFSET SMNAND_ENV_OFFSET
+#define CONFIG_ENV_OFFSET 0x260000
/* SRAM config */
#define CONFIG_SYS_SRAM_START 0x40200000
#define CONFIG_BMP_16BPP
#define CONFIG_VIDEO_LOGO
#define CONFIG_VIDEO_BMP_LOGO
-#define CONFIG_IPUV3_CLK 260000000
#define CONFIG_IMX_HDMI
#define CONFIG_IMX_VIDEO_SKIP
#define CONFIG_BMP_16BPP
#define CONFIG_VIDEO_LOGO
#define CONFIG_VIDEO_BMP_LOGO
-#define CONFIG_IPUV3_CLK 260000000
#define CONFIG_IMX_HDMI
#define CONFIG_IMX_VIDEO_SKIP
#endif
#define CONFIG_SYS_I2C_MXC_I2C2
#define CONFIG_SYS_I2C_MXC_I2C3
+#define CONFIG_SYS_NUM_I2C_BUSES 9
+#define CONFIG_SYS_I2C_MAX_HOPS 1
+#define CONFIG_SYS_I2C_BUSES { {0, {I2C_NULL_HOP} }, \
+ {0, {{I2C_MUX_PCA9547, 0x70, 0} } }, \
+ {0, {{I2C_MUX_PCA9547, 0x70, 1} } }, \
+ {0, {{I2C_MUX_PCA9547, 0x70, 2} } }, \
+ {0, {{I2C_MUX_PCA9547, 0x70, 3} } }, \
+ {0, {{I2C_MUX_PCA9547, 0x70, 4} } }, \
+ {0, {{I2C_MUX_PCA9547, 0x70, 5} } }, \
+ {0, {{I2C_MUX_PCA9547, 0x70, 6} } }, \
+ {0, {{I2C_MUX_PCA9547, 0x70, 7} } }, \
+ }
+
+#define CONFIG_BCH
+
#endif /* __GE_BX50V3_CONFIG_H */
/* Framebuffer and LCD */
#define CONFIG_VIDEO_IPUV3
#define CONFIG_VIDEO_LOGO
-#define CONFIG_IPUV3_CLK 260000000
#define CONFIG_IMX_HDMI
#define CONFIG_IMX_VIDEO_SKIP
#define CONFIG_VIDEO_BMP_LOGO
/* Framebuffer */
#ifdef CONFIG_VIDEO_IPUV3
-# define CONFIG_IPUV3_CLK 260000000
# define CONFIG_IMX_VIDEO_SKIP
# define CONFIG_SPLASH_SCREEN
"run envboot; " \
"run run_mon_hs; " \
"run init_${boot}; " \
- "run set_name_pmmc get_pmmc_${boot} run_pmmc; " \
"run get_fit_${boot}; " \
"bootm ${fit_loadaddr}#${name_fdt}"
#endif
--- /dev/null
+/*
+ * Copyright 2017 NXP
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#ifndef __LS1088_COMMON_H
+#define __LS1088_COMMON_H
+
+
+#define CONFIG_REMAKE_ELF
+#define CONFIG_FSL_LAYERSCAPE
+#define CONFIG_MP
+
+#include <asm/arch/stream_id_lsch3.h>
+#include <asm/arch/config.h>
+#include <asm/arch/soc.h>
+
+/* Link Definitions */
+#define CONFIG_SYS_INIT_SP_ADDR (CONFIG_SYS_FSL_OCRAM_BASE + 0xfff0)
+
+/* Link Definitions */
+#ifdef CONFIG_QSPI_BOOT
+#define CONFIG_SYS_TEXT_BASE 0x20100000
+#else
+#define CONFIG_SYS_TEXT_BASE 0x30100000
+#endif
+
+#define CONFIG_SUPPORT_RAW_INITRD
+
+
+#define CONFIG_SKIP_LOWLEVEL_INIT
+
+#define CONFIG_FSL_DDR_INTERACTIVE /* Interactive debugging */
+
+#define CONFIG_VERY_BIG_RAM
+#define CONFIG_SYS_DDR_SDRAM_BASE 0x80000000UL
+#define CONFIG_SYS_FSL_DDR_SDRAM_BASE_PHY 0
+#define CONFIG_SYS_SDRAM_BASE CONFIG_SYS_DDR_SDRAM_BASE
+#define CONFIG_SYS_DDR_BLOCK2_BASE 0x8080000000ULL
+#define CONFIG_SYS_FSL_DDR_MAIN_NUM_CTRLS 1
+/*
+ * SMP Definitinos
+ */
+#define CPU_RELEASE_ADDR secondary_boot_func
+
+#ifdef CONFIG_PCI
+#define CONFIG_CMD_PCI
+#endif
+
+/* Size of malloc() pool */
+#define CONFIG_SYS_MALLOC_LEN (CONFIG_ENV_SIZE + 2048 * 1024)
+
+/* I2C */
+#define CONFIG_SYS_I2C
+#define CONFIG_SYS_I2C_MXC
+#define CONFIG_SYS_I2C_MXC_I2C1 /* enable I2C bus 1 */
+#define CONFIG_SYS_I2C_MXC_I2C2 /* enable I2C bus 2 */
+#define CONFIG_SYS_I2C_MXC_I2C3 /* enable I2C bus 3 */
+#define CONFIG_SYS_I2C_MXC_I2C4 /* enable I2C bus 4 */
+
+/* Serial Port */
+#define CONFIG_CONS_INDEX 1
+#define CONFIG_SYS_NS16550_SERIAL
+#define CONFIG_SYS_NS16550_REG_SIZE 1
+#define CONFIG_SYS_NS16550_CLK (get_bus_freq(0) / 2)
+
+#define CONFIG_BAUDRATE 115200
+#define CONFIG_SYS_BAUDRATE_TABLE { 9600, 19200, 38400, 57600, 115200 }
+
+/* IFC */
+#define CONFIG_FSL_IFC
+
+/*
+ * During booting, IFC is mapped at the region of 0x30000000.
+ * But this region is limited to 256MB. To accommodate NOR, promjet
+ * and FPGA. This region is divided as below:
+ * 0x30000000 - 0x37ffffff : 128MB : NOR flash
+ * 0x38000000 - 0x3BFFFFFF : 64MB : Promjet
+ * 0x3C000000 - 0x40000000 : 64MB : FPGA etc
+ *
+ * To accommodate bigger NOR flash and other devices, we will map IFC
+ * chip selects to as below:
+ * 0x5_1000_0000..0x5_1fff_ffff Memory Hole
+ * 0x5_2000_0000..0x5_3fff_ffff IFC CSx (FPGA, NAND and others 512MB)
+ * 0x5_4000_0000..0x5_7fff_ffff ASIC or others 1GB
+ * 0x5_8000_0000..0x5_bfff_ffff IFC CS0 1GB (NOR/Promjet)
+ * 0x5_C000_0000..0x5_ffff_ffff IFC CS1 1GB (NOR/Promjet)
+ *
+ * For e.g. NOR flash at CS0 will be mapped to 0x580000000 after relocation.
+ * CONFIG_SYS_FLASH_BASE has the final address (core view)
+ * CONFIG_SYS_FLASH_BASE_PHYS has the final address (IFC view)
+ * CONFIG_SYS_FLASH_BASE_PHYS_EARLY has the temporary IFC address
+ * CONFIG_SYS_TEXT_BASE is linked to 0x30000000 for booting
+ */
+
+#define CONFIG_SYS_FLASH_BASE 0x580000000ULL
+#define CONFIG_SYS_FLASH_BASE_PHYS 0x80000000
+#define CONFIG_SYS_FLASH_BASE_PHYS_EARLY 0x00000000
+
+#define CONFIG_SYS_FLASH1_BASE_PHYS 0xC0000000
+#define CONFIG_SYS_FLASH1_BASE_PHYS_EARLY 0x8000000
+
+#ifndef __ASSEMBLY__
+unsigned long long get_qixis_addr(void);
+#endif
+
+#define QIXIS_BASE get_qixis_addr()
+#define QIXIS_BASE_PHYS 0x20000000
+#define QIXIS_BASE_PHYS_EARLY 0xC000000
+
+
+#define CONFIG_SYS_NAND_BASE 0x530000000ULL
+#define CONFIG_SYS_NAND_BASE_PHYS 0x30000000
+
+
+/* MC firmware */
+/* TODO Actual DPL max length needs to be confirmed with the MC FW team */
+#define CONFIG_SYS_LS_MC_DPC_MAX_LENGTH 0x20000
+#define CONFIG_SYS_LS_MC_DRAM_DPC_OFFSET 0x00F00000
+#define CONFIG_SYS_LS_MC_DPL_MAX_LENGTH 0x20000
+#define CONFIG_SYS_LS_MC_DRAM_DPL_OFFSET 0x00F20000
+#define CONFIG_SYS_LS_MC_AIOP_IMG_MAX_LENGTH 0x200000
+#define CONFIG_SYS_LS_MC_DRAM_AIOP_IMG_OFFSET 0x07000000
+/*
+ * Carve out a DDR region which will not be used by u-boot/Linux
+ *
+ * It will be used by MC and Debug Server. The MC region must be
+ * 512MB aligned, so the min size to hide is 512MB.
+ */
+
+#if defined(CONFIG_FSL_MC_ENET)
+#define CONFIG_SYS_LS_MC_DRAM_BLOCK_MIN_SIZE (512UL * 1024 * 1024)
+#endif
+
+#define CONFIG_FSL_CAAM /* Enable SEC/CAAM */
+
+/* Command line configuration */
+#define CONFIG_CMD_GREPENV
+#define CONFIG_CMD_CACHE
+
+/* Miscellaneous configurable options */
+#define CONFIG_SYS_LOAD_ADDR (CONFIG_SYS_DDR_SDRAM_BASE + 0x10000000)
+
+/* Physical Memory Map */
+#define CONFIG_CHIP_SELECTS_PER_CTRL 4
+
+#define CONFIG_NR_DRAM_BANKS 2
+
+#define CONFIG_HWCONFIG
+#define HWCONFIG_BUFFER_SIZE 128
+
+/* #define CONFIG_DISPLAY_CPUINFO */
+
+/* Allow to overwrite serial and ethaddr */
+#define CONFIG_ENV_OVERWRITE
+
+/* Initial environment variables */
+#define CONFIG_EXTRA_ENV_SETTINGS \
+ "hwconfig=fsl_ddr:bank_intlv=auto\0" \
+ "loadaddr=0x80100000\0" \
+ "kernel_addr=0x100000\0" \
+ "ramdisk_addr=0x800000\0" \
+ "ramdisk_size=0x2000000\0" \
+ "fdt_high=0xa0000000\0" \
+ "initrd_high=0xffffffffffffffff\0" \
+ "kernel_start=0x581000000\0" \
+ "kernel_load=0xa0000000\0" \
+ "kernel_size=0x2800000\0" \
+ "console=ttyAMA0,38400n8\0" \
+ "mcinitcmd=fsl_mc start mc 0x580a00000" \
+ " 0x580e00000 \0"
+
+#define CONFIG_BOOTARGS "console=ttyS0,115200 root=/dev/ram0 " \
+ "earlycon=uart8250,mmio,0x21c0500 " \
+ "ramdisk_size=0x3000000 default_hugepagesz=2m" \
+ " hugepagesz=2m hugepages=256"
+#if defined(CONFIG_QSPI_BOOT)
+#define CONFIG_BOOTCOMMAND "sf probe 0:0;" \
+ "sf read 0x80200000 0xd00000 0x100000;"\
+ " fsl_mc apply dpl 0x80200000 &&" \
+ " sf read $kernel_load $kernel_start" \
+ " $kernel_size && bootm $kernel_load"
+#else /* NOR BOOT*/
+#define CONFIG_BOOTCOMMAND "fsl_mc apply dpl 0x580d00000 &&" \
+ " cp.b $kernel_start $kernel_load" \
+ " $kernel_size && bootm $kernel_load"
+#endif
+
+/* Monitor Command Prompt */
+#define CONFIG_SYS_CBSIZE 512 /* Console I/O Buffer Size */
+#define CONFIG_SYS_PBSIZE (CONFIG_SYS_CBSIZE + \
+ sizeof(CONFIG_SYS_PROMPT) + 16)
+#define CONFIG_SYS_PROMPT_HUSH_PS2 "> "
+#define CONFIG_SYS_BARGSIZE CONFIG_SYS_CBSIZE /* Boot args buffer */
+#define CONFIG_SYS_LONGHELP
+#define CONFIG_CMDLINE_EDITING 1
+#define CONFIG_AUTO_COMPLETE
+#define CONFIG_SYS_MAXARGS 64 /* max command args */
+
+#define CONFIG_PANIC_HANG /* do not reset board on panic */
+
+#define CONFIG_SYS_BOOTM_LEN (64 << 20) /* Increase max gunzip size */
+
+#endif /* __LS1088_COMMON_H */
--- /dev/null
+/*
+ * Copyright 2017 NXP
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#ifndef __LS1088A_QDS_H
+#define __LS1088A_QDS_H
+
+#include "ls1088a_common.h"
+
+
+#define CONFIG_DISPLAY_BOARDINFO_LATE
+
+
+#ifndef __ASSEMBLY__
+unsigned long get_board_sys_clk(void);
+unsigned long get_board_ddr_clk(void);
+#endif
+
+
+#if defined(CONFIG_QSPI_BOOT)
+#define CONFIG_ENV_IS_IN_SPI_FLASH
+#define CONFIG_ENV_SIZE 0x2000 /* 8KB */
+#define CONFIG_ENV_OFFSET 0x300000 /* 3MB */
+#define CONFIG_ENV_SECT_SIZE 0x40000
+#else
+#define CONFIG_ENV_IS_IN_FLASH
+#define CONFIG_ENV_ADDR (CONFIG_SYS_FLASH_BASE + 0x300000)
+#define CONFIG_ENV_SECT_SIZE 0x20000
+#define CONFIG_ENV_SIZE 0x20000
+#endif
+
+#if defined(CONFIG_QSPI_BOOT)
+#define CONFIG_QIXIS_I2C_ACCESS
+#define SYS_NO_FLASH
+
+#undef CONFIG_CMD_IMLS
+#define CONFIG_SYS_CLK_FREQ 100000000
+#define CONFIG_DDR_CLK_FREQ 100000000
+#else
+#define CONFIG_SYS_CLK_FREQ get_board_sys_clk()
+#define CONFIG_DDR_CLK_FREQ get_board_ddr_clk()
+#endif
+
+#define COUNTER_FREQUENCY_REAL (CONFIG_SYS_CLK_FREQ/4)
+#define COUNTER_FREQUENCY 25000000 /* 25MHz */
+
+#define CONFIG_DIMM_SLOTS_PER_CTLR 1
+
+#define CONFIG_DDR_SPD
+#define CONFIG_DDR_ECC
+#define CONFIG_ECC_INIT_VIA_DDRCONTROLLER
+#define CONFIG_MEM_INIT_VALUE 0xdeadbeef
+#define SPD_EEPROM_ADDRESS 0x51
+#define CONFIG_SYS_SPD_BUS_NUM 0
+
+
+/*
+ * IFC Definitions
+ */
+#if !defined(CONFIG_QSPI_BOOT) && !defined(CONFIG_SD_BOOT_QSPI)
+#define CONFIG_SYS_NOR0_CSPR_EXT (0x0)
+#define CONFIG_SYS_NOR_AMASK IFC_AMASK(128*1024*1024)
+#define CONFIG_SYS_NOR_AMASK_EARLY IFC_AMASK(64*1024*1024)
+
+#define CONFIG_SYS_NOR0_CSPR \
+ (CSPR_PHYS_ADDR(CONFIG_SYS_FLASH_BASE_PHYS) | \
+ CSPR_PORT_SIZE_16 | \
+ CSPR_MSEL_NOR | \
+ CSPR_V)
+#define CONFIG_SYS_NOR0_CSPR_EARLY \
+ (CSPR_PHYS_ADDR(CONFIG_SYS_FLASH_BASE_PHYS_EARLY) | \
+ CSPR_PORT_SIZE_16 | \
+ CSPR_MSEL_NOR | \
+ CSPR_V)
+#define CONFIG_SYS_NOR1_CSPR \
+ (CSPR_PHYS_ADDR(CONFIG_SYS_FLASH1_BASE_PHYS) | \
+ CSPR_PORT_SIZE_16 | \
+ CSPR_MSEL_NOR | \
+ CSPR_V)
+#define CONFIG_SYS_NOR1_CSPR_EARLY \
+ (CSPR_PHYS_ADDR(CONFIG_SYS_FLASH1_BASE_PHYS_EARLY) | \
+ CSPR_PORT_SIZE_16 | \
+ CSPR_MSEL_NOR | \
+ CSPR_V)
+#define CONFIG_SYS_NOR_CSOR CSOR_NOR_ADM_SHIFT(12)
+#define CONFIG_SYS_NOR_FTIM0 (FTIM0_NOR_TACSE(0x4) | \
+ FTIM0_NOR_TEADC(0x5) | \
+ FTIM0_NOR_TEAHC(0x5))
+#define CONFIG_SYS_NOR_FTIM1 (FTIM1_NOR_TACO(0x35) | \
+ FTIM1_NOR_TRAD_NOR(0x1a) |\
+ FTIM1_NOR_TSEQRAD_NOR(0x13))
+#define CONFIG_SYS_NOR_FTIM2 (FTIM2_NOR_TCS(0x4) | \
+ FTIM2_NOR_TCH(0x4) | \
+ FTIM2_NOR_TWPH(0x0E) | \
+ FTIM2_NOR_TWP(0x1c))
+#define CONFIG_SYS_NOR_FTIM3 0x04000000
+#define CONFIG_SYS_IFC_CCR 0x01000000
+
+#ifndef SYS_NO_FLASH
+#define CONFIG_FLASH_CFI_DRIVER
+#define CONFIG_SYS_FLASH_CFI
+#define CONFIG_SYS_FLASH_USE_BUFFER_WRITE
+#define CONFIG_SYS_FLASH_QUIET_TEST
+#define CONFIG_FLASH_SHOW_PROGRESS 45 /* count down from 45/5: 9..1 */
+
+#define CONFIG_SYS_MAX_FLASH_BANKS 2 /* number of banks */
+#define CONFIG_SYS_MAX_FLASH_SECT 1024 /* sectors per device */
+#define CONFIG_SYS_FLASH_ERASE_TOUT 60000 /* Flash Erase Timeout (ms) */
+#define CONFIG_SYS_FLASH_WRITE_TOUT 500 /* Flash Write Timeout (ms) */
+
+#define CONFIG_SYS_FLASH_EMPTY_INFO
+#define CONFIG_SYS_FLASH_BANKS_LIST { CONFIG_SYS_FLASH_BASE,\
+ CONFIG_SYS_FLASH_BASE + 0x40000000}
+#endif
+#endif
+
+#define CONFIG_NAND_FSL_IFC
+#define CONFIG_SYS_NAND_MAX_ECCPOS 256
+#define CONFIG_SYS_NAND_MAX_OOBFREE 2
+
+#define CONFIG_SYS_NAND_CSPR_EXT (0x0)
+#define CONFIG_SYS_NAND_CSPR (CSPR_PHYS_ADDR(CONFIG_SYS_NAND_BASE_PHYS) \
+ | CSPR_PORT_SIZE_8 /* Port Size = 8 bit */ \
+ | CSPR_MSEL_NAND /* MSEL = NAND */ \
+ | CSPR_V)
+#define CONFIG_SYS_NAND_AMASK IFC_AMASK(64 * 1024)
+
+#define CONFIG_SYS_NAND_CSOR (CSOR_NAND_ECC_ENC_EN /* ECC on encode */ \
+ | CSOR_NAND_ECC_DEC_EN /* ECC on decode */ \
+ | CSOR_NAND_ECC_MODE_4 /* 4-bit ECC */ \
+ | CSOR_NAND_RAL_3 /* RAL = 3Byes */ \
+ | CSOR_NAND_PGS_2K /* Page Size = 2K */ \
+ | CSOR_NAND_SPRZ_64/* Spare size = 64 */ \
+ | CSOR_NAND_PB(64)) /*Pages Per Block = 64*/
+
+#define CONFIG_SYS_NAND_ONFI_DETECTION
+
+/* ONFI NAND Flash mode0 Timing Params */
+#define CONFIG_SYS_NAND_FTIM0 (FTIM0_NAND_TCCST(0x07) | \
+ FTIM0_NAND_TWP(0x18) | \
+ FTIM0_NAND_TWCHT(0x07) | \
+ FTIM0_NAND_TWH(0x0a))
+#define CONFIG_SYS_NAND_FTIM1 (FTIM1_NAND_TADLE(0x32) | \
+ FTIM1_NAND_TWBE(0x39) | \
+ FTIM1_NAND_TRR(0x0e) | \
+ FTIM1_NAND_TRP(0x18))
+#define CONFIG_SYS_NAND_FTIM2 (FTIM2_NAND_TRAD(0x0f) | \
+ FTIM2_NAND_TREH(0x0a) | \
+ FTIM2_NAND_TWHRE(0x1e))
+#define CONFIG_SYS_NAND_FTIM3 0x0
+
+#define CONFIG_SYS_NAND_BASE_LIST { CONFIG_SYS_NAND_BASE }
+#define CONFIG_SYS_MAX_NAND_DEVICE 1
+#define CONFIG_MTD_NAND_VERIFY_WRITE
+#define CONFIG_CMD_NAND
+
+#define CONFIG_SYS_NAND_BLOCK_SIZE (128 * 1024)
+
+#define CONFIG_FSL_QIXIS
+#define CONFIG_SYS_I2C_FPGA_ADDR 0x66
+#define QIXIS_LBMAP_SWITCH 6
+#define QIXIS_QMAP_MASK 0xe0
+#define QIXIS_QMAP_SHIFT 5
+#define QIXIS_LBMAP_MASK 0x0f
+#define QIXIS_LBMAP_SHIFT 0
+#define QIXIS_LBMAP_DFLTBANK 0x0e
+#define QIXIS_LBMAP_ALTBANK 0x2e
+#define QIXIS_LBMAP_SD 0x00
+#define QIXIS_LBMAP_SD_QSPI 0x0e
+#define QIXIS_LBMAP_QSPI 0x0e
+#define QIXIS_RCW_SRC_SD 0x40
+#define QIXIS_RCW_SRC_QSPI 0x62
+#define QIXIS_RST_CTL_RESET 0x41
+#define QIXIS_RCFG_CTL_RECONFIG_IDLE 0x20
+#define QIXIS_RCFG_CTL_RECONFIG_START 0x21
+#define QIXIS_RCFG_CTL_WATCHDOG_ENBLE 0x08
+#define QIXIS_RST_FORCE_MEM 0x01
+#define QIXIS_STAT_PRES1 0xb
+#define QIXIS_SDID_MASK 0x07
+#define QIXIS_ESDHC_NO_ADAPTER 0x7
+
+#define CONFIG_SYS_FPGA_CSPR_EXT (0x0)
+#define CONFIG_SYS_FPGA_CSPR (CSPR_PHYS_ADDR(QIXIS_BASE_PHYS_EARLY) \
+ | CSPR_PORT_SIZE_8 \
+ | CSPR_MSEL_GPCM \
+ | CSPR_V)
+#define SYS_FPGA_CSPR_FINAL (CSPR_PHYS_ADDR(QIXIS_BASE_PHYS) \
+ | CSPR_PORT_SIZE_8 \
+ | CSPR_MSEL_GPCM \
+ | CSPR_V)
+
+#define CONFIG_SYS_FPGA_AMASK IFC_AMASK(64*1024)
+#if defined(CONFIG_QSPI_BOOT)
+#define CONFIG_SYS_FPGA_CSOR CSOR_GPCM_ADM_SHIFT(0)
+#else
+#define CONFIG_SYS_FPGA_CSOR CSOR_GPCM_ADM_SHIFT(12)
+#endif
+/* QIXIS Timing parameters*/
+#define SYS_FPGA_CS_FTIM0 (FTIM0_GPCM_TACSE(0x0e) | \
+ FTIM0_GPCM_TEADC(0x0e) | \
+ FTIM0_GPCM_TEAHC(0x0e))
+#define SYS_FPGA_CS_FTIM1 (FTIM1_GPCM_TACO(0xff) | \
+ FTIM1_GPCM_TRAD(0x3f))
+#define SYS_FPGA_CS_FTIM2 (FTIM2_GPCM_TCS(0xf) | \
+ FTIM2_GPCM_TCH(0xf) | \
+ FTIM2_GPCM_TWP(0x3E))
+#define SYS_FPGA_CS_FTIM3 0x0
+
+#if defined(CONFIG_QSPI_BOOT) || defined(CONFIG_SD_BOOT_QSPI)
+#define CONFIG_SYS_CSPR0_EXT CONFIG_SYS_NAND_CSPR_EXT
+#define CONFIG_SYS_CSPR0 CONFIG_SYS_NAND_CSPR
+#define CONFIG_SYS_AMASK0 CONFIG_SYS_NAND_AMASK
+#define CONFIG_SYS_CSOR0 CONFIG_SYS_NAND_CSOR
+#define CONFIG_SYS_CS0_FTIM0 CONFIG_SYS_NAND_FTIM0
+#define CONFIG_SYS_CS0_FTIM1 CONFIG_SYS_NAND_FTIM1
+#define CONFIG_SYS_CS0_FTIM2 CONFIG_SYS_NAND_FTIM2
+#define CONFIG_SYS_CS0_FTIM3 CONFIG_SYS_NAND_FTIM3
+#define CONFIG_SYS_CSPR2_EXT CONFIG_SYS_FPGA_CSPR_EXT
+#define CONFIG_SYS_CSPR2 CONFIG_SYS_FPGA_CSPR
+#define CONFIG_SYS_CSPR2_FINAL SYS_FPGA_CSPR_FINAL
+#define CONFIG_SYS_AMASK2 CONFIG_SYS_FPGA_AMASK
+#define CONFIG_SYS_CSOR2 CONFIG_SYS_FPGA_CSOR
+#define CONFIG_SYS_CS2_FTIM0 SYS_FPGA_CS_FTIM0
+#define CONFIG_SYS_CS2_FTIM1 SYS_FPGA_CS_FTIM1
+#define CONFIG_SYS_CS2_FTIM2 SYS_FPGA_CS_FTIM2
+#define CONFIG_SYS_CS2_FTIM3 SYS_FPGA_CS_FTIM3
+#else
+#define CONFIG_SYS_CSPR0_EXT CONFIG_SYS_NOR0_CSPR_EXT
+#define CONFIG_SYS_CSPR0 CONFIG_SYS_NOR0_CSPR_EARLY
+#define CONFIG_SYS_CSPR0_FINAL CONFIG_SYS_NOR0_CSPR
+#define CONFIG_SYS_AMASK0 CONFIG_SYS_NOR_AMASK
+#define CONFIG_SYS_CSOR0 CONFIG_SYS_NOR_CSOR
+#define CONFIG_SYS_CS0_FTIM0 CONFIG_SYS_NOR_FTIM0
+#define CONFIG_SYS_CS0_FTIM1 CONFIG_SYS_NOR_FTIM1
+#define CONFIG_SYS_CS0_FTIM2 CONFIG_SYS_NOR_FTIM2
+#define CONFIG_SYS_CS0_FTIM3 CONFIG_SYS_NOR_FTIM3
+#define CONFIG_SYS_CSPR1_EXT CONFIG_SYS_NOR0_CSPR_EXT
+#define CONFIG_SYS_CSPR1 CONFIG_SYS_NOR1_CSPR_EARLY
+#define CONFIG_SYS_CSPR1_FINAL CONFIG_SYS_NOR1_CSPR
+#define CONFIG_SYS_AMASK1 CONFIG_SYS_NOR_AMASK_EARLY
+#define CONFIG_SYS_AMASK1_FINAL CONFIG_SYS_NOR_AMASK
+#define CONFIG_SYS_CSOR1 CONFIG_SYS_NOR_CSOR
+#define CONFIG_SYS_CS1_FTIM0 CONFIG_SYS_NOR_FTIM0
+#define CONFIG_SYS_CS1_FTIM1 CONFIG_SYS_NOR_FTIM1
+#define CONFIG_SYS_CS1_FTIM2 CONFIG_SYS_NOR_FTIM2
+#define CONFIG_SYS_CS1_FTIM3 CONFIG_SYS_NOR_FTIM3
+#define CONFIG_SYS_CSPR2_EXT CONFIG_SYS_NAND_CSPR_EXT
+#define CONFIG_SYS_CSPR2 CONFIG_SYS_NAND_CSPR
+#define CONFIG_SYS_AMASK2 CONFIG_SYS_NAND_AMASK
+#define CONFIG_SYS_CSOR2 CONFIG_SYS_NAND_CSOR
+#define CONFIG_SYS_CS2_FTIM0 CONFIG_SYS_NAND_FTIM0
+#define CONFIG_SYS_CS2_FTIM1 CONFIG_SYS_NAND_FTIM1
+#define CONFIG_SYS_CS2_FTIM2 CONFIG_SYS_NAND_FTIM2
+#define CONFIG_SYS_CS2_FTIM3 CONFIG_SYS_NAND_FTIM3
+#define CONFIG_SYS_CSPR3_EXT CONFIG_SYS_FPGA_CSPR_EXT
+#define CONFIG_SYS_CSPR3 CONFIG_SYS_FPGA_CSPR
+#define CONFIG_SYS_CSPR3_FINAL CONFIG_SYS_FPGA_CSPR_FINAL
+#define CONFIG_SYS_AMASK3 CONFIG_SYS_FPGA_AMASK
+#define CONFIG_SYS_CSOR3 CONFIG_SYS_FPGA_CSOR
+#define CONFIG_SYS_CS3_FTIM0 CONFIG_SYS_FPGA_CS_FTIM0
+#define CONFIG_SYS_CS3_FTIM1 CONFIG_SYS_FPGA_CS_FTIM1
+#define CONFIG_SYS_CS3_FTIM2 CONFIG_SYS_FPGA_CS_FTIM2
+#define CONFIG_SYS_CS3_FTIM3 CONFIG_SYS_FPGA_CS_FTIM3
+#endif
+
+#define CONFIG_SYS_LS_MC_BOOT_TIMEOUT_MS 5000
+
+/*
+ * I2C bus multiplexer
+ */
+#define I2C_MUX_PCA_ADDR_PRI 0x77
+#define I2C_MUX_PCA_ADDR_SEC 0x76 /* Secondary multiplexer */
+#define I2C_RETIMER_ADDR 0x18
+#define I2C_RETIMER_ADDR2 0x19
+#define I2C_MUX_CH_DEFAULT 0x8
+#define I2C_MUX_CH5 0xD
+
+/*
+* RTC configuration
+*/
+#define RTC
+#define CONFIG_RTC_PCF8563 1
+#define CONFIG_SYS_I2C_RTC_ADDR 0x51 /* Channel 3*/
+#define CONFIG_CMD_DATE
+
+/* EEPROM */
+#define CONFIG_ID_EEPROM
+#define CONFIG_SYS_I2C_EEPROM_NXID
+#define CONFIG_SYS_EEPROM_BUS_NUM 0
+#define CONFIG_SYS_I2C_EEPROM_ADDR 0x57
+#define CONFIG_SYS_I2C_EEPROM_ADDR_LEN 1
+#define CONFIG_SYS_EEPROM_PAGE_WRITE_BITS 3
+#define CONFIG_SYS_EEPROM_PAGE_WRITE_DELAY_MS 5
+
+/* QSPI device */
+#if defined(CONFIG_QSPI_BOOT)
+#define CONFIG_FSL_QSPI
+#define CONFIG_SPI_FLASH_SPANSION
+#define FSL_QSPI_FLASH_SIZE (1 << 26)
+#define FSL_QSPI_FLASH_NUM 2
+
+#endif
+
+#ifdef CONFIG_FSL_DSPI
+#define CONFIG_SPI_FLASH_STMICRO
+#define CONFIG_SPI_FLASH_SST
+#define CONFIG_SPI_FLASH_EON
+#if !defined(CONFIG_QSPI_BOOT) && !defined(CONFIG_SD_BOOT_QSPI)
+#define CONFIG_SF_DEFAULT_BUS 1
+#define CONFIG_SF_DEFAULT_CS 0
+#endif
+#endif
+
+#define CONFIG_CMD_MEMINFO
+#define CONFIG_CMD_MEMTEST
+#define CONFIG_SYS_MEMTEST_START 0x80000000
+#define CONFIG_SYS_MEMTEST_END 0x9fffffff
+
+#define CONFIG_SYS_MONITOR_BASE CONFIG_SYS_TEXT_BASE
+
+#define CONFIG_FSL_MEMAC
+
+/* MMC */
+#define CONFIG_FSL_ESDHC
+#define CONFIG_SYS_FSL_MMC_HAS_CAPBLT_VS33
+#define CONFIG_ESDHC_DETECT_QUIRK ((readb(QIXIS_BASE + QIXIS_STAT_PRES1) & \
+ QIXIS_SDID_MASK) != QIXIS_ESDHC_NO_ADAPTER)
+
+/* Initial environment variables */
+#if defined(CONFIG_QSPI_BOOT)
+#undef CONFIG_EXTRA_ENV_SETTINGS
+#define CONFIG_EXTRA_ENV_SETTINGS \
+ "hwconfig=fsl_ddr:bank_intlv=auto\0" \
+ "loadaddr=0x90100000\0" \
+ "kernel_addr=0x100000\0" \
+ "ramdisk_addr=0x800000\0" \
+ "ramdisk_size=0x2000000\0" \
+ "fdt_high=0xa0000000\0" \
+ "initrd_high=0xffffffffffffffff\0" \
+ "kernel_start=0x1000000\0" \
+ "kernel_load=0xa0000000\0" \
+ "kernel_size=0x2800000\0" \
+ "mcinitcmd=sf probe 0:0;sf read 0x80000000 0xA00000 0x100000;" \
+ "sf read 0x80100000 0xE00000 0x100000;" \
+ "fsl_mc start mc 0x80000000 0x80100000\0" \
+ "mcmemsize=0x70000000 \0"
+#else /* NOR BOOT */
+#undef CONFIG_EXTRA_ENV_SETTINGS
+#define CONFIG_EXTRA_ENV_SETTINGS \
+ "hwconfig=fsl_ddr:bank_intlv=auto\0" \
+ "loadaddr=0x90100000\0" \
+ "kernel_addr=0x100000\0" \
+ "ramdisk_addr=0x800000\0" \
+ "ramdisk_size=0x2000000\0" \
+ "fdt_high=0xa0000000\0" \
+ "initrd_high=0xffffffffffffffff\0" \
+ "kernel_start=0x1000000\0" \
+ "kernel_load=0xa0000000\0" \
+ "kernel_size=0x2800000\0" \
+ "mcinitcmd=fsl_mc start mc 0x580A00000 0x580E00000\0" \
+ "mcmemsize=0x70000000 \0"
+#endif
+
+#ifdef CONFIG_FSL_MC_ENET
+#define CONFIG_FSL_MEMAC
+#define CONFIG_PHYLIB
+#define CONFIG_PHYLIB_10G
+#define CONFIG_PHY_VITESSE
+#define CONFIG_PHY_REALTEK
+#define CONFIG_PHY_TERANETICS
+#define RGMII_PHY1_ADDR 0x1
+#define RGMII_PHY2_ADDR 0x2
+#define SGMII_CARD_PORT1_PHY_ADDR 0x1C
+#define SGMII_CARD_PORT2_PHY_ADDR 0x1d
+#define SGMII_CARD_PORT3_PHY_ADDR 0x1E
+#define SGMII_CARD_PORT4_PHY_ADDR 0x1F
+
+#define XQSGMII_CARD_PHY1_PORT0_ADDR 0x0
+#define XQSGMII_CARD_PHY1_PORT1_ADDR 0x1
+#define XQSGMII_CARD_PHY1_PORT2_ADDR 0x2
+#define XQSGMII_CARD_PHY1_PORT3_ADDR 0x3
+#define XQSGMII_CARD_PHY2_PORT0_ADDR 0x4
+#define XQSGMII_CARD_PHY2_PORT1_ADDR 0x5
+#define XQSGMII_CARD_PHY2_PORT2_ADDR 0x6
+#define XQSGMII_CARD_PHY2_PORT3_ADDR 0x7
+#define XQSGMII_CARD_PHY3_PORT0_ADDR 0x8
+#define XQSGMII_CARD_PHY3_PORT1_ADDR 0x9
+#define XQSGMII_CARD_PHY3_PORT2_ADDR 0xa
+#define XQSGMII_CARD_PHY3_PORT3_ADDR 0xb
+#define XQSGMII_CARD_PHY4_PORT0_ADDR 0xc
+#define XQSGMII_CARD_PHY4_PORT1_ADDR 0xd
+#define XQSGMII_CARD_PHY4_PORT2_ADDR 0xe
+#define XQSGMII_CARD_PHY4_PORT3_ADDR 0xf
+
+#define CONFIG_MII /* MII PHY management */
+#define CONFIG_ETHPRIME "DPMAC1@xgmii"
+#define CONFIG_PHY_GIGE /* Include GbE speed/duplex detection */
+
+#endif
+
+#undef CONFIG_CMDLINE_EDITING
+#include <config_distro_defaults.h>
+#define BOOT_TARGET_DEVICES(func) \
+ func(USB, usb, 0) \
+ func(MMC, mmc, 0) \
+ func(SCSI, scsi, 0) \
+ func(DHCP, dhcp, na)
+#include <config_distro_bootcmd.h>
+
+#include <asm/fsl_secure_boot.h>
+
+#endif /* __LS1088A_QDS_H */
--- /dev/null
+/*
+ * Copyright 2017 NXP
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#ifndef __LS1088A_RDB_H
+#define __LS1088A_RDB_H
+
+#include "ls1088a_common.h"
+
+#define CONFIG_DISPLAY_BOARDINFO_LATE
+
+#if defined(CONFIG_QSPI_BOOT)
+#define CONFIG_ENV_IS_IN_SPI_FLASH
+#define CONFIG_ENV_SIZE 0x2000 /* 8KB */
+#define CONFIG_ENV_OFFSET 0x300000 /* 3MB */
+#define CONFIG_ENV_SECT_SIZE 0x40000
+#else
+#define CONFIG_ENV_IS_IN_FLASH
+#define CONFIG_ENV_ADDR (CONFIG_SYS_FLASH_BASE + 0x300000)
+#define CONFIG_ENV_SECT_SIZE 0x20000
+#define CONFIG_ENV_SIZE 0x20000
+#endif
+
+#if defined(CONFIG_QSPI_BOOT)
+#define CONFIG_QIXIS_I2C_ACCESS
+#define SYS_NO_FLASH
+#undef CONFIG_CMD_IMLS
+#endif
+
+#define CONFIG_SYS_CLK_FREQ 100000000
+#define CONFIG_DDR_CLK_FREQ 100000000
+#define COUNTER_FREQUENCY_REAL 25000000 /* 25MHz */
+#define COUNTER_FREQUENCY 25000000 /* 25MHz */
+
+#define CONFIG_DDR_SPD
+#ifdef CONFIG_EMU
+#define CONFIG_SYS_FSL_DDR_EMU
+#define CONFIG_SYS_MXC_I2C1_SPEED 40000000
+#define CONFIG_SYS_MXC_I2C2_SPEED 40000000
+#else
+#define CONFIG_DDR_ECC
+#define CONFIG_ECC_INIT_VIA_DDRCONTROLLER
+#define CONFIG_MEM_INIT_VALUE 0xdeadbeef
+#endif
+#define SPD_EEPROM_ADDRESS 0x51
+#define CONFIG_SYS_SPD_BUS_NUM 0 /* SPD on I2C bus 0 */
+#define CONFIG_DIMM_SLOTS_PER_CTLR 1
+
+
+#if !defined(CONFIG_QSPI_BOOT) && !defined(CONFIG_SD_BOOT_QSPI)
+#define CONFIG_SYS_NOR0_CSPR_EXT (0x0)
+#define CONFIG_SYS_NOR_AMASK IFC_AMASK(128 * 1024 * 1024)
+#define CONFIG_SYS_NOR_AMASK_EARLY IFC_AMASK(64 * 1024 * 1024)
+
+#define CONFIG_SYS_NOR0_CSPR \
+ (CSPR_PHYS_ADDR(CONFIG_SYS_FLASH_BASE_PHYS) | \
+ CSPR_PORT_SIZE_16 | \
+ CSPR_MSEL_NOR | \
+ CSPR_V)
+#define CONFIG_SYS_NOR0_CSPR_EARLY \
+ (CSPR_PHYS_ADDR(CONFIG_SYS_FLASH_BASE_PHYS_EARLY) | \
+ CSPR_PORT_SIZE_16 | \
+ CSPR_MSEL_NOR | \
+ CSPR_V)
+#define CONFIG_SYS_NOR_CSOR CSOR_NOR_ADM_SHIFT(6)
+#define CONFIG_SYS_NOR_FTIM0 (FTIM0_NOR_TACSE(0x1) | \
+ FTIM0_NOR_TEADC(0x1) | \
+ FTIM0_NOR_TEAHC(0x1))
+#define CONFIG_SYS_NOR_FTIM1 (FTIM1_NOR_TACO(0x1) | \
+ FTIM1_NOR_TRAD_NOR(0x1))
+#define CONFIG_SYS_NOR_FTIM2 (FTIM2_NOR_TCS(0x0) | \
+ FTIM2_NOR_TCH(0x0) | \
+ FTIM2_NOR_TWP(0x1))
+#define CONFIG_SYS_NOR_FTIM3 0x04000000
+#define CONFIG_SYS_IFC_CCR 0x01000000
+
+#ifndef SYS_NO_FLASH
+#define CONFIG_FLASH_CFI_DRIVER
+#define CONFIG_SYS_FLASH_CFI
+#define CONFIG_SYS_FLASH_USE_BUFFER_WRITE
+#define CONFIG_SYS_FLASH_QUIET_TEST
+#define CONFIG_FLASH_SHOW_PROGRESS 45 /* count down from 45/5: 9..1 */
+
+#define CONFIG_SYS_MAX_FLASH_BANKS 1 /* number of banks */
+#define CONFIG_SYS_MAX_FLASH_SECT 1024 /* sectors per device */
+#define CONFIG_SYS_FLASH_ERASE_TOUT 60000 /* Flash Erase Timeout (ms) */
+#define CONFIG_SYS_FLASH_WRITE_TOUT 500 /* Flash Write Timeout (ms) */
+
+#define CONFIG_SYS_FLASH_EMPTY_INFO
+#define CONFIG_SYS_FLASH_BANKS_LIST { CONFIG_SYS_FLASH_BASE }
+#endif
+#endif
+#define CONFIG_SYS_NAND_MAX_ECCPOS 256
+#define CONFIG_SYS_NAND_MAX_OOBFREE 2
+
+#define CONFIG_SYS_NAND_CSPR_EXT (0x0)
+#define CONFIG_SYS_NAND_CSPR (CSPR_PHYS_ADDR(CONFIG_SYS_NAND_BASE_PHYS) \
+ | CSPR_PORT_SIZE_8 /* Port Size = 8 bit */ \
+ | CSPR_MSEL_NAND /* MSEL = NAND */ \
+ | CSPR_V)
+#define CONFIG_SYS_NAND_AMASK IFC_AMASK(64 * 1024)
+
+#define CONFIG_SYS_NAND_CSOR (CSOR_NAND_ECC_ENC_EN /* ECC on encode */ \
+ | CSOR_NAND_ECC_DEC_EN /* ECC on decode */ \
+ | CSOR_NAND_ECC_MODE_4 /* 4-bit ECC */ \
+ | CSOR_NAND_RAL_3 /* RAL = 3Byes */ \
+ | CSOR_NAND_PGS_2K /* Page Size = 2K */ \
+ | CSOR_NAND_SPRZ_64/* Spare size = 64 */ \
+ | CSOR_NAND_PB(64)) /*Pages Per Block = 64*/
+
+#define CONFIG_SYS_NAND_ONFI_DETECTION
+
+/* ONFI NAND Flash mode0 Timing Params */
+#define CONFIG_SYS_NAND_FTIM0 (FTIM0_NAND_TCCST(0x07) | \
+ FTIM0_NAND_TWP(0x18) | \
+ FTIM0_NAND_TWCHT(0x07) | \
+ FTIM0_NAND_TWH(0x0a))
+#define CONFIG_SYS_NAND_FTIM1 (FTIM1_NAND_TADLE(0x32) | \
+ FTIM1_NAND_TWBE(0x39) | \
+ FTIM1_NAND_TRR(0x0e) | \
+ FTIM1_NAND_TRP(0x18))
+#define CONFIG_SYS_NAND_FTIM2 (FTIM2_NAND_TRAD(0x0f) | \
+ FTIM2_NAND_TREH(0x0a) | \
+ FTIM2_NAND_TWHRE(0x1e))
+#define CONFIG_SYS_NAND_FTIM3 0x0
+
+#define CONFIG_SYS_NAND_BASE_LIST { CONFIG_SYS_NAND_BASE }
+#define CONFIG_SYS_MAX_NAND_DEVICE 1
+#define CONFIG_MTD_NAND_VERIFY_WRITE
+
+#define CONFIG_SYS_NAND_BLOCK_SIZE (128 * 1024)
+
+#define CONFIG_FSL_QIXIS
+#define CONFIG_SYS_I2C_FPGA_ADDR 0x66
+#define QIXIS_LBMAP_SWITCH 2
+#define QIXIS_QMAP_MASK 0xe0
+#define QIXIS_QMAP_SHIFT 5
+#define QIXIS_LBMAP_MASK 0x1f
+#define QIXIS_LBMAP_SHIFT 5
+#define QIXIS_LBMAP_DFLTBANK 0x00
+#define QIXIS_LBMAP_ALTBANK 0x20
+#define QIXIS_LBMAP_SD 0x00
+#define QIXIS_LBMAP_SD_QSPI 0x00
+#define QIXIS_LBMAP_QSPI 0x00
+#define QIXIS_RCW_SRC_SD 0x40
+#define QIXIS_RCW_SRC_QSPI 0x62
+#define QIXIS_RST_CTL_RESET 0x31
+#define QIXIS_RCFG_CTL_RECONFIG_IDLE 0x20
+#define QIXIS_RCFG_CTL_RECONFIG_START 0x21
+#define QIXIS_RCFG_CTL_WATCHDOG_ENBLE 0x08
+#define QIXIS_RST_FORCE_MEM 0x01
+
+#define CONFIG_SYS_FPGA_CSPR_EXT (0x0)
+#define CONFIG_SYS_FPGA_CSPR (CSPR_PHYS_ADDR(QIXIS_BASE_PHYS_EARLY) \
+ | CSPR_PORT_SIZE_8 \
+ | CSPR_MSEL_GPCM \
+ | CSPR_V)
+#define SYS_FPGA_CSPR_FINAL (CSPR_PHYS_ADDR(QIXIS_BASE_PHYS) \
+ | CSPR_PORT_SIZE_8 \
+ | CSPR_MSEL_GPCM \
+ | CSPR_V)
+
+#define CONFIG_SYS_FPGA_AMASK IFC_AMASK(64*1024)
+#define CONFIG_SYS_FPGA_CSOR CSOR_GPCM_ADM_SHIFT(0)
+/* QIXIS Timing parameters*/
+#define SYS_FPGA_CS_FTIM0 (FTIM0_GPCM_TACSE(0x0e) | \
+ FTIM0_GPCM_TEADC(0x0e) | \
+ FTIM0_GPCM_TEAHC(0x0e))
+#define SYS_FPGA_CS_FTIM1 (FTIM1_GPCM_TACO(0xff) | \
+ FTIM1_GPCM_TRAD(0x3f))
+#define SYS_FPGA_CS_FTIM2 (FTIM2_GPCM_TCS(0xf) | \
+ FTIM2_GPCM_TCH(0xf) | \
+ FTIM2_GPCM_TWP(0x3E))
+#define SYS_FPGA_CS_FTIM3 0x0
+
+#if defined(CONFIG_QSPI_BOOT) || defined(CONFIG_SD_BOOT_QSPI)
+#define CONFIG_SYS_CSPR0_EXT CONFIG_SYS_NAND_CSPR_EXT
+#define CONFIG_SYS_CSPR0 CONFIG_SYS_NAND_CSPR
+#define CONFIG_SYS_AMASK0 CONFIG_SYS_NAND_AMASK
+#define CONFIG_SYS_CSOR0 CONFIG_SYS_NAND_CSOR
+#define CONFIG_SYS_CS0_FTIM0 CONFIG_SYS_NAND_FTIM0
+#define CONFIG_SYS_CS0_FTIM1 CONFIG_SYS_NAND_FTIM1
+#define CONFIG_SYS_CS0_FTIM2 CONFIG_SYS_NAND_FTIM2
+#define CONFIG_SYS_CS0_FTIM3 CONFIG_SYS_NAND_FTIM3
+#define CONFIG_SYS_CSPR2_EXT CONFIG_SYS_FPGA_CSPR_EXT
+#define CONFIG_SYS_CSPR2 CONFIG_SYS_FPGA_CSPR
+#define CONFIG_SYS_CSPR2_FINAL SYS_FPGA_CSPR_FINAL
+#define CONFIG_SYS_AMASK2 CONFIG_SYS_FPGA_AMASK
+#define CONFIG_SYS_CSOR2 CONFIG_SYS_FPGA_CSOR
+#define CONFIG_SYS_CS2_FTIM0 SYS_FPGA_CS_FTIM0
+#define CONFIG_SYS_CS2_FTIM1 SYS_FPGA_CS_FTIM1
+#define CONFIG_SYS_CS2_FTIM2 SYS_FPGA_CS_FTIM2
+#define CONFIG_SYS_CS2_FTIM3 SYS_FPGA_CS_FTIM3
+#else
+#define CONFIG_SYS_CSPR0_EXT CONFIG_SYS_NOR0_CSPR_EXT
+#define CONFIG_SYS_CSPR0 CONFIG_SYS_NOR0_CSPR_EARLY
+#define CONFIG_SYS_CSPR0_FINAL CONFIG_SYS_NOR0_CSPR
+#define CONFIG_SYS_AMASK0 CONFIG_SYS_NOR_AMASK
+#define CONFIG_SYS_CSOR0 CONFIG_SYS_NOR_CSOR
+#define CONFIG_SYS_CS0_FTIM0 CONFIG_SYS_NOR_FTIM0
+#define CONFIG_SYS_CS0_FTIM1 CONFIG_SYS_NOR_FTIM1
+#define CONFIG_SYS_CS0_FTIM2 CONFIG_SYS_NOR_FTIM2
+#define CONFIG_SYS_CS0_FTIM3 CONFIG_SYS_NOR_FTIM3
+#endif
+
+
+#define CONFIG_SYS_LS_MC_BOOT_TIMEOUT_MS 5000
+
+/*
+ * I2C bus multiplexer
+ */
+#define I2C_MUX_PCA_ADDR_PRI 0x77
+#define I2C_MUX_PCA_ADDR_SEC 0x76 /* Secondary multiplexer */
+#define I2C_RETIMER_ADDR 0x18
+#define I2C_MUX_CH_DEFAULT 0x8
+#define I2C_MUX_CH5 0xD
+/*
+* RTC configuration
+*/
+#define RTC
+#define CONFIG_RTC_PCF8563 1
+#define CONFIG_SYS_I2C_RTC_ADDR 0x51 /* Channel 3*/
+#define CONFIG_CMD_DATE
+
+/* EEPROM */
+#define CONFIG_ID_EEPROM
+#define CONFIG_SYS_I2C_EEPROM_NXID
+#define CONFIG_SYS_EEPROM_BUS_NUM 0
+#define CONFIG_SYS_I2C_EEPROM_ADDR 0x57
+#define CONFIG_SYS_I2C_EEPROM_ADDR_LEN 1
+#define CONFIG_SYS_EEPROM_PAGE_WRITE_BITS 3
+#define CONFIG_SYS_EEPROM_PAGE_WRITE_DELAY_MS 5
+
+/* QSPI device */
+#if defined(CONFIG_QSPI_BOOT)
+#define CONFIG_FSL_QSPI
+#define CONFIG_SPI_FLASH_SPANSION
+#define FSL_QSPI_FLASH_SIZE (1 << 26)
+#define FSL_QSPI_FLASH_NUM 2
+#endif
+
+#define CONFIG_CMD_MEMINFO
+#define CONFIG_CMD_MEMTEST
+#define CONFIG_SYS_MEMTEST_START 0x80000000
+#define CONFIG_SYS_MEMTEST_END 0x9fffffff
+
+#define CONFIG_SYS_MONITOR_BASE CONFIG_SYS_TEXT_BASE
+
+#define CONFIG_FSL_MEMAC
+
+/* Initial environment variables */
+#if defined(CONFIG_QSPI_BOOT)
+#undef CONFIG_EXTRA_ENV_SETTINGS
+#define CONFIG_EXTRA_ENV_SETTINGS \
+ "hwconfig=fsl_ddr:bank_intlv=auto\0" \
+ "loadaddr=0x90100000\0" \
+ "kernel_addr=0x100000\0" \
+ "ramdisk_addr=0x800000\0" \
+ "ramdisk_size=0x2000000\0" \
+ "fdt_high=0xa0000000\0" \
+ "initrd_high=0xffffffffffffffff\0" \
+ "kernel_start=0x1000000\0" \
+ "kernel_load=0xa0000000\0" \
+ "kernel_size=0x2800000\0" \
+ "mcinitcmd=sf probe 0:0;sf read 0x80000000 0xA00000 0x100000;" \
+ "sf read 0x80100000 0xE00000 0x100000;" \
+ "fsl_mc start mc 0x80000000 0x80100000\0" \
+ "mcmemsize=0x70000000 \0"
+
+#endif
+
+/* MAC/PHY configuration */
+#ifdef CONFIG_FSL_MC_ENET
+#define CONFIG_PHYLIB_10G
+#define CONFIG_PHY_GIGE
+#define CONFIG_PHYLIB
+
+#define CONFIG_PHY_VITESSE
+#define CONFIG_PHY_AQUANTIA
+#define AQ_PHY_ADDR1 0x00
+#define AQR105_IRQ_MASK 0x00000004
+
+#define QSGMII1_PORT1_PHY_ADDR 0x0c
+#define QSGMII1_PORT2_PHY_ADDR 0x0d
+#define QSGMII1_PORT3_PHY_ADDR 0x0e
+#define QSGMII1_PORT4_PHY_ADDR 0x0f
+#define QSGMII2_PORT1_PHY_ADDR 0x1c
+#define QSGMII2_PORT2_PHY_ADDR 0x1d
+#define QSGMII2_PORT3_PHY_ADDR 0x1e
+#define QSGMII2_PORT4_PHY_ADDR 0x1f
+
+#define CONFIG_MII
+#define CONFIG_ETHPRIME "DPMAC1@xgmii"
+#define CONFIG_PHY_GIGE
+#endif
+
+/* MMC */
+#ifdef CONFIG_MMC
+#define CONFIG_FSL_ESDHC
+#define CONFIG_SYS_FSL_MMC_HAS_CAPBLT_VS33
+#endif
+
+#undef CONFIG_CMDLINE_EDITING
+#include <config_distro_defaults.h>
+
+#define BOOT_TARGET_DEVICES(func) \
+ func(USB, usb, 0) \
+ func(MMC, mmc, 0) \
+ func(SCSI, scsi, 0) \
+ func(DHCP, dhcp, na)
+#include <config_distro_bootcmd.h>
+
+#include <asm/fsl_secure_boot.h>
+
+#endif /* __LS1088A_RDB_H */
#define CONFIG_BMP_16BPP
#define CONFIG_VIDEO_LOGO
#define CONFIG_SYS_VIDEO_LOGO_MAX_SIZE (2 << 20)
-#define CONFIG_IPUV3_CLK 200000000
#endif
/*
#define CONFIG_SYS_USE_SERIALFLASH 1
#define CONFIG_BOARD_LATE_INIT
+/* Timer */
+#define CONFIG_SYS_TIMER_COUNTER 0xfc06863c
+
/*
* Memory configurations
*/
#define CONFIG_NR_DRAM_BANKS 1
-#define CONFIG_SYS_SDRAM_BASE ATMEL_BASE_DDRCS
+#define CONFIG_SYS_SDRAM_BASE 0x20000000
#define CONFIG_SYS_SDRAM_SIZE 0x10000000
#ifdef CONFIG_SPL_BUILD
* Serial Driver
*/
#define CONFIG_ATMEL_USART
-#define CONFIG_USART_BASE ATMEL_BASE_USART0
-#define CONFIG_USART_ID ATMEL_ID_USART0
+#define CONFIG_USART_BASE 0xf802c000
+#define CONFIG_USART_ID 6
/*
* Ethernet
#define CONFIG_MACH_TYPE MACH_TYPE_MCX
-#define CONFIG_EMIF4 /* The chip has EMIF4 controller */
-
#include <asm/arch/cpu.h> /* get chip and board defs */
#include <asm/arch/omap.h>
#define CONFIG_SYS_NAND_BUSWIDTH_16BIT
#define CONFIG_NAND_OMAP_GPMC
#define CONFIG_NAND_OMAP_GPMC_PREFETCH
-#define SMNAND_ENV_OFFSET 0x180000 /* environment starts here */
/* Redundant Environment */
#define CONFIG_SYS_ENV_SECT_SIZE (128 << 10) /* 128 KiB */
-#define CONFIG_ENV_OFFSET SMNAND_ENV_OFFSET
-#define CONFIG_ENV_ADDR SMNAND_ENV_OFFSET
+#define CONFIG_ENV_OFFSET 0x180000
+#define CONFIG_ENV_ADDR 0x180000
#define CONFIG_ENV_OFFSET_REDUND (CONFIG_ENV_OFFSET + \
2 * CONFIG_SYS_ENV_SECT_SIZE)
#define CONFIG_ENV_SIZE_REDUND CONFIG_ENV_SIZE
#define CONFIG_SPLASH_SCREEN
#define CONFIG_BMP_16BPP
#define CONFIG_VIDEO_LOGO
-#define CONFIG_IPUV3_CLK 133000000
/* allow to overwrite serial and ethaddr */
#define CONFIG_ENV_OVERWRITE
#define CONFIG_SPLASH_SCREEN
#define CONFIG_BMP_16BPP
#define CONFIG_VIDEO_LOGO
-#define CONFIG_IPUV3_CLK 200000000
#endif /* __CONFIG_H */
#define CONFIG_SPLASH_SCREEN
#define CONFIG_BMP_16BPP
#define CONFIG_VIDEO_LOGO
-#define CONFIG_IPUV3_CLK 200000000
#endif /* __CONFIG_H */
/* Framebuffer */
#define CONFIG_VIDEO_IPUV3
-#define CONFIG_IPUV3_CLK 260000000
#define CONFIG_VIDEO_BMP_RLE8
#define CONFIG_SPLASH_SCREEN
#define CONFIG_SPLASH_SCREEN_ALIGN
"fi; " \
"fi\0" \
"findfdt="\
+ "if test $board_name = HUMMINGBOARD2 && test $board_rev = MX6Q ; then " \
+ "setenv fdtfile imx6q-hummingboard2.dtb; fi; " \
+ "if test $board_name = HUMMINGBOARD2 && test $board_rev = MX6DL ; then " \
+ "setenv fdtfile imx6dl-hummingboard2.dtb; fi; " \
"if test $board_name = HUMMINGBOARD && test $board_rev = MX6Q ; then " \
"setenv fdtfile imx6q-hummingboard.dtb; fi; " \
"if test $board_name = HUMMINGBOARD && test $board_rev = MX6DL ; then " \
#define CONFIG_BMP_16BPP
#define CONFIG_VIDEO_LOGO
#define CONFIG_VIDEO_BMP_LOGO
-#ifdef CONFIG_MX6DL
-#define CONFIG_IPUV3_CLK 198000000
-#else
-#define CONFIG_IPUV3_CLK 264000000
-#endif
#define CONFIG_IMX_HDMI
#define CONFIG_IMX_VIDEO_SKIP
#define CONFIG_VIDEO_BMP_GZIP
#define CONFIG_SYS_VIDEO_LOGO_MAX_SIZE (6 * 1024 * 1024)
#define CONFIG_BMP_16BPP
-#define CONFIG_IPUV3_CLK 260000000
#define CONFIG_IMX_HDMI
#define CONFIG_IMX_VIDEO_SKIP
*/
#define CONFIG_SYS_TEXT_BASE 0x80008000
-#define CONFIG_SDRC /* The chip has SDRC controller */
-
#include <asm/arch/cpu.h> /* get chip and board defs */
#include <asm/arch/omap.h>
#include <asm/arch/mem.h>
#define CONFIG_SPLASH_SCREEN
#define CONFIG_BMP_16BPP
#define CONFIG_VIDEO_LOGO
-#define CONFIG_IPUV3_CLK 260000000
#define CONFIG_IMX_HDMI
#define CONFIG_IMX_VIDEO_SKIP
#endif
#define CONFIG_ENV_SIZE (128 << 10) /* 128 KiB */
#define ONENAND_ENV_OFFSET 0x260000 /* environment starts here */
-#define SMNAND_ENV_OFFSET 0x260000 /* environment starts here */
#define CONFIG_SYS_ENV_SECT_SIZE (128 << 10) /* 128 KiB */
-#define CONFIG_ENV_OFFSET SMNAND_ENV_OFFSET
-#define CONFIG_ENV_ADDR SMNAND_ENV_OFFSET
+#define CONFIG_ENV_OFFSET 0x260000
+#define CONFIG_ENV_ADDR 0x260000
/* Defines for SPL */
#define CONFIG_ENV_SIZE (128 << 10) /* 128 KiB */
#define ONENAND_ENV_OFFSET 0x260000 /* environment starts here */
-#define SMNAND_ENV_OFFSET 0x260000 /* environment starts here */
#define CONFIG_SYS_ENV_SECT_SIZE (128 << 10) /* 128 KiB */
-#define CONFIG_ENV_OFFSET SMNAND_ENV_OFFSET
-#define CONFIG_ENV_ADDR SMNAND_ENV_OFFSET
+#define CONFIG_ENV_OFFSET 0x260000
+#define CONFIG_ENV_ADDR 0x260000
/* Defines for SPL */
#define CONFIG_SYS_NAND_U_BOOT_OFFS 0x80000
#define CONFIG_ENV_IS_IN_NAND 1
#define CONFIG_ENV_SIZE (128 << 10) /* 128 KiB */
-#define SMNAND_ENV_OFFSET 0x260000 /* environment starts here */
#define CONFIG_SYS_ENV_SECT_SIZE (128 << 10) /* 128 KiB */
-#define CONFIG_ENV_OFFSET SMNAND_ENV_OFFSET
-#define CONFIG_ENV_ADDR SMNAND_ENV_OFFSET
+#define CONFIG_ENV_OFFSET 0x260000
+#define CONFIG_ENV_ADDR 0x260000
#define CONFIG_ENV_OVERWRITE
#define CONFIG_MTD_PARTITIONS /* required for UBI partition support */
/* NAND: SPL falcon mode configs */
#define CONFIG_SYS_MONITOR_BASE CONFIG_SYS_FLASH_BASE
#define CONFIG_ENV_SIZE (128 << 10) /* 128 KiB */
-#define SMNAND_ENV_OFFSET 0x260000 /* environment starts here */
#define CONFIG_SYS_ENV_SECT_SIZE (128 << 10) /* 128 KiB */
-#define CONFIG_ENV_OFFSET SMNAND_ENV_OFFSET
-#define CONFIG_ENV_ADDR SMNAND_ENV_OFFSET
+#define CONFIG_ENV_OFFSET 0x260000
+#define CONFIG_ENV_ADDR 0x260000
/* SMSC922x Ethernet */
#if defined(CONFIG_CMD_NET)
#define CONFIG_SYS_ONENAND_BASE ONENAND_MAP
#define ONENAND_ENV_OFFSET 0x240000 /* environment starts here */
-#define SMNAND_ENV_OFFSET 0x240000 /* environment starts here */
-
#define CONFIG_SYS_ENV_SECT_SIZE (128 << 10) /* 128 KiB */
-#define CONFIG_ENV_OFFSET SMNAND_ENV_OFFSET
-#define CONFIG_ENV_ADDR SMNAND_ENV_OFFSET
+#define CONFIG_ENV_OFFSET 0x240000
+#define CONFIG_ENV_ADDR 0x240000
/* Configure SMSC9211 ethernet */
#if defined(CONFIG_CMD_NET)
/* Monitor at start of flash */
#define CONFIG_SYS_MONITOR_BASE CONFIG_SYS_FLASH_BASE
-#define SMNAND_ENV_OFFSET 0x260000 /* environment starts here */
#define CONFIG_SYS_ENV_SECT_SIZE (128 << 10) /* 128 KiB */
-#define CONFIG_ENV_OFFSET SMNAND_ENV_OFFSET
-#define CONFIG_ENV_ADDR SMNAND_ENV_OFFSET
+#define CONFIG_ENV_OFFSET 0x260000
+#define CONFIG_ENV_ADDR 0x260000
#endif /* __CONFIG_H */
#define CONFIG_SYS_ONENAND_BASE ONENAND_MAP
#define ONENAND_ENV_OFFSET 0x260000 /* environment starts here */
-#define SMNAND_ENV_OFFSET 0x260000 /* environment starts here */
#define CONFIG_SYS_ENV_SECT_SIZE (128 << 10) /* 128 KiB */
-#define CONFIG_ENV_OFFSET SMNAND_ENV_OFFSET
-#define CONFIG_ENV_ADDR SMNAND_ENV_OFFSET
+#define CONFIG_ENV_OFFSET 0x260000
+#define CONFIG_ENV_ADDR 0x260000
#ifdef CONFIG_CMD_NET
/* Ethernet (LAN9211 from SMSC9118 family) */
#include <config_distro_bootcmd.h>
#define CONFIG_EXTRA_ENV_SETTINGS \
+ ENV_MEM_LAYOUT_SETTINGS \
BOOTENV
#endif
#define CONFIG_SYS_INIT_SP_ADDR (CONFIG_SYS_TEXT_BASE + 0x100000)
#define CONFIG_SYS_LOAD_ADDR (CONFIG_SYS_SDRAM_BASE + 0x2000000)
+/* rockchip ohci host driver */
+#define CONFIG_USB_OHCI_NEW
+#define CONFIG_SYS_USB_OHCI_MAX_ROOT_PORTS 1
#endif
--- /dev/null
+/*
+ * Configuration file for the SAMA5D27 SOM1 EK Board.
+ *
+ * Copyright (C) 2017 Microchip Corporation
+ * Wenyou Yang <wenyou.yang@microchip.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#ifndef __CONFIG_H
+#define __CONFIG_H
+
+#include "at91-sama5_common.h"
+
+#undef CONFIG_SYS_TEXT_BASE
+#undef CONFIG_SYS_AT91_MAIN_CLOCK
+#define CONFIG_SYS_TEXT_BASE 0x23f00000
+#define CONFIG_SYS_AT91_MAIN_CLOCK 24000000 /* from 24 MHz crystal */
+
+#define CONFIG_MISC_INIT_R
+
+/* SDRAM */
+#define CONFIG_NR_DRAM_BANKS 1
+#define CONFIG_SYS_SDRAM_BASE 0x20000000
+#define CONFIG_SYS_SDRAM_SIZE 0x8000000
+
+#ifdef CONFIG_SPL_BUILD
+#define CONFIG_SYS_INIT_SP_ADDR 0x218000
+#else
+#define CONFIG_SYS_INIT_SP_ADDR \
+ (CONFIG_SYS_SDRAM_BASE + 16 * 1024 - GENERATED_GBL_DATA_SIZE)
+#endif
+
+#define CONFIG_SYS_LOAD_ADDR 0x22000000 /* load address */
+
+/* NAND flash */
+#undef CONFIG_CMD_NAND
+
+/* SPI flash */
+#define CONFIG_SF_DEFAULT_SPEED 66000000
+
+#undef CONFIG_BOOTCOMMAND
+#ifdef CONFIG_SD_BOOT
+/* u-boot env in sd/mmc card */
+#define FAT_ENV_INTERFACE "mmc"
+#define FAT_ENV_DEVICE_AND_PART "0"
+#define FAT_ENV_FILE "uboot.env"
+#define CONFIG_ENV_SIZE 0x4000
+/* bootstrap + u-boot + env in sd card */
+#define CONFIG_BOOTCOMMAND "fatload mmc 0:1 0x21000000 at91-sama5d27_som1_ek.dtb; " \
+ "fatload mmc 0:1 0x22000000 zImage; " \
+ "bootz 0x22000000 - 0x21000000"
+#undef CONFIG_BOOTARGS
+#define CONFIG_BOOTARGS \
+ "console=ttyS0,115200 earlyprintk root=/dev/mmcblk0p2 rw rootwait"
+#endif
+
+#ifdef CONFIG_QSPI_BOOT
+#define CONFIG_ENV_OFFSET 0xb0000
+#define CONFIG_ENV_SIZE 0x10000
+#define CONFIG_ENV_SECT_SIZE 0x10000
+#define CONFIG_BOOTCOMMAND "sf probe 0; " \
+ "sf read 0x21000000 0xc0000 0x20000; " \
+ "sf read 0x22000000 0xe0000 0x400000; " \
+ "bootz 0x22000000 - 0x21000000"
+#undef CONFIG_BOOTARGS
+#define CONFIG_BOOTARGS \
+ "console=ttyS0,115200 earlyprintk root=/dev/mmcblk0p2 rw rootwait"
+#endif
+
+/* SPL */
+#define CONFIG_SPL_FRAMEWORK
+#define CONFIG_SPL_TEXT_BASE 0x200000
+#define CONFIG_SPL_MAX_SIZE 0x10000
+#define CONFIG_SPL_BSS_START_ADDR 0x20000000
+#define CONFIG_SPL_BSS_MAX_SIZE 0x80000
+#define CONFIG_SYS_SPL_MALLOC_START 0x20080000
+#define CONFIG_SYS_SPL_MALLOC_SIZE 0x80000
+
+#define CONFIG_SYS_MONITOR_LEN (512 << 10)
+
+#ifdef CONFIG_SD_BOOT
+#define CONFIG_SYS_MMCSD_FS_BOOT_PARTITION 1
+#define CONFIG_SPL_FS_LOAD_PAYLOAD_NAME "u-boot.img"
+#endif
+
+#ifdef CONFIG_QSPI_BOOT
+#define CONFIG_SPL_SPI_LOAD
+#define CONFIG_SYS_SPI_U_BOOT_OFFS 0x10000
+#endif
+
+#endif
/* serial console */
#define CONFIG_ATMEL_USART
-#define CONFIG_USART_BASE ATMEL_BASE_UART0
-#define CONFIG_USART_ID ATMEL_ID_UART0
+#define CONFIG_USART_BASE 0xf801c000
+#define CONFIG_USART_ID 24
-#define CONFIG_SYS_SDRAM_BASE ATMEL_BASE_DDRCS
+#define CONFIG_SYS_SDRAM_BASE 0x20000000
#define CONFIG_SYS_SDRAM_SIZE 0x20000000
+#define CONFIG_SYS_TIMER_COUNTER 0xf804803c
+
#ifdef CONFIG_SPL_BUILD
#define CONFIG_SYS_INIT_SP_ADDR 0x210000
#else
#ifdef CONFIG_CMD_NAND
#define CONFIG_NAND_ATMEL
#define CONFIG_SYS_MAX_NAND_DEVICE 1
-#define CONFIG_SYS_NAND_BASE ATMEL_BASE_CS3
+#define CONFIG_SYS_NAND_BASE 0x80000000
/* our ALE is AD21 */
#define CONFIG_SYS_NAND_MASK_ALE (1 << 21)
/* our CLE is AD22 */
#define CONFIG_NET_RETRY_COUNT 20
#define CONFIG_MACB_SEARCH_PHY
-#ifdef CONFIG_SYS_USE_NANDFLASH
+#ifdef CONFIG_NAND_BOOT
#undef CONFIG_ENV_OFFSET
#undef CONFIG_ENV_OFFSET_REDUND
#undef CONFIG_BOOTCOMMAND
#define CONFIG_SYS_MONITOR_LEN (512 << 10)
-#ifdef CONFIG_SYS_USE_SERIALFLASH
+#ifdef CONFIG_SPI_BOOT
#define CONFIG_SPL_SPI_LOAD
#define CONFIG_SYS_SPI_U_BOOT_OFFS 0x8000
-#elif CONFIG_SYS_USE_NANDFLASH
+#elif CONFIG_NAND_BOOT
#define CONFIG_SPL_NAND_DRIVERS
#define CONFIG_SPL_NAND_BASE
+#endif
#define CONFIG_PMECC_CAP 8
#define CONFIG_PMECC_SECTOR_SIZE 512
#define CONFIG_SYS_NAND_U_BOOT_OFFS 0x40000
#define CONFIG_SYS_NAND_BLOCK_SIZE 0x40000
#define CONFIG_SYS_NAND_BAD_BLOCK_POS 0x0
#define CONFIG_SPL_GENERATE_ATMEL_PMECC_HEADER
-#endif
#endif
/* SDRAM */
#define CONFIG_NR_DRAM_BANKS 1
-#define CONFIG_SYS_SDRAM_BASE ATMEL_BASE_DDRCS
+#define CONFIG_SYS_SDRAM_BASE 0x20000000
#define CONFIG_SYS_SDRAM_SIZE 0x20000000
#ifdef CONFIG_SPL_BUILD
#define CONFIG_SF_DEFAULT_SPEED 30000000
#endif
-/* I2C */
-#define AT24MAC_ADDR 0x5c
-#define AT24MAC_REG 0x9a
-
/* LCD */
#ifdef CONFIG_LCD
#define CONFIG_ATMEL_LCD_RGB565
#endif
-#ifdef CONFIG_SYS_USE_MMC
+#ifdef CONFIG_SD_BOOT
/* bootstrap + u-boot + env in sd card */
#undef CONFIG_BOOTCOMMAND
/* SPL */
#define CONFIG_SPL_FRAMEWORK
#define CONFIG_SPL_TEXT_BASE 0x200000
-#define CONFIG_SPL_MAX_SIZE 0x18000
+#define CONFIG_SPL_MAX_SIZE 0x10000
#define CONFIG_SPL_BSS_START_ADDR 0x20000000
#define CONFIG_SPL_BSS_MAX_SIZE 0x80000
#define CONFIG_SYS_SPL_MALLOC_START 0x20080000
#define CONFIG_SYS_MONITOR_LEN (512 << 10)
-#ifdef CONFIG_SYS_USE_MMC
+#ifdef CONFIG_SD_BOOT
#define CONFIG_SYS_MMCSD_FS_BOOT_PARTITION 1
#define CONFIG_SPL_FS_LOAD_PAYLOAD_NAME "u-boot.img"
-#elif CONFIG_SYS_USE_SERIALFLASH
+#elif CONFIG_SPI_BOOT
#define CONFIG_SPL_SPI_LOAD
#define CONFIG_SYS_SPI_U_BOOT_OFFS 0x10000
* This needs to be defined for the OHCI code to work but it is defined as
* ATMEL_ID_UHPHS in the CPU specific header files.
*/
-#define ATMEL_ID_UHP ATMEL_ID_UHPHS
+#define ATMEL_ID_UHP 32
/*
* Specify the clock enable bit in the PMC_SCER register.
*/
-#define ATMEL_PMC_UHP AT91SAM926x_PMC_UHP
+#define ATMEL_PMC_UHP (1 << 6)
/* SDRAM */
#define CONFIG_NR_DRAM_BANKS 1
-#define CONFIG_SYS_SDRAM_BASE ATMEL_BASE_DDRCS
+#define CONFIG_SYS_SDRAM_BASE 0x20000000
#define CONFIG_SYS_SDRAM_SIZE 0x10000000
#ifdef CONFIG_SPL_BUILD
#ifdef CONFIG_CMD_NAND
#define CONFIG_NAND_ATMEL
#define CONFIG_SYS_MAX_NAND_DEVICE 1
-#define CONFIG_SYS_NAND_BASE ATMEL_BASE_CS3
+#define CONFIG_SYS_NAND_BASE 0x60000000
/* our ALE is AD21 */
#define CONFIG_SYS_NAND_MASK_ALE (1 << 21)
/* our CLE is AD22 */
#define CONFIG_USB_ATMEL_CLK_SEL_UPLL
#define CONFIG_USB_OHCI_NEW
#define CONFIG_SYS_USB_OHCI_CPU_INIT
-#define CONFIG_SYS_USB_OHCI_REGS_BASE ATMEL_BASE_OHCI
+#define CONFIG_SYS_USB_OHCI_REGS_BASE 0x00600000
#define CONFIG_SYS_USB_OHCI_SLOT_NAME "SAMA5D3 Xplained"
#define CONFIG_SYS_USB_OHCI_MAX_ROOT_PORTS 2
#endif
#define CONFIG_SYS_LOAD_ADDR 0x22000000 /* load address */
-#if CONFIG_SYS_USE_NANDFLASH
-/* override the bootcmd, bootargs and other configuration for nandflash env */
-#elif CONFIG_SYS_USE_MMC
-/* override the bootcmd, bootargs and other configuration for sd/mmc env */
-#endif
-
/* SPL */
#define CONFIG_SPL_FRAMEWORK
#define CONFIG_SPL_TEXT_BASE 0x300000
#define CONFIG_SYS_MONITOR_LEN (512 << 10)
-#ifdef CONFIG_SYS_USE_MMC
+#ifdef CONFIG_SD_BOOT
#define CONFIG_SYS_MMCSD_FS_BOOT_PARTITION 1
#define CONFIG_SPL_FS_LOAD_PAYLOAD_NAME "u-boot.img"
-#elif CONFIG_SYS_USE_NANDFLASH
+#elif CONFIG_NAND_BOOT
#define CONFIG_SPL_NAND_DRIVERS
#define CONFIG_SPL_NAND_BASE
+#endif
#define CONFIG_SYS_NAND_U_BOOT_OFFS 0x40000
#define CONFIG_SYS_NAND_5_ADDR_CYCLE
#define CONFIG_SYS_NAND_PAGE_SIZE 0x800
#define CONFIG_SPL_GENERATE_ATMEL_PMECC_HEADER
#endif
-
-#endif
* This needs to be defined for the OHCI code to work but it is defined as
* ATMEL_ID_UHPHS in the CPU specific header files.
*/
-#define ATMEL_ID_UHP ATMEL_ID_UHPHS
+#define ATMEL_ID_UHP 32
/*
* Specify the clock enable bit in the PMC_SCER register.
*/
-#define ATMEL_PMC_UHP AT91SAM926x_PMC_UHP
+#define ATMEL_PMC_UHP (1 << 6)
/* LCD */
#define LCD_BPP LCD_COLOR16
/* SDRAM */
#define CONFIG_NR_DRAM_BANKS 1
-#define CONFIG_SYS_SDRAM_BASE ATMEL_BASE_DDRCS
+#define CONFIG_SYS_SDRAM_BASE 0x20000000
#define CONFIG_SYS_SDRAM_SIZE 0x20000000
#ifdef CONFIG_SPL_BUILD
#ifdef CONFIG_CMD_NAND
#define CONFIG_NAND_ATMEL
#define CONFIG_SYS_MAX_NAND_DEVICE 1
-#define CONFIG_SYS_NAND_BASE ATMEL_BASE_CS3
+#define CONFIG_SYS_NAND_BASE 0x60000000
/* our ALE is AD21 */
#define CONFIG_SYS_NAND_MASK_ALE (1 << 21)
/* our CLE is AD22 */
#define CONFIG_SYS_LOAD_ADDR 0x22000000 /* load address */
-#ifdef CONFIG_SYS_USE_SERIALFLASH
-/* override the bootcmd, bootargs and other configuration for spi flash env*/
-#elif CONFIG_SYS_USE_NANDFLASH
-/* override the bootcmd, bootargs and other configuration nandflash env */
-#elif CONFIG_SYS_USE_MMC
-/* override the bootcmd, bootargs and other configuration for sd/mmc env */
-#endif
-
/* SPL */
#define CONFIG_SPL_FRAMEWORK
#define CONFIG_SPL_TEXT_BASE 0x300000
#define CONFIG_SYS_MONITOR_LEN (512 << 10)
-#ifdef CONFIG_SYS_USE_MMC
+#ifdef CONFIG_SD_BOOT
#define CONFIG_SYS_MMCSD_FS_BOOT_PARTITION 1
#define CONFIG_SPL_FS_LOAD_PAYLOAD_NAME "u-boot.img"
-#elif CONFIG_SYS_USE_NANDFLASH
+#elif CONFIG_SPI_BOOT
+#define CONFIG_SPL_SPI_LOAD
+#define CONFIG_SYS_SPI_U_BOOT_OFFS 0x10000
+
+#elif CONFIG_NAND_BOOT
#define CONFIG_SPL_NAND_DRIVERS
#define CONFIG_SPL_NAND_BASE
+#endif
#define CONFIG_SYS_NAND_U_BOOT_OFFS 0x40000
#define CONFIG_SYS_NAND_5_ADDR_CYCLE
#define CONFIG_SYS_NAND_PAGE_SIZE 0x800
#define CONFIG_SYS_NAND_BAD_BLOCK_POS 0x0
#define CONFIG_SPL_GENERATE_ATMEL_PMECC_HEADER
-#elif CONFIG_SYS_USE_SERIALFLASH
-#define CONFIG_SPL_SPI_LOAD
-#define CONFIG_SYS_SPI_U_BOOT_OFFS 0x10000
-
-#endif
-
#endif
#include "at91-sama5_common.h"
+#define CONFIG_MISC_INIT_R
+
/* SDRAM */
#define CONFIG_NR_DRAM_BANKS 1
-#define CONFIG_SYS_SDRAM_BASE ATMEL_BASE_DDRCS
+#define CONFIG_SYS_SDRAM_BASE 0x20000000
#define CONFIG_SYS_SDRAM_SIZE 0x20000000
#ifdef CONFIG_SPL_BUILD
#ifdef CONFIG_CMD_NAND
#define CONFIG_NAND_ATMEL
#define CONFIG_SYS_MAX_NAND_DEVICE 1
-#define CONFIG_SYS_NAND_BASE ATMEL_BASE_CS3
+#define CONFIG_SYS_NAND_BASE 0x80000000
/* our ALE is AD21 */
#define CONFIG_SYS_NAND_MASK_ALE (1 << 21)
/* our CLE is AD22 */
#define CONFIG_ATMEL_LCD_RGB565
#endif
-#ifdef CONFIG_SYS_USE_SERIALFLASH
-/* override the bootcmd, bootargs and other configuration for spi flash env */
-#elif CONFIG_SYS_USE_NANDFLASH
-/* override the bootcmd, bootargs and other configuration for nandflash env */
-#elif CONFIG_SYS_USE_MMC
-/* override the bootcmd, bootargs and other configuration for sd/mmc env */
-#endif
-
/* SPL */
#define CONFIG_SPL_FRAMEWORK
#define CONFIG_SPL_TEXT_BASE 0x200000
#define CONFIG_SYS_MONITOR_LEN (512 << 10)
-#ifdef CONFIG_SYS_USE_MMC
+#ifdef CONFIG_SD_BOOT
#define CONFIG_SYS_MMCSD_FS_BOOT_PARTITION 1
#define CONFIG_SPL_FS_LOAD_PAYLOAD_NAME "u-boot.img"
#elif CONFIG_SYS_USE_NANDFLASH
+#elif CONFIG_SPI_BOOT
+#define CONFIG_SPL_SPI_LOAD
+#define CONFIG_SYS_SPI_U_BOOT_OFFS 0x10000
+
+#elif CONFIG_NAND_BOOT
#define CONFIG_SPL_NAND_DRIVERS
#define CONFIG_SPL_NAND_BASE
+#endif
#define CONFIG_PMECC_CAP 8
#define CONFIG_PMECC_SECTOR_SIZE 512
#define CONFIG_SYS_NAND_U_BOOT_OFFS 0x40000
#define CONFIG_SYS_NAND_BAD_BLOCK_POS 0x0
#define CONFIG_SPL_GENERATE_ATMEL_PMECC_HEADER
-#elif CONFIG_SYS_USE_SERIALFLASH
-#define CONFIG_SPL_SPI_LOAD
-#define CONFIG_SYS_SPI_U_BOOT_OFFS 0x10000
-
-#endif
#endif
/* SDRAM */
#define CONFIG_NR_DRAM_BANKS 1
-#define CONFIG_SYS_SDRAM_BASE ATMEL_BASE_DDRCS
+#define CONFIG_SYS_SDRAM_BASE 0x20000000
#define CONFIG_SYS_SDRAM_SIZE 0x20000000
#ifdef CONFIG_SPL_BUILD
#ifdef CONFIG_CMD_NAND
#define CONFIG_NAND_ATMEL
#define CONFIG_SYS_MAX_NAND_DEVICE 1
-#define CONFIG_SYS_NAND_BASE ATMEL_BASE_CS3
+#define CONFIG_SYS_NAND_BASE 0x80000000
/* our ALE is AD21 */
#define CONFIG_SYS_NAND_MASK_ALE (1 << 21)
/* our CLE is AD22 */
#define CONFIG_ATMEL_HLCD
#define CONFIG_ATMEL_LCD_RGB565
-#ifdef CONFIG_SYS_USE_SERIALFLASH
-/* override the bootcmd, bootargs and other configuration for spi flash env*/
-#elif CONFIG_SYS_USE_NANDFLASH
-/* override the bootcmd, bootargs and other configuration for nandflash env*/
-#elif CONFIG_SYS_USE_MMC
-/* override the bootcmd, bootargs and other configuration for sd/mmc env */
-#endif
-
/* SPL */
#define CONFIG_SPL_FRAMEWORK
#define CONFIG_SPL_TEXT_BASE 0x200000
#define CONFIG_SYS_MONITOR_LEN (512 << 10)
-#ifdef CONFIG_SYS_USE_MMC
+#ifdef CONFIG_SD_BOOT
#define CONFIG_SYS_MMCSD_FS_BOOT_PARTITION 1
#define CONFIG_SPL_FS_LOAD_PAYLOAD_NAME "u-boot.img"
-#elif CONFIG_SYS_USE_NANDFLASH
+#elif CONFIG_SPI_BOOT
+#define CONFIG_SPL_SPI_LOAD
+#define CONFIG_SYS_SPI_U_BOOT_OFFS 0x10000
+
+#elif CONFIG_NAND_BOOT
#define CONFIG_SPL_NAND_DRIVERS
#define CONFIG_SPL_NAND_BASE
+#endif
#define CONFIG_PMECC_CAP 8
#define CONFIG_PMECC_SECTOR_SIZE 512
#define CONFIG_SYS_NAND_U_BOOT_OFFS 0x40000
#define CONFIG_SYS_NAND_BAD_BLOCK_POS 0x0
#define CONFIG_SPL_GENERATE_ATMEL_PMECC_HEADER
-#elif CONFIG_SYS_USE_SERIALFLASH
-#define CONFIG_SPL_SPI_LOAD
-#define CONFIG_SYS_SPI_U_BOOT_OFFS 0x10000
-
-#endif
#endif
* DRAM
*/
-#define CONFIG_SDRC
#define CONFIG_NR_DRAM_BANKS 2
#define PHYS_SDRAM_1 OMAP34XX_SDRC_CS0
#define PHYS_SDRAM_2 OMAP34XX_SDRC_CS1
#define CONFIG_SYS_TEXT_BASE 0x80008000
-#define CONFIG_EMIF4 /* The chip has EMIF4 controller */
-
#include <asm/arch/cpu.h> /* get chip and board defs */
#include <asm/arch/omap.h>
/* **** PISMO SUPPORT *** */
#define CONFIG_NAND_OMAP_GPMC
-#define SMNAND_ENV_OFFSET 0x180000 /* environment starts here */
/* Redundant Environment */
#define CONFIG_SYS_ENV_SECT_SIZE (128 << 10) /* 128 KiB */
-#define CONFIG_ENV_OFFSET SMNAND_ENV_OFFSET
-#define CONFIG_ENV_ADDR SMNAND_ENV_OFFSET
+#define CONFIG_ENV_OFFSET 0x180000
+#define CONFIG_ENV_ADDR 0x180000
#define CONFIG_ENV_OFFSET_REDUND (CONFIG_ENV_OFFSET + \
2 * CONFIG_SYS_ENV_SECT_SIZE)
#define CONFIG_ENV_SIZE_REDUND CONFIG_ENV_SIZE
* High Level Configuration Options
*/
-#define CONFIG_SDRC /* Has an SDRC controller */
-
#include <asm/arch/cpu.h> /* get chip and board defs */
#include <asm/arch/omap.h>
#define CONFIG_SYS_ONENAND_BASE ONENAND_MAP
#define ONENAND_ENV_OFFSET 0x260000 /* environment starts here */
-#define SMNAND_ENV_OFFSET 0x260000 /* environment starts here */
#define CONFIG_SYS_ENV_SECT_SIZE (128 << 10)
-#define CONFIG_ENV_OFFSET SMNAND_ENV_OFFSET
+#define CONFIG_ENV_OFFSET 0x260000
#define CONFIG_ENV_ADDR CONFIG_ENV_OFFSET
#define CONFIG_SYS_SDRAM_BASE PHYS_SDRAM_1
/* Framebuffer */
#ifdef CONFIG_VIDEO
#define CONFIG_VIDEO_IPUV3
-#define CONFIG_IPUV3_CLK 260000000
#define CONFIG_VIDEO_BMP_RLE8
#define CONFIG_IMX_HDMI
#define CONFIG_IMX_VIDEO_SKIP
#include <asm/arch/cpu.h>
#include <asm/arch/omap.h>
-/* The chip has SDRC controller */
-#define CONFIG_SDRC
-
/* Clock Defines */
#define V_OSCK 26000000 /* Clock output from T2 */
#define V_SCLK (V_OSCK >> 1)
*/
#define CONFIG_SYS_TEXT_BASE 0x80100000
-#define CONFIG_SDRC /* The chip has SDRC controller */
-
#include <asm/arch/cpu.h> /* get chip and board defs */
#include <asm/arch/omap.h>
/* serial console */
#define CONFIG_ATMEL_USART
-#define CONFIG_USART_BASE ATMEL_BASE_USART3
-#define CONFIG_USART_ID ATMEL_ID_USART3
+#define CONFIG_USART_BASE 0xfc00c000
+#define CONFIG_USART_ID 30
+
+/* Timer */
+#define CONFIG_SYS_TIMER_COUNTER 0xfc06863c
/* SDRAM */
#define CONFIG_NR_DRAM_BANKS 1
-#define CONFIG_SYS_SDRAM_BASE ATMEL_BASE_DDRCS
+#define CONFIG_SYS_SDRAM_BASE 0x20000000
#define CONFIG_SYS_SDRAM_SIZE 0x4000000
#define CONFIG_SYS_INIT_SP_ADDR \
#ifdef CONFIG_CMD_MMC
#define CONFIG_SUPPORT_EMMC_BOOT
#define CONFIG_GENERIC_ATMEL_MCI
-#define ATMEL_BASE_MMCI ATMEL_BASE_MCI1
+#define ATMEL_BASE_MMCI 0xfc000000
#define CONFIG_SYS_MMC_CLK_OD 500000
/* For generating MMC partitions */
#define CONFIG_NET_RETRY_COUNT 20
#define CONFIG_MACB_SEARCH_PHY
-#ifdef CONFIG_SYS_USE_SERIALFLASH
+#ifdef CONFIG_SPI_BOOT
/* bootstrap + u-boot + env + linux in serial flash */
#define CONFIG_ENV_SPI_BUS CONFIG_SF_DEFAULT_BUS
#define CONFIG_ENV_SPI_CS CONFIG_SF_DEFAULT_CS
--- /dev/null
+/*
+ * Copyright (C) 2017 Amarula Solutions
+ *
+ * Configuration settings for Amarula Vyasa RK3288.
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#ifndef __CONFIG_H
+#define __CONFIG_H
+
+#define ROCKCHIP_DEVICE_SETTINGS
+#include <configs/rk3288_common.h>
+
+#undef BOOT_TARGET_DEVICES
+
+#define BOOT_TARGET_DEVICES(func) \
+ func(MMC, mmc, 1) \
+
+#define CONFIG_SYS_MMC_ENV_DEV 1
+#undef CONFIG_CMD_USB_MASS_STORAGE
+
+#endif
#define CONFIG_BMP_16BPP
#define CONFIG_VIDEO_LOGO
#define CONFIG_VIDEO_BMP_LOGO
-#define CONFIG_IPUV3_CLK 260000000
#define CONFIG_IMX_HDMI
#define CONFIG_IMX_VIDEO_SKIP
#endif
int ofnode_read_resource_byname(ofnode node, const char *name,
struct resource *res);
+/**
+ * ofnode_for_each_subnode() - iterate over all subnodes of a parent
+ *
+ * @node: child node (ofnode, lvalue)
+ * @parent: parent node (ofnode)
+ *
+ * This is a wrapper around a for loop and is used like so:
+ *
+ * ofnode node;
+ *
+ * ofnode_for_each_subnode(node, parent) {
+ * Use node
+ * ...
+ * }
+ *
+ * Note that this is implemented as a macro and @node is used as
+ * iterator in the loop. The parent variable can be a constant or even a
+ * literal.
+ */
+#define ofnode_for_each_subnode(node, parent) \
+ for (node = ofnode_first_subnode(parent); \
+ ofnode_valid(node); \
+ node = ofnode_next_subnode(node))
+
#endif
*/
fdt_addr_t dev_read_addr(struct udevice *dev);
+/**
+ * dev_read_addr_ptr() - Get the reg property of a device
+ * as a pointer
+ *
+ * @dev: Device to read from
+ *
+ * @return pointer or NULL if not found
+ */
+void *dev_read_addr_ptr(struct udevice *dev);
+
/**
* dev_read_addr_size() - get address and size from a device property
*
return devfdt_get_addr(dev);
}
+static inline void *dev_read_addr_ptr(struct udevice *dev)
+{
+ return devfdt_get_addr_ptr(dev);
+}
+
static inline fdt_addr_t dev_read_addr_size(struct udevice *dev,
const char *propname,
fdt_size_t *sizep)
*/
int dm_scan_fdt(const void *blob, bool pre_reloc_only);
+/**
+ * dm_extended_scan_fdt() - Scan the device tree and bind drivers
+ *
+ * This calls dm_scna_dft() which scans the device tree and creates a driver
+ * for each node. the top-level subnodes are examined and also all sub-nodes
+ * of "clocks" node.
+ *
+ * @blob: Pointer to device tree blob
+ * @pre_reloc_only: If true, bind only drivers with the DM_FLAG_PRE_RELOC
+ * flag. If false bind all drivers.
+ * @return 0 if OK, -ve on error
+ */
+int dm_extended_scan_fdt(const void *blob, bool pre_reloc_only);
+
/**
* dm_scan_other() - Scan for other devices
*
*/
#define DRA7XX_CORE_IOPAD(pa, val) (((pa) & 0xffff) - 0x3400) (val)
+/* DRA7 IODELAY configuration parameters */
+#define A_DELAY_PS(val) ((val) & 0xffff)
+#define G_DELAY_PS(val) ((val) & 0xffff)
#endif
/* These structures may only be used in SPL */
#if CONFIG_IS_ENABLED(OF_PLATDATA)
-struct phandle_2_cell {
+struct phandle_0_arg {
const void *node;
- int id;
+ int arg[0];
};
-#include <generated/dt-structs.h>
+
+struct phandle_1_arg {
+ const void *node;
+ int arg[1];
+};
+
+struct phandle_2_arg {
+ const void *node;
+ int arg[2];
+};
+#include <generated/dt-structs-gen.h>
#endif
#endif
"setenv fdtfile dra72-evm.dtb; fi;" \
"if test $board_name = dra71x; then " \
"setenv fdtfile dra71-evm.dtb; fi;" \
+ "if test $board_name = dra76x; then " \
+ "setenv fdtfile dra76-evm.dtb; fi;" \
"if test $board_name = beagle_x15; then " \
"setenv fdtfile am57xx-beagle-x15.dtb; fi;" \
"if test $board_name = beagle_x15_revb1; then " \
"setenv fdtfile am57xx-beagle-x15-revb1.dtb; fi;" \
+ "if test $board_name = beagle_x15_revc; then " \
+ "setenv fdtfile am57xx-beagle-x15-revc.dtb; fi;" \
"if test $board_name = am572x_idk; then " \
"setenv fdtfile am572x-idk.dtb; fi;" \
"if test $board_name = am57xx_evm; then " \
#define _FAT_H_
#include <asm/byteorder.h>
+#include <fs.h>
#define CONFIG_SUPPORT_VFAT
/* Maximum Long File Name length supported here is 128 UTF-16 code units */
*/
#define LAST_LONG_ENTRY_MASK 0x40
-/* Flags telling whether we should read a file or list a directory */
-#define LS_NO 0
-#define LS_YES 1
-#define LS_DIR 1
-#define LS_ROOT 2
-
#define ISDIRDELIM(c) ((c) == '/' || (c) == '\\')
#define FSTYPE_NONE (-1)
/* Boot sign comes last, 2 bytes */
} volume_info;
+/* see dir_entry::lcase: */
+#define CASE_LOWER_BASE 8 /* base (name) is lower case */
+#define CASE_LOWER_EXT 16 /* extension is lower case */
+
typedef struct dir_entry {
char name[8],ext[3]; /* Name and extension */
__u8 attr; /* Attribute bits */
- __u8 lcase; /* Case for base and extension */
+ __u8 lcase; /* Case for name and ext (CASE_LOWER_x) */
__u8 ctime_ms; /* Creation time, milliseconds */
__u16 ctime; /* Creation time */
__u16 cdate; /* Creation date */
__u16 clust_size; /* Size of clusters in sectors */
int data_begin; /* The sector of the first cluster, can be negative */
int fatbufnum; /* Used by get_fatent, init to -1 */
+ int rootdir_size; /* Size of root dir for non-FAT32 */
+ __u32 root_cluster; /* First cluster of root dir for FAT32 */
} fsdata;
-typedef int (file_detectfs_func)(void);
-typedef int (file_ls_func)(const char *dir);
-typedef int (file_read_func)(const char *filename, void *buffer,
- int maxsize);
-
-struct filesystem {
- file_detectfs_func *detect;
- file_ls_func *ls;
- file_read_func *read;
- const char name[12];
-};
-
-/* FAT tables */
-file_detectfs_func file_fat_detectfs;
-file_ls_func file_fat_ls;
-file_read_func file_fat_read;
-
-/* Currently this doesn't check if the dir exists or is valid... */
-int file_cd(const char *path);
+static inline u32 clust_to_sect(fsdata *fsdata, u32 clust)
+{
+ return fsdata->data_begin + clust * fsdata->clust_size;
+}
+
+static inline u32 sect_to_clust(fsdata *fsdata, u32 sect)
+{
+ return (sect - fsdata->data_begin) / fsdata->clust_size;
+}
+
int file_fat_detectfs(void);
-int file_fat_ls(const char *dir);
int fat_exists(const char *filename);
int fat_size(const char *filename, loff_t *size);
int file_fat_read_at(const char *filename, loff_t pos, void *buffer,
loff_t maxsize, loff_t *actread);
int file_fat_read(const char *filename, void *buffer, int maxsize);
-const char *file_getfsname(int idx);
int fat_set_blk_dev(struct blk_desc *rbdd, disk_partition_t *info);
int fat_register_device(struct blk_desc *dev_desc, int part_no);
loff_t *actwrite);
int fat_read_file(const char *filename, void *buf, loff_t offset, loff_t len,
loff_t *actread);
+int fat_opendir(const char *filename, struct fs_dir_stream **dirsp);
+int fat_readdir(struct fs_dir_stream *dirs, struct fs_dirent **dentp);
+void fat_closedir(struct fs_dir_stream *dirs);
void fat_close(void);
#endif /* _FAT_H_ */
int fdt_setup_simplefb_node(void *fdt, int node, u64 base_address, u32 width,
u32 height, u32 stride, const char *format);
+int fdt_overlay_apply_verbose(void *fdt, void *fdto);
+
#endif /* ifdef CONFIG_OF_LIBFDT */
#ifdef USE_HOSTCC
#define FDT_ADDR_T_NONE (-1ULL)
#define fdt_addr_to_cpu(reg) be64_to_cpu(reg)
#define fdt_size_to_cpu(reg) be64_to_cpu(reg)
+typedef fdt64_t fdt_val_t;
#else
#define FDT_ADDR_T_NONE (-1U)
#define fdt_addr_to_cpu(reg) be32_to_cpu(reg)
#define fdt_size_to_cpu(reg) be32_to_cpu(reg)
+typedef fdt32_t fdt_val_t;
#endif
/* Information obtained about memory from the FDT */
*/
int fs_set_blk_dev(const char *ifname, const char *dev_part_str, int fstype);
+/*
+ * fs_set_blk_dev_with_part - Set current block device + partition
+ *
+ * Similar to fs_set_blk_dev(), but useful for cases where you already
+ * know the blk_desc and part number.
+ *
+ * Returns 0 on success.
+ * Returns non-zero if invalid partition or error accessing the disk.
+ */
+int fs_set_blk_dev_with_part(struct blk_desc *desc, int part);
+
/*
* Print the list of files on the partition previously set by fs_set_blk_dev(),
* in directory "dirname".
int fs_write(const char *filename, ulong addr, loff_t offset, loff_t len,
loff_t *actwrite);
+/*
+ * Directory entry types, matches the subset of DT_x in posix readdir()
+ * which apply to u-boot.
+ */
+#define FS_DT_DIR 4 /* directory */
+#define FS_DT_REG 8 /* regular file */
+#define FS_DT_LNK 10 /* symbolic link */
+
+/*
+ * A directory entry, returned by fs_readdir(). Returns information
+ * about the file/directory at the current directory entry position.
+ */
+struct fs_dirent {
+ unsigned type; /* one of FS_DT_x (not a mask) */
+ loff_t size; /* size in bytes */
+ char name[256];
+};
+
+/* Note: fs_dir_stream should be treated as opaque to the user of fs layer */
+struct fs_dir_stream {
+ /* private to fs. layer: */
+ struct blk_desc *desc;
+ int part;
+};
+
+/*
+ * fs_opendir - Open a directory
+ *
+ * @filename: the path to directory to open
+ * @return a pointer to the directory stream or NULL on error and errno
+ * set appropriately
+ */
+struct fs_dir_stream *fs_opendir(const char *filename);
+
+/*
+ * fs_readdir - Read the next directory entry in the directory stream.
+ *
+ * Works in an analogous way to posix readdir(). The previously returned
+ * directory entry is no longer valid after calling fs_readdir() again.
+ * After fs_closedir() is called, the returned directory entry is no
+ * longer valid.
+ *
+ * @dirs: the directory stream
+ * @return the next directory entry (only valid until next fs_readdir() or
+ * fs_closedir() call, do not attempt to free()) or NULL if the end of
+ * the directory is reached.
+ */
+struct fs_dirent *fs_readdir(struct fs_dir_stream *dirs);
+
+/*
+ * fs_closedir - close a directory stream
+ *
+ * @dirs: the directory stream
+ */
+void fs_closedir(struct fs_dir_stream *dirs);
+
/*
* Common implementation for various filesystem commands, optionally limited
* to a specific filesystem type via the fstype parameter.
void wriop_dpmac_enable(int);
phy_interface_t wriop_dpmac_enet_if(int, int);
void wriop_init_dpmac_qsgmii(int, int);
+void wriop_init_rgmii(void);
+void wriop_init_dpmac_enet_if(int , phy_interface_t);
#endif /* __LDPAA_WRIOP_H */
u8 res_e5c[164];
u32 debug[64]; /* debug_1 to debug_64 */
};
+
+#ifdef CONFIG_SYS_FSL_HAS_CCI400
+#define CCI400_CTRLORD_TERM_BARRIER 0x00000008
+#define CCI400_CTRLORD_EN_BARRIER 0
+#define CCI400_SHAORD_NON_SHAREABLE 0x00000002
+#define CCI400_DVM_MESSAGE_REQ_EN 0x00000002
+#define CCI400_SNOOP_REQ_EN 0x00000001
+
+/* CCI-400 registers */
+struct ccsr_cci400 {
+ u32 ctrl_ord; /* Control Override */
+ u32 spec_ctrl; /* Speculation Control */
+ u32 secure_access; /* Secure Access */
+ u32 status; /* Status */
+ u32 impr_err; /* Imprecise Error */
+ u8 res_14[0x100 - 0x14];
+ u32 pmcr; /* Performance Monitor Control */
+ u8 res_104[0xfd0 - 0x104];
+ u32 pid[8]; /* Peripheral ID */
+ u32 cid[4]; /* Component ID */
+ struct {
+ u32 snoop_ctrl; /* Snoop Control */
+ u32 sha_ord; /* Shareable Override */
+ u8 res_1008[0x1100 - 0x1008];
+ u32 rc_qos_ord; /* read channel QoS Value Override */
+ u32 wc_qos_ord; /* read channel QoS Value Override */
+ u8 res_1108[0x110c - 0x1108];
+ u32 qos_ctrl; /* QoS Control */
+ u32 max_ot; /* Max OT */
+ u8 res_1114[0x1130 - 0x1114];
+ u32 target_lat; /* Target Latency */
+ u32 latency_regu; /* Latency Regulation */
+ u32 qos_range; /* QoS Range */
+ u8 res_113c[0x2000 - 0x113c];
+ } slave[5]; /* Slave Interface */
+ u8 res_6000[0x9004 - 0x6000];
+ u32 cycle_counter; /* Cycle counter */
+ u32 count_ctrl; /* Count Control */
+ u32 overflow_status; /* Overflow Flag Status */
+ u8 res_9010[0xa000 - 0x9010];
+ struct {
+ u32 event_select; /* Event Select */
+ u32 event_count; /* Event Count */
+ u32 counter_ctrl; /* Counter Control */
+ u32 overflow_status; /* Overflow Flag Status */
+ u8 res_a010[0xb000 - 0xa010];
+ } pcounter[4]; /* Performance Counter */
+ u8 res_e004[0x10000 - 0xe004];
+};
+#endif
+
#endif /* __FSL_IMMAP_H */
IH_TYPE_VYBRIDIMAGE, /* VYBRID .vyb Image */
IH_TYPE_TEE, /* Trusted Execution Environment OS Image */
IH_TYPE_FIRMWARE_IVT, /* Firmware Image with HABv4 IVT */
+ IH_TYPE_PMMC, /* TI Power Management Micro-Controller Firmware */
IH_TYPE_COUNT, /* Number of image types */
};
int boot_get_setup_fit(bootm_headers_t *images, uint8_t arch,
ulong *setup_start, ulong *setup_len);
+/**
+ * boot_get_fdt_fit() - load a DTB from a FIT file (applying overlays)
+ *
+ * This deals with all aspects of loading an DTB from a FIT.
+ * The correct base image based on configuration will be selected, and
+ * then any overlays specified will be applied (as present in fit_uname_configp).
+ *
+ * @param images Boot images structure
+ * @param addr Address of FIT in memory
+ * @param fit_unamep On entry this is the requested image name
+ * (e.g. "kernel@1") or NULL to use the default. On exit
+ * points to the selected image name
+ * @param fit_uname_configp On entry this is the requested configuration
+ * name (e.g. "conf@1") or NULL to use the default. On
+ * exit points to the selected configuration name.
+ * @param arch Expected architecture (IH_ARCH_...)
+ * @param datap Returns address of loaded image
+ * @param lenp Returns length of loaded image
+ *
+ * @return node offset of base image, or -ve error code on error
+ */
+int boot_get_fdt_fit(bootm_headers_t *images, ulong addr,
+ const char **fit_unamep, const char **fit_uname_configp,
+ int arch, ulong *datap, ulong *lenp);
+
/**
* fit_image_load() - load an image from a FIT
*
--- /dev/null
+#ifndef _LINUX_DMA_DIRECTION_H
+#define _LINUX_DMA_DIRECTION_H
+/*
+ * These definitions mirror those in pci.h, so they can be used
+ * interchangeably with their PCI_ counterparts.
+ */
+enum dma_data_direction {
+ DMA_BIDIRECTIONAL = 0,
+ DMA_TO_DEVICE = 1,
+ DMA_FROM_DEVICE = 2,
+ DMA_NONE = 3,
+};
+#endif
#include <linux/types.h>
#include <asm/io.h>
+static inline u8 ioread8(const volatile void __iomem *addr)
+{
+ return readb(addr);
+}
+
+static inline u16 ioread16(const volatile void __iomem *addr)
+{
+ return readw(addr);
+}
+
+static inline u32 ioread32(const volatile void __iomem *addr)
+{
+ return readl(addr);
+}
+
+#ifdef CONFIG_64BIT
+static inline u64 ioread64(const volatile void __iomem *addr)
+{
+ return readq(addr);
+}
+#endif /* CONFIG_64BIT */
+
+static inline void iowrite8(u8 value, volatile void __iomem *addr)
+{
+ writeb(value, addr);
+}
+
+static inline void iowrite16(u16 value, volatile void __iomem *addr)
+{
+ writew(value, addr);
+}
+
+static inline void iowrite32(u32 value, volatile void __iomem *addr)
+{
+ writel(value, addr);
+}
+
+#ifdef CONFIG_64BIT
+static inline void iowrite64(u64 value, volatile void __iomem *addr)
+{
+ writeq(value, addr);
+}
+#endif /* CONFIG_64BIT */
+
#ifndef CONFIG_HAVE_ARCH_IOREMAP
static inline void __iomem *ioremap(resource_size_t offset,
resource_size_t size)
#define LDO2_CTRL 0x52
#define LDO2_VOLTAGE 0x53
+/* LDO2 control/voltage */
+#define LDO4_CTRL 0x5e
+#define LDO4_VOLTAGE 0x5f
+
/* LDO9 control/voltage */
#define LDO9_CTRL 0x60
#define LDO9_VOLTAGE 0x61
}
void palmas_init_settings(void);
-int palmas_mmc1_poweron_ldo(uint voltage);
+int palmas_mmc1_poweron_ldo(uint ldo_volt, uint ldo_ctrl, uint voltage);
int lp873x_mmc1_poweron_ldo(uint voltage);
int twl603x_mmc1_set_ldo9(u8 vsel);
int twl603x_audio_power(u8 on);
/* disk/part.c */
int part_get_info(struct blk_desc *dev_desc, int part, disk_partition_t *info);
+/**
+ * part_get_info_whole_disk() - get partition info for the special case of
+ * a partition occupying the entire disk.
+ */
+int part_get_info_whole_disk(struct blk_desc *dev_desc, disk_partition_t *info);
+
void part_print(struct blk_desc *dev_desc);
void part_init(struct blk_desc *dev_desc);
void dev_print(struct blk_desc *dev_desc);
static inline int part_get_info(struct blk_desc *dev_desc, int part,
disk_partition_t *info) { return -1; }
+static inline int part_get_info_whole_disk(struct blk_desc *dev_desc,
+ disk_partition_t *info)
+{ return -1; }
static inline void part_print(struct blk_desc *dev_desc) {}
static inline void part_init(struct blk_desc *dev_desc) {}
static inline void dev_print(struct blk_desc *dev_desc) {}
* @count: Number of pairs (e.g. 1 if the regmap has a single entry)
* @mapp: Returns allocated map
*/
-int regmap_init_mem_platdata(struct udevice *dev, u32 *reg, int count,
+int regmap_init_mem_platdata(struct udevice *dev, fdt_val_t *reg, int count,
struct regmap **mapp);
/**
#ifndef __SYSCON_H
#define __SYSCON_H
+#include <fdtdec.h>
+
/**
* struct syscon_uc_info - Information stored by the syscon UCLASS_UCLASS
*
* We don't support 64-bit machines. If they are so resource-contrained that
* they need to use OF_PLATDATA, something is horribly wrong with the
* education of our hardware engineers.
+ *
+ * Update: 64-bit is now supported and we have an education crisis.
*/
struct syscon_base_platdata {
- u32 reg[2];
+ fdt_val_t reg[2];
};
#endif
bool "Enable LZO decompression support"
help
This enables support for LZO compression algorithm.r
+
+config SPL_GZIP
+ bool "Enable gzip decompression support for SPL build"
+ select SPL_ZLIB
+ help
+ This enables support for GZIP compression altorithm for SPL boot.
+
+config SPL_ZLIB
+ bool
+ help
+ This enables compression lib for SPL boot.
+
endmenu
config ERRNO_STR
obj-$(CONFIG_EFI_LOADER) += efi_loader/
obj-$(CONFIG_LZMA) += lzma/
obj-$(CONFIG_LZO) += lzo/
-obj-$(CONFIG_ZLIB) += zlib/
obj-$(CONFIG_BZIP2) += bzip2/
obj-$(CONFIG_TIZEN) += tizen/
obj-$(CONFIG_FIT) += libfdt/
obj-$(CONFIG_OF_LIVE) += of_live.o
obj-$(CONFIG_CMD_DHRYSTONE) += dhry/
+obj-$(CONFIG_ARCH_AT91) += at91/
obj-$(CONFIG_AES) += aes.o
+obj-y += charset.o
obj-$(CONFIG_USB_TTY) += circbuf.o
obj-y += crc7.o
obj-y += crc8.o
obj-$(CONFIG_ERRNO_STR) += errno_str.o
obj-$(CONFIG_FIT) += fdtdec_common.o
obj-$(CONFIG_TEST_FDTDEC) += fdtdec_test.o
-obj-$(CONFIG_GZIP) += gunzip.o
obj-$(CONFIG_GZIP_COMPRESSED) += gzip.o
obj-$(CONFIG_GENERATE_SMBIOS_TABLE) += smbios.o
obj-y += initcall.o
obj-$(CONFIG_SHA1) += sha1.o
obj-$(CONFIG_SHA256) += sha256.o
+obj-$(CONFIG_$(SPL_)ZLIB) += zlib/
+obj-$(CONFIG_$(SPL_)GZIP) += gunzip.o
+
obj-$(CONFIG_$(SPL_TPL_)SAVEENV) += qsort.o
obj-$(CONFIG_$(SPL_TPL_)OF_LIBFDT) += libfdt/
ifneq ($(CONFIG_$(SPL_TPL_)BUILD)$(CONFIG_$(SPL_TPL_)OF_PLATDATA),yy)
--- /dev/null
+#
+# Copyright (C) 2017 Microchip
+# Wenyou.Yang <wenyou.yang@microchip.com>
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-$(CONFIG_ARCH_AT91) += at91.o
--- /dev/null
+/*
+ * Copyright (C) 2016 Microchip
+ * Wenyou.Yang <wenyou.yang@microchip.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
+#include <atmel_lcd.h>
+
+#include "atmel_logo_8bpp.h"
+#include "microchip_logo_8bpp.h"
+
+void atmel_logo_info(vidinfo_t *info)
+{
+ info->logo_width = ATMEL_LOGO_8BPP_WIDTH;
+ info->logo_height = ATMEL_LOGO_8BPP_HEIGHT;
+ info->logo_x_offset = ATMEL_LOGO_8BPP_X_OFFSET;
+ info->logo_y_offset = ATMEL_LOGO_8BPP_X_OFFSET;
+ info->logo_addr = (u_long)atmel_logo_8bpp;
+}
+
+void microchip_logo_info(vidinfo_t *info)
+{
+ info->logo_width = MICROCHIP_LOGO_8BPP_WIDTH;
+ info->logo_height = MICROCHIP_LOGO_8BPP_HEIGHT;
+ info->logo_x_offset = MICROCHIP_LOGO_8BPP_X_OFFSET;
+ info->logo_y_offset = MICROCHIP_LOGO_8BPP_X_OFFSET;
+ info->logo_addr = (u_long)microchip_logo_8bpp;
+}
--- /dev/null
+/*
+ * Copyright (C) 2017 Microchip
+ * Wenyou.Yang <wenyou.yang@microchip.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#ifndef __ATMEL_LOGO_8BPP_H__
+#define __ATMEL_LOGO_8BPP_H__
+
+#define ATMEL_LOGO_8BPP_WIDTH 240
+#define ATMEL_LOGO_8BPP_HEIGHT 60
+
+#define ATMEL_LOGO_8BPP_X_OFFSET 0
+#define ATMEL_LOGO_8BPP_Y_OFFSET 0
+
+/* Format: BMP 8BPP 240*60 */
+unsigned char atmel_logo_8bpp[] = {
+ 0x42, 0x4d, 0x76, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x36, 0x04,
+ 0x00, 0x00, 0x28, 0x00, 0x00, 0x00, 0xf0, 0x00, 0x00, 0x00, 0x3c, 0x00,
+ 0x00, 0x00, 0x01, 0x00, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0xc4, 0x0e, 0x00, 0x00, 0xc4, 0x0e, 0x00, 0x00, 0x00, 0x01,
+ 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0xc1, 0x79, 0x00, 0xff, 0xc1, 0x7a,
+ 0x01, 0xff, 0xc2, 0x7a, 0x02, 0xff, 0xc2, 0x7b, 0x04, 0xff, 0xc2, 0x7c,
+ 0x05, 0xff, 0xc3, 0x7c, 0x06, 0xff, 0xc3, 0x7d, 0x08, 0xff, 0xc3, 0x7e,
+ 0x09, 0xff, 0xc4, 0x7e, 0x0a, 0xff, 0xc4, 0x7f, 0x0c, 0xff, 0xc4, 0x80,
+ 0x0d, 0xff, 0xc5, 0x81, 0x0f, 0xff, 0xc5, 0x81, 0x10, 0xff, 0xc5, 0x82,
+ 0x11, 0xff, 0xc6, 0x82, 0x12, 0xff, 0xc6, 0x83, 0x14, 0xff, 0xc6, 0x84,
+ 0x15, 0xff, 0xc7, 0x85, 0x17, 0xff, 0xc7, 0x85, 0x18, 0xff, 0xc7, 0x86,
+ 0x1a, 0xff, 0xc8, 0x87, 0x1b, 0xff, 0xc8, 0x87, 0x1c, 0xff, 0xc8, 0x88,
+ 0x1d, 0xff, 0xc9, 0x89, 0x1f, 0xff, 0xc9, 0x8a, 0x1f, 0xff, 0xc8, 0x89,
+ 0x20, 0xff, 0xc9, 0x8a, 0x21, 0xff, 0xca, 0x8b, 0x23, 0xff, 0xca, 0x8c,
+ 0x23, 0xff, 0xc9, 0x8c, 0x24, 0xff, 0xca, 0x8c, 0x25, 0xff, 0xca, 0x8e,
+ 0x28, 0xff, 0xcb, 0x8e, 0x29, 0xff, 0xcb, 0x90, 0x2b, 0xff, 0xcc, 0x90,
+ 0x2b, 0xff, 0xcb, 0x90, 0x2c, 0xff, 0xcc, 0x90, 0x2e, 0xff, 0xcc, 0x91,
+ 0x30, 0xff, 0xcc, 0x92, 0x30, 0xff, 0xcd, 0x92, 0x31, 0xff, 0xcd, 0x94,
+ 0x33, 0xff, 0xcd, 0x93, 0x34, 0xff, 0xcd, 0x94, 0x34, 0xff, 0xce, 0x94,
+ 0x35, 0xff, 0xce, 0x96, 0x37, 0xff, 0xce, 0x96, 0x38, 0xff, 0xcf, 0x97,
+ 0x39, 0xff, 0xcf, 0x98, 0x3d, 0xff, 0xd0, 0x99, 0x3d, 0xff, 0xd0, 0x9a,
+ 0x40, 0xff, 0xd1, 0x9b, 0x41, 0xff, 0xd1, 0x9c, 0x42, 0xff, 0xd1, 0x9c,
+ 0x44, 0xff, 0xd2, 0x9d, 0x46, 0xff, 0xd2, 0x9e, 0x47, 0xff, 0xd2, 0x9e,
+ 0x48, 0xff, 0xd3, 0x9f, 0x49, 0xff, 0xd3, 0xa0, 0x4a, 0xff, 0xd3, 0xa0,
+ 0x4c, 0xff, 0xd4, 0xa2, 0x4e, 0xff, 0xd4, 0xa2, 0x50, 0xff, 0xd5, 0xa4,
+ 0x52, 0xff, 0xd5, 0xa4, 0x55, 0xff, 0xd5, 0xa6, 0x56, 0xff, 0xd6, 0xa6,
+ 0x57, 0xff, 0xd6, 0xa6, 0x58, 0xff, 0xd7, 0xa8, 0x5a, 0xff, 0xd7, 0xa8,
+ 0x5c, 0xff, 0xd7, 0xaa, 0x5d, 0xff, 0xd8, 0xaa, 0x5e, 0xff, 0xd8, 0xab,
+ 0x60, 0xff, 0xd8, 0xac, 0x61, 0xff, 0xd9, 0xad, 0x63, 0xff, 0xd9, 0xad,
+ 0x64, 0xff, 0xd9, 0xae, 0x65, 0xff, 0xda, 0xae, 0x66, 0xff, 0xda, 0xaf,
+ 0x68, 0xff, 0xda, 0xb0, 0x69, 0xff, 0xdb, 0xb0, 0x6b, 0xff, 0xdb, 0xb1,
+ 0x6c, 0xff, 0xdb, 0xb2, 0x6d, 0xff, 0xdc, 0xb3, 0x6f, 0xff, 0xdc, 0xb3,
+ 0x70, 0xff, 0xdc, 0xb4, 0x71, 0xff, 0xdd, 0xb5, 0x73, 0xff, 0xdd, 0xb5,
+ 0x74, 0xff, 0xdd, 0xb6, 0x75, 0xff, 0xde, 0xb7, 0x77, 0xff, 0xde, 0xb7,
+ 0x78, 0xff, 0xde, 0xb8, 0x79, 0xff, 0xdf, 0xb9, 0x7a, 0xff, 0xdf, 0xb9,
+ 0x7c, 0xff, 0xdf, 0xba, 0x7d, 0xff, 0xe0, 0xbb, 0x7f, 0xff, 0xdf, 0xbb,
+ 0x80, 0xff, 0xe0, 0xbc, 0x81, 0xff, 0xe1, 0xbd, 0x83, 0xff, 0xe1, 0xbe,
+ 0x83, 0xff, 0xe0, 0xbe, 0x84, 0xff, 0xe1, 0xbe, 0x84, 0xff, 0xe1, 0xc0,
+ 0x87, 0xff, 0xe2, 0xc0, 0x87, 0xff, 0xe1, 0xc0, 0x88, 0xff, 0xe2, 0xc0,
+ 0x89, 0xff, 0xe3, 0xc2, 0x8b, 0xff, 0xe2, 0xc2, 0x8c, 0xff, 0xe3, 0xc2,
+ 0x8c, 0xff, 0xe3, 0xc3, 0x90, 0xff, 0xe3, 0xc4, 0x90, 0xff, 0xe4, 0xc4,
+ 0x90, 0xff, 0xe4, 0xc6, 0x93, 0xff, 0xe5, 0xc6, 0x93, 0xff, 0xe4, 0xc6,
+ 0x94, 0xff, 0xe5, 0xc6, 0x94, 0xff, 0xe5, 0xc8, 0x97, 0xff, 0xe5, 0xc8,
+ 0x98, 0xff, 0xe6, 0xc8, 0x98, 0xff, 0xe6, 0xca, 0x9a, 0xff, 0xe6, 0xcb,
+ 0x9c, 0xff, 0xe7, 0xcb, 0x9d, 0xff, 0xe7, 0xcc, 0xa0, 0xff, 0xe8, 0xcd,
+ 0xa1, 0xff, 0xe8, 0xce, 0xa2, 0xff, 0xe8, 0xcf, 0xa4, 0xff, 0xe9, 0xcf,
+ 0xa5, 0xff, 0xe9, 0xd0, 0xa6, 0xff, 0xe9, 0xd1, 0xa8, 0xff, 0xea, 0xd1,
+ 0xa9, 0xff, 0xea, 0xd2, 0xaa, 0xff, 0xea, 0xd3, 0xac, 0xff, 0xeb, 0xd3,
+ 0xae, 0xff, 0xeb, 0xd4, 0xae, 0xff, 0xeb, 0xd5, 0xb0, 0xff, 0xeb, 0xd6,
+ 0xb0, 0xff, 0xec, 0xd5, 0xb1, 0xff, 0xec, 0xd6, 0xb1, 0xff, 0xec, 0xd7,
+ 0xb4, 0xff, 0xec, 0xd8, 0xb5, 0xff, 0xed, 0xd8, 0xb6, 0xff, 0xed, 0xd9,
+ 0xb8, 0xff, 0xed, 0xda, 0xb9, 0xff, 0xee, 0xda, 0xba, 0xff, 0xee, 0xdb,
+ 0xbc, 0xff, 0xee, 0xdc, 0xbc, 0xff, 0xef, 0xdc, 0xbe, 0xff, 0xef, 0xdd,
+ 0xc0, 0xff, 0xef, 0xde, 0xc0, 0xff, 0xf0, 0xde, 0xc2, 0xff, 0xf0, 0xe0,
+ 0xc5, 0xff, 0xf1, 0xe0, 0xc6, 0xff, 0xf1, 0xe1, 0xc8, 0xff, 0xf1, 0xe2,
+ 0xc8, 0xff, 0xf2, 0xe3, 0xca, 0xff, 0xf2, 0xe4, 0xcd, 0xff, 0xf3, 0xe5,
+ 0xce, 0xff, 0xf3, 0xe6, 0xd1, 0xff, 0xf4, 0xe7, 0xd3, 0xff, 0xf4, 0xe8,
+ 0xd3, 0xff, 0xf4, 0xe8, 0xd4, 0xff, 0xf5, 0xea, 0xd7, 0xff, 0xf5, 0xea,
+ 0xd9, 0xff, 0xf6, 0xeb, 0xdb, 0xff, 0xf6, 0xec, 0xdb, 0xff, 0xf6, 0xec,
+ 0xdd, 0xff, 0xf6, 0xee, 0xdf, 0xff, 0xf7, 0xee, 0xdf, 0xff, 0xf7, 0xee,
+ 0xe1, 0xff, 0xf8, 0xf0, 0xe3, 0xff, 0xf8, 0xf0, 0xe4, 0xff, 0xf8, 0xf2,
+ 0xe6, 0xff, 0xf9, 0xf2, 0xe6, 0xff, 0xf9, 0xf2, 0xe8, 0xff, 0xf9, 0xf4,
+ 0xea, 0xff, 0xfa, 0xf4, 0xeb, 0xff, 0xfa, 0xf4, 0xec, 0xff, 0xfa, 0xf6,
+ 0xee, 0xff, 0xfb, 0xf6, 0xef, 0xff, 0xfb, 0xf7, 0xf0, 0xff, 0xfb, 0xf8,
+ 0xf2, 0xff, 0xfc, 0xf9, 0xf4, 0xff, 0xfc, 0xfa, 0xf6, 0xff, 0xfc, 0xfa,
+ 0xf8, 0xff, 0xfd, 0xfb, 0xf8, 0xff, 0xfd, 0xfc, 0xfa, 0xff, 0xfd, 0xfd,
+ 0xfc, 0xff, 0xfe, 0xfd, 0xfc, 0xff, 0xfe, 0xfe, 0xfd, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00,
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0xa6, 0xa3,
+ 0xa3, 0xa3, 0xa3, 0xa3, 0xa3, 0xa3, 0xa3, 0xa4, 0xb0, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xb6, 0xa6, 0xa3, 0xa3, 0xa3, 0xa3, 0xa3, 0xa3, 0xa3, 0xab, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb3,
+ 0xa8, 0x9e, 0x9d, 0x9d, 0x9d, 0x9d, 0x9e, 0xb6, 0xba, 0xba, 0xba, 0xba,
+ 0xb8, 0xa8, 0xa3, 0xa3, 0xa3, 0xa3, 0xa3, 0xa3, 0xa3, 0xa3, 0xb7, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xaf, 0xa3, 0xa3, 0xa3, 0xa3, 0xa3, 0xa3, 0xa3,
+ 0xa3, 0xae, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb4, 0xa6, 0xa3, 0xa3, 0xa3,
+ 0xa3, 0xa3, 0xa3, 0xa3, 0xa6, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xae, 0x97, 0x7a, 0x59, 0x3a, 0x27, 0x15, 0x0e, 0x0e, 0x0e, 0x19, 0x2b,
+ 0x3f, 0x5c, 0x80, 0x99, 0xb1, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xb9, 0xaf, 0xa3, 0x9e, 0x9d, 0x9d, 0x9d, 0x9d, 0x9d, 0x66, 0x2a,
+ 0x27, 0x27, 0x27, 0x27, 0x27, 0x27, 0x27, 0x27, 0x4f, 0xae, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xa1, 0x37, 0x27, 0x27, 0x27, 0x27, 0x27, 0x27, 0x27, 0x5a, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb9, 0xb4, 0x90, 0x5b, 0x39,
+ 0x2d, 0x20, 0x20, 0x20, 0x20, 0x20, 0x24, 0xa7, 0xba, 0xba, 0xba, 0xba,
+ 0xb1, 0x44, 0x27, 0x27, 0x27, 0x27, 0x27, 0x27, 0x27, 0x2c, 0xa8, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0x7a, 0x27, 0x27, 0x27, 0x27, 0x27, 0x27, 0x27,
+ 0x27, 0x74, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x9a, 0x36, 0x27, 0x27, 0x27,
+ 0x27, 0x27, 0x27, 0x27, 0x40, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb9, 0xa6, 0x6d,
+ 0x31, 0x16, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x05, 0x1a, 0x37, 0x71, 0xa9, 0xb9, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb7, 0xab,
+ 0x7a, 0x4a, 0x33, 0x27, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0xa8, 0x3c,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x4f, 0xb3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xb7, 0x9e, 0x5d, 0x1a, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x98, 0x53, 0x08, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0c, 0x52, 0x99, 0xb9, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x8a, 0x41, 0x09,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xba, 0xa0,
+ 0x1a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0a, 0x71, 0xb6,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xb2, 0x6a, 0x20, 0x02, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb1, 0x74, 0x1b, 0x02, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x1c, 0x6e, 0xb1, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb9, 0xa0, 0x46, 0x10, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xba, 0xba,
+ 0x92, 0x1a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0a, 0x7c,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0x94, 0x31, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xa3, 0x3a, 0x02, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x35, 0x9e,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xb3, 0x72, 0x12, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xba, 0xba,
+ 0xb7, 0x7e, 0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1e,
+ 0x94, 0xb9, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xb7, 0x8a, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0x9c, 0x35, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x2f,
+ 0x97, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xb1, 0x5c, 0x0c, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xba, 0xba,
+ 0xba, 0xb7, 0x65, 0x09, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x26, 0x9e, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0x7e, 0x0f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xa0, 0x27, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x16, 0x99, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xaf, 0x4d, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xba, 0xba,
+ 0xba, 0xba, 0xaf, 0x4d, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x3b, 0xab, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb9,
+ 0x92, 0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xa8, 0x3d, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x07, 0x0f, 0x27, 0x3e, 0x4d, 0x4d, 0x3c, 0x20,
+ 0x0c, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x34, 0xa3, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xb4, 0x5f, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb1, 0x3a, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x03, 0x46, 0xb1, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xa3,
+ 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xb9, 0x53, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x13, 0x42, 0x80, 0xa8, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb7,
+ 0x9e, 0x6a, 0x31, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x01, 0x42, 0xb8, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0x7e, 0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0x9e, 0x2d, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x06, 0x63, 0xb6, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb7, 0x52,
+ 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08,
+ 0x11, 0x2b, 0x39, 0x3b, 0x3b, 0x3b, 0x3d, 0xab, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0x8f, 0x0d, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x07, 0x3a, 0x97, 0xb2, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xb9, 0xa8, 0x72, 0x1e, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x05, 0x8d, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xa0, 0x27, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x02, 0x0d, 0x16, 0x31, 0x3b, 0x3b, 0x3b, 0x3b, 0x3b, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0x98, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x0b, 0x75, 0xb7, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x8d, 0x10,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x09, 0x3c, 0x80,
+ 0xaa, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xac, 0x39, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0a,
+ 0x73, 0xb2, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0x9e, 0x34, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x37, 0xac, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xb6, 0x53, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x1a, 0x54, 0x94, 0xb3, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xb8, 0x7d, 0x13, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x13, 0x8f, 0xb9, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x43, 0x01,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x17, 0x7d, 0xae, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x84, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x75,
+ 0xb7, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0x9f, 0x35, 0x09, 0x08, 0x08, 0x08, 0x08,
+ 0x08, 0x08, 0x08, 0x16, 0x90, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xa0, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x3a,
+ 0x99, 0xb5, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb8, 0x70, 0x05, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x99, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x9b, 0x0a, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0x95, 0xb9, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb7,
+ 0x37, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x6e, 0xb6,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xa2, 0x7d, 0x7b, 0x7b, 0x7b, 0x7b,
+ 0x7b, 0x7b, 0x7b, 0x7b, 0xa0, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x5c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x4b, 0xad,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x53, 0x05, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x30, 0xa6, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x5f, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0d, 0x8e, 0xb9, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x9a,
+ 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x32, 0xb4, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xab,
+ 0x2b, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x36, 0xa8, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xae, 0x41, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x43, 0xad, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb4, 0x30, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x03, 0x56, 0xb6, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb9, 0x67,
+ 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0c, 0x84, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x8e,
+ 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x90, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xa3, 0x30, 0x01,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x06, 0x55, 0xb3, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x9e, 0x1a, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x1a, 0x9b, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0xaf, 0x3d,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x2f, 0xa9, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6e,
+ 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x41, 0xb7, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x98, 0x1e,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x72, 0xb7, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x8a, 0x0e, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x3d, 0xb7, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0xa3, 0x20,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x50, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb6, 0x50,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x83, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb9, 0x8a,
+ 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x13, 0x7d, 0xb9,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x79, 0x07, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x6a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0x97, 0x07,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x74, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb4, 0x3d,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0d, 0xa0, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb6,
+ 0x74, 0x0a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x16, 0x95,
+ 0xaf, 0xaf, 0xaf, 0xaf, 0xaf, 0xaf, 0xaf, 0xaf, 0xaf, 0xaf, 0xaf, 0xaf,
+ 0xaf, 0xaf, 0xaf, 0xaf, 0xb1, 0xb8, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x71, 0x03, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x83, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0x80, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x83, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x33,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xb6, 0x5c, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0d,
+ 0x13, 0x13, 0x13, 0x13, 0x13, 0x13, 0x13, 0x13, 0x13, 0x13, 0x13, 0x13,
+ 0x13, 0x13, 0x13, 0x13, 0x28, 0xa6, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0x67, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x16, 0x24, 0x24, 0x24,
+ 0x24, 0x24, 0x24, 0x24, 0x24, 0x24, 0x24, 0x24, 0x24, 0x24, 0x24, 0x24,
+ 0x24, 0x24, 0x24, 0x24, 0x24, 0x24, 0x24, 0x24, 0x24, 0x24, 0x24, 0x24,
+ 0x24, 0x24, 0x24, 0x24, 0x24, 0x4d, 0xb2, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xae, 0x43, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x13, 0xa3, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0x55, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x39, 0xb1, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xaa, 0x35, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x13, 0xa3, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0x48, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x39, 0xb1, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0x99, 0x21, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x13, 0xa3, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0x47, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x39, 0xb1, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x91, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x13, 0xa3, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0x47, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x39, 0xb2, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0x75, 0x0a, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x13, 0xa3, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0x4e, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x3d, 0xb4, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xb4, 0x69, 0x07, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x13, 0xa3, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0xa3, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0x68, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x93, 0x14, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0x60, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x47, 0xb9, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x46, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x13, 0xa3, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xaf, 0x2d, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xa0, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb8, 0x5f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x5c, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x92, 0x13, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba, 0x7a, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x5b, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xa9, 0x3e, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x11, 0x6d, 0x77, 0x77, 0x77, 0x77,
+ 0x77, 0x77, 0x77, 0x77, 0x7d, 0xb1, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xb2, 0x38, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x8c, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb6, 0x47, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x44, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x83, 0x08, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x2f, 0xba, 0xba, 0xba, 0xba, 0xba, 0x97, 0x06,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x53, 0xa8, 0xa8, 0xa8,
+ 0xa8, 0xa8, 0xa8, 0xa8, 0xa8, 0xa8, 0xa8, 0xa8, 0xa8, 0xa8, 0xa8, 0xa8,
+ 0xa8, 0xa8, 0xa8, 0xa8, 0xa8, 0xa8, 0xa8, 0x91, 0x16, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x01, 0x7d, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xa0, 0x1e, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x63, 0xb4, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xb3, 0x43, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x63, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb2, 0x27, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x27, 0xb3, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb9, 0x62, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x3d, 0xba, 0xba, 0xba, 0xba, 0xba, 0xa3, 0x1f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x39, 0xb1, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x8a, 0x04, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x01, 0x9b, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x97, 0x1e, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x07, 0x67, 0xb9, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xb8, 0x5f, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x2b, 0xad,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0x93, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x0d, 0x85, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x22, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x5f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x43,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x8d, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x46, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x15, 0xb9, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb7, 0x80, 0x07,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x8d, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0x7d, 0x09, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0a, 0x7a,
+ 0xb9, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xb3, 0x43, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x01, 0x44, 0xb2, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x83, 0x01, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x87, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6e,
+ 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x4a, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xa6, 0x16, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x44, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6d,
+ 0x0a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1a, 0x90, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xa0, 0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1d,
+ 0x9e, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xb8, 0x6c, 0x09, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x02, 0x75, 0xb9, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0x99, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x1e, 0xa3, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xa6,
+ 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x8f, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xb3, 0x51, 0x02, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x08, 0x87, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb1,
+ 0x50, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x2b, 0xa8,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xb7, 0x3e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x3b, 0xa6, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xb9, 0x90, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x18, 0x89, 0xb7, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xae, 0x31, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x44, 0xb2, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x4a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x2f, 0x9f,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0x8b, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x2b, 0xa6, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xb5, 0x3b, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x39,
+ 0xa7, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0x8e, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x27, 0x90, 0xb6, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xae,
+ 0x67, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x0c, 0x6d, 0xad, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xb7, 0x88, 0x2d, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x0a, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x99, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x2a,
+ 0xa0, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb7, 0x93, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x6f, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0x9e, 0x2e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04,
+ 0x4d, 0xb6, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xb2, 0xb2, 0xb2, 0xb2, 0x67, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x82, 0xb2, 0xb2, 0xb2, 0xb2, 0xb2, 0xb2,
+ 0xb2, 0xb2, 0xb2, 0xb2, 0xb2, 0xb2, 0xb2, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xae, 0x34, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x16, 0x4c, 0x98, 0xb1, 0xb4, 0xb4, 0xb3, 0xae, 0x78, 0x37,
+ 0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x35, 0x80, 0xab, 0xb3, 0xb4, 0xb3,
+ 0xb2, 0x92, 0x4f, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x31, 0xb3, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xb4, 0x56, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x2e, 0x8b, 0xb6, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xb5, 0x80, 0x1e, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x17, 0xae, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0x9f, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x05, 0x5f, 0xb3, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb1, 0x23, 0x0d, 0x0d, 0x0d, 0x07, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x0a, 0x0d, 0x0d, 0x0d, 0x0d, 0x0d, 0x0d,
+ 0x0d, 0x0d, 0x0d, 0x0d, 0x0d, 0x0d, 0x24, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0x8b, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x01, 0x13, 0x2f, 0x34, 0x26, 0x0a, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0a, 0x27, 0x33, 0x2e,
+ 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x0d, 0x8e, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xab, 0x27, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x04, 0x45, 0x83, 0xa8, 0xb9, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb9,
+ 0xa8, 0x83, 0x3d, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x0a, 0x78, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0x7e, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x0d, 0x7c, 0xb9, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb1, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x16, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb4, 0x4e, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x03, 0x52, 0xb3, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0x86, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x0d, 0x28, 0x40, 0x5f, 0x71, 0x7c, 0x72, 0x5f, 0x41,
+ 0x27, 0x0d, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x43, 0xaf, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb7, 0x79, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x10, 0x8e, 0xb9, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb1, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x16, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xaa, 0x31, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x02, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x32, 0xae, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xb7, 0x77, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x27, 0xa9, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xb6, 0x53, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x01, 0x26, 0x9b, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb1, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x16, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xb9, 0x98, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x07, 0x56, 0x48, 0x03, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x2b,
+ 0x98, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb4, 0x5f, 0x0a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x23,
+ 0x92, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xae, 0x49, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x30, 0xa6, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb1, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x16, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x97, 0x26, 0x01, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x07, 0x56, 0xb4, 0xb1, 0x4c, 0x06,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x2b, 0x9e,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xb4, 0x73, 0x0c, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0x98,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xa8, 0x2e, 0x01, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x03, 0x46, 0xac, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb1, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x16, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb8, 0x9b, 0x33, 0x04, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x6a, 0xb1, 0xba, 0xba, 0xaf, 0x5c,
+ 0x0b, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, 0x3b, 0x9b, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xb7, 0x7f, 0x24, 0x01, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x39, 0x99, 0xb9,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x9a, 0x25, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x57, 0xb4, 0xba, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb1, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x16, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xac, 0x5e, 0x13, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x02, 0x32, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb6,
+ 0x84, 0x2d, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x16, 0x5f, 0xb2, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xa5, 0x4a, 0x0d, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x16, 0x5f, 0xb1, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb9, 0x90, 0x10, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0b, 0x71, 0xb6, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb1, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x16, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb4, 0x95, 0x43,
+ 0x12, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x07, 0x21, 0x67, 0xa9, 0xb9, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xb9, 0xa3, 0x67, 0x1e, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x03, 0x14, 0x47, 0x9b, 0xb5, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x94, 0x3c, 0x13,
+ 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x04, 0x16, 0x4b, 0x9b, 0xb6, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb8, 0x76, 0x0d, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0x83, 0xba, 0xba, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb2, 0x3b, 0x2e, 0x2e, 0x2e, 0x1a, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x2e, 0x2e, 0x2e, 0x2e, 0x2e, 0x2e,
+ 0x2e, 0x2e, 0x2e, 0x2e, 0x2e, 0x2e, 0x3c, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb9,
+ 0x98, 0x63, 0x35, 0x13, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x06, 0x1e,
+ 0x44, 0x75, 0xab, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xa7, 0x75, 0x41, 0x1e, 0x04, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x02, 0x12, 0x3a, 0x5f, 0x9e, 0xb7, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb7, 0x9a,
+ 0x5f, 0x38, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x01, 0x12, 0x3a, 0x67, 0x9e, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb4, 0x61, 0x04,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x94, 0xb9, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb9, 0xab, 0xa9, 0xa9, 0xa9, 0x5f, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x7b, 0xa9, 0xa9, 0xa9, 0xa9, 0xa9, 0xa9,
+ 0xa9, 0xa9, 0xa9, 0xa9, 0xa9, 0xa9, 0xab, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xb8, 0xac, 0xa2, 0x93, 0x7d, 0x6d, 0x6c, 0x74, 0x83, 0x9b, 0xa6,
+ 0xb2, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xb1, 0xa6, 0x99, 0x83, 0x72, 0x6c, 0x6e,
+ 0x7c, 0x94, 0xa0, 0xae, 0xb7, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xb7, 0xae, 0xa0, 0x8b, 0x67, 0x4e, 0x3d, 0x37, 0x37, 0x37, 0x3d, 0x4e,
+ 0x6a, 0x8d, 0xa0, 0xae, 0xb9, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb3, 0x45,
+ 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x2b, 0xa3, 0xba,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xa8,
+ 0x3a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x3c, 0xa9,
+ 0x9b, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xa0, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x4c,
+ 0x96, 0x13, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xb9, 0x90, 0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05,
+ 0x44, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0x7d, 0x09, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x01, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xb5, 0x69, 0x0a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xb2, 0x50, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xab, 0x3e, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xb7, 0x9e, 0x58, 0x40, 0x44, 0x6a, 0xab, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xa0, 0x29, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0x99, 0x37, 0x74, 0x98, 0x92, 0x59, 0x49, 0xab, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x99, 0x1e, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0x44, 0x7d, 0x85, 0x9e, 0x94, 0x7d, 0x55, 0x71, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb7, 0x81, 0x0d, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xaf, 0x36, 0xa8, 0x62, 0x5f, 0x41, 0x95, 0x8d, 0x49, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb9, 0x72, 0x0a, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xae, 0x38, 0xac, 0x64, 0x71, 0x5c, 0x78, 0x90, 0x48, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x52, 0x03, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xb9, 0x3e, 0x8e, 0x6b, 0x50, 0x53, 0x90, 0x65, 0x63, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb3, 0x43, 0x02,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0x8f, 0x37, 0x88, 0xa3, 0x9e, 0x74, 0x3d, 0xa3, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xa0, 0x2e,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x42, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0x6c, 0x01, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xba, 0xb2, 0x2f,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x24, 0xa8, 0xba, 0xba, 0xba,
+ 0xba, 0xba, 0xb6, 0x8f, 0x3f, 0x31, 0x34, 0x4c, 0xa0, 0xba
+};
+#endif
--- /dev/null
+/*
+ * Copyright (C) 2017 Microchip
+ * Wenyou.Yang <wenyou.yang@microchip.com>
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#ifndef __MICROCHIP_LOGO_8BPP_H__
+#define __MICROCHIP_LOGO_8BPP_H__
+
+#define MICROCHIP_LOGO_8BPP_WIDTH 208
+#define MICROCHIP_LOGO_8BPP_HEIGHT 56
+
+#define MICROCHIP_LOGO_8BPP_X_OFFSET 0
+#define MCIROCHIP_LOGO_8BPP_Y_OFFSET 0
+
+/* Format: BMP 8BPP 240*60 */
+unsigned char microchip_logo_8bpp[] = {
+ 0x42, 0x4d, 0xb6, 0x31, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x36, 0x04,
+ 0x00, 0x00, 0x28, 0x00, 0x00, 0x00, 0xd0, 0x00, 0x00, 0x00, 0x38, 0x00,
+ 0x00, 0x00, 0x01, 0x00, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x2d,
+ 0x00, 0x00, 0x74, 0x12, 0x00, 0x00, 0x74, 0x12, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x80, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x80, 0x80, 0x00, 0x80, 0x00,
+ 0x00, 0x00, 0x80, 0x00, 0x80, 0x00, 0x80, 0x80, 0x00, 0x00, 0xc0, 0xc0,
+ 0xc0, 0x00, 0xc0, 0xdc, 0xc0, 0x00, 0xf0, 0xca, 0xa6, 0x00, 0x00, 0x20,
+ 0x40, 0x00, 0x00, 0x20, 0x60, 0x00, 0x00, 0x20, 0x80, 0x00, 0x00, 0x20,
+ 0xa0, 0x00, 0x00, 0x20, 0xc0, 0x00, 0x00, 0x20, 0xe0, 0x00, 0x00, 0x40,
+ 0x00, 0x00, 0x00, 0x40, 0x20, 0x00, 0x00, 0x40, 0x40, 0x00, 0x00, 0x40,
+ 0x60, 0x00, 0x00, 0x40, 0x80, 0x00, 0x00, 0x40, 0xa0, 0x00, 0x00, 0x40,
+ 0xc0, 0x00, 0x00, 0x40, 0xe0, 0x00, 0x00, 0x60, 0x00, 0x00, 0x00, 0x60,
+ 0x20, 0x00, 0x00, 0x60, 0x40, 0x00, 0x00, 0x60, 0x60, 0x00, 0x00, 0x60,
+ 0x80, 0x00, 0x00, 0x60, 0xa0, 0x00, 0x00, 0x60, 0xc0, 0x00, 0x00, 0x60,
+ 0xe0, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x80, 0x20, 0x00, 0x00, 0x80,
+ 0x40, 0x00, 0x00, 0x80, 0x60, 0x00, 0x00, 0x80, 0x80, 0x00, 0x00, 0x80,
+ 0xa0, 0x00, 0x00, 0x80, 0xc0, 0x00, 0x00, 0x80, 0xe0, 0x00, 0x00, 0xa0,
+ 0x00, 0x00, 0x00, 0xa0, 0x20, 0x00, 0x00, 0xa0, 0x40, 0x00, 0x00, 0xa0,
+ 0x60, 0x00, 0x00, 0xa0, 0x80, 0x00, 0x00, 0xa0, 0xa0, 0x00, 0x00, 0xa0,
+ 0xc0, 0x00, 0x00, 0xa0, 0xe0, 0x00, 0x00, 0xc0, 0x00, 0x00, 0x00, 0xc0,
+ 0x20, 0x00, 0x00, 0xc0, 0x40, 0x00, 0x00, 0xc0, 0x60, 0x00, 0x00, 0xc0,
+ 0x80, 0x00, 0x00, 0xc0, 0xa0, 0x00, 0x00, 0xc0, 0xc0, 0x00, 0x00, 0xc0,
+ 0xe0, 0x00, 0x00, 0xe0, 0x00, 0x00, 0x00, 0xe0, 0x20, 0x00, 0x00, 0xe0,
+ 0x40, 0x00, 0x00, 0xe0, 0x60, 0x00, 0x00, 0xe0, 0x80, 0x00, 0x00, 0xe0,
+ 0xa0, 0x00, 0x00, 0xe0, 0xc0, 0x00, 0x00, 0xe0, 0xe0, 0x00, 0x40, 0x00,
+ 0x00, 0x00, 0x40, 0x00, 0x20, 0x00, 0x40, 0x00, 0x40, 0x00, 0x40, 0x00,
+ 0x60, 0x00, 0x40, 0x00, 0x80, 0x00, 0x40, 0x00, 0xa0, 0x00, 0x40, 0x00,
+ 0xc0, 0x00, 0x40, 0x00, 0xe0, 0x00, 0x40, 0x20, 0x00, 0x00, 0x40, 0x20,
+ 0x20, 0x00, 0x40, 0x20, 0x40, 0x00, 0x40, 0x20, 0x60, 0x00, 0x40, 0x20,
+ 0x80, 0x00, 0x40, 0x20, 0xa0, 0x00, 0x40, 0x20, 0xc0, 0x00, 0x40, 0x20,
+ 0xe0, 0x00, 0x40, 0x40, 0x00, 0x00, 0x40, 0x40, 0x20, 0x00, 0x40, 0x40,
+ 0x40, 0x00, 0x40, 0x40, 0x60, 0x00, 0x40, 0x40, 0x80, 0x00, 0x40, 0x40,
+ 0xa0, 0x00, 0x40, 0x40, 0xc0, 0x00, 0x40, 0x40, 0xe0, 0x00, 0x40, 0x60,
+ 0x00, 0x00, 0x40, 0x60, 0x20, 0x00, 0x40, 0x60, 0x40, 0x00, 0x40, 0x60,
+ 0x60, 0x00, 0x40, 0x60, 0x80, 0x00, 0x40, 0x60, 0xa0, 0x00, 0x40, 0x60,
+ 0xc0, 0x00, 0x40, 0x60, 0xe0, 0x00, 0x40, 0x80, 0x00, 0x00, 0x40, 0x80,
+ 0x20, 0x00, 0x40, 0x80, 0x40, 0x00, 0x40, 0x80, 0x60, 0x00, 0x40, 0x80,
+ 0x80, 0x00, 0x40, 0x80, 0xa0, 0x00, 0x40, 0x80, 0xc0, 0x00, 0x40, 0x80,
+ 0xe0, 0x00, 0x40, 0xa0, 0x00, 0x00, 0x40, 0xa0, 0x20, 0x00, 0x40, 0xa0,
+ 0x40, 0x00, 0x40, 0xa0, 0x60, 0x00, 0x40, 0xa0, 0x80, 0x00, 0x40, 0xa0,
+ 0xa0, 0x00, 0x40, 0xa0, 0xc0, 0x00, 0x40, 0xa0, 0xe0, 0x00, 0x40, 0xc0,
+ 0x00, 0x00, 0x40, 0xc0, 0x20, 0x00, 0x40, 0xc0, 0x40, 0x00, 0x40, 0xc0,
+ 0x60, 0x00, 0x40, 0xc0, 0x80, 0x00, 0x40, 0xc0, 0xa0, 0x00, 0x40, 0xc0,
+ 0xc0, 0x00, 0x40, 0xc0, 0xe0, 0x00, 0x40, 0xe0, 0x00, 0x00, 0x40, 0xe0,
+ 0x20, 0x00, 0x40, 0xe0, 0x40, 0x00, 0x40, 0xe0, 0x60, 0x00, 0x40, 0xe0,
+ 0x80, 0x00, 0x40, 0xe0, 0xa0, 0x00, 0x40, 0xe0, 0xc0, 0x00, 0x40, 0xe0,
+ 0xe0, 0x00, 0x80, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x00, 0x80, 0x00,
+ 0x40, 0x00, 0x80, 0x00, 0x60, 0x00, 0x80, 0x00, 0x80, 0x00, 0x80, 0x00,
+ 0xa0, 0x00, 0x80, 0x00, 0xc0, 0x00, 0x80, 0x00, 0xe0, 0x00, 0x80, 0x20,
+ 0x00, 0x00, 0x80, 0x20, 0x20, 0x00, 0x80, 0x20, 0x40, 0x00, 0x80, 0x20,
+ 0x60, 0x00, 0x80, 0x20, 0x80, 0x00, 0x80, 0x20, 0xa0, 0x00, 0x80, 0x20,
+ 0xc0, 0x00, 0x80, 0x20, 0xe0, 0x00, 0x80, 0x40, 0x00, 0x00, 0x80, 0x40,
+ 0x20, 0x00, 0x80, 0x40, 0x40, 0x00, 0x80, 0x40, 0x60, 0x00, 0x80, 0x40,
+ 0x80, 0x00, 0x80, 0x40, 0xa0, 0x00, 0x80, 0x40, 0xc0, 0x00, 0x80, 0x40,
+ 0xe0, 0x00, 0x80, 0x60, 0x00, 0x00, 0x80, 0x60, 0x20, 0x00, 0x80, 0x60,
+ 0x40, 0x00, 0x80, 0x60, 0x60, 0x00, 0x80, 0x60, 0x80, 0x00, 0x80, 0x60,
+ 0xa0, 0x00, 0x80, 0x60, 0xc0, 0x00, 0x80, 0x60, 0xe0, 0x00, 0x80, 0x80,
+ 0x00, 0x00, 0x80, 0x80, 0x20, 0x00, 0x80, 0x80, 0x40, 0x00, 0x80, 0x80,
+ 0x60, 0x00, 0x80, 0x80, 0x80, 0x00, 0x80, 0x80, 0xa0, 0x00, 0x80, 0x80,
+ 0xc0, 0x00, 0x80, 0x80, 0xe0, 0x00, 0x80, 0xa0, 0x00, 0x00, 0x80, 0xa0,
+ 0x20, 0x00, 0x80, 0xa0, 0x40, 0x00, 0x80, 0xa0, 0x60, 0x00, 0x80, 0xa0,
+ 0x80, 0x00, 0x80, 0xa0, 0xa0, 0x00, 0x80, 0xa0, 0xc0, 0x00, 0x80, 0xa0,
+ 0xe0, 0x00, 0x80, 0xc0, 0x00, 0x00, 0x80, 0xc0, 0x20, 0x00, 0x80, 0xc0,
+ 0x40, 0x00, 0x80, 0xc0, 0x60, 0x00, 0x80, 0xc0, 0x80, 0x00, 0x80, 0xc0,
+ 0xa0, 0x00, 0x80, 0xc0, 0xc0, 0x00, 0x80, 0xc0, 0xe0, 0x00, 0x80, 0xe0,
+ 0x00, 0x00, 0x80, 0xe0, 0x20, 0x00, 0x80, 0xe0, 0x40, 0x00, 0x80, 0xe0,
+ 0x60, 0x00, 0x80, 0xe0, 0x80, 0x00, 0x80, 0xe0, 0xa0, 0x00, 0x80, 0xe0,
+ 0xc0, 0x00, 0x80, 0xe0, 0xe0, 0x00, 0xc0, 0x00, 0x00, 0x00, 0xc0, 0x00,
+ 0x20, 0x00, 0xc0, 0x00, 0x40, 0x00, 0xc0, 0x00, 0x60, 0x00, 0xc0, 0x00,
+ 0x80, 0x00, 0xc0, 0x00, 0xa0, 0x00, 0xc0, 0x00, 0xc0, 0x00, 0xc0, 0x00,
+ 0xe0, 0x00, 0xc0, 0x20, 0x00, 0x00, 0xc0, 0x20, 0x20, 0x00, 0xc0, 0x20,
+ 0x40, 0x00, 0xc0, 0x20, 0x60, 0x00, 0xc0, 0x20, 0x80, 0x00, 0xc0, 0x20,
+ 0xa0, 0x00, 0xc0, 0x20, 0xc0, 0x00, 0xc0, 0x20, 0xe0, 0x00, 0xc0, 0x40,
+ 0x00, 0x00, 0xc0, 0x40, 0x20, 0x00, 0xc0, 0x40, 0x40, 0x00, 0xc0, 0x40,
+ 0x60, 0x00, 0xc0, 0x40, 0x80, 0x00, 0xc0, 0x40, 0xa0, 0x00, 0xc0, 0x40,
+ 0xc0, 0x00, 0xc0, 0x40, 0xe0, 0x00, 0xc0, 0x60, 0x00, 0x00, 0xc0, 0x60,
+ 0x20, 0x00, 0xc0, 0x60, 0x40, 0x00, 0xc0, 0x60, 0x60, 0x00, 0xc0, 0x60,
+ 0x80, 0x00, 0xc0, 0x60, 0xa0, 0x00, 0xc0, 0x60, 0xc0, 0x00, 0xc0, 0x60,
+ 0xe0, 0x00, 0xc0, 0x80, 0x00, 0x00, 0xc0, 0x80, 0x20, 0x00, 0xc0, 0x80,
+ 0x40, 0x00, 0xc0, 0x80, 0x60, 0x00, 0xc0, 0x80, 0x80, 0x00, 0xc0, 0x80,
+ 0xa0, 0x00, 0xc0, 0x80, 0xc0, 0x00, 0xc0, 0x80, 0xe0, 0x00, 0xc0, 0xa0,
+ 0x00, 0x00, 0xc0, 0xa0, 0x20, 0x00, 0xc0, 0xa0, 0x40, 0x00, 0xc0, 0xa0,
+ 0x60, 0x00, 0xc0, 0xa0, 0x80, 0x00, 0xc0, 0xa0, 0xa0, 0x00, 0xc0, 0xa0,
+ 0xc0, 0x00, 0xc0, 0xa0, 0xe0, 0x00, 0xc0, 0xc0, 0x00, 0x00, 0xc0, 0xc0,
+ 0x20, 0x00, 0xc0, 0xc0, 0x40, 0x00, 0xc0, 0xc0, 0x60, 0x00, 0xc0, 0xc0,
+ 0x80, 0x00, 0xc0, 0xc0, 0xa0, 0x00, 0xf0, 0xfb, 0xff, 0x00, 0xa4, 0xa0,
+ 0xa0, 0x00, 0x80, 0x80, 0x80, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0xff,
+ 0x00, 0x00, 0x00, 0xff, 0xff, 0x00, 0xff, 0x00, 0x00, 0x00, 0xff, 0x00,
+ 0xff, 0x00, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0xff, 0x00, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0xef, 0xef,
+ 0xa7, 0x9f, 0x57, 0x57, 0x4f, 0x4f, 0x57, 0x57, 0x5f, 0xa7, 0xef, 0xef,
+ 0xf6, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0xf6,
+ 0xa7, 0x5f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x57, 0xa7, 0xef, 0xf6, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xf6, 0xef, 0xa7, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x5f,
+ 0xef, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xf6, 0xa7, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x9f, 0xef, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x57, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x57, 0xaf,
+ 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0xaf, 0x57, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x9f, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xa7, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0xef, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xf6, 0x57, 0x0f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0x0f, 0x0f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f,
+ 0x57, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xaf, 0x0f, 0x0f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f,
+ 0xa7, 0xef, 0x9f, 0x0f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x0f, 0x0f, 0xef, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xf6, 0x9f, 0x0f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x0f, 0x9f, 0xf6, 0xff, 0xf6, 0x9f, 0x0f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0xa7, 0xf6, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x57, 0x0f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0x57, 0xef, 0xff, 0xff, 0xff, 0xf6,
+ 0x57, 0x0f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0x57, 0xef,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x4f,
+ 0x0f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0x4f, 0xaf, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xef, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x0f, 0x0f, 0xaf, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xa7, 0x0f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x0f, 0x5f, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xa7, 0x0f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0x9f, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x5f, 0x0f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x0f, 0x57, 0xef, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xf6, 0x57, 0x0f, 0x4f, 0x4f, 0x4f, 0x0f, 0x57, 0xef, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6,
+ 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0xf6, 0xf6, 0xf6,
+ 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xef, 0x57, 0x0f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0xa7, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0xaf, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0xa4, 0x5b, 0x5b, 0x5b, 0x07,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xf7, 0x5b, 0x5b, 0x5b, 0xa4, 0xff, 0xf6, 0x9b, 0x5b,
+ 0x5b, 0xa4, 0xf6, 0xff, 0xff, 0xf6, 0xf7, 0x5b, 0x52, 0x52, 0x52, 0x52,
+ 0x52, 0x52, 0x52, 0x52, 0x52, 0xa4, 0x08, 0xff, 0xf6, 0xa4, 0x5b, 0x5b,
+ 0xa4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0xf7, 0x5b, 0x5b, 0x9b,
+ 0x08, 0xff, 0xff, 0xf6, 0xf7, 0x5b, 0x52, 0x52, 0x52, 0x52, 0x52, 0x52,
+ 0x52, 0x52, 0x5b, 0xa4, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xf6, 0xa4, 0x5b,
+ 0x52, 0x52, 0x52, 0x52, 0x52, 0x52, 0x52, 0x52, 0x52, 0x9b, 0x08, 0xff,
+ 0xf6, 0xa4, 0x5b, 0x5b, 0xa4, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6,
+ 0xa4, 0x5b, 0x5b, 0x9b, 0xff, 0xf6, 0xa4, 0x5b, 0x5b, 0x5b, 0x07, 0xff,
+ 0xf7, 0x5b, 0x5b, 0x9b, 0x08, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xaf, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0x57,
+ 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x9f,
+ 0x0f, 0x4f, 0x0f, 0x5f, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xef, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x08, 0x52,
+ 0x00, 0x00, 0x00, 0xa4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0xa4, 0x5b,
+ 0xa4, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0x5b, 0x00, 0x00, 0x00, 0x52,
+ 0xff, 0x08, 0x00, 0x00, 0x00, 0x49, 0x08, 0xff, 0xf6, 0x5b, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x5b, 0xf6,
+ 0xf6, 0x52, 0x00, 0x00, 0x52, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6,
+ 0x52, 0x00, 0x00, 0x00, 0x07, 0xff, 0xff, 0x9b, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x52, 0xf6, 0xff, 0xff,
+ 0xf6, 0x52, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x52, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x52, 0xf6, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xf6, 0x49, 0x00, 0x00, 0x49, 0xff, 0xf6, 0x52, 0x00,
+ 0x00, 0x00, 0xf7, 0xff, 0xa4, 0x00, 0x00, 0x00, 0x07, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0xf6, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x5f, 0x0f,
+ 0x4f, 0x0f, 0x4f, 0xef, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xef, 0x57, 0x4f, 0x0f, 0x4f, 0xef, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x57, 0xef, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0xa4, 0xff, 0xff, 0xff, 0xff,
+ 0xf6, 0x52, 0x00, 0x00, 0x00, 0x9b, 0xff, 0xff, 0xff, 0xff, 0xff, 0x5b,
+ 0x00, 0x00, 0x00, 0x9b, 0xff, 0x08, 0x00, 0x00, 0x00, 0x52, 0x08, 0xff,
+ 0xa4, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x49, 0x07, 0xff, 0x52, 0x00, 0x00, 0x52, 0xf6, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xf6, 0x5b, 0x00, 0x00, 0x00, 0x07, 0xff, 0x07, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0xa4, 0xff, 0xff, 0xa4, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0xf6, 0x52, 0x00, 0x00,
+ 0x52, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x49,
+ 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0xf7, 0xff, 0xa4, 0x00, 0x00, 0x00,
+ 0x07, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xf6, 0x57, 0xef, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0x5f, 0x0f, 0x4f, 0x0f, 0xa7, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x5f, 0x0f, 0x4f, 0x0f, 0xa7, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x5f, 0x0f,
+ 0xa7, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x5b, 0x00, 0x00, 0x00, 0x9b,
+ 0xf6, 0xff, 0xff, 0xff, 0xf7, 0x00, 0x00, 0x00, 0x00, 0x49, 0x07, 0xff,
+ 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0xa4, 0xff, 0x08, 0x00, 0x00,
+ 0x00, 0x52, 0x08, 0xff, 0x52, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x07, 0xff, 0x52, 0x00, 0x00,
+ 0x52, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x5b, 0x00, 0x00, 0x00,
+ 0x07, 0xff, 0x9b, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x52, 0xf6, 0xff, 0x52, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08,
+ 0xf6, 0x52, 0x00, 0x00, 0x52, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6,
+ 0x52, 0x00, 0x00, 0x49, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0xf7, 0xff,
+ 0xa4, 0x00, 0x00, 0x00, 0x07, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x0f, 0x5f, 0xf6, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x57, 0x4f, 0x0f, 0x57, 0xf6, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xaf, 0x0f, 0x4f,
+ 0x0f, 0x57, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xaf, 0x0f, 0x4f, 0x5f, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0x9b,
+ 0x00, 0x00, 0x00, 0x5b, 0xf6, 0xff, 0xff, 0xf6, 0x5b, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0xa4, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0xf7,
+ 0xff, 0x08, 0x00, 0x00, 0x00, 0x52, 0x08, 0xf6, 0x52, 0x00, 0x00, 0x00,
+ 0x49, 0x5b, 0x5b, 0x5b, 0x5b, 0x5b, 0x5b, 0x5b, 0x5b, 0x52, 0x5b, 0x08,
+ 0xf6, 0x52, 0x00, 0x00, 0x52, 0x07, 0x07, 0x07, 0x07, 0x07, 0x07, 0xf7,
+ 0x49, 0x00, 0x00, 0x49, 0x08, 0xff, 0x52, 0x00, 0x00, 0x00, 0x00, 0x52,
+ 0x5b, 0x5b, 0x5b, 0x5b, 0x5b, 0x49, 0x00, 0x00, 0x00, 0x49, 0x08, 0xf6,
+ 0x49, 0x00, 0x00, 0x00, 0x49, 0x5b, 0x5b, 0x5b, 0x5b, 0x5b, 0x5b, 0x5b,
+ 0x5b, 0x5b, 0x52, 0xf6, 0xf6, 0x52, 0x00, 0x00, 0x52, 0xf6, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x49, 0xff, 0xf6, 0x52, 0x00,
+ 0x00, 0x00, 0xf7, 0xff, 0xa4, 0x00, 0x00, 0x00, 0xa4, 0x07, 0xf7, 0xf7,
+ 0xf7, 0xf7, 0xf7, 0xf7, 0xf7, 0x07, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x4f, 0x0f,
+ 0xa7, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x5f, 0x0f, 0x4f,
+ 0x4f, 0xef, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xf6, 0x57, 0x0f, 0x4f, 0x4f, 0xef, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xf6, 0x57, 0x0f, 0x4f, 0x57, 0xf6, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xa4, 0x00, 0x00, 0x00, 0x52, 0xf6, 0xff, 0xff, 0x07,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x52, 0x08, 0xff, 0xff, 0xf6, 0x49,
+ 0x00, 0x00, 0x00, 0x07, 0xff, 0x08, 0x00, 0x00, 0x00, 0x52, 0xf6, 0x07,
+ 0x49, 0x00, 0x00, 0x00, 0x07, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x52, 0xf6, 0xf6, 0x52, 0x00,
+ 0x00, 0x00, 0xf7, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07, 0x49, 0x00,
+ 0x00, 0x00, 0x07, 0xf6, 0x49, 0x00, 0x00, 0x00, 0x07, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00,
+ 0x52, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x49,
+ 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0xf7, 0xff, 0xa4, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xa4, 0xf6,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xaf, 0x4f, 0x0f, 0x4f, 0xef, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xa7, 0x0f, 0x4f, 0x0f, 0x9f, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xf6, 0x9f, 0x0f, 0x4f, 0x0f, 0xa7, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x9f, 0x0f, 0x4f, 0x4f,
+ 0x57, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf7, 0x00, 0x00, 0x00, 0x52,
+ 0xf6, 0xff, 0xff, 0xa4, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf7,
+ 0xff, 0xff, 0xf6, 0x49, 0x00, 0x00, 0x00, 0x08, 0xff, 0x08, 0x00, 0x00,
+ 0x00, 0x52, 0xf6, 0x07, 0x49, 0x00, 0x00, 0x52, 0xf6, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x49, 0x07,
+ 0xff, 0x08, 0x49, 0x00, 0x00, 0x49, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0x52, 0x00, 0x00, 0x00, 0x07, 0xf6, 0x49, 0x00, 0x00, 0x52,
+ 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xf6, 0x52, 0x00, 0x00, 0x49, 0xf7, 0xf7, 0xf7, 0xf7, 0xf7, 0xf7, 0xf7,
+ 0x49, 0x00, 0x00, 0x49, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0xf7, 0xff,
+ 0xa4, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x07, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xaf, 0x4f, 0x4f, 0x0f, 0x57, 0xf6, 0xff,
+ 0xff, 0xff, 0xff, 0xef, 0x57, 0x0f, 0x0f, 0x57, 0xf6, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x4f, 0x4f, 0x0f, 0x57,
+ 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xef,
+ 0x4f, 0x0f, 0x4f, 0x4f, 0xaf, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf7,
+ 0x00, 0x00, 0x00, 0x49, 0x08, 0xff, 0xf6, 0x49, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x5b, 0xf6, 0xff, 0x08, 0x49, 0x00, 0x00, 0x00, 0xf6,
+ 0xff, 0x08, 0x00, 0x00, 0x00, 0x52, 0xf6, 0x07, 0x49, 0x00, 0x00, 0x5b,
+ 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xf6, 0x52, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x49, 0x07, 0xff, 0xf6, 0x49, 0x00, 0x00, 0x49, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x9b, 0x00, 0x00, 0x00, 0x07, 0xf6,
+ 0x49, 0x00, 0x00, 0x52, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x49, 0xff, 0xf6, 0x52, 0x00,
+ 0x00, 0x00, 0xf7, 0xff, 0xa4, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xa4, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xaf, 0x4f, 0x4f,
+ 0x4f, 0x0f, 0x9f, 0xf6, 0xff, 0xff, 0xf6, 0x5f, 0x0f, 0x4f, 0x0f, 0xaf,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x57,
+ 0x0f, 0x4f, 0x0f, 0xaf, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xf6, 0x57, 0x0f, 0x4f, 0x4f, 0x5f, 0xf6, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0x07, 0x49, 0x00, 0x00, 0x00, 0x08, 0xff, 0x07, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x07, 0xff, 0x07, 0x00,
+ 0x00, 0x00, 0x49, 0xf6, 0xff, 0x08, 0x00, 0x00, 0x00, 0x52, 0xf6, 0x07,
+ 0x49, 0x00, 0x00, 0x5b, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0x49, 0x49, 0x49,
+ 0x49, 0x49, 0x49, 0x00, 0x00, 0x00, 0x00, 0x5b, 0xf6, 0xf6, 0x49, 0x00,
+ 0x00, 0x49, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x9b, 0x00,
+ 0x00, 0x00, 0x07, 0xf6, 0x49, 0x00, 0x00, 0x9b, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x49,
+ 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0xf7, 0xff, 0xa4, 0x00, 0x00, 0x00,
+ 0x49, 0x52, 0x52, 0x52, 0x52, 0x52, 0x52, 0x00, 0x00, 0x00, 0x00, 0x9b,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xaf, 0x4f, 0x4f, 0x4f, 0x0f, 0x0f, 0xaf, 0xff, 0xff, 0xaf, 0x0f,
+ 0x4f, 0x0f, 0x5f, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xa7, 0x0f, 0x4f, 0x0f, 0x5f, 0xf6, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xa7, 0x0f, 0x4f, 0x4f, 0x4f, 0xef,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07, 0x49, 0x00, 0x00, 0x00,
+ 0x07, 0xff, 0x5b, 0x00, 0x00, 0x00, 0x49, 0xa4, 0x49, 0x00, 0x00, 0x00,
+ 0xa4, 0xff, 0x07, 0x00, 0x00, 0x00, 0x52, 0xf6, 0xff, 0x08, 0x00, 0x00,
+ 0x00, 0x52, 0xf6, 0x07, 0x49, 0x00, 0x00, 0x5b, 0xf6, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00,
+ 0x52, 0x07, 0x07, 0x07, 0x07, 0x07, 0x07, 0x07, 0x52, 0x00, 0x00, 0x49,
+ 0x08, 0xf6, 0x49, 0x00, 0x00, 0x49, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0x9b, 0x00, 0x00, 0x00, 0x07, 0xf6, 0x49, 0x00, 0x00, 0x5b,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xf6, 0x52, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x49, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0xf7, 0xff,
+ 0xa4, 0x00, 0x00, 0x00, 0xf7, 0x08, 0x08, 0x08, 0x08, 0x08, 0x08, 0xa4,
+ 0x00, 0x00, 0x00, 0x5b, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0x57,
+ 0xf6, 0xf6, 0x57, 0x0f, 0x0f, 0x4f, 0xef, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x4f, 0x0f, 0x0f, 0x57, 0xef, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x4f, 0x0f,
+ 0x4f, 0x4f, 0xa7, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x08,
+ 0x52, 0x00, 0x00, 0x00, 0x07, 0xf6, 0x49, 0x00, 0x00, 0x00, 0x5b, 0xf6,
+ 0x52, 0x00, 0x00, 0x00, 0x52, 0xf6, 0xf7, 0x00, 0x00, 0x00, 0x5b, 0xff,
+ 0xff, 0x08, 0x00, 0x00, 0x00, 0x52, 0xf6, 0x07, 0x49, 0x00, 0x00, 0x5b,
+ 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xf6, 0x52, 0x00, 0x00, 0x52, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xa4, 0x00, 0x00, 0x00, 0x08, 0xf6, 0x49, 0x00, 0x00, 0x49, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x5b, 0x00, 0x00, 0x00, 0x07, 0xf6,
+ 0x49, 0x00, 0x00, 0x52, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x49, 0xff, 0xf6, 0x52, 0x00,
+ 0x00, 0x00, 0xf7, 0xff, 0xa4, 0x00, 0x00, 0x00, 0x07, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0x08, 0x49, 0x00, 0x00, 0x52, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x0f, 0x5f, 0x5f, 0x0f, 0x4f, 0x0f, 0xa7, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x5f, 0x0f, 0x4f,
+ 0x0f, 0xaf, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xf6, 0x5f, 0x0f, 0x4f, 0x4f, 0x57, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0x07, 0xf7, 0x00, 0x00,
+ 0x00, 0x00, 0xf7, 0xff, 0xa4, 0x00, 0x00, 0x00, 0x00, 0x07, 0xf7, 0x00,
+ 0x00, 0x00, 0x9b, 0xff, 0xff, 0x08, 0x00, 0x00, 0x00, 0x52, 0xf6, 0x07,
+ 0x49, 0x00, 0x00, 0x52, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x52, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xa4, 0x00, 0x00, 0x00, 0x08, 0xf6, 0x49, 0x00,
+ 0x00, 0x00, 0x08, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x52, 0x00,
+ 0x00, 0x00, 0x07, 0xf6, 0x49, 0x00, 0x00, 0x49, 0xf6, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00,
+ 0x49, 0xa4, 0xf7, 0xf7, 0xf7, 0xf7, 0xf7, 0xa4, 0x49, 0x00, 0x00, 0x49,
+ 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0xf7, 0xff, 0xa4, 0x00, 0x00, 0x00,
+ 0x07, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x08, 0x49, 0x00, 0x00, 0x52,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xef, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0x4f, 0x0f,
+ 0x5f, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xa7, 0x0f, 0x4f, 0x0f, 0x5f, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xa7, 0x0f, 0x0f, 0x4f, 0x4f, 0xef, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00,
+ 0xf7, 0x52, 0x00, 0x00, 0x00, 0x52, 0xf6, 0xff, 0x07, 0x49, 0x00, 0x00,
+ 0x00, 0xa4, 0x9b, 0x00, 0x00, 0x00, 0xa4, 0xff, 0xff, 0x08, 0x00, 0x00,
+ 0x00, 0x52, 0xf6, 0x08, 0x49, 0x00, 0x00, 0x00, 0xa4, 0xf6, 0xf6, 0xf6,
+ 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xff, 0xf6, 0x52, 0x00, 0x00,
+ 0x52, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xff, 0x08, 0x52, 0x00, 0x00, 0x00,
+ 0x08, 0xff, 0x52, 0x00, 0x00, 0x00, 0x9b, 0xf6, 0xff, 0xf6, 0xf6, 0xf6,
+ 0xff, 0xf7, 0x00, 0x00, 0x00, 0x00, 0x08, 0xf6, 0x49, 0x00, 0x00, 0x00,
+ 0xa4, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xff,
+ 0xf6, 0x52, 0x00, 0x00, 0x52, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6,
+ 0x52, 0x00, 0x00, 0x49, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0xf7, 0xff,
+ 0xa4, 0x00, 0x00, 0x00, 0x07, 0xff, 0xf6, 0xf6, 0xf6, 0xf6, 0xf6, 0xa4,
+ 0x00, 0x00, 0x00, 0x5b, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x57, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x0f, 0x4f, 0xef, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xef, 0x57, 0x0f, 0x0f, 0x4f, 0xef, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x57, 0x0f, 0x4f, 0x4f,
+ 0xa7, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x9b, 0x00, 0x00, 0x00, 0x52, 0x00, 0x00, 0x00, 0x00, 0xa4, 0xff, 0xff,
+ 0xf6, 0x5b, 0x00, 0x00, 0x00, 0x49, 0x52, 0x00, 0x00, 0x00, 0xf7, 0xff,
+ 0xff, 0x08, 0x00, 0x00, 0x00, 0x52, 0x08, 0xf6, 0x52, 0x00, 0x00, 0x00,
+ 0x00, 0x49, 0x49, 0x49, 0x49, 0x49, 0x49, 0x49, 0x49, 0x49, 0x52, 0x08,
+ 0xf6, 0x52, 0x00, 0x00, 0x00, 0x52, 0x52, 0x52, 0x52, 0x52, 0x52, 0x49,
+ 0x00, 0x00, 0x00, 0x00, 0x07, 0xff, 0x52, 0x00, 0x00, 0x00, 0x00, 0x49,
+ 0x52, 0x52, 0x52, 0x52, 0x49, 0x00, 0x00, 0x00, 0x00, 0x49, 0x08, 0xf6,
+ 0x49, 0x00, 0x00, 0x00, 0x00, 0x49, 0x49, 0x49, 0x49, 0x49, 0x49, 0x49,
+ 0x49, 0x49, 0x49, 0xf6, 0xf6, 0x52, 0x00, 0x00, 0x52, 0xf6, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x49, 0xff, 0xf6, 0x52, 0x00,
+ 0x00, 0x00, 0xf7, 0xff, 0xa4, 0x00, 0x00, 0x00, 0x49, 0x52, 0x52, 0x52,
+ 0x52, 0x52, 0x49, 0x00, 0x00, 0x00, 0x00, 0x9b, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xa7, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0xa7, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x9f, 0x0f, 0x4f, 0x0f, 0xa7,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x5f,
+ 0x0f, 0x4f, 0x4f, 0x57, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xa4, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x07, 0xff, 0xff, 0xff, 0xf7, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0xf7, 0xff, 0xff, 0x08, 0x00, 0x00, 0x00, 0x52, 0x08, 0xff,
+ 0x52, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x49, 0x08, 0xff, 0x52, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x49, 0x08, 0xff, 0x9b, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x52, 0xf6, 0xff, 0x5b, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf6, 0xf6, 0x52, 0x00, 0x00,
+ 0x52, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x49,
+ 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0xf7, 0xff, 0xa4, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xa4,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xef, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0x9f,
+ 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xaf, 0x0f,
+ 0x0f, 0x4f, 0x0f, 0x9f, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xaf, 0x0f, 0x0f, 0x4f, 0x4f, 0xef, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf7, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x5b, 0xff, 0xff, 0xff, 0xff, 0x08, 0x52, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x07, 0xff, 0xff, 0x08, 0x00, 0x00,
+ 0x00, 0x52, 0x08, 0xff, 0xf7, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x52, 0xf6, 0xf6, 0x52, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x9b,
+ 0xf6, 0xff, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xf7, 0xff, 0xff, 0xf7, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x49, 0xf6,
+ 0xf6, 0x52, 0x00, 0x00, 0x52, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6,
+ 0x52, 0x00, 0x00, 0x49, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0xf7, 0xff,
+ 0xa4, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x49, 0x07, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x57, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x0f, 0xaf, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xf6, 0x57, 0x0f, 0x4f, 0x4f, 0x4f, 0x0f, 0xa7, 0xf6, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x57, 0x0f, 0x4f, 0x4f, 0x9f, 0xf6,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xf7, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf7, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xa4, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x49, 0x07, 0xff,
+ 0xff, 0x08, 0x00, 0x00, 0x00, 0x52, 0x08, 0xff, 0xff, 0xa4, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x9b, 0xf6,
+ 0xf6, 0x52, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x49, 0x07, 0xff, 0xff, 0xff, 0xa4, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x5b, 0xf6, 0xff, 0xff,
+ 0xf6, 0xa4, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0xa4, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x52, 0xf6, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x49, 0xff, 0xf6, 0x52, 0x00,
+ 0x00, 0x00, 0xf7, 0xff, 0xa4, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x49, 0xf7, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xa7,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0x4f, 0xef, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xf6, 0x9f, 0x0f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f,
+ 0x4f, 0xef, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x9f, 0x0f, 0x4f,
+ 0x4f, 0x57, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0x07, 0x49, 0x00, 0x00, 0x00, 0x00, 0x00, 0x49,
+ 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07, 0x49, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x49, 0xf6, 0xff, 0xff, 0xf6, 0xa4, 0xa4, 0xa4, 0xf7, 0xf6, 0xff,
+ 0xff, 0xff, 0x07, 0xa4, 0x5b, 0x5b, 0x5b, 0x5b, 0x5b, 0x5b, 0x5b, 0x5b,
+ 0x5b, 0xf7, 0xf6, 0xff, 0xf6, 0xf7, 0xa4, 0xa4, 0xa4, 0xa4, 0xa4, 0xa4,
+ 0xa4, 0xa4, 0xa4, 0xa4, 0xa4, 0xf7, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x08, 0xa4, 0x9b, 0x5b, 0x5b, 0x5b, 0x5b, 0x5b, 0x5b, 0x5b, 0xa4, 0x07,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07, 0xa4, 0x9b, 0x5b, 0x5b, 0x5b,
+ 0x5b, 0x5b, 0x5b, 0x5b, 0x9b, 0xf7, 0xf6, 0xff, 0xf6, 0xf7, 0xa4, 0xa4,
+ 0xf7, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0xf7, 0xa4, 0xa4, 0xa4,
+ 0xff, 0xf6, 0xf7, 0xa4, 0xa4, 0xa4, 0x07, 0xff, 0x07, 0xa4, 0xa4, 0xa4,
+ 0xa4, 0xa4, 0xa4, 0xa4, 0xa4, 0xa4, 0xa4, 0xa4, 0xf7, 0xf6, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xf6, 0x57, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x0f, 0x57, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x0f, 0x0f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0x57, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xef, 0x0f, 0x0f, 0x4f, 0x4f, 0xaf, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07, 0x49, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0xa4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x9b,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x52, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xaf, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0xa7, 0xff, 0xff, 0xff, 0xff, 0xf6,
+ 0x57, 0x0f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0xa7, 0xf6,
+ 0xff, 0xff, 0xff, 0xf6, 0x57, 0x0f, 0x4f, 0x4f, 0x5f, 0xf6, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x08, 0x49, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xf7, 0x00, 0x00, 0x00, 0x00, 0x00, 0x52, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xf6, 0x9f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0x0f, 0xef,
+ 0xff, 0xff, 0xf6, 0xa7, 0x0f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x0f, 0xaf, 0xff, 0xff, 0xf6, 0xa7, 0x0f, 0x4f, 0x4f, 0x57,
+ 0xef, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00, 0x00, 0x5b, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x52, 0x00, 0x00, 0x00,
+ 0x00, 0x5b, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x57, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x0f, 0x57, 0xef, 0xef, 0xa7, 0x0f, 0x0f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0x4f, 0xaf, 0xef, 0xa7, 0x0f,
+ 0x0f, 0x4f, 0x4f, 0xa7, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xa4, 0x00, 0x00,
+ 0x00, 0x49, 0x07, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xf7, 0x00, 0x00, 0x00, 0x00, 0x07, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x57,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0x4f, 0x57, 0x0f, 0x0f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x0f,
+ 0x4f, 0x57, 0x0f, 0x0f, 0x4f, 0x4f, 0x5f, 0xf6, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xf6, 0xa4, 0x52, 0x5b, 0x07, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xf7, 0x52, 0x52, 0xa4, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xef, 0x57, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x0f, 0x0f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x0f, 0x0f, 0x4f, 0x4f, 0x4f, 0x57, 0xef, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0xf6,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xef, 0x57, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0xa7, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xef, 0x57, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x57, 0xf6, 0xff, 0x07, 0xa4, 0xf7, 0xf6, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0xa7, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0xef, 0xff, 0x07, 0x5b,
+ 0x52, 0x52, 0x07, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6,
+ 0xef, 0x5f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x9f,
+ 0xf6, 0xff, 0xf7, 0x52, 0x52, 0x52, 0xf7, 0xf6, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0xef, 0x5f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x5f, 0xf6, 0xff, 0xff, 0x08, 0x5b, 0x52, 0x5b, 0x07, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6,
+ 0xef, 0xa7, 0x5f, 0x57, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f, 0x4f,
+ 0x4f, 0x4f, 0x4f, 0x5f, 0xa7, 0xef, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xf6,
+ 0x08, 0xf6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf6, 0xf6, 0xef, 0xaf, 0xa7, 0xa7,
+ 0xa7, 0xa7, 0xa7, 0xa7, 0xaf, 0xef, 0xef, 0xf6, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff
+};
+
+#endif
--- /dev/null
+/*
+ * charset conversion utils
+ *
+ * Copyright (c) 2017 Rob Clark
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+#include <common.h>
+#include <charset.h>
+#include <malloc.h>
+
+/*
+ * utf8/utf16 conversion mostly lifted from grub
+ */
+
+size_t utf16_strlen(const uint16_t *in)
+{
+ size_t i;
+ for (i = 0; in[i]; i++);
+ return i;
+}
+
+size_t utf16_strnlen(const uint16_t *in, size_t count)
+{
+ size_t i;
+ for (i = 0; count-- && in[i]; i++);
+ return i;
+}
+
+uint16_t *utf16_strcpy(uint16_t *dest, const uint16_t *src)
+{
+ uint16_t *tmp = dest;
+
+ while ((*dest++ = *src++) != '\0')
+ /* nothing */;
+ return tmp;
+
+}
+
+uint16_t *utf16_strdup(const uint16_t *s)
+{
+ uint16_t *new;
+ if (!s || !(new = malloc((utf16_strlen(s) + 1) * 2)))
+ return NULL;
+ utf16_strcpy(new, s);
+ return new;
+}
+
+/* Convert UTF-16 to UTF-8. */
+uint8_t *utf16_to_utf8(uint8_t *dest, const uint16_t *src, size_t size)
+{
+ uint32_t code_high = 0;
+
+ while (size--) {
+ uint32_t code = *src++;
+
+ if (code_high) {
+ if (code >= 0xDC00 && code <= 0xDFFF) {
+ /* Surrogate pair. */
+ code = ((code_high - 0xD800) << 10) + (code - 0xDC00) + 0x10000;
+
+ *dest++ = (code >> 18) | 0xF0;
+ *dest++ = ((code >> 12) & 0x3F) | 0x80;
+ *dest++ = ((code >> 6) & 0x3F) | 0x80;
+ *dest++ = (code & 0x3F) | 0x80;
+ } else {
+ /* Error... */
+ *dest++ = '?';
+ /* *src may be valid. Don't eat it. */
+ src--;
+ }
+
+ code_high = 0;
+ } else {
+ if (code <= 0x007F) {
+ *dest++ = code;
+ } else if (code <= 0x07FF) {
+ *dest++ = (code >> 6) | 0xC0;
+ *dest++ = (code & 0x3F) | 0x80;
+ } else if (code >= 0xD800 && code <= 0xDBFF) {
+ code_high = code;
+ continue;
+ } else if (code >= 0xDC00 && code <= 0xDFFF) {
+ /* Error... */
+ *dest++ = '?';
+ } else if (code < 0x10000) {
+ *dest++ = (code >> 12) | 0xE0;
+ *dest++ = ((code >> 6) & 0x3F) | 0x80;
+ *dest++ = (code & 0x3F) | 0x80;
+ } else {
+ *dest++ = (code >> 18) | 0xF0;
+ *dest++ = ((code >> 12) & 0x3F) | 0x80;
+ *dest++ = ((code >> 6) & 0x3F) | 0x80;
+ *dest++ = (code & 0x3F) | 0x80;
+ }
+ }
+ }
+
+ return dest;
+}
*/
#include <common.h>
+#include <charset.h>
#include <efi_loader.h>
static bool console_size_queried;
static void print_unicode_in_utf8(u16 c)
{
- char utf8[4] = { 0 };
- char *b = utf8;
-
- if (c < 0x80) {
- *(b++) = c;
- } else if (c < 0x800) {
- *(b++) = 192 + c / 64;
- *(b++) = 128 + c % 64;
- } else {
- *(b++) = 224 + c / 4096;
- *(b++) = 128 + c / 64 % 64;
- *(b++) = 128 + c % 64;
- }
-
+ char utf8[MAX_UTF8_PER_UTF16] = { 0 };
+ utf16_to_utf8((u8 *)utf8, &c, 1);
puts(utf8);
}
* @fdt: Base device tree blob
* @fdto: Device tree overlay blob
* @fragment: node offset of the fragment in the overlay
+ * @pathp: pointer which receives the path of the target (or NULL)
*
* overlay_get_target() retrieves the target offset in the base
* device tree of a fragment, no matter how the actual targetting is
* Negative error code on error
*/
static int overlay_get_target(const void *fdt, const void *fdto,
- int fragment)
+ int fragment, char const **pathp)
{
uint32_t phandle;
- const char *path;
- int path_len;
+ const char *path = NULL;
+ int path_len = 0, ret;
/* Try first to do a phandle based lookup */
phandle = overlay_get_target_phandle(fdto, fragment);
if (phandle == (uint32_t)-1)
return -FDT_ERR_BADPHANDLE;
- if (phandle)
- return fdt_node_offset_by_phandle(fdt, phandle);
+ /* no phandle, try path */
+ if (!phandle) {
+ /* And then a path based lookup */
+ path = fdt_getprop(fdto, fragment, "target-path", &path_len);
+ if (path)
+ ret = fdt_path_offset(fdt, path);
+ else
+ ret = path_len;
+ } else
+ ret = fdt_node_offset_by_phandle(fdt, phandle);
- /* And then a path based lookup */
- path = fdt_getprop(fdto, fragment, "target-path", &path_len);
- if (!path) {
- /*
- * If we haven't found either a target or a
- * target-path property in a node that contains a
- * __overlay__ subnode (we wouldn't be called
- * otherwise), consider it a improperly written
- * overlay
- */
- if (path_len == -FDT_ERR_NOTFOUND)
- return -FDT_ERR_BADOVERLAY;
+ /*
+ * If we haven't found either a target or a
+ * target-path property in a node that contains a
+ * __overlay__ subnode (we wouldn't be called
+ * otherwise), consider it a improperly written
+ * overlay
+ */
+ if (ret < 0 && path_len == -FDT_ERR_NOTFOUND)
+ ret = -FDT_ERR_BADOVERLAY;
+
+ /* return on error */
+ if (ret < 0)
+ return ret;
- return path_len;
- }
+ /* return pointer to path (if available) */
+ if (pathp)
+ *pathp = path ? path : NULL;
- return fdt_path_offset(fdt, path);
+ return ret;
}
/**
*
* overlay_merge() merges an overlay into its base device tree.
*
- * This is the final step in the device tree overlay application
+ * This is the next to last step in the device tree overlay application
* process, when all the phandles have been adjusted and resolved and
* you just have to merge overlay into the base device tree.
*
if (overlay < 0)
return overlay;
- target = overlay_get_target(fdt, fdto, fragment);
+ target = overlay_get_target(fdt, fdto, fragment, NULL);
if (target < 0)
return target;
return 0;
}
+static int get_path_len(const void *fdt, int nodeoffset)
+{
+ int len = 0, namelen;
+ const char *name;
+
+ FDT_CHECK_HEADER(fdt);
+
+ for (;;) {
+ name = fdt_get_name(fdt, nodeoffset, &namelen);
+ if (!name)
+ return namelen;
+
+ /* root? we're done */
+ if (namelen == 0)
+ break;
+
+ nodeoffset = fdt_parent_offset(fdt, nodeoffset);
+ if (nodeoffset < 0)
+ return nodeoffset;
+ len += namelen + 1;
+ }
+
+ /* in case of root pretend it's "/" */
+ if (len == 0)
+ len++;
+ return len;
+}
+
+/**
+ * overlay_symbol_update - Update the symbols of base tree after a merge
+ * @fdt: Base Device Tree blob
+ * @fdto: Device tree overlay blob
+ *
+ * overlay_symbol_update() updates the symbols of the base tree with the
+ * symbols of the applied overlay
+ *
+ * This is the last step in the device tree overlay application
+ * process, allowing the reference of overlay symbols by subsequent
+ * overlay operations.
+ *
+ * returns:
+ * 0 on success
+ * Negative error code on failure
+ */
+static int overlay_symbol_update(void *fdt, void *fdto)
+{
+ int root_sym, ov_sym, prop, path_len, fragment, target;
+ int len, frag_name_len, ret, rel_path_len;
+ const char *s, *e;
+ const char *path;
+ const char *name;
+ const char *frag_name;
+ const char *rel_path;
+ const char *target_path;
+ char *buf;
+ void *p;
+
+ ov_sym = fdt_subnode_offset(fdto, 0, "__symbols__");
+
+ /* if no overlay symbols exist no problem */
+ if (ov_sym < 0)
+ return 0;
+
+ root_sym = fdt_subnode_offset(fdt, 0, "__symbols__");
+
+ /* it no root symbols exist we should create them */
+ if (root_sym == -FDT_ERR_NOTFOUND)
+ root_sym = fdt_add_subnode(fdt, 0, "__symbols__");
+
+ /* any error is fatal now */
+ if (root_sym < 0)
+ return root_sym;
+
+ /* iterate over each overlay symbol */
+ fdt_for_each_property_offset(prop, fdto, ov_sym) {
+ path = fdt_getprop_by_offset(fdto, prop, &name, &path_len);
+ if (!path)
+ return path_len;
+
+ /* verify it's a string property (terminated by a single \0) */
+ if (path_len < 1 || memchr(path, '\0', path_len) != &path[path_len - 1])
+ return -FDT_ERR_BADVALUE;
+
+ /* keep end marker to avoid strlen() */
+ e = path + path_len;
+
+ /* format: /<fragment-name>/__overlay__/<relative-subnode-path> */
+
+ if (*path != '/')
+ return -FDT_ERR_BADVALUE;
+
+ /* get fragment name first */
+ s = strchr(path + 1, '/');
+ if (!s)
+ return -FDT_ERR_BADOVERLAY;
+
+ frag_name = path + 1;
+ frag_name_len = s - path - 1;
+
+ /* verify format; safe since "s" lies in \0 terminated prop */
+ len = sizeof("/__overlay__/") - 1;
+ if ((e - s) < len || memcmp(s, "/__overlay__/", len))
+ return -FDT_ERR_BADOVERLAY;
+
+ rel_path = s + len;
+ rel_path_len = e - rel_path;
+
+ /* find the fragment index in which the symbol lies */
+ ret = fdt_subnode_offset_namelen(fdto, 0, frag_name,
+ frag_name_len);
+ /* not found? */
+ if (ret < 0)
+ return -FDT_ERR_BADOVERLAY;
+ fragment = ret;
+
+ /* an __overlay__ subnode must exist */
+ ret = fdt_subnode_offset(fdto, fragment, "__overlay__");
+ if (ret < 0)
+ return -FDT_ERR_BADOVERLAY;
+
+ /* get the target of the fragment */
+ ret = overlay_get_target(fdt, fdto, fragment, &target_path);
+ if (ret < 0)
+ return ret;
+ target = ret;
+
+ /* if we have a target path use */
+ if (!target_path) {
+ ret = get_path_len(fdt, target);
+ if (ret < 0)
+ return ret;
+ len = ret;
+ } else {
+ len = strlen(target_path);
+ }
+
+ ret = fdt_setprop_placeholder(fdt, root_sym, name,
+ len + (len > 1) + rel_path_len + 1, &p);
+ if (ret < 0)
+ return ret;
+
+ if (!target_path) {
+ /* again in case setprop_placeholder changed it */
+ ret = overlay_get_target(fdt, fdto, fragment, &target_path);
+ if (ret < 0)
+ return ret;
+ target = ret;
+ }
+
+ buf = p;
+ if (len > 1) { /* target is not root */
+ if (!target_path) {
+ ret = fdt_get_path(fdt, target, buf, len + 1);
+ if (ret < 0)
+ return ret;
+ } else
+ memcpy(buf, target_path, len + 1);
+
+ } else
+ len--;
+
+ buf[len] = '/';
+ memcpy(buf + len + 1, rel_path, rel_path_len);
+ buf[len + 1 + rel_path_len] = '\0';
+ }
+
+ return 0;
+}
+
int fdt_overlay_apply(void *fdt, void *fdto)
{
uint32_t delta = fdt_get_max_phandle(fdt);
if (ret)
goto err;
+ ret = overlay_symbol_update(fdt, fdto);
+ if (ret)
+ goto err;
+
/*
* The overlay has been damaged, erase its magic.
*/
return 0;
}
-int fdt_setprop(void *fdt, int nodeoffset, const char *name,
- const void *val, int len)
+int fdt_setprop_placeholder(void *fdt, int nodeoffset, const char *name,
+ int len, void **prop_data)
{
struct fdt_property *prop;
int err;
if (err)
return err;
+ *prop_data = prop->data;
+ return 0;
+}
+
+int fdt_setprop(void *fdt, int nodeoffset, const char *name,
+ const void *val, int len)
+{
+ void *prop_data;
+ int err;
+
+ err = fdt_setprop_placeholder(fdt, nodeoffset, name, len, &prop_data);
+ if (err)
+ return err;
+
if (len)
- memcpy(prop->data, val, len);
+ memcpy(prop_data, val, len);
return 0;
}
struct fdt_region region[], int max_regions,
char *path, int path_len, int add_string_tab)
{
- int stack[FDT_MAX_DEPTH];
+ int stack[FDT_MAX_DEPTH] = { 0 };
char *end;
int nextoffset = 0;
uint32_t tag;
int fdt_setprop(void *fdt, int nodeoffset, const char *name,
const void *val, int len);
+/**
+ * fdt_setprop _placeholder - allocate space for a property
+ * @fdt: pointer to the device tree blob
+ * @nodeoffset: offset of the node whose property to change
+ * @name: name of the property to change
+ * @len: length of the property value
+ * @prop_data: return pointer to property data
+ *
+ * fdt_setprop_placeholer() allocates the named property in the given node.
+ * If the property exists it is resized. In either case a pointer to the
+ * property data is returned.
+ *
+ * This function may insert or delete data from the blob, and will
+ * therefore change the offsets of some existing nodes.
+ *
+ * returns:
+ * 0, on success
+ * -FDT_ERR_NOSPACE, there is insufficient free space in the blob to
+ * contain the new property value
+ * -FDT_ERR_BADOFFSET, nodeoffset did not point to FDT_BEGIN_NODE tag
+ * -FDT_ERR_BADLAYOUT,
+ * -FDT_ERR_BADMAGIC,
+ * -FDT_ERR_BADVERSION,
+ * -FDT_ERR_BADSTATE,
+ * -FDT_ERR_BADSTRUCTURE,
+ * -FDT_ERR_BADLAYOUT,
+ * -FDT_ERR_TRUNCATED, standard meanings
+ */
+int fdt_setprop_placeholder(void *fdt, int nodeoffset, const char *name,
+ int len, void **prop_data);
+
/**
* fdt_setprop_u32 - set a property to a 32-bit integer
* @fdt: pointer to the device tree blob
%module libfdt
+%include <stdint.i>
+
%{
#define SWIG_FILE_WITH_INIT
#include "libfdt.h"
self._fdt = bytearray(data)
check_err(fdt_check_header(self._fdt));
+ def subnode_offset(self, parentoffset, name, quiet=()):
+ """Get the offset of a named subnode
+
+ Args:
+ parentoffset: Offset of the parent node to check
+ name: Name of the required subnode, e.g. 'subnode@1'
+ quiet: Errors to ignore (empty to raise on all errors)
+
+ Returns:
+ The node offset of the found node, if any
+
+ Raises
+ FdtException if there is no node with that name, or other error
+ """
+ return check_err(fdt_subnode_offset(self._fdt, parentoffset, name),
+ quiet)
+
def path_offset(self, path, quiet=()):
"""Get the offset for a given path
return pdata
return bytearray(pdata[0])
+ def get_phandle(self, nodeoffset):
+ """Get the phandle of a node
+
+ Args:
+ nodeoffset: Node offset to check
+
+ Returns:
+ phandle of node, or 0 if the node has no phandle or another error
+ occurs
+ """
+ return fdt_get_phandle(self._fdt, nodeoffset)
+
+ def parent_offset(self, nodeoffset, quiet=()):
+ """Get the offset of a node's parent
+
+ Args:
+ nodeoffset: Node offset to check
+ quiet: Errors to ignore (empty to raise on all errors)
+
+ Returns:
+ The offset of the parent node, if any
+
+ Raises:
+ FdtException if no parent found or other error occurs
+ """
+ return check_err(fdt_parent_offset(self._fdt, nodeoffset), quiet)
+
+ def node_offset_by_phandle(self, phandle, quiet=()):
+ """Get the offset of a node with the given phandle
+
+ Args:
+ phandle: Phandle to search for
+ quiet: Errors to ignore (empty to raise on all errors)
+
+ Returns:
+ The offset of node with that phandle, if any
+
+ Raises:
+ FdtException if no node found or other error occurs
+ """
+ return check_err(fdt_node_offset_by_phandle(self._fdt, phandle), quiet)
class Property:
"""Holds a device tree property name and value.
#include <errno.h>
#include <linux/ctype.h>
+/* from lib/kstrtox.c */
+static const char *_parse_integer_fixup_radix(const char *s, unsigned int *base)
+{
+ if (*base == 0) {
+ if (s[0] == '0') {
+ if (tolower(s[1]) == 'x' && isxdigit(s[2]))
+ *base = 16;
+ else
+ *base = 8;
+ } else
+ *base = 10;
+ }
+ if (*base == 16 && s[0] == '0' && tolower(s[1]) == 'x')
+ s += 2;
+ return s;
+}
+
unsigned long simple_strtoul(const char *cp, char **endp,
unsigned int base)
{
unsigned long result = 0;
unsigned long value;
- if (*cp == '0') {
- cp++;
- if ((*cp == 'x') && isxdigit(cp[1])) {
- base = 16;
- cp++;
- }
-
- if (!base)
- base = 8;
- }
-
- if (!base)
- base = 10;
+ cp = _parse_integer_fixup_radix(cp, &base);
while (isxdigit(*cp) && (value = isdigit(*cp) ? *cp-'0' : (islower(*cp)
? toupper(*cp) : *cp)-'A'+10) < base) {
{
unsigned long long result = 0, value;
- if (*cp == '0') {
- cp++;
- if ((*cp == 'x') && isxdigit(cp[1])) {
- base = 16;
- cp++;
- }
-
- if (!base)
- base = 8;
- }
-
- if (!base)
- base = 10;
+ cp = _parse_integer_fixup_radix(cp, &base);
while (isxdigit(*cp) && (value = isdigit(*cp) ? *cp - '0'
: (islower(*cp) ? toupper(*cp) : *cp) - 'A' + 10) < base) {
#include <linux/ctype.h>
#include <common.h>
+#include <charset.h>
+#include <uuid.h>
#include <div64.h>
#define noinline __attribute__((noinline))
return buf;
}
+static char *string16(char *buf, char *end, u16 *s, int field_width,
+ int precision, int flags)
+{
+ u16 *str = s ? s : L"<NULL>";
+ int utf16_len = utf16_strnlen(str, precision);
+ u8 utf8[utf16_len * MAX_UTF8_PER_UTF16];
+ int utf8_len, i;
+
+ utf8_len = utf16_to_utf8(utf8, str, utf16_len) - utf8;
+
+ if (!(flags & LEFT))
+ while (utf8_len < field_width--)
+ ADDCH(buf, ' ');
+ for (i = 0; i < utf8_len; ++i)
+ ADDCH(buf, utf8[i]);
+ while (utf8_len < field_width--)
+ ADDCH(buf, ' ');
+ return buf;
+}
+
#ifdef CONFIG_CMD_NET
static const char hex_asc[] = "0123456789abcdef";
#define hex_asc_lo(x) hex_asc[((x) & 0x0f)]
}
#endif
+#ifdef CONFIG_LIB_UUID
+/*
+ * This works (roughly) the same way as linux's, but we currently always
+ * print lower-case (ie. we just keep %pUB and %pUL for compat with linux),
+ * mostly just because that is what uuid_bin_to_str() supports.
+ *
+ * %pUb: 01020304-0506-0708-090a-0b0c0d0e0f10
+ * %pUl: 04030201-0605-0807-090a-0b0c0d0e0f10
+ */
+static char *uuid_string(char *buf, char *end, u8 *addr, int field_width,
+ int precision, int flags, const char *fmt)
+{
+ char uuid[UUID_STR_LEN + 1];
+ int str_format = UUID_STR_FORMAT_STD;
+
+ switch (*(++fmt)) {
+ case 'L':
+ case 'l':
+ str_format = UUID_STR_FORMAT_GUID;
+ break;
+ case 'B':
+ case 'b':
+ /* this is the default */
+ break;
+ default:
+ break;
+ }
+
+ uuid_bin_to_str(addr, uuid, str_format);
+
+ return string(buf, end, uuid, field_width, precision, flags);
+}
+#endif
+
/*
* Show a '%p' thing. A kernel extension is that the '%p' is followed
* by an extra set of alphanumeric characters that are extended format
flags);
#endif
-#ifdef CONFIG_CMD_NET
switch (*fmt) {
+#ifdef CONFIG_CMD_NET
case 'a':
flags |= SPECIAL | ZEROPAD;
precision, flags);
flags &= ~SPECIAL;
break;
- }
#endif
+#ifdef CONFIG_LIB_UUID
+ case 'U':
+ return uuid_string(buf, end, ptr, field_width, precision,
+ flags, fmt);
+#endif
+ default:
+ break;
+ }
flags |= SMALL;
if (field_width == -1) {
field_width = 2*sizeof(void *);
continue;
case 's':
- str = string(str, end, va_arg(args, char *),
- field_width, precision, flags);
+ if (qualifier == 'l' && !IS_ENABLED(CONFIG_SPL_BUILD)) {
+ str = string16(str, end, va_arg(args, u16 *),
+ field_width, precision, flags);
+ } else {
+ str = string(str, end, va_arg(args, char *),
+ field_width, precision, flags);
+ }
continue;
case 'p':
dtc-tmp = $(subst $(comma),_,$(dot-target).dts.tmp)
+# DTCO
+# ---------------------------------------------------------------------------
+
+quiet_cmd_dtco = DTCO $@
+# Rule for objects only; does not put specific u-boot include at the end
+# No generation of assembly file either
+# Modified for U-Boot
+cmd_dtco = mkdir -p $(dir ${dtc-tmp}) ; \
+ $(CPP) $(dtc_cpp_flags) -x assembler-with-cpp -o $(dtc-tmp) - ; \
+ $(DTC) -@ -O dtb -o $@ -b 0 \
+ -i $(dir $<) $(DTC_FLAGS) \
+ -d $(depfile).dtc.tmp $(dtc-tmp) ; \
+ cat $(depfile).pre.tmp $(depfile).dtc.tmp > $(depfile)
+
+$(obj)/%.dtbo: $(src)/%.dts FORCE
+ $(call if_changed_dep,dtco)
+
# Fonts
# ---------------------------------------------------------------------------
quiet_cmd_plat = PLAT $@
cmd_plat = $(CC) $(c_flags) -c $< -o $@
-$(obj)/dts/dt-platdata.o: $(obj)/dts/dt-platdata.c include/generated/dt-structs.h
+$(obj)/dts/dt-platdata.o: $(obj)/dts/dt-platdata.c \
+ include/generated/dt-structs-gen.h
$(call if_changed,plat)
PHONY += dts_dir
dts_dir:
$(shell [ -d $(obj)/dts ] || mkdir -p $(obj)/dts)
-include/generated/dt-structs.h: $(obj)/$(SPL_BIN).dtb dts_dir checkdtoc
+include/generated/dt-structs-gen.h: $(obj)/$(SPL_BIN).dtb dts_dir checkdtoc
$(call if_changed,dtoch)
$(obj)/dts/dt-platdata.c: $(obj)/$(SPL_BIN).dtb dts_dir checkdtoc
-#!/usr/bin/perl -w
+#!/usr/bin/env perl
# (c) 2001, Dave Jones. (the file handling bit)
# (c) 2005, Joel Schopp <jschopp@austin.ibm.com> (the ugly bit)
# (c) 2007,2008, Andy Whitcroft <apw@uk.ibm.com> (new conditions, test suite)
# Licensed under the terms of the GNU GPL License version 2
use strict;
+use warnings;
use POSIX;
use File::Basename;
use Cwd 'abs_path';
+use Term::ANSIColor qw(:constants);
my $P = $0;
-$P =~ s@.*/@@g;
my $D = dirname(abs_path($P));
my $V = '0.32';
my $tst_only;
my $emacs = 0;
my $terse = 0;
+my $showfile = 0;
my $file = 0;
+my $git = 0;
+my %git_commits = ();
my $check = 0;
+my $check_orig = 0;
my $summary = 1;
my $mailback = 0;
my $summary_file = 0;
my $show_types = 0;
+my $list_types = 0;
my $fix = 0;
my $fix_inplace = 0;
my $root;
my $max_line_length = 80;
my $ignore_perl_version = 0;
my $minimum_perl_version = 5.10.0;
+my $min_conf_desc_length = 4;
my $spelling_file = "$D/spelling.txt";
my $codespell = 0;
my $codespellfile = "/usr/share/codespell/dictionary.txt";
+my $conststructsfile = "$D/const_structs.checkpatch";
+my $typedefsfile = "";
+my $color = "auto";
+my $allow_c99_comments = 1;
sub help {
my ($exitcode) = @_;
--patch treat FILE as patchfile (default)
--emacs emacs compile window format
--terse one line per report
+ --showfile emit diffed file position, not input file position
+ -g, --git treat FILE as a single commit or git revision range
+ single git commit with:
+ <rev>
+ <rev>^
+ <rev>~n
+ multiple git commits with:
+ <rev1>..<rev2>
+ <rev1>...<rev2>
+ <rev>-<count>
+ git merges are ignored
-f, --file treat FILE as regular source file
--subjective, --strict enable more subjective tests
+ --list-types list the possible message types
--types TYPE(,TYPE2...) show only these comma separated message types
--ignore TYPE(,TYPE2...) ignore various comma separated message types
+ --show-types show the specific message type in the output
--max-line-length=n set the maximum line length, if exceeded, warn
- --show-types show the message "types" in the output
+ --min-conf-desc-length=n set the min description length, if shorter, warn
--root=PATH PATH to the kernel tree root
--no-summary suppress the per-file summary
--mailback only produce a report in case of warnings/errors
--ignore-perl-version override checking of perl version. expect
runtime errors.
--codespell Use the codespell dictionary for spelling/typos
- (default:/usr/local/share/codespell/dictionary.txt)
+ (default:/usr/share/codespell/dictionary.txt)
--codespellfile Use this codespell dictionary
+ --typedefsfile Read additional types from this file
+ --color[=WHEN] Use colors 'always', 'never', or only when output
+ is a terminal ('auto'). Default is 'auto'.
-h, --help, --version display this help and exit
When FILE is - read standard input.
exit($exitcode);
}
+sub uniq {
+ my %seen;
+ return grep { !$seen{$_}++ } @_;
+}
+
+sub list_types {
+ my ($exitcode) = @_;
+
+ my $count = 0;
+
+ local $/ = undef;
+
+ open(my $script, '<', abs_path($P)) or
+ die "$P: Can't read '$P' $!\n";
+
+ my $text = <$script>;
+ close($script);
+
+ my @types = ();
+ for ($text =~ /\b(?:(?:CHK|WARN|ERROR)\s*\(\s*"([^"]+)")/g) {
+ push (@types, $_);
+ }
+ @types = sort(uniq(@types));
+ print("#\tMessage type\n\n");
+ foreach my $type (@types) {
+ print(++$count . "\t" . $type . "\n");
+ }
+
+ exit($exitcode);
+}
+
my $conf = which_conf($configuration_file);
if (-f $conf) {
my @conf_args;
unshift(@ARGV, @conf_args) if @conf_args;
}
+# Perl's Getopt::Long allows options to take optional arguments after a space.
+# Prevent --color by itself from consuming other arguments
+foreach (@ARGV) {
+ if ($_ eq "--color" || $_ eq "-color") {
+ $_ = "--color=$color";
+ }
+}
+
GetOptions(
'q|quiet+' => \$quiet,
'tree!' => \$tree,
'patch!' => \$chk_patch,
'emacs!' => \$emacs,
'terse!' => \$terse,
+ 'showfile!' => \$showfile,
'f|file!' => \$file,
+ 'g|git!' => \$git,
'subjective!' => \$check,
'strict!' => \$check,
'ignore=s' => \@ignore,
'types=s' => \@use,
'show-types!' => \$show_types,
+ 'list-types!' => \$list_types,
'max-line-length=i' => \$max_line_length,
+ 'min-conf-desc-length=i' => \$min_conf_desc_length,
'root=s' => \$root,
'summary!' => \$summary,
'mailback!' => \$mailback,
'ignore-perl-version!' => \$ignore_perl_version,
'debug=s' => \%debug,
'test-only=s' => \$tst_only,
- 'codespell!' => \$codespell,
- 'codespellfile=s' => \$codespellfile,
+ 'codespell!' => \$codespell,
+ 'codespellfile=s' => \$codespellfile,
+ 'typedefsfile=s' => \$typedefsfile,
+ 'color=s' => \$color,
+ 'no-color' => \$color, #keep old behaviors of -nocolor
+ 'nocolor' => \$color, #keep old behaviors of -nocolor
'h|help' => \$help,
'version' => \$help
) or help(1);
help(0) if ($help);
+list_types(0) if ($list_types);
+
$fix = 1 if ($fix_inplace);
+$check_orig = $check;
my $exit = 0;
}
}
+#if no filenames are given, push '-' to read patch from stdin
if ($#ARGV < 0) {
- print "$P: no input files\n";
- exit(1);
+ push(@ARGV, '-');
+}
+
+if ($color =~ /^[01]$/) {
+ $color = !$color;
+} elsif ($color =~ /^always$/i) {
+ $color = 1;
+} elsif ($color =~ /^never$/i) {
+ $color = 0;
+} elsif ($color =~ /^auto$/i) {
+ $color = (-t STDOUT);
+} else {
+ die "Invalid color mode: $color\n";
}
sub hash_save_array_words {
sub hash_show_words {
my ($hashRef, $prefix) = @_;
- if ($quiet == 0 && keys %$hashRef) {
- print "NOTE: $prefix message types:";
+ if (keys %$hashRef) {
+ print "\nNOTE: $prefix message types:";
foreach my $word (sort keys %$hashRef) {
print " $word";
}
- print "\n\n";
+ print "\n";
}
}
__init_refok|
__kprobes|
__ref|
- __rcu
+ __rcu|
+ __private
}x;
our $InitAttributePrefix = qr{__(?:mem|cpu|dev|net_|)};
our $InitAttributeData = qr{$InitAttributePrefix(?:initdata\b)};
__percpu|
__nocast|
__safe|
- __bitwise__|
+ __bitwise|
__packed__|
__packed2__|
__naked|
__noreturn|
__used|
__cold|
+ __pure|
__noclone|
__deprecated|
__read_mostly|
__weak
}x;
our $Modifier;
-our $Inline = qr{inline|__always_inline|noinline};
+our $Inline = qr{inline|__always_inline|noinline|__inline|__inline__};
our $Member = qr{->$Ident|\.$Ident|\[[^]]*\]};
our $Lval = qr{$Ident(?:$Member)*};
our $Binary = qr{(?i)0b[01]+$Int_type?};
our $Hex = qr{(?i)0x[0-9a-f]+$Int_type?};
our $Int = qr{[0-9]+$Int_type?};
+our $Octal = qr{0[0-7]+$Int_type?};
+our $String = qr{"[X\t]*"};
our $Float_hex = qr{(?i)0x[0-9a-f]+p-?[0-9]+[fl]?};
our $Float_dec = qr{(?i)(?:[0-9]+\.[0-9]*|[0-9]*\.[0-9]+)(?:e-?[0-9]+)?[fl]?};
our $Float_int = qr{(?i)[0-9]+e-?[0-9]+[fl]?};
our $Float = qr{$Float_hex|$Float_dec|$Float_int};
-our $Constant = qr{$Float|$Binary|$Hex|$Int};
+our $Constant = qr{$Float|$Binary|$Octal|$Hex|$Int};
our $Assignment = qr{\*\=|/=|%=|\+=|-=|<<=|>>=|&=|\^=|\|=|=};
-our $Compare = qr{<=|>=|==|!=|<|>};
+our $Compare = qr{<=|>=|==|!=|<|(?<!-)>};
our $Arithmetic = qr{\+|-|\*|\/|%};
our $Operators = qr{
<=|>=|==|!=|
&&|\|\||,|\^|\+\+|--|&|\||$Arithmetic
}x;
+our $c90_Keywords = qr{do|for|while|if|else|return|goto|continue|switch|default|case|break}x;
+
+our $BasicType;
our $NonptrType;
+our $NonptrTypeMisordered;
our $NonptrTypeWithAttr;
our $Type;
+our $TypeMisordered;
our $Declare;
+our $DeclareMisordered;
our $NON_ASCII_UTF8 = qr{
[\xC2-\xDF][\x80-\xBF] # non-overlong 2-byte
| $NON_ASCII_UTF8
}x;
-our $typeTypedefs = qr{(?x:
+our $typeC99Typedefs = qr{(?:__)?(?:[us]_?)?int_?(?:8|16|32|64)_t};
+our $typeOtherOSTypedefs = qr{(?x:
+ u_(?:char|short|int|long) | # bsd
+ u(?:nchar|short|int|long) # sysv
+)};
+our $typeKernelTypedefs = qr{(?x:
(?:__)?(?:u|s|be|le)(?:8|16|32|64)|
atomic_t
)};
+our $typeTypedefs = qr{(?x:
+ $typeC99Typedefs\b|
+ $typeOtherOSTypedefs\b|
+ $typeKernelTypedefs\b
+)};
+
+our $zero_initializer = qr{(?:(?:0[xX])?0+$Int_type?|NULL|false)\b};
our $logFunctions = qr{(?x:
- printk(?:_ratelimited|_once|)|
+ printk(?:_ratelimited|_once|_deferred_once|_deferred|)|
(?:[a-z0-9]+_){1,2}(?:printk|emerg|alert|crit|err|warning|warn|notice|info|debug|dbg|vdbg|devel|cont|WARN)(?:_ratelimited|_once|)|
WARN(?:_RATELIMIT|_ONCE|)|
panic|
- debug|
- printf|
- puts|
MODULE_[A-Z_]+|
seq_vprintf|seq_printf|seq_puts
)};
Cc:
)};
+our @typeListMisordered = (
+ qr{char\s+(?:un)?signed},
+ qr{int\s+(?:(?:un)?signed\s+)?short\s},
+ qr{int\s+short(?:\s+(?:un)?signed)},
+ qr{short\s+int(?:\s+(?:un)?signed)},
+ qr{(?:un)?signed\s+int\s+short},
+ qr{short\s+(?:un)?signed},
+ qr{long\s+int\s+(?:un)?signed},
+ qr{int\s+long\s+(?:un)?signed},
+ qr{long\s+(?:un)?signed\s+int},
+ qr{int\s+(?:un)?signed\s+long},
+ qr{int\s+(?:un)?signed},
+ qr{int\s+long\s+long\s+(?:un)?signed},
+ qr{long\s+long\s+int\s+(?:un)?signed},
+ qr{long\s+long\s+(?:un)?signed\s+int},
+ qr{long\s+long\s+(?:un)?signed},
+ qr{long\s+(?:un)?signed},
+);
+
our @typeList = (
qr{void},
- qr{(?:unsigned\s+)?char},
- qr{(?:unsigned\s+)?short},
- qr{(?:unsigned\s+)?int},
- qr{(?:unsigned\s+)?long},
- qr{(?:unsigned\s+)?long\s+int},
- qr{(?:unsigned\s+)?long\s+long},
- qr{(?:unsigned\s+)?long\s+long\s+int},
- qr{unsigned},
+ qr{(?:(?:un)?signed\s+)?char},
+ qr{(?:(?:un)?signed\s+)?short\s+int},
+ qr{(?:(?:un)?signed\s+)?short},
+ qr{(?:(?:un)?signed\s+)?int},
+ qr{(?:(?:un)?signed\s+)?long\s+int},
+ qr{(?:(?:un)?signed\s+)?long\s+long\s+int},
+ qr{(?:(?:un)?signed\s+)?long\s+long},
+ qr{(?:(?:un)?signed\s+)?long},
+ qr{(?:un)?signed},
qr{float},
qr{double},
qr{bool},
qr{${Ident}_t},
qr{${Ident}_handler},
qr{${Ident}_handler_fn},
+ @typeListMisordered,
);
+
+our $C90_int_types = qr{(?x:
+ long\s+long\s+int\s+(?:un)?signed|
+ long\s+long\s+(?:un)?signed\s+int|
+ long\s+long\s+(?:un)?signed|
+ (?:(?:un)?signed\s+)?long\s+long\s+int|
+ (?:(?:un)?signed\s+)?long\s+long|
+ int\s+long\s+long\s+(?:un)?signed|
+ int\s+(?:(?:un)?signed\s+)?long\s+long|
+
+ long\s+int\s+(?:un)?signed|
+ long\s+(?:un)?signed\s+int|
+ long\s+(?:un)?signed|
+ (?:(?:un)?signed\s+)?long\s+int|
+ (?:(?:un)?signed\s+)?long|
+ int\s+long\s+(?:un)?signed|
+ int\s+(?:(?:un)?signed\s+)?long|
+
+ int\s+(?:un)?signed|
+ (?:(?:un)?signed\s+)?int
+)};
+
+our @typeListFile = ();
our @typeListWithAttr = (
@typeList,
qr{struct\s+$InitAttribute\s+$Ident},
our @modifierList = (
qr{fastcall},
);
+our @modifierListFile = ();
+
+our @mode_permission_funcs = (
+ ["module_param", 3],
+ ["module_param_(?:array|named|string)", 4],
+ ["module_param_array_named", 5],
+ ["debugfs_create_(?:file|u8|u16|u32|u64|x8|x16|x32|x64|size_t|atomic_t|bool|blob|regset32|u32_array)", 2],
+ ["proc_create(?:_data|)", 2],
+ ["(?:CLASS|DEVICE|SENSOR|SENSOR_DEVICE|IIO_DEVICE)_ATTR", 2],
+ ["IIO_DEV_ATTR_[A-Z_]+", 1],
+ ["SENSOR_(?:DEVICE_|)ATTR_2", 2],
+ ["SENSOR_TEMPLATE(?:_2|)", 3],
+ ["__ATTR", 2],
+);
+
+#Create a search pattern for all these functions to speed up a loop below
+our $mode_perms_search = "";
+foreach my $entry (@mode_permission_funcs) {
+ $mode_perms_search .= '|' if ($mode_perms_search ne "");
+ $mode_perms_search .= $entry->[0];
+}
+
+our $mode_perms_world_writable = qr{
+ S_IWUGO |
+ S_IWOTH |
+ S_IRWXUGO |
+ S_IALLUGO |
+ 0[0-7][0-7][2367]
+}x;
+
+our %mode_permission_string_types = (
+ "S_IRWXU" => 0700,
+ "S_IRUSR" => 0400,
+ "S_IWUSR" => 0200,
+ "S_IXUSR" => 0100,
+ "S_IRWXG" => 0070,
+ "S_IRGRP" => 0040,
+ "S_IWGRP" => 0020,
+ "S_IXGRP" => 0010,
+ "S_IRWXO" => 0007,
+ "S_IROTH" => 0004,
+ "S_IWOTH" => 0002,
+ "S_IXOTH" => 0001,
+ "S_IRWXUGO" => 0777,
+ "S_IRUGO" => 0444,
+ "S_IWUGO" => 0222,
+ "S_IXUGO" => 0111,
+);
+
+#Create a search pattern for all these strings to speed up a loop below
+our $mode_perms_string_search = "";
+foreach my $entry (keys %mode_permission_string_types) {
+ $mode_perms_string_search .= '|' if ($mode_perms_string_search ne "");
+ $mode_perms_string_search .= $entry;
+}
our $allowed_asm_includes = qr{(?x:
irq|
- memory
+ memory|
+ time|
+ reboot
)};
# memory.h: ARM has a custom one
$misspellings = join("|", sort keys %spelling_fix) if keys %spelling_fix;
+sub read_words {
+ my ($wordsRef, $file) = @_;
+
+ if (open(my $words, '<', $file)) {
+ while (<$words>) {
+ my $line = $_;
+
+ $line =~ s/\s*\n?$//g;
+ $line =~ s/^\s*//g;
+
+ next if ($line =~ m/^\s*#/);
+ next if ($line =~ m/^\s*$/);
+ if ($line =~ /\s/) {
+ print("$file: '$line' invalid - ignored\n");
+ next;
+ }
+
+ $$wordsRef .= '|' if ($$wordsRef ne "");
+ $$wordsRef .= $line;
+ }
+ close($file);
+ return 1;
+ }
+
+ return 0;
+}
+
+my $const_structs = "";
+read_words(\$const_structs, $conststructsfile)
+ or warn "No structs that should be const will be found - file '$conststructsfile': $!\n";
+
+my $typeOtherTypedefs = "";
+if (length($typedefsfile)) {
+ read_words(\$typeOtherTypedefs, $typedefsfile)
+ or warn "No additional types will be considered - file '$typedefsfile': $!\n";
+}
+$typeTypedefs .= '|' . $typeOtherTypedefs if ($typeOtherTypedefs ne "");
sub build_types {
- my $mods = "(?x: \n" . join("|\n ", @modifierList) . "\n)";
- my $all = "(?x: \n" . join("|\n ", @typeList) . "\n)";
+ my $mods = "(?x: \n" . join("|\n ", (@modifierList, @modifierListFile)) . "\n)";
+ my $all = "(?x: \n" . join("|\n ", (@typeList, @typeListFile)) . "\n)";
+ my $Misordered = "(?x: \n" . join("|\n ", @typeListMisordered) . "\n)";
my $allWithAttr = "(?x: \n" . join("|\n ", @typeListWithAttr) . "\n)";
$Modifier = qr{(?:$Attribute|$Sparse|$mods)};
+ $BasicType = qr{
+ (?:$typeTypedefs\b)|
+ (?:${all}\b)
+ }x;
$NonptrType = qr{
(?:$Modifier\s+|const\s+)*
(?:
)
(?:\s+$Modifier|\s+const)*
}x;
+ $NonptrTypeMisordered = qr{
+ (?:$Modifier\s+|const\s+)*
+ (?:
+ (?:${Misordered}\b)
+ )
+ (?:\s+$Modifier|\s+const)*
+ }x;
$NonptrTypeWithAttr = qr{
(?:$Modifier\s+|const\s+)*
(?:
}x;
$Type = qr{
$NonptrType
- (?:(?:\s|\*|\[\])+\s*const|(?:\s|\*|\[\])+|(?:\s*\[\s*\])+)?
+ (?:(?:\s|\*|\[\])+\s*const|(?:\s|\*\s*(?:const\s*)?|\[\])+|(?:\s*\[\s*\])+)?
+ (?:\s+$Inline|\s+$Modifier)*
+ }x;
+ $TypeMisordered = qr{
+ $NonptrTypeMisordered
+ (?:(?:\s|\*|\[\])+\s*const|(?:\s|\*\s*(?:const\s*)?|\[\])+|(?:\s*\[\s*\])+)?
(?:\s+$Inline|\s+$Modifier)*
}x;
- $Declare = qr{(?:$Storage\s+)?$Type};
+ $Declare = qr{(?:$Storage\s+(?:$Inline\s+)?)?$Type};
+ $DeclareMisordered = qr{(?:$Storage\s+(?:$Inline\s+)?)?$TypeMisordered};
}
build_types();
# Any use must be runtime checked with $^V
our $balanced_parens = qr/(\((?:[^\(\)]++|(?-1))*\))/;
-our $LvalOrFunc = qr{($Lval)\s*($balanced_parens{0,1})\s*};
-our $FuncArg = qr{$Typecast{0,1}($LvalOrFunc|$Constant)};
+our $LvalOrFunc = qr{((?:[\&\*]\s*)?$Lval)\s*($balanced_parens{0,1})\s*};
+our $FuncArg = qr{$Typecast{0,1}($LvalOrFunc|$Constant|$String)};
+
+our $declaration_macros = qr{(?x:
+ (?:$Storage\s+)?(?:[A-Z_][A-Z0-9]*_){0,2}(?:DEFINE|DECLARE)(?:_[A-Z0-9]+){1,6}\s*\(|
+ (?:$Storage\s+)?[HLP]?LIST_HEAD\s*\(|
+ (?:$Storage\s+)?${Type}\s+uninitialized_var\s*\(
+)};
sub deparenthesize {
my ($string) = @_;
return "" if (!defined($string));
- $string =~ s@^\s*\(\s*@@g;
- $string =~ s@\s*\)\s*$@@g;
+
+ while ($string =~ /^\s*\(.*\)\s*$/) {
+ $string =~ s@^\s*\(\s*@@;
+ $string =~ s@\s*\)\s*$@@;
+ }
+
$string =~ s@\s+@ @g;
+
return $string;
}
}
}
+sub is_maintained_obsolete {
+ my ($filename) = @_;
+
+ return 0 if (!$tree || !(-e "$root/scripts/get_maintainer.pl"));
+
+ my $status = `perl $root/scripts/get_maintainer.pl --status --nom --nol --nogit --nogit-fallback -f $filename 2>&1`;
+
+ return $status =~ /obsolete/i;
+}
+
my $camelcase_seeded = 0;
sub seed_camelcase_includes {
return if ($camelcase_seeded);
}
}
+sub git_commit_info {
+ my ($commit, $id, $desc) = @_;
+
+ return ($id, $desc) if ((which("git") eq "") || !(-e ".git"));
+
+ my $output = `git log --no-color --format='%H %s' -1 $commit 2>&1`;
+ $output =~ s/^\s*//gm;
+ my @lines = split("\n", $output);
+
+ return ($id, $desc) if ($#lines < 0);
+
+ if ($lines[0] =~ /^error: short SHA1 $commit is ambiguous\./) {
+# Maybe one day convert this block of bash into something that returns
+# all matching commit ids, but it's very slow...
+#
+# echo "checking commits $1..."
+# git rev-list --remotes | grep -i "^$1" |
+# while read line ; do
+# git log --format='%H %s' -1 $line |
+# echo "commit $(cut -c 1-12,41-)"
+# done
+ } elsif ($lines[0] =~ /^fatal: ambiguous argument '$commit': unknown revision or path not in the working tree\./) {
+ $id = undef;
+ } else {
+ $id = substr($lines[0], 0, 12);
+ $desc = substr($lines[0], 41);
+ }
+
+ return ($id, $desc);
+}
+
$chk_signoff = 0 if ($file);
my @rawlines = ();
my @lines = ();
my @fixed = ();
-my $vname;
+my @fixed_inserted = ();
+my @fixed_deleted = ();
my $fixlinenr = -1;
+# If input is git commits, extract all commits from the commit expressions.
+# For example, HEAD-3 means we need check 'HEAD, HEAD~1, HEAD~2'.
+die "$P: No git repository found\n" if ($git && !-e ".git");
+
+if ($git) {
+ my @commits = ();
+ foreach my $commit_expr (@ARGV) {
+ my $git_range;
+ if ($commit_expr =~ m/^(.*)-(\d+)$/) {
+ $git_range = "-$2 $1";
+ } elsif ($commit_expr =~ m/\.\./) {
+ $git_range = "$commit_expr";
+ } else {
+ $git_range = "-1 $commit_expr";
+ }
+ my $lines = `git log --no-color --no-merges --pretty=format:'%H %s' $git_range`;
+ foreach my $line (split(/\n/, $lines)) {
+ $line =~ /^([0-9a-fA-F]{40,40}) (.*)$/;
+ next if (!defined($1) || !defined($2));
+ my $sha1 = $1;
+ my $subject = $2;
+ unshift(@commits, $sha1);
+ $git_commits{$sha1} = $subject;
+ }
+ }
+ die "$P: no git commits after extraction!\n" if (@commits == 0);
+ @ARGV = @commits;
+}
+
+my $vname;
for my $filename (@ARGV) {
my $FILE;
- if ($file) {
+ if ($git) {
+ open($FILE, '-|', "git format-patch -M --stdout -1 $filename") ||
+ die "$P: $filename: git format-patch failed - $!\n";
+ } elsif ($file) {
open($FILE, '-|', "diff -u /dev/null $filename") ||
die "$P: $filename: diff failed - $!\n";
} elsif ($filename eq '-') {
}
if ($filename eq '-') {
$vname = 'Your patch';
+ } elsif ($git) {
+ $vname = "Commit " . substr($filename, 0, 12) . ' ("' . $git_commits{$filename} . '")';
} else {
$vname = $filename;
}
push(@rawlines, $_);
}
close($FILE);
+
+ if ($#ARGV > 0 && $quiet == 0) {
+ print '-' x length($vname) . "\n";
+ print "$vname\n";
+ print '-' x length($vname) . "\n";
+ }
+
if (!process($filename)) {
$exit = 1;
}
@rawlines = ();
@lines = ();
@fixed = ();
+ @fixed_inserted = ();
+ @fixed_deleted = ();
+ $fixlinenr = -1;
+ @modifierListFile = ();
+ @typeListFile = ();
+ build_types();
+}
+
+if (!$quiet) {
+ hash_show_words(\%use_type, "Used");
+ hash_show_words(\%ignore_type, "Ignored");
+
+ if ($^V lt 5.10.0) {
+ print << "EOM"
+
+NOTE: perl $^V is not modern enough to detect all possible issues.
+ An upgrade to at least perl v5.10.0 is suggested.
+EOM
+ }
+ if ($exit) {
+ print << "EOM"
+
+NOTE: If any of the errors are false positives, please report
+ them to the maintainer, see CHECKPATCH in MAINTAINERS.
+EOM
+ }
}
exit($exit);
return $formatted_email;
}
+sub which {
+ my ($bin) = @_;
+
+ foreach my $path (split(/:/, $ENV{PATH})) {
+ if (-e "$path/$bin") {
+ return "$path/$bin";
+ }
+ }
+
+ return "";
+}
+
sub which_conf {
my ($conf) = @_;
$res =~ s@(\#\s*(?:error|warning)\s+).*@$1$clean@;
}
+ if ($allow_c99_comments && $res =~ m@(//.*$)@) {
+ my $match = $1;
+ $res =~ s/\Q$match\E/"$;" x length($match)/e;
+ }
+
return $res;
}
sub get_quoted_string {
my ($line, $rawline) = @_;
- return "" if ($line !~ m/(\"[X]+\")/g);
+ return "" if ($line !~ m/($String)/g);
return substr($rawline, $-[0], $+[0] - $-[0]);
}
for my $modifier (split(' ', $possible)) {
if ($modifier !~ $notPermitted) {
warn "MODIFIER: $modifier ($possible) ($line)\n" if ($dbg_possible);
- push(@modifierList, $modifier);
+ push(@modifierListFile, $modifier);
}
}
} else {
warn "POSSIBLE: $possible ($line)\n" if ($dbg_possible);
- push(@typeList, $possible);
+ push(@typeListFile, $possible);
}
build_types();
} else {
my $prefix = '';
sub show_type {
- return defined $use_type{$_[0]} if (scalar keys %use_type > 0);
+ my ($type) = @_;
+
+ $type =~ tr/[a-z]/[A-Z]/;
- return !defined $ignore_type{$_[0]};
+ return defined $use_type{$type} if (scalar keys %use_type > 0);
+
+ return !defined $ignore_type{$type};
}
sub report {
- if (!show_type($_[1]) ||
- (defined $tst_only && $_[2] !~ /\Q$tst_only\E/)) {
+ my ($level, $type, $msg) = @_;
+
+ if (!show_type($type) ||
+ (defined $tst_only && $msg !~ /\Q$tst_only\E/)) {
return 0;
}
- my $line;
+ my $output = '';
+ if ($color) {
+ if ($level eq 'ERROR') {
+ $output .= RED;
+ } elsif ($level eq 'WARNING') {
+ $output .= YELLOW;
+ } else {
+ $output .= GREEN;
+ }
+ }
+ $output .= $prefix . $level . ':';
if ($show_types) {
- $line = "$prefix$_[0]:$_[1]: $_[2]\n";
- } else {
- $line = "$prefix$_[0]: $_[2]\n";
+ $output .= BLUE if ($color);
+ $output .= "$type:";
+ }
+ $output .= RESET if ($color);
+ $output .= ' ' . $msg . "\n";
+
+ if ($showfile) {
+ my @lines = split("\n", $output, -1);
+ splice(@lines, 1, 1);
+ $output = join("\n", @lines);
}
- $line = (split('\n', $line))[0] . "\n" if ($terse);
+ $output = (split('\n', $output))[0] . "\n" if ($terse);
- push(our @report, $line);
+ push(our @report, $output);
return 1;
}
+
sub report_dump {
our @report;
}
+sub fixup_current_range {
+ my ($lineRef, $offset, $length) = @_;
+
+ if ($$lineRef =~ /^\@\@ -\d+,\d+ \+(\d+),(\d+) \@\@/) {
+ my $o = $1;
+ my $l = $2;
+ my $no = $o + $offset;
+ my $nl = $l + $length;
+ $$lineRef =~ s/\+$o,$l \@\@/\+$no,$nl \@\@/;
+ }
+}
+
+sub fix_inserted_deleted_lines {
+ my ($linesRef, $insertedRef, $deletedRef) = @_;
+
+ my $range_last_linenr = 0;
+ my $delta_offset = 0;
+
+ my $old_linenr = 0;
+ my $new_linenr = 0;
+
+ my $next_insert = 0;
+ my $next_delete = 0;
+
+ my @lines = ();
+
+ my $inserted = @{$insertedRef}[$next_insert++];
+ my $deleted = @{$deletedRef}[$next_delete++];
+
+ foreach my $old_line (@{$linesRef}) {
+ my $save_line = 1;
+ my $line = $old_line; #don't modify the array
+ if ($line =~ /^(?:\+\+\+|\-\-\-)\s+\S+/) { #new filename
+ $delta_offset = 0;
+ } elsif ($line =~ /^\@\@ -\d+,\d+ \+\d+,\d+ \@\@/) { #new hunk
+ $range_last_linenr = $new_linenr;
+ fixup_current_range(\$line, $delta_offset, 0);
+ }
+
+ while (defined($deleted) && ${$deleted}{'LINENR'} == $old_linenr) {
+ $deleted = @{$deletedRef}[$next_delete++];
+ $save_line = 0;
+ fixup_current_range(\$lines[$range_last_linenr], $delta_offset--, -1);
+ }
+
+ while (defined($inserted) && ${$inserted}{'LINENR'} == $old_linenr) {
+ push(@lines, ${$inserted}{'LINE'});
+ $inserted = @{$insertedRef}[$next_insert++];
+ $new_linenr++;
+ fixup_current_range(\$lines[$range_last_linenr], $delta_offset++, 1);
+ }
+
+ if ($save_line) {
+ push(@lines, $line);
+ $new_linenr++;
+ }
+
+ $old_linenr++;
+ }
+
+ return @lines;
+}
+
+sub fix_insert_line {
+ my ($linenr, $line) = @_;
+
+ my $inserted = {
+ LINENR => $linenr,
+ LINE => $line,
+ };
+ push(@fixed_inserted, $inserted);
+}
+
+sub fix_delete_line {
+ my ($linenr, $line) = @_;
+
+ my $deleted = {
+ LINENR => $linenr,
+ LINE => $line,
+ };
+
+ push(@fixed_deleted, $deleted);
+}
+
sub ERROR {
- if (report("ERROR", $_[0], $_[1])) {
+ my ($type, $msg) = @_;
+
+ if (report("ERROR", $type, $msg)) {
our $clean = 0;
our $cnt_error++;
return 1;
return 0;
}
sub WARN {
- if (report("WARNING", $_[0], $_[1])) {
+ my ($type, $msg) = @_;
+
+ if (report("WARNING", $type, $msg)) {
our $clean = 0;
our $cnt_warn++;
return 1;
return 0;
}
sub CHK {
- if ($check && report("CHECK", $_[0], $_[1])) {
+ my ($type, $msg) = @_;
+
+ if ($check && report("CHECK", $type, $msg)) {
our $clean = 0;
our $cnt_chk++;
return 1;
}
}
- return $last_openparen + 1;
+ return length(expand_tabs(substr($line, 0, $last_openparen))) + 1;
}
sub process {
our $clean = 1;
my $signoff = 0;
my $is_patch = 0;
-
- my $in_header_lines = 1;
+ my $in_header_lines = $file ? 0 : 1;
my $in_commit_log = 0; #Scanning lines before patch
-
+ my $has_commit_log = 0; #Encountered lines before patch
+ my $commit_log_possible_stack_dump = 0;
+ my $commit_log_long_line = 0;
+ my $commit_log_has_diff = 0;
+ my $reported_maintainer_file = 0;
my $non_utf8_charset = 0;
+ my $last_blank_line = 0;
+ my $last_coalesced_string_linenr = -1;
+
our @report = ();
our $cnt_lines = 0;
our $cnt_error = 0;
my $realline = 0;
my $realcnt = 0;
my $here = '';
+ my $context_function; #undef'd unless there's a known function
my $in_comment = 0;
my $comment_edge = 0;
my $first_line = 0;
if ($rawline=~/^\+\+\+\s+(\S+)/) {
$setup_docs = 0;
- if ($1 =~ m@Documentation/kernel-parameters.txt$@) {
+ if ($1 =~ m@Documentation/admin-guide/kernel-parameters.rst$@) {
$setup_docs = 1;
}
#next;
}
- if ($rawline=~/^\@\@ -\d+(?:,\d+)? \+(\d+)(,(\d+))? \@\@/) {
+ if ($rawline =~ /^\@\@ -\d+(?:,\d+)? \+(\d+)(,(\d+))? \@\@/) {
$realline=$1-1;
if (defined $2) {
$realcnt=$3+1;
$realcnt = 0;
$linenr = 0;
+ $fixlinenr = -1;
foreach my $line (@lines) {
$linenr++;
+ $fixlinenr++;
my $sline = $line; #copy of $line
$sline =~ s/$;/ /g; #with comments as spaces
my $rawline = $rawlines[$linenr - 1];
#extract the line range in the file after the patch is applied
- if ($line=~/^\@\@ -\d+(?:,\d+)? \+(\d+)(,(\d+))? \@\@/) {
+ if (!$in_commit_log &&
+ $line =~ /^\@\@ -\d+(?:,\d+)? \+(\d+)(,(\d+))? \@\@(.*)/) {
+ my $context = $4;
$is_patch = 1;
$first_line = $linenr + 1;
$realline=$1-1;
%suppress_whiletrailers = ();
%suppress_export = ();
$suppress_statement = 0;
+ if ($context =~ /\b(\w+)\s*\(/) {
+ $context_function = $1;
+ } else {
+ undef $context_function;
+ }
next;
# track the line number as we move through the hunk, note that
my $hunk_line = ($realcnt != 0);
-#make up the handle for any error we report on this line
- $prefix = "$filename:$realline: " if ($emacs && $file);
- $prefix = "$filename:$linenr: " if ($emacs && !$file);
-
$here = "#$linenr: " if (!$file);
$here = "#$realline: " if ($file);
+ my $found_file = 0;
# extract the filename as it passes
if ($line =~ /^diff --git.*?(\S+)$/) {
$realfile = $1;
$realfile =~ s@^([^/]*)/@@ if (!$file);
$in_commit_log = 0;
+ $found_file = 1;
} elsif ($line =~ /^\+\+\+\s+(\S+)/) {
$realfile = $1;
$realfile =~ s@^([^/]*)/@@ if (!$file);
ERROR("MODIFIED_INCLUDE_ASM",
"do not modify files in include/asm, change architecture specific files in include/asm-<architecture>\n" . "$here$rawline\n");
}
+ $found_file = 1;
+ }
+
+#make up the handle for any error we report on this line
+ if ($showfile) {
+ $prefix = "$realfile:$realline: "
+ } elsif ($emacs) {
+ if ($file) {
+ $prefix = "$filename:$realline: ";
+ } else {
+ $prefix = "$filename:$linenr: ";
+ }
+ }
+
+ if ($found_file) {
+ if (is_maintained_obsolete($realfile)) {
+ WARN("OBSOLETE",
+ "$realfile is marked as 'obsolete' in the MAINTAINERS hierarchy. No unnecessary modifications please.\n");
+ }
+ if ($realfile =~ m@^(?:drivers/net/|net/|drivers/staging/)@) {
+ $check = 1;
+ } else {
+ $check = $check_orig;
+ }
next;
}
$cnt_lines++ if ($realcnt != 0);
+# Check if the commit log has what seems like a diff which can confuse patch
+ if ($in_commit_log && !$commit_log_has_diff &&
+ (($line =~ m@^\s+diff\b.*a/[\w/]+@ &&
+ $line =~ m@^\s+diff\b.*a/([\w/]+)\s+b/$1\b@) ||
+ $line =~ m@^\s*(?:\-\-\-\s+a/|\+\+\+\s+b/)@ ||
+ $line =~ m/^\s*\@\@ \-\d+,\d+ \+\d+,\d+ \@\@/)) {
+ ERROR("DIFF_IN_COMMIT_MSG",
+ "Avoid using diff content in the commit message - patch(1) might not work\n" . $herecurr);
+ $commit_log_has_diff = 1;
+ }
+
# Check for incorrect file permissions
if ($line =~ /^new (file )?mode.*[7531]\d{0,2}$/) {
my $permhere = $here . "FILE: $realfile\n";
$in_commit_log = 0;
}
+# Check if MAINTAINERS is being updated. If so, there's probably no need to
+# emit the "does MAINTAINERS need updating?" message on file add/move/delete
+ if ($line =~ /^\s*MAINTAINERS\s*\|/) {
+ $reported_maintainer_file = 1;
+ }
+
# Check signature styles
if (!$in_header_lines &&
$line =~ /^(\s*)([a-z0-9_-]+by:|$signature_tags)(\s*)(.*)/i) {
if (WARN("BAD_SIGN_OFF",
"Do not use whitespace before $ucfirst_sign_off\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =
+ $fixed[$fixlinenr] =
"$ucfirst_sign_off $email";
}
}
if (WARN("BAD_SIGN_OFF",
"'$ucfirst_sign_off' is the preferred signature form\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =
+ $fixed[$fixlinenr] =
"$ucfirst_sign_off $email";
}
if (WARN("BAD_SIGN_OFF",
"Use a single space after $ucfirst_sign_off\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =
+ $fixed[$fixlinenr] =
"$ucfirst_sign_off $email";
}
}
}
}
+# Check email subject for common tools that don't need to be mentioned
+ if ($in_header_lines &&
+ $line =~ /^Subject:.*\b(?:checkpatch|sparse|smatch)\b[^:]/i) {
+ WARN("EMAIL_SUBJECT",
+ "A patch subject line should describe the change not the tool that found it\n" . $herecurr);
+ }
+
+# Check for old stable address
+ if ($line =~ /^\s*cc:\s*.*<?\bstable\@kernel\.org\b>?.*$/i) {
+ ERROR("STABLE_ADDRESS",
+ "The 'stable' address should be 'stable\@vger.kernel.org'\n" . $herecurr);
+ }
+
+# Check for unwanted Gerrit info
+ if ($in_commit_log && $line =~ /^\s*change-id:/i) {
+ ERROR("GERRIT_CHANGE_ID",
+ "Remove Gerrit Change-Id's before submitting upstream.\n" . $herecurr);
+ }
+
+# Check if the commit log is in a possible stack dump
+ if ($in_commit_log && !$commit_log_possible_stack_dump &&
+ ($line =~ /^\s*(?:WARNING:|BUG:)/ ||
+ $line =~ /^\s*\[\s*\d+\.\d{6,6}\s*\]/ ||
+ # timestamp
+ $line =~ /^\s*\[\<[0-9a-fA-F]{8,}\>\]/)) {
+ # stack dump address
+ $commit_log_possible_stack_dump = 1;
+ }
+
+# Check for line lengths > 75 in commit log, warn once
+ if ($in_commit_log && !$commit_log_long_line &&
+ length($line) > 75 &&
+ !($line =~ /^\s*[a-zA-Z0-9_\/\.]+\s+\|\s+\d+/ ||
+ # file delta changes
+ $line =~ /^\s*(?:[\w\.\-]+\/)++[\w\.\-]+:/ ||
+ # filename then :
+ $line =~ /^\s*(?:Fixes:|Link:)/i ||
+ # A Fixes: or Link: line
+ $commit_log_possible_stack_dump)) {
+ WARN("COMMIT_LOG_LONG_LINE",
+ "Possible unwrapped commit description (prefer a maximum 75 chars per line)\n" . $herecurr);
+ $commit_log_long_line = 1;
+ }
+
+# Reset possible stack dump if a blank line is found
+ if ($in_commit_log && $commit_log_possible_stack_dump &&
+ $line =~ /^\s*$/) {
+ $commit_log_possible_stack_dump = 0;
+ }
+
+# Check for git id commit length and improperly formed commit descriptions
+ if ($in_commit_log && !$commit_log_possible_stack_dump &&
+ $line !~ /^\s*(?:Link|Patchwork|http|https|BugLink):/i &&
+ $line !~ /^This reverts commit [0-9a-f]{7,40}/ &&
+ ($line =~ /\bcommit\s+[0-9a-f]{5,}\b/i ||
+ ($line =~ /(?:\s|^)[0-9a-f]{12,40}(?:[\s"'\(\[]|$)/i &&
+ $line !~ /[\<\[][0-9a-f]{12,40}[\>\]]/i &&
+ $line !~ /\bfixes:\s*[0-9a-f]{12,40}/i))) {
+ my $init_char = "c";
+ my $orig_commit = "";
+ my $short = 1;
+ my $long = 0;
+ my $case = 1;
+ my $space = 1;
+ my $hasdesc = 0;
+ my $hasparens = 0;
+ my $id = '0123456789ab';
+ my $orig_desc = "commit description";
+ my $description = "";
+
+ if ($line =~ /\b(c)ommit\s+([0-9a-f]{5,})\b/i) {
+ $init_char = $1;
+ $orig_commit = lc($2);
+ } elsif ($line =~ /\b([0-9a-f]{12,40})\b/i) {
+ $orig_commit = lc($1);
+ }
+
+ $short = 0 if ($line =~ /\bcommit\s+[0-9a-f]{12,40}/i);
+ $long = 1 if ($line =~ /\bcommit\s+[0-9a-f]{41,}/i);
+ $space = 0 if ($line =~ /\bcommit [0-9a-f]/i);
+ $case = 0 if ($line =~ /\b[Cc]ommit\s+[0-9a-f]{5,40}[^A-F]/);
+ if ($line =~ /\bcommit\s+[0-9a-f]{5,}\s+\("([^"]+)"\)/i) {
+ $orig_desc = $1;
+ $hasparens = 1;
+ } elsif ($line =~ /\bcommit\s+[0-9a-f]{5,}\s*$/i &&
+ defined $rawlines[$linenr] &&
+ $rawlines[$linenr] =~ /^\s*\("([^"]+)"\)/) {
+ $orig_desc = $1;
+ $hasparens = 1;
+ } elsif ($line =~ /\bcommit\s+[0-9a-f]{5,}\s+\("[^"]+$/i &&
+ defined $rawlines[$linenr] &&
+ $rawlines[$linenr] =~ /^\s*[^"]+"\)/) {
+ $line =~ /\bcommit\s+[0-9a-f]{5,}\s+\("([^"]+)$/i;
+ $orig_desc = $1;
+ $rawlines[$linenr] =~ /^\s*([^"]+)"\)/;
+ $orig_desc .= " " . $1;
+ $hasparens = 1;
+ }
+
+ ($id, $description) = git_commit_info($orig_commit,
+ $id, $orig_desc);
+
+ if (defined($id) &&
+ ($short || $long || $space || $case || ($orig_desc ne $description) || !$hasparens)) {
+ ERROR("GIT_COMMIT_ID",
+ "Please use git commit description style 'commit <12+ chars of sha1> (\"<title line>\")' - ie: '${init_char}ommit $id (\"$description\")'\n" . $herecurr);
+ }
+ }
+
+# Check for added, moved or deleted files
+ if (!$reported_maintainer_file && !$in_commit_log &&
+ ($line =~ /^(?:new|deleted) file mode\s*\d+\s*$/ ||
+ $line =~ /^rename (?:from|to) [\w\/\.\-]+\s*$/ ||
+ ($line =~ /\{\s*([\w\/\.\-]*)\s*\=\>\s*([\w\/\.\-]*)\s*\}/ &&
+ (defined($1) || defined($2))))) {
+ $is_patch = 1;
+ $reported_maintainer_file = 1;
+ WARN("FILE_PATH_CHANGES",
+ "added, moved or deleted file(s), does MAINTAINERS need updating?\n" . $herecurr);
+ }
+
# Check for wrappage within a valid hunk of the file
if ($realcnt != 0 && $line !~ m{^(?:\+|-| |\\ No newline|$)}) {
ERROR("CORRUPTED_PATCH",
$herecurr) if (!$emitted_corrupt++);
}
-# Check for absolute kernel paths.
- if ($tree) {
- while ($line =~ m{(?:^|\s)(/\S*)}g) {
- my $file = $1;
-
- if ($file =~ m{^(.*?)(?::\d+)+:?$} &&
- check_absolute_file($1, $herecurr)) {
- #
- } else {
- check_absolute_file($file, $herecurr);
- }
- }
- }
-
# UTF-8 regex found at http://www.w3.org/International/questions/qa-forms-utf-8.en.php
if (($realfile =~ /^$/ || $line =~ /^\+/) &&
$rawline !~ m/^$UTF8*$/) {
# Check if it's the start of a commit log
# (not a header line and we haven't seen the patch filename)
if ($in_header_lines && $realfile =~ /^$/ &&
- $rawline !~ /^(commit\b|from\b|[\w-]+:).+$/i) {
+ !($rawline =~ /^\s+(?:\S|$)/ ||
+ $rawline =~ /^(?:commit\b|from\b|[\w-]+:)/i)) {
$in_header_lines = 0;
$in_commit_log = 1;
+ $has_commit_log = 1;
}
# Check if there is UTF-8 in a commit log when a mail header has explicitly
"8-bit UTF-8 used in possible commit log\n" . $herecurr);
}
+# Check for absolute kernel paths in commit message
+ if ($tree && $in_commit_log) {
+ while ($line =~ m{(?:^|\s)(/\S*)}g) {
+ my $file = $1;
+
+ if ($file =~ m{^(.*?)(?::\d+)+:?$} &&
+ check_absolute_file($1, $herecurr)) {
+ #
+ } else {
+ check_absolute_file($file, $herecurr);
+ }
+ }
+ }
+
# Check for various typo / spelling mistakes
if (defined($misspellings) &&
($in_commit_log || $line =~ /^(?:\+|Subject:)/i)) {
if (ERROR("DOS_LINE_ENDINGS",
"DOS line endings\n" . $herevet) &&
$fix) {
- $fixed[$linenr - 1] =~ s/[\s\015]+$//;
+ $fixed[$fixlinenr] =~ s/[\s\015]+$//;
}
} elsif ($rawline =~ /^\+.*\S\s+$/ || $rawline =~ /^\+\s+$/) {
my $herevet = "$here\n" . cat_vet($rawline) . "\n";
if (ERROR("TRAILING_WHITESPACE",
"trailing whitespace\n" . $herevet) &&
$fix) {
- $fixed[$linenr - 1] =~ s/\s+$//;
+ $fixed[$fixlinenr] =~ s/\s+$//;
}
$rpt_cleaners = 1;
# Check for FSF mailing addresses.
if ($rawline =~ /\bwrite to the Free/i ||
+ $rawline =~ /\b675\s+Mass\s+Ave/i ||
$rawline =~ /\b59\s+Temple\s+Pl/i ||
$rawline =~ /\b51\s+Franklin\s+St/i) {
my $herevet = "$here\n" . cat_vet($rawline) . "\n";
# Only applies when adding the entry originally, after that we do not have
# sufficient context to determine whether it is indeed long enough.
if ($realfile =~ /Kconfig/ &&
- $line =~ /.\s*config\s+/) {
+ $line =~ /^\+\s*config\s+/) {
my $length = 0;
my $cnt = $realcnt;
my $ln = $linenr + 1;
$is_end = $lines[$ln - 1] =~ /^\+/;
next if ($f =~ /^-/);
+ last if (!$file && $f =~ /^\@\@/);
- if ($lines[$ln - 1] =~ /.\s*(?:bool|tristate)\s*\"/) {
+ if ($lines[$ln - 1] =~ /^\+\s*(?:bool|tristate)\s*\"/) {
$is_start = 1;
- } elsif ($lines[$ln - 1] =~ /.\s*(?:---)?help(?:---)?$/) {
+ } elsif ($lines[$ln - 1] =~ /^\+\s*(?:---)?help(?:---)?$/) {
$length = -1;
}
}
$length++;
}
- WARN("CONFIG_DESCRIPTION",
- "please write a paragraph that describes the config symbol fully\n" . $herecurr) if ($is_start && $is_end && $length < 4);
+ if ($is_start && $is_end && $length < $min_conf_desc_length) {
+ WARN("CONFIG_DESCRIPTION",
+ "please write a paragraph that describes the config symbol fully\n" . $herecurr);
+ }
#print "is_start<$is_start> is_end<$is_end> length<$length>\n";
}
-# discourage the addition of CONFIG_EXPERIMENTAL in Kconfig.
+# check for MAINTAINERS entries that don't have the right form
+ if ($realfile =~ /^MAINTAINERS$/ &&
+ $rawline =~ /^\+[A-Z]:/ &&
+ $rawline !~ /^\+[A-Z]:\t\S/) {
+ if (WARN("MAINTAINERS_STYLE",
+ "MAINTAINERS entries use one tab after TYPE:\n" . $herecurr) &&
+ $fix) {
+ $fixed[$fixlinenr] =~ s/^(\+[A-Z]):\s*/$1:\t/;
+ }
+ }
+
+# discourage the use of boolean for type definition attributes of Kconfig options
if ($realfile =~ /Kconfig/ &&
- $line =~ /.\s*depends on\s+.*\bEXPERIMENTAL\b/) {
- WARN("CONFIG_EXPERIMENTAL",
- "Use of CONFIG_EXPERIMENTAL is deprecated. For alternatives, see https://lkml.org/lkml/2012/10/23/580\n");
+ $line =~ /^\+\s*\bboolean\b/) {
+ WARN("CONFIG_TYPE_BOOLEAN",
+ "Use of boolean is deprecated, please use bool instead.\n" . $herecurr);
}
if (($realfile =~ /Makefile.*/ || $realfile =~ /Kbuild.*/) &&
}
# check for DT compatible documentation
- if (defined $root && $realfile =~ /\.dts/ &&
- $rawline =~ /^\+\s*compatible\s*=/) {
+ if (defined $root &&
+ (($realfile =~ /\.dtsi?$/ && $line =~ /^\+\s*compatible\s*=\s*\"/) ||
+ ($realfile =~ /\.[ch]$/ && $line =~ /^\+.*\.compatible\s*=\s*\"/))) {
+
my @compats = $rawline =~ /\"([a-zA-Z0-9\-\,\.\+_]+)\"/g;
+ my $dt_path = $root . "/Documentation/devicetree/bindings/";
+ my $vp_file = $dt_path . "vendor-prefixes.txt";
+
foreach my $compat (@compats) {
my $compat2 = $compat;
- my $dt_path = $root . "/Documentation/devicetree/bindings/";
- $compat2 =~ s/\,[a-z]*\-/\,<\.\*>\-/;
- `grep -Erq "$compat|$compat2" $dt_path`;
+ $compat2 =~ s/\,[a-zA-Z0-9]*\-/\,<\.\*>\-/;
+ my $compat3 = $compat;
+ $compat3 =~ s/\,([a-z]*)[0-9]*\-/\,$1<\.\*>\-/;
+ `grep -Erq "$compat|$compat2|$compat3" $dt_path`;
if ( $? >> 8 ) {
WARN("UNDOCUMENTED_DT_STRING",
"DT compatible string \"$compat\" appears un-documented -- check $dt_path\n" . $herecurr);
}
- my $vendor = $compat;
- my $vendor_path = $dt_path . "vendor-prefixes.txt";
- next if (! -f $vendor_path);
- $vendor =~ s/^([a-zA-Z0-9]+)\,.*/$1/;
- `grep -Eq "$vendor" $vendor_path`;
+ next if $compat !~ /^([a-zA-Z0-9\-]+)\,/;
+ my $vendor = $1;
+ `grep -Eq "^$vendor\\b" $vp_file`;
if ( $? >> 8 ) {
WARN("UNDOCUMENTED_DT_STRING",
- "DT compatible string vendor \"$vendor\" appears un-documented -- check $vendor_path\n" . $herecurr);
+ "DT compatible string vendor \"$vendor\" appears un-documented -- check $vp_file\n" . $herecurr);
}
}
}
# check we are in a valid source file if not then ignore this hunk
- next if ($realfile !~ /\.(h|c|s|S|pl|sh)$/);
-
-#line length limit
- if ($line =~ /^\+/ && $prevrawline !~ /\/\*\*/ &&
- $rawline !~ /^.\s*\*\s*\@$Ident\s/ &&
- !($line =~ /^\+\s*$logFunctions\s*\(\s*(?:(KERN_\S+\s*|[^"]*))?"[X\t]*"\s*(?:|,|\)\s*;)\s*$/ ||
- $line =~ /^\+\s*"[^"]*"\s*(?:\s*|,|\)\s*;)\s*$/) &&
- $length > $max_line_length)
- {
- WARN("LONG_LINE",
- "line over $max_line_length characters\n" . $herecurr);
- }
+ next if ($realfile !~ /\.(h|c|s|S|sh|dtsi|dts)$/);
-# Check for user-visible strings broken across lines, which breaks the ability
-# to grep for the string. Make exceptions when the previous string ends in a
-# newline (multiple lines in one string constant) or '\t', '\r', ';', or '{'
-# (common in inline assembly) or is a octal \123 or hexadecimal \xaf value
- if ($line =~ /^\+\s*"/ &&
- $prevline =~ /"\s*$/ &&
- $prevrawline !~ /(?:\\(?:[ntr]|[0-7]{1,3}|x[0-9a-fA-F]{1,2})|;\s*|\{\s*)"\s*$/) {
- WARN("SPLIT_STRING",
- "quoted string split across lines\n" . $hereprev);
- }
+# line length limit (with some exclusions)
+#
+# There are a few types of lines that may extend beyond $max_line_length:
+# logging functions like pr_info that end in a string
+# lines with a single string
+# #defines that are a single string
+#
+# There are 3 different line length message types:
+# LONG_LINE_COMMENT a comment starts before but extends beyond $max_linelength
+# LONG_LINE_STRING a string starts before but extends beyond $max_line_length
+# LONG_LINE all other lines longer than $max_line_length
+#
+# if LONG_LINE is ignored, the other 2 types are also ignored
+#
-# check for spaces before a quoted newline
- if ($rawline =~ /^.*\".*\s\\n/) {
- if (WARN("QUOTED_WHITESPACE_BEFORE_NEWLINE",
- "unnecessary whitespace before a quoted newline\n" . $herecurr) &&
- $fix) {
- $fixed[$linenr - 1] =~ s/^(\+.*\".*)\s+\\n/$1\\n/;
+ if ($line =~ /^\+/ && $length > $max_line_length) {
+ my $msg_type = "LONG_LINE";
+
+ # Check the allowed long line types first
+
+ # logging functions that end in a string that starts
+ # before $max_line_length
+ if ($line =~ /^\+\s*$logFunctions\s*\(\s*(?:(?:KERN_\S+\s*|[^"]*))?($String\s*(?:|,|\)\s*;)\s*)$/ &&
+ length(expand_tabs(substr($line, 1, length($line) - length($1) - 1))) <= $max_line_length) {
+ $msg_type = "";
+
+ # lines with only strings (w/ possible termination)
+ # #defines with only strings
+ } elsif ($line =~ /^\+\s*$String\s*(?:\s*|,|\)\s*;)\s*$/ ||
+ $line =~ /^\+\s*#\s*define\s+\w+\s+$String$/) {
+ $msg_type = "";
+
+ # EFI_GUID is another special case
+ } elsif ($line =~ /^\+.*\bEFI_GUID\s*\(/) {
+ $msg_type = "";
+
+ # Otherwise set the alternate message types
+
+ # a comment starts before $max_line_length
+ } elsif ($line =~ /($;[\s$;]*)$/ &&
+ length(expand_tabs(substr($line, 1, length($line) - length($1) - 1))) <= $max_line_length) {
+ $msg_type = "LONG_LINE_COMMENT"
+
+ # a quoted string starts before $max_line_length
+ } elsif ($sline =~ /\s*($String(?:\s*(?:\\|,\s*|\)\s*;\s*))?)$/ &&
+ length(expand_tabs(substr($line, 1, length($line) - length($1) - 1))) <= $max_line_length) {
+ $msg_type = "LONG_LINE_STRING"
}
+ if ($msg_type ne "" &&
+ (show_type("LONG_LINE") || show_type($msg_type))) {
+ WARN($msg_type,
+ "line over $max_line_length characters\n" . $herecurr);
+ }
}
# check for adding lines without a newline.
}
# check we are in a valid source file C or perl if not then ignore this hunk
- next if ($realfile !~ /\.(h|c|pl)$/);
+ next if ($realfile !~ /\.(h|c|pl|dtsi|dts)$/);
# at the beginning of a line any tabs must come first and anything
# more than 8 must use tabs.
if (ERROR("CODE_INDENT",
"code indent should use tabs where possible\n" . $herevet) &&
$fix) {
- $fixed[$linenr - 1] =~ s/^\+([ \t]+)/"\+" . tabify($1)/e;
+ $fixed[$fixlinenr] =~ s/^\+([ \t]+)/"\+" . tabify($1)/e;
}
}
if (WARN("SPACE_BEFORE_TAB",
"please, no space before tabs\n" . $herevet) &&
$fix) {
- while ($fixed[$linenr - 1] =~
+ while ($fixed[$fixlinenr] =~
s/(^\+.*) {8,8}\t/$1\t\t/) {}
- while ($fixed[$linenr - 1] =~
+ while ($fixed[$fixlinenr] =~
s/(^\+.*) +\t/$1\t/) {}
}
}
"Logical continuations should be on the previous line\n" . $hereprev);
}
+# check indentation starts on a tab stop
+ if ($^V && $^V ge 5.10.0 &&
+ $sline =~ /^\+\t+( +)(?:$c90_Keywords\b|\{\s*$|\}\s*(?:else\b|while\b|\s*$))/) {
+ my $indent = length($1);
+ if ($indent % 8) {
+ if (WARN("TABSTOP",
+ "Statements should start on a tabstop\n" . $herecurr) &&
+ $fix) {
+ $fixed[$fixlinenr] =~ s@(^\+\t+) +@$1 . "\t" x ($indent/8)@e;
+ }
+ }
+ }
+
# check multi-line statement indentation matches previous line
if ($^V && $^V ge 5.10.0 &&
- $prevline =~ /^\+(\t*)(if \(|$Ident\().*(\&\&|\|\||,)\s*$/) {
+ $prevline =~ /^\+([ \t]*)((?:$c90_Keywords(?:\s+if)\s*)|(?:$Declare\s*)?(?:$Ident|\(\s*\*\s*$Ident\s*\))\s*|(?:\*\s*)*$Lval\s*=\s*$Ident\s*)\(.*(\&\&|\|\||,)\s*$/) {
$prevline =~ /^\+(\t*)(.*)$/;
my $oldindent = $1;
my $rest = $2;
if (CHK("PARENTHESIS_ALIGNMENT",
"Alignment should match open parenthesis\n" . $hereprev) &&
$fix && $line =~ /^\+/) {
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s/^\+[ \t]*/\+$goodtabindent/;
}
}
}
}
- if ($line =~ /^\+.*\*[ \t]*\)[ \t]+(?!$Assignment|$Arithmetic)/) {
+# check for space after cast like "(int) foo" or "(struct foo) bar"
+# avoid checking a few false positives:
+# "sizeof(<type>)" or "__alignof__(<type>)"
+# function pointer declarations like "(*foo)(int) = bar;"
+# structure definitions like "(struct foo) { 0 };"
+# multiline macros that define functions
+# known attributes or the __attribute__ keyword
+ if ($line =~ /^\+(.*)\(\s*$Type\s*\)([ \t]++)((?![={]|\\$|$Attribute|__attribute__))/ &&
+ (!defined($1) || $1 !~ /\b(?:sizeof|__alignof__)\s*$/)) {
if (CHK("SPACING",
- "No space is necessary after a cast\n" . $hereprev) &&
+ "No space is necessary after a cast\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~
- s/^(\+.*\*[ \t]*\))[ \t]+/$1/;
+ $fixed[$fixlinenr] =~
+ s/(\(\s*$Type\s*\))[ \t]+/$1/;
}
}
+# Block comment styles
+# Networking with an initial /*
if ($realfile =~ m@^(drivers/net/|net/)@ &&
$prevrawline =~ /^\+[ \t]*\/\*[ \t]*$/ &&
- $rawline =~ /^\+[ \t]*\*/) {
+ $rawline =~ /^\+[ \t]*\*/ &&
+ $realline > 2) {
WARN("NETWORKING_BLOCK_COMMENT_STYLE",
"networking block comments don't use an empty /* line, use /* Comment...\n" . $hereprev);
}
- if ($realfile =~ m@^(drivers/net/|net/)@ &&
- $prevrawline =~ /^\+[ \t]*\/\*/ && #starting /*
+# Block comments use * on subsequent lines
+ if ($prevline =~ /$;[ \t]*$/ && #ends in comment
+ $prevrawline =~ /^\+.*?\/\*/ && #starting /*
$prevrawline !~ /\*\/[ \t]*$/ && #no trailing */
$rawline =~ /^\+/ && #line is new
$rawline !~ /^\+[ \t]*\*/) { #no leading *
- WARN("NETWORKING_BLOCK_COMMENT_STYLE",
- "networking block comments start with * on subsequent lines\n" . $hereprev);
+ WARN("BLOCK_COMMENT_STYLE",
+ "Block comments use * on subsequent lines\n" . $hereprev);
}
- if ($realfile =~ m@^(drivers/net/|net/)@ &&
- $rawline !~ m@^\+[ \t]*\*/[ \t]*$@ && #trailing */
+# Block comments use */ on trailing lines
+ if ($rawline !~ m@^\+[ \t]*\*/[ \t]*$@ && #trailing */
$rawline !~ m@^\+.*/\*.*\*/[ \t]*$@ && #inline /*...*/
$rawline !~ m@^\+.*\*{2,}/[ \t]*$@ && #trailing **/
$rawline =~ m@^\+[ \t]*.+\*\/[ \t]*$@) { #non blank */
- WARN("NETWORKING_BLOCK_COMMENT_STYLE",
- "networking block comments put the trailing */ on a separate line\n" . $herecurr);
+ WARN("BLOCK_COMMENT_STYLE",
+ "Block comments use a trailing */ on a separate line\n" . $herecurr);
+ }
+
+# Block comment * alignment
+ if ($prevline =~ /$;[ \t]*$/ && #ends in comment
+ $line =~ /^\+[ \t]*$;/ && #leading comment
+ $rawline =~ /^\+[ \t]*\*/ && #leading *
+ (($prevrawline =~ /^\+.*?\/\*/ && #leading /*
+ $prevrawline !~ /\*\/[ \t]*$/) || #no trailing */
+ $prevrawline =~ /^\+[ \t]*\*/)) { #leading *
+ my $oldindent;
+ $prevrawline =~ m@^\+([ \t]*/?)\*@;
+ if (defined($1)) {
+ $oldindent = expand_tabs($1);
+ } else {
+ $prevrawline =~ m@^\+(.*/?)\*@;
+ $oldindent = expand_tabs($1);
+ }
+ $rawline =~ m@^\+([ \t]*)\*@;
+ my $newindent = $1;
+ $newindent = expand_tabs($newindent);
+ if (length($oldindent) ne length($newindent)) {
+ WARN("BLOCK_COMMENT_STYLE",
+ "Block comments should align the * on each line\n" . $hereprev);
+ }
+ }
+
+# check for missing blank lines after struct/union declarations
+# with exceptions for various attributes and macros
+ if ($prevline =~ /^[\+ ]};?\s*$/ &&
+ $line =~ /^\+/ &&
+ !($line =~ /^\+\s*$/ ||
+ $line =~ /^\+\s*EXPORT_SYMBOL/ ||
+ $line =~ /^\+\s*MODULE_/i ||
+ $line =~ /^\+\s*\#\s*(?:end|elif|else)/ ||
+ $line =~ /^\+[a-z_]*init/ ||
+ $line =~ /^\+\s*(?:static\s+)?[A-Z_]*ATTR/ ||
+ $line =~ /^\+\s*DECLARE/ ||
+ $line =~ /^\+\s*__setup/)) {
+ if (CHK("LINE_SPACING",
+ "Please use a blank line after function/struct/union/enum declarations\n" . $hereprev) &&
+ $fix) {
+ fix_insert_line($fixlinenr, "\+");
+ }
+ }
+
+# check for multiple consecutive blank lines
+ if ($prevline =~ /^[\+ ]\s*$/ &&
+ $line =~ /^\+\s*$/ &&
+ $last_blank_line != ($linenr - 1)) {
+ if (CHK("LINE_SPACING",
+ "Please don't use multiple blank lines\n" . $hereprev) &&
+ $fix) {
+ fix_delete_line($fixlinenr, $rawline);
+ }
+
+ $last_blank_line = $linenr;
+ }
+
+# check for missing blank lines after declarations
+ if ($sline =~ /^\+\s+\S/ && #Not at char 1
+ # actual declarations
+ ($prevline =~ /^\+\s+$Declare\s*$Ident\s*[=,;:\[]/ ||
+ # function pointer declarations
+ $prevline =~ /^\+\s+$Declare\s*\(\s*\*\s*$Ident\s*\)\s*[=,;:\[\(]/ ||
+ # foo bar; where foo is some local typedef or #define
+ $prevline =~ /^\+\s+$Ident(?:\s+|\s*\*\s*)$Ident\s*[=,;\[]/ ||
+ # known declaration macros
+ $prevline =~ /^\+\s+$declaration_macros/) &&
+ # for "else if" which can look like "$Ident $Ident"
+ !($prevline =~ /^\+\s+$c90_Keywords\b/ ||
+ # other possible extensions of declaration lines
+ $prevline =~ /(?:$Compare|$Assignment|$Operators)\s*$/ ||
+ # not starting a section or a macro "\" extended line
+ $prevline =~ /(?:\{\s*|\\)$/) &&
+ # looks like a declaration
+ !($sline =~ /^\+\s+$Declare\s*$Ident\s*[=,;:\[]/ ||
+ # function pointer declarations
+ $sline =~ /^\+\s+$Declare\s*\(\s*\*\s*$Ident\s*\)\s*[=,;:\[\(]/ ||
+ # foo bar; where foo is some local typedef or #define
+ $sline =~ /^\+\s+$Ident(?:\s+|\s*\*\s*)$Ident\s*[=,;\[]/ ||
+ # known declaration macros
+ $sline =~ /^\+\s+$declaration_macros/ ||
+ # start of struct or union or enum
+ $sline =~ /^\+\s+(?:union|struct|enum|typedef)\b/ ||
+ # start or end of block or continuation of declaration
+ $sline =~ /^\+\s+(?:$|[\{\}\.\#\"\?\:\(\[])/ ||
+ # bitfield continuation
+ $sline =~ /^\+\s+$Ident\s*:\s*\d+\s*[,;]/ ||
+ # other possible extensions of declaration lines
+ $sline =~ /^\+\s+\(?\s*(?:$Compare|$Assignment|$Operators)/) &&
+ # indentation of previous and current line are the same
+ (($prevline =~ /\+(\s+)\S/) && $sline =~ /^\+$1\S/)) {
+ if (WARN("LINE_SPACING",
+ "Missing a blank line after declarations\n" . $hereprev) &&
+ $fix) {
+ fix_insert_line($fixlinenr, "\+");
+ }
}
# check for spaces at the beginning of a line.
if (WARN("LEADING_SPACE",
"please, no spaces at the start of a line\n" . $herevet) &&
$fix) {
- $fixed[$linenr - 1] =~ s/^\+([ \t]+)/"\+" . tabify($1)/e;
+ $fixed[$fixlinenr] =~ s/^\+([ \t]+)/"\+" . tabify($1)/e;
}
}
# check we are in a valid C source file if not then ignore this hunk
next if ($realfile !~ /\.(h|c)$/);
-# discourage the addition of CONFIG_EXPERIMENTAL in #if(def).
- if ($line =~ /^\+\s*\#\s*if.*\bCONFIG_EXPERIMENTAL\b/) {
- WARN("CONFIG_EXPERIMENTAL",
- "Use of CONFIG_EXPERIMENTAL is deprecated. For alternatives, see https://lkml.org/lkml/2012/10/23/580\n");
+# check if this appears to be the start function declaration, save the name
+ if ($sline =~ /^\+\{\s*$/ &&
+ $prevline =~ /^\+(?:(?:(?:$Storage|$Inline)\s*)*\s*$Type\s*)?($Ident)\(/) {
+ $context_function = $1;
+ }
+
+# check if this appears to be the end of function declaration
+ if ($sline =~ /^\+\}\s*$/) {
+ undef $context_function;
+ }
+
+# check indentation of any line with a bare else
+# (but not if it is a multiple line "if (foo) return bar; else return baz;")
+# if the previous line is a break or return and is indented 1 tab more...
+ if ($sline =~ /^\+([\t]+)(?:}[ \t]*)?else(?:[ \t]*{)?\s*$/) {
+ my $tabs = length($1) + 1;
+ if ($prevline =~ /^\+\t{$tabs,$tabs}break\b/ ||
+ ($prevline =~ /^\+\t{$tabs,$tabs}return\b/ &&
+ defined $lines[$linenr] &&
+ $lines[$linenr] !~ /^[ \+]\t{$tabs,$tabs}return/)) {
+ WARN("UNNECESSARY_ELSE",
+ "else is not generally useful after a break or return\n" . $hereprev);
+ }
+ }
+
+# check indentation of a line with a break;
+# if the previous line is a goto or return and is indented the same # of tabs
+ if ($sline =~ /^\+([\t]+)break\s*;\s*$/) {
+ my $tabs = $1;
+ if ($prevline =~ /^\+$tabs(?:goto|return)\b/) {
+ WARN("UNNECESSARY_BREAK",
+ "break is not useful after a goto or return\n" . $hereprev);
+ }
}
# check for RCS/CVS revision markers
my ($stat, $cond, $line_nr_next, $remain_next, $off_next,
$realline_next);
#print "LINE<$line>\n";
- if ($linenr >= $suppress_statement &&
+ if ($linenr > $suppress_statement &&
$realcnt && $sline =~ /.\s*\S/) {
($stat, $cond, $line_nr_next, $remain_next, $off_next) =
ctx_statement_block($linenr, $realcnt, 0);
# if/while/etc brace do not go on next line, unless defining a do while loop,
# or if that brace on the next line is for something else
- if ($line =~ /(.*)\b((?:if|while|for|switch)\s*\(|do\b|else\b)/ && $line !~ /^.\s*\#/) {
+ if ($line =~ /(.*)\b((?:if|while|for|switch|(?:[a-z_]+|)for_each[a-z_]+)\s*\(|do\b|else\b)/ && $line !~ /^.\s*\#/) {
my $pre_ctx = "$1$2";
my ($level, @ctx) = ctx_statement_level($linenr, $realcnt, 0);
#print "realcnt<$realcnt> ctx_cnt<$ctx_cnt>\n";
#print "pre<$pre_ctx>\nline<$line>\nctx<$ctx>\nnext<$lines[$ctx_ln - 1]>\n";
- if ($ctx !~ /{\s*/ && defined($lines[$ctx_ln -1]) && $lines[$ctx_ln - 1] =~ /^\+\s*{/) {
+ if ($ctx !~ /{\s*/ && defined($lines[$ctx_ln - 1]) && $lines[$ctx_ln - 1] =~ /^\+\s*{/) {
ERROR("OPEN_BRACE",
"that open brace { should be on the previous line\n" .
"$here\n$ctx\n$rawlines[$ctx_ln - 1]\n");
}
# Check relative indent for conditionals and blocks.
- if ($line =~ /\b(?:(?:if|while|for)\s*\(|do\b)/ && $line !~ /^.\s*#/ && $line !~ /\}\s*while\s*/) {
+ if ($line =~ /\b(?:(?:if|while|for|(?:[a-z_]+|)for_each[a-z_]+)\s*\(|(?:do|else)\b)/ && $line !~ /^.\s*#/ && $line !~ /\}\s*while\s*/) {
($stat, $cond, $line_nr_next, $remain_next, $off_next) =
ctx_statement_block($linenr, $realcnt, 0)
if (!defined $stat);
substr($s, 0, length($c), '');
- # Make sure we remove the line prefixes as we have
- # none on the first line, and are going to readd them
- # where necessary.
- $s =~ s/\n./\n/gs;
+ # remove inline comments
+ $s =~ s/$;/ /g;
+ $c =~ s/$;/ /g;
# Find out how long the conditional actually is.
my @newlines = ($c =~ /\n/gs);
my $cond_lines = 1 + $#newlines;
+ # Make sure we remove the line prefixes as we have
+ # none on the first line, and are going to readd them
+ # where necessary.
+ $s =~ s/\n./\n/gs;
+ while ($s =~ /\n\s+\\\n/) {
+ $cond_lines += $s =~ s/\n\s+\\\n/\n/g;
+ }
+
# We want to check the first line inside the block
# starting at the end of the conditional, so remove:
# 1) any blank line termination
#print "line<$line> prevline<$prevline> indent<$indent> sindent<$sindent> check<$check> continuation<$continuation> s<$s> cond_lines<$cond_lines> stat_real<$stat_real> stat<$stat>\n";
- if ($check && (($sindent % 8) != 0 ||
- ($sindent <= $indent && $s ne ''))) {
+ if ($check && $s ne '' &&
+ (($sindent % 8) != 0 ||
+ ($sindent < $indent) ||
+ ($sindent == $indent &&
+ ($s !~ /^\s*(?:\}|\{|else\b)/)) ||
+ ($sindent > $indent + 8))) {
WARN("SUSPECT_CODE_INDENT",
"suspect code indent for conditional statements ($indent, $sindent)\n" . $herecurr . "$stat_real\n");
}
#ignore lines not being added
next if ($line =~ /^[^\+]/);
+# check for dereferences that span multiple lines
+ if ($prevline =~ /^\+.*$Lval\s*(?:\.|->)\s*$/ &&
+ $line =~ /^\+\s*(?!\#\s*(?!define\s+|if))\s*$Lval/) {
+ $prevline =~ /($Lval\s*(?:\.|->))\s*$/;
+ my $ref = $1;
+ $line =~ /^.\s*($Lval)/;
+ $ref .= $1;
+ $ref =~ s/\s//g;
+ WARN("MULTILINE_DEREFERENCE",
+ "Avoid multiple line dereference - prefer '$ref'\n" . $hereprev);
+ }
+
+# check for declarations of signed or unsigned without int
+ while ($line =~ m{\b($Declare)\s*(?!char\b|short\b|int\b|long\b)\s*($Ident)?\s*[=,;\[\)\(]}g) {
+ my $type = $1;
+ my $var = $2;
+ $var = "" if (!defined $var);
+ if ($type =~ /^(?:(?:$Storage|$Inline|$Attribute)\s+)*((?:un)?signed)((?:\s*\*)*)\s*$/) {
+ my $sign = $1;
+ my $pointer = $2;
+
+ $pointer = "" if (!defined $pointer);
+
+ if (WARN("UNSPECIFIED_INT",
+ "Prefer '" . trim($sign) . " int" . rtrim($pointer) . "' to bare use of '$sign" . rtrim($pointer) . "'\n" . $herecurr) &&
+ $fix) {
+ my $decl = trim($sign) . " int ";
+ my $comp_pointer = $pointer;
+ $comp_pointer =~ s/\s//g;
+ $decl .= $comp_pointer;
+ $decl = rtrim($decl) if ($var eq "");
+ $fixed[$fixlinenr] =~ s@\b$sign\s*\Q$pointer\E\s*$var\b@$decl$var@;
+ }
+ }
+ }
+
# TEST: allow direct testing of the type matcher.
if ($dbg_type) {
if ($line =~ /^.\s*$Declare\s*$/) {
# check for initialisation to aggregates open brace on the next line
if ($line =~ /^.\s*{/ &&
$prevline =~ /(?:^|[^=])=\s*$/) {
- ERROR("OPEN_BRACE",
- "that open brace { should be on the previous line\n" . $hereprev);
+ if (ERROR("OPEN_BRACE",
+ "that open brace { should be on the previous line\n" . $hereprev) &&
+ $fix && $prevline =~ /^\+/ && $line =~ /^\+/) {
+ fix_delete_line($fixlinenr - 1, $prevrawline);
+ fix_delete_line($fixlinenr, $rawline);
+ my $fixedline = $prevrawline;
+ $fixedline =~ s/\s*=\s*$/ = {/;
+ fix_insert_line($fixlinenr, $fixedline);
+ $fixedline = $line;
+ $fixedline =~ s/^(.\s*)\{\s*/$1/;
+ fix_insert_line($fixlinenr, $fixedline);
+ }
}
#
if (ERROR("C99_COMMENTS",
"do not use C99 // comments\n" . $herecurr) &&
$fix) {
- my $line = $fixed[$linenr - 1];
+ my $line = $fixed[$fixlinenr];
if ($line =~ /\/\/(.*)$/) {
my $comment = trim($1);
- $fixed[$linenr - 1] =~ s@\/\/(.*)$@/\* $comment \*/@;
+ $fixed[$fixlinenr] =~ s@\/\/(.*)$@/\* $comment \*/@;
}
}
}
}
# check for global initialisers.
- if ($line =~ /^\+(\s*$Type\s*$Ident\s*(?:\s+$Modifier))*\s*=\s*(0|NULL|false)\s*;/) {
+ if ($line =~ /^\+$Type\s*$Ident(?:\s+$Modifier)*\s*=\s*($zero_initializer)\s*;/) {
if (ERROR("GLOBAL_INITIALISERS",
- "do not initialise globals to 0 or NULL\n" .
- $herecurr) &&
+ "do not initialise globals to $1\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~ s/($Type\s*$Ident\s*(?:\s+$Modifier))*\s*=\s*(0|NULL|false)\s*;/$1;/;
+ $fixed[$fixlinenr] =~ s/(^.$Type\s*$Ident(?:\s+$Modifier)*)\s*=\s*$zero_initializer\s*;/$1;/;
}
}
# check for static initialisers.
- if ($line =~ /^\+.*\bstatic\s.*=\s*(0|NULL|false)\s*;/) {
+ if ($line =~ /^\+.*\bstatic\s.*=\s*($zero_initializer)\s*;/) {
if (ERROR("INITIALISED_STATIC",
- "do not initialise statics to 0 or NULL\n" .
+ "do not initialise statics to $1\n" .
$herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~ s/(\bstatic\s.*?)\s*=\s*(0|NULL|false)\s*;/$1;/;
+ $fixed[$fixlinenr] =~ s/(\bstatic\s.*?)\s*=\s*$zero_initializer\s*;/$1;/;
}
}
+# check for misordered declarations of char/short/int/long with signed/unsigned
+ while ($sline =~ m{(\b$TypeMisordered\b)}g) {
+ my $tmp = trim($1);
+ WARN("MISORDERED_TYPE",
+ "type '$tmp' should be specified in [[un]signed] [short|int|long|long long] order\n" . $herecurr);
+ }
+
# check for static const char * arrays.
if ($line =~ /\bstatic\s+const\s+char\s*\*\s*(\w+)\s*\[\s*\]\s*=\s*/) {
WARN("STATIC_CONST_CHAR_ARRAY",
$herecurr);
}
+# check for const <foo> const where <foo> is not a pointer or array type
+ if ($sline =~ /\bconst\s+($BasicType)\s+const\b/) {
+ my $found = $1;
+ if ($sline =~ /\bconst\s+\Q$found\E\s+const\b\s*\*/) {
+ WARN("CONST_CONST",
+ "'const $found const *' should probably be 'const $found * const'\n" . $herecurr);
+ } elsif ($sline !~ /\bconst\s+\Q$found\E\s+const\s+\w+\s*\[/) {
+ WARN("CONST_CONST",
+ "'const $found const' should probably be 'const $found'\n" . $herecurr);
+ }
+ }
+
+# check for non-global char *foo[] = {"bar", ...} declarations.
+ if ($line =~ /^.\s+(?:static\s+|const\s+)?char\s+\*\s*\w+\s*\[\s*\]\s*=\s*\{/) {
+ WARN("STATIC_CONST_CHAR_ARRAY",
+ "char * array declaration might be better as static const\n" .
+ $herecurr);
+ }
+
+# check for sizeof(foo)/sizeof(foo[0]) that could be ARRAY_SIZE(foo)
+ if ($line =~ m@\bsizeof\s*\(\s*($Lval)\s*\)@) {
+ my $array = $1;
+ if ($line =~ m@\b(sizeof\s*\(\s*\Q$array\E\s*\)\s*/\s*sizeof\s*\(\s*\Q$array\E\s*\[\s*0\s*\]\s*\))@) {
+ my $array_div = $1;
+ if (WARN("ARRAY_SIZE",
+ "Prefer ARRAY_SIZE($array)\n" . $herecurr) &&
+ $fix) {
+ $fixed[$fixlinenr] =~ s/\Q$array_div\E/ARRAY_SIZE($array)/;
+ }
+ }
+ }
+
# check for function declarations without arguments like "int foo()"
if ($line =~ /(\b$Type\s+$Ident)\s*\(\s*\)/) {
if (ERROR("FUNCTION_WITHOUT_ARGS",
"Bad function definition - $1() should probably be $1(void)\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~ s/(\b($Type)\s+($Ident))\s*\(\s*\)/$2 $3(void)/;
- }
- }
-
-# check for uses of DEFINE_PCI_DEVICE_TABLE
- if ($line =~ /\bDEFINE_PCI_DEVICE_TABLE\s*\(\s*(\w+)\s*\)\s*=/) {
- if (WARN("DEFINE_PCI_DEVICE_TABLE",
- "Prefer struct pci_device_id over deprecated DEFINE_PCI_DEVICE_TABLE\n" . $herecurr) &&
- $fix) {
- $fixed[$linenr - 1] =~ s/\b(?:static\s+|)DEFINE_PCI_DEVICE_TABLE\s*\(\s*(\w+)\s*\)\s*=\s*/static const struct pci_device_id $1\[\] = /;
+ $fixed[$fixlinenr] =~ s/(\b($Type)\s+($Ident))\s*\(\s*\)/$2 $3(void)/;
}
}
$line !~ /\btypedef\s+$Type\s*\(\s*\*?$Ident\s*\)\s*\(/ &&
$line !~ /\btypedef\s+$Type\s+$Ident\s*\(/ &&
$line !~ /\b$typeTypedefs\b/ &&
- $line !~ /\b__bitwise(?:__|)\b/) {
+ $line !~ /\b__bitwise\b/) {
WARN("NEW_TYPEDEFS",
"do not add new typedefs\n" . $herecurr);
}
my $sub_from = $ident;
my $sub_to = $ident;
$sub_to =~ s/\Q$from\E/$to/;
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s@\Q$sub_from\E@$sub_to@;
}
}
my $sub_from = $match;
my $sub_to = $match;
$sub_to =~ s/\Q$from\E/$to/;
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s@\Q$sub_from\E@$sub_to@;
}
}
}
-# # no BUG() or BUG_ON()
-# if ($line =~ /\b(BUG|BUG_ON)\b/) {
-# print "Try to use WARN_ON & Recovery code rather than BUG() or BUG_ON()\n";
-# print "$herecurr";
-# $clean = 0;
-# }
+# avoid BUG() or BUG_ON()
+ if ($line =~ /\b(?:BUG|BUG_ON)\b/) {
+ my $msg_type = \&WARN;
+ $msg_type = \&CHK if ($file);
+ &{$msg_type}("AVOID_BUG",
+ "Avoid crashing the kernel - try using WARN_ON & recovery code rather than BUG() or BUG_ON()\n" . $herecurr);
+ }
+# avoid LINUX_VERSION_CODE
if ($line =~ /\bLINUX_VERSION_CODE\b/) {
WARN("LINUX_VERSION_CODE",
"LINUX_VERSION_CODE should be avoided, code should be for the version to which it is merged\n" . $herecurr);
# check for uses of printk_ratelimit
if ($line =~ /\bprintk_ratelimit\s*\(/) {
WARN("PRINTK_RATELIMITED",
-"Prefer printk_ratelimited or pr_<level>_ratelimited to printk_ratelimit\n" . $herecurr);
+ "Prefer printk_ratelimited or pr_<level>_ratelimited to printk_ratelimit\n" . $herecurr);
}
# printk should use KERN_* levels. Note that follow on printk's on the
my $level2 = $level;
$level2 = "dbg" if ($level eq "debug");
WARN("PREFER_PR_LEVEL",
- "Prefer netdev_$level2(netdev, ... then dev_$level2(dev, ... then pr_$level(... to printk(KERN_$orig ...\n" . $herecurr);
+ "Prefer [subsystem eg: netdev]_$level2([subsystem]dev, ... then dev_$level2(dev, ... then pr_$level(... to printk(KERN_$orig ...\n" . $herecurr);
}
if ($line =~ /\bpr_warning\s*\(/) {
if (WARN("PREFER_PR_LEVEL",
"Prefer pr_warn(... to pr_warning(...\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s/\bpr_warning\b/pr_warn/;
}
}
"Prefer dev_$level(... to dev_printk(KERN_$orig, ...\n" . $herecurr);
}
+# ENOSYS means "bad syscall nr" and nothing else. This will have a small
+# number of false positives, but assembly files are not checked, so at
+# least the arch entry code will not trigger this warning.
+ if ($line =~ /\bENOSYS\b/) {
+ WARN("ENOSYS",
+ "ENOSYS means 'invalid syscall nr' and nothing else\n" . $herecurr);
+ }
+
# function brace can't be on same line, except for #defines of do while,
# or if closed on same line
- if (($line=~/$Type\s*$Ident\(.*\).*\s\{/) and
+ if (($line=~/$Type\s*$Ident\(.*\).*\s*{/) and
!($line=~/\#\s*define.*do\s\{/) and !($line=~/}/)) {
- ERROR("OPEN_BRACE",
- "open brace '{' following function declarations go on the next line\n" . $herecurr);
+ if (ERROR("OPEN_BRACE",
+ "open brace '{' following function declarations go on the next line\n" . $herecurr) &&
+ $fix) {
+ fix_delete_line($fixlinenr, $rawline);
+ my $fixed_line = $rawline;
+ $fixed_line =~ /(^..*$Type\s*$Ident\(.*\)\s*){(.*)$/;
+ my $line1 = $1;
+ my $line2 = $2;
+ fix_insert_line($fixlinenr, ltrim($line1));
+ fix_insert_line($fixlinenr, "\+{");
+ if ($line2 !~ /^\s*$/) {
+ fix_insert_line($fixlinenr, "\+\t" . trim($line2));
+ }
+ }
}
# open braces for enum, union and struct go on the same line.
if ($line =~ /^.\s*{/ &&
$prevline =~ /^.\s*(?:typedef\s+)?(enum|union|struct)(?:\s+$Ident)?\s*$/) {
- ERROR("OPEN_BRACE",
- "open brace '{' following $1 go on the same line\n" . $hereprev);
+ if (ERROR("OPEN_BRACE",
+ "open brace '{' following $1 go on the same line\n" . $hereprev) &&
+ $fix && $prevline =~ /^\+/ && $line =~ /^\+/) {
+ fix_delete_line($fixlinenr - 1, $prevrawline);
+ fix_delete_line($fixlinenr, $rawline);
+ my $fixedline = rtrim($prevrawline) . " {";
+ fix_insert_line($fixlinenr, $fixedline);
+ $fixedline = $rawline;
+ $fixedline =~ s/^(.\s*)\{\s*/$1\t/;
+ if ($fixedline !~ /^\+\s*$/) {
+ fix_insert_line($fixlinenr, $fixedline);
+ }
+ }
}
# missing space after union, struct or enum definition
if (WARN("SPACING",
"missing space after $1 definition\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s/^(.\s*(?:typedef\s+)?(?:enum|union|struct)(?:\s+$Ident){1,2})([=\{])/$1 $2/;
}
}
# Function pointer declarations
# check spacing between type, funcptr, and args
# canonical declaration is "type (*funcptr)(args...)"
-#
-# the $Declare variable will capture all spaces after the type
-# so check it for trailing missing spaces or multiple spaces
- if ($line =~ /^.\s*($Declare)\((\s*)\*(\s*)$Ident(\s*)\)(\s*)\(/) {
+ if ($line =~ /^.\s*($Declare)\((\s*)\*(\s*)($Ident)(\s*)\)(\s*)\(/) {
my $declare = $1;
my $pre_pointer_space = $2;
my $post_pointer_space = $3;
my $post_funcname_space = $5;
my $pre_args_space = $6;
- if ($declare !~ /\s$/) {
+# the $Declare variable will capture all spaces after the type
+# so check it for a missing trailing missing space but pointer return types
+# don't need a space so don't warn for those.
+ my $post_declare_space = "";
+ if ($declare =~ /(\s+)$/) {
+ $post_declare_space = $1;
+ $declare = rtrim($declare);
+ }
+ if ($declare !~ /\*$/ && $post_declare_space =~ /^$/) {
WARN("SPACING",
"missing space after return type\n" . $herecurr);
+ $post_declare_space = " ";
}
# unnecessary space "type (*funcptr)(args...)"
- elsif ($declare =~ /\s{2,}$/) {
- WARN("SPACING",
- "Multiple spaces after return type\n" . $herecurr);
- }
+# This test is not currently implemented because these declarations are
+# equivalent to
+# int foo(int bar, ...)
+# and this is form shouldn't/doesn't generate a checkpatch warning.
+#
+# elsif ($declare =~ /\s{2,}$/) {
+# WARN("SPACING",
+# "Multiple spaces after return type\n" . $herecurr);
+# }
# unnecessary space "type ( *funcptr)(args...)"
if (defined $pre_pointer_space &&
}
if (show_type("SPACING") && $fix) {
- $fixed[$linenr - 1] =~
- s/^(.\s*$Declare)\(\s*\*\s*($Ident)\s*\)\s*\(/rtrim($1) . " " . "\(\*$2\)\("/ex;
+ $fixed[$fixlinenr] =~
+ s/^(.\s*)$Declare\s*\(\s*\*\s*$Ident\s*\)\s*\(/$1 . $declare . $post_declare_space . '(*' . $funcname . ')('/ex;
}
}
if (ERROR("BRACKET_SPACE",
"space prohibited before open square bracket '['\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s/^(\+.*?)\s+\[/$1\[/;
}
}
if (WARN("SPACING",
"space prohibited between function name and open parenthesis '('\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s/\b$name\s+\(/$name\(/;
}
}
# Ignore operators passed as parameters.
if ($op_type ne 'V' &&
- $ca =~ /\s$/ && $cc =~ /^\s*,/) {
+ $ca =~ /\s$/ && $cc =~ /^\s*[,\)]/) {
# # Ignore comments
# } elsif ($op =~ /^$;+$/) {
# // is a comment
} elsif ($op eq '//') {
+ # : when part of a bitfield
+ } elsif ($opv eq ':B') {
+ # skip the bitfield test for now
+
# No spaces for:
# ->
- # : when part of a bitfield
- } elsif ($op eq '->' || $opv eq ':B') {
+ } elsif ($op eq '->') {
if ($ctx =~ /Wx.|.xW/) {
if (ERROR("SPACING",
"spaces prohibited around that '$op' $at\n" . $hereptr)) {
}
}
- # , must have a space on the right.
+ # , must not have a space before and must have a space on the right.
} elsif ($op eq ',') {
+ my $rtrim_before = 0;
+ my $space_after = 0;
+ if ($ctx =~ /Wx./) {
+ if (ERROR("SPACING",
+ "space prohibited before that '$op' $at\n" . $hereptr)) {
+ $line_fixed = 1;
+ $rtrim_before = 1;
+ }
+ }
if ($ctx !~ /.x[WEC]/ && $cc !~ /^}/) {
if (ERROR("SPACING",
"space required after that '$op' $at\n" . $hereptr)) {
- $good = $fix_elements[$n] . trim($fix_elements[$n + 1]) . " ";
$line_fixed = 1;
$last_after = $n;
+ $space_after = 1;
+ }
+ }
+ if ($rtrim_before || $space_after) {
+ if ($rtrim_before) {
+ $good = rtrim($fix_elements[$n]) . trim($fix_elements[$n + 1]);
+ } else {
+ $good = $fix_elements[$n] . trim($fix_elements[$n + 1]);
+ }
+ if ($space_after) {
+ $good .= " ";
}
}
$op eq '*' or $op eq '/' or
$op eq '%')
{
- if ($ctx =~ /Wx[^WCE]|[^WCE]xW/) {
+ if ($check) {
+ if (defined $fix_elements[$n + 2] && $ctx !~ /[EW]x[EW]/) {
+ if (CHK("SPACING",
+ "spaces preferred around that '$op' $at\n" . $hereptr)) {
+ $good = rtrim($fix_elements[$n]) . " " . trim($fix_elements[$n + 1]) . " ";
+ $fix_elements[$n + 2] =~ s/^\s+//;
+ $line_fixed = 1;
+ }
+ } elsif (!defined $fix_elements[$n + 2] && $ctx !~ /Wx[OE]/) {
+ if (CHK("SPACING",
+ "space preferred before that '$op' $at\n" . $hereptr)) {
+ $good = rtrim($fix_elements[$n]) . " " . trim($fix_elements[$n + 1]);
+ $line_fixed = 1;
+ }
+ }
+ } elsif ($ctx =~ /Wx[^WCE]|[^WCE]xW/) {
if (ERROR("SPACING",
"need consistent spacing around '$op' $at\n" . $hereptr)) {
$good = rtrim($fix_elements[$n]) . " " . trim($fix_elements[$n + 1]) . " ";
$ok = 1;
}
+ # for asm volatile statements
+ # ignore a colon with another
+ # colon immediately before or after
+ if (($op eq ':') &&
+ ($ca =~ /:$/ || $cc =~ /^:/)) {
+ $ok = 1;
+ }
+
# messages are ERROR, but ?: are CHK
if ($ok == 0) {
my $msg_type = \&ERROR;
$fixed_line = $fixed_line . $fix_elements[$#elements];
}
- if ($fix && $line_fixed && $fixed_line ne $fixed[$linenr - 1]) {
- $fixed[$linenr - 1] = $fixed_line;
+ if ($fix && $line_fixed && $fixed_line ne $fixed[$fixlinenr]) {
+ $fixed[$fixlinenr] = $fixed_line;
}
if (WARN("SPACING",
"space prohibited before semicolon\n" . $herecurr) &&
$fix) {
- 1 while $fixed[$linenr - 1] =~
+ 1 while $fixed[$fixlinenr] =~
s/^(\+.*\S)\s+;/$1;/;
}
}
## }
#need space before brace following if, while, etc
- if (($line =~ /\(.*\)\{/ && $line !~ /\($Type\){/) ||
+ if (($line =~ /\(.*\)\{/ && $line !~ /\($Type\)\{/) ||
$line =~ /do\{/) {
if (ERROR("SPACING",
"space required before the open brace '{'\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~ s/^(\+.*(?:do|\))){/$1 {/;
+ $fixed[$fixlinenr] =~ s/^(\+.*(?:do|\)))\{/$1 {/;
}
}
if (ERROR("SPACING",
"space required after that close brace '}'\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s/}((?!(?:,|;|\)))\S)/} $1/;
}
}
if (ERROR("SPACING",
"space prohibited after that open square bracket '['\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s/\[\s+/\[/;
}
}
if (ERROR("SPACING",
"space prohibited before that close square bracket ']'\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s/\s+\]/\]/;
}
}
if (ERROR("SPACING",
"space prohibited after that open parenthesis '('\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s/\(\s+/\(/;
}
}
if (ERROR("SPACING",
"space prohibited before that close parenthesis ')'\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s/\s+\)/\)/;
}
}
+# check unnecessary parentheses around addressof/dereference single $Lvals
+# ie: &(foo->bar) should be &foo->bar and *(foo->bar) should be *foo->bar
+
+ while ($line =~ /(?:[^&]&\s*|\*)\(\s*($Ident\s*(?:$Member\s*)+)\s*\)/g) {
+ my $var = $1;
+ if (CHK("UNNECESSARY_PARENTHESES",
+ "Unnecessary parentheses around $var\n" . $herecurr) &&
+ $fix) {
+ $fixed[$fixlinenr] =~ s/\(\s*\Q$var\E\s*\)/$var/;
+ }
+ }
+
+# check for unnecessary parentheses around function pointer uses
+# ie: (foo->bar)(); should be foo->bar();
+# but not "if (foo->bar) (" to avoid some false positives
+ if ($line =~ /(\bif\s*|)(\(\s*$Ident\s*(?:$Member\s*)+\))[ \t]*\(/ && $1 !~ /^if/) {
+ my $var = $2;
+ if (CHK("UNNECESSARY_PARENTHESES",
+ "Unnecessary parentheses around function pointer $var\n" . $herecurr) &&
+ $fix) {
+ my $var2 = deparenthesize($var);
+ $var2 =~ s/\s//g;
+ $fixed[$fixlinenr] =~ s/\Q$var\E/$var2/;
+ }
+ }
+
#goto labels aren't indented, allow a single space however
if ($line=~/^.\s+[A-Za-z\d_]+:(?![0-9]+)/ and
!($line=~/^. [A-Za-z\d_]+:/) and !($line=~/^.\s+default:/)) {
if (WARN("INDENTED_LABEL",
"labels should not be indented\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s/^(.)\s+/$1/;
}
}
-# Return is not a function.
+# return is not a function
if (defined($stat) && $stat =~ /^.\s*return(\s*)\(/s) {
my $spacing = $1;
if ($^V && $^V ge 5.10.0 &&
- $stat =~ /^.\s*return\s*$balanced_parens\s*;\s*$/) {
- ERROR("RETURN_PARENTHESES",
- "return is not a function, parentheses are not required\n" . $herecurr);
-
+ $stat =~ /^.\s*return\s*($balanced_parens)\s*;\s*$/) {
+ my $value = $1;
+ $value = deparenthesize($value);
+ if ($value =~ m/^\s*$FuncArg\s*(?:\?|$)/) {
+ ERROR("RETURN_PARENTHESES",
+ "return is not a function, parentheses are not required\n" . $herecurr);
+ }
} elsif ($spacing !~ /\s+/) {
ERROR("SPACING",
"space required before the open parenthesis '('\n" . $herecurr);
}
}
+# unnecessary return in a void function
+# at end-of-function, with the previous line a single leading tab, then return;
+# and the line before that not a goto label target like "out:"
+ if ($sline =~ /^[ \+]}\s*$/ &&
+ $prevline =~ /^\+\treturn\s*;\s*$/ &&
+ $linenr >= 3 &&
+ $lines[$linenr - 3] =~ /^[ +]/ &&
+ $lines[$linenr - 3] !~ /^[ +]\s*$Ident\s*:/) {
+ WARN("RETURN_VOID",
+ "void function return statements are not generally useful\n" . $hereprev);
+ }
+
# if statements using unnecessary parentheses - ie: if ((foo == bar))
if ($^V && $^V ge 5.10.0 &&
$line =~ /\bif\s*((?:\(\s*){2,})/) {
}
}
-# Return of what appears to be an errno should normally be -'ve
- if ($line =~ /^.\s*return\s*(E[A-Z]*)\s*;/) {
+# comparisons with a constant or upper case identifier on the left
+# avoid cases like "foo + BAR < baz"
+# only fix matches surrounded by parentheses to avoid incorrect
+# conversions like "FOO < baz() + 5" being "misfixed" to "baz() > FOO + 5"
+ if ($^V && $^V ge 5.10.0 &&
+ $line =~ /^\+(.*)\b($Constant|[A-Z_][A-Z0-9_]*)\s*($Compare)\s*($LvalOrFunc)/) {
+ my $lead = $1;
+ my $const = $2;
+ my $comp = $3;
+ my $to = $4;
+ my $newcomp = $comp;
+ if ($lead !~ /(?:$Operators|\.)\s*$/ &&
+ $to !~ /^(?:Constant|[A-Z_][A-Z0-9_]*)$/ &&
+ WARN("CONSTANT_COMPARISON",
+ "Comparisons should place the constant on the right side of the test\n" . $herecurr) &&
+ $fix) {
+ if ($comp eq "<") {
+ $newcomp = ">";
+ } elsif ($comp eq "<=") {
+ $newcomp = ">=";
+ } elsif ($comp eq ">") {
+ $newcomp = "<";
+ } elsif ($comp eq ">=") {
+ $newcomp = "<=";
+ }
+ $fixed[$fixlinenr] =~ s/\(\s*\Q$const\E\s*$Compare\s*\Q$to\E\s*\)/($to $newcomp $const)/;
+ }
+ }
+
+# Return of what appears to be an errno should normally be negative
+ if ($sline =~ /\breturn(?:\s*\(+\s*|\s+)(E[A-Z]+)(?:\s*\)+\s*|\s*)[;:,]/) {
my $name = $1;
if ($name ne 'EOF' && $name ne 'ERROR') {
WARN("USE_NEGATIVE_ERRNO",
- "return of an errno should typically be -ve (return -$1)\n" . $herecurr);
+ "return of an errno should typically be negative (ie: return -$1)\n" . $herecurr);
}
}
if (ERROR("SPACING",
"space required before the open parenthesis '('\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s/\b(if|while|for|switch)\(/$1 \(/;
}
}
# if should not continue a brace
if ($line =~ /}\s*if\b/) {
ERROR("TRAILING_STATEMENTS",
- "trailing statements should be on next line\n" .
+ "trailing statements should be on next line (or did you mean 'else if'?)\n" .
$herecurr);
}
# case and default should not have general statements after them
# Check for }<nl>else {, these must be at the same
# indent level to be relevant to each other.
- if ($prevline=~/}\s*$/ and $line=~/^.\s*else\s*/ and
- $previndent == $indent) {
- ERROR("ELSE_AFTER_BRACE",
- "else should follow close brace '}'\n" . $hereprev);
+ if ($prevline=~/}\s*$/ and $line=~/^.\s*else\s*/ &&
+ $previndent == $indent) {
+ if (ERROR("ELSE_AFTER_BRACE",
+ "else should follow close brace '}'\n" . $hereprev) &&
+ $fix && $prevline =~ /^\+/ && $line =~ /^\+/) {
+ fix_delete_line($fixlinenr - 1, $prevrawline);
+ fix_delete_line($fixlinenr, $rawline);
+ my $fixedline = $prevrawline;
+ $fixedline =~ s/}\s*$//;
+ if ($fixedline !~ /^\+\s*$/) {
+ fix_insert_line($fixlinenr, $fixedline);
+ }
+ $fixedline = $rawline;
+ $fixedline =~ s/^(.\s*)else/$1} else/;
+ fix_insert_line($fixlinenr, $fixedline);
+ }
}
- if ($prevline=~/}\s*$/ and $line=~/^.\s*while\s*/ and
- $previndent == $indent) {
+ if ($prevline=~/}\s*$/ and $line=~/^.\s*while\s*/ &&
+ $previndent == $indent) {
my ($s, $c) = ctx_statement_block($linenr, $realcnt, 0);
# Find out what is on the end of the line after the
$s =~ s/\n.*//g;
if ($s =~ /^\s*;/) {
- ERROR("WHILE_AFTER_BRACE",
- "while should follow close brace '}'\n" . $hereprev);
+ if (ERROR("WHILE_AFTER_BRACE",
+ "while should follow close brace '}'\n" . $hereprev) &&
+ $fix && $prevline =~ /^\+/ && $line =~ /^\+/) {
+ fix_delete_line($fixlinenr - 1, $prevrawline);
+ fix_delete_line($fixlinenr, $rawline);
+ my $fixedline = $prevrawline;
+ my $trailing = $rawline;
+ $trailing =~ s/^\+//;
+ $trailing = trim($trailing);
+ $fixedline =~ s/}\s*$/} $trailing/;
+ fix_insert_line($fixlinenr, $fixedline);
+ }
}
}
"Avoid gcc v4.3+ binary constant extension: <$var>\n" . $herecurr) &&
$fix) {
my $hexval = sprintf("0x%x", oct($var));
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s/\b$var\b/$hexval/;
}
}
#Ignore Page<foo> variants
$var !~ /^(?:Clear|Set|TestClear|TestSet|)Page[A-Z]/ &&
#Ignore SI style variants like nS, mV and dB (ie: max_uV, regulator_min_uA_show)
- $var !~ /^(?:[a-z_]*?)_?[a-z][A-Z](?:_[a-z_]+)?$/) {
+ $var !~ /^(?:[a-z_]*?)_?[a-z][A-Z](?:_[a-z_]+)?$/ &&
+#Ignore some three character SI units explicitly, like MiB and KHz
+ $var !~ /^(?:[a-z_]*?)_?(?:[KMGT]iB|[KMGT]?Hz)(?:_[a-z_]+)?$/) {
while ($var =~ m{($Ident)}g) {
my $word = $1;
next if ($word !~ /[A-Z][a-z]|[a-z][A-Z]/);
if (WARN("WHITESPACE_AFTER_LINE_CONTINUATION",
"Whitespace after \\ makes next lines useless\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~ s/\s+$//;
+ $fixed[$fixlinenr] =~ s/\s+$//;
}
}
-#warn if <asm/foo.h> is #included and <linux/foo.h> is available (uses RAW line)
+# warn if <asm/foo.h> is #included and <linux/foo.h> is available and includes
+# itself <asm/foo.h> (uses RAW line)
if ($tree && $rawline =~ m{^.\s*\#\s*include\s*\<asm\/(.*)\.h\>}) {
my $file = "$1.h";
my $checkfile = "include/linux/$file";
$realfile ne $checkfile &&
$1 !~ /$allowed_asm_includes/)
{
- if ($realfile =~ m{^arch/}) {
- CHK("ARCH_INCLUDE_LINUX",
- "Consider using #include <linux/$file> instead of <asm/$file>\n" . $herecurr);
- } else {
- WARN("INCLUDE_LINUX",
- "Use #include <linux/$file> instead of <asm/$file>\n" . $herecurr);
+ my $asminclude = `grep -Ec "#include\\s+<asm/$file>" $root/$checkfile`;
+ if ($asminclude > 0) {
+ if ($realfile =~ m{^arch/}) {
+ CHK("ARCH_INCLUDE_LINUX",
+ "Consider using #include <linux/$file> instead of <asm/$file>\n" . $herecurr);
+ } else {
+ WARN("INCLUDE_LINUX",
+ "Use #include <linux/$file> instead of <asm/$file>\n" . $herecurr);
+ }
}
}
}
my $cnt = $realcnt;
my ($off, $dstat, $dcond, $rest);
my $ctx = '';
+ my $has_flow_statement = 0;
+ my $has_arg_concat = 0;
($dstat, $dcond, $ln, $cnt, $off) =
ctx_statement_block($linenr, $realcnt, 0);
$ctx = $dstat;
#print "dstat<$dstat> dcond<$dcond> cnt<$cnt> off<$off>\n";
#print "LINE<$lines[$ln-1]> len<" . length($lines[$ln-1]) . "\n";
- $dstat =~ s/^.\s*\#\s*define\s+$Ident(?:\([^\)]*\))?\s*//;
+ $has_flow_statement = 1 if ($ctx =~ /\b(goto|return)\b/);
+ $has_arg_concat = 1 if ($ctx =~ /\#\#/ && $ctx !~ /\#\#\s*(?:__VA_ARGS__|args)\b/);
+
+ $dstat =~ s/^.\s*\#\s*define\s+$Ident(\([^\)]*\))?\s*//;
+ my $define_args = $1;
+ my $define_stmt = $dstat;
+ my @def_args = ();
+
+ if (defined $define_args && $define_args ne "") {
+ $define_args = substr($define_args, 1, length($define_args) - 2);
+ $define_args =~ s/\s*//g;
+ @def_args = split(",", $define_args);
+ }
+
$dstat =~ s/$;//g;
$dstat =~ s/\\\n.//g;
$dstat =~ s/^\s*//s;
# Flatten any parentheses and braces
while ($dstat =~ s/\([^\(\)]*\)/1/ ||
$dstat =~ s/\{[^\{\}]*\}/1/ ||
- $dstat =~ s/\[[^\[\]]*\]/1/)
+ $dstat =~ s/.\[[^\[\]]*\]/1/)
{
}
# Flatten any obvious string concatentation.
- while ($dstat =~ s/("X*")\s*$Ident/$1/ ||
- $dstat =~ s/$Ident\s*("X*")/$1/)
+ while ($dstat =~ s/($String)\s*$Ident/$1/ ||
+ $dstat =~ s/$Ident\s*($String)/$1/)
{
}
+ # Make asm volatile uses seem like a generic function
+ $dstat =~ s/\b_*asm_*\s+_*volatile_*\b/asm_volatile/g;
+
my $exceptions = qr{
$Declare|
module_param_named|
union|
struct|
\.$Ident\s*=\s*|
- ^\"|\"$
+ ^\"|\"$|
+ ^\[
}x;
#print "REST<$rest> dstat<$dstat> ctx<$ctx>\n";
+
+ $ctx =~ s/\n*$//;
+ my $herectx = $here . "\n";
+ my $stmt_cnt = statement_rawlines($ctx);
+
+ for (my $n = 0; $n < $stmt_cnt; $n++) {
+ $herectx .= raw_line($linenr, $n) . "\n";
+ }
+
if ($dstat ne '' &&
$dstat !~ /^(?:$Ident|-?$Constant),$/ && # 10, // foo(),
$dstat !~ /^(?:$Ident|-?$Constant);$/ && # foo();
$dstat !~ /^[!~-]?(?:$Lval|$Constant)$/ && # 10 // foo() // !foo // ~foo // -foo // foo->bar // foo.bar->baz
- $dstat !~ /^'X'$/ && # character constants
+ $dstat !~ /^'X'$/ && $dstat !~ /^'XX'$/ && # character constants
$dstat !~ /$exceptions/ &&
$dstat !~ /^\.$Ident\s*=/ && # .foo =
$dstat !~ /^(?:\#\s*$Ident|\#\s*$Constant)\s*$/ && # stringification #foo
$dstat !~ /^\(\{/ && # ({...
$ctx !~ /^.\s*#\s*define\s+TRACE_(?:SYSTEM|INCLUDE_FILE|INCLUDE_PATH)\b/)
{
- $ctx =~ s/\n*$//;
+ if ($dstat =~ /^\s*if\b/) {
+ ERROR("MULTISTATEMENT_MACRO_USE_DO_WHILE",
+ "Macros starting with if should be enclosed by a do - while loop to avoid possible if/else logic defects\n" . "$herectx");
+ } elsif ($dstat =~ /;/) {
+ ERROR("MULTISTATEMENT_MACRO_USE_DO_WHILE",
+ "Macros with multiple statements should be enclosed in a do - while loop\n" . "$herectx");
+ } else {
+ ERROR("COMPLEX_MACRO",
+ "Macros with complex values should be enclosed in parentheses\n" . "$herectx");
+ }
+
+ }
+
+ # Make $define_stmt single line, comment-free, etc
+ my @stmt_array = split('\n', $define_stmt);
+ my $first = 1;
+ $define_stmt = "";
+ foreach my $l (@stmt_array) {
+ $l =~ s/\\$//;
+ if ($first) {
+ $define_stmt = $l;
+ $first = 0;
+ } elsif ($l =~ /^[\+ ]/) {
+ $define_stmt .= substr($l, 1);
+ }
+ }
+ $define_stmt =~ s/$;//g;
+ $define_stmt =~ s/\s+/ /g;
+ $define_stmt = trim($define_stmt);
+
+# check if any macro arguments are reused (ignore '...' and 'type')
+ foreach my $arg (@def_args) {
+ next if ($arg =~ /\.\.\./);
+ next if ($arg =~ /^type$/i);
+ my $tmp_stmt = $define_stmt;
+ $tmp_stmt =~ s/\b(typeof|__typeof__|__builtin\w+|typecheck\s*\(\s*$Type\s*,|\#+)\s*\(*\s*$arg\s*\)*\b//g;
+ $tmp_stmt =~ s/\#+\s*$arg\b//g;
+ $tmp_stmt =~ s/\b$arg\s*\#\#//g;
+ my $use_cnt = $tmp_stmt =~ s/\b$arg\b//g;
+ if ($use_cnt > 1) {
+ CHK("MACRO_ARG_REUSE",
+ "Macro argument reuse '$arg' - possible side-effects?\n" . "$herectx");
+ }
+# check if any macro arguments may have other precedence issues
+ if ($tmp_stmt =~ m/($Operators)?\s*\b$arg\b\s*($Operators)?/m &&
+ ((defined($1) && $1 ne ',') ||
+ (defined($2) && $2 ne ','))) {
+ CHK("MACRO_ARG_PRECEDENCE",
+ "Macro argument '$arg' may be better as '($arg)' to avoid precedence issues\n" . "$herectx");
+ }
+ }
+
+# check for macros with flow control, but without ## concatenation
+# ## concatenation is commonly a macro that defines a function so ignore those
+ if ($has_flow_statement && !$has_arg_concat) {
my $herectx = $here . "\n";
my $cnt = statement_rawlines($ctx);
for (my $n = 0; $n < $cnt; $n++) {
$herectx .= raw_line($linenr, $n) . "\n";
}
-
- if ($dstat =~ /;/) {
- ERROR("MULTISTATEMENT_MACRO_USE_DO_WHILE",
- "Macros with multiple statements should be enclosed in a do - while loop\n" . "$herectx");
- } else {
- ERROR("COMPLEX_MACRO",
- "Macros with complex values should be enclosed in parenthesis\n" . "$herectx");
- }
+ WARN("MACRO_WITH_FLOW_CONTROL",
+ "Macros with flow control statements should be avoided\n" . "$herectx");
}
# check for line continuations outside of #defines, preprocessor #, and asm
$ctx = $dstat;
$dstat =~ s/\\\n.//g;
+ $dstat =~ s/$;/ /g;
if ($dstat =~ /^\+\s*#\s*define\s+$Ident\s*${balanced_parens}\s*do\s*{(.*)\s*}\s*while\s*\(\s*0\s*\)\s*([;\s]*)\s*$/) {
my $stmts = $2;
WARN("DO_WHILE_MACRO_WITH_TRAILING_SEMICOLON",
"do {} while (0) macros should not be semicolon terminated\n" . "$herectx");
}
+ } elsif ($dstat =~ /^\+\s*#\s*define\s+$Ident.*;\s*$/) {
+ $ctx =~ s/\n*$//;
+ my $cnt = statement_rawlines($ctx);
+ my $herectx = $here . "\n";
+
+ for (my $n = 0; $n < $cnt; $n++) {
+ $herectx .= raw_line($linenr, $n) . "\n";
+ }
+
+ WARN("TRAILING_SEMICOLON",
+ "macros should not use a trailing semicolon\n" . "$herectx");
}
}
}
}
+# check for single line unbalanced braces
+ if ($sline =~ /^.\s*\}\s*else\s*$/ ||
+ $sline =~ /^.\s*else\s*\{\s*$/) {
+ CHK("BRACES", "Unbalanced braces around else statement\n" . $herecurr);
+ }
+
# check for unnecessary blank lines around braces
if (($line =~ /^.\s*}\s*$/ && $prevrawline =~ /^.\s*$/)) {
- CHK("BRACES",
- "Blank lines aren't necessary before a close brace '}'\n" . $hereprev);
+ if (CHK("BRACES",
+ "Blank lines aren't necessary before a close brace '}'\n" . $hereprev) &&
+ $fix && $prevrawline =~ /^\+/) {
+ fix_delete_line($fixlinenr - 1, $prevrawline);
+ }
}
if (($rawline =~ /^.\s*$/ && $prevline =~ /^..*{\s*$/)) {
- CHK("BRACES",
- "Blank lines aren't necessary after an open brace '{'\n" . $hereprev);
+ if (CHK("BRACES",
+ "Blank lines aren't necessary after an open brace '{'\n" . $hereprev) &&
+ $fix) {
+ fix_delete_line($fixlinenr, $rawline);
+ }
}
# no volatiles please
my $asm_volatile = qr{\b(__asm__|asm)\s+(__volatile__|volatile)\b};
if ($line =~ /\bvolatile\b/ && $line !~ /$asm_volatile/) {
WARN("VOLATILE",
- "Use of volatile is usually wrong: see Documentation/volatile-considered-harmful.txt\n" . $herecurr);
+ "Use of volatile is usually wrong: see Documentation/process/volatile-considered-harmful.rst\n" . $herecurr);
+ }
+
+# Check for user-visible strings broken across lines, which breaks the ability
+# to grep for the string. Make exceptions when the previous string ends in a
+# newline (multiple lines in one string constant) or '\t', '\r', ';', or '{'
+# (common in inline assembly) or is a octal \123 or hexadecimal \xaf value
+ if ($line =~ /^\+\s*$String/ &&
+ $prevline =~ /"\s*$/ &&
+ $prevrawline !~ /(?:\\(?:[ntr]|[0-7]{1,3}|x[0-9a-fA-F]{1,2})|;\s*|\{\s*)"\s*$/) {
+ if (WARN("SPLIT_STRING",
+ "quoted string split across lines\n" . $hereprev) &&
+ $fix &&
+ $prevrawline =~ /^\+.*"\s*$/ &&
+ $last_coalesced_string_linenr != $linenr - 1) {
+ my $extracted_string = get_quoted_string($line, $rawline);
+ my $comma_close = "";
+ if ($rawline =~ /\Q$extracted_string\E(\s*\)\s*;\s*$|\s*,\s*)/) {
+ $comma_close = $1;
+ }
+
+ fix_delete_line($fixlinenr - 1, $prevrawline);
+ fix_delete_line($fixlinenr, $rawline);
+ my $fixedline = $prevrawline;
+ $fixedline =~ s/"\s*$//;
+ $fixedline .= substr($extracted_string, 1) . trim($comma_close);
+ fix_insert_line($fixlinenr - 1, $fixedline);
+ $fixedline = $rawline;
+ $fixedline =~ s/\Q$extracted_string\E\Q$comma_close\E//;
+ if ($fixedline !~ /\+\s*$/) {
+ fix_insert_line($fixlinenr, $fixedline);
+ }
+ $last_coalesced_string_linenr = $linenr;
+ }
+ }
+
+# check for missing a space in a string concatenation
+ if ($prevrawline =~ /[^\\]\w"$/ && $rawline =~ /^\+[\t ]+"\w/) {
+ WARN('MISSING_SPACE',
+ "break quoted strings at a space character\n" . $hereprev);
+ }
+
+# check for an embedded function name in a string when the function is known
+# This does not work very well for -f --file checking as it depends on patch
+# context providing the function name or a single line form for in-file
+# function declarations
+ if ($line =~ /^\+.*$String/ &&
+ defined($context_function) &&
+ get_quoted_string($line, $rawline) =~ /\b$context_function\b/ &&
+ length(get_quoted_string($line, $rawline)) != (length($context_function) + 2)) {
+ WARN("EMBEDDED_FUNCTION_NAME",
+ "Prefer using '\"%s...\", __func__' to using '$context_function', this function's name, in a string\n" . $herecurr);
+ }
+
+# check for spaces before a quoted newline
+ if ($rawline =~ /^.*\".*\s\\n/) {
+ if (WARN("QUOTED_WHITESPACE_BEFORE_NEWLINE",
+ "unnecessary whitespace before a quoted newline\n" . $herecurr) &&
+ $fix) {
+ $fixed[$fixlinenr] =~ s/^(\+.*\".*)\s+\\n/$1\\n/;
+ }
+
+ }
+
+# concatenated string without spaces between elements
+ if ($line =~ /$String[A-Z_]/ || $line =~ /[A-Za-z0-9_]$String/) {
+ CHK("CONCATENATED_STRING",
+ "Concatenated strings should use spaces between elements\n" . $herecurr);
+ }
+
+# uncoalesced string fragments
+ if ($line =~ /$String\s*"/) {
+ WARN("STRING_FRAGMENTS",
+ "Consecutive strings are generally better as a single string\n" . $herecurr);
+ }
+
+# check for non-standard and hex prefixed decimal printf formats
+ my $show_L = 1; #don't show the same defect twice
+ my $show_Z = 1;
+ while ($line =~ /(?:^|")([X\t]*)(?:"|$)/g) {
+ my $string = substr($rawline, $-[1], $+[1] - $-[1]);
+ $string =~ s/%%/__/g;
+ # check for %L
+ if ($show_L && $string =~ /%[\*\d\.\$]*L([diouxX])/) {
+ WARN("PRINTF_L",
+ "\%L$1 is non-standard C, use %ll$1\n" . $herecurr);
+ $show_L = 0;
+ }
+ # check for %Z
+ if ($show_Z && $string =~ /%[\*\d\.\$]*Z([diouxX])/) {
+ WARN("PRINTF_Z",
+ "%Z$1 is non-standard C, use %z$1\n" . $herecurr);
+ $show_Z = 0;
+ }
+ # check for 0x<decimal>
+ if ($string =~ /0x%[\*\d\.\$\Llzth]*[diou]/) {
+ ERROR("PRINTF_0XDECIMAL",
+ "Prefixing 0x with decimal output is defective\n" . $herecurr);
+ }
+ }
+
+# check for line continuations in quoted strings with odd counts of "
+ if ($rawline =~ /\\$/ && $rawline =~ tr/"/"/ % 2) {
+ WARN("LINE_CONTINUATIONS",
+ "Avoid line continuations in quoted strings\n" . $herecurr);
}
# warn about #if 0
# check for needless "if (<foo>) fn(<foo>)" uses
if ($prevline =~ /\bif\s*\(\s*($Lval)\s*\)/) {
- my $expr = '\s*\(\s*' . quotemeta($1) . '\s*\)\s*;';
- if ($line =~ /\b(kfree|usb_free_urb|debugfs_remove(?:_recursive)?)$expr/) {
- WARN('NEEDLESS_IF',
- "$1(NULL) is safe this check is probably not required\n" . $hereprev);
+ my $tested = quotemeta($1);
+ my $expr = '\s*\(\s*' . $tested . '\s*\)\s*;';
+ if ($line =~ /\b(kfree|usb_free_urb|debugfs_remove(?:_recursive)?|(?:kmem_cache|mempool|dma_pool)_destroy)$expr/) {
+ my $func = $1;
+ if (WARN('NEEDLESS_IF',
+ "$func(NULL) is safe and this check is probably not required\n" . $hereprev) &&
+ $fix) {
+ my $do_fix = 1;
+ my $leading_tabs = "";
+ my $new_leading_tabs = "";
+ if ($lines[$linenr - 2] =~ /^\+(\t*)if\s*\(\s*$tested\s*\)\s*$/) {
+ $leading_tabs = $1;
+ } else {
+ $do_fix = 0;
+ }
+ if ($lines[$linenr - 1] =~ /^\+(\t+)$func\s*\(\s*$tested\s*\)\s*;\s*$/) {
+ $new_leading_tabs = $1;
+ if (length($leading_tabs) + 1 ne length($new_leading_tabs)) {
+ $do_fix = 0;
+ }
+ } else {
+ $do_fix = 0;
+ }
+ if ($do_fix) {
+ fix_delete_line($fixlinenr - 1, $prevrawline);
+ $fixed[$fixlinenr] =~ s/^\+$new_leading_tabs/\+$leading_tabs/;
+ }
+ }
+ }
+ }
+
+# check for unnecessary "Out of Memory" messages
+ if ($line =~ /^\+.*\b$logFunctions\s*\(/ &&
+ $prevline =~ /^[ \+]\s*if\s*\(\s*(\!\s*|NULL\s*==\s*)?($Lval)(\s*==\s*NULL\s*)?\s*\)/ &&
+ (defined $1 || defined $3) &&
+ $linenr > 3) {
+ my $testval = $2;
+ my $testline = $lines[$linenr - 3];
+
+ my ($s, $c) = ctx_statement_block($linenr - 3, $realcnt, 0);
+# print("line: <$line>\nprevline: <$prevline>\ns: <$s>\nc: <$c>\n\n\n");
+
+ if ($s =~ /(?:^|\n)[ \+]\s*(?:$Type\s*)?\Q$testval\E\s*=\s*(?:\([^\)]*\)\s*)?\s*(?:devm_)?(?:[kv][czm]alloc(?:_node|_array)?\b|kstrdup|kmemdup|(?:dev_)?alloc_skb)/) {
+ WARN("OOM_MESSAGE",
+ "Possible unnecessary 'out of memory' message\n" . $hereprev);
+ }
+ }
+
+# check for logging functions with KERN_<LEVEL>
+ if ($line !~ /printk(?:_ratelimited|_once)?\s*\(/ &&
+ $line =~ /\b$logFunctions\s*\(.*\b(KERN_[A-Z]+)\b/) {
+ my $level = $1;
+ if (WARN("UNNECESSARY_KERN_LEVEL",
+ "Possible unnecessary $level\n" . $herecurr) &&
+ $fix) {
+ $fixed[$fixlinenr] =~ s/\s*$level\s*//;
+ }
+ }
+
+# check for logging continuations
+ if ($line =~ /\bprintk\s*\(\s*KERN_CONT\b|\bpr_cont\s*\(/) {
+ WARN("LOGGING_CONTINUATION",
+ "Avoid logging continuation uses where feasible\n" . $herecurr);
+ }
+
+# check for mask then right shift without a parentheses
+ if ($^V && $^V ge 5.10.0 &&
+ $line =~ /$LvalOrFunc\s*\&\s*($LvalOrFunc)\s*>>/ &&
+ $4 !~ /^\&/) { # $LvalOrFunc may be &foo, ignore if so
+ WARN("MASK_THEN_SHIFT",
+ "Possible precedence defect with mask then right shift - may need parentheses\n" . $herecurr);
+ }
+
+# check for pointer comparisons to NULL
+ if ($^V && $^V ge 5.10.0) {
+ while ($line =~ /\b$LvalOrFunc\s*(==|\!=)\s*NULL\b/g) {
+ my $val = $1;
+ my $equal = "!";
+ $equal = "" if ($4 eq "!=");
+ if (CHK("COMPARISON_TO_NULL",
+ "Comparison to NULL could be written \"${equal}${val}\"\n" . $herecurr) &&
+ $fix) {
+ $fixed[$fixlinenr] =~ s/\b\Q$val\E\s*(?:==|\!=)\s*NULL\b/$equal$val/;
+ }
}
}
WARN("MISPLACED_INIT",
"$attr should be placed after $var\n" . $herecurr))) &&
$fix) {
- $fixed[$linenr - 1] =~ s/(\bstatic\s+(?:const\s+)?)(?:$attr\s+)?($NonptrTypeWithAttr)\s+(?:$attr\s+)?($Ident(?:\[[^]]*\])?)\s*([=;])\s*/"$1" . trim(string_find_replace($2, "\\s*$attr\\s*", " ")) . " " . trim(string_find_replace($3, "\\s*$attr\\s*", "")) . " $attr" . ("$4" eq ";" ? ";" : " = ")/e;
+ $fixed[$fixlinenr] =~ s/(\bstatic\s+(?:const\s+)?)(?:$attr\s+)?($NonptrTypeWithAttr)\s+(?:$attr\s+)?($Ident(?:\[[^]]*\])?)\s*([=;])\s*/"$1" . trim(string_find_replace($2, "\\s*$attr\\s*", " ")) . " " . trim(string_find_replace($3, "\\s*$attr\\s*", "")) . " $attr" . ("$4" eq ";" ? ";" : " = ")/e;
}
}
}
if (ERROR("INIT_ATTRIBUTE",
"Use of const init definition must use ${attr_prefix}initconst\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s/$InitAttributeData/${attr_prefix}initconst/;
}
}
if (ERROR("INIT_ATTRIBUTE",
"Use of $attr requires a separate use of const\n" . $herecurr) &&
$fix) {
- my $lead = $fixed[$linenr - 1] =~
+ my $lead = $fixed[$fixlinenr] =~
/(^\+\s*(?:static\s+))/;
$lead = rtrim($1);
$lead = "$lead " if ($lead !~ /^\+$/);
$lead = "${lead}const ";
- $fixed[$linenr - 1] =~ s/(^\+\s*(?:static\s+))/$lead/;
+ $fixed[$fixlinenr] =~ s/(^\+\s*(?:static\s+))/$lead/;
+ }
+ }
+
+# check for __read_mostly with const non-pointer (should just be const)
+ if ($line =~ /\b__read_mostly\b/ &&
+ $line =~ /($Type)\s*$Ident/ && $1 !~ /\*\s*$/ && $1 =~ /\bconst\b/) {
+ if (ERROR("CONST_READ_MOSTLY",
+ "Invalid use of __read_mostly with const type\n" . $herecurr) &&
+ $fix) {
+ $fixed[$fixlinenr] =~ s/\s+__read_mostly\b//;
+ }
+ }
+
+# don't use __constant_<foo> functions outside of include/uapi/
+ if ($realfile !~ m@^include/uapi/@ &&
+ $line =~ /(__constant_(?:htons|ntohs|[bl]e(?:16|32|64)_to_cpu|cpu_to_[bl]e(?:16|32|64)))\s*\(/) {
+ my $constant_func = $1;
+ my $func = $constant_func;
+ $func =~ s/^__constant_//;
+ if (WARN("CONSTANT_CONVERSION",
+ "$constant_func should be $func\n" . $herecurr) &&
+ $fix) {
+ $fixed[$fixlinenr] =~ s/\b$constant_func\b/$func/g;
}
}
# prefer usleep_range over udelay
if ($line =~ /\budelay\s*\(\s*(\d+)\s*\)/) {
+ my $delay = $1;
# ignore udelay's < 10, however
- if (! ($1 < 10) ) {
+ if (! ($delay < 10) ) {
CHK("USLEEP_RANGE",
- "usleep_range is preferred over udelay; see Documentation/timers/timers-howto.txt\n" . $line);
+ "usleep_range is preferred over udelay; see Documentation/timers/timers-howto.txt\n" . $herecurr);
+ }
+ if ($delay > 2000) {
+ WARN("LONG_UDELAY",
+ "long udelay - prefer mdelay; see arch/arm/include/asm/delay.h\n" . $herecurr);
}
}
if ($line =~ /\bmsleep\s*\((\d+)\);/) {
if ($1 < 20) {
WARN("MSLEEP",
- "msleep < 20ms can sleep for up to 20ms; see Documentation/timers/timers-howto.txt\n" . $line);
+ "msleep < 20ms can sleep for up to 20ms; see Documentation/timers/timers-howto.txt\n" . $herecurr);
}
}
if (ERROR("SPACING",
"exactly one space required after that #$1\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~
+ $fixed[$fixlinenr] =~
s/^(.\s*\#\s*(ifdef|ifndef|elif))\s{2,}/$1 /;
}
}
}
# check for memory barriers without a comment.
- if ($line =~ /\b(mb|rmb|wmb|read_barrier_depends|smp_mb|smp_rmb|smp_wmb|smp_read_barrier_depends)\(/) {
+
+ my $barriers = qr{
+ mb|
+ rmb|
+ wmb|
+ read_barrier_depends
+ }x;
+ my $barrier_stems = qr{
+ mb__before_atomic|
+ mb__after_atomic|
+ store_release|
+ load_acquire|
+ store_mb|
+ (?:$barriers)
+ }x;
+ my $all_barriers = qr{
+ (?:$barriers)|
+ smp_(?:$barrier_stems)|
+ virt_(?:$barrier_stems)
+ }x;
+
+ if ($line =~ /\b(?:$all_barriers)\s*\(/) {
if (!ctx_has_comment($first_line, $linenr)) {
WARN("MEMORY_BARRIER",
"memory barrier without comment\n" . $herecurr);
}
}
+
+ my $underscore_smp_barriers = qr{__smp_(?:$barrier_stems)}x;
+
+ if ($realfile !~ m@^include/asm-generic/@ &&
+ $realfile !~ m@/barrier\.h$@ &&
+ $line =~ m/\b(?:$underscore_smp_barriers)\s*\(/ &&
+ $line !~ m/^.\s*\#\s*define\s+(?:$underscore_smp_barriers)\s*\(/) {
+ WARN("MEMORY_BARRIER",
+ "__smp memory barriers shouldn't be used outside barrier.h and asm-generic\n" . $herecurr);
+ }
+
+# check for waitqueue_active without a comment.
+ if ($line =~ /\bwaitqueue_active\s*\(/) {
+ if (!ctx_has_comment($first_line, $linenr)) {
+ WARN("WAITQUEUE_ACTIVE",
+ "waitqueue_active without comment\n" . $herecurr);
+ }
+ }
+
# check of hardware specific defines
if ($line =~ m@^.\s*\#\s*if.*\b(__i386__|__powerpc64__|__sun__|__s390x__)\b@ && $realfile !~ m@include/asm-@) {
CHK("ARCH_DEFINES",
"architecture specific defines should be avoided\n" . $herecurr);
}
+# check that the storage class is not after a type
+ if ($line =~ /\b($Type)\s+($Storage)\b/) {
+ WARN("STORAGE_CLASS",
+ "storage class '$2' should be located before type '$1'\n" . $herecurr);
+ }
# Check that the storage class is at the beginning of a declaration
- if ($line =~ /\b$Storage\b/ && $line !~ /^.\s*$Storage\b/) {
+ if ($line =~ /\b$Storage\b/ &&
+ $line !~ /^.\s*$Storage/ &&
+ $line =~ /^.\s*(.+?)\$Storage\s/ &&
+ $1 !~ /[\,\)]\s*$/) {
WARN("STORAGE_CLASS",
- "storage class should be at the beginning of the declaration\n" . $herecurr)
+ "storage class should be at the beginning of the declaration\n" . $herecurr);
}
# check the location of the inline attribute, that it is between
if (WARN("INLINE",
"plain inline is preferred over $1\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~ s/\b(__inline__|__inline)\b/inline/;
+ $fixed[$fixlinenr] =~ s/\b(__inline__|__inline)\b/inline/;
}
}
WARN("PREFER_PACKED",
"__packed is preferred over __attribute__((packed))\n" . $herecurr);
}
+
# Check for new packed members, warn to use care
- if ($line =~ /\b(__attribute__\s*\(\s*\(.*\bpacked|__packed)\b/) {
+ if ($realfile !~ m@\binclude/uapi/@ &&
+ $line =~ /\b(__attribute__\s*\(\s*\(.*\bpacked|__packed)\b/) {
WARN("NEW_PACKED",
"Adding new packed members is to be done with care\n" . $herecurr);
}
if (WARN("PREFER_PRINTF",
"__printf(string-index, first-to-check) is preferred over __attribute__((format(printf, string-index, first-to-check)))\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~ s/\b__attribute__\s*\(\s*\(\s*format\s*\(\s*printf\s*,\s*(.*)\)\s*\)\s*\)/"__printf(" . trim($1) . ")"/ex;
+ $fixed[$fixlinenr] =~ s/\b__attribute__\s*\(\s*\(\s*format\s*\(\s*printf\s*,\s*(.*)\)\s*\)\s*\)/"__printf(" . trim($1) . ")"/ex;
}
}
if (WARN("PREFER_SCANF",
"__scanf(string-index, first-to-check) is preferred over __attribute__((format(scanf, string-index, first-to-check)))\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~ s/\b__attribute__\s*\(\s*\(\s*format\s*\(\s*scanf\s*,\s*(.*)\)\s*\)\s*\)/"__scanf(" . trim($1) . ")"/ex;
+ $fixed[$fixlinenr] =~ s/\b__attribute__\s*\(\s*\(\s*format\s*\(\s*scanf\s*,\s*(.*)\)\s*\)\s*\)/"__scanf(" . trim($1) . ")"/ex;
+ }
+ }
+
+# Check for __attribute__ weak, or __weak declarations (may have link issues)
+ if ($^V && $^V ge 5.10.0 &&
+ $line =~ /(?:$Declare|$DeclareMisordered)\s*$Ident\s*$balanced_parens\s*(?:$Attribute)?\s*;/ &&
+ ($line =~ /\b__attribute__\s*\(\s*\(.*\bweak\b/ ||
+ $line =~ /\b__weak\b/)) {
+ ERROR("WEAK_DECLARATION",
+ "Using weak declarations can have unintended link defects\n" . $herecurr);
+ }
+
+# check for c99 types like uint8_t used outside of uapi/ and tools/
+ if ($realfile !~ m@\binclude/uapi/@ &&
+ $realfile !~ m@\btools/@ &&
+ $line =~ /\b($Declare)\s*$Ident\s*[=;,\[]/) {
+ my $type = $1;
+ if ($type =~ /\b($typeC99Typedefs)\b/) {
+ $type = $1;
+ my $kernel_type = 'u';
+ $kernel_type = 's' if ($type =~ /^_*[si]/);
+ $type =~ /(\d+)/;
+ $kernel_type .= $1;
+ if (CHK("PREFER_KERNEL_TYPES",
+ "Prefer kernel type '$kernel_type' over '$type'\n" . $herecurr) &&
+ $fix) {
+ $fixed[$fixlinenr] =~ s/\b$type\b/$kernel_type/;
+ }
+ }
+ }
+
+# check for cast of C90 native int or longer types constants
+ if ($line =~ /(\(\s*$C90_int_types\s*\)\s*)($Constant)\b/) {
+ my $cast = $1;
+ my $const = $2;
+ if (WARN("TYPECAST_INT_CONSTANT",
+ "Unnecessary typecast of c90 int constant\n" . $herecurr) &&
+ $fix) {
+ my $suffix = "";
+ my $newconst = $const;
+ $newconst =~ s/${Int_type}$//;
+ $suffix .= 'U' if ($cast =~ /\bunsigned\b/);
+ if ($cast =~ /\blong\s+long\b/) {
+ $suffix .= 'LL';
+ } elsif ($cast =~ /\blong\b/) {
+ $suffix .= 'L';
+ }
+ $fixed[$fixlinenr] =~ s/\Q$cast\E$const\b/$newconst$suffix/;
}
}
if (WARN("SIZEOF_PARENTHESIS",
"sizeof $1 should be sizeof($1)\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~ s/\bsizeof\s+((?:\*\s*|)$Lval|$Type(?:\s+$Lval|))/"sizeof(" . trim($1) . ")"/ex;
+ $fixed[$fixlinenr] =~ s/\bsizeof\s+((?:\*\s*|)$Lval|$Type(?:\s+$Lval|))/"sizeof(" . trim($1) . ")"/ex;
}
}
-# check for line continuations in quoted strings with odd counts of "
- if ($rawline =~ /\\$/ && $rawline =~ tr/"/"/ % 2) {
- WARN("LINE_CONTINUATIONS",
- "Avoid line continuations in quoted strings\n" . $herecurr);
- }
-
# check for struct spinlock declarations
if ($line =~ /^.\s*\bstruct\s+spinlock\s+\w+\s*;/) {
WARN("USE_SPINLOCK_T",
# check for seq_printf uses that could be seq_puts
if ($sline =~ /\bseq_printf\s*\(.*"\s*\)\s*;\s*$/) {
my $fmt = get_quoted_string($line, $rawline);
- if ($fmt ne "" && $fmt !~ /[^\\]\%/) {
+ $fmt =~ s/%%//g;
+ if ($fmt !~ /%/) {
if (WARN("PREFER_SEQ_PUTS",
"Prefer seq_puts to seq_printf\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~ s/\bseq_printf\b/seq_puts/;
+ $fixed[$fixlinenr] =~ s/\bseq_printf\b/seq_puts/;
+ }
+ }
+ }
+
+ # check for vsprintf extension %p<foo> misuses
+ if ($^V && $^V ge 5.10.0 &&
+ defined $stat &&
+ $stat =~ /^\+(?![^\{]*\{\s*).*\b(\w+)\s*\(.*$String\s*,/s &&
+ $1 !~ /^_*volatile_*$/) {
+ my $bad_extension = "";
+ my $lc = $stat =~ tr@\n@@;
+ $lc = $lc + $linenr;
+ for (my $count = $linenr; $count <= $lc; $count++) {
+ my $fmt = get_quoted_string($lines[$count - 1], raw_line($count, 0));
+ $fmt =~ s/%%//g;
+ if ($fmt =~ /(\%[\*\d\.]*p(?![\WFfSsBKRraEhMmIiUDdgVCbGNO]).)/) {
+ $bad_extension = $1;
+ last;
}
}
+ if ($bad_extension ne "") {
+ my $stat_real = raw_line($linenr, 0);
+ for (my $count = $linenr + 1; $count <= $lc; $count++) {
+ $stat_real = $stat_real . "\n" . raw_line($count, 0);
+ }
+ WARN("VSPRINTF_POINTER_EXTENSION",
+ "Invalid vsprintf pointer extension '$bad_extension'\n" . "$here\n$stat_real\n");
+ }
}
# Check for misused memsets
if ($^V && $^V ge 5.10.0 &&
defined $stat &&
- $stat =~ /^\+(?:.*?)\bmemset\s*\(\s*$FuncArg\s*,\s*$FuncArg\s*\,\s*$FuncArg\s*\)/s) {
+ $stat =~ /^\+(?:.*?)\bmemset\s*\(\s*$FuncArg\s*,\s*$FuncArg\s*\,\s*$FuncArg\s*\)/) {
my $ms_addr = $2;
my $ms_val = $7;
}
# Check for memcpy(foo, bar, ETH_ALEN) that could be ether_addr_copy(foo, bar)
- if ($^V && $^V ge 5.10.0 &&
- $line =~ /^\+(?:.*?)\bmemcpy\s*\(\s*$FuncArg\s*,\s*$FuncArg\s*\,\s*ETH_ALEN\s*\)/s) {
- if (WARN("PREFER_ETHER_ADDR_COPY",
- "Prefer ether_addr_copy() over memcpy() if the Ethernet addresses are __aligned(2)\n" . $herecurr) &&
- $fix) {
- $fixed[$linenr - 1] =~ s/\bmemcpy\s*\(\s*$FuncArg\s*,\s*$FuncArg\s*\,\s*ETH_ALEN\s*\)/ether_addr_copy($2, $7)/;
- }
- }
+# if ($^V && $^V ge 5.10.0 &&
+# defined $stat &&
+# $stat =~ /^\+(?:.*?)\bmemcpy\s*\(\s*$FuncArg\s*,\s*$FuncArg\s*\,\s*ETH_ALEN\s*\)/) {
+# if (WARN("PREFER_ETHER_ADDR_COPY",
+# "Prefer ether_addr_copy() over memcpy() if the Ethernet addresses are __aligned(2)\n" . "$here\n$stat\n") &&
+# $fix) {
+# $fixed[$fixlinenr] =~ s/\bmemcpy\s*\(\s*$FuncArg\s*,\s*$FuncArg\s*\,\s*ETH_ALEN\s*\)/ether_addr_copy($2, $7)/;
+# }
+# }
+
+# Check for memcmp(foo, bar, ETH_ALEN) that could be ether_addr_equal*(foo, bar)
+# if ($^V && $^V ge 5.10.0 &&
+# defined $stat &&
+# $stat =~ /^\+(?:.*?)\bmemcmp\s*\(\s*$FuncArg\s*,\s*$FuncArg\s*\,\s*ETH_ALEN\s*\)/) {
+# WARN("PREFER_ETHER_ADDR_EQUAL",
+# "Prefer ether_addr_equal() or ether_addr_equal_unaligned() over memcmp()\n" . "$here\n$stat\n")
+# }
+
+# check for memset(foo, 0x0, ETH_ALEN) that could be eth_zero_addr
+# check for memset(foo, 0xFF, ETH_ALEN) that could be eth_broadcast_addr
+# if ($^V && $^V ge 5.10.0 &&
+# defined $stat &&
+# $stat =~ /^\+(?:.*?)\bmemset\s*\(\s*$FuncArg\s*,\s*$FuncArg\s*\,\s*ETH_ALEN\s*\)/) {
+#
+# my $ms_val = $7;
+#
+# if ($ms_val =~ /^(?:0x|)0+$/i) {
+# if (WARN("PREFER_ETH_ZERO_ADDR",
+# "Prefer eth_zero_addr over memset()\n" . "$here\n$stat\n") &&
+# $fix) {
+# $fixed[$fixlinenr] =~ s/\bmemset\s*\(\s*$FuncArg\s*,\s*$FuncArg\s*,\s*ETH_ALEN\s*\)/eth_zero_addr($2)/;
+# }
+# } elsif ($ms_val =~ /^(?:0xff|255)$/i) {
+# if (WARN("PREFER_ETH_BROADCAST_ADDR",
+# "Prefer eth_broadcast_addr() over memset()\n" . "$here\n$stat\n") &&
+# $fix) {
+# $fixed[$fixlinenr] =~ s/\bmemset\s*\(\s*$FuncArg\s*,\s*$FuncArg\s*,\s*ETH_ALEN\s*\)/eth_broadcast_addr($2)/;
+# }
+# }
+# }
# typecasts on min/max could be min_t/max_t
if ($^V && $^V ge 5.10.0 &&
# check for naked sscanf
if ($^V && $^V ge 5.10.0 &&
defined $stat &&
- $stat =~ /\bsscanf\b/ &&
+ $line =~ /\bsscanf\b/ &&
($stat !~ /$Ident\s*=\s*sscanf\s*$balanced_parens/ &&
$stat !~ /\bsscanf\s*$balanced_parens\s*(?:$Compare)/ &&
$stat !~ /(?:$Compare)\s*\bsscanf\s*$balanced_parens/)) {
"unchecked sscanf return value\n" . "$here\n$stat_real\n");
}
+# check for simple sscanf that should be kstrto<foo>
+ if ($^V && $^V ge 5.10.0 &&
+ defined $stat &&
+ $line =~ /\bsscanf\b/) {
+ my $lc = $stat =~ tr@\n@@;
+ $lc = $lc + $linenr;
+ my $stat_real = raw_line($linenr, 0);
+ for (my $count = $linenr + 1; $count <= $lc; $count++) {
+ $stat_real = $stat_real . "\n" . raw_line($count, 0);
+ }
+ if ($stat_real =~ /\bsscanf\b\s*\(\s*$FuncArg\s*,\s*("[^"]+")/) {
+ my $format = $6;
+ my $count = $format =~ tr@%@%@;
+ if ($count == 1 &&
+ $format =~ /^"\%(?i:ll[udxi]|[udxi]ll|ll|[hl]h?[udxi]|[udxi][hl]h?|[hl]h?|[udxi])"$/) {
+ WARN("SSCANF_TO_KSTRTO",
+ "Prefer kstrto<type> to single variable sscanf\n" . "$here\n$stat_real\n");
+ }
+ }
+ }
+
# check for new externs in .h files.
if ($realfile =~ /\.h$/ &&
$line =~ /^\+\s*(extern\s+)$Type\s*$Ident\s*\(/s) {
if (CHK("AVOID_EXTERNS",
"extern prototypes should be avoided in .h files\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~ s/(.*)\bextern\b\s*(.*)/$1$2/;
+ $fixed[$fixlinenr] =~ s/(.*)\bextern\b\s*(.*)/$1$2/;
}
}
"externs should be avoided in .c files\n" . $herecurr);
}
+# check for function declarations that have arguments without identifier names
+ if (defined $stat &&
+ $stat =~ /^.\s*(?:extern\s+)?$Type\s*$Ident\s*\(\s*([^{]+)\s*\)\s*;/s &&
+ $1 ne "void") {
+ my $args = trim($1);
+ while ($args =~ m/\s*($Type\s*(?:$Ident|\(\s*\*\s*$Ident?\s*\)\s*$balanced_parens)?)/g) {
+ my $arg = trim($1);
+ if ($arg =~ /^$Type$/ && $arg !~ /enum\s+$Ident$/) {
+ WARN("FUNCTION_ARGUMENTS",
+ "function definition argument '$arg' should also have an identifier name\n" . $herecurr);
+ }
+ }
+ }
+
+# check for function definitions
+ if ($^V && $^V ge 5.10.0 &&
+ defined $stat &&
+ $stat =~ /^.\s*(?:$Storage\s+)?$Type\s*($Ident)\s*$balanced_parens\s*{/s) {
+ $context_function = $1;
+
+# check for multiline function definition with misplaced open brace
+ my $ok = 0;
+ my $cnt = statement_rawlines($stat);
+ my $herectx = $here . "\n";
+ for (my $n = 0; $n < $cnt; $n++) {
+ my $rl = raw_line($linenr, $n);
+ $herectx .= $rl . "\n";
+ $ok = 1 if ($rl =~ /^[ \+]\{/);
+ $ok = 1 if ($rl =~ /\{/ && $n == 0);
+ last if $rl =~ /^[ \+].*\{/;
+ }
+ if (!$ok) {
+ ERROR("OPEN_BRACE",
+ "open brace '{' following function definitions go on the next line\n" . $herectx);
+ }
+ }
+
# checks for new __setup's
if ($rawline =~ /\b__setup\("([^"]*)"/) {
my $name = $1;
if (!grep(/$name/, @setup_docs)) {
CHK("UNDOCUMENTED_SETUP",
- "__setup appears un-documented -- check Documentation/kernel-parameters.txt\n" . $herecurr);
+ "__setup appears un-documented -- check Documentation/admin-guide/kernel-parameters.rst\n" . $herecurr);
}
}
"Prefer $3(sizeof(*$1)...) over $3($4...)\n" . $herecurr);
}
+# check for k[mz]alloc with multiplies that could be kmalloc_array/kcalloc
+ if ($^V && $^V ge 5.10.0 &&
+ defined $stat &&
+ $stat =~ /^\+\s*($Lval)\s*\=\s*(?:$balanced_parens)?\s*(k[mz]alloc)\s*\(\s*($FuncArg)\s*\*\s*($FuncArg)\s*,/) {
+ my $oldfunc = $3;
+ my $a1 = $4;
+ my $a2 = $10;
+ my $newfunc = "kmalloc_array";
+ $newfunc = "kcalloc" if ($oldfunc eq "kzalloc");
+ my $r1 = $a1;
+ my $r2 = $a2;
+ if ($a1 =~ /^sizeof\s*\S/) {
+ $r1 = $a2;
+ $r2 = $a1;
+ }
+ if ($r1 !~ /^sizeof\b/ && $r2 =~ /^sizeof\s*\S/ &&
+ !($r1 =~ /^$Constant$/ || $r1 =~ /^[A-Z_][A-Z0-9_]*$/)) {
+ my $ctx = '';
+ my $herectx = $here . "\n";
+ my $cnt = statement_rawlines($stat);
+ for (my $n = 0; $n < $cnt; $n++) {
+ $herectx .= raw_line($linenr, $n) . "\n";
+ }
+ if (WARN("ALLOC_WITH_MULTIPLY",
+ "Prefer $newfunc over $oldfunc with multiply\n" . $herectx) &&
+ $cnt == 1 &&
+ $fix) {
+ $fixed[$fixlinenr] =~ s/\b($Lval)\s*\=\s*(?:$balanced_parens)?\s*(k[mz]alloc)\s*\(\s*($FuncArg)\s*\*\s*($FuncArg)/$1 . ' = ' . "$newfunc(" . trim($r1) . ', ' . trim($r2)/e;
+ }
+ }
+ }
+
# check for krealloc arg reuse
if ($^V && $^V ge 5.10.0 &&
$line =~ /\b($Lval)\s*\=\s*(?:$balanced_parens)?\s*krealloc\s*\(\s*\1\s*,/) {
"$1 uses number as first arg, sizeof is generally wrong\n" . $herecurr);
}
-# check for GFP_NOWAIT use
- if ($line =~ /\b__GFP_NOFAIL\b/) {
- WARN("__GFP_NOFAIL",
- "Use of __GFP_NOFAIL is deprecated, no new users should be added\n" . $herecurr);
- }
-
# check for multiple semicolons
if ($line =~ /;\s*;\s*$/) {
if (WARN("ONE_SEMICOLON",
"Statements terminations use 1 semicolon\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~ s/(\s*;\s*){2,}$/;/g;
+ $fixed[$fixlinenr] =~ s/(\s*;\s*){2,}$/;/g;
+ }
+ }
+
+# check for #defines like: 1 << <digit> that could be BIT(digit), it is not exported to uapi
+ if ($realfile !~ m@^include/uapi/@ &&
+ $line =~ /#\s*define\s+\w+\s+\(?\s*1\s*([ulUL]*)\s*\<\<\s*(?:\d+|$Ident)\s*\)?/) {
+ my $ull = "";
+ $ull = "_ULL" if (defined($1) && $1 =~ /ll/i);
+ if (CHK("BIT_MACRO",
+ "Prefer using the BIT$ull macro\n" . $herecurr) &&
+ $fix) {
+ $fixed[$fixlinenr] =~ s/\(?\s*1\s*[ulUL]*\s*<<\s*(\d+|$Ident)\s*\)?/BIT${ull}($1)/;
+ }
+ }
+
+# check for #if defined CONFIG_<FOO> || defined CONFIG_<FOO>_MODULE
+ if ($line =~ /^\+\s*#\s*if\s+defined(?:\s*\(?\s*|\s+)(CONFIG_[A-Z_]+)\s*\)?\s*\|\|\s*defined(?:\s*\(?\s*|\s+)\1_MODULE\s*\)?\s*$/) {
+ my $config = $1;
+ if (WARN("PREFER_IS_ENABLED",
+ "Prefer IS_ENABLED(<FOO>) to CONFIG_<FOO> || CONFIG_<FOO>_MODULE\n" . $herecurr) &&
+ $fix) {
+ $fixed[$fixlinenr] = "\+#if IS_ENABLED($config)";
}
}
my $has_statement = 0;
my $count = 0;
my $prevline = $linenr;
- while ($prevline > 1 && $count < 3 && !$has_break) {
+ while ($prevline > 1 && ($file || $count < 3) && !$has_break) {
$prevline--;
my $rline = $rawlines[$prevline - 1];
my $fline = $lines[$prevline - 1];
if (WARN("USE_FUNC",
"__func__ should be used instead of gcc specific __FUNCTION__\n" . $herecurr) &&
$fix) {
- $fixed[$linenr - 1] =~ s/\b__FUNCTION__\b/__func__/g;
+ $fixed[$fixlinenr] =~ s/\b__FUNCTION__\b/__func__/g;
}
}
+# check for uses of __DATE__, __TIME__, __TIMESTAMP__
+ while ($line =~ /\b(__(?:DATE|TIME|TIMESTAMP)__)\b/g) {
+ ERROR("DATE_TIME",
+ "Use of the '$1' macro makes the build non-deterministic\n" . $herecurr);
+ }
+
# check for use of yield()
if ($line =~ /\byield\s*\(\s*\)/) {
WARN("YIELD",
"$1 is obsolete, use k$3 instead\n" . $herecurr);
}
-# check for __initcall(), use device_initcall() explicitly please
+# check for __initcall(), use device_initcall() explicitly or more appropriate function please
if ($line =~ /^.\s*__initcall\s*\(/) {
WARN("USE_DEVICE_INITCALL",
- "please use device_initcall() instead of __initcall()\n" . $herecurr);
- }
-
-# check for various ops structs, ensure they are const.
- my $struct_ops = qr{acpi_dock_ops|
- address_space_operations|
- backlight_ops|
- block_device_operations|
- dentry_operations|
- dev_pm_ops|
- dma_map_ops|
- extent_io_ops|
- file_lock_operations|
- file_operations|
- hv_ops|
- ide_dma_ops|
- intel_dvo_dev_ops|
- item_operations|
- iwl_ops|
- kgdb_arch|
- kgdb_io|
- kset_uevent_ops|
- lock_manager_operations|
- microcode_ops|
- mtrr_ops|
- neigh_ops|
- nlmsvc_binding|
- pci_raw_ops|
- pipe_buf_operations|
- platform_hibernation_ops|
- platform_suspend_ops|
- proto_ops|
- rpc_pipe_ops|
- seq_operations|
- snd_ac97_build_ops|
- soc_pcmcia_socket_ops|
- stacktrace_ops|
- sysfs_ops|
- tty_operations|
- usb_mon_operations|
- wd_ops}x;
+ "please use device_initcall() or more appropriate function instead of __initcall() (see include/linux/init.h)\n" . $herecurr);
+ }
+
+# check for various structs that are normally const (ops, kgdb, device_tree)
+# and avoid what seem like struct definitions 'struct foo {'
if ($line !~ /\bconst\b/ &&
- $line =~ /\bstruct\s+($struct_ops)\b/) {
+ $line =~ /\bstruct\s+($const_structs)\b(?!\s*\{)/) {
WARN("CONST_STRUCT",
- "struct $1 should normally be const\n" .
- $herecurr);
+ "struct $1 should normally be const\n" . $herecurr);
}
# use of NR_CPUS is usually wrong
"#define of '$1' is wrong - use Kconfig variables or standard guards instead\n" . $herecurr);
}
-# check for %L{u,d,i} in strings
- my $string;
- while ($line =~ /(?:^|")([X\t]*)(?:"|$)/g) {
- $string = substr($rawline, $-[1], $+[1] - $-[1]);
- $string =~ s/%%/__/g;
- if ($string =~ /(?<!%)%L[udi]/) {
- WARN("PRINTF_L",
- "\%Ld/%Lu are not-standard C, use %lld/%llu\n" . $herecurr);
- last;
- }
+# likely/unlikely comparisons similar to "(likely(foo) > 0)"
+ if ($^V && $^V ge 5.10.0 &&
+ $line =~ /\b((?:un)?likely)\s*\(\s*$FuncArg\s*\)\s*$Compare/) {
+ WARN("LIKELY_MISUSE",
+ "Using $1 should generally have parentheses around the comparison\n" . $herecurr);
}
# whine mightly about in_atomic
}
}
+# whine about ACCESS_ONCE
+ if ($^V && $^V ge 5.10.0 &&
+ $line =~ /\bACCESS_ONCE\s*$balanced_parens\s*(=(?!=))?\s*($FuncArg)?/) {
+ my $par = $1;
+ my $eq = $2;
+ my $fun = $3;
+ $par =~ s/^\(\s*(.*)\s*\)$/$1/;
+ if (defined($eq)) {
+ if (WARN("PREFER_WRITE_ONCE",
+ "Prefer WRITE_ONCE(<FOO>, <BAR>) over ACCESS_ONCE(<FOO>) = <BAR>\n" . $herecurr) &&
+ $fix) {
+ $fixed[$fixlinenr] =~ s/\bACCESS_ONCE\s*\(\s*\Q$par\E\s*\)\s*$eq\s*\Q$fun\E/WRITE_ONCE($par, $fun)/;
+ }
+ } else {
+ if (WARN("PREFER_READ_ONCE",
+ "Prefer READ_ONCE(<FOO>) over ACCESS_ONCE(<FOO>)\n" . $herecurr) &&
+ $fix) {
+ $fixed[$fixlinenr] =~ s/\bACCESS_ONCE\s*\(\s*\Q$par\E\s*\)/READ_ONCE($par)/;
+ }
+ }
+ }
+
+# check for mutex_trylock_recursive usage
+ if ($line =~ /mutex_trylock_recursive/) {
+ ERROR("LOCKING",
+ "recursive locking is bad, do not use this ever.\n" . $herecurr);
+ }
+
# check for lockdep_set_novalidate_class
if ($line =~ /^.\s*lockdep_set_novalidate_class\s*\(/ ||
$line =~ /__lockdep_no_validate__\s*\)/ ) {
}
}
- if ($line =~ /debugfs_create_file.*S_IWUGO/ ||
- $line =~ /DEVICE_ATTR.*S_IWUGO/ ) {
+ if ($line =~ /debugfs_create_\w+.*\b$mode_perms_world_writable\b/ ||
+ $line =~ /DEVICE_ATTR.*\b$mode_perms_world_writable\b/) {
WARN("EXPORTED_WORLD_WRITABLE",
"Exporting world writable files is usually an error. Consider more restrictive permissions.\n" . $herecurr);
}
+
+# Mode permission misuses where it seems decimal should be octal
+# This uses a shortcut match to avoid unnecessary uses of a slow foreach loop
+ if ($^V && $^V ge 5.10.0 &&
+ defined $stat &&
+ $line =~ /$mode_perms_search/) {
+ foreach my $entry (@mode_permission_funcs) {
+ my $func = $entry->[0];
+ my $arg_pos = $entry->[1];
+
+ my $lc = $stat =~ tr@\n@@;
+ $lc = $lc + $linenr;
+ my $stat_real = raw_line($linenr, 0);
+ for (my $count = $linenr + 1; $count <= $lc; $count++) {
+ $stat_real = $stat_real . "\n" . raw_line($count, 0);
+ }
+
+ my $skip_args = "";
+ if ($arg_pos > 1) {
+ $arg_pos--;
+ $skip_args = "(?:\\s*$FuncArg\\s*,\\s*){$arg_pos,$arg_pos}";
+ }
+ my $test = "\\b$func\\s*\\(${skip_args}($FuncArg(?:\\|\\s*$FuncArg)*)\\s*[,\\)]";
+ if ($stat =~ /$test/) {
+ my $val = $1;
+ $val = $6 if ($skip_args ne "");
+ if (($val =~ /^$Int$/ && $val !~ /^$Octal$/) ||
+ ($val =~ /^$Octal$/ && length($val) ne 4)) {
+ ERROR("NON_OCTAL_PERMISSIONS",
+ "Use 4 digit octal (0777) not decimal permissions\n" . "$here\n" . $stat_real);
+ }
+ if ($val =~ /^$Octal$/ && (oct($val) & 02)) {
+ ERROR("EXPORTED_WORLD_WRITABLE",
+ "Exporting writable files is usually an error. Consider more restrictive permissions.\n" . "$here\n" . $stat_real);
+ }
+ }
+ }
+ }
+
+# check for uses of S_<PERMS> that could be octal for readability
+ if ($line =~ /\b$mode_perms_string_search\b/) {
+ my $val = "";
+ my $oval = "";
+ my $to = 0;
+ my $curpos = 0;
+ my $lastpos = 0;
+ while ($line =~ /\b(($mode_perms_string_search)\b(?:\s*\|\s*)?\s*)/g) {
+ $curpos = pos($line);
+ my $match = $2;
+ my $omatch = $1;
+ last if ($lastpos > 0 && ($curpos - length($omatch) != $lastpos));
+ $lastpos = $curpos;
+ $to |= $mode_permission_string_types{$match};
+ $val .= '\s*\|\s*' if ($val ne "");
+ $val .= $match;
+ $oval .= $omatch;
+ }
+ $oval =~ s/^\s*\|\s*//;
+ $oval =~ s/\s*\|\s*$//;
+ my $octal = sprintf("%04o", $to);
+ if (WARN("SYMBOLIC_PERMS",
+ "Symbolic permissions '$oval' are not preferred. Consider using octal permissions '$octal'.\n" . $herecurr) &&
+ $fix) {
+ $fixed[$fixlinenr] =~ s/$val/$octal/;
+ }
+ }
+
+# validate content of MODULE_LICENSE against list from include/linux/module.h
+ if ($line =~ /\bMODULE_LICENSE\s*\(\s*($String)\s*\)/) {
+ my $extracted_string = get_quoted_string($line, $rawline);
+ my $valid_licenses = qr{
+ GPL|
+ GPL\ v2|
+ GPL\ and\ additional\ rights|
+ Dual\ BSD/GPL|
+ Dual\ MIT/GPL|
+ Dual\ MPL/GPL|
+ Proprietary
+ }x;
+ if ($extracted_string !~ /^"(?:$valid_licenses)"$/x) {
+ WARN("MODULE_LICENSE",
+ "unknown module license " . $extracted_string . "\n" . $herecurr);
+ }
+ }
}
# If we have no input at all, then there is nothing to report on
exit(0);
}
- if (!$is_patch) {
+ if (!$is_patch && $file !~ /cover-letter\.patch$/) {
ERROR("NOT_UNIFIED_DIFF",
"Does not appear to be a unified-diff format patch\n");
}
- if ($is_patch && $chk_signoff && $signoff == 0) {
+ if ($is_patch && $has_commit_log && $chk_signoff && $signoff == 0) {
ERROR("MISSING_SIGN_OFF",
"Missing Signed-off-by: line(s)\n");
}
print "total: $cnt_error errors, $cnt_warn warnings, " .
(($check)? "$cnt_chk checks, " : "") .
"$cnt_lines lines checked\n";
- print "\n" if ($quiet == 0);
}
if ($quiet == 0) {
+ # If there were any defects found and not already fixing them
+ if (!$clean and !$fix) {
+ print << "EOM"
- if ($^V lt 5.10.0) {
- print("NOTE: perl $^V is not modern enough to detect all possible issues.\n");
- print("An upgrade to at least perl v5.10.0 is suggested.\n\n");
+NOTE: For some of the reported defects, checkpatch may be able to
+ mechanically convert to the typical style using --fix or --fix-inplace.
+EOM
}
-
# If there were whitespace errors which cleanpatch can fix
# then suggest that.
if ($rpt_cleaners) {
- print "NOTE: whitespace errors detected, you may wish to use scripts/cleanpatch or\n";
- print " scripts/cleanfile\n\n";
$rpt_cleaners = 0;
+ print << "EOM"
+
+NOTE: Whitespace errors detected.
+ You may wish to use scripts/cleanpatch or scripts/cleanfile
+EOM
}
}
- hash_show_words(\%use_type, "Used");
- hash_show_words(\%ignore_type, "Ignored");
-
- if ($clean == 0 && $fix && "@rawlines" ne "@fixed") {
+ if ($clean == 0 && $fix &&
+ ("@rawlines" ne "@fixed" ||
+ $#fixed_inserted >= 0 || $#fixed_deleted >= 0)) {
my $newfile = $filename;
$newfile .= ".EXPERIMENTAL-checkpatch-fixes" if (!$fix_inplace);
my $linecount = 0;
my $f;
+ @fixed = fix_inserted_deleted_lines(\@fixed, \@fixed_inserted, \@fixed_deleted);
+
open($f, '>', $newfile)
or die "$P: Can't open $newfile for write\n";
foreach my $fixed_line (@fixed) {
if ($file) {
if ($linecount > 3) {
$fixed_line =~ s/^\+//;
- print $f $fixed_line. "\n";
+ print $f $fixed_line . "\n";
}
} else {
print $f $fixed_line . "\n";
if (!$quiet) {
print << "EOM";
+
Wrote EXPERIMENTAL --fix correction(s) to '$newfile'
Do _NOT_ trust the results written to this file.
This EXPERIMENTAL file is simply a convenience to help rewrite patches.
No warranties, expressed or implied...
-
EOM
}
}
- if ($clean == 1 && $quiet == 0) {
- print "$vname has no obvious style problems and is ready for submission.\n"
- }
- if ($clean == 0 && $quiet == 0) {
- print << "EOM";
-$vname has style problems, please review.
-
-If any of these errors are false positives, please report
-them to the maintainer, see CHECKPATCH in MAINTAINERS.
-EOM
+ if ($quiet == 0) {
+ print "\n";
+ if ($clean == 1) {
+ print "$vname has no obvious style problems and is ready for submission.\n";
+ } else {
+ print "$vname has style problems, please review.\n";
+ }
}
-
return $clean;
}
CONFIG_EHCI_MXS_PORT0
CONFIG_EHCI_MXS_PORT1
CONFIG_ELBC_NAND_SPL_STATIC_PGSIZE
-CONFIG_EMIF4
CONFIG_EMMC_BOOT
CONFIG_EMU
CONFIG_ENABLE_36BIT_PHYS
CONFIG_IPAM390_GPIO_LED_GREEN
CONFIG_IPAM390_GPIO_LED_RED
CONFIG_IPROC
-CONFIG_IPUV3_CLK
CONFIG_IP_DEFRAG
CONFIG_IRAM_BASE
CONFIG_IRAM_END
CONFIG_MACH_TYPE
CONFIG_MACH_TYPE_COMPAT_REV
CONFIG_MACRESET_TIMEOUT
-CONFIG_MAC_ADDR_IN_EEPROM
-CONFIG_MAC_ADDR_IN_SPIFLASH
CONFIG_MALLOC_F_ADDR
CONFIG_MALTA
CONFIG_MARCO_MEMSET
CONFIG_SAMSUNG_ONENAND
CONFIG_SANDBOX_ARCH
CONFIG_SANDBOX_BIG_ENDIAN
-CONFIG_SANDBOX_BITS_PER_LONG
CONFIG_SANDBOX_SDL
CONFIG_SANDBOX_SPI_MAX_BUS
CONFIG_SANDBOX_SPI_MAX_CS
CONFIG_SC_TIMER_CLK
CONFIG_SDCARD
CONFIG_SDRAM_OFFSET_FOR_RT
-CONFIG_SDRC
CONFIG_SD_BOOT_QSPI
CONFIG_SECBOOT
CONFIG_SECURE_BL1_ONLY
CONFIG_SYS_CADMUS_BASE_REG
CONFIG_SYS_CBSIZE
CONFIG_SYS_CCCR
-CONFIG_SYS_CCI400_ADDR
CONFIG_SYS_CCSRBAR
CONFIG_SYS_CCSRBAR_PHYS
CONFIG_SYS_CCSRBAR_PHYS_HIGH
CONFIG_SYS_PSSR_VAL
CONFIG_SYS_PTCPAR
CONFIG_SYS_PTDPAR
-CONFIG_SYS_PTL2_BITS
CONFIG_SYS_PTV
CONFIG_SYS_PUAPAR
CONFIG_SYS_QE_FMAN_FW_IN_MMC
CONFIG_SYS_USE_SPIFLASH
CONFIG_SYS_USR_EXCEP
CONFIG_SYS_U_BOOT_OFFS
-CONFIG_SYS_VA_BITS
CONFIG_SYS_VCXK_ACKNOWLEDGE_DDR
CONFIG_SYS_VCXK_ACKNOWLEDGE_PIN
CONFIG_SYS_VCXK_ACKNOWLEDGE_PORT
--- /dev/null
+# Put structs here that should be constant
+__dummy__
/* Create two, one the parent of the other */
ut_assertok(blk_create_device(gd->dm_root, "sandbox_host_blk", "test",
- IF_TYPE_HOST, 1, 512, 1024, &blk));
+ IF_TYPE_HOST, 1, 512, 2, &blk));
ut_assertok(blk_create_device(blk, "usb_storage_blk", "test",
- IF_TYPE_USB, 3, 512, 1024, &usb_blk));
+ IF_TYPE_USB, 3, 512, 2, &usb_blk));
/* Check we can find them */
ut_asserteq(-ENODEV, blk_get_device(IF_TYPE_HOST, 0, &dev));
struct udevice *blk, *dev;
ut_assertok(blk_create_device(gd->dm_root, "sandbox_host_blk", "test",
- IF_TYPE_HOST, 1, 512, 1024, &blk));
+ IF_TYPE_HOST, 1, 512, 2, &blk));
ut_asserteq(-ENODEV, blk_find_device(IF_TYPE_HOST, 0, &dev));
ut_assertok(blk_find_device(IF_TYPE_HOST, 1, &dev));
ut_asserteq_ptr(blk, dev);
if (test->flags & DM_TESTF_PROBE_TEST)
ut_assertok(do_autoprobe(uts));
if (test->flags & DM_TESTF_SCAN_FDT)
- ut_assertok(dm_scan_fdt(gd->fdt_blob, false));
+ ut_assertok(dm_extended_scan_fdt(gd->fdt_blob, false));
/*
* Silence the console and rely on console reocrding to get
# DT overlays
obj-y += test-fdt-base.dtb.o
obj-y += test-fdt-overlay.dtb.o
+obj-y += test-fdt-overlay-stacked.dtb.o
extern u32 __dtb_test_fdt_base_begin;
extern u32 __dtb_test_fdt_overlay_begin;
+extern u32 __dtb_test_fdt_overlay_stacked_begin;
-static int fdt_getprop_u32_by_index(void *fdt, const char *path,
+static int ut_fdt_getprop_u32_by_index(void *fdt, const char *path,
const char *name, int index,
u32 *out)
{
return 0;
}
-static int fdt_getprop_u32(void *fdt, const char *path, const char *name,
+static int ut_fdt_getprop_u32(void *fdt, const char *path, const char *name,
u32 *out)
{
- return fdt_getprop_u32_by_index(fdt, path, name, 0, out);
+ return ut_fdt_getprop_u32_by_index(fdt, path, name, 0, out);
}
static int fdt_getprop_str(void *fdt, const char *path, const char *name,
void *fdt = uts->priv;
u32 val = 0;
- ut_assertok(fdt_getprop_u32(fdt, "/test-node", "test-int-property",
+ ut_assertok(ut_fdt_getprop_u32(fdt, "/test-node", "test-int-property",
&val));
ut_asserteq(43, val);
local_phandle = fdt_get_phandle(fdt, off);
ut_assert(local_phandle);
- ut_assertok(fdt_getprop_u32_by_index(fdt, "/", "test-several-phandle",
+ ut_assertok(ut_fdt_getprop_u32_by_index(fdt, "/", "test-several-phandle",
0, &val));
ut_asserteq(local_phandle, val);
- ut_assertok(fdt_getprop_u32_by_index(fdt, "/", "test-several-phandle",
+ ut_assertok(ut_fdt_getprop_u32_by_index(fdt, "/", "test-several-phandle",
1, &val));
ut_asserteq(local_phandle, val);
test_phandle = fdt_get_phandle(fdt, off);
ut_assert(test_phandle);
- ut_assertok(fdt_getprop_u32_by_index(fdt, "/", "test-phandle", 0,
+ ut_assertok(ut_fdt_getprop_u32_by_index(fdt, "/", "test-phandle", 0,
&val));
ut_asserteq(test_phandle, val);
- ut_assertok(fdt_getprop_u32_by_index(fdt, "/", "test-phandle", 1,
+ ut_assertok(ut_fdt_getprop_u32_by_index(fdt, "/", "test-phandle", 1,
&val));
ut_asserteq(local_phandle, val);
}
OVERLAY_TEST(fdt_overlay_local_phandles, 0);
+static int fdt_overlay_stacked(struct unit_test_state *uts)
+{
+ void *fdt = uts->priv;
+ u32 val = 0;
+
+ ut_assertok(ut_fdt_getprop_u32(fdt, "/new-local-node",
+ "stacked-test-int-property", &val));
+ ut_asserteq(43, val);
+
+ return CMD_RET_SUCCESS;
+}
+OVERLAY_TEST(fdt_overlay_stacked, 0);
+
int do_ut_overlay(cmd_tbl_t *cmdtp, int flag, int argc, char * const argv[])
{
struct unit_test *tests = ll_entry_start(struct unit_test,
struct unit_test *test;
void *fdt_base = &__dtb_test_fdt_base_begin;
void *fdt_overlay = &__dtb_test_fdt_overlay_begin;
- void *fdt_base_copy, *fdt_overlay_copy;
+ void *fdt_overlay_stacked = &__dtb_test_fdt_overlay_stacked_begin;
+ void *fdt_base_copy, *fdt_overlay_copy, *fdt_overlay_stacked_copy;
uts = calloc(1, sizeof(*uts));
if (!uts)
if (!fdt_overlay_copy)
return -ENOMEM;
+ fdt_overlay_stacked_copy = malloc(FDT_COPY_SIZE);
+ if (!fdt_overlay_stacked_copy)
+ return -ENOMEM;
+
/*
* Resize the FDT to 4k so that we have room to operate on
*
ut_assertok(fdt_open_into(fdt_overlay, fdt_overlay_copy,
FDT_COPY_SIZE));
+ /*
+ * Resize the stacked overlay to 4k so that we have room to operate on
+ *
+ * (and relocate it since the memory might be mapped
+ * read-only)
+ */
+ ut_assertok(fdt_open_into(fdt_overlay_stacked, fdt_overlay_stacked_copy,
+ FDT_COPY_SIZE));
+
/* Apply the overlay */
ut_assertok(fdt_overlay_apply(fdt_base_copy, fdt_overlay_copy));
+ /* Apply the stacked overlay */
+ ut_assertok(fdt_overlay_apply(fdt_base_copy, fdt_overlay_stacked_copy));
+
if (argc == 1)
printf("Running %d environment tests\n", n_ents);
printf("Failures: %d\n", uts->fail_count);
+ free(fdt_overlay_stacked_copy);
free(fdt_overlay_copy);
free(fdt_base_copy);
free(uts);
--- /dev/null
+/*
+ * Copyright (c) 2016 NextThing Co
+ * Copyright (c) 2016 Free Electrons
+ * Copyright (c) 2018 Konsulko Group
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+/dts-v1/;
+/plugin/;
+
+/ {
+ /* Test that we can reference an overlay symbol */
+ fragment@0 {
+ target = <&local>;
+
+ __overlay__ {
+ stacked-test-int-property = <43>;
+ };
+ };
+};
--- /dev/null
+# Copyright (c) 2017 Alison Chaiken
+# Copyright (c) 2017, NVIDIA CORPORATION. All rights reserved.
+#
+# SPDX-License-Identifier: GPL-2.0
+
+# Test GPT manipulation commands.
+
+import os
+import pytest
+import u_boot_utils
+
+"""
+These tests rely on a 4 MB disk image, which is automatically created by
+the test.
+"""
+
+class GptTestDiskImage(object):
+ """Disk Image used by the GPT tests."""
+
+ def __init__(self, u_boot_console):
+ """Initialize a new GptTestDiskImage object.
+
+ Args:
+ u_boot_console: A U-Boot console.
+
+ Returns:
+ Nothing.
+ """
+
+ filename = 'test_gpt_disk_image.bin'
+ self.path = u_boot_console.config.persistent_data_dir + '/' + filename
+
+ if os.path.exists(self.path):
+ u_boot_console.log.action('Disk image file ' + self.path +
+ ' already exists')
+ else:
+ u_boot_console.log.action('Generating ' + self.path)
+ fd = os.open(self.path, os.O_RDWR | os.O_CREAT)
+ os.ftruncate(fd, 4194304)
+ os.close(fd)
+ sgdisk = '/sbin/sgdisk'
+ cmd = (sgdisk, '-U', '375a56f7-d6c9-4e81-b5f0-09d41ca89efe',
+ self.path)
+ u_boot_utils.run_and_log(u_boot_console, cmd)
+ cmd = (sgdisk, '--new=1:2048:2560', self.path)
+ u_boot_utils.run_and_log(u_boot_console, cmd)
+ cmd = (sgdisk, '--new=2:4096:4608', self.path)
+ u_boot_utils.run_and_log(u_boot_console, cmd)
+ cmd = (sgdisk, '-l', self.path)
+ u_boot_utils.run_and_log(u_boot_console, cmd)
+
+gtdi = None
+@pytest.fixture(scope='function')
+def state_disk_image(u_boot_console):
+ """pytest fixture to provide a GptTestDiskImage object to tests.
+ This is function-scoped because it uses u_boot_console, which is also
+ function-scoped. However, we don't need to actually do any function-scope
+ work, so this simply returns the same object over and over each time."""
+
+ global gtdi
+ if not gtdi:
+ gtdi = GptTestDiskImage(u_boot_console)
+ return gtdi
+
+@pytest.mark.boardspec('sandbox')
+@pytest.mark.buildconfigspec('cmd_gpt')
+def test_gpt_guid(state_disk_image, u_boot_console):
+ """Test the gpt guid command."""
+
+ u_boot_console.run_command('host bind 0 ' + state_disk_image.path)
+ output = u_boot_console.run_command('gpt guid host 0')
+ assert '375a56f7-d6c9-4e81-b5f0-09d41ca89efe' in output
+
+@pytest.mark.boardspec('sandbox')
+@pytest.mark.buildconfigspec('cmd_gpt')
+def test_gpt_save_guid(state_disk_image, u_boot_console):
+ """Test the gpt guid command to save GUID into a string."""
+
+ if u_boot_console.config.buildconfig.get('config_cmd_gpt', 'n') != 'y':
+ pytest.skip('gpt command not supported')
+ u_boot_console.run_command('host bind 0 ' + state_disk_image.path)
+ output = u_boot_console.run_command('gpt guid host 0 newguid')
+ output = u_boot_console.run_command('printenv newguid')
+ assert '375a56f7-d6c9-4e81-b5f0-09d41ca89efe' in output
+
+@pytest.mark.boardspec('sandbox')
+@pytest.mark.buildconfigspec('cmd_gpt')
+@pytest.mark.buildconfigspec('cmd_gpt_rename')
+def test_gpt_rename_partition(state_disk_image, u_boot_console):
+ """Test the gpt rename command to write partition names."""
+
+ u_boot_console.run_command('host bind 0 ' + state_disk_image.path)
+ u_boot_console.run_command('gpt rename host 0 1 first')
+ output = u_boot_console.run_command('gpt read host 0')
+ assert 'name first' in output
+ u_boot_console.run_command('gpt rename host 0 2 second')
+ output = u_boot_console.run_command('gpt read host 0')
+ assert 'name second' in output
+
+@pytest.mark.boardspec('sandbox')
+@pytest.mark.buildconfigspec('cmd_gpt')
+@pytest.mark.buildconfigspec('cmd_gpt_rename')
+@pytest.mark.buildconfigspec('cmd_part')
+def test_gpt_swap_partitions(state_disk_image, u_boot_console):
+ """Test the gpt swap command to exchange two partition names."""
+
+ u_boot_console.run_command('host bind 0 ' + state_disk_image.path)
+ output = u_boot_console.run_command('part list host 0')
+ assert '0x000007ff "first"' in output
+ assert '0x000017ff "second"' in output
+ u_boot_console.run_command('gpt swap host 0 first second')
+ output = u_boot_console.run_command('part list host 0')
+ assert '0x000007ff "second"' in output
+ assert '0x000017ff "first"' in output
Args:
cmd: The command to send.
- wait_for_each: Boolean indicating whether to wait for U-Boot to
+ wait_for_echo: Boolean indicating whether to wait for U-Boot to
echo the command text back to its output.
send_nl: Boolean indicating whether to send a newline character
after the command string.
--- /dev/null
+#
+# Copyright (C) 2017, Bin Meng <bmeng.cn@gmail.com>
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Entry-type module for Intel Video BIOS Table binary blob
+#
+
+from entry import Entry
+from blob import Entry_blob
+
+class Entry_intel_vbt(Entry_blob):
+ def __init__(self, image, etype, node):
+ Entry_blob.__init__(self, image, etype, node)
U_BOOT_NODTB_DATA = 'nodtb with microcode pointer somewhere in here'
FSP_DATA = 'fsp'
CMC_DATA = 'cmc'
+VBT_DATA = 'vbt'
class TestFunctional(unittest.TestCase):
"""Functional tests for binman
TestFunctional._MakeInputFile('u-boot-nodtb.bin', U_BOOT_NODTB_DATA)
TestFunctional._MakeInputFile('fsp.bin', FSP_DATA)
TestFunctional._MakeInputFile('cmc.bin', CMC_DATA)
+ TestFunctional._MakeInputFile('vbt.bin', VBT_DATA)
self._output_setup = False
# ELF file with a '_dt_ucode_base_size' symbol
self.assertEqual(FSP_DATA, data[:len(FSP_DATA)])
def testPackCmc(self):
- """Test that an image with a FSP binary can be created"""
+ """Test that an image with a CMC binary can be created"""
data = self._DoReadFile('43_intel-cmc.dts')
self.assertEqual(CMC_DATA, data[:len(CMC_DATA)])
+
+ def testPackVbt(self):
+ """Test that an image with a VBT binary can be created"""
+ data = self._DoReadFile('46_intel-vbt.dts')
+ self.assertEqual(VBT_DATA, data[:len(VBT_DATA)])
--- /dev/null
+/dts-v1/;
+
+/ {
+ #address-cells = <1>;
+ #size-cells = <1>;
+
+ binman {
+ size = <16>;
+
+ intel-vbt {
+ filename = "vbt.bin";
+ };
+ };
+};
self.print_warnings = print_warnings
self.print_undef_assign = print_undef_assign
+ self._warnings = []
# For parsing routines that stop when finding a line belonging to a
# different construct, these holds that line and the tokenized version
need to refer to the top-level kernel directory with "$srctree".
replace (default: True): True if the configuration should replace the
- old configuration; False if it should add to it."""
+ old configuration; False if it should add to it.
+ Returns a list or warnings (hopefully empty)
+ """
+
+ self._warnings = []
# Put this first so that a missing file doesn't screw up our state
filename = os.path.expandvars(filename)
line_feeder = _FileFeed(filename)
while 1:
line = line_feeder.get_next()
if line is None:
- return
+ return self._warnings
line = line.rstrip()
def _warn(self, msg, filename=None, linenr=None):
"""For printing warnings to stderr."""
+ msg = _build_msg("warning: " + msg, filename, linenr)
if self.print_warnings:
- _stderr_msg("warning: " + msg, filename, linenr)
+ sys.stderr.write(msg + "\n")
+ self._warnings.append(msg)
class Item(object):
path = path[2:]
return path.rstrip("/")
-def _stderr_msg(msg, filename, linenr):
+def _build_msg(msg, filename, linenr):
if filename is not None:
- sys.stderr.write("{0}:{1}: ".format(_clean_up_path(filename), linenr))
- sys.stderr.write(msg + "\n")
+ msg = "{0}:{1}: ".format(_clean_up_path(filename), linenr) + msg
+ return msg
+
+def _stderr_msg(msg, filename, linenr):
+ sys.stderr.write(_build_msg(msg, filename, linenr) + "\n")
def _tokenization_error(s, filename, linenr):
loc = "" if filename is None else "{0}:{1}: ".format(filename, linenr)
static data.
"""
+import collections
import copy
import sys
fdt.TYPE_BYTE: 'unsigned char',
fdt.TYPE_STRING: 'const char *',
fdt.TYPE_BOOL: 'bool',
+ fdt.TYPE_INT64: 'fdt64_t',
}
STRUCT_PREFIX = 'dtd_'
VAL_PREFIX = 'dtv_'
+# This holds information about a property which includes phandles.
+#
+# max_args: integer: Maximum number or arguments that any phandle uses (int).
+# args: Number of args for each phandle in the property. The total number of
+# phandles is len(args). This is a list of integers.
+PhandleInfo = collections.namedtuple('PhandleInfo', ['max_args', 'args'])
+
+
def conv_name_to_c(name):
"""Convert a device-tree name to a C identifier
return '"%s"' % value
elif ftype == fdt.TYPE_BOOL:
return 'true'
+ elif ftype == fdt.TYPE_INT64:
+ return '%#x' % value
def get_compat_name(node):
"""Get a node's first compatible string as a C identifier
compat, aliases = compat[0], compat[1:]
return conv_name_to_c(compat), [conv_name_to_c(a) for a in aliases]
-def is_phandle(prop):
- """Check if a node contains phandles
-
- We have no reliable way of detecting whether a node uses a phandle
- or not. As an interim measure, use a list of known property names.
-
- Args:
- prop: Prop object to check
- Return:
- True if the object value contains phandles, else False
- """
- if prop.name in ['clocks']:
- return True
- return False
-
class DtbPlatdata(object):
"""Provide a means to convert device tree binary data to platform data
_dtb_fname: Filename of the input device tree binary file
_valid_nodes: A list of Node object with compatible strings
_include_disabled: true to include nodes marked status = "disabled"
- _phandle_nodes: A dict of nodes indexed by phandle number (1, 2...)
_outfile: The current output file (sys.stdout or a real file)
_lines: Stashed list of output lines for outputting in the future
- _phandle_nodes: A dict of Nodes indexed by phandle (an integer)
"""
def __init__(self, dtb_fname, include_disabled):
self._fdt = None
self._dtb_fname = dtb_fname
self._valid_nodes = None
self._include_disabled = include_disabled
- self._phandle_nodes = {}
self._outfile = None
self._lines = []
self._aliases = {}
self._lines = []
return lines
+ def out_header(self):
+ """Output a message indicating that this is an auto-generated file"""
+ self.out('''/*
+ * DO NOT MODIFY
+ *
+ * This file was generated by dtoc from a .dtb (device tree binary) file.
+ */
+
+''')
+
+ def get_phandle_argc(self, prop, node_name):
+ """Check if a node contains phandles
+
+ We have no reliable way of detecting whether a node uses a phandle
+ or not. As an interim measure, use a list of known property names.
+
+ Args:
+ prop: Prop object to check
+ Return:
+ Number of argument cells is this is a phandle, else None
+ """
+ if prop.name in ['clocks']:
+ val = prop.value
+ if not isinstance(val, list):
+ val = [val]
+ i = 0
+
+ max_args = 0
+ args = []
+ while i < len(val):
+ phandle = fdt_util.fdt32_to_cpu(val[i])
+ target = self._fdt.phandle_to_node.get(phandle)
+ if not target:
+ raise ValueError("Cannot parse '%s' in node '%s'" %
+ (prop.name, node_name))
+ prop_name = '#clock-cells'
+ cells = target.props.get(prop_name)
+ if not cells:
+ raise ValueError("Node '%s' has no '%s' property" %
+ (target.name, prop_name))
+ num_args = fdt_util.fdt32_to_cpu(cells.value)
+ max_args = max(max_args, num_args)
+ args.append(num_args)
+ i += 1 + num_args
+ return PhandleInfo(max_args, args)
+ return None
+
def scan_dtb(self):
"""Scan the device tree to obtain a tree of nodes and properties
def scan_node(self, root):
"""Scan a node and subnodes to build a tree of node and phandle info
- This adds each node to self._valid_nodes and each phandle to
- self._phandle_nodes.
+ This adds each node to self._valid_nodes.
Args:
root: Root node for scan
if (not self._include_disabled and not status or
status.value != 'disabled'):
self._valid_nodes.append(node)
- phandle_prop = node.props.get('phandle')
- if phandle_prop:
- phandle = phandle_prop.GetPhandle()
- self._phandle_nodes[phandle] = node
# recurse to handle any subnodes
self.scan_node(node)
"""Scan the device tree for useful information
This fills in the following properties:
- _phandle_nodes: A dict of Nodes indexed by phandle (an integer)
_valid_nodes: A list of nodes we wish to consider include in the
platform data
"""
- self._phandle_nodes = {}
self._valid_nodes = []
return self.scan_node(self._fdt.GetRoot())
+ @staticmethod
+ def get_num_cells(node):
+ """Get the number of cells in addresses and sizes for this node
+
+ Args:
+ node: Node to check
+
+ Returns:
+ Tuple:
+ Number of address cells for this node
+ Number of size cells for this node
+ """
+ parent = node.parent
+ na, ns = 2, 2
+ if parent:
+ na_prop = parent.props.get('#address-cells')
+ ns_prop = parent.props.get('#size-cells')
+ if na_prop:
+ na = fdt_util.fdt32_to_cpu(na_prop.value)
+ if ns_prop:
+ ns = fdt_util.fdt32_to_cpu(ns_prop.value)
+ return na, ns
+
+ def scan_reg_sizes(self):
+ """Scan for 64-bit 'reg' properties and update the values
+
+ This finds 'reg' properties with 64-bit data and converts the value to
+ an array of 64-values. This allows it to be output in a way that the
+ C code can read.
+ """
+ for node in self._valid_nodes:
+ reg = node.props.get('reg')
+ if not reg:
+ continue
+ na, ns = self.get_num_cells(node)
+ total = na + ns
+
+ if reg.type != fdt.TYPE_INT:
+ raise ValueError("Node '%s' reg property is not an int")
+ if len(reg.value) % total:
+ raise ValueError("Node '%s' reg property has %d cells "
+ 'which is not a multiple of na + ns = %d + %d)' %
+ (node.name, len(reg.value), na, ns))
+ reg.na = na
+ reg.ns = ns
+ if na != 1 or ns != 1:
+ reg.type = fdt.TYPE_INT64
+ i = 0
+ new_value = []
+ val = reg.value
+ if not isinstance(val, list):
+ val = [val]
+ while i < len(val):
+ addr = fdt_util.fdt_cells_to_cpu(val[i:], reg.na)
+ i += na
+ size = fdt_util.fdt_cells_to_cpu(val[i:], reg.ns)
+ i += ns
+ new_value += [addr, size]
+ reg.value = new_value
+
def scan_structs(self):
"""Scan the device tree building up the C structures we will use.
for pname, prop in node.props.items():
if pname in PROP_IGNORE_LIST or pname[0] == '#':
continue
- if isinstance(prop.value, list):
- if is_phandle(prop):
- # Process the list as pairs of (phandle, id)
- value_it = iter(prop.value)
- for phandle_cell, _ in zip(value_it, value_it):
- phandle = fdt_util.fdt32_to_cpu(phandle_cell)
- target_node = self._phandle_nodes[phandle]
- node.phandles.add(target_node)
+ info = self.get_phandle_argc(prop, node.name)
+ if info:
+ if not isinstance(prop.value, list):
+ prop.value = [prop.value]
+ # Process the list as pairs of (phandle, id)
+ pos = 0
+ for args in info.args:
+ phandle_cell = prop.value[pos]
+ phandle = fdt_util.fdt32_to_cpu(phandle_cell)
+ target_node = self._fdt.phandle_to_node[phandle]
+ node.phandles.add(target_node)
+ pos += 1 + args
def generate_structs(self, structs):
definitions for node in self._valid_nodes. See the documentation in
README.of-plat for more information.
"""
+ self.out_header()
self.out('#include <stdbool.h>\n')
self.out('#include <libfdt.h>\n')
self.out('struct %s%s {\n' % (STRUCT_PREFIX, name))
for pname in sorted(structs[name]):
prop = structs[name][pname]
- if is_phandle(prop):
+ info = self.get_phandle_argc(prop, structs[name])
+ if info:
# For phandles, include a reference to the target
- self.out('\t%s%s[%d]' % (tab_to(2, 'struct phandle_2_cell'),
+ struct_name = 'struct phandle_%d_arg' % info.max_args
+ self.out('\t%s%s[%d]' % (tab_to(2, struct_name),
conv_name_to_c(prop.name),
- len(prop.value) / 2))
+ len(info.args)))
else:
ptype = TYPE_NAMES[prop.type]
self.out('\t%s%s' % (tab_to(2, ptype),
vals = []
# For phandles, output a reference to the platform data
# of the target node.
- if is_phandle(prop):
+ info = self.get_phandle_argc(prop, node.name)
+ if info:
# Process the list as pairs of (phandle, id)
- value_it = iter(prop.value)
- for phandle_cell, id_cell in zip(value_it, value_it):
+ pos = 0
+ for args in info.args:
+ phandle_cell = prop.value[pos]
phandle = fdt_util.fdt32_to_cpu(phandle_cell)
- id_num = fdt_util.fdt32_to_cpu(id_cell)
- target_node = self._phandle_nodes[phandle]
+ target_node = self._fdt.phandle_to_node[phandle]
name = conv_name_to_c(target_node.name)
- vals.append('{&%s%s, %d}' % (VAL_PREFIX, name, id_num))
+ arg_values = []
+ for i in range(args):
+ arg_values.append(str(fdt_util.fdt32_to_cpu(prop.value[pos + 1 + i])))
+ pos += 1 + args
+ vals.append('\t{&%s%s, {%s}}' % (VAL_PREFIX, name,
+ ', '.join(arg_values)))
+ for val in vals:
+ self.buf('\n\t\t%s,' % val)
else:
for val in prop.value:
vals.append(get_value(prop.type, val))
- self.buf(', '.join(vals))
+
+ # Put 8 values per line to avoid very long lines.
+ for i in xrange(0, len(vals), 8):
+ if i:
+ self.buf(',\n\t\t')
+ self.buf(', '.join(vals[i:i + 8]))
self.buf('}')
else:
self.buf(get_value(prop.type, prop.value))
See the documentation in doc/driver-model/of-plat.txt for more
information.
"""
+ self.out_header()
self.out('#include <common.h>\n')
self.out('#include <dm.h>\n')
self.out('#include <dt-structs.h>\n')
plat = DtbPlatdata(dtb_file, include_disabled)
plat.scan_dtb()
plat.scan_tree()
+ plat.scan_reg_sizes()
plat.setup_output(output)
structs = plat.scan_structs()
plat.scan_phandles()
--- /dev/null
+/*
+ * Test device tree file for dtoc
+ *
+ * Copyright 2017 Google, Inc
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+ /dts-v1/;
+
+/ {
+ #address-cells = <1>;
+ #size-cells = <1>;
+
+ test1 {
+ u-boot,dm-pre-reloc;
+ compatible = "test1";
+ reg = <0x1234 0x5678>;
+ };
+
+ test2 {
+ u-boot,dm-pre-reloc;
+ compatible = "test2";
+ reg = <0x12345678 0x98765432 2 3>;
+ };
+
+};
--- /dev/null
+/*
+ * Test device tree file for dtoc
+ *
+ * Copyright 2017 Google, Inc
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+ /dts-v1/;
+
+/ {
+ #address-cells = <1>;
+ #size-cells = <2>;
+
+ test1 {
+ u-boot,dm-pre-reloc;
+ compatible = "test1";
+ reg = <0x1234 0x5678 0x0>;
+ };
+
+ test2 {
+ u-boot,dm-pre-reloc;
+ compatible = "test2";
+ reg = <0x12345678 0x98765432 0x10987654>;
+ };
+
+ test3 {
+ u-boot,dm-pre-reloc;
+ compatible = "test3";
+ reg = <0x12345678 0x98765432 0x10987654 2 0 3>;
+ };
+
+};
--- /dev/null
+/*
+ * Test device tree file for dtoc
+ *
+ * Copyright 2017 Google, Inc
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+ /dts-v1/;
+
+/ {
+ #address-cells = <2>;
+ #size-cells = <2>;
+
+ test1 {
+ u-boot,dm-pre-reloc;
+ compatible = "test1";
+ reg = /bits/ 64 <0x1234 0x5678>;
+ };
+
+ test2 {
+ u-boot,dm-pre-reloc;
+ compatible = "test2";
+ reg = /bits/ 64 <0x1234567890123456 0x9876543210987654>;
+ };
+
+ test3 {
+ u-boot,dm-pre-reloc;
+ compatible = "test3";
+ reg = /bits/ 64 <0x1234567890123456 0x9876543210987654 2 3>;
+ };
+
+};
--- /dev/null
+/*
+ * Test device tree file for dtoc
+ *
+ * Copyright 2017 Google, Inc
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ */
+
+ /dts-v1/;
+
+/ {
+ #address-cells = <2>;
+ #size-cells = <1>;
+
+ test1 {
+ u-boot,dm-pre-reloc;
+ compatible = "test1";
+ reg = <0x1234 0x0 0x5678>;
+ };
+
+ test2 {
+ u-boot,dm-pre-reloc;
+ compatible = "test2";
+ reg = <0x12345678 0x90123456 0x98765432>;
+ };
+
+ test3 {
+ u-boot,dm-pre-reloc;
+ compatible = "test3";
+ reg = <0x12345678 0x90123456 0x98765432 0 2 3>;
+ };
+
+};
/ {
phandle: phandle-target {
+ u-boot,dm-pre-reloc;
+ compatible = "target";
+ intval = <0>;
+ #clock-cells = <0>;
+ };
+
+ phandle_1: phandle2-target {
u-boot,dm-pre-reloc;
compatible = "target";
intval = <1>;
+ #clock-cells = <1>;
+ };
+ phandle_2: phandle3-target {
+ u-boot,dm-pre-reloc;
+ compatible = "target";
+ intval = <2>;
+ #clock-cells = <2>;
};
phandle-source {
u-boot,dm-pre-reloc;
compatible = "source";
- clocks = <&phandle 1>;
+ clocks = <&phandle &phandle_1 11 &phandle_2 12 13 &phandle>;
};
};
/dts-v1/;
/ {
+ #address-cells = <1>;
+ #size-cells = <1>;
spl-test {
u-boot,dm-pre-reloc;
compatible = "sandbox,spl-test";
compatible = "sandbox,spl-test.2";
};
+ i2c@0 {
+ compatible = "sandbox,i2c-test";
+ u-boot,dm-pre-reloc;
+ #address-cells = <1>;
+ #size-cells = <0>;
+ pmic@9 {
+ compatible = "sandbox,pmic-test";
+ u-boot,dm-pre-reloc;
+ reg = <9>;
+ low-power;
+ };
+ };
};
# so it is fairly efficient.
# A list of types we support
-(TYPE_BYTE, TYPE_INT, TYPE_STRING, TYPE_BOOL) = range(4)
+(TYPE_BYTE, TYPE_INT, TYPE_STRING, TYPE_BOOL, TYPE_INT64) = range(5)
def CheckErr(errnum, msg):
if errnum:
props: A dict of properties for this node, each a Prop object.
Keyed by property name
"""
- def __init__(self, fdt, offset, name, path):
+ def __init__(self, fdt, parent, offset, name, path):
self._fdt = fdt
+ self.parent = parent
self._offset = offset
self.name = name
self.path = path
searching into subnodes so that the entire tree is built.
"""
self.props = self._fdt.GetProps(self)
+ phandle = self.props.get('phandle')
+ if phandle:
+ val = fdt_util.fdt32_to_cpu(phandle.value)
+ self._fdt.phandle_to_node[val] = self
offset = libfdt.fdt_first_subnode(self._fdt.GetFdt(), self.Offset())
while offset >= 0:
sep = '' if self.path[-1] == '/' else '/'
name = self._fdt._fdt_obj.get_name(offset)
path = self.path + sep + name
- node = Node(self._fdt, offset, name, path)
+ node = Node(self._fdt, self, offset, name, path)
self.subnodes.append(node)
node.Scan()
def __init__(self, fname):
self._fname = fname
self._cached_offsets = False
+ self.phandle_to_node = {}
if self._fname:
self._fname = fdt_util.EnsureCompiled(self._fname)
TODO(sjg@chromium.org): Implement the 'root' parameter
"""
- self._root = self.Node(self, 0, '/', '/')
+ self._root = self.Node(self, None, 0, '/', '/')
self._root.Scan()
def GetRoot(self):
return libfdt.fdt_off_dt_struct(self._fdt) + offset
@classmethod
- def Node(self, fdt, offset, name, path):
+ def Node(self, fdt, parent, offset, name, path):
"""Create a new node
This is used by Fdt.Scan() to create a new node using the correct
Args:
fdt: Fdt object
+ parent: Parent node, or None if this is the root node
offset: Offset of node
name: Node name
path: Full path to node
"""
- node = Node(fdt, offset, name, path)
+ node = Node(fdt, parent, offset, name, path)
return node
def FdtScan(fname):
val = val.encode('raw_unicode_escape')
return struct.unpack('>I', val)[0]
+def fdt_cells_to_cpu(val, cells):
+ """Convert one or two cells to a long integer
+
+ Args:
+ Value to convert (array of one or more 4-character strings)
+
+ Return:
+ A native-endian long value
+ """
+ if not cells:
+ return 0
+ out = long(fdt32_to_cpu(val[0]))
+ if cells == 2:
+ out = out << 32 | fdt32_to_cpu(val[1])
+ return out
+
def EnsureCompiled(fname):
"""Compile an fdt .dts source file into a .dtb binary blob if needed.
data = infile.read()
self.assertEqual('''#include <stdbool.h>
#include <libfdt.h>
+struct dtd_sandbox_i2c_test {
+};
+struct dtd_sandbox_pmic_test {
+\tbool\t\tlow_power;
+\tfdt64_t\t\treg[2];
+};
struct dtd_sandbox_spl_test {
\tbool\t\tboolval;
\tunsigned char\tbytearray[3];
\t.bytearray\t\t= {0x6, 0x0, 0x0},
\t.byteval\t\t= 0x5,
\t.intval\t\t\t= 0x1,
-\t.longbytearray\t\t= {0x9, 0xa, 0xb, 0xc, 0xd, 0xe, 0xf, 0x10, 0x11},
+\t.longbytearray\t\t= {0x9, 0xa, 0xb, 0xc, 0xd, 0xe, 0xf, 0x10,
+\t\t0x11},
\t.stringval\t\t= "message",
\t.boolval\t\t= true,
\t.intarray\t\t= {0x2, 0x3, 0x4, 0x0},
\t.bytearray\t\t= {0x1, 0x23, 0x34},
\t.byteval\t\t= 0x8,
\t.intval\t\t\t= 0x3,
-\t.longbytearray\t\t= {0x9, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0},
+\t.longbytearray\t\t= {0x9, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0,
+\t\t0x0},
\t.stringval\t\t= "message2",
\t.intarray\t\t= {0x5, 0x0, 0x0, 0x0},
\t.stringarray\t\t= {"another", "multi-word", "message"},
\t.platdata_size\t= sizeof(dtv_spl_test4),
};
+static struct dtd_sandbox_i2c_test dtv_i2c_at_0 = {
+};
+U_BOOT_DEVICE(i2c_at_0) = {
+\t.name\t\t= "sandbox_i2c_test",
+\t.platdata\t= &dtv_i2c_at_0,
+\t.platdata_size\t= sizeof(dtv_i2c_at_0),
+};
+
+static struct dtd_sandbox_pmic_test dtv_pmic_at_9 = {
+\t.low_power\t\t= true,
+\t.reg\t\t\t= {0x9, 0x0},
+};
+U_BOOT_DEVICE(pmic_at_9) = {
+\t.name\t\t= "sandbox_pmic_test",
+\t.platdata\t= &dtv_pmic_at_9,
+\t.platdata_size\t= sizeof(dtv_pmic_at_9),
+};
+
''', data)
def test_phandle(self):
self.assertEqual('''#include <stdbool.h>
#include <libfdt.h>
struct dtd_source {
-\tstruct phandle_2_cell clocks[1];
+\tstruct phandle_2_arg clocks[4];
};
struct dtd_target {
\tfdt32_t\t\tintval;
#include <dt-structs.h>
static struct dtd_target dtv_phandle_target = {
-\t.intval\t\t\t= 0x1,
+\t.intval\t\t\t= 0x0,
};
U_BOOT_DEVICE(phandle_target) = {
\t.name\t\t= "target",
\t.platdata_size\t= sizeof(dtv_phandle_target),
};
+static struct dtd_target dtv_phandle2_target = {
+\t.intval\t\t\t= 0x1,
+};
+U_BOOT_DEVICE(phandle2_target) = {
+\t.name\t\t= "target",
+\t.platdata\t= &dtv_phandle2_target,
+\t.platdata_size\t= sizeof(dtv_phandle2_target),
+};
+
+static struct dtd_target dtv_phandle3_target = {
+\t.intval\t\t\t= 0x2,
+};
+U_BOOT_DEVICE(phandle3_target) = {
+\t.name\t\t= "target",
+\t.platdata\t= &dtv_phandle3_target,
+\t.platdata_size\t= sizeof(dtv_phandle3_target),
+};
+
static struct dtd_source dtv_phandle_source = {
-\t.clocks\t\t\t= {{&dtv_phandle_target, 1}},
+\t.clocks\t\t\t= {
+\t\t\t{&dtv_phandle_target, {}},
+\t\t\t{&dtv_phandle2_target, {11}},
+\t\t\t{&dtv_phandle3_target, {12, 13}},
+\t\t\t{&dtv_phandle_target, {}},},
};
U_BOOT_DEVICE(phandle_source) = {
\t.name\t\t= "source",
\t.platdata_size\t= sizeof(dtv_spl_test),
};
+''', data)
+
+ def test_addresses64(self):
+ """Test output from a node with a 'reg' property with na=2, ns=2"""
+ dtb_file = get_dtb_file('dtoc_test_addr64.dts')
+ output = tools.GetOutputFilename('output')
+ dtb_platdata.run_steps(['struct'], dtb_file, False, output)
+ with open(output) as infile:
+ data = infile.read()
+ self.assertEqual('''#include <stdbool.h>
+#include <libfdt.h>
+struct dtd_test1 {
+\tfdt64_t\t\treg[2];
+};
+struct dtd_test2 {
+\tfdt64_t\t\treg[2];
+};
+struct dtd_test3 {
+\tfdt64_t\t\treg[4];
+};
+''', data)
+
+ dtb_platdata.run_steps(['platdata'], dtb_file, False, output)
+ with open(output) as infile:
+ data = infile.read()
+ self.assertEqual('''#include <common.h>
+#include <dm.h>
+#include <dt-structs.h>
+
+static struct dtd_test1 dtv_test1 = {
+\t.reg\t\t\t= {0x1234, 0x5678},
+};
+U_BOOT_DEVICE(test1) = {
+\t.name\t\t= "test1",
+\t.platdata\t= &dtv_test1,
+\t.platdata_size\t= sizeof(dtv_test1),
+};
+
+static struct dtd_test2 dtv_test2 = {
+\t.reg\t\t\t= {0x1234567890123456, 0x9876543210987654},
+};
+U_BOOT_DEVICE(test2) = {
+\t.name\t\t= "test2",
+\t.platdata\t= &dtv_test2,
+\t.platdata_size\t= sizeof(dtv_test2),
+};
+
+static struct dtd_test3 dtv_test3 = {
+\t.reg\t\t\t= {0x1234567890123456, 0x9876543210987654, 0x2, 0x3},
+};
+U_BOOT_DEVICE(test3) = {
+\t.name\t\t= "test3",
+\t.platdata\t= &dtv_test3,
+\t.platdata_size\t= sizeof(dtv_test3),
+};
+
+''', data)
+
+ def test_addresses32(self):
+ """Test output from a node with a 'reg' property with na=1, ns=1"""
+ dtb_file = get_dtb_file('dtoc_test_addr32.dts')
+ output = tools.GetOutputFilename('output')
+ dtb_platdata.run_steps(['struct'], dtb_file, False, output)
+ with open(output) as infile:
+ data = infile.read()
+ self.assertEqual('''#include <stdbool.h>
+#include <libfdt.h>
+struct dtd_test1 {
+\tfdt32_t\t\treg[2];
+};
+struct dtd_test2 {
+\tfdt32_t\t\treg[4];
+};
+''', data)
+
+ dtb_platdata.run_steps(['platdata'], dtb_file, False, output)
+ with open(output) as infile:
+ data = infile.read()
+ self.assertEqual('''#include <common.h>
+#include <dm.h>
+#include <dt-structs.h>
+
+static struct dtd_test1 dtv_test1 = {
+\t.reg\t\t\t= {0x1234, 0x5678},
+};
+U_BOOT_DEVICE(test1) = {
+\t.name\t\t= "test1",
+\t.platdata\t= &dtv_test1,
+\t.platdata_size\t= sizeof(dtv_test1),
+};
+
+static struct dtd_test2 dtv_test2 = {
+\t.reg\t\t\t= {0x12345678, 0x98765432, 0x2, 0x3},
+};
+U_BOOT_DEVICE(test2) = {
+\t.name\t\t= "test2",
+\t.platdata\t= &dtv_test2,
+\t.platdata_size\t= sizeof(dtv_test2),
+};
+
+''', data)
+
+ def test_addresses64_32(self):
+ """Test output from a node with a 'reg' property with na=2, ns=1"""
+ dtb_file = get_dtb_file('dtoc_test_addr64_32.dts')
+ output = tools.GetOutputFilename('output')
+ dtb_platdata.run_steps(['struct'], dtb_file, False, output)
+ with open(output) as infile:
+ data = infile.read()
+ self.assertEqual('''#include <stdbool.h>
+#include <libfdt.h>
+struct dtd_test1 {
+\tfdt64_t\t\treg[2];
+};
+struct dtd_test2 {
+\tfdt64_t\t\treg[2];
+};
+struct dtd_test3 {
+\tfdt64_t\t\treg[4];
+};
+''', data)
+
+ dtb_platdata.run_steps(['platdata'], dtb_file, False, output)
+ with open(output) as infile:
+ data = infile.read()
+ self.assertEqual('''#include <common.h>
+#include <dm.h>
+#include <dt-structs.h>
+
+static struct dtd_test1 dtv_test1 = {
+\t.reg\t\t\t= {0x123400000000, 0x5678},
+};
+U_BOOT_DEVICE(test1) = {
+\t.name\t\t= "test1",
+\t.platdata\t= &dtv_test1,
+\t.platdata_size\t= sizeof(dtv_test1),
+};
+
+static struct dtd_test2 dtv_test2 = {
+\t.reg\t\t\t= {0x1234567890123456, 0x98765432},
+};
+U_BOOT_DEVICE(test2) = {
+\t.name\t\t= "test2",
+\t.platdata\t= &dtv_test2,
+\t.platdata_size\t= sizeof(dtv_test2),
+};
+
+static struct dtd_test3 dtv_test3 = {
+\t.reg\t\t\t= {0x1234567890123456, 0x98765432, 0x2, 0x3},
+};
+U_BOOT_DEVICE(test3) = {
+\t.name\t\t= "test3",
+\t.platdata\t= &dtv_test3,
+\t.platdata_size\t= sizeof(dtv_test3),
+};
+
+''', data)
+
+ def test_addresses32_64(self):
+ """Test output from a node with a 'reg' property with na=1, ns=2"""
+ dtb_file = get_dtb_file('dtoc_test_addr32_64.dts')
+ output = tools.GetOutputFilename('output')
+ dtb_platdata.run_steps(['struct'], dtb_file, False, output)
+ with open(output) as infile:
+ data = infile.read()
+ self.assertEqual('''#include <stdbool.h>
+#include <libfdt.h>
+struct dtd_test1 {
+\tfdt64_t\t\treg[2];
+};
+struct dtd_test2 {
+\tfdt64_t\t\treg[2];
+};
+struct dtd_test3 {
+\tfdt64_t\t\treg[4];
+};
+''', data)
+
+ dtb_platdata.run_steps(['platdata'], dtb_file, False, output)
+ with open(output) as infile:
+ data = infile.read()
+ self.assertEqual('''#include <common.h>
+#include <dm.h>
+#include <dt-structs.h>
+
+static struct dtd_test1 dtv_test1 = {
+\t.reg\t\t\t= {0x1234, 0x567800000000},
+};
+U_BOOT_DEVICE(test1) = {
+\t.name\t\t= "test1",
+\t.platdata\t= &dtv_test1,
+\t.platdata_size\t= sizeof(dtv_test1),
+};
+
+static struct dtd_test2 dtv_test2 = {
+\t.reg\t\t\t= {0x12345678, 0x9876543210987654},
+};
+U_BOOT_DEVICE(test2) = {
+\t.name\t\t= "test2",
+\t.platdata\t= &dtv_test2,
+\t.platdata_size\t= sizeof(dtv_test2),
+};
+
+static struct dtd_test3 dtv_test3 = {
+\t.reg\t\t\t= {0x12345678, 0x9876543210987654, 0x2, 0x3},
+};
+U_BOOT_DEVICE(test3) = {
+\t.name\t\t= "test3",
+\t.platdata\t= &dtv_test3,
+\t.platdata_size\t= sizeof(dtv_test3),
+};
+
''', data)
os.environ['srctree'] = os.getcwd()
os.environ['UBOOTVERSION'] = 'dummy'
os.environ['KCONFIG_OBJDIR'] = ''
- self._conf = kconfiglib.Config()
+ self._conf = kconfiglib.Config(print_warnings=False)
def __del__(self):
"""Delete a leftover temporary file before exit.
else:
f.write(line[colon + 1:])
- self._conf.load_config(self._tmpfile)
+ warnings = self._conf.load_config(self._tmpfile)
+ if warnings:
+ for warning in warnings:
+ print '%s: %s' % (defconfig, warning)
try_remove(self._tmpfile)
self._tmpfile = None
if options.build_db:
with open(CONFIG_DATABASE, 'w') as fd:
for defconfig, configs in config_db.iteritems():
- print >>fd, '%s' % defconfig
+ fd.write('%s\n' % defconfig)
for config in sorted(configs.keys()):
- print >>fd, ' %s=%s' % (config, configs[config])
- print >>fd
+ fd.write(' %s=%s\n' % (config, configs[config]))
+ fd.write('\n')
if __name__ == '__main__':
main()
The checkpatch.pl in the U-Boot tools/ subdirectory will be located and
used. Failing that you can put it into your path or ~/bin/checkpatch.pl
+If you want to avoid sending patches to email addresses that are picked up
+by patman but are known to bounce you can add a [bounces] section to your
+.patman file. Unlike the [alias] section these are simple key: value pairs
+that are not recursive.
+
+>>>
+
+[bounces]
+gonefishing: Fred Bloggs <f.bloggs@napier.net>
+
+<<<
+
If you want to change the defaults for patman's command-line arguments,
you can add a [settings] section to your .patman file. This can be used
import get_maintainer
import gitutil
+import settings
import terminal
# Series-xxx tags that we understand
Return:
Filename of temp file created
"""
+ col = terminal.Color()
# Look for commit tags (of the form 'xxx:' at the start of the subject)
fname = '/tmp/patman.%d' % os.getpid()
fd = open(fname, 'w')
cc += add_maintainers
elif add_maintainers:
cc += get_maintainer.GetMaintainer(commit.patch)
+ for x in set(cc) & set(settings.bounces):
+ print(col.Color(col.YELLOW, 'Skipping "%s"' % x))
+ cc = set(cc) - set(settings.bounces)
cc = [m.encode('utf-8') if type(m) != str else m for m in cc]
all_ccs += cc
print(commit.patch, ', '.join(set(cc)), file=fd)
print("Couldn't create patman config file\n")
raise
- print("[alias]\nme: %s <%s>" % (name, email), file=f)
+ print('''[alias]
+me: %s <%s>
+
+[bounces]
+nxp = Zhikang Zhang <zhikang.zhang@nxp.com>
+''' % (name, email), file=f)
f.close();
def _UpdateDefaults(parser, config):
if bad_line:
print(bad_line)
+def _ReadBouncesFile(fname):
+ """Read in the bounces file if it exists
+
+ Args:
+ fname: Filename to read.
+ """
+ if os.path.exists(fname):
+ with open(fname) as fd:
+ for line in fd:
+ if line.startswith('#'):
+ continue
+ bounces.add(line.strip())
+
+def GetItems(config, section):
+ """Get the items from a section of the config.
+
+ Args:
+ config: _ProjectConfigParser object containing settings
+ section: name of section to retrieve
+
+ Returns:
+ List of (name, value) tuples for the section
+ """
+ try:
+ return config.items(section)
+ except ConfigParser.NoSectionError as e:
+ return []
+ except:
+ raise
+
def Setup(parser, project_name, config_fname=''):
"""Set up the settings module by reading config files.
config.read(config_fname)
- for name, value in config.items('alias'):
+ for name, value in GetItems(config, 'alias'):
alias[name] = value.split(',')
+ _ReadBouncesFile('doc/bounces')
+ for name, value in GetItems(config, 'bounces'):
+ bounces.add(value)
+
_UpdateDefaults(parser, config)
# These are the aliases we understand, indexed by alias. Each member is a list.
alias = {}
+bounces = set()
if __name__ == "__main__":
import doctest
pbi_crc_cmd2 = 0;
pbl_cmd_initaddr = params->addr & PBL_ADDR_24BIT_MASK;
pbl_cmd_initaddr |= PBL_ACS_CONT_CMD;
- pbl_cmd_initaddr |= uboot_size;
+ pbl_cmd_initaddr += uboot_size;
pbl_end_cmd[0] = 0x09610000;
pbl_end_cmd[1] = 0x00000000;
pbl_end_cmd[2] = 0x096100c0;